E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0240(Multifunctional peptide)
DFBP ID DFBPMUFU0240
Peptide sequence AEL
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 2
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI1184 Short-necked clam (Tapes philippinarum) Short-necked clam powder hydrolysates

N.D

DFBPACEI1514 Chlorella vulgaris and Spirulina platensis Microalgae powder hydrolysates

N.D

Antihypertensive peptides
DFBPID Organism Precursor protein Residue position
DFBPANHY0446 Chlorella vulgaris and Spirulina platensis Microalgae powder hydrolysates

N.D

DFBPANHY0849 Short-necked clam (Tapes philippinarum) Short-necked clam powder hydrolysates

N.D

Physical & computational properties
Three-letter amino acid Ala-Glu-Leu
Single-letter amino acid AEL
Peptide length 3
Theoretical mass 331.36 Da c
Net charge 0.00 c
Isoelectric point (pI) 3.34 c
GRAVY 0.7000
Hydrophilic residue ratio 66.67%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0810 ---- Plant proteins ---- APETALA2-like protein 1
Source.2: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1
Source.3: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25
Source.4: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.5: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.6: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.7: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5
Source.8: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.9: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71
Source.10: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1
Source.11: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.12: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.13: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.14: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.15: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46
Source.16: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.17: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.18: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1
Source.19: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.20: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.21: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1
Source.22: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.23: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53
Source.24: DFBPPR0900 ---- Plant proteins ---- GTPase activating protein 1
Source.25: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2
Source.26: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.27: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.28: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.29: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.30: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6
Source.31: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1
Source.32: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.33: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.34: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.35: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.36: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1
Source.37: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC
Source.38: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.39: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.40: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.41: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70
Source.42: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.43: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.44: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.45: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1
Source.46: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.47: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.48: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.49: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.50: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75
Source.51: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.52: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.53: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.54: DFBPPR1022 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK3
Source.55: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform
Source.56: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic
Source.57: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.58: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8
Source.59: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56
Source.60: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.61: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.62: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.63: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A
Source.64: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.65: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c
Source.66: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1
Source.67: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79
Source.68: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.69: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.70: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.71: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51
Source.72: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.73: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1
Source.74: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.75: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.76: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.77: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.78: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.79: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic
Source.80: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.81: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E
Source.82: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4
Source.83: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.84: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic
Source.85: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.86: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3
Source.87: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.88: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.89: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.90: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.91: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.92: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic
Source.93: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b
Source.94: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.95: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.96: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28
Source.97: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.98: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15
Source.99: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.100: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.101: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.102: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.103: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.104: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.105: DFBPPR1271 ---- Plant proteins ---- CBL-interacting protein kinase 23
Source.106: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3
Source.107: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.108: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.109: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase
Source.110: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.111: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.112: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.113: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.114: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.115: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.116: DFBPPR1300 ---- Plant proteins ---- Protein G1
Source.117: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.118: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.119: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.120: DFBPPR1313 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1
Source.121: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.122: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22
Source.123: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic
Source.124: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d
Source.125: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.126: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.127: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.128: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.129: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1
Source.130: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.131: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.132: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.133: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.134: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.135: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.136: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1
Source.137: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.138: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.139: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic
Source.140: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.141: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.142: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.143: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase
Source.144: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic
Source.145: DFBPPR1396 ---- Plant proteins ---- Peroxidase 2
Source.146: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.147: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B
Source.148: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.149: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.150: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.151: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.152: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.153: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.154: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.155: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.156: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.157: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.158: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.159: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29
Source.160: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1
Source.161: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.162: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.163: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.164: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.165: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3
Source.166: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.167: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.168: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.169: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1
Source.170: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A
Source.171: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.172: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.173: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.174: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.175: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.176: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase
Source.177: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.178: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.179: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.180: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.181: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.182: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.183: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d
Source.184: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.185: DFBPPR1513 ---- Plant proteins ---- 14-3-3-like protein GF14-F
Source.186: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.187: DFBPPR1515 ---- Plant proteins ---- Serine/threonine-protein kinase Nek3
Source.188: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.189: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3
Source.190: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1
Source.191: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2
Source.192: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.193: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.194: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.195: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.196: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.197: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.198: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.199: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.200: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.201: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.202: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic
Source.203: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.204: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.205: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic
Source.206: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.207: DFBPPR1600 ---- Plant proteins ---- Phytosulfokines 5
Source.208: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.209: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.210: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.211: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2
Source.212: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1
Source.213: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.214: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.215: DFBPPR1623 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 2, chloroplastic
Source.216: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.217: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.218: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic
Source.219: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.220: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.221: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.222: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.223: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.224: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.225: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.226: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.227: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1
Source.228: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.229: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10
Source.230: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.231: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.232: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.233: DFBPPR1687 ---- Plant proteins ---- Transcription factor ILI1
Source.234: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG
Source.235: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.236: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.237: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.238: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a
Source.239: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.240: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.241: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.242: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.243: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.244: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.245: DFBPPR1722 ---- Plant proteins ---- Protein TIFY 11a
Source.246: DFBPPR1726 ---- Plant proteins ---- SPX domain-containing protein 1
Source.247: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.248: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.249: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.250: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.251: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial
Source.252: DFBPPR1754 ---- Plant proteins ---- Transcription factor BHLH094
Source.253: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.254: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.255: DFBPPR1769 ---- Plant proteins ---- Two-component response regulator ORR3
Source.256: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.257: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.258: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.259: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.260: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic
Source.261: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4
Source.262: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.263: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase
Source.264: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial
Source.265: DFBPPR1810 ---- Plant proteins ---- Shaggy-related protein kinase GSK4
Source.266: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1
Source.267: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.268: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a
Source.269: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.270: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.271: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.272: DFBPPR1841 ---- Plant proteins ---- SPX domain-containing protein 2
Source.273: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.274: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.275: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.276: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.277: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.278: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.279: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.280: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.281: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4
Source.282: DFBPPR1881 ---- Plant proteins ---- Protein TIFY 11d
Source.283: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.284: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.285: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic
Source.286: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic
Source.287: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.288: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial
Source.289: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.290: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.291: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.292: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2
Source.293: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.294: DFBPPR1929 ---- Plant proteins ---- Guanylate kinase 1
Source.295: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.296: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.297: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.298: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.299: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.300: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.301: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3
Source.302: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.303: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A
Source.304: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.305: DFBPPR1988 ---- Plant proteins ---- Protein FLORAL ORGAN NUMBER2
Source.306: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.307: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28
Source.308: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.309: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.310: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.311: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.312: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.313: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.314: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.315: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1
Source.316: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.317: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.318: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.319: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.320: DFBPPR2070 ---- Plant proteins ---- Calmodulin-1
Source.321: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.322: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.323: DFBPPR2083 ---- Plant proteins ---- Lectin
Source.324: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.325: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.326: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.327: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.328: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.329: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.330: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase
Source.331: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.332: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.333: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.334: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.335: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.336: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2
Source.337: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.338: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic
Source.339: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.340: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.341: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.342: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.343: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.344: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.345: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.346: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.347: DFBPPR2179 ---- Plant proteins ---- 14-3-3-like protein GF14-C
Source.348: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.349: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.350: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4
Source.351: DFBPPR2216 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit gamma 1
Source.352: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.353: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.354: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.355: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.356: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.357: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.358: DFBPPR2237 ---- Plant proteins ---- Probable glutathione S-transferase GSTU1
Source.359: DFBPPR2239 ---- Plant proteins ---- Elongation factor 1-alpha
Source.360: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1
Source.361: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9
Source.362: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.363: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1
Source.364: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.365: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.366: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.367: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.368: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.369: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.370: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3
Source.371: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.372: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.373: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4
Source.374: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7
Source.375: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.376: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.377: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.378: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2
Source.379: DFBPPR2325 ---- Plant proteins ---- Peroxiredoxin-2E-2, chloroplastic
Source.380: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.381: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.382: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.383: DFBPPR2364 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.384: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5
Source.385: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.386: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase
Source.387: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.388: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1
Source.389: DFBPPR2387 ---- Plant proteins ---- Chitinase 8
Source.390: DFBPPR2389 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-1
Source.391: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic
Source.392: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22
Source.393: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.394: DFBPPR2405 ---- Plant proteins ---- Transcription factor BHLH089
Source.395: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6
Source.396: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.397: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.398: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic
Source.399: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1
Source.400: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1
Source.401: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.402: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1
Source.403: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.404: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.405: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial
Source.406: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.407: DFBPPR2504 ---- Plant proteins ---- 14-3-3-like protein GF14-B
Source.408: DFBPPR2508 ---- Plant proteins ---- Transcription factor RF2b
Source.409: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.410: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.411: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.412: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.413: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.414: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.415: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.416: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1
Source.417: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.418: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.419: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.420: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.421: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic
Source.422: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.423: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.424: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.425: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.426: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.427: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b
Source.428: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial
Source.429: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic
Source.430: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic
Source.431: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1
Source.432: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.433: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.434: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.435: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.436: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.437: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.438: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24
Source.439: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.440: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.441: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.442: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1
Source.443: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.444: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.445: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.446: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.447: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.448: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.449: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.450: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.451: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.452: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.453: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5
Source.454: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.455: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.456: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.457: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.458: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2
Source.459: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.460: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.461: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.462: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.463: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.464: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.465: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.466: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.467: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.468: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.469: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.470: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.471: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.472: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.473: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.474: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.475: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.476: DFBPPR2847 ---- Plant proteins ---- Glutaredoxin-C4, chloroplastic
Source.477: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.478: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9
Source.479: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.480: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase
Source.481: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX
Source.482: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2
Source.483: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.484: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.485: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.486: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.487: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.488: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.489: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB
Source.490: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.491: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.492: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4
Source.493: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.494: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.495: DFBPPR2947 ---- Plant proteins ---- Peroxisomal membrane protein 11-5
Source.496: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.497: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8
Source.498: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1
Source.499: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.500: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.501: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.502: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1
Source.503: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.504: DFBPPR3006 ---- Plant proteins ---- 3'(2'),5'-bisphosphate nucleotidase
Source.505: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.506: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.507: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.508: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic
Source.509: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase
Source.510: DFBPPR3054 ---- Plant proteins ---- Pectinesterase inhibitor 8
Source.511: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.512: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5
Source.513: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.514: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.515: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1
Source.516: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.517: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2
Source.518: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.519: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.520: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.521: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.522: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.523: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1
Source.524: DFBPPR3110 ---- Plant proteins ---- Thioredoxin H5
Source.525: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.526: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.527: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.528: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2
Source.529: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.530: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.531: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.532: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2
Source.533: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3
Source.534: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.535: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2
Source.536: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.537: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48
Source.538: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.539: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3
Source.540: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.541: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3
Source.542: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.543: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.544: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.545: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4
Source.546: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1
Source.547: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.548: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3
Source.549: DFBPPR3225 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit M, chloroplastic
Source.550: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1
Source.551: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37
Source.552: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.553: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26
Source.554: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.555: DFBPPR3242 ---- Plant proteins ---- Peroxisomal membrane protein 11-1
Source.556: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.557: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.558: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70
Source.559: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.560: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.561: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.562: DFBPPR3270 ---- Plant proteins ---- Calmodulin-like protein 1
Source.563: DFBPPR3276 ---- Plant proteins ---- MADS-box transcription factor 27
Source.564: DFBPPR3296 ---- Plant proteins ---- MADS-box transcription factor 32
Source.565: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.566: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.567: DFBPPR3301 ---- Plant proteins ---- 14-3-3-like protein GF14-E
Source.568: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.569: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2
Source.570: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5
Source.571: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.572: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.573: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.574: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3
Source.575: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2
Source.576: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8
Source.577: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.578: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2
Source.579: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.580: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.581: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.582: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1
Source.583: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1
Source.584: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28
Source.585: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.586: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14
Source.587: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.588: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.589: DFBPPR3393 ---- Plant proteins ---- Auxin-responsive protein IAA20
Source.590: DFBPPR3443 ---- Plant proteins ---- Calmodulin-2
Source.591: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.592: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.593: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.594: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12
Source.595: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.596: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1
Source.597: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34
Source.598: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27
Source.599: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68
Source.600: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.601: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.602: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9
Source.603: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2
Source.604: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.605: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.606: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.607: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3
Source.608: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic
Source.609: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18
Source.610: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4
Source.611: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.612: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2
Source.613: DFBPPR3543 ---- Plant proteins ---- 26.7 kDa heat shock protein, chloroplastic
Source.614: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.615: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.616: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.617: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.618: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3
Source.619: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5
Source.620: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.621: DFBPPR3584 ---- Plant proteins ---- Signal recognition particle 19 kDa protein
Source.622: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.623: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2
Source.624: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.625: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.626: DFBPPR3617 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog
Source.627: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.628: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.629: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5
Source.630: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.631: DFBPPR3639 ---- Plant proteins ---- Calmodulin-3
Source.632: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3
Source.633: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.634: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.635: DFBPPR3674 ---- Plant proteins ---- Putative calmodulin-like protein 2
Source.636: DFBPPR3680 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.637: DFBPPR3681 ---- Plant proteins ---- Transcription factor JAMYB
Source.638: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.639: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.640: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.641: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.642: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5
Source.643: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.644: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.645: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1
Source.646: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.647: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71
Source.648: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1
Source.649: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.650: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.651: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.652: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3
Source.653: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1
Source.654: DFBPPR3792 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 1
Source.655: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B
Source.656: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.657: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G
Source.658: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.659: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.660: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.661: DFBPPR3844 ---- Plant proteins ---- Probable protein phosphatase 2C 41
Source.662: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78
Source.663: DFBPPR3860 ---- Plant proteins ---- Probable protein phosphatase 2C 62
Source.664: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1
Source.665: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.666: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5
Source.667: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.668: DFBPPR3876 ---- Plant proteins ---- Bifunctional nuclease 2
Source.669: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.670: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.671: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.672: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.673: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11
Source.674: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1
Source.675: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.676: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4
Source.677: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.678: DFBPPR3920 ---- Plant proteins ---- Glutaredoxin-C9
Source.679: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.680: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.681: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.682: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2
Source.683: DFBPPR3933 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-2 catalytic subunit
Source.684: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.685: DFBPPR3938 ---- Plant proteins ---- Calmodulin-like protein 3
Source.686: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.687: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10
Source.688: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog
Source.689: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16
Source.690: DFBPPR3955 ---- Plant proteins ---- Cysteine proteinase inhibitor 3
Source.691: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1
Source.692: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.693: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.694: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.695: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.696: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.697: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4
Source.698: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.699: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.700: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5
Source.701: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.702: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1
Source.703: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.704: DFBPPR4031 ---- Plant proteins ---- Probable protein phosphatase 2C 27
Source.705: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A
Source.706: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase
Source.707: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta
Source.708: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.709: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.710: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.711: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F
Source.712: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.713: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3
Source.714: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.715: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.716: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic
Source.717: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2
Source.718: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B
Source.719: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.720: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.721: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5
Source.722: DFBPPR4098 ---- Plant proteins ---- ESCRT-related protein CHMP1
Source.723: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.724: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2
Source.725: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.726: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.727: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33
Source.728: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1
Source.729: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3
Source.730: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5
Source.731: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.732: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16
Source.733: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1
Source.734: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.735: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6
Source.736: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.737: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67
Source.738: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.739: DFBPPR4174 ---- Plant proteins ---- Mitochondrial intermembrane space import and assembly protein 40 homolog
Source.740: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.741: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.742: DFBPPR4189 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.743: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2
Source.744: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.745: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.746: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.747: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial
Source.748: DFBPPR4213 ---- Plant proteins ---- Mitochondrial import inner membrane translocase subunit Tim9
Source.749: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.750: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.751: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22
Source.752: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.753: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic
Source.754: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1
Source.755: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.756: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.757: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.758: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2
Source.759: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3
Source.760: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.761: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.762: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1
Source.763: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.764: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2
Source.765: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.766: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3
Source.767: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3
Source.768: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like
Source.769: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1
Source.770: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.771: DFBPPR4318 ---- Plant proteins ---- Golgin-84
Source.772: DFBPPR4322 ---- Plant proteins ---- Microtubule-associated protein 70-3
Source.773: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2
Source.774: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.775: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5
Source.776: DFBPPR4336 ---- Plant proteins ---- Putative cyclin-F3-2
Source.777: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5
Source.778: DFBPPR4343 ---- Plant proteins ---- Transcription factor ILI7
Source.779: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E
Source.780: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2
Source.781: DFBPPR4348 ---- Plant proteins ---- Probable calcium-binding protein CML11
Source.782: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1
Source.783: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3
Source.784: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4
Source.785: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic
Source.786: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.787: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.788: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.789: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.790: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.791: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.792: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.793: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4
Source.794: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.795: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8
Source.796: DFBPPR4409 ---- Plant proteins ---- 14-3-3-like protein GF14-D
Source.797: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.798: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.799: DFBPPR4416 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 4
Source.800: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.801: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.802: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.803: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.804: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.805: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.806: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.807: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1
Source.808: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.809: DFBPPR4461 ---- Plant proteins ---- Probable calcium-binding protein CML18
Source.810: DFBPPR4463 ---- Plant proteins ---- Probable calcium-binding protein CML17
Source.811: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1
Source.812: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2
Source.813: DFBPPR4474 ---- Plant proteins ---- Probable calcium-binding protein CML16
Source.814: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.815: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6
Source.816: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.817: DFBPPR4482 ---- Plant proteins ---- Probable calcium-binding protein CML30
Source.818: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.819: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1
Source.820: DFBPPR4505 ---- Plant proteins ---- TPD1 protein homolog 1B
Source.821: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.822: DFBPPR4518 ---- Plant proteins ---- Probable calcium-binding protein CML14
Source.823: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.824: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2
Source.825: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.826: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6
Source.827: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.828: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.829: DFBPPR4539 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 3
Source.830: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.831: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27
Source.832: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59
Source.833: DFBPPR4547 ---- Plant proteins ---- Probable calcium-binding protein CML31
Source.834: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.835: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.836: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H
Source.837: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1
Source.838: DFBPPR4577 ---- Plant proteins ---- Probable calcium-binding protein CML10
Source.839: DFBPPR4582 ---- Plant proteins ---- Probable calcium-binding protein CML12
Source.840: DFBPPR4583 ---- Plant proteins ---- Probable calcium-binding protein CML15
Source.841: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21
Source.842: DFBPPR4596 ---- Plant proteins ---- Putative calcium-binding protein CML19
Source.843: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39
Source.844: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic
Source.845: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.846: DFBPPR4640 ---- Plant proteins ---- Protein Brevis radix-like 4
Source.847: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5
Source.848: DFBPPR4660 ---- Plant proteins ---- Transcription factor ILI2
Source.849: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2
Source.850: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.851: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic
Source.852: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.853: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19
Source.854: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.855: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8
Source.856: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9
Source.857: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400
Source.858: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.859: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21
Source.860: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1
Source.861: DFBPPR4764 ---- Plant proteins ---- 14-3-3-like protein GF14-A
Source.862: DFBPPR4766 ---- Plant proteins ---- 14-3-3-like protein GF14-G
Source.863: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700
Source.864: DFBPPR4789 ---- Plant proteins ---- B3 domain-containing protein Os11g0197600
Source.865: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.866: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2
Source.867: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000
Source.868: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56
Source.869: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.870: DFBPPR4860 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.871: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.872: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12
Source.873: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.874: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5
Source.875: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.876: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2
Source.877: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8
Source.878: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.879: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.880: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.881: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23
Source.882: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A
Source.883: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.884: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.885: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1
Source.886: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.887: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.888: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.889: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase
Source.890: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.891: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.892: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.893: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.894: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.895: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.896: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.897: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.898: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.899: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic
Source.900: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2
Source.901: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.902: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.903: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.904: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.905: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.906: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.907: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.908: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.909: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.910: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.911: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.912: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.913: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.914: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.915: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.916: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.917: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase
Source.918: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.919: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.920: DFBPPR5133 ---- Plant proteins ---- Elongation factor 1-alpha
Source.921: DFBPPR5135 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-2
Source.922: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6
Source.923: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.924: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.925: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.926: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.927: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.928: DFBPPR5206 ---- Plant proteins ---- Calmodulin-2
Source.929: DFBPPR5212 ---- Plant proteins ---- Small ribosomal subunit protein S13, mitochondrial
Source.930: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.931: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3
Source.932: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.933: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.934: DFBPPR5242 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-1
Source.935: DFBPPR5255 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-B
Source.936: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.937: DFBPPR5266 ---- Plant proteins ---- Cyanate hydratase
Source.938: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.939: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.940: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.941: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.942: DFBPPR5296 ---- Plant proteins ---- 18 kDa seed maturation protein
Source.943: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2
Source.944: DFBPPR5307 ---- Plant proteins ---- 4-coumarate--CoA ligase 1
Source.945: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.946: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6
Source.947: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.948: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1
Source.949: DFBPPR5353 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.950: DFBPPR5360 ---- Plant proteins ---- 14-3-3-like protein A
Source.951: DFBPPR5361 ---- Plant proteins ---- 14-3-3-like protein B
Source.952: DFBPPR5362 ---- Plant proteins ---- 14-3-3-like protein C
Source.953: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.954: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.955: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.956: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.957: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.958: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.959: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.960: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.961: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.962: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.963: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.964: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.965: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.966: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1
Source.967: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2
Source.968: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.969: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.970: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.971: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2
Source.972: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1
Source.973: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.974: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.975: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.976: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1
Source.977: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.978: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.979: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.980: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic
Source.981: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.982: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.983: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.984: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1
Source.985: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.986: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1
Source.987: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.988: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.989: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.990: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.991: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.992: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.993: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.994: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.995: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.996: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.997: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.998: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.999: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.1000: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.1001: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.1002: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.1003: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.1004: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9
Source.1005: DFBPPR5626 ---- Plant proteins ---- Single myb histone 6
Source.1006: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1007: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.1008: DFBPPR5642 ---- Plant proteins ---- Zeamatin
Source.1009: DFBPPR5661 ---- Plant proteins ---- Albumin b-32
Source.1010: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1
Source.1011: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1012: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2
Source.1013: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.1014: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.1015: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.1016: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1017: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.1018: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic
Source.1019: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.1020: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.1021: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3
Source.1022: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.1023: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.1024: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1025: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1026: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5
Source.1027: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.1028: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2
Source.1029: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.1030: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.1031: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.1032: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.1033: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1034: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1
Source.1035: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1036: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.1037: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.1038: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.1039: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.1040: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.1041: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase
Source.1042: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1
Source.1043: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1044: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.1045: DFBPPR5822 ---- Plant proteins ---- Elongation factor 1-alpha
Source.1046: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.1047: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3
Source.1048: DFBPPR5845 ---- Plant proteins ---- 14-3-3-like protein GF14-12
Source.1049: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase
Source.1050: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.1051: DFBPPR5855 ---- Plant proteins ---- 14-3-3-like protein GF14-6
Source.1052: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1053: DFBPPR5866 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.1054: DFBPPR5878 ---- Plant proteins ---- Ocs element-binding factor 1
Source.1055: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1
Source.1056: DFBPPR5903 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.1057: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2
Source.1058: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4
Source.1059: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4
Source.1060: DFBPPR5945 ---- Plant proteins ---- Calmodulin
Source.1061: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2
Source.1062: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.1063: DFBPPR5975 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.1064: DFBPPR5976 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog
Source.1065: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2
Source.1066: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1
Source.1067: DFBPPR5986 ---- Plant proteins ---- Beta-amylase
Source.1068: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.1069: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1
Source.1070: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2
Source.1071: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1
Source.1072: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1073: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.1074: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1
Source.1075: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2
Source.1076: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1077: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.1078: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1
Source.1079: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2
Source.1080: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1
Source.1081: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.1082: DFBPPR6174 ---- Plant proteins ---- Oil body-associated protein 2A
Source.1083: DFBPPR6210 ---- Plant proteins ---- Cysteine synthase
Source.1084: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic
Source.1085: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic
Source.1086: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.1087: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1088: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial
Source.1089: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.1090: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic
Source.1091: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.1092: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic
Source.1093: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic
Source.1094: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.1095: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1096: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.1097: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial
Source.1098: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96
Source.1099: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic
Source.1100: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.1101: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.1102: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1103: DFBPPR6265 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.1104: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.1105: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.1106: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.1107: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic
Source.1108: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1109: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.1110: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.1111: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.1112: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1113: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1114: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1115: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1116: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.1117: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1118: DFBPPR6386 ---- Plant proteins ---- ATP synthase subunit delta', mitochondrial
Source.1119: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1120: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.1121: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1122: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic
Source.1123: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.1124: DFBPPR6424 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.1125: DFBPPR6429 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.1126: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha
Source.1127: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA
Source.1128: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.1129: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.1130: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein
Source.1131: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.1132: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1133: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1134: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial
Source.1135: DFBPPR6571 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.1136: DFBPPR6611 ---- Plant proteins ---- 14-3-3-like protein
Source.1137: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1138: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.1139: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D
Source.1140: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase
Source.1141: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.1142: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1143: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1
Source.1144: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1145: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic
Source.1146: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.1147: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.1148: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B
Source.1149: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A
Source.1150: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic
Source.1151: DFBPPR6705 ---- Plant proteins ---- Calmodulin
Source.1152: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1153: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.1154: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1155: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.1156: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1157: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic
Source.1158: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase
Source.1159: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.1160: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1161: DFBPPR6794 ---- Plant proteins ---- Elongation factor 1-alpha
Source.1162: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1163: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1164: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1165: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.1166: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1167: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1168: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.1169: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1170: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.1171: DFBPPR6902 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.1172: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1173: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.1174: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin
Source.1175: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1176: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.1177: DFBPPR6953 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.1178: DFBPPR6982 ---- Plant proteins ---- 60S ribosomal protein L35
Source.1179: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1
Source.1180: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme
Source.1181: DFBPPR7013 ---- Plant proteins ---- Protein MLO
Source.1182: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.1183: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1
Source.1184: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1185: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1186: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.1187: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic
Source.1188: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.1189: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd
Source.1190: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.1191: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1192: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1193: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.1194: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic
Source.1195: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.1196: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1197: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1198: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1
Source.1199: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2
Source.1200: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3
Source.1201: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial
Source.1202: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.1203: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.1204: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1205: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1206: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.1207: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1208: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1209: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.1210: DFBPPR7228 ---- Plant proteins ---- Calmodulin
Source.1211: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1
Source.1212: DFBPPR7258 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV90, chloroplastic
Source.1213: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic
Source.1214: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic
Source.1215: DFBPPR7266 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.1216: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1217: DFBPPR7300 ---- Plant proteins ---- 40S ribosomal protein S27
Source.1218: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1219: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein
Source.1220: DFBPPR7333 ---- Plant proteins ---- C-hordein
Source.1221: DFBPPR7334 ---- Plant proteins ---- C-hordein
Source.1222: DFBPPR7343 ---- Plant proteins ---- 14-3-3-like protein A
Source.1223: DFBPPR7347 ---- Plant proteins ---- 14-3-3-like protein B
Source.1224: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic
Source.1225: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.1226: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.1227: DFBPPR7426 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.1228: DFBPPR7429 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.1229: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.1230: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.1231: DFBPPR7435 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.1232: DFBPPR7436 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.1233: DFBPPR7454 ---- Plant proteins ---- Peptide methionine sulfoxide reductase
Source.1234: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.1235: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.1236: DFBPPR7461 ---- Plant proteins ---- Shaggy-related protein kinase theta
Source.1237: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1238: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION
Source.1239: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1240: DFBPPR7518 ---- Plant proteins ---- Agamous-like MADS-box protein AGL15
Source.1241: DFBPPR7528 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.1242: DFBPPR7530 ---- Plant proteins ---- Glycine-rich RNA-binding protein 10
Source.1243: DFBPPR7541 ---- Plant proteins ---- Polcalcin Bra n 1
Source.1244: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.1245: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.1246: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.1247: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.1248: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.1249: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1
Source.1250: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.1251: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.1252: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.1253: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.1254: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.1255: DFBPPR7705 ---- Milk proteins ---- Late lactation protein A, LLP-A
Source.1256: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.1257: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.1258: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.1259: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.1260: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1261: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.1262: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.1263: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1264: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1265: DFBPPR8428 ---- Plant proteins ---- 11S globulin seed storage protein 2
Source.1266: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1267: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.1268: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.1269: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.1270: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic
Source.1271: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.1272: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.1273: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.1274: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.1275: DFBPPR15936 ---- Animal proteins ---- Apolipoprotein E
Source.1276: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2
Source.1277: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.1278: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.1279: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.1280: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.1281: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.1282: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.1283: DFBPPR15960 ---- Animal proteins ---- Apolipoprotein A-IV
Source.1284: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.1285: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.1286: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1
Source.1287: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.1288: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.1289: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9
Source.1290: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1291: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14
Source.1292: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.1293: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1294: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.1295: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1296: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.1297: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.1298: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1299: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.1300: DFBPPR16073 ---- Animal proteins ---- Endothelin-1
Source.1301: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.1302: DFBPPR16093 ---- Animal proteins ---- Menin
Source.1303: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.1304: DFBPPR16102 ---- Animal proteins ---- 40S ribosomal protein S3
Source.1305: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.1306: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1307: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.1308: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1309: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.1310: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.1311: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.1312: DFBPPR16166 ---- Animal proteins ---- Ras-related protein Rab-12
Source.1313: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.1314: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1315: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1316: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.1317: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.1318: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1319: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1320: DFBPPR16214 ---- Animal proteins ---- Insulin-like growth factor I
Source.1321: DFBPPR16216 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.1322: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.1323: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.1324: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.1325: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.1326: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72
Source.1327: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2
Source.1328: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.1329: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta
Source.1330: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type
Source.1331: DFBPPR16264 ---- Animal proteins ---- Pancreatic prohormone
Source.1332: DFBPPR16265 ---- Animal proteins ---- Caspase-1
Source.1333: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.1334: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1335: DFBPPR16282 ---- Animal proteins ---- COMM domain-containing protein 1
Source.1336: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1337: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain
Source.1338: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.1339: DFBPPR16307 ---- Animal proteins ---- DNA-binding protein inhibitor ID-3
Source.1340: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.1341: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.1342: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.1343: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1344: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.1345: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.1346: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2
Source.1347: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.1348: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.1349: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1350: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.1351: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.1352: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.1353: DFBPPR16516 ---- Animal proteins ---- Cytospin-A
Source.1354: DFBPPR16534 ---- Animal proteins ---- Myoglobin
Source.1355: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31
Source.1356: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.1357: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.1358: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.1359: DFBPPR16593 ---- Animal proteins ---- Calcyphosin
Source.1360: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.1361: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.1362: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.1363: DFBPPR16636 ---- Animal proteins ---- Prefoldin subunit 6
Source.1364: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.1365: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1366: DFBPPR16651 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.1367: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.1368: DFBPPR16655 ---- Animal proteins ---- Somatostatin
Source.1369: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5
Source.1370: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.1371: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.1372: DFBPPR16693 ---- Animal proteins ---- Cingulin
Source.1373: DFBPPR16698 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-3
Source.1374: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.1375: DFBPPR16714 ---- Animal proteins ---- Protein fosB
Source.1376: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2
Source.1377: DFBPPR16730 ---- Animal proteins ---- RING finger protein 141
Source.1378: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46
Source.1379: DFBPPR16776 ---- Animal proteins ---- Nucleoside diphosphate kinase
Source.1380: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.1381: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.1382: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin
Source.1383: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1384: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.1385: DFBPPR16834 ---- Animal proteins ---- Seminal plasma protein PDC-109
Source.1386: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.1387: DFBPPR16843 ---- Animal proteins ---- Calmodulin
Source.1388: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.1389: DFBPPR16859 ---- Animal proteins ---- Ubiquitin-like protein ISG15
Source.1390: DFBPPR16862 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3
Source.1391: DFBPPR16868 ---- Animal proteins ---- Insulin-like growth factor I
Source.1392: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.1393: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.1394: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.1395: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.1396: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.1397: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.1398: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1399: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.1400: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.1401: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.1402: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2
Source.1403: DFBPPR17000 ---- Animal proteins ---- Vimentin
Source.1404: DFBPPR17010 ---- Animal proteins ---- Sestrin-2
Source.1405: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1
Source.1406: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.1407: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.1408: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.1409: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1410: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1411: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.1412: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.1413: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.1414: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5
Source.1415: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1416: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21
Source.1417: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.1418: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.1419: DFBPPR17090 ---- Animal proteins ---- Phakinin
Source.1420: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.1421: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.1422: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1423: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1424: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2
Source.1425: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.1426: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.1427: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.1428: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.1429: DFBPPR17189 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.1430: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial
Source.1431: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.1432: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.1433: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35
Source.1434: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.1435: DFBPPR17272 ---- Animal proteins ---- Dysbindin
Source.1436: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.1437: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1438: DFBPPR17286 ---- Animal proteins ---- Septin-2
Source.1439: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.1440: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D
Source.1441: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.1442: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.1443: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2
Source.1444: DFBPPR17314 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit beta
Source.1445: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta
Source.1446: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.1447: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.1448: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase
Source.1449: DFBPPR17334 ---- Animal proteins ---- Prohibitin
Source.1450: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1451: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.1452: DFBPPR17341 ---- Animal proteins ---- Radixin
Source.1453: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B
Source.1454: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.1455: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.1456: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.1457: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.1458: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H
Source.1459: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.1460: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.1461: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.1462: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.1463: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.1464: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10
Source.1465: DFBPPR17401 ---- Animal proteins ---- Moesin
Source.1466: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.1467: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.1468: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.1469: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.1470: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial
Source.1471: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.1472: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.1473: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5
Source.1474: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.1475: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.1476: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.1477: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.1478: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.1479: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.1480: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.1481: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.1482: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.1483: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.1484: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.1485: DFBPPR17522 ---- Animal proteins ---- Homer protein homolog 1
Source.1486: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6
Source.1487: DFBPPR17538 ---- Animal proteins ---- Septin-7
Source.1488: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.1489: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.1490: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.1491: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.1492: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.1493: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1494: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.1495: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1496: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.1497: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.1498: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.1499: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.1500: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.1501: DFBPPR17661 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.1502: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.1503: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.1504: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.1505: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.1506: DFBPPR17694 ---- Animal proteins ---- Pyridoxal kinase
Source.1507: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B
Source.1508: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B
Source.1509: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.1510: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A
Source.1511: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.1512: DFBPPR17753 ---- Animal proteins ---- Apoptosis-associated speck-like protein containing a CARD
Source.1513: DFBPPR17764 ---- Animal proteins ---- L-selectin
Source.1514: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5
Source.1515: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.1516: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C
Source.1517: DFBPPR17783 ---- Animal proteins ---- 40S ribosomal protein S3
Source.1518: DFBPPR17787 ---- Animal proteins ---- Septin-6
Source.1519: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.1520: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.1521: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.1522: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.1523: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1524: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B
Source.1525: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.1526: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.1527: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.1528: DFBPPR17866 ---- Animal proteins ---- PIH1 domain-containing protein 1
Source.1529: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.1530: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.1531: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.1532: DFBPPR17879 ---- Animal proteins ---- Menin
Source.1533: DFBPPR17880 ---- Animal proteins ---- Apolipoprotein A-IV
Source.1534: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.1535: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.1536: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.1537: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1538: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.1539: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.1540: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A
Source.1541: DFBPPR17923 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.1542: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.1543: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1544: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.1545: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2
Source.1546: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.1547: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1
Source.1548: DFBPPR17955 ---- Animal proteins ---- m7GpppX diphosphatase
Source.1549: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.1550: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.1551: DFBPPR17966 ---- Animal proteins ---- Clathrin light chain A
Source.1552: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.1553: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.1554: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN
Source.1555: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.1556: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.1557: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.1558: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.1559: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein
Source.1560: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1
Source.1561: DFBPPR18041 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 S
Source.1562: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6
Source.1563: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5
Source.1564: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.1565: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1566: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.1567: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.1568: DFBPPR18065 ---- Animal proteins ---- Isopentenyl-diphosphate Delta-isomerase 1
Source.1569: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.1570: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8
Source.1571: DFBPPR18078 ---- Animal proteins ---- 14-3-3 protein eta
Source.1572: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8
Source.1573: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.1574: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.1575: DFBPPR18111 ---- Animal proteins ---- Transcriptional adapter 3
Source.1576: DFBPPR18114 ---- Animal proteins ---- Charged multivesicular body protein 4a
Source.1577: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.1578: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.1579: DFBPPR18150 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 1
Source.1580: DFBPPR18174 ---- Animal proteins ---- Interferon-inducible double-stranded RNA-dependent protein kinase activator A
Source.1581: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.1582: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.1583: DFBPPR18220 ---- Animal proteins ---- Platelet-activating factor receptor
Source.1584: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.1585: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.1586: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1
Source.1587: DFBPPR18242 ---- Animal proteins ---- Heparanase
Source.1588: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.1589: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase
Source.1590: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.1591: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.1592: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2
Source.1593: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.1594: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56
Source.1595: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.1596: DFBPPR18290 ---- Animal proteins ---- Cyclin-dependent kinase 10
Source.1597: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C
Source.1598: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.1599: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.1600: DFBPPR18325 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.1601: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon
Source.1602: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.1603: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.1604: DFBPPR18335 ---- Animal proteins ---- Septin-11
Source.1605: DFBPPR18337 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 alpha
Source.1606: DFBPPR18346 ---- Animal proteins ---- DNA-binding protein inhibitor ID-3
Source.1607: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3
Source.1608: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.1609: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.1610: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.1611: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.1612: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3
Source.1613: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.1614: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.1615: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.1616: DFBPPR18408 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.1617: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1
Source.1618: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.1619: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor
Source.1620: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.1621: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.1622: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.1623: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin
Source.1624: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1
Source.1625: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.1626: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.1627: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22
Source.1628: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.1629: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1
Source.1630: DFBPPR18459 ---- Animal proteins ---- Transcription factor AP-1
Source.1631: DFBPPR18466 ---- Animal proteins ---- Retinoic acid receptor responder protein 2
Source.1632: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.1633: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.1634: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47
Source.1635: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein
Source.1636: DFBPPR18497 ---- Animal proteins ---- Synaptobrevin homolog YKT6
Source.1637: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.1638: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.1639: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.1640: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.1641: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.1642: DFBPPR18541 ---- Animal proteins ---- Chromatin modification-related protein MEAF6
Source.1643: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.1644: DFBPPR18578 ---- Animal proteins ---- 5-demethoxyubiquinone hydroxylase, mitochondrial
Source.1645: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.1646: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.1647: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit
Source.1648: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2
Source.1649: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.1650: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.1651: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1
Source.1652: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1653: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta
Source.1654: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.1655: DFBPPR18641 ---- Animal proteins ---- Cadherin-5
Source.1656: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type
Source.1657: DFBPPR18649 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.1658: DFBPPR18698 ---- Animal proteins ---- ATPase GET3
Source.1659: DFBPPR18702 ---- Animal proteins ---- E3 ubiquitin-protein ligase E3D
Source.1660: DFBPPR18720 ---- Animal proteins ---- Protein quaking
Source.1661: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.1662: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.1663: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.1664: DFBPPR18745 ---- Animal proteins ---- Cocaine- and amphetamine-regulated transcript protein
Source.1665: DFBPPR18754 ---- Animal proteins ---- Collectin-11
Source.1666: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.1667: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.1668: DFBPPR18766 ---- Animal proteins ---- Negative elongation factor E
Source.1669: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.1670: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.1671: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.1672: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.1673: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5
Source.1674: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.1675: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.1676: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.1677: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6
Source.1678: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.1679: DFBPPR18840 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F
Source.1680: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1681: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.1682: DFBPPR18848 ---- Animal proteins ---- Ras-related protein Rab-15
Source.1683: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin
Source.1684: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.1685: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.1686: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.1687: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.1688: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.1689: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11
Source.1690: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.1691: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.1692: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.1693: DFBPPR18933 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.1694: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.1695: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.1696: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.1697: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2
Source.1698: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1
Source.1699: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.1700: DFBPPR18966 ---- Animal proteins ---- Lupus La protein homolog
Source.1701: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1
Source.1702: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.1703: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.1704: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.1705: DFBPPR18993 ---- Animal proteins ---- Dynein regulatory complex protein 1
Source.1706: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.1707: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2
Source.1708: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3
Source.1709: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D
Source.1710: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11
Source.1711: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic
Source.1712: DFBPPR19044 ---- Animal proteins ---- Adenylosuccinate lyase
Source.1713: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2
Source.1714: DFBPPR19053 ---- Animal proteins ---- Transmembrane protein 100
Source.1715: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.1716: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.1717: DFBPPR19069 ---- Animal proteins ---- Small glutamine-rich tetratricopeptide repeat-containing protein alpha
Source.1718: DFBPPR19076 ---- Animal proteins ---- Protein MGARP
Source.1719: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1
Source.1720: DFBPPR19083 ---- Animal proteins ---- UBX domain-containing protein 1
Source.1721: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.1722: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.1723: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.1724: DFBPPR19105 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein
Source.1725: DFBPPR19107 ---- Animal proteins ---- Lymphocyte transmembrane adapter 1
Source.1726: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.1727: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3
Source.1728: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8
Source.1729: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.1730: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like
Source.1731: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2
Source.1732: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14
Source.1733: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2
Source.1734: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1
Source.1735: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone
Source.1736: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3
Source.1737: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1738: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4
Source.1739: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.1740: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5
Source.1741: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial
Source.1742: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.1743: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.1744: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.1745: DFBPPR19237 ---- Animal proteins ---- Cadherin-18
Source.1746: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.1747: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.1748: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.1749: DFBPPR19246 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.1750: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.1751: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.1752: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.1753: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.1754: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1
Source.1755: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.1756: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.1757: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.1758: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.1759: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.1760: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1
Source.1761: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.1762: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1763: DFBPPR19352 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit GRINL1A
Source.1764: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.1765: DFBPPR19361 ---- Animal proteins ---- Retinol dehydrogenase 14
Source.1766: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog
Source.1767: DFBPPR19371 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 1
Source.1768: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor
Source.1769: DFBPPR19381 ---- Animal proteins ---- BRCA2 and CDKN1A-interacting protein
Source.1770: DFBPPR19396 ---- Animal proteins ---- SAM and SH3 domain-containing protein 3
Source.1771: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein
Source.1772: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.1773: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.1774: DFBPPR19429 ---- Animal proteins ---- Protein Spindly
Source.1775: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70
Source.1776: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor
Source.1777: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59
Source.1778: DFBPPR19440 ---- Animal proteins ---- Phosphoglycerate mutase 2
Source.1779: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3
Source.1780: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.1781: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.1782: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2
Source.1783: DFBPPR19463 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide VF
Source.1784: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.1785: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.1786: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.1787: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.1788: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.1789: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.1790: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.1791: DFBPPR19482 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.1792: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13
Source.1793: DFBPPR19486 ---- Animal proteins ---- Probable dimethyladenosine transferase
Source.1794: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.1795: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.1796: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73
Source.1797: DFBPPR19499 ---- Animal proteins ---- Transcription factor MafG
Source.1798: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2
Source.1799: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.1800: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.1801: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.1802: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.1803: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.1804: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.1805: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.1806: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.1807: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.1808: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial
Source.1809: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2
Source.1810: DFBPPR19582 ---- Animal proteins ---- dCTP pyrophosphatase 1
Source.1811: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin
Source.1812: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4
Source.1813: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.1814: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.1815: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase
Source.1816: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.1817: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.1818: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5
Source.1819: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.1820: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta
Source.1821: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2
Source.1822: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.1823: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein
Source.1824: DFBPPR19648 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit
Source.1825: DFBPPR19668 ---- Animal proteins ---- Calicin
Source.1826: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein
Source.1827: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2
Source.1828: DFBPPR19683 ---- Animal proteins ---- COMM domain-containing protein 1
Source.1829: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.1830: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.1831: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase
Source.1832: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.1833: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3
Source.1834: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.1835: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.1836: DFBPPR19709 ---- Animal proteins ---- Centromere protein X
Source.1837: DFBPPR19713 ---- Animal proteins ---- Shadow of prion protein
Source.1838: DFBPPR19718 ---- Animal proteins ---- Type 2 phosphatidylinositol 4,5-bisphosphate 4-phosphatase
Source.1839: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.1840: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.1841: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.1842: DFBPPR19740 ---- Animal proteins ---- Sin3 histone deacetylase corepressor complex component SDS3
Source.1843: DFBPPR19752 ---- Animal proteins ---- Chromatin target of PRMT1 protein
Source.1844: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1
Source.1845: DFBPPR19776 ---- Animal proteins ---- Tropomyosin alpha-3 chain
Source.1846: DFBPPR19785 ---- Animal proteins ---- Calcyclin-binding protein
Source.1847: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4
Source.1848: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.1849: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4
Source.1850: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.1851: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L
Source.1852: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1853: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.1854: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial
Source.1855: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.1856: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.1857: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.1858: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.1859: DFBPPR19874 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor B
Source.1860: DFBPPR19876 ---- Animal proteins ---- Placenta-expressed transcript 1 protein
Source.1861: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.1862: DFBPPR19884 ---- Animal proteins ---- Activator of basal transcription 1
Source.1863: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27
Source.1864: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.1865: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.1866: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.1867: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.1868: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase
Source.1869: DFBPPR19935 ---- Animal proteins ---- Reticulon-3
Source.1870: DFBPPR19940 ---- Animal proteins ---- Keratin, type II cytoskeletal 78
Source.1871: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40
Source.1872: DFBPPR19949 ---- Animal proteins ---- Syndecan-2
Source.1873: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.1874: DFBPPR19970 ---- Animal proteins ---- 14-3-3 protein gamma
Source.1875: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.1876: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7
Source.1877: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.1878: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3
Source.1879: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.1880: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer
Source.1881: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.1882: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1
Source.1883: DFBPPR20058 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2
Source.1884: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.1885: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.1886: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.1887: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1
Source.1888: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.1889: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.1890: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.1891: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.1892: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1
Source.1893: DFBPPR20099 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit WDR4
Source.1894: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1
Source.1895: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.1896: DFBPPR20149 ---- Animal proteins ---- Flotillin-2
Source.1897: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.1898: DFBPPR20155 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF181
Source.1899: DFBPPR20161 ---- Animal proteins ---- Calponin-2
Source.1900: DFBPPR20166 ---- Animal proteins ---- Programmed cell death protein 5
Source.1901: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1
Source.1902: DFBPPR20183 ---- Animal proteins ---- Mitochondrial intermembrane space import and assembly protein 40
Source.1903: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.1904: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.1905: DFBPPR20195 ---- Animal proteins ---- GSK3B-interacting protein
Source.1906: DFBPPR20197 ---- Animal proteins ---- Ribonuclease P protein subunit p20
Source.1907: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1
Source.1908: DFBPPR20224 ---- Animal proteins ---- Sclerostin
Source.1909: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2
Source.1910: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase
Source.1911: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.1912: DFBPPR20250 ---- Animal proteins ---- General transcription factor IIH subunit 5
Source.1913: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2
Source.1914: DFBPPR20258 ---- Animal proteins ---- Ribosome biogenesis regulatory protein homolog
Source.1915: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79
Source.1916: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.1917: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.1918: DFBPPR20290 ---- Animal proteins ---- Dynein light chain 1, axonemal
Source.1919: DFBPPR20305 ---- Animal proteins ---- Nostrin
Source.1920: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.1921: DFBPPR20323 ---- Animal proteins ---- Myosin light chain 3
Source.1922: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14
Source.1923: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.1924: DFBPPR20344 ---- Animal proteins ---- Dynactin subunit 2
Source.1925: DFBPPR20354 ---- Animal proteins ---- Single-strand selective monofunctional uracil DNA glycosylase
Source.1926: DFBPPR20359 ---- Animal proteins ---- Glutathione S-transferase theta-1
Source.1927: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.1928: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6
Source.1929: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.1930: DFBPPR20388 ---- Animal proteins ---- SOSS complex subunit C
Source.1931: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2
Source.1932: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.1933: DFBPPR20399 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC4
Source.1934: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.1935: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.1936: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein
Source.1937: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.1938: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.1939: DFBPPR20442 ---- Animal proteins ---- DNA replication complex GINS protein SLD5
Source.1940: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4
Source.1941: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C
Source.1942: DFBPPR20468 ---- Animal proteins ---- 28S ribosomal protein S28, mitochondrial
Source.1943: DFBPPR20481 ---- Animal proteins ---- Ropporin-1
Source.1944: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.1945: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.1946: DFBPPR20495 ---- Animal proteins ---- Spliceosome-associated protein CWC15 homolog
Source.1947: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.1948: DFBPPR20531 ---- Animal proteins ---- Myozenin-2
Source.1949: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.1950: DFBPPR20544 ---- Animal proteins ---- 28S ribosomal protein S34, mitochondrial
Source.1951: DFBPPR20557 ---- Animal proteins ---- Asporin
Source.1952: DFBPPR20560 ---- Animal proteins ---- Draxin
Source.1953: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.1954: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta
Source.1955: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related
Source.1956: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16
Source.1957: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.1958: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.1959: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase
Source.1960: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.1961: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.1962: DFBPPR20627 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.1963: DFBPPR20652 ---- Animal proteins ---- HAUS augmin-like complex subunit 1
Source.1964: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa
Source.1965: DFBPPR20666 ---- Animal proteins ---- Tektin-2
Source.1966: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11
Source.1967: DFBPPR20695 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 28 homolog
Source.1968: DFBPPR20702 ---- Animal proteins ---- 5-azacytidine-induced protein 2
Source.1969: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1
Source.1970: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21
Source.1971: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.1972: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.1973: DFBPPR20743 ---- Animal proteins ---- Myozenin-1
Source.1974: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.1975: DFBPPR20762 ---- Animal proteins ---- Mucosal pentraxin
Source.1976: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.1977: DFBPPR20776 ---- Animal proteins ---- C4b-binding protein beta chain
Source.1978: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.1979: DFBPPR20789 ---- Animal proteins ---- Prefoldin subunit 6
Source.1980: DFBPPR20791 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 13
Source.1981: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.1982: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase
Source.1983: DFBPPR20823 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.1984: DFBPPR20824 ---- Animal proteins ---- CD151 antigen
Source.1985: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.1986: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.1987: DFBPPR20856 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim10
Source.1988: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial
Source.1989: DFBPPR20860 ---- Animal proteins ---- Vesicle-associated membrane protein 5
Source.1990: DFBPPR20861 ---- Animal proteins ---- Zinc finger protein 135
Source.1991: DFBPPR20883 ---- Animal proteins ---- Pre-mRNA-splicing factor 38A
Source.1992: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237
Source.1993: DFBPPR20894 ---- Animal proteins ---- THAP domain-containing protein 11
Source.1994: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.1995: DFBPPR20899 ---- Animal proteins ---- Centrosomal protein kizuna
Source.1996: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.1997: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668
Source.1998: DFBPPR20913 ---- Animal proteins ---- Somatostatin
Source.1999: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.2000: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.2001: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4
Source.2002: DFBPPR20942 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.2003: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A
Source.2004: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1
Source.2005: DFBPPR20954 ---- Animal proteins ---- Secretagogin
Source.2006: DFBPPR20959 ---- Animal proteins ---- Janus kinase and microtubule-interacting protein 1
Source.2007: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.2008: DFBPPR20972 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP11
Source.2009: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.2010: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.2011: DFBPPR20997 ---- Animal proteins ---- Prefoldin subunit 2
Source.2012: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2
Source.2013: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha
Source.2014: DFBPPR21003 ---- Animal proteins ---- Protein BCAP
Source.2015: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1
Source.2016: DFBPPR21033 ---- Animal proteins ---- 26S proteasome complex subunit SEM1
Source.2017: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.2018: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10
Source.2019: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28
Source.2020: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.2021: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C
Source.2022: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.2023: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein
Source.2024: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43
Source.2025: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1
Source.2026: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4
Source.2027: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7
Source.2028: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.2029: DFBPPR21107 ---- Animal proteins ---- Proteasome assembly chaperone 2
Source.2030: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.2031: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.2032: DFBPPR21121 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-3
Source.2033: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2
Source.2034: DFBPPR21155 ---- Animal proteins ---- Cyclin-H
Source.2035: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22
Source.2036: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.2037: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase
Source.2038: DFBPPR21180 ---- Animal proteins ---- Golgin subfamily A member 7
Source.2039: DFBPPR21184 ---- Animal proteins ---- Kinetochore protein Spc24
Source.2040: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal
Source.2041: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.2042: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1
Source.2043: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog
Source.2044: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2
Source.2045: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2
Source.2046: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase
Source.2047: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.2048: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.2049: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase
Source.2050: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1
Source.2051: DFBPPR21293 ---- Animal proteins ---- IST1 homolog
Source.2052: DFBPPR21296 ---- Animal proteins ---- Parathymosin
Source.2053: DFBPPR21303 ---- Animal proteins ---- Palmdelphin
Source.2054: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.2055: DFBPPR21312 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim8 B
Source.2056: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein
Source.2057: DFBPPR21315 ---- Animal proteins ---- PCNA-interacting partner
Source.2058: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.2059: DFBPPR21342 ---- Animal proteins ---- G kinase-anchoring protein 1
Source.2060: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.2061: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3
Source.2062: DFBPPR21358 ---- Animal proteins ---- Myosin light chain 1/3, skeletal muscle isoform
Source.2063: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18
Source.2064: DFBPPR21369 ---- Animal proteins ---- Protein MIS12 homolog
Source.2065: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.2066: DFBPPR21377 ---- Animal proteins ---- Hemoglobin subunit mu
Source.2067: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B
Source.2068: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.2069: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.2070: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.2071: DFBPPR21397 ---- Animal proteins ---- Leucine zipper transcription factor-like protein 1
Source.2072: DFBPPR21399 ---- Animal proteins ---- Trafficking protein particle complex subunit 6A
Source.2073: DFBPPR21401 ---- Animal proteins ---- THAP domain-containing protein 5
Source.2074: DFBPPR21404 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 1
Source.2075: DFBPPR21407 ---- Animal proteins ---- Ribosome biogenesis protein BRX1 homolog
Source.2076: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A
Source.2077: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C
Source.2078: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B
Source.2079: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1
Source.2080: DFBPPR21451 ---- Animal proteins ---- Nurim
Source.2081: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.2082: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.2083: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3
Source.2084: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.2085: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.2086: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.2087: DFBPPR21479 ---- Animal proteins ---- Pentraxin-related protein PTX3
Source.2088: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8
Source.2089: DFBPPR21498 ---- Animal proteins ---- Alanyl-tRNA editing protein Aarsd1
Source.2090: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1
Source.2091: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2
Source.2092: DFBPPR21532 ---- Animal proteins ---- Transmembrane protein 225
Source.2093: DFBPPR21562 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.2094: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.2095: DFBPPR21586 ---- Animal proteins ---- Cyclin-C
Source.2096: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma
Source.2097: DFBPPR21594 ---- Animal proteins ---- SH3 domain-binding protein 5-like
Source.2098: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2
Source.2099: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.2100: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.2101: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.2102: DFBPPR21689 ---- Animal proteins ---- ADP-ribosylation factor-like protein 11
Source.2103: DFBPPR21691 ---- Animal proteins ---- Protein LRATD1
Source.2104: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.2105: DFBPPR21731 ---- Animal proteins ---- DnaJ homolog subfamily C member 17
Source.2106: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.2107: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1
Source.2108: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15
Source.2109: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.2110: DFBPPR21750 ---- Animal proteins ---- 14-3-3 protein theta
Source.2111: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1
Source.2112: DFBPPR21763 ---- Animal proteins ---- Protein GOLM2
Source.2113: DFBPPR21768 ---- Animal proteins ---- Tektin-4
Source.2114: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4
Source.2115: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.2116: DFBPPR21779 ---- Animal proteins ---- Serpin B8
Source.2117: DFBPPR21783 ---- Animal proteins ---- Radial spoke head protein 9 homolog
Source.2118: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.2119: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44
Source.2120: DFBPPR21799 ---- Animal proteins ---- Major vault protein
Source.2121: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.2122: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.2123: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.2124: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein
Source.2125: DFBPPR21825 ---- Animal proteins ---- Meiosis-specific nuclear structural protein 1
Source.2126: DFBPPR21826 ---- Animal proteins ---- RING finger protein 141
Source.2127: DFBPPR21828 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 11
Source.2128: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1
Source.2129: DFBPPR21856 ---- Animal proteins ---- Protein FAM32A
Source.2130: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.2131: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.2132: DFBPPR21897 ---- Animal proteins ---- ZW10 interactor
Source.2133: DFBPPR21901 ---- Animal proteins ---- Calcyphosin
Source.2134: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.2135: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog
Source.2136: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.2137: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein
Source.2138: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog
Source.2139: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial
Source.2140: DFBPPR21968 ---- Animal proteins ---- F-box only protein 28
Source.2141: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1
Source.2142: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein
Source.2143: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1
Source.2144: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.2145: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1
Source.2146: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14
Source.2147: DFBPPR22012 ---- Animal proteins ---- GRB2-related adapter protein
Source.2148: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein
Source.2149: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.2150: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.2151: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12
Source.2152: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C
Source.2153: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.2154: DFBPPR22066 ---- Animal proteins ---- Pyridoxal phosphate homeostasis protein
Source.2155: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.2156: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5
Source.2157: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9
Source.2158: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512
Source.2159: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor
Source.2160: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1
Source.2161: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2
Source.2162: DFBPPR22101 ---- Animal proteins ---- DNA polymerase epsilon subunit 4
Source.2163: DFBPPR22112 ---- Animal proteins ---- DPY30 domain-containing protein 1
Source.2164: DFBPPR22113 ---- Animal proteins ---- DPY30 domain-containing protein 1
Source.2165: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2
Source.2166: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2
Source.2167: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B
Source.2168: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein
Source.2169: DFBPPR22159 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 24
Source.2170: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.2171: DFBPPR22165 ---- Animal proteins ---- Coiled-coil domain-containing protein 106
Source.2172: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.2173: DFBPPR22171 ---- Animal proteins ---- Leucine-rich repeat flightless-interacting protein 2
Source.2174: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.2175: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial
Source.2176: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.2177: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5
Source.2178: DFBPPR22201 ---- Animal proteins ---- Pleckstrin homology domain-containing family J member 1
Source.2179: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.2180: DFBPPR22209 ---- Animal proteins ---- Transmembrane protein 147
Source.2181: DFBPPR22213 ---- Animal proteins ---- Protein TEX261
Source.2182: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1
Source.2183: DFBPPR22223 ---- Animal proteins ---- Calretinin
Source.2184: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.2185: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.2186: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5
Source.2187: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.2188: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.2189: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.2190: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.2191: DFBPPR22262 ---- Animal proteins ---- Tetraspanin-18
Source.2192: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog
Source.2193: DFBPPR22275 ---- Animal proteins ---- 60S ribosomal protein L17
Source.2194: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B
Source.2195: DFBPPR22282 ---- Animal proteins ---- Optic atrophy 3 protein homolog
Source.2196: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B
Source.2197: DFBPPR22291 ---- Animal proteins ---- Keratin-like protein KRT222
Source.2198: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2
Source.2199: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A
Source.2200: DFBPPR22322 ---- Animal proteins ---- Testis-specific protein 10-interacting protein
Source.2201: DFBPPR22324 ---- Animal proteins ---- Arginine and glutamate-rich protein 1
Source.2202: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.2203: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.2204: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.2205: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B
Source.2206: DFBPPR22346 ---- Animal proteins ---- FUN14 domain-containing protein 2
Source.2207: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63
Source.2208: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.2209: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein
Source.2210: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.2211: DFBPPR22369 ---- Animal proteins ---- Transmembrane protein 247
Source.2212: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1
Source.2213: DFBPPR22380 ---- Animal proteins ---- G patch domain-containing protein 4
Source.2214: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A
Source.2215: DFBPPR22395 ---- Animal proteins ---- UPF0524 protein C3orf70 homolog
Source.2216: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9
Source.2217: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog
Source.2218: DFBPPR22419 ---- Animal proteins ---- Prolyl-tRNA synthetase associated domain-containing protein 1
Source.2219: DFBPPR22422 ---- Animal proteins ---- UPF0428 protein CXorf56 homolog
Source.2220: DFBPPR22431 ---- Animal proteins ---- BolA-like protein 3
Source.2221: DFBPPR22445 ---- Animal proteins ---- Tetratricopeptide repeat protein 1
Source.2222: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2
Source.2223: DFBPPR22448 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 5B
Source.2224: DFBPPR22455 ---- Animal proteins ---- Phosducin-like protein 2
Source.2225: DFBPPR22460 ---- Animal proteins ---- Coiled-coil domain-containing protein 149
Source.2226: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein
Source.2227: DFBPPR22469 ---- Animal proteins ---- Protein FAM136A
Source.2228: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.2229: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.2230: DFBPPR22497 ---- Animal proteins ---- Enkurin domain-containing protein 1
Source.2231: DFBPPR22508 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 2
Source.2232: DFBPPR22520 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 2
Source.2233: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8
Source.2234: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2
Source.2235: DFBPPR22559 ---- Animal proteins ---- Vimentin-type intermediate filament-associated coiled-coil protein
Source.2236: DFBPPR22560 ---- Animal proteins ---- Mesenteric estrogen-dependent adipogenesis protein
Source.2237: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.2238: DFBPPR22575 ---- Animal proteins ---- UPF0687 protein C20orf27 homolog
Source.2239: DFBPPR22584 ---- Animal proteins ---- Arginine vasopressin-induced protein 1
Source.2240: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.2241: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19
Source.2242: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13
Source.2243: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.2244: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4
Source.2245: DFBPPR22614 ---- Animal proteins ---- Protein FAM81B
Source.2246: DFBPPR22617 ---- Animal proteins ---- SNRPN upstream reading frame protein
Source.2247: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72
Source.2248: DFBPPR22629 ---- Animal proteins ---- Coiled-coil domain-containing protein 153
Source.2249: DFBPPR22639 ---- Animal proteins ---- UPF0235 protein C15orf40 homolog
Source.2250: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.2251: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65
Source.2252: DFBPPR22652 ---- Animal proteins ---- PX domain-containing protein 1
Source.2253: DFBPPR22667 ---- Animal proteins ---- Uncharacterized protein C17orf78 homolog
Source.2254: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog
Source.2255: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C
Source.2256: DFBPPR22699 ---- Animal proteins ---- LYR motif-containing protein 9
Source.2257: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog
Source.2258: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein
Source.2259: DFBPPR22749 ---- Animal proteins ---- Uncharacterized protein C2orf73 homolog
Source.2260: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog
Source.2261: DFBPPR8531 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.2262: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.2263: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.2264: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.2265: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2266: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.2267: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.2268: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.2269: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.2270: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.2271: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.2272: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.2273: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.2274: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.2275: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.2276: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.2277: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.2278: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.2279: DFBPPR8639 ---- Animal proteins ---- Mannose-binding protein A
Source.2280: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.2281: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.2282: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A
Source.2283: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2284: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.2285: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.2286: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.2287: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.2288: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.2289: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.2290: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C
Source.2291: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9
Source.2292: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.2293: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.2294: DFBPPR8738 ---- Animal proteins ---- Interleukin-8
Source.2295: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2296: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.2297: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.2298: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.2299: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.2300: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.2301: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.2302: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.2303: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.2304: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.2305: DFBPPR8784 ---- Animal proteins ---- Transcription factor AP-1
Source.2306: DFBPPR8785 ---- Animal proteins ---- 40S ribosomal protein S3
Source.2307: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.2308: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.2309: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.2310: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.2311: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.2312: DFBPPR8823 ---- Animal proteins ---- Sodium/potassium ATPase inhibitor SPAI-2
Source.2313: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase
Source.2314: DFBPPR8825 ---- Animal proteins ---- Optineurin
Source.2315: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1
Source.2316: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.2317: DFBPPR8849 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.2318: DFBPPR8850 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.2319: DFBPPR8851 ---- Animal proteins ---- Vimentin
Source.2320: DFBPPR8852 ---- Animal proteins ---- Vimentin
Source.2321: DFBPPR8854 ---- Animal proteins ---- Vimentin
Source.2322: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog
Source.2323: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide
Source.2324: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.2325: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.2326: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.2327: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.2328: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.2329: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.2330: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.2331: DFBPPR8969 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha
Source.2332: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.2333: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.2334: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.2335: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.2336: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.2337: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.2338: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.2339: DFBPPR9048 ---- Animal proteins ---- Neuroendocrine protein 7B2
Source.2340: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.2341: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.2342: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.2343: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.2344: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.2345: DFBPPR9085 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1
Source.2346: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.2347: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.2348: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.2349: DFBPPR9108 ---- Animal proteins ---- Somatostatin
Source.2350: DFBPPR9110 ---- Animal proteins ---- Insulin-like growth factor I
Source.2351: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.2352: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.2353: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.2354: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.2355: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.2356: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.2357: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.2358: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.2359: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein
Source.2360: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.2361: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.2362: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.2363: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10
Source.2364: DFBPPR9236 ---- Animal proteins ---- Radixin
Source.2365: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3
Source.2366: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B
Source.2367: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.2368: DFBPPR9254 ---- Animal proteins ---- Complement factor D
Source.2369: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.2370: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.2371: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3
Source.2372: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.2373: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.2374: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.2375: DFBPPR9315 ---- Animal proteins ---- Protein S100-G
Source.2376: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.2377: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase
Source.2378: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1
Source.2379: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.2380: DFBPPR9346 ---- Animal proteins ---- Myozenin-1
Source.2381: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.2382: DFBPPR9352 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.2383: DFBPPR9363 ---- Animal proteins ---- Moesin
Source.2384: DFBPPR9369 ---- Animal proteins ---- Nuclear receptor subfamily 6 group A member 1
Source.2385: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.2386: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.2387: DFBPPR9373 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.2388: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.2389: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1
Source.2390: DFBPPR9395 ---- Animal proteins ---- Calponin-2
Source.2391: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.2392: DFBPPR9403 ---- Animal proteins ---- Ras-related protein Rab-34
Source.2393: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.2394: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type
Source.2395: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type
Source.2396: DFBPPR9408 ---- Animal proteins ---- CD70 antigen
Source.2397: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.2398: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2399: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.2400: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.2401: DFBPPR9427 ---- Animal proteins ---- Protein quaking
Source.2402: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59
Source.2403: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59
Source.2404: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.2405: DFBPPR9447 ---- Animal proteins ---- Myosin light chain 4
Source.2406: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.2407: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.2408: DFBPPR9497 ---- Animal proteins ---- Myoglobin
Source.2409: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1
Source.2410: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.2411: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.2412: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.2413: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1
Source.2414: DFBPPR9535 ---- Animal proteins ---- Ribonuclease inhibitor
Source.2415: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.2416: DFBPPR9552 ---- Animal proteins ---- Electron transfer flavoprotein subunit beta
Source.2417: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.2418: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.2419: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.2420: DFBPPR9595 ---- Animal proteins ---- Platelet-activating factor receptor
Source.2421: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.2422: DFBPPR9606 ---- Animal proteins ---- Pancreatic prohormone precursor
Source.2423: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2424: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.2425: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.2426: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.2427: DFBPPR9729 ---- Animal proteins ---- Secretagogin
Source.2428: DFBPPR9734 ---- Animal proteins ---- Replication termination factor 2
Source.2429: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.2430: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain
Source.2431: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.2432: DFBPPR9751 ---- Animal proteins ---- Perilipin-3
Source.2433: DFBPPR9759 ---- Animal proteins ---- Palmdelphin
Source.2434: DFBPPR9801 ---- Animal proteins ---- Tropomyosin alpha-3 chain
Source.2435: DFBPPR9808 ---- Animal proteins ---- Epidermal growth factor-like protein 8
Source.2436: DFBPPR9816 ---- Animal proteins ---- Metaxin-2
Source.2437: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.2438: DFBPPR9821 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.2439: DFBPPR9839 ---- Animal proteins ---- Nurim
Source.2440: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.2441: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1
Source.2442: DFBPPR9860 ---- Animal proteins ---- Transcription factor 19
Source.2443: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.2444: DFBPPR9898 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.2445: DFBPPR9904 ---- Animal proteins ---- EKC/KEOPS complex subunit GON7
Source.2446: DFBPPR9906 ---- Animal proteins ---- Tetraspanin-9
Source.2447: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.2448: DFBPPR9938 ---- Animal proteins ---- FUN14 domain-containing protein 2
Source.2449: DFBPPR9940 ---- Animal proteins ---- Neuronatin
Source.2450: DFBPPR9963 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.2451: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2452: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2
Source.2453: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.2454: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.2455: DFBPPR9991 ---- Animal proteins ---- Insulin-like growth factor I
Source.2456: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.2457: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2458: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.2459: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.2460: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2
Source.2461: DFBPPR10030 ---- Animal proteins ---- Calbindin
Source.2462: DFBPPR10033 ---- Animal proteins ---- Apolipoprotein A-I
Source.2463: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.2464: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.2465: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta
Source.2466: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.2467: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.2468: DFBPPR10061 ---- Animal proteins ---- Ovocleidin-17
Source.2469: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11
Source.2470: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9
Source.2471: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2472: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor
Source.2473: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2
Source.2474: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.2475: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.2476: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2
Source.2477: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.2478: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog
Source.2479: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.2480: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1
Source.2481: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.2482: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7
Source.2483: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.2484: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.2485: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.2486: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.2487: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.2488: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.2489: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.2490: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.2491: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.2492: DFBPPR10163 ---- Animal proteins ---- Annexin A6
Source.2493: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8
Source.2494: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.2495: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.2496: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.2497: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1
Source.2498: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.2499: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.2500: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.2501: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.2502: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.2503: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1
Source.2504: DFBPPR10215 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.2505: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.2506: DFBPPR10240 ---- Animal proteins ---- Cerberus
Source.2507: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.2508: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.2509: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1
Source.2510: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.2511: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.2512: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.2513: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2514: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.2515: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.2516: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.2517: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.2518: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.2519: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP
Source.2520: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.2521: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1
Source.2522: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.2523: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.2524: DFBPPR10311 ---- Animal proteins ---- Homeobox protein engrailed-2
Source.2525: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.2526: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.2527: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.2528: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7
Source.2529: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.2530: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.2531: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.2532: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.2533: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.2534: DFBPPR10366 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.2535: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.2536: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.2537: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.2538: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.2539: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65
Source.2540: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.2541: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.2542: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.2543: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.2544: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.2545: DFBPPR10412 ---- Animal proteins ---- Dysbindin
Source.2546: DFBPPR10416 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.2547: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5
Source.2548: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.2549: DFBPPR10424 ---- Animal proteins ---- Charged multivesicular body protein 4b
Source.2550: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10
Source.2551: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.2552: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.2553: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.2554: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2555: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.2556: DFBPPR10481 ---- Animal proteins ---- Syndecan-3
Source.2557: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.2558: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.2559: DFBPPR10490 ---- Animal proteins ---- Tudor-interacting repair regulator protein
Source.2560: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.2561: DFBPPR10496 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.2562: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.2563: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.2564: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.2565: DFBPPR10508 ---- Animal proteins ---- Septin-2
Source.2566: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase
Source.2567: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.2568: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.2569: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.2570: DFBPPR10540 ---- Animal proteins ---- Nucleoside diphosphate kinase
Source.2571: DFBPPR10544 ---- Animal proteins ---- Thioredoxin
Source.2572: DFBPPR10546 ---- Animal proteins ---- Calmodulin
Source.2573: DFBPPR10552 ---- Animal proteins ---- Transcription factor AP-1
Source.2574: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.2575: DFBPPR10563 ---- Animal proteins ---- Optineurin
Source.2576: DFBPPR10567 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial
Source.2577: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase
Source.2578: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.2579: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.2580: DFBPPR10584 ---- Animal proteins ---- Nuclear distribution protein nudE homolog 1
Source.2581: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.2582: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.2583: DFBPPR10590 ---- Animal proteins ---- Centromere protein X
Source.2584: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.2585: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.2586: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.2587: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.2588: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.2589: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.2590: DFBPPR10616 ---- Animal proteins ---- Cholecystokinin
Source.2591: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.2592: DFBPPR10620 ---- Animal proteins ---- Centromere protein T
Source.2593: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.2594: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.2595: DFBPPR10629 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.2596: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.2597: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.2598: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.2599: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.2600: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.2601: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.2602: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.2603: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.2604: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.2605: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.2606: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.2607: DFBPPR10670 ---- Animal proteins ---- Interferon lambda-3
Source.2608: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.2609: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.2610: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.2611: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.2612: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.2613: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.2614: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.2615: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.2616: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2
Source.2617: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.2618: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.2619: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.2620: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.2621: DFBPPR10718 ---- Animal proteins ---- Myosin light chain 1, skeletal muscle isoform
Source.2622: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.2623: DFBPPR10726 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.2624: DFBPPR10727 ---- Animal proteins ---- Vimentin
Source.2625: DFBPPR10728 ---- Animal proteins ---- Myelomonocytic growth factor
Source.2626: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.2627: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1
Source.2628: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.2629: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.2630: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.2631: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein
Source.2632: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.2633: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.2634: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12
Source.2635: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.2636: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.2637: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.2638: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.2639: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.2640: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha
Source.2641: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2642: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa
Source.2643: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.2644: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26
Source.2645: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.2646: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.2647: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.2648: DFBPPR10882 ---- Animal proteins ---- Noggin
Source.2649: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.2650: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.2651: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.2652: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain
Source.2653: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.2654: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.2655: DFBPPR10903 ---- Animal proteins ---- Myosin light chain 3, skeletal muscle isoform
Source.2656: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.2657: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.2658: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2
Source.2659: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.2660: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.2661: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.2662: DFBPPR10938 ---- Animal proteins ---- Serine/threonine-protein kinase mos
Source.2663: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.2664: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.2665: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.2666: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.2667: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2
Source.2668: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor
Source.2669: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like
Source.2670: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1
Source.2671: DFBPPR10970 ---- Animal proteins ---- Prohibitin
Source.2672: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1
Source.2673: DFBPPR10976 ---- Animal proteins ---- Lamin-B2
Source.2674: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.2675: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.2676: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.2677: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.2678: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.2679: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein
Source.2680: DFBPPR11009 ---- Animal proteins ---- Cathelicidin-B1
Source.2681: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.2682: DFBPPR11014 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F
Source.2683: DFBPPR11023 ---- Animal proteins ---- 43 kDa receptor-associated protein of the synapse
Source.2684: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.2685: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.2686: DFBPPR11035 ---- Animal proteins ---- Protein Dr1
Source.2687: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.2688: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.2689: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.2690: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13
Source.2691: DFBPPR11064 ---- Animal proteins ---- General transcription factor IIH subunit 5
Source.2692: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2693: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.2694: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1
Source.2695: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.2696: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.2697: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.2698: DFBPPR11094 ---- Animal proteins ---- Transcription factor MafA
Source.2699: DFBPPR11095 ---- Animal proteins ---- Ras-related protein Rab-33B
Source.2700: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin
Source.2701: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2
Source.2702: DFBPPR11112 ---- Animal proteins ---- Protein quaking
Source.2703: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.2704: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.2705: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform
Source.2706: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit
Source.2707: DFBPPR11133 ---- Animal proteins ---- Transcription factor MafG
Source.2708: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1
Source.2709: DFBPPR11141 ---- Animal proteins ---- Serine/threonine-protein kinase ULK3
Source.2710: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1
Source.2711: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.2712: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.2713: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2
Source.2714: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein
Source.2715: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.2716: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1
Source.2717: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.2718: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.2719: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.2720: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.2721: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.2722: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1
Source.2723: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.2724: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.2725: DFBPPR11219 ---- Animal proteins ---- Cytospin-A
Source.2726: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.2727: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.2728: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.2729: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.2730: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.2731: DFBPPR11254 ---- Animal proteins ---- Intracellular hyaluronan-binding protein 4
Source.2732: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.2733: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.2734: DFBPPR11264 ---- Animal proteins ---- Charged multivesicular body protein 7
Source.2735: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3
Source.2736: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.2737: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4
Source.2738: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.2739: DFBPPR11294 ---- Animal proteins ---- Frizzled-8
Source.2740: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2
Source.2741: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.2742: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.2743: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.2744: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog
Source.2745: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2
Source.2746: DFBPPR11318 ---- Animal proteins ---- Chromatin modification-related protein MEAF6
Source.2747: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2
Source.2748: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2
Source.2749: DFBPPR11330 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.2750: DFBPPR11334 ---- Animal proteins ---- Heme oxygenase 1
Source.2751: DFBPPR11335 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.2752: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.2753: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.2754: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47
Source.2755: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.2756: DFBPPR11369 ---- Animal proteins ---- SAGA-associated factor 29
Source.2757: DFBPPR11376 ---- Animal proteins ---- Lamin-A
Source.2758: DFBPPR11377 ---- Animal proteins ---- UBX domain-containing protein 2B
Source.2759: DFBPPR11379 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2
Source.2760: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1
Source.2761: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.2762: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.2763: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner
Source.2764: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.2765: DFBPPR11415 ---- Animal proteins ---- Elongation factor Tu, mitochondrial
Source.2766: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.2767: DFBPPR11429 ---- Animal proteins ---- Centrosomal protein 20
Source.2768: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5
Source.2769: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2770: DFBPPR11455 ---- Animal proteins ---- Growth factor receptor-bound protein 2
Source.2771: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.2772: DFBPPR11472 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein
Source.2773: DFBPPR11480 ---- Animal proteins ---- Cytochrome P450 1A2
Source.2774: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3
Source.2775: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase
Source.2776: DFBPPR11490 ---- Animal proteins ---- Twinfilin-2
Source.2777: DFBPPR11493 ---- Animal proteins ---- Interferon regulatory factor 1
Source.2778: DFBPPR11495 ---- Animal proteins ---- Calretinin
Source.2779: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7
Source.2780: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2
Source.2781: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog
Source.2782: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.2783: DFBPPR11516 ---- Animal proteins ---- Gastrin/cholecystokinin-like peptide
Source.2784: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD
Source.2785: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.2786: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.2787: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2
Source.2788: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog
Source.2789: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.2790: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic
Source.2791: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein
Source.2792: DFBPPR11569 ---- Animal proteins ---- Homeobox protein Hox-D8
Source.2793: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1
Source.2794: DFBPPR11575 ---- Animal proteins ---- Myosin light chain 1, cardiac muscle
Source.2795: DFBPPR11577 ---- Animal proteins ---- Vasotocin-neurophysin VT
Source.2796: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.2797: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.2798: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622
Source.2799: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein
Source.2800: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.2801: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.2802: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.2803: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2
Source.2804: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5
Source.2805: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2
Source.2806: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.2807: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.2808: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.2809: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.2810: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.2811: DFBPPR11673 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4
Source.2812: DFBPPR11677 ---- Animal proteins ---- SOSS complex subunit C
Source.2813: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.2814: DFBPPR11683 ---- Animal proteins ---- Somatostatin
Source.2815: DFBPPR11684 ---- Animal proteins ---- 14-3-3 protein theta
Source.2816: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog
Source.2817: DFBPPR11698 ---- Animal proteins ---- NADH-cytochrome b5 reductase 2
Source.2818: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit
Source.2819: DFBPPR11700 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.2820: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.2821: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.2822: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.2823: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.2824: DFBPPR11717 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.2825: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D
Source.2826: DFBPPR11724 ---- Animal proteins ---- Protein TENP
Source.2827: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.2828: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.2829: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.2830: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.2831: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.2832: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.2833: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1
Source.2834: DFBPPR11759 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.2835: DFBPPR11762 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.2836: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.2837: DFBPPR11792 ---- Animal proteins ---- Selenoprotein W
Source.2838: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.2839: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.2840: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.2841: DFBPPR11814 ---- Animal proteins ---- Centromere protein R
Source.2842: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.2843: DFBPPR11846 ---- Animal proteins ---- Golgin subfamily A member 7
Source.2844: DFBPPR11851 ---- Animal proteins ---- Borealin
Source.2845: DFBPPR11864 ---- Animal proteins ---- Radixin
Source.2846: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2
Source.2847: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog
Source.2848: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.2849: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.2850: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A
Source.2851: DFBPPR11911 ---- Animal proteins ---- NmrA-like family domain-containing protein 1
Source.2852: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19
Source.2853: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.2854: DFBPPR11924 ---- Animal proteins ---- Centromere protein P
Source.2855: DFBPPR11928 ---- Animal proteins ---- Cyclin-C
Source.2856: DFBPPR11932 ---- Animal proteins ---- 14-3-3 protein zeta
Source.2857: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7
Source.2858: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.2859: DFBPPR11940 ---- Animal proteins ---- Calmodulin, striated muscle
Source.2860: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A
Source.2861: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.2862: DFBPPR11949 ---- Animal proteins ---- Spindle assembly abnormal protein 6 homolog
Source.2863: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.2864: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.2865: DFBPPR11959 ---- Animal proteins ---- Deubiquitinase OTUD6B
Source.2866: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.2867: DFBPPR11975 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.2868: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.2869: DFBPPR11983 ---- Animal proteins ---- Tumor protein D53 homolog
Source.2870: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.2871: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.2872: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal
Source.2873: DFBPPR12014 ---- Animal proteins ---- Raftlin
Source.2874: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5
Source.2875: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.2876: DFBPPR12039 ---- Animal proteins ---- Protein GOLM2
Source.2877: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24
Source.2878: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.2879: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9
Source.2880: DFBPPR12068 ---- Animal proteins ---- Serine/arginine repetitive matrix protein 1
Source.2881: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.2882: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.2883: DFBPPR12071 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1
Source.2884: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.2885: DFBPPR12081 ---- Animal proteins ---- 14-3-3 protein gamma
Source.2886: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.2887: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.2888: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.2889: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox
Source.2890: DFBPPR12110 ---- Animal proteins ---- Myosin light chain, embryonic
Source.2891: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21
Source.2892: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19
Source.2893: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93
Source.2894: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.2895: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.2896: DFBPPR12164 ---- Animal proteins ---- Neo-calmodulin
Source.2897: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45
Source.2898: DFBPPR12189 ---- Animal proteins ---- Arginine and glutamate-rich protein 1
Source.2899: DFBPPR12198 ---- Animal proteins ---- RING finger protein 141
Source.2900: DFBPPR12201 ---- Animal proteins ---- Protein lin-52 homolog
Source.2901: DFBPPR12207 ---- Animal proteins ---- WD repeat, SAM and U-box domain-containing protein 1
Source.2902: DFBPPR12216 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial
Source.2903: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174
Source.2904: DFBPPR12226 ---- Animal proteins ---- Protein DGCR6
Source.2905: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2
Source.2906: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog
Source.2907: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.2908: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.2909: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.2910: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1
Source.2911: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.2912: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.2913: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.2914: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1
Source.2915: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.2916: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.2917: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.2918: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2919: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.2920: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.2921: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.2922: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.2923: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.2924: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.2925: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.2926: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.2927: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.2928: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1
Source.2929: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.2930: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.2931: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.2932: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2933: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.2934: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.2935: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.2936: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2937: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.2938: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.2939: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.2940: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1
Source.2941: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.2942: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.2943: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.2944: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2945: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.2946: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.2947: DFBPPR12429 ---- Animal proteins ---- Apolipoprotein A-I
Source.2948: DFBPPR12433 ---- Animal proteins ---- Carbonic anhydrase 2
Source.2949: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.2950: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.2951: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.2952: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.2953: DFBPPR12478 ---- Animal proteins ---- Protein phosphatase 1A
Source.2954: DFBPPR12483 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.2955: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.2956: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.2957: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle
Source.2958: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.2959: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.2960: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.2961: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.2962: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.2963: DFBPPR12517 ---- Animal proteins ---- 5-formyltetrahydrofolate cyclo-ligase
Source.2964: DFBPPR12523 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.2965: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.2966: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.2967: DFBPPR12539 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1
Source.2968: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.2969: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2970: DFBPPR12551 ---- Animal proteins ---- C-reactive protein
Source.2971: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.2972: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.2973: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2
Source.2974: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.2975: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.2976: DFBPPR12578 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.2977: DFBPPR12580 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2
Source.2978: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.2979: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.2980: DFBPPR12585 ---- Animal proteins ---- Calmodulin
Source.2981: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.2982: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.2983: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.2984: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.2985: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.2986: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12
Source.2987: DFBPPR12630 ---- Animal proteins ---- Insulin-like growth factor I
Source.2988: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.2989: DFBPPR12681 ---- Animal proteins ---- Myosin-7
Source.2990: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2991: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.2992: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.2993: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.2994: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.2995: DFBPPR12742 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.2996: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1
Source.2997: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain
Source.2998: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform
Source.2999: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3
Source.3000: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.3001: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.3002: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.3003: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.3004: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.3005: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor
Source.3006: DFBPPR12833 ---- Animal proteins ---- Cullin-5
Source.3007: DFBPPR12853 ---- Animal proteins ---- Insulin
Source.3008: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.3009: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.3010: DFBPPR12880 ---- Animal proteins ---- Corticostatin 1
Source.3011: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.3012: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.3013: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.3014: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.3015: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.3016: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.3017: DFBPPR12918 ---- Animal proteins ---- Myosin heavy chain, embryonic smooth muscle isoform
Source.3018: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.3019: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.3020: DFBPPR12950 ---- Animal proteins ---- Vitamin D-binding protein
Source.3021: DFBPPR12954 ---- Animal proteins ---- Apolipoprotein B
Source.3022: DFBPPR12959 ---- Animal proteins ---- Keratin, type I cytoskeletal 12
Source.3023: DFBPPR12964 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-5
Source.3024: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.3025: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.3026: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.3027: DFBPPR12981 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-4
Source.3028: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.3029: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1
Source.3030: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.3031: DFBPPR13080 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.3032: DFBPPR13089 ---- Animal proteins ---- 14-3-3 protein theta
Source.3033: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.3034: DFBPPR13094 ---- Animal proteins ---- Atherin
Source.3035: DFBPPR13138 ---- Animal proteins ---- SNRPN upstream reading frame protein
Source.3036: DFBPPR13139 ---- Animal proteins ---- Ig kappa chain b5 variant C region
Source.3037: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.3038: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3039: DFBPPR13170 ---- Animal proteins ---- Carbonic anhydrase 1
Source.3040: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3041: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.3042: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A
Source.3043: DFBPPR13195 ---- Animal proteins ---- Albumin
Source.3044: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.3045: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.3046: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3
Source.3047: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3048: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.3049: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.3050: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2
Source.3051: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3052: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.3053: DFBPPR13250 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3, truncated
Source.3054: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.3055: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.3056: DFBPPR13276 ---- Animal proteins ---- Protein quaking
Source.3057: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.3058: DFBPPR13284 ---- Animal proteins ---- Interleukin-8
Source.3059: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.3060: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.3061: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.3062: DFBPPR13301 ---- Animal proteins ---- Protein S100-A6
Source.3063: DFBPPR13313 ---- Animal proteins ---- Insulin-like growth factor I
Source.3064: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.3065: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.3066: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.3067: DFBPPR13323 ---- Animal proteins ---- Myoglobin
Source.3068: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha
Source.3069: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.3070: DFBPPR13436 ---- Animal proteins ---- Transmembrane protein 147
Source.3071: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3072: DFBPPR13447 ---- Animal proteins ---- Insulin-like growth factor I
Source.3073: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3074: DFBPPR13453 ---- Animal proteins ---- Hemoglobin subunit beta-C
Source.3075: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.3076: DFBPPR13502 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.3077: DFBPPR13504 ---- Animal proteins ---- Platelet-activating factor receptor
Source.3078: DFBPPR13505 ---- Animal proteins ---- Spectrin beta chain, non-erythrocytic 1
Source.3079: DFBPPR13506 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3080: DFBPPR13513 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.3081: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin
Source.3082: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.3083: DFBPPR13542 ---- Animal proteins ---- Pyridoxal kinase
Source.3084: DFBPPR13546 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.3085: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3086: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.3087: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3088: DFBPPR13564 ---- Animal proteins ---- Calmodulin
Source.3089: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.3090: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.3091: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.3092: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53
Source.3093: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3094: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3095: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.3096: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2
Source.3097: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.3098: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.3099: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.3100: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.3101: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3102: DFBPPR13673 ---- Animal proteins ---- Insulin-like growth factor I
Source.3103: DFBPPR13686 ---- Animal proteins ---- Vimentin
Source.3104: DFBPPR13697 ---- Animal proteins ---- Carbonic anhydrase 1
Source.3105: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.3106: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.3107: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.3108: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.3109: DFBPPR13747 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.3110: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2
Source.3111: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.3112: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.3113: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.3114: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.3115: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1
Source.3116: DFBPPR13802 ---- Animal proteins ---- Pancreatic prohormone
Source.3117: DFBPPR13803 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.3118: DFBPPR13811 ---- Animal proteins ---- 14-3-3 protein gamma
Source.3119: DFBPPR13814 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide VF
Source.3120: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1
Source.3121: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3
Source.3122: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa
Source.3123: DFBPPR13861 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.3124: DFBPPR13863 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.3125: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1
Source.3126: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.3127: DFBPPR13896 ---- Animal proteins ---- Somatostatin
Source.3128: DFBPPR13907 ---- Animal proteins ---- Shadow of prion protein
Source.3129: DFBPPR13908 ---- Animal proteins ---- Shadow of prion protein
Source.3130: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.3131: DFBPPR13939 ---- Animal proteins ---- T-cell surface glycoprotein CD4
Source.3132: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.3133: DFBPPR13953 ---- Animal proteins ---- Tetraspanin-9
Source.3134: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.3135: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.3136: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B
Source.3137: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A
Source.3138: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3139: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.3140: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.3141: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.3142: DFBPPR14019 ---- Animal proteins ---- Vimentin
Source.3143: DFBPPR14046 ---- Animal proteins ---- Myoglobin
Source.3144: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.3145: DFBPPR14052 ---- Animal proteins ---- Insulin-like growth factor I, adult form
Source.3146: DFBPPR14055 ---- Animal proteins ---- Insulin-like growth factor I, juvenile form
Source.3147: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.3148: DFBPPR14087 ---- Marine protein ---- Lissencephaly-1 homolog A
Source.3149: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B
Source.3150: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1
Source.3151: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183
Source.3152: DFBPPR14123 ---- Marine protein ---- Albumin 1
Source.3153: DFBPPR14124 ---- Marine protein ---- Albumin 2
Source.3154: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.3155: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.3156: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I
Source.3157: DFBPPR14170 ---- Marine protein ---- SOSS complex subunit C
Source.3158: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.3159: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein
Source.3160: DFBPPR14210 ---- Marine protein ---- Tetraspanin-9
Source.3161: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1
Source.3162: DFBPPR14257 ---- Marine protein ---- Somatolactin
Source.3163: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.3164: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE
Source.3165: DFBPPR14313 ---- Marine protein ---- Photosystem I reaction center subunit PsaK
Source.3166: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B
Source.3167: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.3168: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N
Source.3169: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.3170: DFBPPR14354 ---- Marine protein ---- Cytochrome c-550
Source.3171: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha
Source.3172: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.3173: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain
Source.3174: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.3175: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.3176: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta
Source.3177: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.3178: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha
Source.3179: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic
Source.3180: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.3181: DFBPPR14458 ---- Marine protein ---- 50S ribosomal protein L12, chloroplastic
Source.3182: DFBPPR14460 ---- Marine protein ---- Probable 30S ribosomal protein 3, chloroplastic
Source.3183: DFBPPR14487 ---- Marine protein ---- Chloroplast envelope membrane protein
Source.3184: DFBPPR14495 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.3185: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.3186: DFBPPR14525 ---- Marine protein ---- Uncharacterized protein ycf55
Source.3187: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.3188: DFBPPR14545 ---- Marine protein ---- Ghrelin
Source.3189: DFBPPR14547 ---- Marine protein ---- Interleukin-6
Source.3190: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.3191: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.3192: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.3193: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.3194: DFBPPR14583 ---- Marine protein ---- Insulin-like growth factor I
Source.3195: DFBPPR14591 ---- Marine protein ---- Vimentin
Source.3196: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b
Source.3197: DFBPPR14600 ---- Marine protein ---- Transforming growth factor beta-1 proprotein
Source.3198: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1
Source.3199: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1
Source.3200: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a
Source.3201: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3
Source.3202: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain
Source.3203: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.3204: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2
Source.3205: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13
Source.3206: DFBPPR14706 ---- Marine protein ---- 14-3-3 protein beta/alpha-1
Source.3207: DFBPPR14707 ---- Marine protein ---- 14-3-3 protein beta/alpha-2
Source.3208: DFBPPR14709 ---- Marine protein ---- Protein lin-52 homolog
Source.3209: DFBPPR14711 ---- Marine protein ---- UI
Source.3210: DFBPPR14714 ---- Marine protein ---- 14-3-3 protein gamma-2
Source.3211: DFBPPR14715 ---- Marine protein ---- 14-3-3 protein gamma-1
Source.3212: DFBPPR14716 ---- Marine protein ---- Secreted phosphoprotein 24
Source.3213: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.3214: DFBPPR14783 ---- Marine protein ---- Enolase
Source.3215: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.3216: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.3217: DFBPPR14832 ---- Marine protein ---- Troponin C, isoform 2B
Source.3218: DFBPPR14853 ---- Marine protein ---- Sarcoplasmic calcium-binding protein 1
Source.3219: DFBPPR14860 ---- Marine protein ---- Thyrotropin subunit beta
Source.3220: DFBPPR14873 ---- Marine protein ---- Somatolactin
Source.3221: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.3222: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.3223: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.3224: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.3225: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.3226: DFBPPR14897 ---- Microorganism protein ---- Calmodulin
Source.3227: DFBPPR14898 ---- Microorganism protein ---- Transcription factor IIIB 70 kDa subunit
Source.3228: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.3229: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.3230: DFBPPR14908 ---- Microorganism protein ---- Flap endonuclease 1
Source.3231: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific
Source.3232: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific
Source.3233: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.3234: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.3235: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.3236: DFBPPR14942 ---- Microorganism protein ---- Transcription initiation factor IIB
Source.3237: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4
Source.3238: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1
Source.3239: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1
Source.3240: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.3241: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase
Source.3242: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.3243: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.3244: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.3245: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3
Source.3246: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.3247: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.3248: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.3249: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.3250: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.3251: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.3252: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.3253: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase
Source.3254: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.3255: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.3256: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.3257: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1
Source.3258: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.3259: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.3260: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1
Source.3261: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4
Source.3262: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.3263: DFBPPR15080 ---- Microorganism protein ---- Dimethyladenosine transferase
Source.3264: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13
Source.3265: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.3266: DFBPPR15103 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein END3
Source.3267: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.3268: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.3269: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.3270: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2
Source.3271: DFBPPR15148 ---- Microorganism protein ---- Riboflavin kinase
Source.3272: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.3273: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.3274: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3
Source.3275: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.3276: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.3277: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3
Source.3278: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.3279: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase
Source.3280: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60
Source.3281: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1
Source.3282: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8
Source.3283: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.3284: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20
Source.3285: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.3286: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.3287: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.3288: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.3289: DFBPPR15282 ---- Microorganism protein ---- Peroxisomal biogenesis factor 3
Source.3290: DFBPPR15309 ---- Microorganism protein ---- Respiratory supercomplex factor 1, mitochondrial
Source.3291: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.3292: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial
Source.3293: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10
Source.3294: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10
Source.3295: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.3296: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18
Source.3297: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial
Source.3298: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.3299: DFBPPR15353 ---- Microorganism protein ---- Pre-mRNA-splicing factor ISY1
Source.3300: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.3301: DFBPPR15382 ---- Microorganism protein ---- Sensitive to high expression protein 9 homolog, mitochondrial
Source.3302: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.3303: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase
Source.3304: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1
Source.3305: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41
Source.3306: DFBPPR15404 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM10
Source.3307: DFBPPR15430 ---- Microorganism protein ---- Exportin-T
Source.3308: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101
Source.3309: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.3310: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.3311: DFBPPR15461 ---- Microorganism protein ---- EKC/KEOPS complex subunit CGI121
Source.3312: DFBPPR15462 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM21
Source.3313: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10
Source.3314: DFBPPR15478 ---- Microorganism protein ---- COP9 signalosome complex subunit 9
Source.3315: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.3316: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.3317: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.3318: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1
Source.3319: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.3320: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.3321: DFBPPR15521 ---- Microorganism protein ---- rRNA-processing protein EFG1
Source.3322: DFBPPR15531 ---- Microorganism protein ---- DNA replication complex GINS protein SLD5
Source.3323: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.3324: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.3325: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.3326: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.3327: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.3328: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9
Source.3329: DFBPPR15596 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit BLS1
Source.3330: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1
Source.3331: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase
Source.3332: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.3333: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.3334: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4
Source.3335: DFBPPR15642 ---- Microorganism protein ---- Spindle pole component 29
Source.3336: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit
Source.3337: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.3338: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.3339: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.3340: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5
Source.3341: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.3342: DFBPPR15720 ---- Microorganism protein ---- Protein BFR2
Source.3343: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.3344: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.3345: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21
Source.3346: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1
Source.3347: DFBPPR15744 ---- Microorganism protein ---- Peroxisomal membrane protein PEX21
Source.3348: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8
Source.3349: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1
Source.3350: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.3351: DFBPPR15771 ---- Microorganism protein ---- Required for respiratory growth protein 1, mitochondrial
Source.3352: DFBPPR15773 ---- Microorganism protein ---- 37S ribosomal protein S25, mitochondrial
Source.3353: DFBPPR15775 ---- Microorganism protein ---- Increased recombination centers protein 6
Source.3354: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3
Source.3355: DFBPPR15789 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 4
Source.3356: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.3357: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.3358: DFBPPR15809 ---- Microorganism protein ---- PTS system sorbose-specific EIIA component
Source.3359: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.3360: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.3361: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.3362: DFBPPR15840 ---- Microorganism protein ---- Protein RecA
Source.3363: DFBPPR15845 ---- Microorganism protein ---- Calmodulin
Source.3364: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.3365: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.3366: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.3367: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase
Source.3368: DFBPPR15869 ---- Microorganism protein ---- Phenylalanine ammonia-lyase
Source.3369: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.3370: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.3371: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.3372: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.3373: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic
Source.3374: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.3375: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.3376: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.3377: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.3378: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.3379: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.3380: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.3381: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic
Source.3382: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase
Source.3383: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial
Source.3384: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.3385: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.3386: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3387: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.3388: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2
Source.3389: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.3390: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.3391: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3392: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.3393: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.3394: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.3395: DFBPPR7864 ---- Plant protein ---- ATP synthase epsilon chain, chloroplastic
Source.3396: DFBPPR7891 ---- Plant protein ---- CASP-like protein 1B1
Source.3397: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1
Source.3398: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.3399: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2
Source.3400: DFBPPR7909 ---- Plant protein ---- CASP-like protein 2D1
Source.3401: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.3402: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.3403: DFBPPR7936 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase, chloroplastic
Source.3404: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha
Source.3405: DFBPPR7983 ---- Plant protein ---- 14-3-3-like protein B
Source.3406: DFBPPR7984 ---- Plant protein ---- 14-3-3-like protein A
Source.3407: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase
Source.3408: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.3409: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.3410: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.3411: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.3412: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3413: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.3414: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.3415: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.3416: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.3417: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.3418: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.3419: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1
Source.3420: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.3421: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase
Source.3422: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial
Source.3423: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase
Source.3424: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase
Source.3425: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1
Source.3426: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.3427: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.3428: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.3429: DFBPPR8284 ---- Plant protein ---- Calmodulin
Source.3430: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.3431: DFBPPR8335 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.3432: DFBPPR8355 ---- Plant protein ---- 14-3-3-like protein
Taste proterties & Structure
Bitterness
Non-bitter taste prediction
SMILES N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP 9088
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214