E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0318(Multifunctional peptide)
DFBP ID DFBPMUFU0318
Peptide sequence AAP
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 2
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI1312 Iberian dry-cured ham Iberian dry-cured ham extract

N.D

DFBPACEI0468 Bovine milk protein Lactoferrin, Lactotransferrin

f(19-21)

DFBPACEI1902 Amaranth seed proteins Amaranth glutelins

N.D

Antihypertensive peptides
DFBPID Organism Precursor protein Residue position
DFBPANHY0162 Iberian dry-cured ham Iberian dry-cured ham extract

N.D

Physical & computational properties
Three-letter amino acid Ala-Ala-Pro
Single-letter amino acid AAP
Peptide length 3
Theoretical mass 257.28 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
GRAVY 0.6667
Hydrophilic residue ratio 100%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2
Source.2: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1
Source.3: DFBPPR0810 ---- Plant proteins ---- APETALA2-like protein 1
Source.4: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1
Source.5: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25
Source.6: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.7: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.8: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2
Source.9: DFBPPR0833 ---- Plant proteins ---- Allene oxide cyclase, chloroplastic
Source.10: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71
Source.11: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1
Source.12: DFBPPR0843 ---- Plant proteins ---- MADS-box transcription factor 1
Source.13: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14
Source.14: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.15: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.16: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46
Source.17: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.18: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.19: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.20: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.21: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.22: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1
Source.23: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1
Source.24: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53
Source.25: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.26: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.27: DFBPPR0922 ---- Plant proteins ---- Obg-like ATPase 1
Source.28: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.29: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.30: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.31: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.32: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.33: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.34: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5
Source.35: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.36: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3
Source.37: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog
Source.38: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC
Source.39: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9
Source.40: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.41: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.42: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1
Source.43: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.44: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.45: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.46: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1
Source.47: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.48: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.49: DFBPPR1022 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK3
Source.50: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.51: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1
Source.52: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.53: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP
Source.54: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic
Source.55: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1
Source.56: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.57: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.58: DFBPPR1057 ---- Plant proteins ---- Abscisic acid receptor PYL10
Source.59: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.60: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62
Source.61: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.62: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.63: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c
Source.64: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4
Source.65: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79
Source.66: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.67: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.68: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51
Source.69: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24
Source.70: DFBPPR1086 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 46
Source.71: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706
Source.72: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.73: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.74: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.75: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.76: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.77: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.78: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.79: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E
Source.80: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG
Source.81: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic
Source.82: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic
Source.83: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6
Source.84: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.85: DFBPPR1129 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.86: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.87: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.88: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP
Source.89: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.90: DFBPPR1140 ---- Plant proteins ---- Protein PARTING DANCERS homolog
Source.91: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.92: DFBPPR1158 ---- Plant proteins ---- Cysteine and histidine-rich domain-containing protein RAR1
Source.93: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B
Source.94: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.95: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.96: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.97: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.98: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog
Source.99: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.100: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19
Source.101: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.102: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1
Source.103: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1
Source.104: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.105: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28
Source.106: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.107: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.108: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.109: DFBPPR1259 ---- Plant proteins ---- Beta-carotene isomerase D27, chloroplastic
Source.110: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic
Source.111: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.112: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.113: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.114: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.115: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3
Source.116: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.117: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.118: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase
Source.119: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.120: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.121: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.122: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic
Source.123: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1
Source.124: DFBPPR1297 ---- Plant proteins ---- Peroxygenase
Source.125: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.126: DFBPPR1302 ---- Plant proteins ---- 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase, chloroplastic
Source.127: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22
Source.128: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.129: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.130: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.131: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.132: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.133: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1
Source.134: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.135: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.136: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14
Source.137: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.138: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.139: DFBPPR1358 ---- Plant proteins ---- Fructose-bisphosphate aldolase, chloroplastic
Source.140: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.141: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.142: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.143: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic
Source.144: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.145: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.146: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.147: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.148: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.149: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic
Source.150: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29
Source.151: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.152: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2
Source.153: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.154: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2
Source.155: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.156: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.157: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.158: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.159: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156
Source.160: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.161: DFBPPR1435 ---- Plant proteins ---- Photosystem II 22 kDa protein 1, chloroplastic
Source.162: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3
Source.163: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.164: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.165: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.166: DFBPPR1446 ---- Plant proteins ---- Nucleoside diphosphate kinase 1
Source.167: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.168: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b
Source.169: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.170: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c
Source.171: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2
Source.172: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.173: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.174: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.175: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.176: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.177: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.178: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.179: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.180: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.181: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.182: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.183: DFBPPR1501 ---- Plant proteins ---- Polygalacturonase inhibitor 1
Source.184: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5
Source.185: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.186: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.187: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.188: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.189: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15
Source.190: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1
Source.191: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2
Source.192: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.193: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.194: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.195: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.196: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.197: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.198: DFBPPR1539 ---- Plant proteins ---- Probable L-ascorbate peroxidase 4, peroxisomal
Source.199: DFBPPR1540 ---- Plant proteins ---- Protein DROOPING LEAF
Source.200: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.201: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.202: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.203: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.204: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.205: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3
Source.206: DFBPPR1561 ---- Plant proteins ---- Chitinase 4
Source.207: DFBPPR1563 ---- Plant proteins ---- TPD1 protein homolog 1A
Source.208: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.209: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.210: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9
Source.211: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic
Source.212: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.213: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2
Source.214: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4
Source.215: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.216: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C
Source.217: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.218: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic
Source.219: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.220: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.221: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.222: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.223: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.224: DFBPPR1620 ---- Plant proteins ---- MADS-box transcription factor 29
Source.225: DFBPPR1623 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 2, chloroplastic
Source.226: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.227: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71
Source.228: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic
Source.229: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.230: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a
Source.231: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.232: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic
Source.233: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial
Source.234: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.235: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.236: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.237: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10
Source.238: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal
Source.239: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.240: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.241: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.242: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG
Source.243: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.244: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.245: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.246: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.247: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a
Source.248: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.249: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.250: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic
Source.251: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.252: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.253: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.254: DFBPPR1722 ---- Plant proteins ---- Protein TIFY 11a
Source.255: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.256: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.257: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2
Source.258: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.259: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic
Source.260: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.261: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.262: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2
Source.263: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial
Source.264: DFBPPR1750 ---- Plant proteins ---- Transcription factor IBH1
Source.265: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.266: DFBPPR1758 ---- Plant proteins ---- MADS-box transcription factor 57
Source.267: DFBPPR1763 ---- Plant proteins ---- E3 ubiquitin-protein ligase SRFP1
Source.268: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2
Source.269: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.270: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1
Source.271: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.272: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3
Source.273: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.274: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.275: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.276: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.277: DFBPPR1789 ---- Plant proteins ---- NAC domain-containing protein 22
Source.278: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.279: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.280: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4
Source.281: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1
Source.282: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9
Source.283: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5
Source.284: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.285: DFBPPR1819 ---- Plant proteins ---- Ribosome-recycling factor, chloroplastic
Source.286: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1
Source.287: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.288: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3
Source.289: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.290: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.291: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO
Source.292: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.293: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.294: DFBPPR1847 ---- Plant proteins ---- Amidase 1
Source.295: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.296: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1
Source.297: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.298: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.299: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.300: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.301: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.302: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.303: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.304: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.305: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4
Source.306: DFBPPR1879 ---- Plant proteins ---- Germin-like protein 1-3
Source.307: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.308: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.309: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.310: DFBPPR1893 ---- Plant proteins ---- Probable glucosamine 6-phosphate N-acetyltransferase 2
Source.311: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1
Source.312: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3
Source.313: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic
Source.314: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1
Source.315: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2
Source.316: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.317: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial
Source.318: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.319: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2
Source.320: DFBPPR1931 ---- Plant proteins ---- Thioredoxin X, chloroplastic
Source.321: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA
Source.322: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.323: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.324: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.325: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.326: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.327: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2
Source.328: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5
Source.329: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.330: DFBPPR1973 ---- Plant proteins ---- Transcription factor MYB30
Source.331: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.332: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.333: DFBPPR1980 ---- Plant proteins ---- Germin-like protein 1-4
Source.334: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.335: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.336: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.337: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.338: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.339: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.340: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.341: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.342: DFBPPR2015 ---- Plant proteins ---- 50S ribosomal protein L12, chloroplastic
Source.343: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a
Source.344: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.345: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1
Source.346: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.347: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.348: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.349: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.350: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.351: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial
Source.352: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1
Source.353: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11
Source.354: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.355: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.356: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.357: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176
Source.358: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.359: DFBPPR2063 ---- Plant proteins ---- Non-specific lipid-transfer protein C6
Source.360: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA
Source.361: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.362: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.363: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C
Source.364: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.365: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.366: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80
Source.367: DFBPPR2096 ---- Plant proteins ---- Peroxiredoxin-2E-1, chloroplastic
Source.368: DFBPPR2100 ---- Plant proteins ---- Germin-like protein 1-1
Source.369: DFBPPR2101 ---- Plant proteins ---- Cupincin
Source.370: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.371: DFBPPR2111 ---- Plant proteins ---- Iron-sulfur cluster assembly protein 1
Source.372: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.373: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.374: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.375: DFBPPR2122 ---- Plant proteins ---- FAD-linked sulfhydryl oxidase ERV1
Source.376: DFBPPR2123 ---- Plant proteins ---- Ninja-family protein MODD
Source.377: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic
Source.378: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.379: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.380: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic
Source.381: DFBPPR2134 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.382: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.383: DFBPPR2137 ---- Plant proteins ---- Metallothionein-like protein 2C
Source.384: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.385: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.386: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.387: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.388: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.389: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.390: DFBPPR2209 ---- Plant proteins ---- Succinate dehydrogenase subunit 4, mitochondrial
Source.391: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.392: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.393: DFBPPR2220 ---- Plant proteins ---- Expansin-A7
Source.394: DFBPPR2226 ---- Plant proteins ---- Two-component response regulator ORR7
Source.395: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like
Source.396: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.397: DFBPPR2233 ---- Plant proteins ---- Thioredoxin Y, chloroplastic
Source.398: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.399: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1
Source.400: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.401: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3
Source.402: DFBPPR2279 ---- Plant proteins ---- Thioredoxin-like protein CITRX, chloroplastic
Source.403: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.404: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.405: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS
Source.406: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3
Source.407: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.408: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3
Source.409: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B
Source.410: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic
Source.411: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10
Source.412: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7
Source.413: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b
Source.414: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5
Source.415: DFBPPR2317 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.416: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.417: DFBPPR2325 ---- Plant proteins ---- Peroxiredoxin-2E-2, chloroplastic
Source.418: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3
Source.419: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.420: DFBPPR2337 ---- Plant proteins ---- Protein TIFY 11b
Source.421: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1
Source.422: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400
Source.423: DFBPPR2342 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic
Source.424: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A
Source.425: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.426: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.427: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.428: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.429: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.430: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.431: DFBPPR2368 ---- Plant proteins ---- Thioredoxin M1, chloroplastic
Source.432: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.433: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.434: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.435: DFBPPR2381 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.436: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23
Source.437: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.438: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1
Source.439: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic
Source.440: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.441: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.442: DFBPPR2395 ---- Plant proteins ---- Pantoate--beta-alanine ligase
Source.443: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22
Source.444: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.445: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.446: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2
Source.447: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.448: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.449: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.450: DFBPPR2434 ---- Plant proteins ---- Non-specific lipid transfer protein-like 1
Source.451: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.452: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B
Source.453: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6
Source.454: DFBPPR2462 ---- Plant proteins ---- Arabinogalactan peptide 1
Source.455: DFBPPR2467 ---- Plant proteins ---- MADS-box transcription factor 34
Source.456: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2
Source.457: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.458: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.459: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.460: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2
Source.461: DFBPPR2487 ---- Plant proteins ---- Two-component response regulator ORR2
Source.462: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1
Source.463: DFBPPR2507 ---- Plant proteins ---- Protein YABBY 4
Source.464: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13
Source.465: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.466: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.467: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2
Source.468: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4
Source.469: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta
Source.470: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.471: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c
Source.472: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.473: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.474: DFBPPR2547 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 3, chloroplastic
Source.475: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.476: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.477: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.478: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.479: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.480: DFBPPR2569 ---- Plant proteins ---- MADS-box transcription factor 20
Source.481: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200
Source.482: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b
Source.483: DFBPPR2575 ---- Plant proteins ---- Protein TIFY 9
Source.484: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic
Source.485: DFBPPR2583 ---- Plant proteins ---- Thioredoxin-like 2, chloroplastic
Source.486: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.487: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.488: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic
Source.489: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.490: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A
Source.491: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.492: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1
Source.493: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.494: DFBPPR2605 ---- Plant proteins ---- Clathrin light chain 2
Source.495: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.496: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2
Source.497: DFBPPR2621 ---- Plant proteins ---- Germin-like protein 4-1
Source.498: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.499: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.500: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.501: DFBPPR2634 ---- Plant proteins ---- 16.0 kDa heat shock protein, peroxisomal
Source.502: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.503: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.504: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8
Source.505: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.506: DFBPPR2667 ---- Plant proteins ---- Germin-like protein 3-1
Source.507: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.508: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.509: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.510: DFBPPR2679 ---- Plant proteins ---- Expansin-A22
Source.511: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1
Source.512: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.513: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.514: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.515: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27
Source.516: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.517: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.518: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B
Source.519: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5
Source.520: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.521: DFBPPR2736 ---- Plant proteins ---- Ethylene-responsive transcription factor ABI4
Source.522: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.523: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.524: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.525: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.526: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.527: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.528: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.529: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3
Source.530: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.531: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2
Source.532: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2
Source.533: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.534: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.535: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a
Source.536: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.537: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.538: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.539: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.540: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.541: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.542: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.543: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.544: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.545: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.546: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3
Source.547: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.548: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.549: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.550: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103
Source.551: DFBPPR2859 ---- Plant proteins ---- Proton pump-interactor BIP131
Source.552: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.553: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2
Source.554: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.555: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.556: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.557: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32
Source.558: DFBPPR2900 ---- Plant proteins ---- Expansin-A23
Source.559: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB
Source.560: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.561: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2
Source.562: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7
Source.563: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.564: DFBPPR2928 ---- Plant proteins ---- 18.9 kDa heat shock protein
Source.565: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.566: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.567: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.568: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic
Source.569: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.570: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1
Source.571: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.572: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21
Source.573: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.574: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8
Source.575: DFBPPR2964 ---- Plant proteins ---- Expansin-A14
Source.576: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.577: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.578: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4
Source.579: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic
Source.580: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.581: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic
Source.582: DFBPPR2992 ---- Plant proteins ---- DnaJ protein ERDJ7
Source.583: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.584: DFBPPR2995 ---- Plant proteins ---- Eukaryotic translation initiation factor 4E-1
Source.585: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.586: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a
Source.587: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.588: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.589: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.590: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1
Source.591: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.592: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.593: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic
Source.594: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B
Source.595: DFBPPR3047 ---- Plant proteins ---- Zinc finger protein 36
Source.596: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2
Source.597: DFBPPR3051 ---- Plant proteins ---- Protein YABBY 3
Source.598: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.599: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5
Source.600: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial
Source.601: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial
Source.602: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.603: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.604: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.605: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase
Source.606: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.607: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.608: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.609: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28
Source.610: DFBPPR3110 ---- Plant proteins ---- Thioredoxin H5
Source.611: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6
Source.612: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.613: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.614: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.615: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5
Source.616: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2
Source.617: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1
Source.618: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.619: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.620: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11
Source.621: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.622: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20
Source.623: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.624: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.625: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.626: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2
Source.627: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.628: DFBPPR3177 ---- Plant proteins ---- Two-component response regulator ORR4
Source.629: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.630: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300
Source.631: DFBPPR3191 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial
Source.632: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.633: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3
Source.634: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3
Source.635: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3
Source.636: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.637: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A
Source.638: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.639: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.640: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.641: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7
Source.642: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.643: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.644: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic
Source.645: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.646: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.647: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.648: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.649: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.650: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic
Source.651: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.652: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.653: DFBPPR3270 ---- Plant proteins ---- Calmodulin-like protein 1
Source.654: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein
Source.655: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.656: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial
Source.657: DFBPPR3283 ---- Plant proteins ---- Auxin-responsive protein IAA21
Source.658: DFBPPR3286 ---- Plant proteins ---- Expansin-A32
Source.659: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.660: DFBPPR3289 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3b
Source.661: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500
Source.662: DFBPPR3293 ---- Plant proteins ---- Protein-ribulosamine 3-kinase, chloroplastic
Source.663: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.664: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.665: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1
Source.666: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1
Source.667: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.668: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.669: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial
Source.670: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.671: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.672: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.673: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.674: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68
Source.675: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.676: DFBPPR3357 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein B
Source.677: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.678: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.679: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.680: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.681: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1
Source.682: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.683: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1
Source.684: DFBPPR3381 ---- Plant proteins ---- GATA transcription factor 18
Source.685: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.686: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2
Source.687: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.688: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2
Source.689: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.690: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.691: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.692: DFBPPR3400 ---- Plant proteins ---- Auxin-responsive protein IAA12
Source.693: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.694: DFBPPR3404 ---- Plant proteins ---- Auxin-responsive protein IAA3
Source.695: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1
Source.696: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9
Source.697: DFBPPR3417 ---- Plant proteins ---- Protein CutA 1, chloroplastic
Source.698: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.699: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.700: DFBPPR3430 ---- Plant proteins ---- Dehydrin DHN1
Source.701: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2
Source.702: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3
Source.703: DFBPPR3434 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.704: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49
Source.705: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.706: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1
Source.707: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.708: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17
Source.709: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.710: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1
Source.711: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68
Source.712: DFBPPR3476 ---- Plant proteins ---- Glutaredoxin-C3
Source.713: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17
Source.714: DFBPPR3485 ---- Plant proteins ---- Auxin-responsive protein IAA31
Source.715: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9
Source.716: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2
Source.717: DFBPPR3502 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 1
Source.718: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.719: DFBPPR3506 ---- Plant proteins ---- Growth-regulating factor 12
Source.720: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.721: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14
Source.722: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6
Source.723: DFBPPR3521 ---- Plant proteins ---- Photosystem II reaction center W protein, chloroplastic
Source.724: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36
Source.725: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial
Source.726: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.727: DFBPPR3543 ---- Plant proteins ---- 26.7 kDa heat shock protein, chloroplastic
Source.728: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.729: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3
Source.730: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.731: DFBPPR3550 ---- Plant proteins ---- NRR repressor homolog 2
Source.732: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8
Source.733: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic
Source.734: DFBPPR3557 ---- Plant proteins ---- NRR repressor homolog 3
Source.735: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16
Source.736: DFBPPR3573 ---- Plant proteins ---- Protein TIFY 5
Source.737: DFBPPR3581 ---- Plant proteins ---- Auxin-responsive protein IAA17
Source.738: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.739: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.740: DFBPPR3593 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 1
Source.741: DFBPPR3595 ---- Plant proteins ---- Auxin-responsive protein IAA24
Source.742: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2
Source.743: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.744: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.745: DFBPPR3609 ---- Plant proteins ---- Thioredoxin-like 1-1, chloroplastic
Source.746: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6
Source.747: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A
Source.748: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L
Source.749: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.750: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1
Source.751: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.752: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5
Source.753: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.754: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.755: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3
Source.756: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2
Source.757: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.758: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3
Source.759: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.760: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9
Source.761: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.762: DFBPPR3686 ---- Plant proteins ---- NifU-like protein 1, chloroplastic
Source.763: DFBPPR3687 ---- Plant proteins ---- Two-component response regulator ORR41
Source.764: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.765: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.766: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.767: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2
Source.768: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1
Source.769: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.770: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3
Source.771: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.772: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.773: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.774: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.775: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B
Source.776: DFBPPR3747 ---- Plant proteins ---- Cysteine proteinase inhibitor 12
Source.777: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.778: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71
Source.779: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9
Source.780: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.781: DFBPPR3778 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 2
Source.782: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.783: DFBPPR3782 ---- Plant proteins ---- Auxin-responsive protein IAA16
Source.784: DFBPPR3783 ---- Plant proteins ---- Patatin-like protein 2
Source.785: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1
Source.786: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77
Source.787: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.788: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.789: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.790: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog
Source.791: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1
Source.792: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G
Source.793: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4
Source.794: DFBPPR3832 ---- Plant proteins ---- 26.2 kDa heat shock protein, mitochondrial
Source.795: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52
Source.796: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.797: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66
Source.798: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57
Source.799: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1
Source.800: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic
Source.801: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.802: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1
Source.803: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13
Source.804: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3
Source.805: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1
Source.806: DFBPPR3878 ---- Plant proteins ---- Growth-regulating factor 10
Source.807: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1
Source.808: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.809: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.810: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.811: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11
Source.812: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5
Source.813: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7
Source.814: DFBPPR3906 ---- Plant proteins ---- Protein G1-like8
Source.815: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6
Source.816: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1
Source.817: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.818: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.819: DFBPPR3927 ---- Plant proteins ---- Basic leucine zipper 2
Source.820: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.821: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2
Source.822: DFBPPR3937 ---- Plant proteins ---- Zinc-finger homeodomain protein 10
Source.823: DFBPPR3939 ---- Plant proteins ---- Non-specific lipid-transfer protein 4
Source.824: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3
Source.825: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.826: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10
Source.827: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.828: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog
Source.829: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic
Source.830: DFBPPR3955 ---- Plant proteins ---- Cysteine proteinase inhibitor 3
Source.831: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2
Source.832: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.833: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.834: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic
Source.835: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.836: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.837: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1
Source.838: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.839: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.840: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2
Source.841: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.842: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.843: DFBPPR3998 ---- Plant proteins ---- Protein G1-like9
Source.844: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7
Source.845: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.846: DFBPPR4012 ---- Plant proteins ---- Protein G1-like5
Source.847: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.848: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2
Source.849: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.850: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A
Source.851: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58
Source.852: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1
Source.853: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2
Source.854: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6
Source.855: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta
Source.856: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.857: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C
Source.858: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.859: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19
Source.860: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5
Source.861: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.862: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.863: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic
Source.864: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.865: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.866: DFBPPR4088 ---- Plant proteins ---- Cysteine proteinase inhibitor 10
Source.867: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.868: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5
Source.869: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.870: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic
Source.871: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.872: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4
Source.873: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2
Source.874: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2
Source.875: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33
Source.876: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.877: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31
Source.878: DFBPPR4137 ---- Plant proteins ---- Casparian strip membrane protein 7
Source.879: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600
Source.880: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16
Source.881: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.882: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.883: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H
Source.884: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1
Source.885: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67
Source.886: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.887: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10
Source.888: DFBPPR4163 ---- Plant proteins ---- Barley B recombinant-like protein A
Source.889: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.890: DFBPPR4174 ---- Plant proteins ---- Mitochondrial intermembrane space import and assembly protein 40 homolog
Source.891: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.892: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.893: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3
Source.894: DFBPPR4180 ---- Plant proteins ---- Barley B recombinant-like protein B
Source.895: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic
Source.896: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.897: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C
Source.898: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.899: DFBPPR4192 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic
Source.900: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1
Source.901: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.902: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.903: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.904: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1
Source.905: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.906: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.907: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.908: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.909: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.910: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4
Source.911: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2
Source.912: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600
Source.913: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1
Source.914: DFBPPR4253 ---- Plant proteins ---- Zinc-finger homeodomain protein 5
Source.915: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4
Source.916: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.917: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.918: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6
Source.919: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2
Source.920: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.921: DFBPPR4284 ---- Plant proteins ---- Protein IN2-1 homolog B
Source.922: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.923: DFBPPR4292 ---- Plant proteins ---- Double-stranded RNA-binding protein 3
Source.924: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.925: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.926: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1
Source.927: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8
Source.928: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28
Source.929: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.930: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C
Source.931: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like
Source.932: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24
Source.933: DFBPPR4342 ---- Plant proteins ---- Nucleolin 1
Source.934: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.935: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4
Source.936: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2
Source.937: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8
Source.938: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.939: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.940: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10
Source.941: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E
Source.942: DFBPPR4378 ---- Plant proteins ---- Basic leucine zipper 6
Source.943: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.944: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.945: DFBPPR4387 ---- Plant proteins ---- Dof zinc finger protein 5
Source.946: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic
Source.947: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.948: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9
Source.949: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4
Source.950: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2
Source.951: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.952: DFBPPR4409 ---- Plant proteins ---- 14-3-3-like protein GF14-D
Source.953: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.954: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6
Source.955: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.956: DFBPPR4416 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 4
Source.957: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15
Source.958: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.959: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.960: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.961: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein
Source.962: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.963: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.964: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.965: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.966: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45
Source.967: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic
Source.968: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1
Source.969: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.970: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.971: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.972: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.973: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.974: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.975: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.976: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme
Source.977: DFBPPR4518 ---- Plant proteins ---- Probable calcium-binding protein CML14
Source.978: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.979: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2
Source.980: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.981: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.982: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5
Source.983: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic
Source.984: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3
Source.985: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59
Source.986: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7
Source.987: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase
Source.988: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.989: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.990: DFBPPR4561 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 5
Source.991: DFBPPR4563 ---- Plant proteins ---- CASP-like protein 4C1
Source.992: DFBPPR4569 ---- Plant proteins ---- Probable protein ABIL5
Source.993: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2
Source.994: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.995: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3
Source.996: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.997: DFBPPR4592 ---- Plant proteins ---- Ubiquitin-fold modifier 1
Source.998: DFBPPR4593 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 15
Source.999: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D
Source.1000: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.1001: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3
Source.1002: DFBPPR4630 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 11
Source.1003: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.1004: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700
Source.1005: DFBPPR4634 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 9
Source.1006: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900
Source.1007: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5
Source.1008: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7
Source.1009: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.1010: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic
Source.1011: DFBPPR4660 ---- Plant proteins ---- Transcription factor ILI2
Source.1012: DFBPPR4662 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor SMR1
Source.1013: DFBPPR4666 ---- Plant proteins ---- Protein IN2-1 homolog A
Source.1014: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62
Source.1015: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.1016: DFBPPR4672 ---- Plant proteins ---- Ninja-family protein Os03g0419100
Source.1017: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3
Source.1018: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.1019: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2
Source.1020: DFBPPR4682 ---- Plant proteins ---- Protein SPIRAL1-like 1
Source.1021: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1
Source.1022: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic
Source.1023: DFBPPR4690 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 44
Source.1024: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B
Source.1025: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8
Source.1026: DFBPPR4705 ---- Plant proteins ---- 40S ribosomal protein S26
Source.1027: DFBPPR4706 ---- Plant proteins ---- Tubby-like protein 4
Source.1028: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.1029: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.1030: DFBPPR4728 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 12
Source.1031: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.1032: DFBPPR4735 ---- Plant proteins ---- Uncharacterized protein Os08g0218700/LOC_Os08g12160
Source.1033: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400
Source.1034: DFBPPR4740 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 2
Source.1035: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.1036: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.1037: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9
Source.1038: DFBPPR4755 ---- Plant proteins ---- 40S ribosomal protein S8
Source.1039: DFBPPR4761 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 13
Source.1040: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35
Source.1041: DFBPPR4768 ---- Plant proteins ---- Protein SPIRAL1-like 2
Source.1042: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31
Source.1043: DFBPPR4784 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19
Source.1044: DFBPPR4785 ---- Plant proteins ---- B3 domain-containing protein Os04g0386900
Source.1045: DFBPPR4791 ---- Plant proteins ---- B3 domain-containing protein Os02g0683500
Source.1046: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100
Source.1047: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800
Source.1048: DFBPPR4807 ---- Plant proteins ---- Protein MEI2-like 6
Source.1049: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.1050: DFBPPR4813 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0157700
Source.1051: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47
Source.1052: DFBPPR4821 ---- Plant proteins ---- Protein SPIRAL1-like 4
Source.1053: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.1054: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500
Source.1055: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6
Source.1056: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.1057: DFBPPR4836 ---- Plant proteins ---- Protein SPIRAL1-like 3
Source.1058: DFBPPR4840 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 3
Source.1059: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400
Source.1060: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200
Source.1061: DFBPPR4848 ---- Plant proteins ---- B3 domain-containing protein Os02g0455800
Source.1062: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.1063: DFBPPR4863 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 1
Source.1064: DFBPPR4874 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 1
Source.1065: DFBPPR4879 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 58
Source.1066: DFBPPR4882 ---- Plant proteins ---- Salt stress root protein RS1
Source.1067: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.1068: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3
Source.1069: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.1070: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.1071: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein
Source.1072: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.1073: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.1074: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2
Source.1075: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase
Source.1076: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1
Source.1077: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.1078: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2
Source.1079: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID
Source.1080: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1
Source.1081: DFBPPR4920 ---- Plant proteins ---- RNA-binding protein Y14A
Source.1082: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.1083: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.1084: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.1085: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.1086: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1
Source.1087: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.1088: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.1089: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.1090: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1091: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.1092: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.1093: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.1094: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.1095: DFBPPR5029 ---- Plant proteins ---- Trypsin inhibitor A
Source.1096: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1097: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.1098: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1099: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.1100: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.1101: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.1102: DFBPPR5189 ---- Plant proteins ---- HMG-Y-related protein A
Source.1103: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.1104: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.1105: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.1106: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1107: DFBPPR5231 ---- Plant proteins ---- Casparian strip membrane protein 5
Source.1108: DFBPPR5237 ---- Plant proteins ---- Trypsin inhibitor B
Source.1109: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1110: DFBPPR5250 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.1111: DFBPPR5267 ---- Plant proteins ---- Casparian strip membrane protein 3
Source.1112: DFBPPR5278 ---- Plant proteins ---- 40S ribosomal protein SA
Source.1113: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2
Source.1114: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.1115: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.1116: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.1117: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.1118: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.1119: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.1120: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.1121: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.1122: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1123: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3
Source.1124: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.1125: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.1126: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.1127: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.1128: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.1129: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1130: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.1131: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2
Source.1132: DFBPPR5435 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.1133: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1
Source.1134: DFBPPR5451 ---- Plant proteins ---- Histone deacetylase HDT1
Source.1135: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.1136: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2
Source.1137: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1
Source.1138: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1139: DFBPPR5469 ---- Plant proteins ---- Indole-3-glycerol phosphate lyase, chloroplastic
Source.1140: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1
Source.1141: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.1142: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.1143: DFBPPR5490 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.1144: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.1145: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.1146: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.1147: DFBPPR5518 ---- Plant proteins ---- Ferredoxin-2, chloroplastic
Source.1148: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.1149: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1150: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.1151: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.1152: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.1153: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.1154: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.1155: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.1156: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10
Source.1157: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.1158: DFBPPR5588 ---- Plant proteins ---- 60S acidic ribosomal protein P2A
Source.1159: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.1160: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.1161: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.1162: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3
Source.1163: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.1164: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.1165: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.1166: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1167: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.1168: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.1169: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.1170: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.1171: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.1172: DFBPPR5625 ---- Plant proteins ---- Dof zinc finger protein MNB1A
Source.1173: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1174: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1175: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.1176: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.1177: DFBPPR5638 ---- Plant proteins ---- Histone H2B.5
Source.1178: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.1179: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.1180: DFBPPR5654 ---- Plant proteins ---- Molybdopterin synthase sulfur carrier subunit
Source.1181: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.1182: DFBPPR5663 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.1183: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6
Source.1184: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.1185: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.1186: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.1187: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.1188: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.1189: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.1190: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5
Source.1191: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.1192: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase
Source.1193: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.1194: DFBPPR5736 ---- Plant proteins ---- Histone H1
Source.1195: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1196: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.1197: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.1198: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.1199: DFBPPR5752 ---- Plant proteins ---- 60S acidic ribosomal protein P1
Source.1200: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic
Source.1201: DFBPPR5761 ---- Plant proteins ---- Ferredoxin-6, chloroplastic
Source.1202: DFBPPR5766 ---- Plant proteins ---- MADS-box protein ZMM17
Source.1203: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1
Source.1204: DFBPPR5769 ---- Plant proteins ---- Ferredoxin-5, chloroplastic
Source.1205: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1
Source.1206: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.1207: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic
Source.1208: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1209: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1210: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.1211: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.1212: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.1213: DFBPPR5827 ---- Plant proteins ---- 60S acidic ribosomal protein P2B
Source.1214: DFBPPR5834 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.1215: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1216: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.1217: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1
Source.1218: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.1219: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1
Source.1220: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1
Source.1221: DFBPPR5885 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.1222: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.1223: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1224: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.1225: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.1226: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2
Source.1227: DFBPPR5912 ---- Plant proteins ---- Histone deacetylase HDT3
Source.1228: DFBPPR5914 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase, variable chain
Source.1229: DFBPPR5925 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic
Source.1230: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1231: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2
Source.1232: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1233: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A
Source.1234: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1
Source.1235: DFBPPR5950 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1236: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B
Source.1237: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.1238: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.1239: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3
Source.1240: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1
Source.1241: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1
Source.1242: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1
Source.1243: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.1244: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1
Source.1245: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.1246: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.1247: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1248: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.1249: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1
Source.1250: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.1251: DFBPPR6047 ---- Plant proteins ---- CASP-like protein 1D1
Source.1252: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1
Source.1253: DFBPPR6054 ---- Plant proteins ---- CASP-like protein 5A3
Source.1254: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2
Source.1255: DFBPPR6070 ---- Plant proteins ---- 40S ribosomal protein S8
Source.1256: DFBPPR6072 ---- Plant proteins ---- CASP-like protein 5A2
Source.1257: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.1258: DFBPPR6080 ---- Plant proteins ---- Zein-alpha 19A2
Source.1259: DFBPPR6083 ---- Plant proteins ---- Cell number regulator 7
Source.1260: DFBPPR6085 ---- Plant proteins ---- Zein-alpha A30
Source.1261: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10
Source.1262: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2
Source.1263: DFBPPR6098 ---- Plant proteins ---- CASP-like protein 5A1
Source.1264: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.1265: DFBPPR6142 ---- Plant proteins ---- Metallothionein-like protein 1
Source.1266: DFBPPR6145 ---- Plant proteins ---- Ninja-family protein 6
Source.1267: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5
Source.1268: DFBPPR6159 ---- Plant proteins ---- MFS14 protein
Source.1269: DFBPPR6205 ---- Plant proteins ---- Unknown protein from spot 1131 of 2D-PAGE of etiolated coleoptile
Source.1270: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1271: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.1272: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1273: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.1274: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1275: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1276: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.1277: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.1278: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1279: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1280: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.1281: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64
Source.1282: DFBPPR6297 ---- Plant proteins ---- Aminomethyltransferase, mitochondrial
Source.1283: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.1284: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.1285: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.1286: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.1287: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.1288: DFBPPR6335 ---- Plant proteins ---- Protein CYCLOPS
Source.1289: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.1290: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5
Source.1291: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic
Source.1292: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.1293: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1294: DFBPPR6389 ---- Plant proteins ---- Auxin-induced protein IAA4
Source.1295: DFBPPR6443 ---- Plant proteins ---- Disease resistance response protein 206
Source.1296: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1297: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2
Source.1298: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1
Source.1299: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.1300: DFBPPR6546 ---- Plant proteins ---- Disease resistance response protein Pi49
Source.1301: DFBPPR6547 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.1302: DFBPPR6561 ---- Plant proteins ---- Blue copper protein
Source.1303: DFBPPR6599 ---- Plant proteins ---- Unknown protein from spot 115 of 2D-PAGE of thylakoid
Source.1304: DFBPPR6611 ---- Plant proteins ---- 14-3-3-like protein
Source.1305: DFBPPR6615 ---- Plant proteins ---- Photosystem I reaction center subunit IV
Source.1306: DFBPPR6616 ---- Plant proteins ---- Disease resistance response protein Pi176
Source.1307: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.1308: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.1309: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase
Source.1310: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.1311: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.1312: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.1313: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.1314: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.1315: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3
Source.1316: DFBPPR6691 ---- Plant proteins ---- Histone H2A.2.1
Source.1317: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic
Source.1318: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1319: DFBPPR6697 ---- Plant proteins ---- Non-specific lipid-transfer protein 2G
Source.1320: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein
Source.1321: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase
Source.1322: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1323: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1
Source.1324: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.1325: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.1326: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase
Source.1327: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.1328: DFBPPR6788 ---- Plant proteins ---- Histone H1
Source.1329: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1
Source.1330: DFBPPR6795 ---- Plant proteins ---- Elongation factor 1-beta
Source.1331: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.1332: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a
Source.1333: DFBPPR6812 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.1334: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.1335: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2
Source.1336: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A
Source.1337: DFBPPR6847 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.1338: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1339: DFBPPR6874 ---- Plant proteins ---- Dehydrin COR410
Source.1340: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.1341: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1342: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1
Source.1343: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1344: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin
Source.1345: DFBPPR6995 ---- Plant proteins ---- HMG1/2-like protein
Source.1346: DFBPPR7003 ---- Plant proteins ---- Protein RAFTIN 1C
Source.1347: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.1348: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme
Source.1349: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1350: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.1351: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1352: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.1353: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.1354: DFBPPR7030 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.1355: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase
Source.1356: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1357: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1358: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1359: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1360: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic
Source.1361: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.1362: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1363: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.1364: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.1365: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.1366: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1367: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.1368: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.1369: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.1370: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9
Source.1371: DFBPPR7173 ---- Plant proteins ---- Photosystem I reaction center subunit II, chloroplastic
Source.1372: DFBPPR7178 ---- Plant proteins ---- Elongation factor 1-alpha
Source.1373: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha
Source.1374: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.1375: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.1376: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1377: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.1378: DFBPPR7217 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic
Source.1379: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1380: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1
Source.1381: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic
Source.1382: DFBPPR7262 ---- Plant proteins ---- Photosystem I reaction center subunit IV, chloroplastic
Source.1383: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.1384: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein
Source.1385: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.1386: DFBPPR7407 ---- Plant proteins ---- Oleosin-B1
Source.1387: DFBPPR7418 ---- Plant proteins ---- Oleosin-B6
Source.1388: DFBPPR7438 ---- Plant proteins ---- Oleosin-B3
Source.1389: DFBPPR7439 ---- Plant proteins ---- Oleosin-B4
Source.1390: DFBPPR7449 ---- Plant proteins ---- Oleosin-B2
Source.1391: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.1392: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.1393: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic
Source.1394: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.1395: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.1396: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA
Source.1397: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1398: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.1399: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.1400: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b
Source.1401: DFBPPR7618 ---- Milk proteins ---- Plasminogen
Source.1402: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.1403: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.1404: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.1405: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2
Source.1406: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.1407: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1
Source.1408: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1
Source.1409: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor
Source.1410: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.1411: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.1412: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.1413: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.1414: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B
Source.1415: DFBPPR8379 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 1
Source.1416: DFBPPR8385 ---- Plant proteins ---- Alpha-methyl-mannoside-specific lectin
Source.1417: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.1418: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1419: DFBPPR8444 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.1420: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.1421: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic
Source.1422: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase
Source.1423: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.1424: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.1425: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4
Source.1426: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.1427: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1
Source.1428: DFBPPR8521 ---- Milk proteins ---- Probetacellulin
Source.1429: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.1430: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1
Source.1431: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.1432: DFBPPR15969 ---- Animal proteins ---- Natriuretic peptides A
Source.1433: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.1434: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.1435: DFBPPR15980 ---- Animal proteins ---- Peroxisome proliferator-activated receptor alpha
Source.1436: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.1437: DFBPPR15988 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.1438: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.1439: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1
Source.1440: DFBPPR16005 ---- Animal proteins ---- Myc proto-oncogene protein
Source.1441: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1442: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.1443: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.1444: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.1445: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.1446: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.1447: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.1448: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.1449: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.1450: DFBPPR16103 ---- Animal proteins ---- Laforin
Source.1451: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1452: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.1453: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.1454: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.1455: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.1456: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.1457: DFBPPR16142 ---- Animal proteins ---- Procathepsin L
Source.1458: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.1459: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.1460: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.1461: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.1462: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.1463: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.1464: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.1465: DFBPPR16180 ---- Animal proteins ---- Orexin
Source.1466: DFBPPR16181 ---- Animal proteins ---- Inositol polyphosphate-5-phosphatase A
Source.1467: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.1468: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.1469: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.1470: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1471: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.1472: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.1473: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1474: DFBPPR16224 ---- Animal proteins ---- Uromodulin
Source.1475: DFBPPR16230 ---- Animal proteins ---- Survival motor neuron protein
Source.1476: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.1477: DFBPPR16263 ---- Animal proteins ---- Protein 4.1
Source.1478: DFBPPR16264 ---- Animal proteins ---- Pancreatic prohormone
Source.1479: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.1480: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.1481: DFBPPR16279 ---- Animal proteins ---- Galactokinase
Source.1482: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.1483: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.1484: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.1485: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.1486: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.1487: DFBPPR16338 ---- Animal proteins ---- Endothelin-2
Source.1488: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.1489: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.1490: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.1491: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.1492: DFBPPR16446 ---- Animal proteins ---- Anionic trypsin
Source.1493: DFBPPR16447 ---- Animal proteins ---- Anionic trypsin
Source.1494: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.1495: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.1496: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.1497: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.1498: DFBPPR16484 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain
Source.1499: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1
Source.1500: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.1501: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.1502: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.1503: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.1504: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a
Source.1505: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor
Source.1506: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein
Source.1507: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2
Source.1508: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.1509: DFBPPR16566 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta
Source.1510: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.1511: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4
Source.1512: DFBPPR16598 ---- Animal proteins ---- Keratin, type I cytoskeletal 9
Source.1513: DFBPPR16616 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.1514: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7
Source.1515: DFBPPR16635 ---- Animal proteins ---- Corticoliberin
Source.1516: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.1517: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.1518: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.1519: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4
Source.1520: DFBPPR16701 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog
Source.1521: DFBPPR16704 ---- Animal proteins ---- Retbindin
Source.1522: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.1523: DFBPPR16714 ---- Animal proteins ---- Protein fosB
Source.1524: DFBPPR16715 ---- Animal proteins ---- Submaxillary mucin
Source.1525: DFBPPR16724 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2
Source.1526: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.1527: DFBPPR16756 ---- Animal proteins ---- Unknown protein from spot 11 of 2D-PAGE of heart tissue
Source.1528: DFBPPR16775 ---- Animal proteins ---- Pinopsin
Source.1529: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.1530: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.1531: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.1532: DFBPPR16809 ---- Animal proteins ---- Rhodopsin
Source.1533: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1534: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1535: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein
Source.1536: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.1537: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.1538: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor
Source.1539: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.1540: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.1541: DFBPPR16876 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.1542: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.1543: DFBPPR16879 ---- Animal proteins ---- Inhibin beta A chain
Source.1544: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.1545: DFBPPR16894 ---- Animal proteins ---- Procathepsin L
Source.1546: DFBPPR16897 ---- Animal proteins ---- Interleukin-4
Source.1547: DFBPPR16903 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate
Source.1548: DFBPPR16913 ---- Animal proteins ---- Alpha-crystallin B chain
Source.1549: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.1550: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.1551: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.1552: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.1553: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1554: DFBPPR16950 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.1555: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.1556: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.1557: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.1558: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6
Source.1559: DFBPPR16985 ---- Animal proteins ---- Filensin
Source.1560: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.1561: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.1562: DFBPPR17007 ---- Animal proteins ---- Microtubule-associated protein tau
Source.1563: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1
Source.1564: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1565: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1566: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.1567: DFBPPR17047 ---- Animal proteins ---- Neuromodulin
Source.1568: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1569: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.1570: DFBPPR17055 ---- Animal proteins ---- Phospholipase A2, membrane associated
Source.1571: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.1572: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.1573: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.1574: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.1575: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.1576: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit
Source.1577: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.1578: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1
Source.1579: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.1580: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog
Source.1581: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.1582: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.1583: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.1584: DFBPPR17268 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.1585: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.1586: DFBPPR17280 ---- Animal proteins ---- Serine racemase
Source.1587: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1
Source.1588: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.1589: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B
Source.1590: DFBPPR17296 ---- Animal proteins ---- Dynamin-2
Source.1591: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial
Source.1592: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.1593: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.1594: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein
Source.1595: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.1596: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase
Source.1597: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1598: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B
Source.1599: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.1600: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.1601: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.1602: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1
Source.1603: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.1604: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.1605: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1
Source.1606: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial
Source.1607: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10
Source.1608: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.1609: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1
Source.1610: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.1611: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.1612: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1
Source.1613: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.1614: DFBPPR17432 ---- Animal proteins ---- Ephrin-A1
Source.1615: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.1616: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.1617: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.1618: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1
Source.1619: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.1620: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.1621: DFBPPR17484 ---- Animal proteins ---- Histone H1.8
Source.1622: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.1623: DFBPPR17521 ---- Animal proteins ---- Transforming growth factor beta-1-induced transcript 1 protein
Source.1624: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1625: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein
Source.1626: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5
Source.1627: DFBPPR17549 ---- Animal proteins ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.1628: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4
Source.1629: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.1630: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.1631: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.1632: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.1633: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1634: DFBPPR17618 ---- Animal proteins ---- Synaptophysin
Source.1635: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein
Source.1636: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A
Source.1637: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A
Source.1638: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.1639: DFBPPR17637 ---- Animal proteins ---- Cytochrome c oxidase subunit 7C, mitochondrial
Source.1640: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.1641: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.1642: DFBPPR17661 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.1643: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L
Source.1644: DFBPPR17713 ---- Animal proteins ---- Urokinase plasminogen activator surface receptor
Source.1645: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.1646: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.1647: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.1648: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1
Source.1649: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.1650: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.1651: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.1652: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.1653: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.1654: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1
Source.1655: DFBPPR17807 ---- Animal proteins ---- Opticin
Source.1656: DFBPPR17810 ---- Animal proteins ---- Histone H1.2
Source.1657: DFBPPR17815 ---- Animal proteins ---- 40S ribosomal protein SA
Source.1658: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.1659: DFBPPR17842 ---- Animal proteins ---- Vascular endothelial growth factor B
Source.1660: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.1661: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.1662: DFBPPR17858 ---- Animal proteins ---- Calsenilin
Source.1663: DFBPPR17859 ---- Animal proteins ---- Beta-nerve growth factor
Source.1664: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.1665: DFBPPR17875 ---- Animal proteins ---- Brain acid soluble protein 1
Source.1666: DFBPPR17879 ---- Animal proteins ---- Menin
Source.1667: DFBPPR17881 ---- Animal proteins ---- Myoblast determination protein 1
Source.1668: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.1669: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.1670: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein
Source.1671: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.1672: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.1673: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.1674: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.1675: DFBPPR17934 ---- Animal proteins ---- RNA-binding motif protein, X chromosome
Source.1676: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.1677: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.1678: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.1679: DFBPPR17947 ---- Animal proteins ---- Erythropoietin
Source.1680: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.1681: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial
Source.1682: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.1683: DFBPPR17976 ---- Animal proteins ---- Apoptosis regulator Bcl-2
Source.1684: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor
Source.1685: DFBPPR17987 ---- Animal proteins ---- DCN1-like protein 3
Source.1686: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.1687: DFBPPR18001 ---- Animal proteins ---- Syntaxin-1B
Source.1688: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.1689: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon
Source.1690: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein
Source.1691: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2
Source.1692: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.1693: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1
Source.1694: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.1695: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.1696: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.1697: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein
Source.1698: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.1699: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.1700: DFBPPR18106 ---- Animal proteins ---- Natriuretic peptides B
Source.1701: DFBPPR18116 ---- Animal proteins ---- Carbonic anhydrase 4
Source.1702: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23
Source.1703: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.1704: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.1705: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.1706: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha
Source.1707: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.1708: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.1709: DFBPPR18174 ---- Animal proteins ---- Interferon-inducible double-stranded RNA-dependent protein kinase activator A
Source.1710: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform
Source.1711: DFBPPR18199 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 N
Source.1712: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5
Source.1713: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.1714: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.1715: DFBPPR18242 ---- Animal proteins ---- Heparanase
Source.1716: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.1717: DFBPPR18252 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.1718: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.1719: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.1720: DFBPPR18278 ---- Animal proteins ---- ATP synthase F(0) complex subunit B1, mitochondrial
Source.1721: DFBPPR18299 ---- Animal proteins ---- Synapsin-1
Source.1722: DFBPPR18301 ---- Animal proteins ---- SOSS complex subunit B1
Source.1723: DFBPPR18315 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.1724: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.1725: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.1726: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.1727: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.1728: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.1729: DFBPPR18339 ---- Animal proteins ---- SPARC
Source.1730: DFBPPR18353 ---- Animal proteins ---- Lactosylceramide alpha-2,3-sialyltransferase
Source.1731: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3
Source.1732: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial
Source.1733: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.1734: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.1735: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z
Source.1736: DFBPPR18394 ---- Animal proteins ---- Histone H1.1
Source.1737: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase
Source.1738: DFBPPR18396 ---- Animal proteins ---- Corticoliberin
Source.1739: DFBPPR18402 ---- Animal proteins ---- Uromodulin
Source.1740: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3
Source.1741: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain
Source.1742: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.1743: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.1744: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.1745: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.1746: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.1747: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1
Source.1748: DFBPPR18438 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.1749: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.1750: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3
Source.1751: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.1752: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component
Source.1753: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2
Source.1754: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47
Source.1755: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.1756: DFBPPR18506 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.1757: DFBPPR18516 ---- Animal proteins ---- Galactokinase
Source.1758: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1
Source.1759: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.1760: DFBPPR18538 ---- Animal proteins ---- Vesicle-associated membrane protein 1
Source.1761: DFBPPR18541 ---- Animal proteins ---- Chromatin modification-related protein MEAF6
Source.1762: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1
Source.1763: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.1764: DFBPPR18560 ---- Animal proteins ---- Rho-related GTP-binding protein RhoF
Source.1765: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3
Source.1766: DFBPPR18569 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.1767: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.1768: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.1769: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.1770: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.1771: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.1772: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1773: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.1774: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.1775: DFBPPR18638 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 E3
Source.1776: DFBPPR18720 ---- Animal proteins ---- Protein quaking
Source.1777: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.1778: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.1779: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor
Source.1780: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.1781: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase
Source.1782: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50
Source.1783: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.1784: DFBPPR18774 ---- Animal proteins ---- Testis-specific serine/threonine-protein kinase 1
Source.1785: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.1786: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.1787: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.1788: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5
Source.1789: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6
Source.1790: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.1791: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.1792: DFBPPR18849 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF3
Source.1793: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.1794: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.1795: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.1796: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A
Source.1797: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.1798: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6
Source.1799: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.1800: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.1801: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.1802: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3
Source.1803: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11
Source.1804: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.1805: DFBPPR18926 ---- Animal proteins ---- Keratin, type I cytoskeletal 10
Source.1806: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.1807: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.1808: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108
Source.1809: DFBPPR18939 ---- Animal proteins ---- Acylpyruvase FAHD1, mitochondrial
Source.1810: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.1811: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1
Source.1812: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.1813: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase
Source.1814: DFBPPR18982 ---- Animal proteins ---- Gastrin-releasing peptide
Source.1815: DFBPPR19004 ---- Animal proteins ---- Histone H1.3
Source.1816: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746
Source.1817: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2
Source.1818: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase
Source.1819: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1
Source.1820: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3
Source.1821: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3
Source.1822: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.1823: DFBPPR19045 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta
Source.1824: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.1825: DFBPPR19049 ---- Animal proteins ---- Caprin-1
Source.1826: DFBPPR19076 ---- Animal proteins ---- Protein MGARP
Source.1827: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1
Source.1828: DFBPPR19090 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.1829: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1
Source.1830: DFBPPR19098 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 9
Source.1831: DFBPPR19103 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein 70 kDa
Source.1832: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.1833: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3
Source.1834: DFBPPR19124 ---- Animal proteins ---- Neuroguidin
Source.1835: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein
Source.1836: DFBPPR19132 ---- Animal proteins ---- DNA oxidative demethylase ALKBH2
Source.1837: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.1838: DFBPPR19137 ---- Animal proteins ---- Serpin H1
Source.1839: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.1840: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial
Source.1841: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.1842: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14
Source.1843: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.1844: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3
Source.1845: DFBPPR19185 ---- Animal proteins ---- Partner of Y14 and mago
Source.1846: DFBPPR19205 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF169
Source.1847: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2
Source.1848: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.1849: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.1850: DFBPPR19223 ---- Animal proteins ---- Caveolae-associated protein 4
Source.1851: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A
Source.1852: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.1853: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.1854: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.1855: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.1856: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3
Source.1857: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.1858: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1
Source.1859: DFBPPR19277 ---- Animal proteins ---- Prolactin-releasing peptide
Source.1860: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8
Source.1861: DFBPPR19312 ---- Animal proteins ---- Copine-1
Source.1862: DFBPPR19316 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 2, mitochondrial
Source.1863: DFBPPR19329 ---- Animal proteins ---- CD302 antigen
Source.1864: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.1865: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1
Source.1866: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.1867: DFBPPR19351 ---- Animal proteins ---- Caveolae-associated protein 3
Source.1868: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.1869: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.1870: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.1871: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.1872: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.1873: DFBPPR19419 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.1874: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF
Source.1875: DFBPPR19432 ---- Animal proteins ---- ATP synthase subunit ATP5MPL, mitochondrial
Source.1876: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor
Source.1877: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3
Source.1878: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.1879: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.1880: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.1881: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.1882: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1
Source.1883: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.1884: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.1885: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.1886: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain
Source.1887: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.1888: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.1889: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase
Source.1890: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.1891: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.1892: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2
Source.1893: DFBPPR19533 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3
Source.1894: DFBPPR19542 ---- Animal proteins ---- Phosphomannomutase 2
Source.1895: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase
Source.1896: DFBPPR19548 ---- Animal proteins ---- Reticulophagy regulator 1
Source.1897: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.1898: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.1899: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.1900: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.1901: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.1902: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4
Source.1903: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.1904: DFBPPR19619 ---- Animal proteins ---- PAXIP1-associated glutamate-rich protein 1
Source.1905: DFBPPR19627 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain
Source.1906: DFBPPR19629 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide FF
Source.1907: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25
Source.1908: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4
Source.1909: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2
Source.1910: DFBPPR19664 ---- Animal proteins ---- Protein OS-9
Source.1911: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.1912: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1
Source.1913: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.1914: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10
Source.1915: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205
Source.1916: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17
Source.1917: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4
Source.1918: DFBPPR19725 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 1
Source.1919: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.1920: DFBPPR19743 ---- Animal proteins ---- C-X-C motif chemokine 16
Source.1921: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1
Source.1922: DFBPPR19763 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.1923: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma
Source.1924: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4
Source.1925: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2
Source.1926: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.1927: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4
Source.1928: DFBPPR19796 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.1929: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma
Source.1930: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1931: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein
Source.1932: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.1933: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.1934: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.1935: DFBPPR19844 ---- Animal proteins ---- Prosalusin
Source.1936: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2
Source.1937: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.1938: DFBPPR19877 ---- Animal proteins ---- Histone H3-like centromeric protein A
Source.1939: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial
Source.1940: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.1941: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.1942: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase
Source.1943: DFBPPR19927 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] flavoprotein 3, mitochondrial
Source.1944: DFBPPR19931 ---- Animal proteins ---- Tryptophan--tRNA ligase, mitochondrial
Source.1945: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2
Source.1946: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor
Source.1947: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.1948: DFBPPR19960 ---- Animal proteins ---- 60S ribosomal protein L24
Source.1949: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14
Source.1950: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10
Source.1951: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor
Source.1952: DFBPPR19976 ---- Animal proteins ---- Mammalian ependymin-related protein 1
Source.1953: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27
Source.1954: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20
Source.1955: DFBPPR19995 ---- Animal proteins ---- 39S ribosomal protein L55, mitochondrial
Source.1956: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit
Source.1957: DFBPPR20038 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 20
Source.1958: DFBPPR20055 ---- Animal proteins ---- Myelin protein zero-like protein 1
Source.1959: DFBPPR20060 ---- Animal proteins ---- Fibulin-5
Source.1960: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.1961: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1
Source.1962: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6
Source.1963: DFBPPR20099 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit WDR4
Source.1964: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1
Source.1965: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2
Source.1966: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.1967: DFBPPR20149 ---- Animal proteins ---- Flotillin-2
Source.1968: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9
Source.1969: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2
Source.1970: DFBPPR20170 ---- Animal proteins ---- EEF1A lysine methyltransferase 4
Source.1971: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.1972: DFBPPR20176 ---- Animal proteins ---- Wiskott-Aldrich syndrome protein family member 2
Source.1973: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase
Source.1974: DFBPPR20204 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.1975: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.1976: DFBPPR20209 ---- Animal proteins ---- Ran-specific GTPase-activating protein
Source.1977: DFBPPR20217 ---- Animal proteins ---- Cytochrome c oxidase assembly factor 8
Source.1978: DFBPPR20224 ---- Animal proteins ---- Sclerostin
Source.1979: DFBPPR20227 ---- Animal proteins ---- 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline decarboxylase
Source.1980: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.1981: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3
Source.1982: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.1983: DFBPPR20251 ---- Animal proteins ---- Follistatin-related protein 3
Source.1984: DFBPPR20264 ---- Animal proteins ---- AP-3 complex subunit sigma-2
Source.1985: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.1986: DFBPPR20301 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 3
Source.1987: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.1988: DFBPPR20323 ---- Animal proteins ---- Myosin light chain 3
Source.1989: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.1990: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27
Source.1991: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14
Source.1992: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1
Source.1993: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2
Source.1994: DFBPPR20357 ---- Animal proteins ---- Snurportin-1
Source.1995: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial
Source.1996: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56
Source.1997: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha
Source.1998: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6
Source.1999: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.2000: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.2001: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial
Source.2002: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1
Source.2003: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5
Source.2004: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1
Source.2005: DFBPPR20466 ---- Animal proteins ---- Ribonuclease P protein subunit p38
Source.2006: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.2007: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.2008: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102
Source.2009: DFBPPR20501 ---- Animal proteins ---- 28S ribosomal protein S2, mitochondrial
Source.2010: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.2011: DFBPPR20510 ---- Animal proteins ---- Josephin-1
Source.2012: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42
Source.2013: DFBPPR20524 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A
Source.2014: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.2015: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.2016: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.2017: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.2018: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.2019: DFBPPR20558 ---- Animal proteins ---- N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase
Source.2020: DFBPPR20566 ---- Animal proteins ---- RecQ-mediated genome instability protein 2
Source.2021: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.2022: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.2023: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.2024: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.2025: DFBPPR20590 ---- Animal proteins ---- POU domain class 2-associating factor 1
Source.2026: DFBPPR20607 ---- Animal proteins ---- Spliceosome-associated protein CWC27 homolog
Source.2027: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.2028: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.2029: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.2030: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2
Source.2031: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.2032: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.2033: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.2034: DFBPPR20669 ---- Animal proteins ---- D site-binding protein
Source.2035: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.2036: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.2037: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.2038: DFBPPR20690 ---- Animal proteins ---- Neurotrimin
Source.2039: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11
Source.2040: DFBPPR20700 ---- Animal proteins ---- General transcription factor IIE subunit 1
Source.2041: DFBPPR20704 ---- Animal proteins ---- C-X-C motif chemokine 17
Source.2042: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2
Source.2043: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1
Source.2044: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial
Source.2045: DFBPPR20735 ---- Animal proteins ---- Microtubule-associated tumor suppressor 1 homolog
Source.2046: DFBPPR20738 ---- Animal proteins ---- Ferritin, mitochondrial
Source.2047: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.2048: DFBPPR20754 ---- Animal proteins ---- Transcription factor Maf
Source.2049: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45
Source.2050: DFBPPR20769 ---- Animal proteins ---- Coiled-coil domain-containing protein 69
Source.2051: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.2052: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.2053: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6
Source.2054: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2055: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.2056: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14
Source.2057: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.2058: DFBPPR20815 ---- Animal proteins ---- Translation initiation factor IF-3, mitochondrial
Source.2059: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase
Source.2060: DFBPPR20823 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.2061: DFBPPR20837 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.2062: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2
Source.2063: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.2064: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.2065: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.2066: DFBPPR20878 ---- Animal proteins ---- Protein SMG9
Source.2067: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1
Source.2068: DFBPPR20892 ---- Animal proteins ---- Lysosomal thioesterase PPT2
Source.2069: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668
Source.2070: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.2071: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.2072: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4
Source.2073: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.2074: DFBPPR20973 ---- Animal proteins ---- Growth-regulated protein homolog gamma
Source.2075: DFBPPR20993 ---- Animal proteins ---- 39S ribosomal protein L12, mitochondrial
Source.2076: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.2077: DFBPPR21005 ---- Animal proteins ---- Growth-regulated protein homolog beta
Source.2078: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.2079: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26
Source.2080: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein
Source.2081: DFBPPR21028 ---- Animal proteins ---- Growth arrest and DNA damage-inducible proteins-interacting protein 1
Source.2082: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial
Source.2083: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.2084: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.2085: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28
Source.2086: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2
Source.2087: DFBPPR21067 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.2088: DFBPPR21068 ---- Animal proteins ---- 40S ribosomal protein S5
Source.2089: DFBPPR21076 ---- Animal proteins ---- Ferredoxin-2, mitochondrial
Source.2090: DFBPPR21077 ---- Animal proteins ---- Growth-regulated protein homolog alpha
Source.2091: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A
Source.2092: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4
Source.2093: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.2094: DFBPPR21111 ---- Animal proteins ---- Zinc finger protein-like 1
Source.2095: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.2096: DFBPPR21125 ---- Animal proteins ---- Male-enhanced antigen 1
Source.2097: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial
Source.2098: DFBPPR21127 ---- Animal proteins ---- 60S acidic ribosomal protein P1
Source.2099: DFBPPR21140 ---- Animal proteins ---- High mobility group nucleosome-binding domain-containing protein 3
Source.2100: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.2101: DFBPPR21181 ---- Animal proteins ---- Calpastatin
Source.2102: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.2103: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1
Source.2104: DFBPPR21203 ---- Animal proteins ---- Nuclear protein 2
Source.2105: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9
Source.2106: DFBPPR21225 ---- Animal proteins ---- 28S ribosomal protein S31, mitochondrial
Source.2107: DFBPPR21226 ---- Animal proteins ---- GPN-loop GTPase 2
Source.2108: DFBPPR21227 ---- Animal proteins ---- FUN14 domain-containing protein 1
Source.2109: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.2110: DFBPPR21240 ---- Animal proteins ---- 6-phosphogluconolactonase
Source.2111: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.2112: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2
Source.2113: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1
Source.2114: DFBPPR21267 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 22
Source.2115: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4
Source.2116: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.2117: DFBPPR21290 ---- Animal proteins ---- Metaxin-1
Source.2118: DFBPPR21292 ---- Animal proteins ---- Probable inactive serine protease 58
Source.2119: DFBPPR21293 ---- Animal proteins ---- IST1 homolog
Source.2120: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1
Source.2121: DFBPPR21301 ---- Animal proteins ---- Lymphocyte antigen 6D
Source.2122: DFBPPR21311 ---- Animal proteins ---- WD repeat-containing protein 18
Source.2123: DFBPPR21321 ---- Animal proteins ---- Zinc finger matrin-type protein 3
Source.2124: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115
Source.2125: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.2126: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65
Source.2127: DFBPPR21356 ---- Animal proteins ---- Sideroflexin-2
Source.2128: DFBPPR21358 ---- Animal proteins ---- Myosin light chain 1/3, skeletal muscle isoform
Source.2129: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.2130: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.2131: DFBPPR21362 ---- Animal proteins ---- 40S ribosomal protein S4
Source.2132: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.2133: DFBPPR21374 ---- Animal proteins ---- Cytochrome c oxidase assembly factor 6 homolog
Source.2134: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D
Source.2135: DFBPPR21376 ---- Animal proteins ---- Calponin-3
Source.2136: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3
Source.2137: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.2138: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.2139: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein
Source.2140: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.2141: DFBPPR21414 ---- Animal proteins ---- Neuromedin-B
Source.2142: DFBPPR21416 ---- Animal proteins ---- 39S ribosomal protein L32, mitochondrial
Source.2143: DFBPPR21431 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 4 homolog A
Source.2144: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2
Source.2145: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.2146: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3
Source.2147: DFBPPR21474 ---- Animal proteins ---- m-AAA protease-interacting protein 1, mitochondrial
Source.2148: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1
Source.2149: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein
Source.2150: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8
Source.2151: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial
Source.2152: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.2153: DFBPPR21500 ---- Animal proteins ---- Docking protein 2
Source.2154: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3
Source.2155: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1
Source.2156: DFBPPR21512 ---- Animal proteins ---- Membrane protein FAM174B
Source.2157: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2
Source.2158: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase
Source.2159: DFBPPR21521 ---- Animal proteins ---- Active regulator of SIRT1
Source.2160: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1
Source.2161: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2
Source.2162: DFBPPR21528 ---- Animal proteins ---- Vasculin
Source.2163: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2
Source.2164: DFBPPR21534 ---- Animal proteins ---- 39S ribosomal protein L46, mitochondrial
Source.2165: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39
Source.2166: DFBPPR21565 ---- Animal proteins ---- Insulin-like growth factor-binding protein-like 1
Source.2167: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1
Source.2168: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3
Source.2169: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.2170: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4
Source.2171: DFBPPR21594 ---- Animal proteins ---- SH3 domain-binding protein 5-like
Source.2172: DFBPPR21606 ---- Animal proteins ---- Surfeit locus protein 6
Source.2173: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.2174: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.2175: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.2176: DFBPPR21633 ---- Animal proteins ---- DNA fragmentation factor subunit beta
Source.2177: DFBPPR21635 ---- Animal proteins ---- Regulator of G-protein signaling 19
Source.2178: DFBPPR21637 ---- Animal proteins ---- 60S acidic ribosomal protein P2
Source.2179: DFBPPR21641 ---- Animal proteins ---- U5 small nuclear ribonucleoprotein 40 kDa protein
Source.2180: DFBPPR21648 ---- Animal proteins ---- Keratin, type I cytoskeletal 26
Source.2181: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.2182: DFBPPR21671 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog
Source.2183: DFBPPR21680 ---- Animal proteins ---- 40S ribosomal protein S26
Source.2184: DFBPPR21692 ---- Animal proteins ---- Mitotic-spindle organizing protein 2
Source.2185: DFBPPR21701 ---- Animal proteins ---- Prefoldin subunit 1
Source.2186: DFBPPR21721 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor C2
Source.2187: DFBPPR21728 ---- Animal proteins ---- Galectin-9
Source.2188: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.2189: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1
Source.2190: DFBPPR21742 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.2191: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.2192: DFBPPR21749 ---- Animal proteins ---- Protein CUSTOS
Source.2193: DFBPPR21757 ---- Animal proteins ---- Transmembrane protein 190
Source.2194: DFBPPR21762 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 28
Source.2195: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4
Source.2196: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.2197: DFBPPR21775 ---- Animal proteins ---- Protein FAM193B
Source.2198: DFBPPR21799 ---- Animal proteins ---- Major vault protein
Source.2199: DFBPPR21806 ---- Animal proteins ---- Keratin, type II cuticular Hb1
Source.2200: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11
Source.2201: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526
Source.2202: DFBPPR21833 ---- Animal proteins ---- Keratin, type II cuticular Hb3
Source.2203: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750
Source.2204: DFBPPR21848 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 39
Source.2205: DFBPPR21850 ---- Animal proteins ---- GATA zinc finger domain-containing protein 1
Source.2206: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.2207: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6
Source.2208: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1
Source.2209: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1
Source.2210: DFBPPR21909 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 11
Source.2211: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog
Source.2212: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6
Source.2213: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.2214: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.2215: DFBPPR21935 ---- Animal proteins ---- Sentan
Source.2216: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2
Source.2217: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414
Source.2218: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.2219: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1
Source.2220: DFBPPR21989 ---- Animal proteins ---- Morphine-modulating neuropeptide A
Source.2221: DFBPPR22006 ---- Animal proteins ---- EKC/KEOPS complex subunit GON7
Source.2222: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4
Source.2223: DFBPPR22035 ---- Animal proteins ---- Protein CCSMST1
Source.2224: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C
Source.2225: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.2226: DFBPPR22052 ---- Animal proteins ---- Caspase activity and apoptosis inhibitor 1
Source.2227: DFBPPR22054 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.2228: DFBPPR22063 ---- Animal proteins ---- 60S ribosomal protein L29
Source.2229: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1
Source.2230: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.2231: DFBPPR22072 ---- Animal proteins ---- Brain protein I3
Source.2232: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2
Source.2233: DFBPPR22101 ---- Animal proteins ---- DNA polymerase epsilon subunit 4
Source.2234: DFBPPR22111 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.2235: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein
Source.2236: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.2237: DFBPPR22121 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.2238: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A
Source.2239: DFBPPR22129 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.2240: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.2241: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1
Source.2242: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.2243: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2
Source.2244: DFBPPR22168 ---- Animal proteins ---- Transmembrane protein 182
Source.2245: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.2246: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.2247: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.2248: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein
Source.2249: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1
Source.2250: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.2251: DFBPPR22232 ---- Animal proteins ---- Transmembrane protein 176A
Source.2252: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.2253: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.2254: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.2255: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.2256: DFBPPR22256 ---- Animal proteins ---- Proteolipid protein 2
Source.2257: DFBPPR22266 ---- Animal proteins ---- Vexin
Source.2258: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial
Source.2259: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B
Source.2260: DFBPPR22280 ---- Animal proteins ---- 60S ribosomal protein L27a
Source.2261: DFBPPR22282 ---- Animal proteins ---- Optic atrophy 3 protein homolog
Source.2262: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B
Source.2263: DFBPPR22293 ---- Animal proteins ---- Nutritionally-regulated adipose and cardiac-enriched protein homolog
Source.2264: DFBPPR22295 ---- Animal proteins ---- Protein PROCA1
Source.2265: DFBPPR22313 ---- Animal proteins ---- Nucleolar protein 16
Source.2266: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like
Source.2267: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.2268: DFBPPR22342 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog
Source.2269: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B
Source.2270: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80
Source.2271: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.2272: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.2273: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4
Source.2274: DFBPPR22369 ---- Animal proteins ---- Transmembrane protein 247
Source.2275: DFBPPR22395 ---- Animal proteins ---- UPF0524 protein C3orf70 homolog
Source.2276: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.2277: DFBPPR22401 ---- Animal proteins ---- Zinc finger protein 474
Source.2278: DFBPPR22413 ---- Animal proteins ---- Protein LSM12 homolog
Source.2279: DFBPPR22427 ---- Animal proteins ---- Coiled-coil domain-containing protein 58
Source.2280: DFBPPR22430 ---- Animal proteins ---- UPF0561 protein C2orf68 homolog
Source.2281: DFBPPR22435 ---- Animal proteins ---- CDAN1-interacting nuclease 1
Source.2282: DFBPPR22454 ---- Animal proteins ---- R3H domain-containing protein 4
Source.2283: DFBPPR22461 ---- Animal proteins ---- Ashwin
Source.2284: DFBPPR22470 ---- Animal proteins ---- Coiled-coil domain-containing protein 137
Source.2285: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.2286: DFBPPR22486 ---- Animal proteins ---- Transmembrane protein 223
Source.2287: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.2288: DFBPPR22491 ---- Animal proteins ---- Zinc finger C2HC domain-containing protein 1B
Source.2289: DFBPPR22519 ---- Animal proteins ---- Transmembrane protein 248
Source.2290: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1
Source.2291: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54
Source.2292: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9
Source.2293: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.2294: DFBPPR22565 ---- Animal proteins ---- Probable RNA-binding protein 18
Source.2295: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.2296: DFBPPR22588 ---- Animal proteins ---- Uncharacterized protein C1orf198 homolog
Source.2297: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19
Source.2298: DFBPPR22598 ---- Animal proteins ---- UPF0488 protein C8orf33 homolog
Source.2299: DFBPPR22601 ---- Animal proteins ---- Leukocyte receptor cluster member 1 homolog
Source.2300: DFBPPR22602 ---- Animal proteins ---- Transmembrane protein 125
Source.2301: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B
Source.2302: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4
Source.2303: DFBPPR22629 ---- Animal proteins ---- Coiled-coil domain-containing protein 153
Source.2304: DFBPPR22639 ---- Animal proteins ---- UPF0235 protein C15orf40 homolog
Source.2305: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65
Source.2306: DFBPPR22657 ---- Animal proteins ---- Protein FAM110D
Source.2307: DFBPPR22697 ---- Animal proteins ---- MORN repeat-containing protein 2
Source.2308: DFBPPR22709 ---- Animal proteins ---- PIH1 domain-containing protein 2
Source.2309: DFBPPR22719 ---- Animal proteins ---- Uncharacterized protein C12orf45 homolog
Source.2310: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog
Source.2311: DFBPPR22732 ---- Animal proteins ---- Uncharacterized protein C3orf22 homolog
Source.2312: DFBPPR22742 ---- Animal proteins ---- Uncharacterized protein C12orf71 homolog
Source.2313: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog
Source.2314: DFBPPR8531 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.2315: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.2316: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.2317: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.2318: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.2319: DFBPPR8545 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.2320: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6
Source.2321: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.2322: DFBPPR8568 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.2323: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.2324: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.2325: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.2326: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1
Source.2327: DFBPPR8586 ---- Animal proteins ---- Aurora kinase B
Source.2328: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha
Source.2329: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.2330: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.2331: DFBPPR8628 ---- Animal proteins ---- Inhibin beta A chain
Source.2332: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.2333: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.2334: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.2335: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2
Source.2336: DFBPPR8670 ---- Animal proteins ---- Aurora kinase A
Source.2337: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.2338: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1
Source.2339: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.2340: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.2341: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.2342: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.2343: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.2344: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.2345: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.2346: DFBPPR8704 ---- Animal proteins ---- Myc proto-oncogene protein
Source.2347: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53
Source.2348: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.2349: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.2350: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.2351: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.2352: DFBPPR8720 ---- Animal proteins ---- Interleukin-4
Source.2353: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.2354: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.2355: DFBPPR8731 ---- Animal proteins ---- Natriuretic peptides A
Source.2356: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.2357: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.2358: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.2359: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.2360: DFBPPR8766 ---- Animal proteins ---- Myoblast determination protein 1
Source.2361: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.2362: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.2363: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.2364: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.2365: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.2366: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase
Source.2367: DFBPPR8816 ---- Animal proteins ---- 40S ribosomal protein SA
Source.2368: DFBPPR8849 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.2369: DFBPPR8850 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.2370: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.2371: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.2372: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.2373: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.2374: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain
Source.2375: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain
Source.2376: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.2377: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2378: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.2379: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2
Source.2380: DFBPPR9034 ---- Animal proteins ---- Carbohydrate-binding protein AWN
Source.2381: DFBPPR9044 ---- Animal proteins ---- Albumin
Source.2382: DFBPPR9070 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.2383: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.2384: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.2385: DFBPPR9076 ---- Animal proteins ---- Histone H1t
Source.2386: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.2387: DFBPPR9100 ---- Animal proteins ---- Ras-related protein Rab-32
Source.2388: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.2389: DFBPPR9109 ---- Animal proteins ---- Natriuretic peptides B
Source.2390: DFBPPR9117 ---- Animal proteins ---- Cell cycle exit and neuronal differentiation protein 1
Source.2391: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.2392: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.2393: DFBPPR9157 ---- Animal proteins ---- POU domain, class 2, transcription factor 2
Source.2394: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.2395: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.2396: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein
Source.2397: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.2398: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10
Source.2399: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.2400: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3
Source.2401: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.2402: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.2403: DFBPPR9280 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.2404: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.2405: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2
Source.2406: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.2407: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.2408: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.2409: DFBPPR9320 ---- Animal proteins ---- Aromatase 1
Source.2410: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.2411: DFBPPR9325 ---- Animal proteins ---- Ephrin-A1
Source.2412: DFBPPR9338 ---- Animal proteins ---- SPARC
Source.2413: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1
Source.2414: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.2415: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.2416: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.2417: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein
Source.2418: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.2419: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.2420: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase
Source.2421: DFBPPR9381 ---- Animal proteins ---- Alpha-crystallin B chain
Source.2422: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D
Source.2423: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase
Source.2424: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.2425: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.2426: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.2427: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.2428: DFBPPR9427 ---- Animal proteins ---- Protein quaking
Source.2429: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59
Source.2430: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59
Source.2431: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.2432: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.2433: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.2434: DFBPPR9447 ---- Animal proteins ---- Myosin light chain 4
Source.2435: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.2436: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14
Source.2437: DFBPPR9505 ---- Animal proteins ---- Cytochrome c oxidase subunit 7C, mitochondrial
Source.2438: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.2439: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.2440: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1
Source.2441: DFBPPR9559 ---- Animal proteins ---- CD302 antigen
Source.2442: DFBPPR9573 ---- Animal proteins ---- 40S ribosomal protein S26
Source.2443: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.2444: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.2445: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.2446: DFBPPR9589 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A
Source.2447: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.2448: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.2449: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2
Source.2450: DFBPPR9606 ---- Animal proteins ---- Pancreatic prohormone precursor
Source.2451: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.2452: DFBPPR9617 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.2453: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.2454: DFBPPR9639 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase
Source.2455: DFBPPR9643 ---- Animal proteins ---- Apolipoprotein M
Source.2456: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial
Source.2457: DFBPPR9661 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial
Source.2458: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.2459: DFBPPR9667 ---- Animal proteins ---- Brain and acute leukemia cytoplasmic protein
Source.2460: DFBPPR9683 ---- Animal proteins ---- Calpastatin
Source.2461: DFBPPR9693 ---- Animal proteins ---- LIM and cysteine-rich domains protein 1
Source.2462: DFBPPR9736 ---- Animal proteins ---- Metaxin-1
Source.2463: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2
Source.2464: DFBPPR9744 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 14B
Source.2465: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.2466: DFBPPR9754 ---- Animal proteins ---- Ig lambda chain C region
Source.2467: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform
Source.2468: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1
Source.2469: DFBPPR9794 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3
Source.2470: DFBPPR9812 ---- Animal proteins ---- 60S ribosomal protein L29
Source.2471: DFBPPR9817 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 3
Source.2472: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.2473: DFBPPR9842 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1
Source.2474: DFBPPR9856 ---- Animal proteins ---- 60S acidic ribosomal protein P1
Source.2475: DFBPPR9860 ---- Animal proteins ---- Transcription factor 19
Source.2476: DFBPPR9867 ---- Animal proteins ---- Phostensin
Source.2477: DFBPPR9871 ---- Animal proteins ---- DNA-binding protein inhibitor ID-4
Source.2478: DFBPPR9877 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.2479: DFBPPR9890 ---- Animal proteins ---- 60S acidic ribosomal protein P2
Source.2480: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.2481: DFBPPR9904 ---- Animal proteins ---- EKC/KEOPS complex subunit GON7
Source.2482: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.2483: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.2484: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin
Source.2485: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.2486: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.2487: DFBPPR9980 ---- Animal proteins ---- Cathelicidin-1
Source.2488: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.2489: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.2490: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.2491: DFBPPR9999 ---- Animal proteins ---- Apoptosis regulator Bcl-2
Source.2492: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain
Source.2493: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.2494: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b
Source.2495: DFBPPR10009 ---- Animal proteins ---- Transthyretin
Source.2496: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src
Source.2497: DFBPPR10019 ---- Animal proteins ---- Extracellular fatty acid-binding protein
Source.2498: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.2499: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.2500: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.2501: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta
Source.2502: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.2503: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase
Source.2504: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.2505: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.2506: DFBPPR10093 ---- Animal proteins ---- Beta-nerve growth factor
Source.2507: DFBPPR10101 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.2508: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.2509: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.2510: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.2511: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.2512: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.2513: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3
Source.2514: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.2515: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.2516: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.2517: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1
Source.2518: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5
Source.2519: DFBPPR10142 ---- Animal proteins ---- Calpain-3
Source.2520: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.2521: DFBPPR10157 ---- Animal proteins ---- CD40 ligand
Source.2522: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.2523: DFBPPR10170 ---- Animal proteins ---- Drebrin
Source.2524: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.2525: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2
Source.2526: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.2527: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1
Source.2528: DFBPPR10187 ---- Animal proteins ---- Myogenin
Source.2529: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3
Source.2530: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.2531: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.2532: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.2533: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.2534: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1
Source.2535: DFBPPR10218 ---- Animal proteins ---- Occludin
Source.2536: DFBPPR10220 ---- Animal proteins ---- Paxillin
Source.2537: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein
Source.2538: DFBPPR10240 ---- Animal proteins ---- Cerberus
Source.2539: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.2540: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.2541: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.2542: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.2543: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.2544: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.2545: DFBPPR10274 ---- Animal proteins ---- CCN family member 1
Source.2546: DFBPPR10288 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.2547: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.2548: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.2549: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2
Source.2550: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.2551: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1
Source.2552: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.2553: DFBPPR10311 ---- Animal proteins ---- Homeobox protein engrailed-2
Source.2554: DFBPPR10341 ---- Animal proteins ---- Brain acid soluble protein 1 homolog
Source.2555: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.2556: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.2557: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.2558: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.2559: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.2560: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2
Source.2561: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.2562: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24
Source.2563: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.2564: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.2565: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.2566: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.2567: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf
Source.2568: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.2569: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.2570: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.2571: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.2572: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin
Source.2573: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.2574: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.2575: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.2576: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.2577: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.2578: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.2579: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.2580: DFBPPR10467 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.2581: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1
Source.2582: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.2583: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.2584: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.2585: DFBPPR10481 ---- Animal proteins ---- Syndecan-3
Source.2586: DFBPPR10484 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.2587: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.2588: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.2589: DFBPPR10495 ---- Animal proteins ---- Y-box-binding protein 1
Source.2590: DFBPPR10496 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.2591: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.2592: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.2593: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.2594: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase
Source.2595: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.2596: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.2597: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor
Source.2598: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2
Source.2599: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.2600: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.2601: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.2602: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase
Source.2603: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.2604: DFBPPR10583 ---- Animal proteins ---- Gallinacin-9
Source.2605: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.2606: DFBPPR10594 ---- Animal proteins ---- Aromatase
Source.2607: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit
Source.2608: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.2609: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.2610: DFBPPR10605 ---- Animal proteins ---- Elastin
Source.2611: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.2612: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.2613: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX
Source.2614: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.2615: DFBPPR10620 ---- Animal proteins ---- Centromere protein T
Source.2616: DFBPPR10624 ---- Animal proteins ---- 40S ribosomal protein SA
Source.2617: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.2618: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.2619: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53
Source.2620: DFBPPR10640 ---- Animal proteins ---- Caveolin-1
Source.2621: DFBPPR10646 ---- Animal proteins ---- Netrin-1
Source.2622: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1
Source.2623: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.2624: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.2625: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.2626: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.2627: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.2628: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.2629: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.2630: DFBPPR10688 ---- Animal proteins ---- Protein S100-A6
Source.2631: DFBPPR10691 ---- Animal proteins ---- Beclin-1
Source.2632: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.2633: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.2634: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.2635: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2
Source.2636: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.2637: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.2638: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.2639: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.2640: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.2641: DFBPPR10718 ---- Animal proteins ---- Myosin light chain 1, skeletal muscle isoform
Source.2642: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.2643: DFBPPR10724 ---- Animal proteins ---- Insulin-induced gene 1 protein
Source.2644: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.2645: DFBPPR10738 ---- Animal proteins ---- Histone H1.10
Source.2646: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.2647: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein
Source.2648: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase
Source.2649: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.2650: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.2651: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.2652: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.2653: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain
Source.2654: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe
Source.2655: DFBPPR10790 ---- Animal proteins ---- Histone H1
Source.2656: DFBPPR10794 ---- Animal proteins ---- Zyxin
Source.2657: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.2658: DFBPPR10806 ---- Animal proteins ---- Cathelicidin-3
Source.2659: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.2660: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha
Source.2661: DFBPPR10840 ---- Animal proteins ---- C-C motif chemokine 4 homolog
Source.2662: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.2663: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.2664: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.2665: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.2666: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.2667: DFBPPR10877 ---- Animal proteins ---- Histone H1.01
Source.2668: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.2669: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.2670: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.2671: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.2672: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.2673: DFBPPR10932 ---- Animal proteins ---- Histone H1.11L
Source.2674: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2
Source.2675: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.2676: DFBPPR10960 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate
Source.2677: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2
Source.2678: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1
Source.2679: DFBPPR10979 ---- Animal proteins ---- Myc proto-oncogene protein
Source.2680: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.2681: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.2682: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1
Source.2683: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.2684: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.2685: DFBPPR11012 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.2686: DFBPPR11018 ---- Animal proteins ---- Transcriptional coactivator YAP1
Source.2687: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor
Source.2688: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.2689: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.2690: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.2691: DFBPPR11048 ---- Animal proteins ---- Calcitonin
Source.2692: DFBPPR11057 ---- Animal proteins ---- Calcitonin gene-related peptide
Source.2693: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2
Source.2694: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.2695: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.2696: DFBPPR11094 ---- Animal proteins ---- Transcription factor MafA
Source.2697: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.2698: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A
Source.2699: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1
Source.2700: DFBPPR11113 ---- Animal proteins ---- POU domain, class 4, transcription factor 1
Source.2701: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.2702: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D
Source.2703: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1
Source.2704: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.2705: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.2706: DFBPPR11151 ---- Animal proteins ---- SPARC
Source.2707: DFBPPR11155 ---- Animal proteins ---- Stathmin
Source.2708: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.2709: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.2710: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta
Source.2711: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2
Source.2712: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2
Source.2713: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1
Source.2714: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.2715: DFBPPR11194 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.2716: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.2717: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1
Source.2718: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.2719: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1
Source.2720: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38
Source.2721: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.2722: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.2723: DFBPPR11256 ---- Animal proteins ---- Neuroblastoma suppressor of tumorigenicity 1
Source.2724: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1
Source.2725: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.2726: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4
Source.2727: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3
Source.2728: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.2729: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.2730: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.2731: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.2732: DFBPPR11301 ---- Animal proteins ---- cAMP-regulated phosphoprotein 19
Source.2733: DFBPPR11302 ---- Animal proteins ---- Histone H1.11R
Source.2734: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.2735: DFBPPR11308 ---- Animal proteins ---- Histone H1.03
Source.2736: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.2737: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog
Source.2738: DFBPPR11314 ---- Animal proteins ---- Multivesicular body subunit 12A
Source.2739: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4
Source.2740: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.2741: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.2742: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.2743: DFBPPR11350 ---- Animal proteins ---- Homeobox protein Hox-D13
Source.2744: DFBPPR11354 ---- Animal proteins ---- Centromere protein O
Source.2745: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.2746: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX
Source.2747: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A
Source.2748: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1
Source.2749: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.2750: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5
Source.2751: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.2752: DFBPPR11466 ---- Animal proteins ---- GDNF family receptor alpha-2
Source.2753: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.2754: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5
Source.2755: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3
Source.2756: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1
Source.2757: DFBPPR11520 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2
Source.2758: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.2759: DFBPPR11529 ---- Animal proteins ---- Alpha-endosulfine
Source.2760: DFBPPR11531 ---- Animal proteins ---- Protein AATF
Source.2761: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.2762: DFBPPR11538 ---- Animal proteins ---- Non-histone chromosomal protein HMG-17
Source.2763: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.2764: DFBPPR11546 ---- Animal proteins ---- Transcriptional adapter 2-alpha
Source.2765: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.2766: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog
Source.2767: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.2768: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic
Source.2769: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein
Source.2770: DFBPPR11569 ---- Animal proteins ---- Homeobox protein Hox-D8
Source.2771: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.2772: DFBPPR11581 ---- Animal proteins ---- PRKR-interacting protein 1 homolog
Source.2773: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.2774: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.2775: DFBPPR11605 ---- Animal proteins ---- DNA repair protein complementing XP-A cells homolog
Source.2776: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2777: DFBPPR11615 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.2778: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.2779: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2
Source.2780: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3
Source.2781: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.2782: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.2783: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.2784: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4
Source.2785: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.2786: DFBPPR11657 ---- Animal proteins ---- Protein BTG1
Source.2787: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.2788: DFBPPR11664 ---- Animal proteins ---- Swi5-dependent recombination DNA repair protein 1 homolog
Source.2789: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.2790: DFBPPR11670 ---- Animal proteins ---- Snurportin-1
Source.2791: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1
Source.2792: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.2793: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.2794: DFBPPR11683 ---- Animal proteins ---- Somatostatin
Source.2795: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H
Source.2796: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog
Source.2797: DFBPPR11700 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.2798: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.2799: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.2800: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.2801: DFBPPR11712 ---- Animal proteins ---- 60S acidic ribosomal protein P1
Source.2802: DFBPPR11724 ---- Animal proteins ---- Protein TENP
Source.2803: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi
Source.2804: DFBPPR11733 ---- Animal proteins ---- Non-histone chromosomal protein HMG-14A
Source.2805: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.2806: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.2807: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein
Source.2808: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3
Source.2809: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38
Source.2810: DFBPPR11763 ---- Animal proteins ---- Activated RNA polymerase II transcriptional coactivator p15
Source.2811: DFBPPR11769 ---- Animal proteins ---- Cytokine-inducible SH2-containing protein
Source.2812: DFBPPR11774 ---- Animal proteins ---- Musculoskeletal embryonic nuclear protein 1
Source.2813: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.2814: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2
Source.2815: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5
Source.2816: DFBPPR11801 ---- Animal proteins ---- Homeobox protein SAX-1
Source.2817: DFBPPR11805 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.2818: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.2819: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.2820: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.2821: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.2822: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.2823: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.2824: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7
Source.2825: DFBPPR11834 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.2826: DFBPPR11836 ---- Animal proteins ---- Gallinacin-14
Source.2827: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17
Source.2828: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.2829: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3
Source.2830: DFBPPR11871 ---- Animal proteins ---- RAD51-associated protein 1
Source.2831: DFBPPR11873 ---- Animal proteins ---- Ligand-dependent nuclear receptor corepressor-like protein
Source.2832: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2
Source.2833: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9
Source.2834: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.2835: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13
Source.2836: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3
Source.2837: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19
Source.2838: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.2839: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.2840: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2
Source.2841: DFBPPR11938 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.2842: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3
Source.2843: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.2844: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.2845: DFBPPR11958 ---- Animal proteins ---- Homeobox protein engrailed-1
Source.2846: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.2847: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.2848: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130
Source.2849: DFBPPR11982 ---- Animal proteins ---- Transcription termination factor 3, mitochondrial
Source.2850: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4
Source.2851: DFBPPR11987 ---- Animal proteins ---- NEDD4-binding protein 3 homolog
Source.2852: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.2853: DFBPPR12017 ---- Animal proteins ---- Zinc finger protein CKR1
Source.2854: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.2855: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2
Source.2856: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.2857: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.2858: DFBPPR12068 ---- Animal proteins ---- Serine/arginine repetitive matrix protein 1
Source.2859: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.2860: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.2861: DFBPPR12073 ---- Animal proteins ---- 40S ribosomal protein S4
Source.2862: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9
Source.2863: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.2864: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129
Source.2865: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2
Source.2866: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.2867: DFBPPR12103 ---- Animal proteins ---- FUN14 domain-containing protein 1
Source.2868: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.2869: DFBPPR12110 ---- Animal proteins ---- Myosin light chain, embryonic
Source.2870: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.2871: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.2872: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.2873: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.2874: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.2875: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A
Source.2876: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45
Source.2877: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog
Source.2878: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.2879: DFBPPR12193 ---- Animal proteins ---- Protein FAM122A
Source.2880: DFBPPR12201 ---- Animal proteins ---- Protein lin-52 homolog
Source.2881: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.2882: DFBPPR12206 ---- Animal proteins ---- CDAN1-interacting nuclease 1
Source.2883: DFBPPR12222 ---- Animal proteins ---- Coiled-coil domain-containing protein 43
Source.2884: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like
Source.2885: DFBPPR12242 ---- Animal proteins ---- Protein LSM12 homolog
Source.2886: DFBPPR12245 ---- Animal proteins ---- Overexpressed in colon carcinoma 1 protein homolog
Source.2887: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2
Source.2888: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.2889: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.2890: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.2891: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5
Source.2892: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1
Source.2893: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.2894: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.2895: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.2896: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.2897: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.2898: DFBPPR12304 ---- Animal proteins ---- Cellular tumor antigen p53
Source.2899: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.2900: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor
Source.2901: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.2902: DFBPPR12330 ---- Animal proteins ---- Alpha-crystallin B chain
Source.2903: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E
Source.2904: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.2905: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.2906: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.2907: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.2908: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.2909: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2
Source.2910: DFBPPR12371 ---- Animal proteins ---- Y-box-binding protein 1
Source.2911: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.2912: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2913: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1
Source.2914: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma
Source.2915: DFBPPR12386 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.2916: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1
Source.2917: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.2918: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.2919: DFBPPR12401 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.2920: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.2921: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1
Source.2922: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.2923: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase
Source.2924: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.2925: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.2926: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.2927: DFBPPR12441 ---- Animal proteins ---- Triadin
Source.2928: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.2929: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.2930: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.2931: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.2932: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.2933: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase
Source.2934: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.2935: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.2936: DFBPPR12499 ---- Animal proteins ---- Interleukin-1 alpha
Source.2937: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3
Source.2938: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.2939: DFBPPR12537 ---- Animal proteins ---- 14 kDa phosphohistidine phosphatase
Source.2940: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.2941: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2
Source.2942: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.2943: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.2944: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.2945: DFBPPR12594 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.2946: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan
Source.2947: DFBPPR12607 ---- Animal proteins ---- Basigin
Source.2948: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.2949: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.2950: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.2951: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.2952: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12
Source.2953: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.2954: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2955: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.2956: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.2957: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.2958: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.2959: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1
Source.2960: DFBPPR12738 ---- Animal proteins ---- Histone H1.4
Source.2961: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14
Source.2962: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.2963: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.2964: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.2965: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.2966: DFBPPR12762 ---- Animal proteins ---- SPARC
Source.2967: DFBPPR12772 ---- Animal proteins ---- Colipase
Source.2968: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.2969: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.2970: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.2971: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.2972: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.2973: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.2974: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.2975: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.2976: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.2977: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2
Source.2978: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.2979: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.2980: DFBPPR12856 ---- Animal proteins ---- Leupaxin
Source.2981: DFBPPR12869 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.2982: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.2983: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.2984: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.2985: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.2986: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.2987: DFBPPR12935 ---- Animal proteins ---- Histone H1.3
Source.2988: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.2989: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.2990: DFBPPR12959 ---- Animal proteins ---- Keratin, type I cytoskeletal 12
Source.2991: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3
Source.2992: DFBPPR12962 ---- Animal proteins ---- Coronin-1B
Source.2993: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.2994: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.2995: DFBPPR12988 ---- Animal proteins ---- Calpastatin
Source.2996: DFBPPR13024 ---- Animal proteins ---- Erythropoietin
Source.2997: DFBPPR13031 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial
Source.2998: DFBPPR13047 ---- Animal proteins ---- Elongation factor 1-delta
Source.2999: DFBPPR13051 ---- Animal proteins ---- Permeability factor 2
Source.3000: DFBPPR13060 ---- Animal proteins ---- Growth-regulated protein homolog
Source.3001: DFBPPR13083 ---- Animal proteins ---- Promotilin
Source.3002: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.3003: DFBPPR13094 ---- Animal proteins ---- Atherin
Source.3004: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2
Source.3005: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.3006: DFBPPR13148 ---- Animal proteins ---- Cellular tumor antigen p53
Source.3007: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.3008: DFBPPR13157 ---- Animal proteins ---- Inhibin beta A chain
Source.3009: DFBPPR13167 ---- Animal proteins ---- Natriuretic peptides A
Source.3010: DFBPPR13176 ---- Animal proteins ---- Aromatase
Source.3011: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.3012: DFBPPR13207 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.3013: DFBPPR13218 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.3014: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.3015: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.3016: DFBPPR13250 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3, truncated
Source.3017: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.3018: DFBPPR13276 ---- Animal proteins ---- Protein quaking
Source.3019: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.3020: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.3021: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1
Source.3022: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.3023: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.3024: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.3025: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.3026: DFBPPR13337 ---- Animal proteins ---- Calcitonin gene-related peptide 1
Source.3027: DFBPPR13338 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.3028: DFBPPR13348 ---- Animal proteins ---- Calcitonin
Source.3029: DFBPPR13358 ---- Animal proteins ---- Erythropoietin
Source.3030: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.3031: DFBPPR13405 ---- Animal proteins ---- 60S acidic ribosomal protein P2
Source.3032: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.3033: DFBPPR13434 ---- Animal proteins ---- Aromatase
Source.3034: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2
Source.3035: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.3036: DFBPPR13442 ---- Animal proteins ---- Microtubule-associated protein tau
Source.3037: DFBPPR13458 ---- Animal proteins ---- Interleukin-4
Source.3038: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.3039: DFBPPR13475 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.3040: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.3041: DFBPPR13503 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.3042: DFBPPR13513 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.3043: DFBPPR13521 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.3044: DFBPPR13522 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2
Source.3045: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.3046: DFBPPR13541 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.3047: DFBPPR13543 ---- Animal proteins ---- Myoblast determination protein 1
Source.3048: DFBPPR13552 ---- Animal proteins ---- Inhibin beta A chain
Source.3049: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36
Source.3050: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein
Source.3051: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.3052: DFBPPR13600 ---- Animal proteins ---- Glucocorticoid receptor
Source.3053: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.3054: DFBPPR13614 ---- Animal proteins ---- Insulin-like growth factor II
Source.3055: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.3056: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.3057: DFBPPR13627 ---- Animal proteins ---- Erythropoietin
Source.3058: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.3059: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2
Source.3060: DFBPPR13654 ---- Animal proteins ---- Corticoliberin
Source.3061: DFBPPR13660 ---- Animal proteins ---- 40S ribosomal protein SA
Source.3062: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2
Source.3063: DFBPPR13670 ---- Animal proteins ---- Vasopressin-neurophysin 2-copeptin
Source.3064: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.3065: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.3066: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.3067: DFBPPR13727 ---- Animal proteins ---- Prolactin-releasing peptide
Source.3068: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.3069: DFBPPR13738 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.3070: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.3071: DFBPPR13755 ---- Animal proteins ---- Aromatase
Source.3072: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.3073: DFBPPR13776 ---- Animal proteins ---- Keratin, type II microfibrillar, component 7C
Source.3074: DFBPPR13777 ---- Animal proteins ---- Centromere protein C
Source.3075: DFBPPR13779 ---- Animal proteins ---- Syntaxin-1B
Source.3076: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.3077: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.3078: DFBPPR13787 ---- Animal proteins ---- Alpha-crystallin B chain
Source.3079: DFBPPR13789 ---- Animal proteins ---- Tryptase-2
Source.3080: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1
Source.3081: DFBPPR13800 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.3082: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A
Source.3083: DFBPPR13839 ---- Animal proteins ---- Interleukin-4
Source.3084: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.3085: DFBPPR13847 ---- Animal proteins ---- Growth-regulated alpha protein
Source.3086: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor
Source.3087: DFBPPR13853 ---- Animal proteins ---- Keratin, type II microfibrillar, component 5
Source.3088: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa
Source.3089: DFBPPR13861 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.3090: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.3091: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1
Source.3092: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.3093: DFBPPR13899 ---- Animal proteins ---- Natriuretic peptides B
Source.3094: DFBPPR13900 ---- Animal proteins ---- Keratin, type I cytoskeletal 15
Source.3095: DFBPPR13915 ---- Animal proteins ---- Gastrin-releasing peptide
Source.3096: DFBPPR13917 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.3097: DFBPPR13923 ---- Animal proteins ---- CCAAT/enhancer-binding protein epsilon
Source.3098: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.3099: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.3100: DFBPPR13951 ---- Animal proteins ---- 40S ribosomal protein S26
Source.3101: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.3102: DFBPPR13956 ---- Animal proteins ---- Proteolipid protein 2
Source.3103: DFBPPR13957 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.3104: DFBPPR13959 ---- Animal proteins ---- Calpastatin
Source.3105: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.3106: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.3107: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3108: DFBPPR14063 ---- Animal proteins ---- Homeobox protein Hox-B1
Source.3109: DFBPPR14064 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.3110: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.3111: DFBPPR14078 ---- Marine protein ---- Histone H1
Source.3112: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.3113: DFBPPR14090 ---- Marine protein ---- Trypsin-3
Source.3114: DFBPPR14091 ---- Marine protein ---- 40S ribosomal protein SA
Source.3115: DFBPPR14107 ---- Marine protein ---- E3 ubiquitin-protein ligase rnf146
Source.3116: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin
Source.3117: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.3118: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I
Source.3119: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein
Source.3120: DFBPPR14186 ---- Marine protein ---- 60S ribosomal protein L18
Source.3121: DFBPPR14189 ---- Marine protein ---- Protein Flattop
Source.3122: DFBPPR14205 ---- Marine protein ---- Intraflagellar transport protein 43 homolog A
Source.3123: DFBPPR14206 ---- Marine protein ---- Intraflagellar transport protein 43 homolog B
Source.3124: DFBPPR14220 ---- Marine protein ---- Coiled-coil domain-containing protein 58
Source.3125: DFBPPR14235 ---- Marine protein ---- Calcitonin-1
Source.3126: DFBPPR14250 ---- Marine protein ---- Vasotocin-neurophysin VT 2
Source.3127: DFBPPR14251 ---- Marine protein ---- Isotocin-neurophysin IT 1
Source.3128: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.3129: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1
Source.3130: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3131: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein
Source.3132: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.3133: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic
Source.3134: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.3135: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic
Source.3136: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.3137: DFBPPR14556 ---- Marine protein ---- Interleukin-1 beta
Source.3138: DFBPPR14559 ---- Marine protein ---- Histone H1
Source.3139: DFBPPR14566 ---- Marine protein ---- Non-histone chromosomal protein H6
Source.3140: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.3141: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.3142: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1
Source.3143: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.3144: DFBPPR14666 ---- Marine protein ---- High mobility group-T protein
Source.3145: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A
Source.3146: DFBPPR14671 ---- Marine protein ---- Toll-interacting protein B
Source.3147: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13
Source.3148: DFBPPR14800 ---- Marine protein ---- Crustacyanin-A1 subunit
Source.3149: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit
Source.3150: DFBPPR14804 ---- Marine protein ---- Crustacyanin-C1 subunit
Source.3151: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1
Source.3152: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.3153: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.3154: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.3155: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.3156: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.3157: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP
Source.3158: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.3159: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.3160: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.3161: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2
Source.3162: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.3163: DFBPPR14964 ---- Microorganism protein ---- Arginine biosynthesis bifunctional protein ArgJ, mitochondrial
Source.3164: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.3165: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.3166: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.3167: DFBPPR15001 ---- Microorganism protein ---- ARS-binding factor 1
Source.3168: DFBPPR15004 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 6
Source.3169: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein
Source.3170: DFBPPR15058 ---- Microorganism protein ---- DNA repair and recombination protein RAD52
Source.3171: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1
Source.3172: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.3173: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.3174: DFBPPR15107 ---- Microorganism protein ---- Calcineurin subunit B
Source.3175: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.3176: DFBPPR15125 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit G
Source.3177: DFBPPR15159 ---- Microorganism protein ---- Centromere-binding protein 1
Source.3178: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.3179: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84
Source.3180: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8
Source.3181: DFBPPR15240 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-B
Source.3182: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial
Source.3183: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.3184: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.3185: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4
Source.3186: DFBPPR15285 ---- Microorganism protein ---- Superoxide dismutase 1 copper chaperone
Source.3187: DFBPPR15291 ---- Microorganism protein ---- mRNA-capping enzyme subunit beta
Source.3188: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.3189: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter
Source.3190: DFBPPR15299 ---- Microorganism protein ---- Histone chaperone RTT106
Source.3191: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1
Source.3192: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.3193: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1
Source.3194: DFBPPR15366 ---- Microorganism protein ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1
Source.3195: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.3196: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.3197: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2
Source.3198: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.3199: DFBPPR15413 ---- Microorganism protein ---- U1 small nuclear ribonucleoprotein component SNU71
Source.3200: DFBPPR15435 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit GAR1
Source.3201: DFBPPR15486 ---- Microorganism protein ---- Transcription factor IWS1
Source.3202: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.3203: DFBPPR15532 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit beta
Source.3204: DFBPPR15533 ---- Microorganism protein ---- Non-histone chromosomal protein 6
Source.3205: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23
Source.3206: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.3207: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.3208: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.3209: DFBPPR15607 ---- Microorganism protein ---- Histone H2A.Z-specific chaperone CHZ1
Source.3210: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1
Source.3211: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7
Source.3212: DFBPPR15646 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 36, mitochondrial
Source.3213: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.3214: DFBPPR15671 ---- Microorganism protein ---- Outer spore wall protein 5
Source.3215: DFBPPR15677 ---- Microorganism protein ---- Ribosome-recycling factor, mitochondrial
Source.3216: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.3217: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.3218: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23
Source.3219: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial
Source.3220: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21
Source.3221: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1
Source.3222: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1
Source.3223: DFBPPR15798 ---- Microorganism protein ---- HPr kinase/phosphorylase
Source.3224: DFBPPR15807 ---- Microorganism protein ---- PTS system sorbose-specific EIIB component
Source.3225: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase
Source.3226: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.3227: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2
Source.3228: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3
Source.3229: DFBPPR15860 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.3230: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1
Source.3231: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.3232: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.3233: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.3234: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.3235: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.3236: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.3237: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.3238: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3239: DFBPPR7773 ---- Plant protein ---- Lipoyl synthase, chloroplastic
Source.3240: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.3241: DFBPPR7778 ---- Plant protein ---- ATP synthase delta chain, chloroplastic
Source.3242: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.3243: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.3244: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.3245: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.3246: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.3247: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.3248: DFBPPR7826 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-2
Source.3249: DFBPPR7827 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-1
Source.3250: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.3251: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2
Source.3252: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.3253: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a
Source.3254: DFBPPR7871 ---- Plant protein ---- Casparian strip membrane protein 3
Source.3255: DFBPPR7874 ---- Plant protein ---- CASP-like protein 1D1
Source.3256: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1
Source.3257: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1
Source.3258: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1
Source.3259: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.3260: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.3261: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.3262: DFBPPR7970 ---- Plant protein ---- Subtilisin inhibitor
Source.3263: DFBPPR7984 ---- Plant protein ---- 14-3-3-like protein A
Source.3264: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3265: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1
Source.3266: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.3267: DFBPPR8042 ---- Plant protein ---- Pyridoxal 5'-phosphate synthase subunit PDX1
Source.3268: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3269: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.3270: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.3271: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.3272: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.3273: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase
Source.3274: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.3275: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3276: DFBPPR8225 ---- Plant protein ---- Non-specific lipid-transfer protein AP10
Source.3277: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.3278: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1
Source.3279: DFBPPR8332 ---- Plant protein ---- Glutathione peroxidase 1
Source.3280: DFBPPR8338 ---- Plant protein ---- Pollen-specific protein SF3
Source.3281: DFBPPR8340 ---- Plant protein ---- 40S ribosomal protein S3a
Taste proterties & Structure
Bitterness
No prediction can be made about the peptide bitterness. prediction
SMILES N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP 3375
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214