E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0407(Multifunctional peptide)
DFBP ID DFBPMUFU0407
Peptide sequence IYP
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 2
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI0383 Human milk protein β-Casein

f(50-52)

PEP-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPPEPI0053 Human milk protein β-Casein

f(50-52)

Physical & computational properties
Three-letter amino acid Ile-Tyr-Pro
Single-letter amino acid IYP
Peptide length 3
Theoretical mass 391.46 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.92 c
GRAVY 0.5333
Hydrophilic residue ratio 66.67%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1
Source.2: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6
Source.3: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70
Source.4: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.5: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1
Source.6: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1
Source.7: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.8: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.9: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.10: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.11: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.12: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.13: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.14: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.15: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.16: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6
Source.17: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.18: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.19: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.20: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.21: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.22: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.23: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.24: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.25: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.26: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.27: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.28: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.29: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.30: DFBPPR1752 ---- Plant proteins ---- TATA-binding protein 2
Source.31: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.32: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.33: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.34: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.35: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.36: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.37: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.38: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.39: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.40: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.41: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.42: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.43: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.44: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.45: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.46: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.47: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.48: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.49: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.50: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.51: DFBPPR2302 ---- Plant proteins ---- Bowman-Birk type bran trypsin inhibitor
Source.52: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic
Source.53: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23
Source.54: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.55: DFBPPR2408 ---- Plant proteins ---- Cytochrome f
Source.56: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1
Source.57: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.58: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.59: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4
Source.60: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.61: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E
Source.62: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.63: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.64: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.65: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3
Source.66: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.67: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.68: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2
Source.69: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.70: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24
Source.71: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.72: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.73: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.74: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.75: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.76: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.77: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.78: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13
Source.79: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.80: DFBPPR3449 ---- Plant proteins ---- 13 kDa prolamin C
Source.81: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34
Source.82: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.83: DFBPPR3565 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.84: DFBPPR3584 ---- Plant proteins ---- Signal recognition particle 19 kDa protein
Source.85: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.86: DFBPPR3614 ---- Plant proteins ---- Prolamin PPROL 17D
Source.87: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.88: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.89: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.90: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.91: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.92: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.93: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.94: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.95: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A
Source.96: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.97: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.98: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.99: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.100: DFBPPR4216 ---- Plant proteins ---- Prolamin PPROL 14P
Source.101: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.102: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial
Source.103: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.104: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.105: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.106: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.107: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.108: DFBPPR4702 ---- Plant proteins ---- Uncharacterized protein ycf73
Source.109: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8
Source.110: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.111: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500
Source.112: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.113: DFBPPR4965 ---- Plant proteins ---- Glycinin G1
Source.114: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.115: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.116: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.117: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.118: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.119: DFBPPR5055 ---- Plant proteins ---- TATA-box-binding protein
Source.120: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.121: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase
Source.122: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.123: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.124: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.125: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.126: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.127: DFBPPR5325 ---- Plant proteins ---- Nodulin-C51
Source.128: DFBPPR5356 ---- Plant proteins ---- Nodulin-23
Source.129: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.130: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.131: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase
Source.132: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.133: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.134: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase
Source.135: DFBPPR5554 ---- Plant proteins ---- TATA-box-binding protein 1
Source.136: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.137: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.138: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.139: DFBPPR5629 ---- Plant proteins ---- TATA-box-binding protein 2
Source.140: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.141: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.142: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.143: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.144: DFBPPR5828 ---- Plant proteins ---- Cytochrome f
Source.145: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.146: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.147: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.148: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.149: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.150: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2
Source.151: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3
Source.152: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.153: DFBPPR6143 ---- Plant proteins ---- Uncharacterized protein ycf73
Source.154: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.155: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.156: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.157: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.158: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.159: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.160: DFBPPR6392 ---- Plant proteins ---- Cytochrome f
Source.161: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.162: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.163: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.164: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.165: DFBPPR6694 ---- Plant proteins ---- TATA-box-binding protein 1
Source.166: DFBPPR6699 ---- Plant proteins ---- TATA-box-binding protein 2
Source.167: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.168: DFBPPR6805 ---- Plant proteins ---- Cytochrome f
Source.169: DFBPPR6821 ---- Plant proteins ---- bZIP transcription factor 1-B
Source.170: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.171: DFBPPR6825 ---- Plant proteins ---- bZIP transcription factor 1-D
Source.172: DFBPPR6827 ---- Plant proteins ---- bZIP transcription factor 1-A
Source.173: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.174: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.175: DFBPPR6906 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.176: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.177: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.178: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.179: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.180: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.181: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.182: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.183: DFBPPR7194 ---- Plant proteins ---- Cytochrome f
Source.184: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.185: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.186: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.187: DFBPPR7338 ---- Plant proteins ---- 60S ribosomal protein L24
Source.188: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic
Source.189: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.190: DFBPPR7441 ---- Plant proteins ---- Defensin-like protein 4
Source.191: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.192: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.193: DFBPPR7605 ---- Milk proteins ---- Beta-casein
Source.194: DFBPPR7673 ---- Milk proteins ---- Kappa-casein
Source.195: DFBPPR7677 ---- Milk proteins ---- Alpha-S2-casein-like A
Source.196: DFBPPR7722 ---- Plant proteins ---- Peroxygenase 1
Source.197: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain
Source.198: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.199: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.200: DFBPPR8420 ---- Plant proteins ---- Peroxygenase
Source.201: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.202: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.203: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase
Source.204: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.205: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.206: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.207: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase
Source.208: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN
Source.209: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.210: DFBPPR16093 ---- Animal proteins ---- Menin
Source.211: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.212: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.213: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.214: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.215: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1
Source.216: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.217: DFBPPR16230 ---- Animal proteins ---- Survival motor neuron protein
Source.218: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.219: DFBPPR16265 ---- Animal proteins ---- Caspase-1
Source.220: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin
Source.221: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.222: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.223: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.224: DFBPPR16365 ---- Animal proteins ---- Fibroblast growth factor 5
Source.225: DFBPPR16462 ---- Animal proteins ---- Pantetheinase
Source.226: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.227: DFBPPR16481 ---- Animal proteins ---- Caspase-12
Source.228: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.229: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.230: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.231: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.232: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.233: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.234: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.235: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.236: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.237: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.238: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.239: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.240: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.241: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.242: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.243: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase
Source.244: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.245: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.246: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.247: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.248: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.249: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.250: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.251: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10
Source.252: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.253: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.254: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.255: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.256: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.257: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform
Source.258: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.259: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial
Source.260: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.261: DFBPPR17797 ---- Animal proteins ---- Caspase-13
Source.262: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.263: DFBPPR17879 ---- Animal proteins ---- Menin
Source.264: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.265: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB
Source.266: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.267: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein
Source.268: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.269: DFBPPR17925 ---- Animal proteins ---- Caspase-4
Source.270: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2
Source.271: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.272: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2
Source.273: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.274: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.275: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform
Source.276: DFBPPR18241 ---- Animal proteins ---- Seminal plasma protein BSP-30 kDa
Source.277: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.278: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.279: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.280: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.281: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain
Source.282: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase
Source.283: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.284: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.285: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.286: DFBPPR18397 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4
Source.287: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.288: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.289: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4
Source.290: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.291: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein
Source.292: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1
Source.293: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.294: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.295: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain
Source.296: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain
Source.297: DFBPPR18566 ---- Animal proteins ---- Cytochrome c oxidase subunit 5A, mitochondrial
Source.298: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1
Source.299: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4
Source.300: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.301: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.302: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.303: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.304: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.305: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.306: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav
Source.307: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.308: DFBPPR18815 ---- Animal proteins ---- Pantetheinase
Source.309: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.310: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B
Source.311: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase
Source.312: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.313: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.314: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5
Source.315: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1
Source.316: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase
Source.317: DFBPPR19098 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 9
Source.318: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.319: DFBPPR19144 ---- Animal proteins ---- C-X-C motif chemokine 11
Source.320: DFBPPR19152 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF186
Source.321: DFBPPR19172 ---- Animal proteins ---- Persulfide dioxygenase ETHE1, mitochondrial
Source.322: DFBPPR19209 ---- Animal proteins ---- mRNA export factor
Source.323: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.324: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3
Source.325: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.326: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9
Source.327: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1
Source.328: DFBPPR19404 ---- Animal proteins ---- Microfibril-associated glycoprotein 4
Source.329: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.330: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.331: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.332: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.333: DFBPPR19485 ---- Animal proteins ---- Fibroblast growth factor 5
Source.334: DFBPPR19488 ---- Animal proteins ---- Placental prolactin-related protein 3
Source.335: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.336: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.337: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.338: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.339: DFBPPR19807 ---- Animal proteins ---- Spermine synthase
Source.340: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.341: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1
Source.342: DFBPPR19880 ---- Animal proteins ---- TATA box-binding protein-like 1
Source.343: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.344: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2
Source.345: DFBPPR19960 ---- Animal proteins ---- 60S ribosomal protein L24
Source.346: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein
Source.347: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase
Source.348: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4
Source.349: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.350: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.351: DFBPPR20238 ---- Animal proteins ---- tRNA methyltransferase 10 homolog B
Source.352: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.353: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.354: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.355: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.356: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.357: DFBPPR20406 ---- Animal proteins ---- 28S ribosomal protein S11, mitochondrial
Source.358: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.359: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.360: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.361: DFBPPR20729 ---- Animal proteins ---- 60S ribosomal protein L6
Source.362: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2
Source.363: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.364: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.365: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.366: DFBPPR20903 ---- Animal proteins ---- 40S ribosomal protein S3a
Source.367: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.368: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.369: DFBPPR21009 ---- Animal proteins ---- Endoribonuclease LACTB2
Source.370: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.371: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor
Source.372: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial
Source.373: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.374: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7
Source.375: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.376: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24
Source.377: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2
Source.378: DFBPPR21576 ---- Animal proteins ---- Signal recognition particle 19 kDa protein
Source.379: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.380: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1
Source.381: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.382: DFBPPR22111 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.383: DFBPPR22216 ---- Animal proteins ---- UPF0729 protein C18orf32 homolog
Source.384: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.385: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2
Source.386: DFBPPR22615 ---- Animal proteins ---- Coiled-coil domain-containing protein 54
Source.387: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog
Source.388: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.389: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.390: DFBPPR22761 ---- Animal proteins ---- Uncharacterized protein C10orf120 homolog
Source.391: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.392: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.393: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B
Source.394: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.395: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.396: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.397: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.398: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6
Source.399: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.400: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.401: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.402: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain
Source.403: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain
Source.404: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.405: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance
Source.406: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.407: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.408: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.409: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.410: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.411: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.412: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.413: DFBPPR9061 ---- Animal proteins ---- Caspase-1
Source.414: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.415: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.416: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6
Source.417: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.418: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.419: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B
Source.420: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.421: DFBPPR9392 ---- Animal proteins ---- mRNA export factor
Source.422: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.423: DFBPPR9523 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.424: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.425: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.426: DFBPPR9636 ---- Animal proteins ---- D-aspartate oxidase
Source.427: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.428: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.429: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.430: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.431: DFBPPR9925 ---- Animal proteins ---- Corneodesmosin
Source.432: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.433: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain
Source.434: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.435: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase
Source.436: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.437: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.438: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.439: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.440: DFBPPR10221 ---- Animal proteins ---- Blood vessel epicardial substance
Source.441: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.442: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1
Source.443: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.444: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.445: DFBPPR10366 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.446: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.447: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.448: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.449: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16
Source.450: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.451: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.452: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.453: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain
Source.454: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.455: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.456: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.457: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.458: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A
Source.459: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain
Source.460: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.461: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.462: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.463: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.464: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.465: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2
Source.466: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein
Source.467: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1
Source.468: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.469: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1
Source.470: DFBPPR11139 ---- Animal proteins ---- Homeobox protein Hox-A7
Source.471: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain
Source.472: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.473: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.474: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein
Source.475: DFBPPR11327 ---- Animal proteins ---- Integrin alpha-1
Source.476: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.477: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.478: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4
Source.479: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.480: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5
Source.481: DFBPPR11478 ---- Animal proteins ---- Gastrin-releasing peptide
Source.482: DFBPPR11504 ---- Animal proteins ---- TATA box-binding protein-like 1
Source.483: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.484: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein
Source.485: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.486: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial
Source.487: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1
Source.488: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B
Source.489: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.490: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.491: DFBPPR11971 ---- Animal proteins ---- Protein YIPF4
Source.492: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.493: DFBPPR12083 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.494: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.495: DFBPPR12140 ---- Animal proteins ---- Centromere protein N
Source.496: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.497: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.498: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.499: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.500: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.501: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.502: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.503: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase
Source.504: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.505: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.506: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.507: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.508: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.509: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform
Source.510: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.511: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.512: DFBPPR13032 ---- Animal proteins ---- Alpha-S2-casein-like A
Source.513: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.514: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.515: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.516: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase
Source.517: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.518: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.519: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.520: DFBPPR13550 ---- Animal proteins ---- Corticotropin-releasing factor-binding protein
Source.521: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.522: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.523: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.524: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.525: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.526: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.527: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor
Source.528: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.529: DFBPPR13914 ---- Animal proteins ---- Homeobox protein Hox-C6
Source.530: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.531: DFBPPR14140 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.532: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog
Source.533: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.534: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a
Source.535: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.536: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.537: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.538: DFBPPR14367 ---- Marine protein ---- Cytochrome f
Source.539: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.540: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase
Source.541: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.542: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.543: DFBPPR14587 ---- Marine protein ---- Thyrotropin subunit beta
Source.544: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.545: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.546: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain
Source.547: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain
Source.548: DFBPPR14883 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.549: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific
Source.550: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial
Source.551: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.552: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.553: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase
Source.554: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase
Source.555: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2
Source.556: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.557: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase
Source.558: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog
Source.559: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.560: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.561: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1
Source.562: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3
Source.563: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase
Source.564: DFBPPR15306 ---- Microorganism protein ---- UDP-N-acetylglucosamine transferase subunit ALG14
Source.565: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1
Source.566: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10
Source.567: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10
Source.568: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.569: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.570: DFBPPR15464 ---- Microorganism protein ---- Pre-rRNA-processing protein PNO1
Source.571: DFBPPR15465 ---- Microorganism protein ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.572: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.573: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.574: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase
Source.575: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial
Source.576: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.577: DFBPPR15750 ---- Microorganism protein ---- 60S ribosomal protein L24
Source.578: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.579: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.580: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.581: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta
Source.582: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.583: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.584: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2
Source.585: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.586: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein
Source.587: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.588: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.589: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.590: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.591: DFBPPR7810 ---- Plant protein ---- Cytochrome f
Source.592: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.593: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.594: DFBPPR7949 ---- Plant protein ---- Cytochrome f
Source.595: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.596: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.597: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.598: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.599: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1
Source.600: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.601: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.602: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.603: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.604: DFBPPR8242 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.605: DFBPPR8259 ---- Plant protein ---- Cytochrome f
Source.606: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.607: DFBPPR8340 ---- Plant protein ---- 40S ribosomal protein S3a
Taste proterties & Structure
Bitterness
Bitter taste prediction
SMILES N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP 2627
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214