E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0421(Multifunctional peptide)
DFBP ID DFBPMUFU0421
Peptide sequence ALP
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 2
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI1536 Dried bonito (Katsuobusi) Muscle protein

N.D

Antioxidative peptides
DFBPID Organism Precursor protein Residue position
DFBPANOX0954 Bovine whey protein β-Lactoglobulin

N.D

Physical & computational properties
Three-letter amino acid Ala-Leu-Pro
Single-letter amino acid ALP
Peptide length 3
Theoretical mass 299.36 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
GRAVY 1.3333
Hydrophilic residue ratio 100%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin
Source.2: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1
Source.3: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2
Source.4: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25
Source.5: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.6: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5
Source.7: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.8: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1
Source.9: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.10: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.11: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.12: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53
Source.13: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.14: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.15: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.16: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.17: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.18: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.19: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.20: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.21: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3
Source.22: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.23: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.24: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.25: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.26: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic
Source.27: DFBPPR0997 ---- Plant proteins ---- Tricin synthase 1
Source.28: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.29: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.30: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform
Source.31: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.32: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3
Source.33: DFBPPR1051 ---- Plant proteins ---- MADS-box transcription factor 14
Source.34: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.35: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.36: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.37: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79
Source.38: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51
Source.39: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.40: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706
Source.41: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.42: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL
Source.43: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.44: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic
Source.45: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.46: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.47: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.48: DFBPPR1105 ---- Plant proteins ---- Solanesyl-diphosphate synthase 1, mitochondrial
Source.49: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.50: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.51: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG
Source.52: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.53: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.54: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13
Source.55: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.56: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.57: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.58: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.59: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog
Source.60: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4
Source.61: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic
Source.62: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.63: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.64: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.65: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial
Source.66: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.67: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.68: DFBPPR1259 ---- Plant proteins ---- Beta-carotene isomerase D27, chloroplastic
Source.69: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.70: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1
Source.71: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.72: DFBPPR1265 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B1, chloroplastic
Source.73: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.74: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.75: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.76: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.77: DFBPPR1302 ---- Plant proteins ---- 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase, chloroplastic
Source.78: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22
Source.79: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.80: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.81: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.82: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.83: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.84: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.85: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.86: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.87: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase
Source.88: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.89: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.90: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.91: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.92: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic
Source.93: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.94: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.95: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2
Source.96: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.97: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.98: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.99: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.100: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.101: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.102: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.103: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.104: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.105: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.106: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.107: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.108: DFBPPR1464 ---- Plant proteins ---- Remorin 4.1
Source.109: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.110: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.111: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.112: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.113: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.114: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.115: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.116: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.117: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein
Source.118: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.119: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.120: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.121: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5
Source.122: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.123: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3
Source.124: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39
Source.125: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.126: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.127: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6
Source.128: DFBPPR1557 ---- Plant proteins ---- WRKY transcription factor WRKY51
Source.129: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.130: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.131: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.132: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.133: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.134: DFBPPR1604 ---- Plant proteins ---- Putative bifunctional dihydrofolate reductase-thymidylate synthase
Source.135: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.136: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.137: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2
Source.138: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1
Source.139: DFBPPR1615 ---- Plant proteins ---- Phosphatidylinositol:ceramide inositolphosphotransferase
Source.140: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.141: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.142: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.143: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.144: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.145: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.146: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.147: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1
Source.148: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10
Source.149: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic
Source.150: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.151: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.152: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.153: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.154: DFBPPR1702 ---- Plant proteins ---- Glutelin type-A 2
Source.155: DFBPPR1704 ---- Plant proteins ---- RNA-binding protein Y14B
Source.156: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.157: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.158: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.159: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.160: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic
Source.161: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase
Source.162: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.163: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.164: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.165: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.166: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.167: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.168: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4
Source.169: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.170: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B
Source.171: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.172: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.173: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5
Source.174: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.175: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.176: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.177: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.178: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.179: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.180: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.181: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.182: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.183: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.184: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.185: DFBPPR1881 ---- Plant proteins ---- Protein TIFY 11d
Source.186: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.187: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.188: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.189: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.190: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.191: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.192: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.193: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.194: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.195: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.196: DFBPPR1952 ---- Plant proteins ---- CBL-interacting protein kinase 1
Source.197: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17
Source.198: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.199: DFBPPR1962 ---- Plant proteins ---- Expansin-A2
Source.200: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5
Source.201: DFBPPR1973 ---- Plant proteins ---- Transcription factor MYB30
Source.202: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12
Source.203: DFBPPR1975 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.204: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.205: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.206: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.207: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.208: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b
Source.209: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A
Source.210: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.211: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.212: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.213: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.214: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.215: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.216: DFBPPR2035 ---- Plant proteins ---- Glutelin type-A 1
Source.217: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.218: DFBPPR2045 ---- Plant proteins ---- Expansin-A5
Source.219: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.220: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.221: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.222: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.223: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c
Source.224: DFBPPR2081 ---- Plant proteins ---- Expansin-A1
Source.225: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.226: DFBPPR2115 ---- Plant proteins ---- E3 ubiquitin-protein ligase SIRP1
Source.227: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1
Source.228: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.229: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2
Source.230: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.231: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.232: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.233: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic
Source.234: DFBPPR2151 ---- Plant proteins ---- Glutelin type-A 3
Source.235: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.236: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.237: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.238: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.239: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.240: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.241: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.242: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.243: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.244: DFBPPR2208 ---- Plant proteins ---- CBL-interacting protein kinase 21
Source.245: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.246: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.247: DFBPPR2220 ---- Plant proteins ---- Expansin-A7
Source.248: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.249: DFBPPR2223 ---- Plant proteins ---- Urease
Source.250: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.251: DFBPPR2233 ---- Plant proteins ---- Thioredoxin Y, chloroplastic
Source.252: DFBPPR2239 ---- Plant proteins ---- Elongation factor 1-alpha
Source.253: DFBPPR2242 ---- Plant proteins ---- Expansin-A3
Source.254: DFBPPR2244 ---- Plant proteins ---- Expansin-A6
Source.255: DFBPPR2252 ---- Plant proteins ---- MADS-box transcription factor 21
Source.256: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.257: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.258: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.259: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.260: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.261: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.262: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.263: DFBPPR2292 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.264: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.265: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2
Source.266: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1
Source.267: DFBPPR2342 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic
Source.268: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.269: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.270: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.271: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.272: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.273: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.274: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23
Source.275: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33
Source.276: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1
Source.277: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.278: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.279: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic
Source.280: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.281: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.282: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain
Source.283: DFBPPR2446 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-9
Source.284: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.285: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial
Source.286: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.287: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic
Source.288: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.289: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1
Source.290: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.291: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase
Source.292: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.293: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic
Source.294: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900
Source.295: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.296: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.297: DFBPPR2547 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 3, chloroplastic
Source.298: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.299: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.300: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase
Source.301: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4
Source.302: DFBPPR2567 ---- Plant proteins ---- Origin of replication complex subunit 4
Source.303: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.304: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4
Source.305: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.306: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a
Source.307: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.308: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.309: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9
Source.310: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5
Source.311: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.312: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.313: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.314: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.315: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.316: DFBPPR2634 ---- Plant proteins ---- 16.0 kDa heat shock protein, peroxisomal
Source.317: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25
Source.318: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8
Source.319: DFBPPR2651 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL3
Source.320: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2
Source.321: DFBPPR2675 ---- Plant proteins ---- Anamorsin homolog 2
Source.322: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.323: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.324: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27
Source.325: DFBPPR2710 ---- Plant proteins ---- 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase, chloroplastic
Source.326: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic
Source.327: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5
Source.328: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.329: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8
Source.330: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.331: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9
Source.332: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.333: DFBPPR2763 ---- Plant proteins ---- Actin-1
Source.334: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.335: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.336: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.337: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.338: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.339: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.340: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.341: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a
Source.342: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.343: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.344: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.345: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.346: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.347: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.348: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.349: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.350: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10
Source.351: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.352: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.353: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.354: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.355: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.356: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.357: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.358: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.359: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2
Source.360: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.361: DFBPPR2910 ---- Plant proteins ---- Expansin-B5
Source.362: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.363: DFBPPR2914 ---- Plant proteins ---- Glutelin type-D 1
Source.364: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.365: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.366: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.367: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27
Source.368: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.369: DFBPPR2948 ---- Plant proteins ---- Expansin-A25
Source.370: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.371: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40
Source.372: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8
Source.373: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4
Source.374: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic
Source.375: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.376: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.377: DFBPPR2994 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic
Source.378: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a
Source.379: DFBPPR3011 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG4
Source.380: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.381: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.382: DFBPPR3027 ---- Plant proteins ---- Expansin-A31
Source.383: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.384: DFBPPR3034 ---- Plant proteins ---- Anamorsin homolog 1
Source.385: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1
Source.386: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.387: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.388: DFBPPR3048 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL10
Source.389: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.390: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6
Source.391: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.392: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.393: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.394: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.395: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1
Source.396: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.397: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.398: DFBPPR3087 ---- Plant proteins ---- Actin-3
Source.399: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.400: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.401: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.402: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.403: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.404: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.405: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.406: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.407: DFBPPR3142 ---- Plant proteins ---- Squamosa promoter-binding-like protein 13
Source.408: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.409: DFBPPR3166 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.410: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.411: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.412: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.413: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.414: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.415: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3
Source.416: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3
Source.417: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.418: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.419: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.420: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A
Source.421: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.422: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain
Source.423: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.424: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70
Source.425: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic
Source.426: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.427: DFBPPR3278 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 3
Source.428: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.429: DFBPPR3302 ---- Plant proteins ---- Expansin-A21
Source.430: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1
Source.431: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.432: DFBPPR3316 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 7
Source.433: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.434: DFBPPR3323 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL7
Source.435: DFBPPR3332 ---- Plant proteins ---- Vacuolar iron transporter homolog 5
Source.436: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.437: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.438: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.439: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4
Source.440: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.441: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.442: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.443: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1
Source.444: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2
Source.445: DFBPPR3393 ---- Plant proteins ---- Auxin-responsive protein IAA20
Source.446: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.447: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.448: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6
Source.449: DFBPPR3417 ---- Plant proteins ---- Protein CutA 1, chloroplastic
Source.450: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.451: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2
Source.452: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.453: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.454: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.455: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.456: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A
Source.457: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34
Source.458: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.459: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5
Source.460: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.461: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B
Source.462: DFBPPR3494 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS32
Source.463: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9
Source.464: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.465: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2
Source.466: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3
Source.467: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4
Source.468: DFBPPR3530 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL2
Source.469: DFBPPR3531 ---- Plant proteins ---- Zinc transporter 10
Source.470: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.471: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2
Source.472: DFBPPR3543 ---- Plant proteins ---- 26.7 kDa heat shock protein, chloroplastic
Source.473: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3
Source.474: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.475: DFBPPR3550 ---- Plant proteins ---- NRR repressor homolog 2
Source.476: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.477: DFBPPR3554 ---- Plant proteins ---- GTP-binding nuclear protein Ran-3
Source.478: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.479: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.480: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76
Source.481: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.482: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12
Source.483: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1
Source.484: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.485: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.486: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.487: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L
Source.488: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1
Source.489: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.490: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6
Source.491: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.492: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4
Source.493: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.494: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.495: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.496: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.497: DFBPPR3666 ---- Plant proteins ---- Glutelin type-B 5
Source.498: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3
Source.499: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.500: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.501: DFBPPR3695 ---- Plant proteins ---- Auxin-responsive protein IAA23
Source.502: DFBPPR3703 ---- Plant proteins ---- Zinc-finger homeodomain protein 1
Source.503: DFBPPR3704 ---- Plant proteins ---- Zinc-finger homeodomain protein 2
Source.504: DFBPPR3705 ---- Plant proteins ---- Protein YABBY 2
Source.505: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11
Source.506: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15
Source.507: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.508: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.509: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.510: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.511: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1
Source.512: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.513: DFBPPR3765 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 1
Source.514: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2
Source.515: DFBPPR3773 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 3
Source.516: DFBPPR3778 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 2
Source.517: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.518: DFBPPR3782 ---- Plant proteins ---- Auxin-responsive protein IAA16
Source.519: DFBPPR3794 ---- Plant proteins ---- UDP-D-apiose/UDP-D-xylose synthase
Source.520: DFBPPR3798 ---- Plant proteins ---- Actin-related protein 7
Source.521: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.522: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E
Source.523: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.524: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.525: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4
Source.526: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.527: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.528: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.529: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.530: DFBPPR3854 ---- Plant proteins ---- Glutaredoxin-C10
Source.531: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57
Source.532: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13
Source.533: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.534: DFBPPR3880 ---- Plant proteins ---- Monothiol glutaredoxin-S2
Source.535: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.536: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.537: DFBPPR3898 ---- Plant proteins ---- Squamosa promoter-binding-like protein 11
Source.538: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial
Source.539: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.540: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.541: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.542: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1
Source.543: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.544: DFBPPR3937 ---- Plant proteins ---- Zinc-finger homeodomain protein 10
Source.545: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10
Source.546: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial
Source.547: DFBPPR3960 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.548: DFBPPR3961 ---- Plant proteins ---- Zinc-finger homeodomain protein 8
Source.549: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.550: DFBPPR3964 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 1
Source.551: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.552: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.553: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.554: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25
Source.555: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2
Source.556: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.557: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.558: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.559: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic
Source.560: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.561: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4
Source.562: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1
Source.563: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.564: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.565: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.566: DFBPPR4033 ---- Plant proteins ---- Urease accessory protein G
Source.567: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.568: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.569: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.570: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F
Source.571: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1
Source.572: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog
Source.573: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.574: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.575: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.576: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B
Source.577: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.578: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.579: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.580: DFBPPR4101 ---- Plant proteins ---- Succinate dehydrogenase subunit 7, mitochondrial
Source.581: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4
Source.582: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.583: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33
Source.584: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75
Source.585: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.586: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.587: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7
Source.588: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1
Source.589: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.590: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10
Source.591: DFBPPR4161 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 1
Source.592: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.593: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.594: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.595: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.596: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3
Source.597: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.598: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.599: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.600: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1
Source.601: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.602: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.603: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.604: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.605: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.606: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.607: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H
Source.608: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.609: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2
Source.610: DFBPPR4254 ---- Plant proteins ---- Cysteine proteinase inhibitor 6
Source.611: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.612: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.613: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1
Source.614: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.615: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.616: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17
Source.617: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8
Source.618: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.619: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C
Source.620: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24
Source.621: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2
Source.622: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A
Source.623: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.624: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.625: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.626: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.627: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic
Source.628: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4
Source.629: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.630: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8
Source.631: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.632: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.633: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15
Source.634: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.635: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9
Source.636: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.637: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.638: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.639: DFBPPR4454 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.640: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.641: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.642: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15
Source.643: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.644: DFBPPR4486 ---- Plant proteins ---- CASP-like protein 4B1
Source.645: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.646: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.647: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog
Source.648: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.649: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6
Source.650: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.651: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase
Source.652: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.653: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.654: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39
Source.655: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.656: DFBPPR4624 ---- Plant proteins ---- Actin-depolymerizing factor 5
Source.657: DFBPPR4630 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 11
Source.658: DFBPPR4639 ---- Plant proteins ---- CASP-like protein 4D1
Source.659: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12
Source.660: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2
Source.661: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.662: DFBPPR4666 ---- Plant proteins ---- Protein IN2-1 homolog A
Source.663: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62
Source.664: DFBPPR4672 ---- Plant proteins ---- Ninja-family protein Os03g0419100
Source.665: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.666: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1
Source.667: DFBPPR4696 ---- Plant proteins ---- Uncharacterized protein ycf72
Source.668: DFBPPR4699 ---- Plant proteins ---- Probable GTP-binding protein OBGC2
Source.669: DFBPPR4701 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 15
Source.670: DFBPPR4730 ---- Plant proteins ---- 40S ribosomal protein S13-2
Source.671: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.672: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1
Source.673: DFBPPR4744 ---- Plant proteins ---- BURP domain-containing protein 3
Source.674: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8
Source.675: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.676: DFBPPR4758 ---- Plant proteins ---- BURP domain-containing protein 7
Source.677: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1
Source.678: DFBPPR4785 ---- Plant proteins ---- B3 domain-containing protein Os04g0386900
Source.679: DFBPPR4787 ---- Plant proteins ---- 60S ribosomal protein L7a-1
Source.680: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.681: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20
Source.682: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b
Source.683: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.684: DFBPPR4823 ---- Plant proteins ---- 60S ribosomal protein L7a-2
Source.685: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a
Source.686: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1
Source.687: DFBPPR4842 ---- Plant proteins ---- B3 domain-containing protein Os06g0194400
Source.688: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48
Source.689: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.690: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.691: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3
Source.692: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.693: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.694: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2
Source.695: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.696: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.697: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic
Source.698: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7
Source.699: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70
Source.700: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2
Source.701: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.702: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.703: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A
Source.704: DFBPPR4965 ---- Plant proteins ---- Glycinin G1
Source.705: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.706: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.707: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.708: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.709: DFBPPR4973 ---- Plant proteins ---- Glycinin G2
Source.710: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.711: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.712: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1
Source.713: DFBPPR4986 ---- Plant proteins ---- Uricase-2 isozyme 1
Source.714: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.715: DFBPPR4992 ---- Plant proteins ---- Glycinin G3
Source.716: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.717: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.718: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.719: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.720: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.721: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic
Source.722: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.723: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.724: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.725: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.726: DFBPPR5052 ---- Plant proteins ---- Uricase-2 isozyme 2
Source.727: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.728: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic
Source.729: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.730: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.731: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.732: DFBPPR5110 ---- Plant proteins ---- Stress-induced protein SAM22
Source.733: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.734: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6
Source.735: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1
Source.736: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.737: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.738: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.739: DFBPPR5180 ---- Plant proteins ---- Biotin carboxyl carrier protein of acetyl-CoA carboxylase, chloroplastic
Source.740: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2
Source.741: DFBPPR5185 ---- Plant proteins ---- Actin-1
Source.742: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.743: DFBPPR5223 ---- Plant proteins ---- Stem 28 kDa glycoprotein
Source.744: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.745: DFBPPR5243 ---- Plant proteins ---- 50S ribosomal protein L2-A, chloroplastic
Source.746: DFBPPR5250 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.747: DFBPPR5257 ---- Plant proteins ---- 50S ribosomal protein L2-B, chloroplastic
Source.748: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.749: DFBPPR5266 ---- Plant proteins ---- Cyanate hydratase
Source.750: DFBPPR5283 ---- Plant proteins ---- Actin-3
Source.751: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.752: DFBPPR5324 ---- Plant proteins ---- CASP-like protein 4D1
Source.753: DFBPPR5338 ---- Plant proteins ---- 40S ribosomal protein S13
Source.754: DFBPPR5345 ---- Plant proteins ---- CASP-like protein 2A1
Source.755: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.756: DFBPPR5391 ---- Plant proteins ---- Glutathione S-transferase 4
Source.757: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.758: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.759: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.760: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.761: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.762: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.763: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.764: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.765: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.766: DFBPPR5435 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.767: DFBPPR5441 ---- Plant proteins ---- Peroxidase 1
Source.768: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2
Source.769: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.770: DFBPPR5469 ---- Plant proteins ---- Indole-3-glycerol phosphate lyase, chloroplastic
Source.771: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.772: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.773: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.774: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.775: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.776: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.777: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.778: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase
Source.779: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.780: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.781: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.782: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.783: DFBPPR5568 ---- Plant proteins ---- Microtubule-binding protein TANGLED1
Source.784: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3
Source.785: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.786: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.787: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.788: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.789: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.790: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.791: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.792: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.793: DFBPPR5636 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.3, mitochondrial
Source.794: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.795: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.796: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5
Source.797: DFBPPR5658 ---- Plant proteins ---- Kiwellin-1
Source.798: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.799: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1
Source.800: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.801: DFBPPR5674 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.4, mitochondrial
Source.802: DFBPPR5679 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.2, mitochondrial
Source.803: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2
Source.804: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.805: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.806: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.807: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.808: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.809: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3
Source.810: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.811: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23
Source.812: DFBPPR5747 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.813: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2
Source.814: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.815: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic
Source.816: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.817: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1
Source.818: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.819: DFBPPR5775 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 2
Source.820: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.821: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.822: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic
Source.823: DFBPPR5817 ---- Plant proteins ---- Anamorsin homolog
Source.824: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic
Source.825: DFBPPR5822 ---- Plant proteins ---- Elongation factor 1-alpha
Source.826: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.827: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.828: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1
Source.829: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.830: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.831: DFBPPR5892 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic
Source.832: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.833: DFBPPR5905 ---- Plant proteins ---- Cyanate hydratase
Source.834: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.835: DFBPPR5929 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.836: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.837: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.838: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.839: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1
Source.840: DFBPPR6004 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.841: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.842: DFBPPR6022 ---- Plant proteins ---- Stress-related protein 1
Source.843: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.844: DFBPPR6065 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.845: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.846: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A
Source.847: DFBPPR6133 ---- Plant proteins ---- 40S ribosomal protein S13
Source.848: DFBPPR6138 ---- Plant proteins ---- Anther-specific protein MZm3-3
Source.849: DFBPPR6140 ---- Plant proteins ---- Uncharacterized protein ycf72
Source.850: DFBPPR6153 ---- Plant proteins ---- Ninja-family protein 8
Source.851: DFBPPR6154 ---- Plant proteins ---- Ninja-family protein 7
Source.852: DFBPPR6164 ---- Plant proteins ---- Oil body-associated protein 2B
Source.853: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2
Source.854: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.855: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.856: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1
Source.857: DFBPPR6249 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.858: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.859: DFBPPR6295 ---- Plant proteins ---- Outer envelope pore protein 37, chloroplastic
Source.860: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.861: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic
Source.862: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.863: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH
Source.864: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.865: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.866: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.867: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.868: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.869: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha
Source.870: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase
Source.871: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.872: DFBPPR6469 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.873: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.874: DFBPPR6534 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic
Source.875: DFBPPR6536 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.876: DFBPPR6545 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.877: DFBPPR6547 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.878: DFBPPR6550 ---- Plant proteins ---- Actin-3
Source.879: DFBPPR6551 ---- Plant proteins ---- Actin-2
Source.880: DFBPPR6552 ---- Plant proteins ---- Actin-1
Source.881: DFBPPR6561 ---- Plant proteins ---- Blue copper protein
Source.882: DFBPPR6585 ---- Plant proteins ---- 40S ribosomal protein S13
Source.883: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.884: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.885: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.886: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.887: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.888: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.889: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19
Source.890: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.891: DFBPPR6717 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM3
Source.892: DFBPPR6721 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.893: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53
Source.894: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic
Source.895: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.896: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.897: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.898: DFBPPR6776 ---- Plant proteins ---- Alpha-amylase inhibitor WDAI-3
Source.899: DFBPPR6793 ---- Plant proteins ---- Chymotrypsin inhibitor WCI
Source.900: DFBPPR6794 ---- Plant proteins ---- Elongation factor 1-alpha
Source.901: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.902: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.903: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.904: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.905: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.906: DFBPPR6841 ---- Plant proteins ---- Glutathione S-transferase
Source.907: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A
Source.908: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.909: DFBPPR6866 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic
Source.910: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.911: DFBPPR6880 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.912: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.913: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1
Source.914: DFBPPR6912 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.915: DFBPPR6915 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.916: DFBPPR6951 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.917: DFBPPR6953 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.918: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.919: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.920: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.921: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic
Source.922: DFBPPR7029 ---- Plant proteins ---- Trypsin inhibitor CMe
Source.923: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.924: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.925: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.926: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd
Source.927: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.928: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.929: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.930: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.931: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.932: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic
Source.933: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2
Source.934: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.935: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.936: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.937: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.938: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1
Source.939: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2
Source.940: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A
Source.941: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.942: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A
Source.943: DFBPPR7144 ---- Plant proteins ---- L-lactate dehydrogenase B
Source.944: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.945: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.946: DFBPPR7157 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.947: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.948: DFBPPR7178 ---- Plant proteins ---- Elongation factor 1-alpha
Source.949: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.950: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.951: DFBPPR7189 ---- Plant proteins ---- Trypsin inhibitor CMc
Source.952: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha
Source.953: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.954: DFBPPR7201 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.955: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain
Source.956: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.957: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.958: DFBPPR7222 ---- Plant proteins ---- Protein HVA22
Source.959: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.960: DFBPPR7250 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic
Source.961: DFBPPR7257 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.962: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33
Source.963: DFBPPR7290 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.964: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C
Source.965: DFBPPR7319 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.966: DFBPPR7323 ---- Plant proteins ---- Antifungal protein R
Source.967: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic
Source.968: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.969: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.970: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.971: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic
Source.972: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.973: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.974: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.975: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.976: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1
Source.977: DFBPPR7461 ---- Plant proteins ---- Shaggy-related protein kinase theta
Source.978: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.979: DFBPPR7524 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.980: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.981: DFBPPR7597 ---- Milk proteins ---- Alpha-lactalbumin
Source.982: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.983: DFBPPR7605 ---- Milk proteins ---- Beta-casein
Source.984: DFBPPR7610 ---- Milk proteins ---- Immunoglobulin heavy constant alpha 2
Source.985: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.986: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.987: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.988: DFBPPR7637 ---- Milk proteins ---- Perilipin-2
Source.989: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2
Source.990: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.991: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.992: DFBPPR7663 ---- Milk proteins ---- Kappa-casein
Source.993: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin
Source.994: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B
Source.995: DFBPPR7702 ---- Milk proteins ---- Alpha-lactalbumin (Lactose synthase B protein)
Source.996: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.997: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin
Source.998: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.999: DFBPPR7725 ---- Plant proteins ---- Avenin-3
Source.1000: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.1001: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.1002: DFBPPR7733 ---- Plant proteins ---- 12S seed storage globulin 2
Source.1003: DFBPPR7734 ---- Plant proteins ---- 12S seed storage globulin 1
Source.1004: DFBPPR7739 ---- Plant proteins ---- Avenin-E
Source.1005: DFBPPR7749 ---- Plant proteins ---- Avenin
Source.1006: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1007: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.1008: DFBPPR8373 ---- Plant proteins ---- Non-specific lipid-transfer protein
Source.1009: DFBPPR8382 ---- Plant proteins ---- Cationic peroxidase 1
Source.1010: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.1011: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3
Source.1012: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2
Source.1013: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1
Source.1014: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.1015: DFBPPR8438 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.1016: DFBPPR8440 ---- Plant proteins ---- Non-specific lipid-transfer protein 4
Source.1017: DFBPPR8441 ---- Plant proteins ---- Non-specific lipid-transfer protein 6
Source.1018: DFBPPR8442 ---- Plant proteins ---- Non-specific lipid-transfer protein 5
Source.1019: DFBPPR8444 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.1020: DFBPPR8471 ---- Plant proteins ---- Beta-amylase
Source.1021: DFBPPR8491 ---- Milk proteins ---- Osteopontin
Source.1022: DFBPPR8494 ---- Milk proteins ---- Alpha-S2-casein
Source.1023: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.1024: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin
Source.1025: DFBPPR8523 ---- Milk proteins ---- Perilipin-2
Source.1026: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.1027: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.1028: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.1029: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1030: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.1031: DFBPPR15960 ---- Animal proteins ---- Apolipoprotein A-IV
Source.1032: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.1033: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.1034: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.1035: DFBPPR15982 ---- Animal proteins ---- Triadin
Source.1036: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.1037: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.1038: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase
Source.1039: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.1040: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1041: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1042: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.1043: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV
Source.1044: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.1045: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.1046: DFBPPR16028 ---- Animal proteins ---- Presenilin-1
Source.1047: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.1048: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.1049: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta
Source.1050: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.1051: DFBPPR16058 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.1052: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.1053: DFBPPR16064 ---- Animal proteins ---- Calnexin
Source.1054: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.1055: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.1056: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.1057: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.1058: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.1059: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1060: DFBPPR16116 ---- Animal proteins ---- Kit ligand
Source.1061: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.1062: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.1063: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4
Source.1064: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12
Source.1065: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.1066: DFBPPR16138 ---- Animal proteins ---- Claudin-3
Source.1067: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3
Source.1068: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.1069: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6
Source.1070: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.1071: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.1072: DFBPPR16172 ---- Animal proteins ---- Translocator protein 2
Source.1073: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.1074: DFBPPR16183 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase
Source.1075: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.1076: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1077: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.1078: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.1079: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1
Source.1080: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.1081: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1082: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.1083: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.1084: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.1085: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.1086: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin
Source.1087: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1088: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor
Source.1089: DFBPPR16303 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.1090: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41
Source.1091: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel
Source.1092: DFBPPR16323 ---- Animal proteins ---- Aquaporin-2
Source.1093: DFBPPR16327 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.1094: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.1095: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1096: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.1097: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1098: DFBPPR16439 ---- Animal proteins ---- Lutropin subunit beta
Source.1099: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.1100: DFBPPR16458 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.1101: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.1102: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6
Source.1103: DFBPPR16464 ---- Animal proteins ---- Interferon alpha-1/2
Source.1104: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1105: DFBPPR16467 ---- Animal proteins ---- Opticin
Source.1106: DFBPPR16471 ---- Animal proteins ---- Interferon alpha-3
Source.1107: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4
Source.1108: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.1109: DFBPPR16478 ---- Animal proteins ---- Chymotrypsinogen 2
Source.1110: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.1111: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.1112: DFBPPR16486 ---- Animal proteins ---- Natriuretic peptides B
Source.1113: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.1114: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.1115: DFBPPR16502 ---- Animal proteins ---- Natural killer cells antigen CD94
Source.1116: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin
Source.1117: DFBPPR16513 ---- Animal proteins ---- Endothelin-1 receptor
Source.1118: DFBPPR16517 ---- Animal proteins ---- Cholinesterase
Source.1119: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.1120: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor
Source.1121: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1122: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.1123: DFBPPR16577 ---- Animal proteins ---- Insulin-like 3
Source.1124: DFBPPR16594 ---- Animal proteins ---- Macoilin
Source.1125: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype
Source.1126: DFBPPR16604 ---- Animal proteins ---- Biglycan
Source.1127: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1128: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.1129: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.1130: DFBPPR16638 ---- Animal proteins ---- Synapsin-1
Source.1131: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.1132: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1133: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22
Source.1134: DFBPPR16669 ---- Animal proteins ---- C-C motif chemokine 28
Source.1135: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8
Source.1136: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.1137: DFBPPR16704 ---- Animal proteins ---- Retbindin
Source.1138: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2
Source.1139: DFBPPR16749 ---- Animal proteins ---- Keratinocyte differentiation-associated protein
Source.1140: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.1141: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor
Source.1142: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.1143: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.1144: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.1145: DFBPPR16808 ---- Animal proteins ---- Fibroblast growth factor 2
Source.1146: DFBPPR16824 ---- Animal proteins ---- Insulin-like growth factor II
Source.1147: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1148: DFBPPR16840 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.1149: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.1150: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.1151: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6
Source.1152: DFBPPR16863 ---- Animal proteins ---- Biglycan
Source.1153: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.1154: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.1155: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1
Source.1156: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.1157: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial
Source.1158: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1159: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV
Source.1160: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.1161: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1162: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.1163: DFBPPR16969 ---- Animal proteins ---- Adenosine deaminase
Source.1164: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.1165: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.1166: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.1167: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.1168: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.1169: DFBPPR17006 ---- Animal proteins ---- Syntaxin-17
Source.1170: DFBPPR17013 ---- Animal proteins ---- Presenilin-1
Source.1171: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.1172: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.1173: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1174: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.1175: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.1176: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1177: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.1178: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1179: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.1180: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.1181: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1182: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.1183: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.1184: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.1185: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.1186: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.1187: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.1188: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2
Source.1189: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.1190: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.1191: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1192: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1193: DFBPPR17140 ---- Animal proteins ---- Adiponectin
Source.1194: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.1195: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.1196: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.1197: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.1198: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.1199: DFBPPR17192 ---- Animal proteins ---- Kit ligand
Source.1200: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.1201: DFBPPR17231 ---- Animal proteins ---- Protein sprouty homolog 2
Source.1202: DFBPPR17256 ---- Animal proteins ---- X-box-binding protein 1
Source.1203: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.1204: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.1205: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.1206: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2
Source.1207: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2
Source.1208: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.1209: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial
Source.1210: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.1211: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.1212: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.1213: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.1214: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.1215: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.1216: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1
Source.1217: DFBPPR17371 ---- Animal proteins ---- Autophagy protein 5
Source.1218: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6
Source.1219: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.1220: DFBPPR17388 ---- Animal proteins ---- Beta-arrestin-2
Source.1221: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.1222: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.1223: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.1224: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1
Source.1225: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.1226: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.1227: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.1228: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.1229: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.1230: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.1231: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.1232: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.1233: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.1234: DFBPPR17467 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.1235: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.1236: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2
Source.1237: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.1238: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.1239: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.1240: DFBPPR17491 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.1241: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1242: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.1243: DFBPPR17516 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.1244: DFBPPR17522 ---- Animal proteins ---- Homer protein homolog 1
Source.1245: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein
Source.1246: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.1247: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase
Source.1248: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial
Source.1249: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1
Source.1250: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4
Source.1251: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.1252: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1
Source.1253: DFBPPR17583 ---- Animal proteins ---- Cathelicidin-1
Source.1254: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial
Source.1255: DFBPPR17589 ---- Animal proteins ---- Aquaporin-2
Source.1256: DFBPPR17592 ---- Animal proteins ---- Claudin-3
Source.1257: DFBPPR17593 ---- Animal proteins ---- Claudin-3
Source.1258: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.1259: DFBPPR17610 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A2, mitochondrial
Source.1260: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.1261: DFBPPR17635 ---- Animal proteins ---- Frataxin, mitochondrial
Source.1262: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.1263: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.1264: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1
Source.1265: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.1266: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3
Source.1267: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.1268: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.1269: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.1270: DFBPPR17795 ---- Animal proteins ---- Acyl-coenzyme A thioesterase THEM4
Source.1271: DFBPPR17806 ---- Animal proteins ---- Uroplakin-2
Source.1272: DFBPPR17807 ---- Animal proteins ---- Opticin
Source.1273: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.1274: DFBPPR17823 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 1
Source.1275: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.1276: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.1277: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.1278: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase
Source.1279: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.1280: DFBPPR17880 ---- Animal proteins ---- Apolipoprotein A-IV
Source.1281: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1
Source.1282: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.1283: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB
Source.1284: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.1285: DFBPPR17916 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF126
Source.1286: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1
Source.1287: DFBPPR17926 ---- Animal proteins ---- Glutathione S-transferase P
Source.1288: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.1289: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1290: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.1291: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2
Source.1292: DFBPPR17940 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM38
Source.1293: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.1294: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.1295: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial
Source.1296: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.1297: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.1298: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.1299: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.1300: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.1301: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1302: DFBPPR18055 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF8
Source.1303: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.1304: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.1305: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein
Source.1306: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.1307: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor
Source.1308: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1309: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33
Source.1310: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit
Source.1311: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.1312: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1
Source.1313: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.1314: DFBPPR18114 ---- Animal proteins ---- Charged multivesicular body protein 4a
Source.1315: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.1316: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.1317: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.1318: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.1319: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1
Source.1320: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.1321: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.1322: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII
Source.1323: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.1324: DFBPPR18162 ---- Animal proteins ---- Renin receptor
Source.1325: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.1326: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.1327: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.1328: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.1329: DFBPPR18237 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.1330: DFBPPR18238 ---- Animal proteins ---- Protein odd-skipped-related 2
Source.1331: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.1332: DFBPPR18256 ---- Animal proteins ---- Proteasome subunit beta type-10
Source.1333: DFBPPR18259 ---- Animal proteins ---- Exosome complex component RRP41
Source.1334: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.1335: DFBPPR18262 ---- Animal proteins ---- Claudin-1
Source.1336: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.1337: DFBPPR18299 ---- Animal proteins ---- Synapsin-1
Source.1338: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.1339: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.1340: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.1341: DFBPPR18307 ---- Animal proteins ---- Claudin-4
Source.1342: DFBPPR18313 ---- Animal proteins ---- Septin-12
Source.1343: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.1344: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.1345: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.1346: DFBPPR18339 ---- Animal proteins ---- SPARC
Source.1347: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2
Source.1348: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.1349: DFBPPR18349 ---- Animal proteins ---- Phosphoglycerate mutase 1
Source.1350: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B
Source.1351: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.1352: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.1353: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.1354: DFBPPR18376 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase
Source.1355: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z
Source.1356: DFBPPR18388 ---- Animal proteins ---- Elongation factor Tu, mitochondrial
Source.1357: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.1358: DFBPPR18394 ---- Animal proteins ---- Histone H1.1
Source.1359: DFBPPR18396 ---- Animal proteins ---- Corticoliberin
Source.1360: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1
Source.1361: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.1362: DFBPPR18433 ---- Animal proteins ---- Basigin
Source.1363: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1
Source.1364: DFBPPR18448 ---- Animal proteins ---- Septin-1
Source.1365: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.1366: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4
Source.1367: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor
Source.1368: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.1369: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.1370: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component
Source.1371: DFBPPR18484 ---- Animal proteins ---- Charged multivesicular body protein 3
Source.1372: DFBPPR18485 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.1373: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.1374: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.1375: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5
Source.1376: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.1377: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.1378: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.1379: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.1380: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.1381: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.1382: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1
Source.1383: DFBPPR18564 ---- Animal proteins ---- BRISC and BRCA1-A complex member 1
Source.1384: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.1385: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.1386: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.1387: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.1388: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2
Source.1389: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.1390: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2
Source.1391: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1392: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.1393: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial
Source.1394: DFBPPR18621 ---- Animal proteins ---- Cytochrome b561
Source.1395: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.1396: DFBPPR18626 ---- Animal proteins ---- Thymidylate synthase
Source.1397: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4
Source.1398: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14
Source.1399: DFBPPR18643 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III
Source.1400: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.1401: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.1402: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.1403: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.1404: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase
Source.1405: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein
Source.1406: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9
Source.1407: DFBPPR18788 ---- Animal proteins ---- Ceramide-1-phosphate transfer protein
Source.1408: DFBPPR18793 ---- Animal proteins ---- BPI fold-containing family A member 1
Source.1409: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba
Source.1410: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8
Source.1411: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.1412: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1
Source.1413: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.1414: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type
Source.1415: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1
Source.1416: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.1417: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.1418: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.1419: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.1420: DFBPPR18853 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor D
Source.1421: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.1422: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2
Source.1423: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.1424: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A
Source.1425: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.1426: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.1427: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6
Source.1428: DFBPPR18889 ---- Animal proteins ---- Achaete-scute homolog 2
Source.1429: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.1430: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.1431: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless
Source.1432: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.1433: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.1434: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11
Source.1435: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.1436: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.1437: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.1438: DFBPPR18955 ---- Animal proteins ---- Lymphotoxin-alpha
Source.1439: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.1440: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.1441: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase
Source.1442: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb
Source.1443: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase
Source.1444: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.1445: DFBPPR18998 ---- Animal proteins ---- E3 ubiquitin-protein ligase ZNRF1
Source.1446: DFBPPR19006 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.1447: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2
Source.1448: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.1449: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.1450: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.1451: DFBPPR19069 ---- Animal proteins ---- Small glutamine-rich tetratricopeptide repeat-containing protein alpha
Source.1452: DFBPPR19072 ---- Animal proteins ---- Growth/differentiation factor 9
Source.1453: DFBPPR19073 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 21
Source.1454: DFBPPR19075 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 J2
Source.1455: DFBPPR19076 ---- Animal proteins ---- Protein MGARP
Source.1456: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1
Source.1457: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.1458: DFBPPR19089 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 2
Source.1459: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase
Source.1460: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1461: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.1462: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.1463: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1
Source.1464: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase
Source.1465: DFBPPR19158 ---- Animal proteins ---- Tuberoinfundibular peptide of 39 residues
Source.1466: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14
Source.1467: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2
Source.1468: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.1469: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase
Source.1470: DFBPPR19186 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.1471: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1472: DFBPPR19205 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF169
Source.1473: DFBPPR19208 ---- Animal proteins ---- Sushi repeat-containing protein SRPX2
Source.1474: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.1475: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.1476: DFBPPR19229 ---- Animal proteins ---- Interferon alpha-F
Source.1477: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.1478: DFBPPR19246 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.1479: DFBPPR19247 ---- Animal proteins ---- Calmegin
Source.1480: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.1481: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.1482: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.1483: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3
Source.1484: DFBPPR19260 ---- Animal proteins ---- rRNA N6-adenosine-methyltransferase ZCCHC4
Source.1485: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.1486: DFBPPR19277 ---- Animal proteins ---- Prolactin-releasing peptide
Source.1487: DFBPPR19286 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.1488: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.1489: DFBPPR19291 ---- Animal proteins ---- Multicilin
Source.1490: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8
Source.1491: DFBPPR19312 ---- Animal proteins ---- Copine-1
Source.1492: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47
Source.1493: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2
Source.1494: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85
Source.1495: DFBPPR19331 ---- Animal proteins ---- Cathelicidin-6
Source.1496: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1497: DFBPPR19343 ---- Animal proteins ---- Interferon alpha-inducible protein 6
Source.1498: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog
Source.1499: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.1500: DFBPPR19381 ---- Animal proteins ---- BRCA2 and CDKN1A-interacting protein
Source.1501: DFBPPR19385 ---- Animal proteins ---- Cathelicidin-5
Source.1502: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129
Source.1503: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF
Source.1504: DFBPPR19440 ---- Animal proteins ---- Phosphoglycerate mutase 2
Source.1505: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.1506: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.1507: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.1508: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.1509: DFBPPR19460 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase NIMA-interacting 4
Source.1510: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.1511: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.1512: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137
Source.1513: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.1514: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.1515: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.1516: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.1517: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.1518: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.1519: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.1520: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.1521: DFBPPR19538 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial
Source.1522: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.1523: DFBPPR19557 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.1524: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.1525: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.1526: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.1527: DFBPPR19574 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit 2
Source.1528: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2
Source.1529: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1
Source.1530: DFBPPR19602 ---- Animal proteins ---- Dynactin subunit 3
Source.1531: DFBPPR19607 ---- Animal proteins ---- Obg-like ATPase 1
Source.1532: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.1533: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.1534: DFBPPR19618 ---- Animal proteins ---- TCF3 fusion partner homolog
Source.1535: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1
Source.1536: DFBPPR19640 ---- Animal proteins ---- Prolargin
Source.1537: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.1538: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1
Source.1539: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor
Source.1540: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.1541: DFBPPR19698 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 7
Source.1542: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.1543: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205
Source.1544: DFBPPR19718 ---- Animal proteins ---- Type 2 phosphatidylinositol 4,5-bisphosphate 4-phosphatase
Source.1545: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.1546: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase
Source.1547: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase
Source.1548: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.1549: DFBPPR19783 ---- Animal proteins ---- Syndecan-1
Source.1550: DFBPPR19788 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.1551: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3
Source.1552: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.1553: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.1554: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.1555: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3
Source.1556: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.1557: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial
Source.1558: DFBPPR19844 ---- Animal proteins ---- Prosalusin
Source.1559: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.1560: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.1561: DFBPPR19875 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 26A
Source.1562: DFBPPR19882 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.1563: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60
Source.1564: DFBPPR19916 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1
Source.1565: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.1566: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase
Source.1567: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7
Source.1568: DFBPPR19948 ---- Animal proteins ---- Tensin-4
Source.1569: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.1570: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10
Source.1571: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.1572: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor
Source.1573: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27
Source.1574: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.1575: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20
Source.1576: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.1577: DFBPPR19994 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.1578: DFBPPR20022 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.1579: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7
Source.1580: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.1581: DFBPPR20033 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 9
Source.1582: DFBPPR20036 ---- Animal proteins ---- Urocortin-3
Source.1583: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta
Source.1584: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1
Source.1585: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6
Source.1586: DFBPPR20123 ---- Animal proteins ---- Securin
Source.1587: DFBPPR20126 ---- Animal proteins ---- 39S ribosomal protein L44, mitochondrial
Source.1588: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6
Source.1589: DFBPPR20149 ---- Animal proteins ---- Flotillin-2
Source.1590: DFBPPR20158 ---- Animal proteins ---- Histone chaperone ASF1A
Source.1591: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.1592: DFBPPR20187 ---- Animal proteins ---- Nitric oxide synthase-interacting protein
Source.1593: DFBPPR20190 ---- Animal proteins ---- DNA polymerase epsilon subunit 3
Source.1594: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.1595: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.1596: DFBPPR20245 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial
Source.1597: DFBPPR20265 ---- Animal proteins ---- Histone-lysine N-methyltransferase EZH1
Source.1598: DFBPPR20273 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT14
Source.1599: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.1600: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.1601: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.1602: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.1603: DFBPPR20289 ---- Animal proteins ---- Di-N-acetylchitobiase
Source.1604: DFBPPR20307 ---- Animal proteins ---- Ras-related protein Rab-6B
Source.1605: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel
Source.1606: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27
Source.1607: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase
Source.1608: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.1609: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.1610: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.1611: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.1612: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial
Source.1613: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6
Source.1614: DFBPPR20386 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59
Source.1615: DFBPPR20401 ---- Animal proteins ---- Bystin
Source.1616: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma
Source.1617: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog
Source.1618: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1
Source.1619: DFBPPR20434 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 1
Source.1620: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5
Source.1621: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.1622: DFBPPR20444 ---- Animal proteins ---- Ribonuclease P/MRP protein subunit POP5
Source.1623: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.1624: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8
Source.1625: DFBPPR20478 ---- Animal proteins ---- Macoilin
Source.1626: DFBPPR20483 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 1
Source.1627: DFBPPR20489 ---- Animal proteins ---- Translocon-associated protein subunit alpha
Source.1628: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.1629: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.1630: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.1631: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial
Source.1632: DFBPPR20515 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 2
Source.1633: DFBPPR20532 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.1634: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.1635: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.1636: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.1637: DFBPPR20564 ---- Animal proteins ---- Ras-related protein Rab-26
Source.1638: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.1639: DFBPPR20577 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor-interacting protein
Source.1640: DFBPPR20590 ---- Animal proteins ---- POU domain class 2-associating factor 1
Source.1641: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16
Source.1642: DFBPPR20604 ---- Animal proteins ---- Phosphoinositide-3-kinase-interacting protein 1
Source.1643: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2
Source.1644: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.1645: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1
Source.1646: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2
Source.1647: DFBPPR20641 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.1648: DFBPPR20648 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM22 homolog
Source.1649: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.1650: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.1651: DFBPPR20688 ---- Animal proteins ---- 28S ribosomal protein S17, mitochondrial
Source.1652: DFBPPR20689 ---- Animal proteins ---- 28S ribosomal protein S14, mitochondrial
Source.1653: DFBPPR20704 ---- Animal proteins ---- C-X-C motif chemokine 17
Source.1654: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase
Source.1655: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1
Source.1656: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial
Source.1657: DFBPPR20724 ---- Animal proteins ---- Exportin-2
Source.1658: DFBPPR20736 ---- Animal proteins ---- Osteopontin-K
Source.1659: DFBPPR20743 ---- Animal proteins ---- Myozenin-1
Source.1660: DFBPPR20748 ---- Animal proteins ---- Protein ABHD14B
Source.1661: DFBPPR20750 ---- Animal proteins ---- 40S ribosomal protein S8
Source.1662: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog
Source.1663: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9
Source.1664: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2
Source.1665: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.1666: DFBPPR20787 ---- Animal proteins ---- UBX domain-containing protein 8
Source.1667: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17
Source.1668: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.1669: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171
Source.1670: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2
Source.1671: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2
Source.1672: DFBPPR20816 ---- Animal proteins ---- Ribosomal L1 domain-containing protein 1
Source.1673: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.1674: DFBPPR20829 ---- Animal proteins ---- Phospholipid phosphatase 6
Source.1675: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24
Source.1676: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.1677: DFBPPR20857 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.1678: DFBPPR20874 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC2
Source.1679: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1
Source.1680: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237
Source.1681: DFBPPR20886 ---- Animal proteins ---- Dentin matrix acidic phosphoprotein 1
Source.1682: DFBPPR20899 ---- Animal proteins ---- Centrosomal protein kizuna
Source.1683: DFBPPR20900 ---- Animal proteins ---- F-box/LRR-repeat protein 12
Source.1684: DFBPPR20902 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 2 homolog
Source.1685: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor
Source.1686: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668
Source.1687: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.1688: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1
Source.1689: DFBPPR20930 ---- Animal proteins ---- Centromere protein U
Source.1690: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14
Source.1691: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial
Source.1692: DFBPPR20938 ---- Animal proteins ---- Serine protease HTR4
Source.1693: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1
Source.1694: DFBPPR20947 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.1695: DFBPPR20962 ---- Animal proteins ---- Protein unc-50 homolog
Source.1696: DFBPPR20967 ---- Animal proteins ---- Phosducin-like protein
Source.1697: DFBPPR20974 ---- Animal proteins ---- Short-chain dehydrogenase/reductase 3
Source.1698: DFBPPR20975 ---- Animal proteins ---- 39S ribosomal protein L2, mitochondrial
Source.1699: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5
Source.1700: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1701: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.1702: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.1703: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1
Source.1704: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.1705: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.1706: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1
Source.1707: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.1708: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.1709: DFBPPR21039 ---- Animal proteins ---- V-type proton ATPase subunit e 2
Source.1710: DFBPPR21040 ---- Animal proteins ---- Neuritin
Source.1711: DFBPPR21041 ---- Animal proteins ---- Cytokine-inducible SH2-containing protein
Source.1712: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2
Source.1713: DFBPPR21074 ---- Animal proteins ---- Cancer-related nucleoside-triphosphatase homolog
Source.1714: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.1715: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7
Source.1716: DFBPPR21098 ---- Animal proteins ---- Pre T-cell antigen receptor alpha
Source.1717: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.1718: DFBPPR21107 ---- Animal proteins ---- Proteasome assembly chaperone 2
Source.1719: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.1720: DFBPPR21118 ---- Animal proteins ---- NADH-cytochrome b5 reductase 1
Source.1721: DFBPPR21134 ---- Animal proteins ---- Cell division cycle-associated protein 7
Source.1722: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.1723: DFBPPR21161 ---- Animal proteins ---- Histone H4 transcription factor
Source.1724: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.1725: DFBPPR21183 ---- Animal proteins ---- LIM and cysteine-rich domains protein 1
Source.1726: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22
Source.1727: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.1728: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2
Source.1729: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1
Source.1730: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog
Source.1731: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4
Source.1732: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231
Source.1733: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.1734: DFBPPR21240 ---- Animal proteins ---- 6-phosphogluconolactonase
Source.1735: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.1736: DFBPPR21253 ---- Animal proteins ---- Sorting nexin-8
Source.1737: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2
Source.1738: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.1739: DFBPPR21267 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 22
Source.1740: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase
Source.1741: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4
Source.1742: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.1743: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4
Source.1744: DFBPPR21317 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.1745: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115
Source.1746: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34
Source.1747: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.1748: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3
Source.1749: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.1750: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.1751: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.1752: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.1753: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3
Source.1754: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.1755: DFBPPR21399 ---- Animal proteins ---- Trafficking protein particle complex subunit 6A
Source.1756: DFBPPR21401 ---- Animal proteins ---- THAP domain-containing protein 5
Source.1757: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.1758: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.1759: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.1760: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.1761: DFBPPR21452 ---- Animal proteins ---- Spermatogenic leucine zipper protein 1
Source.1762: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.1763: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.1764: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1
Source.1765: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like
Source.1766: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.1767: DFBPPR21510 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7
Source.1768: DFBPPR21512 ---- Animal proteins ---- Membrane protein FAM174B
Source.1769: DFBPPR21523 ---- Animal proteins ---- tRNA 2'-phosphotransferase 1
Source.1770: DFBPPR21529 ---- Animal proteins ---- Integrator complex subunit 11
Source.1771: DFBPPR21551 ---- Animal proteins ---- Suppressor of cytokine signaling 4
Source.1772: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.1773: DFBPPR21565 ---- Animal proteins ---- Insulin-like growth factor-binding protein-like 1
Source.1774: DFBPPR21570 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40B
Source.1775: DFBPPR21581 ---- Animal proteins ---- T-cell leukemia translocation-altered gene protein homolog
Source.1776: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.1777: DFBPPR21584 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.1778: DFBPPR21601 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 2
Source.1779: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.1780: DFBPPR21619 ---- Animal proteins ---- CBY1-interacting BAR domain-containing protein 2
Source.1781: DFBPPR21620 ---- Animal proteins ---- Claudin-12
Source.1782: DFBPPR21662 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1
Source.1783: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.1784: DFBPPR21678 ---- Animal proteins ---- Transmembrane protein 35A
Source.1785: DFBPPR21681 ---- Animal proteins ---- Protein FAM110A
Source.1786: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.1787: DFBPPR21691 ---- Animal proteins ---- Protein LRATD1
Source.1788: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.1789: DFBPPR21721 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor C2
Source.1790: DFBPPR21722 ---- Animal proteins ---- Protein DDI1 homolog 1
Source.1791: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3
Source.1792: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.1793: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.1794: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.1795: DFBPPR21749 ---- Animal proteins ---- Protein CUSTOS
Source.1796: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1
Source.1797: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.1798: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.1799: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.1800: DFBPPR21776 ---- Animal proteins ---- Coiled-coil domain-containing protein 130
Source.1801: DFBPPR21792 ---- Animal proteins ---- 39S ribosomal protein L19, mitochondrial
Source.1802: DFBPPR21799 ---- Animal proteins ---- Major vault protein
Source.1803: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.1804: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.1805: DFBPPR21854 ---- Animal proteins ---- Suppressor of IKBKE 1
Source.1806: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B
Source.1807: DFBPPR21869 ---- Animal proteins ---- Centromere protein O
Source.1808: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein
Source.1809: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2
Source.1810: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor
Source.1811: DFBPPR21897 ---- Animal proteins ---- ZW10 interactor
Source.1812: DFBPPR21898 ---- Animal proteins ---- Junctional sarcoplasmic reticulum protein 1
Source.1813: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein
Source.1814: DFBPPR21920 ---- Animal proteins ---- Protein DPCD
Source.1815: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.1816: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.1817: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.1818: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.1819: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein
Source.1820: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.1821: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog
Source.1822: DFBPPR21968 ---- Animal proteins ---- F-box only protein 28
Source.1823: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1
Source.1824: DFBPPR21971 ---- Animal proteins ---- Chemokine-like protein TAFA-5
Source.1825: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.1826: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1
Source.1827: DFBPPR21984 ---- Animal proteins ---- Leucine-rich repeat-containing protein 10
Source.1828: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14
Source.1829: DFBPPR21991 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC7-like
Source.1830: DFBPPR21998 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.1831: DFBPPR22003 ---- Animal proteins ---- 40S ribosomal protein S13
Source.1832: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.1833: DFBPPR22025 ---- Animal proteins ---- Putative deoxyribonuclease TATDN3
Source.1834: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.1835: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6
Source.1836: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma
Source.1837: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.1838: DFBPPR22073 ---- Animal proteins ---- C2 calcium-dependent domain-containing protein 4A
Source.1839: DFBPPR22075 ---- Animal proteins ---- GTP-binding protein 8
Source.1840: DFBPPR22077 ---- Animal proteins ---- 39S ribosomal protein L21, mitochondrial
Source.1841: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9
Source.1842: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1
Source.1843: DFBPPR22093 ---- Animal proteins ---- F-box only protein 3
Source.1844: DFBPPR22096 ---- Animal proteins ---- MOB kinase activator 3B
Source.1845: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.1846: DFBPPR22104 ---- Animal proteins ---- Leptin receptor overlapping transcript-like 1
Source.1847: DFBPPR22106 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.1848: DFBPPR22109 ---- Animal proteins ---- Host cell factor C1 regulator 1
Source.1849: DFBPPR22110 ---- Animal proteins ---- Nucleolar protein 12
Source.1850: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein
Source.1851: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2
Source.1852: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2
Source.1853: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.1854: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein
Source.1855: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.1856: DFBPPR22183 ---- Animal proteins ---- Retrotransposon Gag-like protein 8
Source.1857: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.1858: DFBPPR22191 ---- Animal proteins ---- Heat shock protein beta-3
Source.1859: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.1860: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1
Source.1861: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.1862: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.1863: DFBPPR22251 ---- Animal proteins ---- SUZ domain-containing protein 1
Source.1864: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.1865: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like
Source.1866: DFBPPR22319 ---- Animal proteins ---- Regulator of G-protein signaling 5
Source.1867: DFBPPR22322 ---- Animal proteins ---- Testis-specific protein 10-interacting protein
Source.1868: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.1869: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70
Source.1870: DFBPPR22337 ---- Animal proteins ---- Uncharacterized protein CLBA1
Source.1871: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.1872: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.1873: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein
Source.1874: DFBPPR22360 ---- Animal proteins ---- Mitochondrial fission regulator 1-like
Source.1875: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein
Source.1876: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23
Source.1877: DFBPPR22384 ---- Animal proteins ---- High mobility group nucleosome-binding domain-containing protein 4
Source.1878: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A
Source.1879: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10
Source.1880: DFBPPR22403 ---- Animal proteins ---- Heat shock protein beta-9
Source.1881: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog
Source.1882: DFBPPR22414 ---- Animal proteins ---- Protein C10
Source.1883: DFBPPR22417 ---- Animal proteins ---- Spermatogenesis-associated protein 46
Source.1884: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B
Source.1885: DFBPPR22429 ---- Animal proteins ---- Coiled-coil domain-containing protein 107
Source.1886: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186
Source.1887: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3
Source.1888: DFBPPR22440 ---- Animal proteins ---- PDZK1-interacting protein 1
Source.1889: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2
Source.1890: DFBPPR22448 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 5B
Source.1891: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9
Source.1892: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2
Source.1893: DFBPPR22465 ---- Animal proteins ---- OCIA domain-containing protein 2
Source.1894: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.1895: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3
Source.1896: DFBPPR22507 ---- Animal proteins ---- Secernin-3
Source.1897: DFBPPR22510 ---- Animal proteins ---- GPALPP motifs-containing protein 1
Source.1898: DFBPPR22536 ---- Animal proteins ---- Suprabasin
Source.1899: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1
Source.1900: DFBPPR22561 ---- Animal proteins ---- Pre-rRNA-processing protein TSR2 homolog
Source.1901: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.1902: DFBPPR22585 ---- Animal proteins ---- UPF0449 protein C19orf25 homolog
Source.1903: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.1904: DFBPPR22591 ---- Animal proteins ---- Leucine-rich repeat-containing protein 51
Source.1905: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B
Source.1906: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4
Source.1907: DFBPPR22616 ---- Animal proteins ---- Jhy protein homolog
Source.1908: DFBPPR22618 ---- Animal proteins ---- BSD domain-containing protein 1
Source.1909: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164
Source.1910: DFBPPR22626 ---- Animal proteins ---- Transmembrane protein 253
Source.1911: DFBPPR22627 ---- Animal proteins ---- Leucine-rich repeat-containing protein 61
Source.1912: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175
Source.1913: DFBPPR22651 ---- Animal proteins ---- Spermatogenesis-associated protein 2-like protein
Source.1914: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32
Source.1915: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog
Source.1916: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.1917: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein
Source.1918: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32
Source.1919: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.1920: DFBPPR22700 ---- Animal proteins ---- Protein FAM89A
Source.1921: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1
Source.1922: DFBPPR22734 ---- Animal proteins ---- Uncharacterized protein C1orf226 homolog
Source.1923: DFBPPR22737 ---- Animal proteins ---- UPF0705 protein C11orf49 homolog
Source.1924: DFBPPR22739 ---- Animal proteins ---- Testis, prostate and placenta-expressed protein
Source.1925: DFBPPR22745 ---- Animal proteins ---- Uncharacterized protein C3orf14 homolog
Source.1926: DFBPPR22750 ---- Animal proteins ---- Uncharacterized protein C4orf45 homolog
Source.1927: DFBPPR22762 ---- Animal proteins ---- Uncharacterized protein C6orf136 homolog
Source.1928: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.1929: DFBPPR8537 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.1930: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.1931: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.1932: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein
Source.1933: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1934: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6
Source.1935: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.1936: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1937: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.1938: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.1939: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.1940: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.1941: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.1942: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.1943: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.1944: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.1945: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.1946: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.1947: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.1948: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.1949: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.1950: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A
Source.1951: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1
Source.1952: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.1953: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.1954: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.1955: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.1956: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.1957: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.1958: DFBPPR8689 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.1959: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.1960: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.1961: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1962: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.1963: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1964: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2
Source.1965: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1966: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9
Source.1967: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.1968: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.1969: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.1970: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.1971: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.1972: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.1973: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.1974: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.1975: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.1976: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I
Source.1977: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.1978: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.1979: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.1980: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.1981: DFBPPR8792 ---- Animal proteins ---- Plasminogen
Source.1982: DFBPPR8813 ---- Animal proteins ---- Apolipoprotein A-IV
Source.1983: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.1984: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4
Source.1985: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.1986: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.1987: DFBPPR8904 ---- Animal proteins ---- Osteopontin
Source.1988: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.1989: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.1990: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.1991: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.1992: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.1993: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.1994: DFBPPR8939 ---- Animal proteins ---- Kit ligand
Source.1995: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.1996: DFBPPR8972 ---- Animal proteins ---- Lutropin subunit beta
Source.1997: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.1998: DFBPPR9005 ---- Animal proteins ---- Protein amnionless
Source.1999: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain
Source.2000: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.2001: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2002: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2
Source.2003: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1
Source.2004: DFBPPR9069 ---- Animal proteins ---- E-selectin
Source.2005: DFBPPR9073 ---- Animal proteins ---- Vitronectin
Source.2006: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.2007: DFBPPR9093 ---- Animal proteins ---- Hemopexin
Source.2008: DFBPPR9094 ---- Animal proteins ---- Aquaporin-5
Source.2009: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1
Source.2010: DFBPPR9098 ---- Animal proteins ---- Gastrotropin
Source.2011: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.2012: DFBPPR9109 ---- Animal proteins ---- Natriuretic peptides B
Source.2013: DFBPPR9121 ---- Animal proteins ---- Endoplasmin
Source.2014: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.2015: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.2016: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.2017: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.2018: DFBPPR9178 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 3
Source.2019: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.2020: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.2021: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII
Source.2022: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.2023: DFBPPR9222 ---- Animal proteins ---- Glutathione peroxidase 1
Source.2024: DFBPPR9226 ---- Animal proteins ---- Protein GPR15L
Source.2025: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10
Source.2026: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3
Source.2027: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.2028: DFBPPR9245 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.2029: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.2030: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.2031: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2032: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.2033: DFBPPR9276 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.2034: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.2035: DFBPPR9286 ---- Animal proteins ---- BPI fold-containing family A member 1
Source.2036: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4
Source.2037: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.2038: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.2039: DFBPPR9316 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.2040: DFBPPR9323 ---- Animal proteins ---- Lymphotoxin-alpha
Source.2041: DFBPPR9327 ---- Animal proteins ---- Multicilin
Source.2042: DFBPPR9338 ---- Animal proteins ---- SPARC
Source.2043: DFBPPR9369 ---- Animal proteins ---- Nuclear receptor subfamily 6 group A member 1
Source.2044: DFBPPR9404 ---- Animal proteins ---- Tryptase
Source.2045: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2046: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.2047: DFBPPR9433 ---- Animal proteins ---- Autophagy protein 5
Source.2048: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.2049: DFBPPR9484 ---- Animal proteins ---- Macoilin
Source.2050: DFBPPR9502 ---- Animal proteins ---- Endothelin-1 receptor
Source.2051: DFBPPR9511 ---- Animal proteins ---- Cholinesterase
Source.2052: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.2053: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase
Source.2054: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha
Source.2055: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.2056: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2
Source.2057: DFBPPR9558 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.2058: DFBPPR9561 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2059: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase
Source.2060: DFBPPR9578 ---- Animal proteins ---- Biglycan
Source.2061: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.2062: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.2063: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2064: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2065: DFBPPR9635 ---- Animal proteins ---- Cytochrome b561
Source.2066: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.2067: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.2068: DFBPPR9658 ---- Animal proteins ---- Melanocortin receptor 5
Source.2069: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.2070: DFBPPR9664 ---- Animal proteins ---- Perilipin-2
Source.2071: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.2072: DFBPPR9691 ---- Animal proteins ---- Uroplakin-2
Source.2073: DFBPPR9693 ---- Animal proteins ---- LIM and cysteine-rich domains protein 1
Source.2074: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.2075: DFBPPR9708 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7
Source.2076: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.2077: DFBPPR9730 ---- Animal proteins ---- Urotensin-2
Source.2078: DFBPPR9745 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.2079: DFBPPR9760 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.2080: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1
Source.2081: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8
Source.2082: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.2083: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.2084: DFBPPR9827 ---- Animal proteins ---- Guanylate cyclase activator 2B
Source.2085: DFBPPR9842 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1
Source.2086: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.2087: DFBPPR9921 ---- Animal proteins ---- 40S ribosomal protein S13
Source.2088: DFBPPR9932 ---- Animal proteins ---- Regulator of G-protein signaling 5
Source.2089: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.2090: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2091: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor
Source.2092: DFBPPR9972 ---- Animal proteins ---- Taste receptor type 2 member 40
Source.2093: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.2094: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.2095: DFBPPR9980 ---- Animal proteins ---- Cathelicidin-1
Source.2096: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.2097: DFBPPR9989 ---- Animal proteins ---- VIP peptides
Source.2098: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.2099: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx
Source.2100: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.2101: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.2102: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.2103: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.2104: DFBPPR10070 ---- Animal proteins ---- Vesicle-associated membrane protein 7
Source.2105: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.2106: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.2107: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.2108: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2109: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.2110: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase
Source.2111: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2
Source.2112: DFBPPR10121 ---- Animal proteins ---- Fibroblast growth factor 2
Source.2113: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3
Source.2114: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.2115: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.2116: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.2117: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.2118: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.2119: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.2120: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.2121: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1
Source.2122: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.2123: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.2124: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.2125: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.2126: DFBPPR10219 ---- Animal proteins ---- Presenilin-1
Source.2127: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1
Source.2128: DFBPPR10228 ---- Animal proteins ---- Presenilin-2
Source.2129: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein
Source.2130: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.2131: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1
Source.2132: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.2133: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1
Source.2134: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.2135: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.2136: DFBPPR10267 ---- Animal proteins ---- Gephyrin
Source.2137: DFBPPR10268 ---- Animal proteins ---- CD166 antigen
Source.2138: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1
Source.2139: DFBPPR10271 ---- Animal proteins ---- Cadherin-7
Source.2140: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2
Source.2141: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.2142: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.2143: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.2144: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.2145: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.2146: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.2147: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.2148: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1
Source.2149: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1
Source.2150: DFBPPR10328 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.2151: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.2152: DFBPPR10333 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.2153: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.2154: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.2155: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.2156: DFBPPR10366 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.2157: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.2158: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.2159: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.2160: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.2161: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.2162: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1
Source.2163: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.2164: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.2165: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin
Source.2166: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.2167: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.2168: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.2169: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.2170: DFBPPR10447 ---- Animal proteins ---- Plastin-1
Source.2171: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.2172: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4
Source.2173: DFBPPR10462 ---- Animal proteins ---- Phosphoglycerate mutase 1
Source.2174: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.2175: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.2176: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.2177: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.2178: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.2179: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.2180: DFBPPR10481 ---- Animal proteins ---- Syndecan-3
Source.2181: DFBPPR10490 ---- Animal proteins ---- Tudor-interacting repair regulator protein
Source.2182: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.2183: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon
Source.2184: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.2185: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.2186: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.2187: DFBPPR10515 ---- Animal proteins ---- Cathelicidin-2
Source.2188: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.2189: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.2190: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.2191: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase
Source.2192: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.2193: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.2194: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.2195: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.2196: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase
Source.2197: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.2198: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.2199: DFBPPR10598 ---- Animal proteins ---- Histone chaperone ASF1
Source.2200: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.2201: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.2202: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1
Source.2203: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.2204: DFBPPR10637 ---- Animal proteins ---- CTD small phosphatase-like protein
Source.2205: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.2206: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.2207: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase
Source.2208: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.2209: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3
Source.2210: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.2211: DFBPPR10684 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.2212: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.2213: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.2214: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.2215: DFBPPR10700 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 2
Source.2216: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.2217: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.2218: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.2219: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog
Source.2220: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.2221: DFBPPR10733 ---- Animal proteins ---- Ras-related protein Rab-6A
Source.2222: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.2223: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.2224: DFBPPR10749 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.2225: DFBPPR10755 ---- Animal proteins ---- Draxin
Source.2226: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase
Source.2227: DFBPPR10760 ---- Animal proteins ---- Fatty acid-binding protein, liver
Source.2228: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.2229: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2230: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5
Source.2231: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain
Source.2232: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12
Source.2233: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.2234: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.2235: DFBPPR10806 ---- Animal proteins ---- Cathelicidin-3
Source.2236: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.2237: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.2238: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.2239: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2240: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1
Source.2241: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.2242: DFBPPR10836 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.2243: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.2244: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.2245: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.2246: DFBPPR10866 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.2247: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.2248: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2
Source.2249: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.2250: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.2251: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.2252: DFBPPR10917 ---- Animal proteins ---- Ribonuclease UK114
Source.2253: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1
Source.2254: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.2255: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase
Source.2256: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1
Source.2257: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.2258: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2
Source.2259: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo
Source.2260: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.2261: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.2262: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.2263: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein
Source.2264: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.2265: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.2266: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.2267: DFBPPR11023 ---- Animal proteins ---- 43 kDa receptor-associated protein of the synapse
Source.2268: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.2269: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.2270: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.2271: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.2272: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13
Source.2273: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.2274: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a
Source.2275: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.2276: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1
Source.2277: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.2278: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A
Source.2279: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.2280: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1
Source.2281: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D
Source.2282: DFBPPR11119 ---- Animal proteins ---- Homeobox protein Nkx-2.5
Source.2283: DFBPPR11121 ---- Animal proteins ---- Lysosomal amino acid transporter 1 homolog
Source.2284: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.2285: DFBPPR11142 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.2286: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.2287: DFBPPR11147 ---- Animal proteins ---- Fibulin-1
Source.2288: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.2289: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1
Source.2290: DFBPPR11162 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.2291: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2
Source.2292: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein
Source.2293: DFBPPR11183 ---- Animal proteins ---- Trypsin II-P29
Source.2294: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.2295: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.2296: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22
Source.2297: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.2298: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1
Source.2299: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.2300: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.2301: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.2302: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.2303: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.2304: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2
Source.2305: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.2306: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.2307: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.2308: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.2309: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.2310: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.2311: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.2312: DFBPPR11263 ---- Animal proteins ---- Obg-like ATPase 1
Source.2313: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.2314: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3
Source.2315: DFBPPR11274 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.2316: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.2317: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin
Source.2318: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.2319: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.2320: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.2321: DFBPPR11314 ---- Animal proteins ---- Multivesicular body subunit 12A
Source.2322: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4
Source.2323: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1
Source.2324: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.2325: DFBPPR11344 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.2326: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.2327: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1
Source.2328: DFBPPR11375 ---- Animal proteins ---- Transcription factor E2F1
Source.2329: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6
Source.2330: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.2331: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10
Source.2332: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3
Source.2333: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.2334: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.2335: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B
Source.2336: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.2337: DFBPPR11411 ---- Animal proteins ---- Zinc finger protein ubi-d4
Source.2338: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.2339: DFBPPR11415 ---- Animal proteins ---- Elongation factor Tu, mitochondrial
Source.2340: DFBPPR11419 ---- Animal proteins ---- Glutathione S-transferase
Source.2341: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2342: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7
Source.2343: DFBPPR11466 ---- Animal proteins ---- GDNF family receptor alpha-2
Source.2344: DFBPPR11468 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.2345: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11
Source.2346: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5
Source.2347: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog
Source.2348: DFBPPR11520 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2
Source.2349: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.2350: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.2351: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.2352: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.2353: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2
Source.2354: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.2355: DFBPPR11567 ---- Animal proteins ---- Ovocalyxin-32
Source.2356: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.2357: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.2358: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.2359: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.2360: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.2361: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.2362: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8
Source.2363: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3
Source.2364: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4
Source.2365: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.2366: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.2367: DFBPPR11681 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1
Source.2368: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1
Source.2369: DFBPPR11703 ---- Animal proteins ---- Transcription factor CP2
Source.2370: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.2371: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.2372: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.2373: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1
Source.2374: DFBPPR11717 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.2375: DFBPPR11718 ---- Animal proteins ---- Homeobox protein Hox-C8
Source.2376: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.2377: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.2378: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.2379: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2
Source.2380: DFBPPR11792 ---- Animal proteins ---- Selenoprotein W
Source.2381: DFBPPR11795 ---- Animal proteins ---- Class E basic helix-loop-helix protein 22
Source.2382: DFBPPR11801 ---- Animal proteins ---- Homeobox protein SAX-1
Source.2383: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91
Source.2384: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.2385: DFBPPR11834 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.2386: DFBPPR11844 ---- Animal proteins ---- Integrator complex subunit 11
Source.2387: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9
Source.2388: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.2389: DFBPPR11859 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59
Source.2390: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3
Source.2391: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog
Source.2392: DFBPPR11873 ---- Animal proteins ---- Ligand-dependent nuclear receptor corepressor-like protein
Source.2393: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region
Source.2394: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.2395: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.2396: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1
Source.2397: DFBPPR11908 ---- Animal proteins ---- Centrosomal protein kizuna
Source.2398: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13
Source.2399: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.2400: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.2401: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.2402: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.2403: DFBPPR11980 ---- Animal proteins ---- 40S ribosomal protein S13
Source.2404: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4
Source.2405: DFBPPR11985 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.2406: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog
Source.2407: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.2408: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.2409: DFBPPR12022 ---- Animal proteins ---- Regulator of G-protein signaling 4
Source.2410: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.2411: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.2412: DFBPPR12043 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 5
Source.2413: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9
Source.2414: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.2415: DFBPPR12075 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.2416: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129
Source.2417: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.2418: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.2419: DFBPPR12093 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial
Source.2420: DFBPPR12096 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 4
Source.2421: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.2422: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2
Source.2423: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.2424: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21
Source.2425: DFBPPR12121 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial
Source.2426: DFBPPR12132 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.2427: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.2428: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A
Source.2429: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.2430: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.2431: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.2432: DFBPPR12226 ---- Animal proteins ---- Protein DGCR6
Source.2433: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog
Source.2434: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.2435: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like
Source.2436: DFBPPR12240 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog
Source.2437: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.2438: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.2439: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.2440: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.2441: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5
Source.2442: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.2443: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.2444: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.2445: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.2446: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.2447: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3
Source.2448: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.2449: DFBPPR12304 ---- Animal proteins ---- Cellular tumor antigen p53
Source.2450: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.2451: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.2452: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.2453: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.2454: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor
Source.2455: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type
Source.2456: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2457: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.2458: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.2459: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.2460: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain
Source.2461: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform
Source.2462: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.2463: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.2464: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.2465: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2466: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.2467: DFBPPR12386 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.2468: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.2469: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.2470: DFBPPR12408 ---- Animal proteins ---- Vitronectin
Source.2471: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.2472: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.2473: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A
Source.2474: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.2475: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.2476: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.2477: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.2478: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.2479: DFBPPR12441 ---- Animal proteins ---- Triadin
Source.2480: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.2481: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.2482: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.2483: DFBPPR12464 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.2484: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.2485: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.2486: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.2487: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.2488: DFBPPR12483 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.2489: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.2490: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.2491: DFBPPR12502 ---- Animal proteins ---- Fibroblast growth factor 2
Source.2492: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3
Source.2493: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.2494: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.2495: DFBPPR12536 ---- Animal proteins ---- Albumin
Source.2496: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.2497: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.2498: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.2499: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.2500: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.2501: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2
Source.2502: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.2503: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.2504: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.2505: DFBPPR12602 ---- Animal proteins ---- Osteopontin
Source.2506: DFBPPR12603 ---- Animal proteins ---- Osteopontin
Source.2507: DFBPPR12613 ---- Animal proteins ---- Glutathione peroxidase 1
Source.2508: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.2509: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.2510: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.2511: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4
Source.2512: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2513: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2514: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2515: DFBPPR12708 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.2516: DFBPPR12710 ---- Animal proteins ---- Endoplasmin
Source.2517: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.2518: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.2519: DFBPPR12731 ---- Animal proteins ---- Cholinesterase
Source.2520: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.2521: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.2522: DFBPPR12751 ---- Animal proteins ---- Glutathione S-transferase Mu 1
Source.2523: DFBPPR12762 ---- Animal proteins ---- SPARC
Source.2524: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform
Source.2525: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2526: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.2527: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.2528: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.2529: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.2530: DFBPPR12833 ---- Animal proteins ---- Cullin-5
Source.2531: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.2532: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.2533: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2
Source.2534: DFBPPR12864 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.2535: DFBPPR12877 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.2536: DFBPPR12878 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.2537: DFBPPR12884 ---- Animal proteins ---- Extracellular superoxide dismutase [Cu-Zn]
Source.2538: DFBPPR12892 ---- Animal proteins ---- Translocon-associated protein subunit alpha
Source.2539: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.2540: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.2541: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.2542: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.2543: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.2544: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.2545: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.2546: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3
Source.2547: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.2548: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.2549: DFBPPR12979 ---- Animal proteins ---- Lutropin subunit beta
Source.2550: DFBPPR12983 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial
Source.2551: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.2552: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form
Source.2553: DFBPPR12995 ---- Animal proteins ---- Alpha-1-acid glycoprotein
Source.2554: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2555: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein
Source.2556: DFBPPR13017 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.2557: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2
Source.2558: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.2559: DFBPPR13053 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.2560: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.2561: DFBPPR13094 ---- Animal proteins ---- Atherin
Source.2562: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form
Source.2563: DFBPPR13116 ---- Animal proteins ---- Ig gamma chain C region
Source.2564: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.2565: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2566: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.2567: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase
Source.2568: DFBPPR13182 ---- Animal proteins ---- Insulin-like growth factor II
Source.2569: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.2570: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A
Source.2571: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.2572: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.2573: DFBPPR13219 ---- Animal proteins ---- Kit ligand
Source.2574: DFBPPR13226 ---- Animal proteins ---- Lutropin/choriogonadotropin subunit beta
Source.2575: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2576: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2577: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.2578: DFBPPR13248 ---- Animal proteins ---- Kallikrein-1E2
Source.2579: DFBPPR13250 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3, truncated
Source.2580: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.2581: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.2582: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.2583: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.2584: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain
Source.2585: DFBPPR13296 ---- Animal proteins ---- Complement component C9
Source.2586: DFBPPR13312 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.2587: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2588: DFBPPR13326 ---- Animal proteins ---- Interferon alpha-1
Source.2589: DFBPPR13328 ---- Animal proteins ---- Interferon alpha-2
Source.2590: DFBPPR13332 ---- Animal proteins ---- Interferon alpha-3
Source.2591: DFBPPR13333 ---- Animal proteins ---- Interferon alpha-4
Source.2592: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2593: DFBPPR13362 ---- Animal proteins ---- Biglycan
Source.2594: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.2595: DFBPPR13426 ---- Animal proteins ---- 2-iminobutanoate/2-iminopropanoate deaminase
Source.2596: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2
Source.2597: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.2598: DFBPPR13443 ---- Animal proteins ---- Kit ligand
Source.2599: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.2600: DFBPPR13455 ---- Animal proteins ---- Glutathione S-transferase P
Source.2601: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2602: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3
Source.2603: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9
Source.2604: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2
Source.2605: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2606: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.2607: DFBPPR13569 ---- Animal proteins ---- Fibroblast growth factor 2
Source.2608: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.2609: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53
Source.2610: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2611: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.2612: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.2613: DFBPPR13614 ---- Animal proteins ---- Insulin-like growth factor II
Source.2614: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.2615: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2616: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.2617: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.2618: DFBPPR13654 ---- Animal proteins ---- Corticoliberin
Source.2619: DFBPPR13662 ---- Animal proteins ---- Aquaporin-2
Source.2620: DFBPPR13665 ---- Animal proteins ---- Kit ligand
Source.2621: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.2622: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.2623: DFBPPR13685 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain
Source.2624: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2625: DFBPPR13701 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.2626: DFBPPR13704 ---- Animal proteins ---- Osteopontin
Source.2627: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.2628: DFBPPR13732 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.2629: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.2630: DFBPPR13736 ---- Animal proteins ---- Cathelin-related peptide SC5
Source.2631: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.2632: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.2633: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2634: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.2635: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9
Source.2636: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor
Source.2637: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.2638: DFBPPR13791 ---- Animal proteins ---- Cholinesterase
Source.2639: DFBPPR13794 ---- Animal proteins ---- Inhibin alpha chain
Source.2640: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor
Source.2641: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.2642: DFBPPR13827 ---- Animal proteins ---- Cathelicidin-1
Source.2643: DFBPPR13834 ---- Animal proteins ---- Biglycan
Source.2644: DFBPPR13836 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.2645: DFBPPR13840 ---- Animal proteins ---- Cytochrome b561
Source.2646: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor
Source.2647: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2648: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.2649: DFBPPR13892 ---- Animal proteins ---- Melanocortin receptor 5
Source.2650: DFBPPR13913 ---- Animal proteins ---- Bombesin receptor subtype-3
Source.2651: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.2652: DFBPPR13966 ---- Animal proteins ---- Promotilin
Source.2653: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.2654: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.2655: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.2656: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.2657: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a
Source.2658: DFBPPR14009 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2659: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2660: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.2661: DFBPPR14047 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A, mitochondrial
Source.2662: DFBPPR14051 ---- Animal proteins ---- Pro-thyrotropin-releasing hormone
Source.2663: DFBPPR14073 ---- Marine protein ---- Elastase-1
Source.2664: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.2665: DFBPPR14090 ---- Marine protein ---- Trypsin-3
Source.2666: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran
Source.2667: DFBPPR14107 ---- Marine protein ---- E3 ubiquitin-protein ligase rnf146
Source.2668: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.2669: DFBPPR14117 ---- Marine protein ---- Ferritin, middle subunit
Source.2670: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.2671: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.2672: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.2673: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1
Source.2674: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein
Source.2675: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.2676: DFBPPR14153 ---- Marine protein ---- Progonadoliberin-3
Source.2677: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.2678: DFBPPR14240 ---- Marine protein ---- Otolin-1
Source.2679: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial
Source.2680: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.2681: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase
Source.2682: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.2683: DFBPPR14379 ---- Marine protein ---- Elongation factor 1-alpha
Source.2684: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta
Source.2685: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.2686: DFBPPR14447 ---- Marine protein ---- Protein translocase subunit SecY
Source.2687: DFBPPR14448 ---- Marine protein ---- 50S ribosomal protein L2, chloroplastic
Source.2688: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.2689: DFBPPR14509 ---- Marine protein ---- Uncharacterized protein ycf37
Source.2690: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2
Source.2691: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.2692: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2
Source.2693: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.2694: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2
Source.2695: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.2696: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.2697: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing]
Source.2698: DFBPPR14612 ---- Marine protein ---- Complement component C9
Source.2699: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha
Source.2700: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1
Source.2701: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.2702: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3
Source.2703: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain
Source.2704: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.2705: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.2706: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.2707: DFBPPR14660 ---- Marine protein ---- Otolin-1
Source.2708: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.2709: DFBPPR14686 ---- Marine protein ---- Cytochrome c oxidase subunit 6A, mitochondrial
Source.2710: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme
Source.2711: DFBPPR14768 ---- Marine protein ---- Tachylectin-2
Source.2712: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.2713: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific
Source.2714: DFBPPR14900 ---- Microorganism protein ---- Ethanol acetyltransferase 1
Source.2715: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial
Source.2716: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.2717: DFBPPR14941 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP5
Source.2718: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27
Source.2719: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.2720: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.2721: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like
Source.2722: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3
Source.2723: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.2724: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.2725: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.2726: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16
Source.2727: DFBPPR15015 ---- Microorganism protein ---- Postreplication repair E3 ubiquitin-protein ligase RAD18
Source.2728: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.2729: DFBPPR15046 ---- Microorganism protein ---- Histone acetyltransferase type B catalytic subunit
Source.2730: DFBPPR15051 ---- Microorganism protein ---- Autophagy-related protein 21
Source.2731: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.2732: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.2733: DFBPPR15076 ---- Microorganism protein ---- Fe-S cluster assembly protein DRE2
Source.2734: DFBPPR15106 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.2735: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10
Source.2736: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1
Source.2737: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.2738: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.2739: DFBPPR15158 ---- Microorganism protein ---- DASH complex subunit DAM1
Source.2740: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2
Source.2741: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.2742: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84
Source.2743: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.2744: DFBPPR15180 ---- Microorganism protein ---- Protein ROT1
Source.2745: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.2746: DFBPPR15185 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 8
Source.2747: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.2748: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.2749: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1
Source.2750: DFBPPR15220 ---- Microorganism protein ---- Spindle assembly checkpoint component MAD1
Source.2751: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase
Source.2752: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.2753: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.2754: DFBPPR15248 ---- Microorganism protein ---- DASH complex subunit SPC34
Source.2755: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7
Source.2756: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4
Source.2757: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.2758: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.2759: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1
Source.2760: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.2761: DFBPPR15415 ---- Microorganism protein ---- Transcription initiation factor TFIID subunit 4
Source.2762: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial
Source.2763: DFBPPR15442 ---- Microorganism protein ---- Type 1 phosphatases regulator YPI1
Source.2764: DFBPPR15447 ---- Microorganism protein ---- Genetic interactor of prohibitins 3, mitochondrial
Source.2765: DFBPPR15448 ---- Microorganism protein ---- 40S ribosomal protein S0
Source.2766: DFBPPR15458 ---- Microorganism protein ---- Mitochondrial glycine transporter
Source.2767: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1
Source.2768: DFBPPR15495 ---- Microorganism protein ---- DNA replication complex GINS protein PSF2
Source.2769: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.2770: DFBPPR15545 ---- Microorganism protein ---- Ubiquinone biosynthesis protein COQ4, mitochondrial
Source.2771: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.2772: DFBPPR15587 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 3
Source.2773: DFBPPR15591 ---- Microorganism protein ---- Ras modification protein ERF4
Source.2774: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.2775: DFBPPR15605 ---- Microorganism protein ---- Ribosome biogenesis protein NSA2
Source.2776: DFBPPR15609 ---- Microorganism protein ---- Shugoshin
Source.2777: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2
Source.2778: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1
Source.2779: DFBPPR15626 ---- Microorganism protein ---- Nucleolar protein 12
Source.2780: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.2781: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4
Source.2782: DFBPPR15686 ---- Microorganism protein ---- Polyadenylation factor subunit 2
Source.2783: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.2784: DFBPPR15704 ---- Microorganism protein ---- Oxidation resistance protein 1
Source.2785: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22
Source.2786: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.2787: DFBPPR15737 ---- Microorganism protein ---- Required for respiratory growth protein 9, mitochondrial
Source.2788: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21
Source.2789: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8
Source.2790: DFBPPR15748 ---- Microorganism protein ---- Vacuolar membrane protein KLLA0F03465g
Source.2791: DFBPPR15751 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 41, mitochondrial
Source.2792: DFBPPR15773 ---- Microorganism protein ---- 37S ribosomal protein S25, mitochondrial
Source.2793: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase
Source.2794: DFBPPR15796 ---- Microorganism protein ---- Folylpolyglutamate synthase
Source.2795: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.2796: DFBPPR15804 ---- Microorganism protein ---- Thymidylate synthase
Source.2797: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.2798: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.2799: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component
Source.2800: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.2801: DFBPPR15860 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.2802: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.2803: DFBPPR15865 ---- Microorganism protein ---- Hydrophobin-1
Source.2804: DFBPPR15868 ---- Microorganism protein ---- Thymidylate synthase
Source.2805: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.2806: DFBPPR15874 ---- Microorganism protein ---- Hydrophobin-2
Source.2807: DFBPPR15880 ---- Microorganism protein ---- 40S ribosomal protein S13
Source.2808: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase
Source.2809: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.2810: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.2811: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.2812: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.2813: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B
Source.2814: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase
Source.2815: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.2816: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.2817: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.2818: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2819: DFBPPR7826 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-2
Source.2820: DFBPPR7829 ---- Plant protein ---- Cyanate hydratase
Source.2821: DFBPPR7837 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic
Source.2822: DFBPPR7844 ---- Plant protein ---- Actin-1
Source.2823: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1
Source.2824: DFBPPR7870 ---- Plant protein ---- Translation initiation factor IF-1, chloroplastic
Source.2825: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1
Source.2826: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1
Source.2827: DFBPPR7912 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.2828: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2
Source.2829: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.2830: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.2831: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.2832: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.2833: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha
Source.2834: DFBPPR7966 ---- Plant protein ---- GTP-binding nuclear protein Ran/TC4
Source.2835: DFBPPR8033 ---- Plant protein ---- Uricase-2
Source.2836: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.2837: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.2838: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.2839: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.2840: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2841: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.2842: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.2843: DFBPPR8108 ---- Plant protein ---- Pathogenesis-related protein 1
Source.2844: DFBPPR8125 ---- Plant protein ---- Eukaryotic translation initiation factor 5
Source.2845: DFBPPR8130 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.2846: DFBPPR8150 ---- Plant protein ---- Pathogenesis-related protein 2
Source.2847: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.2848: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.2849: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.2850: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.2851: DFBPPR8279 ---- Plant protein ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.2852: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2853: DFBPPR8290 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic
Source.2854: DFBPPR8303 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.2855: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.2856: DFBPPR8353 ---- Plant protein ---- 17.9 kDa class II heat shock protein
Taste proterties & Structure
Bitterness
Bitter taste prediction
SMILES N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP 9029
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214