E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0425(Multifunctional peptide)
DFBP ID DFBPMUFU0425
Peptide sequence MY
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 2
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI0491 Sardine muscle Muscle protein

N.D

DFBPACEI1891 Amaranth seed proteins Amaranth glutelins

N.D

Antioxidative peptides
DFBPID Organism Precursor protein Residue position
DFBPANOX0305 Sardine Sardine muscle protein

N.D

Physical & computational properties
Three-letter amino acid Met-Tyr
Single-letter amino acid MY
Peptide length 2
Theoretical mass 312.38 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.92 c
GRAVY 0.3000
Hydrophilic residue ratio 50%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein
Source.2: DFBPPR0776 ---- Plant proteins ---- 11S globulin
Source.3: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2
Source.4: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8
Source.5: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.6: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1
Source.7: DFBPPR0843 ---- Plant proteins ---- MADS-box transcription factor 1
Source.8: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.9: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.10: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.11: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.12: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.13: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.14: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.15: DFBPPR0867 ---- Plant proteins ---- Ras-related protein Rab5A
Source.16: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.17: DFBPPR0879 ---- Plant proteins ---- UDP-arabinopyranose mutase 1
Source.18: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8
Source.19: DFBPPR0892 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 1
Source.20: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1
Source.21: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2
Source.22: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase
Source.23: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.24: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.25: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.26: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.27: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.28: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.29: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a
Source.30: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6
Source.31: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.32: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.33: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.34: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.35: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.36: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.37: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.38: DFBPPR0944 ---- Plant proteins ---- UDP-arabinopyranose mutase 3
Source.39: DFBPPR0949 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK7
Source.40: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.41: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5
Source.42: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.43: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.44: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog
Source.45: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.46: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.47: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.48: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1
Source.49: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1
Source.50: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.51: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic
Source.52: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.53: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.54: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.55: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1
Source.56: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.57: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31
Source.58: DFBPPR1001 ---- Plant proteins ---- GRF-interacting factor 1
Source.59: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.60: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.61: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.62: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.63: DFBPPR1024 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK4
Source.64: DFBPPR1034 ---- Plant proteins ---- bZIP transcription factor 50
Source.65: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3
Source.66: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.67: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.68: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5
Source.69: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.70: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A
Source.71: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.72: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1
Source.73: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.74: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.75: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.76: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1
Source.77: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.78: DFBPPR1084 ---- Plant proteins ---- Protein AUXIN-REGULATED GENE INVOLVED IN ORGAN SIZE
Source.79: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.80: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.81: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic
Source.82: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.83: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2
Source.84: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic
Source.85: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.86: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.87: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3
Source.88: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.89: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.90: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.91: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.92: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B
Source.93: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.94: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.95: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.96: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.97: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.98: DFBPPR1179 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 1, mitochondrial
Source.99: DFBPPR1185 ---- Plant proteins ---- PHD finger protein EHD3
Source.100: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.101: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1
Source.102: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.103: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.104: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3
Source.105: DFBPPR1244 ---- Plant proteins ---- MADS-box transcription factor 58
Source.106: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10
Source.107: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.108: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.109: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.110: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.111: DFBPPR1281 ---- Plant proteins ---- Arsenate reductase 2.2
Source.112: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.113: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.114: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.115: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39
Source.116: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.117: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.118: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic
Source.119: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.120: DFBPPR1308 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 4
Source.121: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2
Source.122: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1
Source.123: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d
Source.124: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic
Source.125: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.126: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.127: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14
Source.128: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.129: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.130: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.131: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.132: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.133: DFBPPR1365 ---- Plant proteins ---- Replication protein A 32 kDa subunit A
Source.134: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.135: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.136: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.137: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.138: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic
Source.139: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.140: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2
Source.141: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.142: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.143: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2
Source.144: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.145: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.146: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.147: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.148: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.149: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.150: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29
Source.151: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.152: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.153: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.154: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E
Source.155: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.156: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.157: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.158: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.159: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.160: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.161: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase
Source.162: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.163: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.164: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3
Source.165: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.166: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.167: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.168: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.169: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein
Source.170: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.171: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4
Source.172: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5
Source.173: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.174: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.175: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.176: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.177: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.178: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.179: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.180: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.181: DFBPPR1554 ---- Plant proteins ---- Signal peptidase complex-like protein DTM1
Source.182: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19
Source.183: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.184: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.185: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.186: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.187: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.188: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A
Source.189: DFBPPR1603 ---- Plant proteins ---- MADS-box transcription factor 5
Source.190: DFBPPR1604 ---- Plant proteins ---- Putative bifunctional dihydrofolate reductase-thymidylate synthase
Source.191: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.192: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1
Source.193: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.194: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.195: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.196: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.197: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71
Source.198: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.199: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.200: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a
Source.201: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.202: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.203: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.204: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial
Source.205: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.206: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.207: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.208: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1
Source.209: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.210: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial
Source.211: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A
Source.212: DFBPPR1675 ---- Plant proteins ---- Protein LSD1
Source.213: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic
Source.214: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7
Source.215: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.216: DFBPPR1681 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.217: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.218: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.219: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.220: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.221: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.222: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.223: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.224: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4
Source.225: DFBPPR1726 ---- Plant proteins ---- SPX domain-containing protein 1
Source.226: DFBPPR1727 ---- Plant proteins ---- Cyclin-dependent kinase C-3
Source.227: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.228: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.229: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase
Source.230: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1
Source.231: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.232: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.233: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.234: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic
Source.235: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.236: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.237: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.238: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1
Source.239: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.240: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial
Source.241: DFBPPR1771 ---- Plant proteins ---- Replication protein A 32 kDa subunit B
Source.242: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.243: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1
Source.244: DFBPPR1782 ---- Plant proteins ---- Transcription factor BHLH133
Source.245: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.246: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.247: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.248: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.249: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.250: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2
Source.251: DFBPPR1810 ---- Plant proteins ---- Shaggy-related protein kinase GSK4
Source.252: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2
Source.253: DFBPPR1823 ---- Plant proteins ---- Protein YABBY 1
Source.254: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.255: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.256: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.257: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.258: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.259: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.260: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.261: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.262: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.263: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.264: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.265: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.266: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.267: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.268: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.269: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.270: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.271: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.272: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.273: DFBPPR1948 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5B
Source.274: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.275: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.276: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.277: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.278: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.279: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2
Source.280: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.281: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.282: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.283: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.284: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.285: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial
Source.286: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.287: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.288: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.289: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8
Source.290: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.291: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.292: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.293: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.294: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.295: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.296: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.297: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.298: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.299: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.300: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15
Source.301: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.302: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.303: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3
Source.304: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.305: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2
Source.306: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa
Source.307: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.308: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.309: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.310: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.311: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C
Source.312: DFBPPR2081 ---- Plant proteins ---- Expansin-A1
Source.313: DFBPPR2085 ---- Plant proteins ---- Protein LOL5
Source.314: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.315: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.316: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.317: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80
Source.318: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5
Source.319: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.320: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.321: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.322: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.323: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.324: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.325: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic
Source.326: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.327: DFBPPR2150 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5A
Source.328: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.329: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.330: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.331: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.332: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.333: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.334: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.335: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.336: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.337: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.338: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.339: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.340: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.341: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.342: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.343: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2
Source.344: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.345: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.346: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.347: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.348: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.349: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.350: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.351: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.352: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.353: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.354: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.355: DFBPPR2223 ---- Plant proteins ---- Urease
Source.356: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.357: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.358: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.359: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12
Source.360: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.361: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.362: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.363: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13
Source.364: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial
Source.365: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.366: DFBPPR2258 ---- Plant proteins ---- Proteasome subunit beta type-3
Source.367: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.368: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29
Source.369: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.370: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.371: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.372: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.373: DFBPPR2272 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 2
Source.374: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.375: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.376: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.377: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.378: DFBPPR2286 ---- Plant proteins ---- Proteasome subunit alpha type-4-1
Source.379: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B
Source.380: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.381: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic
Source.382: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.383: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.384: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.385: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.386: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.387: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2
Source.388: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.389: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.390: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.391: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.392: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.393: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.394: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.395: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.396: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.397: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.398: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic
Source.399: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.400: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10
Source.401: DFBPPR2390 ---- Plant proteins ---- Proteasome subunit alpha type-4-2
Source.402: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic
Source.403: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5
Source.404: DFBPPR2397 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2A
Source.405: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.406: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3
Source.407: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.408: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.409: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.410: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.411: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1
Source.412: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1
Source.413: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.414: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.415: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.416: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic
Source.417: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.418: DFBPPR2448 ---- Plant proteins ---- Expansin-A9
Source.419: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.420: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.421: DFBPPR2457 ---- Plant proteins ---- Proteasome subunit alpha type-4-3
Source.422: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.423: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.424: DFBPPR2466 ---- Plant proteins ---- MADS-box transcription factor 26
Source.425: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14
Source.426: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1
Source.427: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2
Source.428: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1
Source.429: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic
Source.430: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.431: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20
Source.432: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.433: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900
Source.434: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic
Source.435: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13
Source.436: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.437: DFBPPR2520 ---- Plant proteins ---- Metallothionein-like protein 4C
Source.438: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.439: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.440: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.441: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20
Source.442: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.443: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.444: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.445: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic
Source.446: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4
Source.447: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.448: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.449: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4
Source.450: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial
Source.451: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.452: DFBPPR2584 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1
Source.453: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.454: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic
Source.455: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.456: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1
Source.457: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.458: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.459: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.460: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.461: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.462: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.463: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.464: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24
Source.465: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.466: DFBPPR2639 ---- Plant proteins ---- Seed allergenic protein RAG2
Source.467: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.468: DFBPPR2641 ---- Plant proteins ---- 18.8 kDa class V heat shock protein
Source.469: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18
Source.470: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.471: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.472: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8
Source.473: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2
Source.474: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.475: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.476: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.477: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein
Source.478: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.479: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.480: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase
Source.481: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.482: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A
Source.483: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.484: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27
Source.485: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.486: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.487: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.488: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.489: DFBPPR2733 ---- Plant proteins ---- Metallothionein-like protein 1B
Source.490: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.491: DFBPPR2735 ---- Plant proteins ---- Expansin-A24
Source.492: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.493: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.494: DFBPPR2748 ---- Plant proteins ---- Secretory carrier-associated membrane protein 6
Source.495: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.496: DFBPPR2751 ---- Plant proteins ---- Actin-7
Source.497: DFBPPR2752 ---- Plant proteins ---- Secretory carrier-associated membrane protein 5
Source.498: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9
Source.499: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.500: DFBPPR2763 ---- Plant proteins ---- Actin-1
Source.501: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.502: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.503: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.504: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.505: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.506: DFBPPR2776 ---- Plant proteins ---- Splicing factor U2af small subunit A
Source.507: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.508: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2
Source.509: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.510: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.511: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.512: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.513: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.514: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.515: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.516: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.517: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.518: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.519: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.520: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3
Source.521: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10
Source.522: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.523: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.524: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A
Source.525: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.526: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.527: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.528: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B
Source.529: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.530: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.531: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.532: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.533: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6
Source.534: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.535: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.536: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.537: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D
Source.538: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.539: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.540: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.541: DFBPPR2877 ---- Plant proteins ---- Splicing factor U2af small subunit B
Source.542: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.543: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.544: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2
Source.545: DFBPPR2892 ---- Plant proteins ---- 30S ribosomal protein S18, chloroplastic
Source.546: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.547: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.548: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.549: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.550: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.551: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.552: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.553: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.554: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5
Source.555: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1
Source.556: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.557: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1
Source.558: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.559: DFBPPR2974 ---- Plant proteins ---- Derlin-1
Source.560: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4
Source.561: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.562: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23
Source.563: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.564: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.565: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B
Source.566: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.567: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.568: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.569: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1
Source.570: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.571: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic
Source.572: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24
Source.573: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase
Source.574: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.575: DFBPPR3052 ---- Plant proteins ---- MADS-box transcription factor 31
Source.576: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16
Source.577: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.578: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.579: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.580: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.581: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.582: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.583: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.584: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.585: DFBPPR3087 ---- Plant proteins ---- Actin-3
Source.586: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.587: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.588: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.589: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.590: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.591: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21
Source.592: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.593: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial
Source.594: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2
Source.595: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.596: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.597: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.598: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.599: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2
Source.600: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.601: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.602: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.603: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.604: DFBPPR3148 ---- Plant proteins ---- Growth-regulating factor 8
Source.605: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.606: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11
Source.607: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.608: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.609: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.610: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.611: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.612: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300
Source.613: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.614: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.615: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3
Source.616: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B
Source.617: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic
Source.618: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3
Source.619: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.620: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain
Source.621: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic
Source.622: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.623: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.624: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.625: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.626: DFBPPR3283 ---- Plant proteins ---- Auxin-responsive protein IAA21
Source.627: DFBPPR3289 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3b
Source.628: DFBPPR3293 ---- Plant proteins ---- Protein-ribulosamine 3-kinase, chloroplastic
Source.629: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.630: DFBPPR3306 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3a
Source.631: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.632: DFBPPR3311 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 2
Source.633: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.634: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.635: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8
Source.636: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3
Source.637: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9
Source.638: DFBPPR3328 ---- Plant proteins ---- Putative expansin-A30
Source.639: DFBPPR3338 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1a
Source.640: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.641: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2
Source.642: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.643: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6
Source.644: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4
Source.645: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.646: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.647: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.648: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.649: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.650: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14
Source.651: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.652: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.653: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.654: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.655: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.656: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.657: DFBPPR3400 ---- Plant proteins ---- Auxin-responsive protein IAA12
Source.658: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.659: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.660: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9
Source.661: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5
Source.662: DFBPPR3414 ---- Plant proteins ---- Seed allergenic protein RA5
Source.663: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6
Source.664: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.665: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.666: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.667: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.668: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2
Source.669: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F
Source.670: DFBPPR3437 ---- Plant proteins ---- Putative acetyl-coenzyme A carboxylase carboxyl transferase subunit beta-like protein
Source.671: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.672: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.673: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.674: DFBPPR3456 ---- Plant proteins ---- Maturase K
Source.675: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.676: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A
Source.677: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.678: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5
Source.679: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B
Source.680: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9
Source.681: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.682: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.683: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2
Source.684: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.685: DFBPPR3542 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 2
Source.686: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.687: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8
Source.688: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.689: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.690: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.691: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16
Source.692: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.693: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.694: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.695: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.696: DFBPPR3582 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7c
Source.697: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.698: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.699: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.700: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.701: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.702: DFBPPR3605 ---- Plant proteins ---- Thioredoxin F, chloroplastic
Source.703: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.704: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1
Source.705: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.706: DFBPPR3615 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7b
Source.707: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.708: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.709: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.710: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6
Source.711: DFBPPR3642 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7e
Source.712: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a
Source.713: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2
Source.714: DFBPPR3654 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7a
Source.715: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9
Source.716: DFBPPR3666 ---- Plant proteins ---- Glutelin type-B 5
Source.717: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.718: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.719: DFBPPR3691 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7d
Source.720: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.721: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11
Source.722: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.723: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15
Source.724: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.725: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.726: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.727: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.728: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1
Source.729: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.730: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.731: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2
Source.732: DFBPPR3754 ---- Plant proteins ---- Auxin-responsive protein IAA30
Source.733: DFBPPR3758 ---- Plant proteins ---- Target of rapamycin complex subunit LST8
Source.734: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.735: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.736: DFBPPR3795 ---- Plant proteins ---- NRR repressor homolog 1
Source.737: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.738: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.739: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.740: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.741: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1
Source.742: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.743: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C
Source.744: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.745: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2
Source.746: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2
Source.747: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.748: DFBPPR3849 ---- Plant proteins ---- Auxin-responsive protein IAA13
Source.749: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21
Source.750: DFBPPR3861 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.751: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1
Source.752: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1
Source.753: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.754: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1
Source.755: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.756: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.757: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20
Source.758: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.759: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.760: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.761: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5
Source.762: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.763: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.764: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.765: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2
Source.766: DFBPPR3916 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1b
Source.767: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b
Source.768: DFBPPR3923 ---- Plant proteins ---- Protein PHOTOSYSTEM I ASSEMBLY 2, chloroplastic
Source.769: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1
Source.770: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.771: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.772: DFBPPR3939 ---- Plant proteins ---- Non-specific lipid-transfer protein 4
Source.773: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.774: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA
Source.775: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.776: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3
Source.777: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.778: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.779: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5
Source.780: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.781: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.782: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.783: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3
Source.784: DFBPPR4022 ---- Plant proteins ---- Protein TIFY 11f
Source.785: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.786: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.787: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.788: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A
Source.789: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1
Source.790: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.791: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.792: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.793: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69
Source.794: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.795: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.796: DFBPPR4055 ---- Plant proteins ---- Serpin-ZXB
Source.797: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog
Source.798: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like
Source.799: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5
Source.800: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.801: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.802: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3
Source.803: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.804: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.805: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic
Source.806: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.807: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2
Source.808: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.809: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.810: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.811: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.812: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1
Source.813: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.814: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.815: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600
Source.816: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16
Source.817: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.818: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2
Source.819: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2
Source.820: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.821: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7
Source.822: DFBPPR4151 ---- Plant proteins ---- Metallothionein-like protein 4A
Source.823: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.824: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10
Source.825: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.826: DFBPPR4192 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic
Source.827: DFBPPR4193 ---- Plant proteins ---- Peptidyl-tRNA hydrolase, mitochondrial
Source.828: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1
Source.829: DFBPPR4196 ---- Plant proteins ---- Cyclin-D5-3
Source.830: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.831: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.832: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.833: DFBPPR4213 ---- Plant proteins ---- Mitochondrial import inner membrane translocase subunit Tim9
Source.834: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2
Source.835: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.836: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.837: DFBPPR4228 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 2
Source.838: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1
Source.839: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3
Source.840: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.841: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2
Source.842: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1
Source.843: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1
Source.844: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4
Source.845: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.846: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16
Source.847: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6
Source.848: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3
Source.849: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2
Source.850: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.851: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP
Source.852: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.853: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.854: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.855: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.856: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.857: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.858: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B
Source.859: DFBPPR4304 ---- Plant proteins ---- Signal recognition particle 14 kDa protein
Source.860: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.861: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C
Source.862: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.863: DFBPPR4318 ---- Plant proteins ---- Golgin-84
Source.864: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11
Source.865: DFBPPR4328 ---- Plant proteins ---- Metallothionein-like protein 2A
Source.866: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.867: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24
Source.868: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.869: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3
Source.870: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.871: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4
Source.872: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E
Source.873: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.874: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2
Source.875: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5
Source.876: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic
Source.877: DFBPPR4393 ---- Plant proteins ---- Late embryogenesis abundant protein 14
Source.878: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.879: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.880: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8
Source.881: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6
Source.882: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.883: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9
Source.884: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.885: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18
Source.886: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.887: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.888: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.889: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.890: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45
Source.891: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3
Source.892: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3
Source.893: DFBPPR4458 ---- Plant proteins ---- CASP-like protein 2C2
Source.894: DFBPPR4461 ---- Plant proteins ---- Probable calcium-binding protein CML18
Source.895: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.896: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.897: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.898: DFBPPR4488 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.899: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.900: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1
Source.901: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L
Source.902: DFBPPR4501 ---- Plant proteins ---- Metallothionein-like protein 4B
Source.903: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.904: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.905: DFBPPR4522 ---- Plant proteins ---- Probable calcium-binding protein CML25/26
Source.906: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.907: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.908: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3
Source.909: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14
Source.910: DFBPPR4547 ---- Plant proteins ---- Probable calcium-binding protein CML31
Source.911: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.912: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.913: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.914: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1
Source.915: DFBPPR4572 ---- Plant proteins ---- DNA-binding protein S1FA1
Source.916: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.917: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.918: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.919: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.920: DFBPPR4596 ---- Plant proteins ---- Putative calcium-binding protein CML19
Source.921: DFBPPR4597 ---- Plant proteins ---- Putative calcium-binding protein CML23
Source.922: DFBPPR4607 ---- Plant proteins ---- Protein LOL2
Source.923: DFBPPR4610 ---- Plant proteins ---- Protein LOL3
Source.924: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3
Source.925: DFBPPR4620 ---- Plant proteins ---- Protein LOL1
Source.926: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43
Source.927: DFBPPR4640 ---- Plant proteins ---- Protein Brevis radix-like 4
Source.928: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900
Source.929: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7
Source.930: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2
Source.931: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.932: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.933: DFBPPR4667 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 4
Source.934: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1
Source.935: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.936: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3
Source.937: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.938: DFBPPR4692 ---- Plant proteins ---- Probable protein ABIL4
Source.939: DFBPPR4699 ---- Plant proteins ---- Probable GTP-binding protein OBGC2
Source.940: DFBPPR4700 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 6
Source.941: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32
Source.942: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.943: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51
Source.944: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.945: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.946: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.947: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.948: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.949: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400
Source.950: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.951: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.952: DFBPPR4758 ---- Plant proteins ---- BURP domain-containing protein 7
Source.953: DFBPPR4759 ---- Plant proteins ---- 60S ribosomal protein L18a
Source.954: DFBPPR4761 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 13
Source.955: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35
Source.956: DFBPPR4770 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 4
Source.957: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10
Source.958: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.959: DFBPPR4802 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 34
Source.960: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000
Source.961: DFBPPR4813 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0157700
Source.962: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1
Source.963: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.964: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2
Source.965: DFBPPR4840 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 3
Source.966: DFBPPR4841 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 5
Source.967: DFBPPR4850 ---- Plant proteins ---- Putative ripening-related protein 1
Source.968: DFBPPR4860 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.969: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37
Source.970: DFBPPR4878 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 10
Source.971: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.972: DFBPPR4899 ---- Plant proteins ---- Casein kinase 1
Source.973: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.974: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.975: DFBPPR4905 ---- Plant proteins ---- Light-regulated protein, chloroplastic
Source.976: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3
Source.977: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.978: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1
Source.979: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic
Source.980: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID
Source.981: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8
Source.982: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.983: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.984: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.985: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.986: DFBPPR4938 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 2, mitochondrial
Source.987: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1
Source.988: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.989: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1
Source.990: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.991: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.992: DFBPPR4965 ---- Plant proteins ---- Glycinin G1
Source.993: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.994: DFBPPR4973 ---- Plant proteins ---- Glycinin G2
Source.995: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1
Source.996: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.997: DFBPPR4992 ---- Plant proteins ---- Glycinin G3
Source.998: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.999: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.1000: DFBPPR5021 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.1001: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1002: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.1003: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.1004: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1005: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.1006: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1007: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.1008: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.1009: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1010: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1011: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.1012: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1
Source.1013: DFBPPR5092 ---- Plant proteins ---- Glutathione S-transferase 3
Source.1014: DFBPPR5099 ---- Plant proteins ---- Metalloendoproteinase 1
Source.1015: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.1016: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1017: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.1018: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.1019: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1020: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7
Source.1021: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.1022: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1023: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.1024: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1
Source.1025: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1026: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1027: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.1028: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.1029: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.1030: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.1031: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.1032: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.1033: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.1034: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.1035: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.1036: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1037: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.1038: DFBPPR5265 ---- Plant proteins ---- Auxin-induced protein AUX22
Source.1039: DFBPPR5271 ---- Plant proteins ---- Auxin-induced protein AUX28
Source.1040: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9
Source.1041: DFBPPR5280 ---- Plant proteins ---- CASP-like protein 6
Source.1042: DFBPPR5283 ---- Plant proteins ---- Actin-3
Source.1043: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.1044: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2
Source.1045: DFBPPR5304 ---- Plant proteins ---- Maturase K
Source.1046: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1
Source.1047: DFBPPR5330 ---- Plant proteins ---- CASP-like protein 2C1
Source.1048: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.1049: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.1050: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.1051: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.1052: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.1053: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.1054: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.1055: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.1056: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.1057: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.1058: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase
Source.1059: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A
Source.1060: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.1061: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.1062: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.1063: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.1064: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6
Source.1065: DFBPPR5434 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.1066: DFBPPR5437 ---- Plant proteins ---- Exopolygalacturonase
Source.1067: DFBPPR5442 ---- Plant proteins ---- GRF-interacting factor 1
Source.1068: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.1069: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.1070: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.1071: DFBPPR5451 ---- Plant proteins ---- Histone deacetylase HDT1
Source.1072: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.1073: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial
Source.1074: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.1075: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.1076: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1077: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.1078: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1079: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.1080: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.1081: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.1082: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.1083: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.1084: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.1085: DFBPPR5513 ---- Plant proteins ---- Bifunctional TENA2 protein
Source.1086: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.1087: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.1088: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.1089: DFBPPR5527 ---- Plant proteins ---- Exopolygalacturonase
Source.1090: DFBPPR5528 ---- Plant proteins ---- Exopolygalacturonase
Source.1091: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1092: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.1093: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1
Source.1094: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.1095: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.1096: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase
Source.1097: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.1098: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B
Source.1099: DFBPPR5555 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial
Source.1100: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.1101: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1102: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.1103: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.1104: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.1105: DFBPPR5587 ---- Plant proteins ---- Protein PHOTOSYSTEM I ASSEMBLY 2, chloroplastic
Source.1106: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1107: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.1108: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.1109: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic
Source.1110: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.1111: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.1112: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I
Source.1113: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.1114: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.1115: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.1116: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1117: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.1118: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.1119: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1120: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.1121: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.1122: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.1123: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1124: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.1125: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.1126: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.1127: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.1128: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.1129: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic
Source.1130: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.1131: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.1132: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.1133: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.1134: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1
Source.1135: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.1136: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2
Source.1137: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1
Source.1138: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic
Source.1139: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1140: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.1141: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1142: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.1143: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B
Source.1144: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2
Source.1145: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.1146: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.1147: DFBPPR5834 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.1148: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.1149: DFBPPR5841 ---- Plant proteins ---- Actin-1
Source.1150: DFBPPR5847 ---- Plant proteins ---- Large ribosomal RNA subunit accumulation protein YCED homolog 1, chloroplastic
Source.1151: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.1152: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.1153: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.1154: DFBPPR5859 ---- Plant proteins ---- 30S ribosomal protein S18, chloroplastic
Source.1155: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase
Source.1156: DFBPPR5871 ---- Plant proteins ---- Cell number regulator 2
Source.1157: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.1158: DFBPPR5900 ---- Plant proteins ---- Histone deacetylase HDT2
Source.1159: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.1160: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.1161: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1
Source.1162: DFBPPR5912 ---- Plant proteins ---- Histone deacetylase HDT3
Source.1163: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.1164: DFBPPR5920 ---- Plant proteins ---- Cell number regulator 1
Source.1165: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.1166: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A
Source.1167: DFBPPR5946 ---- Plant proteins ---- Maturase K
Source.1168: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1
Source.1169: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B
Source.1170: DFBPPR5958 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.1171: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.1172: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2
Source.1173: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2
Source.1174: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.1175: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9
Source.1176: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.1177: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.1178: DFBPPR6052 ---- Plant proteins ---- Cystatin-1
Source.1179: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3
Source.1180: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.1181: DFBPPR6083 ---- Plant proteins ---- Cell number regulator 7
Source.1182: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10
Source.1183: DFBPPR6106 ---- Plant proteins ---- Cell number regulator 4
Source.1184: DFBPPR6112 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.1185: DFBPPR6125 ---- Plant proteins ---- Cell number regulator 3
Source.1186: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.1187: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.1188: DFBPPR6177 ---- Plant proteins ---- Unknown protein from spot 159 of 2D-PAGE of etiolated coleoptile
Source.1189: DFBPPR6187 ---- Plant proteins ---- Transposable element activator uncharacterized 12 kDa protein
Source.1190: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial
Source.1191: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.1192: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial
Source.1193: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic
Source.1194: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1195: DFBPPR6228 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.1196: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.1197: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.1198: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1199: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.1200: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1201: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1202: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.1203: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1204: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1205: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.1206: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64
Source.1207: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1208: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.1209: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.1210: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic
Source.1211: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH
Source.1212: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.1213: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1214: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.1215: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.1216: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.1217: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase
Source.1218: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1219: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.1220: DFBPPR6380 ---- Plant proteins ---- Legumin A
Source.1221: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1222: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3
Source.1223: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1224: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.1225: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.1226: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.1227: DFBPPR6425 ---- Plant proteins ---- Legumin A2
Source.1228: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.1229: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.1230: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.1231: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.1232: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.1233: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.1234: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.1235: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase
Source.1236: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.1237: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.1238: DFBPPR6473 ---- Plant proteins ---- OBERON-like protein
Source.1239: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.1240: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.1241: DFBPPR6509 ---- Plant proteins ---- Auxin-induced protein IAA6
Source.1242: DFBPPR6542 ---- Plant proteins ---- Maturase K
Source.1243: DFBPPR6550 ---- Plant proteins ---- Actin-3
Source.1244: DFBPPR6551 ---- Plant proteins ---- Actin-2
Source.1245: DFBPPR6552 ---- Plant proteins ---- Actin-1
Source.1246: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1247: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1248: DFBPPR6559 ---- Plant proteins ---- Truncated basic helix-loop-helix protein A
Source.1249: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.1250: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.1251: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.1252: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.1253: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.1254: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.1255: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.1256: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.1257: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.1258: DFBPPR6659 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit
Source.1259: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.1260: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1261: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1262: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic
Source.1263: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.1264: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19
Source.1265: DFBPPR6677 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 2
Source.1266: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.1267: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.1268: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1269: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.1270: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.1271: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.1272: DFBPPR6724 ---- Plant proteins ---- Putative ATP synthase protein YMF19
Source.1273: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.1274: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1275: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53
Source.1276: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.1277: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.1278: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.1279: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1280: DFBPPR6762 ---- Plant proteins ---- Nuclear ribonuclease Z
Source.1281: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1282: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.1283: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A
Source.1284: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1285: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1286: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B
Source.1287: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B
Source.1288: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1289: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1290: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a
Source.1291: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1292: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A
Source.1293: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C
Source.1294: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1295: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.1296: DFBPPR6840 ---- Plant proteins ---- 30S ribosomal protein S18, chloroplastic
Source.1297: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1
Source.1298: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1299: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.1300: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.1301: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1302: DFBPPR6882 ---- Plant proteins ---- Maturase K
Source.1303: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.1304: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5
Source.1305: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.1306: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2
Source.1307: DFBPPR6963 ---- Plant proteins ---- Metallothionein-like protein 1
Source.1308: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6
Source.1309: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7
Source.1310: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4
Source.1311: DFBPPR6986 ---- Plant proteins ---- Avenin-like b11
Source.1312: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10
Source.1313: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9
Source.1314: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8
Source.1315: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2
Source.1316: DFBPPR6993 ---- Plant proteins ---- Avenin-like b3
Source.1317: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.1318: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.1319: DFBPPR7013 ---- Plant proteins ---- Protein MLO
Source.1320: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic
Source.1321: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.1322: DFBPPR7022 ---- Plant proteins ---- Alpha-amylase inhibitor BMAI-1
Source.1323: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2
Source.1324: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7
Source.1325: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1326: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.1327: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.1328: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1329: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.1330: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1331: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.1332: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1333: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1334: DFBPPR7071 ---- Plant proteins ---- Serpin-Z4
Source.1335: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase
Source.1336: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic
Source.1337: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.1338: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.1339: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.1340: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1341: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1342: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic
Source.1343: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2
Source.1344: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.1345: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2
Source.1346: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.1347: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.1348: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1349: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.1350: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1351: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1352: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1353: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV
Source.1354: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX
Source.1355: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.1356: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.1357: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3
Source.1358: DFBPPR7155 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.1359: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.1360: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.1361: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic
Source.1362: DFBPPR7170 ---- Plant proteins ---- Maturase K
Source.1363: DFBPPR7174 ---- Plant proteins ---- Photosystem I reaction center subunit XI, chloroplastic
Source.1364: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1365: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.1366: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.1367: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.1368: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.1369: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.1370: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.1371: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1372: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.1373: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.1374: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.1375: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic
Source.1376: DFBPPR7308 ---- Plant proteins ---- 30S ribosomal protein S18, chloroplastic
Source.1377: DFBPPR7322 ---- Plant proteins ---- Metallothionein-like protein 1
Source.1378: DFBPPR7338 ---- Plant proteins ---- 60S ribosomal protein L24
Source.1379: DFBPPR7342 ---- Plant proteins ---- 40S ribosomal protein S7
Source.1380: DFBPPR7402 ---- Plant proteins ---- Probable pectinesterase/pectinesterase inhibitor
Source.1381: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase
Source.1382: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic
Source.1383: DFBPPR7424 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 A, chloroplastic
Source.1384: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic
Source.1385: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.1386: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.1387: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.1388: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1389: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1390: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1391: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1392: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.1393: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic
Source.1394: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1395: DFBPPR7479 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 B, chloroplastic
Source.1396: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III
Source.1397: DFBPPR7486 ---- Plant proteins ---- Major oleosin NAP-II
Source.1398: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial
Source.1399: DFBPPR7488 ---- Plant proteins ---- Homeobox protein HD1
Source.1400: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.1401: DFBPPR7492 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic
Source.1402: DFBPPR7494 ---- Plant proteins ---- Putative ATP synthase protein YMF19
Source.1403: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.1404: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.1405: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.1406: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION
Source.1407: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1408: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial
Source.1409: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A
Source.1410: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1411: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C
Source.1412: DFBPPR7536 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.1413: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.1414: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.1415: DFBPPR7608 ---- Milk proteins ---- Kappa-casein
Source.1416: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.1417: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.1418: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.1419: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2
Source.1420: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.1421: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2
Source.1422: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.1423: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.1424: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4
Source.1425: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.1426: DFBPPR7665 ---- Milk proteins ---- Beta-casein
Source.1427: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.1428: DFBPPR7699 ---- Milk proteins ---- Chymosin
Source.1429: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1
Source.1430: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2
Source.1431: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain
Source.1432: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase
Source.1433: DFBPPR7744 ---- Plant proteins ---- Maturase K
Source.1434: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta
Source.1435: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1436: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.1437: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.1438: DFBPPR8201 ---- Plant proteins ---- 16 kDa phloem protein 1
Source.1439: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2
Source.1440: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP
Source.1441: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B
Source.1442: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1443: DFBPPR8370 ---- Plant proteins ---- Maturase K
Source.1444: DFBPPR8380 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 2
Source.1445: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3
Source.1446: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2
Source.1447: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1
Source.1448: DFBPPR8419 ---- Plant proteins ---- Arachin 21 kDa protein
Source.1449: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.1450: DFBPPR8445 ---- Plant proteins ---- Maturase K
Source.1451: DFBPPR8448 ---- Plant proteins ---- Maturase K
Source.1452: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.1453: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1454: DFBPPR8462 ---- Plant proteins ---- 30S ribosomal protein S18, chloroplastic
Source.1455: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.1456: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.1457: DFBPPR8483 ---- Plant proteins ---- 40S ribosomal protein S7
Source.1458: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.1459: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.1460: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase
Source.1461: DFBPPR8505 ---- Milk proteins ---- Chymosin
Source.1462: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.1463: DFBPPR8524 ---- Milk proteins ---- Lactogenin
Source.1464: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.1465: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.1466: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.1467: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2
Source.1468: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.1469: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.1470: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.1471: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.1472: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1
Source.1473: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.1474: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.1475: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.1476: DFBPPR15980 ---- Animal proteins ---- Peroxisome proliferator-activated receptor alpha
Source.1477: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.1478: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.1479: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.1480: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9
Source.1481: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.1482: DFBPPR15995 ---- Animal proteins ---- Ras-related protein Rab-5A
Source.1483: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1484: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase
Source.1485: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1486: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.1487: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.1488: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV
Source.1489: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.1490: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.1491: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1492: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN
Source.1493: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1494: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2
Source.1495: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.1496: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1497: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase
Source.1498: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.1499: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type
Source.1500: DFBPPR16067 ---- Animal proteins ---- CD40 ligand
Source.1501: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.1502: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.1503: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.1504: DFBPPR16093 ---- Animal proteins ---- Menin
Source.1505: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.1506: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.1507: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1508: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.1509: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.1510: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.1511: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.1512: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4
Source.1513: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.1514: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12
Source.1515: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.1516: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1517: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.1518: DFBPPR16156 ---- Animal proteins ---- Ras-related protein Rab-22A
Source.1519: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.1520: DFBPPR16168 ---- Animal proteins ---- Annexin A2
Source.1521: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.1522: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.1523: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.1524: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.1525: DFBPPR16178 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.1526: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.1527: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.1528: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.1529: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.1530: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.1531: DFBPPR16204 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.1532: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.1533: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.1534: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.1535: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.1536: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1537: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1538: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.1539: DFBPPR16214 ---- Animal proteins ---- Insulin-like growth factor I
Source.1540: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.1541: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.1542: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.1543: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.1544: DFBPPR16224 ---- Animal proteins ---- Uromodulin
Source.1545: DFBPPR16227 ---- Animal proteins ---- Myelin proteolipid protein
Source.1546: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72
Source.1547: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.1548: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1549: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.1550: DFBPPR16244 ---- Animal proteins ---- Interleukin-2
Source.1551: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1552: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a
Source.1553: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.1554: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.1555: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4
Source.1556: DFBPPR16263 ---- Animal proteins ---- Protein 4.1
Source.1557: DFBPPR16265 ---- Animal proteins ---- Caspase-1
Source.1558: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.1559: DFBPPR16271 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.1560: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1
Source.1561: DFBPPR16278 ---- Animal proteins ---- Major prion protein
Source.1562: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1563: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain
Source.1564: DFBPPR16304 ---- Animal proteins ---- Cathepsin K
Source.1565: DFBPPR16313 ---- Animal proteins ---- Ras-related protein Rab-5C
Source.1566: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.1567: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.1568: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.1569: DFBPPR16322 ---- Animal proteins ---- Interleukin-18
Source.1570: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.1571: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.1572: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.1573: DFBPPR16340 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain
Source.1574: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.1575: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.1576: DFBPPR16434 ---- Animal proteins ---- Thyrotropin subunit beta
Source.1577: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1578: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.1579: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6
Source.1580: DFBPPR16444 ---- Animal proteins ---- Interleukin-33
Source.1581: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2
Source.1582: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor
Source.1583: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.1584: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1585: DFBPPR16484 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain
Source.1586: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.1587: DFBPPR16499 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.1588: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.1589: DFBPPR16506 ---- Animal proteins ---- Pepsin B
Source.1590: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor
Source.1591: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.1592: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.1593: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.1594: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1595: DFBPPR16531 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3
Source.1596: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor
Source.1597: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.1598: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.1599: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1600: DFBPPR16559 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.1601: DFBPPR16560 ---- Animal proteins ---- Keratinocyte-associated protein 2
Source.1602: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.1603: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.1604: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.1605: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.1606: DFBPPR16587 ---- Animal proteins ---- B-lymphocyte antigen CD20
Source.1607: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.1608: DFBPPR16591 ---- Animal proteins ---- Gamma-crystallin S
Source.1609: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4
Source.1610: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.1611: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.1612: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1
Source.1613: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.1614: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.1615: DFBPPR16630 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.1616: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.1617: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1618: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5
Source.1619: DFBPPR16661 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.1620: DFBPPR16676 ---- Animal proteins ---- Olfactory receptor-like protein OLF2
Source.1621: DFBPPR16680 ---- Animal proteins ---- Gastrin-releasing peptide
Source.1622: DFBPPR16681 ---- Animal proteins ---- Olfactory receptor-like protein OLF3
Source.1623: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT
Source.1624: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4
Source.1625: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.1626: DFBPPR16706 ---- Animal proteins ---- 60S ribosomal protein L19
Source.1627: DFBPPR16709 ---- Animal proteins ---- Trafficking protein particle complex subunit 2
Source.1628: DFBPPR16721 ---- Animal proteins ---- Testin
Source.1629: DFBPPR16724 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2
Source.1630: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10
Source.1631: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.1632: DFBPPR16765 ---- Animal proteins ---- Annexin A1 isoform p37
Source.1633: DFBPPR16774 ---- Animal proteins ---- Annexin A1 isoform p35
Source.1634: DFBPPR16775 ---- Animal proteins ---- Pinopsin
Source.1635: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.1636: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.1637: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.1638: DFBPPR16831 ---- Animal proteins ---- Fibrinogen beta chain
Source.1639: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.1640: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein
Source.1641: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.1642: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.1643: DFBPPR16868 ---- Animal proteins ---- Insulin-like growth factor I
Source.1644: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor
Source.1645: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.1646: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.1647: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.1648: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.1649: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial
Source.1650: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.1651: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.1652: DFBPPR16901 ---- Animal proteins ---- Lens fiber membrane intrinsic protein
Source.1653: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.1654: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.1655: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV
Source.1656: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.1657: DFBPPR16922 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.1658: DFBPPR16923 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.1659: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.1660: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1661: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.1662: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.1663: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.1664: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.1665: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1666: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.1667: DFBPPR16952 ---- Animal proteins ---- Annexin A2
Source.1668: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.1669: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin
Source.1670: DFBPPR16962 ---- Animal proteins ---- Interleukin-18
Source.1671: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.1672: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6
Source.1673: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.1674: DFBPPR16979 ---- Animal proteins ---- Aquaporin-1
Source.1675: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3
Source.1676: DFBPPR16985 ---- Animal proteins ---- Filensin
Source.1677: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.1678: DFBPPR16995 ---- Animal proteins ---- Urea transporter 1
Source.1679: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.1680: DFBPPR17010 ---- Animal proteins ---- Sestrin-2
Source.1681: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.1682: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.1683: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase
Source.1684: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.1685: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.1686: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1687: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1688: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.1689: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.1690: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.1691: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.1692: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.1693: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.1694: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.1695: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform
Source.1696: DFBPPR17060 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 1
Source.1697: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.1698: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5
Source.1699: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.1700: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.1701: DFBPPR17076 ---- Animal proteins ---- Ras-related protein Rab-3A
Source.1702: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.1703: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.1704: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.1705: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase
Source.1706: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.1707: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.1708: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.1709: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1
Source.1710: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.1711: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.1712: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.1713: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2
Source.1714: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2
Source.1715: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.1716: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit
Source.1717: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1
Source.1718: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.1719: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1720: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta
Source.1721: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.1722: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.1723: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.1724: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.1725: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.1726: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.1727: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.1728: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33
Source.1729: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1
Source.1730: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.1731: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3
Source.1732: DFBPPR17273 ---- Animal proteins ---- Integrin-linked protein kinase
Source.1733: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2
Source.1734: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.1735: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7
Source.1736: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1737: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2
Source.1738: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1
Source.1739: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.1740: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1741: DFBPPR17296 ---- Animal proteins ---- Dynamin-2
Source.1742: DFBPPR17300 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.1743: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.1744: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein
Source.1745: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2
Source.1746: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta
Source.1747: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3
Source.1748: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.1749: DFBPPR17328 ---- Animal proteins ---- Ras-related protein Rab-5A
Source.1750: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.1751: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.1752: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.1753: DFBPPR17341 ---- Animal proteins ---- Radixin
Source.1754: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.1755: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.1756: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.1757: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.1758: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H
Source.1759: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.1760: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.1761: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.1762: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.1763: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.1764: DFBPPR17382 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 5
Source.1765: DFBPPR17386 ---- Animal proteins ---- Epithelial membrane protein 2
Source.1766: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.1767: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.1768: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD
Source.1769: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.1770: DFBPPR17401 ---- Animal proteins ---- Moesin
Source.1771: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.1772: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.1773: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.1774: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.1775: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.1776: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.1777: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.1778: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5
Source.1779: DFBPPR17425 ---- Animal proteins ---- Dynamin-1
Source.1780: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5
Source.1781: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.1782: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.1783: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.1784: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.1785: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3
Source.1786: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.1787: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.1788: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase
Source.1789: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.1790: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.1791: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.1792: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1
Source.1793: DFBPPR17485 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain
Source.1794: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.1795: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.1796: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1
Source.1797: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.1798: DFBPPR17499 ---- Animal proteins ---- Allograft inflammatory factor 1
Source.1799: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform
Source.1800: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.1801: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.1802: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein
Source.1803: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3
Source.1804: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.1805: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.1806: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4
Source.1807: DFBPPR17566 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial
Source.1808: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta
Source.1809: DFBPPR17574 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.1810: DFBPPR17595 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.1811: DFBPPR17596 ---- Animal proteins ---- [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial
Source.1812: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.1813: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor
Source.1814: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1815: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1816: DFBPPR17614 ---- Animal proteins ---- E3 ubiquitin-protein ligase ARIH1
Source.1817: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1
Source.1818: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.1819: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.1820: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L
Source.1821: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.1822: DFBPPR17694 ---- Animal proteins ---- Pyridoxal kinase
Source.1823: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B
Source.1824: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.1825: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.1826: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.1827: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A
Source.1828: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2
Source.1829: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.1830: DFBPPR17756 ---- Animal proteins ---- Ras-related protein Rab-3B
Source.1831: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.1832: DFBPPR17769 ---- Animal proteins ---- Polycomb complex protein BMI-1
Source.1833: DFBPPR17771 ---- Animal proteins ---- Thyrotropin subunit beta
Source.1834: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.1835: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.1836: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3
Source.1837: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.1838: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.1839: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.1840: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.1841: DFBPPR17799 ---- Animal proteins ---- Gamma-synuclein
Source.1842: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1
Source.1843: DFBPPR17812 ---- Animal proteins ---- Dynein light chain Tctex-type 1
Source.1844: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.1845: DFBPPR17816 ---- Animal proteins ---- Lumican
Source.1846: DFBPPR17820 ---- Animal proteins ---- Osteomodulin
Source.1847: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.1848: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.1849: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1850: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B
Source.1851: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.1852: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.1853: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3
Source.1854: DFBPPR17849 ---- Animal proteins ---- Fibromodulin
Source.1855: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.1856: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.1857: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.1858: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.1859: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.1860: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.1861: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.1862: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.1863: DFBPPR17879 ---- Animal proteins ---- Menin
Source.1864: DFBPPR17888 ---- Animal proteins ---- Cation-dependent mannose-6-phosphate receptor
Source.1865: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.1866: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.1867: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.1868: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1869: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.1870: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.1871: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.1872: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3
Source.1873: DFBPPR17928 ---- Animal proteins ---- CD40 ligand
Source.1874: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2
Source.1875: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.1876: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.1877: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.1878: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.1879: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.1880: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.1881: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.1882: DFBPPR17953 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.1883: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase
Source.1884: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.1885: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin
Source.1886: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.1887: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.1888: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.1889: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.1890: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.1891: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.1892: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein
Source.1893: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase
Source.1894: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1895: DFBPPR18028 ---- Animal proteins ---- Atlastin-1
Source.1896: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta
Source.1897: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.1898: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase
Source.1899: DFBPPR18055 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF8
Source.1900: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.1901: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.1902: DFBPPR18068 ---- Animal proteins ---- Annexin A11
Source.1903: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8
Source.1904: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8
Source.1905: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.1906: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.1907: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.1908: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.1909: DFBPPR18090 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1
Source.1910: DFBPPR18091 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.1911: DFBPPR18094 ---- Animal proteins ---- Neutrophil cytosol factor 1
Source.1912: DFBPPR18097 ---- Animal proteins ---- Deoxycytidine kinase
Source.1913: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit
Source.1914: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29
Source.1915: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.1916: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38
Source.1917: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1
Source.1918: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.1919: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.1920: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3
Source.1921: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.1922: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.1923: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.1924: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1
Source.1925: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain
Source.1926: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.1927: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.1928: DFBPPR18162 ---- Animal proteins ---- Renin receptor
Source.1929: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.1930: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.1931: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.1932: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform
Source.1933: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.1934: DFBPPR18216 ---- Animal proteins ---- Collectin-12
Source.1935: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.1936: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.1937: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4
Source.1938: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi
Source.1939: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.1940: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7
Source.1941: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.1942: DFBPPR18263 ---- Animal proteins ---- Neurocalcin-delta
Source.1943: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2
Source.1944: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI
Source.1945: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3
Source.1946: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.1947: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.1948: DFBPPR18290 ---- Animal proteins ---- Cyclin-dependent kinase 10
Source.1949: DFBPPR18297 ---- Animal proteins ---- Casein kinase I isoform beta
Source.1950: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase
Source.1951: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.1952: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.1953: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.1954: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain
Source.1955: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.1956: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a
Source.1957: DFBPPR18334 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.1958: DFBPPR18339 ---- Animal proteins ---- SPARC
Source.1959: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1
Source.1960: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.1961: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.1962: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.1963: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase
Source.1964: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.1965: DFBPPR18361 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.1966: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.1967: DFBPPR18364 ---- Animal proteins ---- Inhibitor of growth protein 4
Source.1968: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.1969: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.1970: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1971: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.1972: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.1973: DFBPPR18402 ---- Animal proteins ---- Uromodulin
Source.1974: DFBPPR18406 ---- Animal proteins ---- Angiotensinogen
Source.1975: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1
Source.1976: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos
Source.1977: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.1978: DFBPPR18415 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-14
Source.1979: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor
Source.1980: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.1981: DFBPPR18430 ---- Animal proteins ---- cAMP-responsive element-binding protein-like 2
Source.1982: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H
Source.1983: DFBPPR18437 ---- Animal proteins ---- Diamine acetyltransferase 1
Source.1984: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.1985: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.1986: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.1987: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22
Source.1988: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4
Source.1989: DFBPPR18460 ---- Animal proteins ---- ATP synthase-coupling factor 6, mitochondrial
Source.1990: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.1991: DFBPPR18464 ---- Animal proteins ---- Regucalcin
Source.1992: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.1993: DFBPPR18468 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.1994: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.1995: DFBPPR18480 ---- Animal proteins ---- Casein kinase I isoform gamma-3
Source.1996: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein
Source.1997: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1
Source.1998: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2
Source.1999: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.2000: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.2001: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1
Source.2002: DFBPPR18501 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain
Source.2003: DFBPPR18503 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10, mitochondrial
Source.2004: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent
Source.2005: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.2006: DFBPPR18514 ---- Animal proteins ---- Ras-related protein Rab-3C
Source.2007: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit
Source.2008: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.2009: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain
Source.2010: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain
Source.2011: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1
Source.2012: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.2013: DFBPPR18541 ---- Animal proteins ---- Chromatin modification-related protein MEAF6
Source.2014: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5
Source.2015: DFBPPR18575 ---- Animal proteins ---- Gamma-crystallin S
Source.2016: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.2017: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.2018: DFBPPR18589 ---- Animal proteins ---- Interleukin-13
Source.2019: DFBPPR18594 ---- Animal proteins ---- Aprataxin and PNK-like factor
Source.2020: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.2021: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.2022: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.2023: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2024: DFBPPR18621 ---- Animal proteins ---- Cytochrome b561
Source.2025: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.2026: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.2027: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.2028: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2
Source.2029: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.2030: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3
Source.2031: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.2032: DFBPPR18720 ---- Animal proteins ---- Protein quaking
Source.2033: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor
Source.2034: DFBPPR18727 ---- Animal proteins ---- Interleukin-2
Source.2035: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.2036: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.2037: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.2038: DFBPPR18754 ---- Animal proteins ---- Collectin-11
Source.2039: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.2040: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.2041: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9
Source.2042: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1
Source.2043: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.2044: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.2045: DFBPPR18795 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C2
Source.2046: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A
Source.2047: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.2048: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.2049: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.2050: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.2051: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.2052: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.2053: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.2054: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.2055: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.2056: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1
Source.2057: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.2058: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.2059: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.2060: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.2061: DFBPPR18855 ---- Animal proteins ---- Tubulin-specific chaperone A
Source.2062: DFBPPR18859 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.2063: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7
Source.2064: DFBPPR18873 ---- Animal proteins ---- Proteasome subunit beta type-3
Source.2065: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.2066: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.2067: DFBPPR18881 ---- Animal proteins ---- Proteasome subunit beta type-4
Source.2068: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.2069: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.2070: DFBPPR18904 ---- Animal proteins ---- Protein KASH5
Source.2071: DFBPPR18905 ---- Animal proteins ---- Beta-catenin-interacting protein 1
Source.2072: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless
Source.2073: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.2074: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.2075: DFBPPR18933 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.2076: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2
Source.2077: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.2078: DFBPPR18945 ---- Animal proteins ---- Stanniocalcin-1
Source.2079: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.2080: DFBPPR18948 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL1
Source.2081: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3
Source.2082: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase
Source.2083: DFBPPR18964 ---- Animal proteins ---- Placental prolactin-related protein 1
Source.2084: DFBPPR18974 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.2085: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.2086: DFBPPR18981 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.2087: DFBPPR18982 ---- Animal proteins ---- Gastrin-releasing peptide
Source.2088: DFBPPR18984 ---- Animal proteins ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.2089: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.2090: DFBPPR19019 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.2091: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.2092: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.2093: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.2094: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic
Source.2095: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1
Source.2096: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2
Source.2097: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.2098: DFBPPR19065 ---- Animal proteins ---- Cadherin-6
Source.2099: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.2100: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1
Source.2101: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5
Source.2102: DFBPPR19076 ---- Animal proteins ---- Protein MGARP
Source.2103: DFBPPR19089 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 2
Source.2104: DFBPPR19090 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.2105: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.2106: DFBPPR19102 ---- Animal proteins ---- Cytoplasmic FMR1-interacting protein 1
Source.2107: DFBPPR19103 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein 70 kDa
Source.2108: DFBPPR19106 ---- Animal proteins ---- Natural killer cells antigen CD94
Source.2109: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.2110: DFBPPR19112 ---- Animal proteins ---- Ubiquitin-like-conjugating enzyme ATG3
Source.2111: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.2112: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.2113: DFBPPR19124 ---- Animal proteins ---- Neuroguidin
Source.2114: DFBPPR19126 ---- Animal proteins ---- Calpain small subunit 1
Source.2115: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1
Source.2116: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5
Source.2117: DFBPPR19139 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-2
Source.2118: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8
Source.2119: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.2120: DFBPPR19148 ---- Animal proteins ---- Ribonuclease 4
Source.2121: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like
Source.2122: DFBPPR19162 ---- Animal proteins ---- Macrophage-capping protein
Source.2123: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2
Source.2124: DFBPPR19178 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter SLC6A17
Source.2125: DFBPPR19186 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.2126: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma
Source.2127: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.2128: DFBPPR19198 ---- Animal proteins ---- Cadherin-3
Source.2129: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.2130: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3
Source.2131: DFBPPR19219 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A2, mitochondrial
Source.2132: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.2133: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase
Source.2134: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.2135: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.2136: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.2137: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.2138: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2
Source.2139: DFBPPR19264 ---- Animal proteins ---- Claudin-16
Source.2140: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.2141: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.2142: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33
Source.2143: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.2144: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.2145: DFBPPR19301 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF220
Source.2146: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12
Source.2147: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8
Source.2148: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1
Source.2149: DFBPPR19328 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 12
Source.2150: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase
Source.2151: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2152: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9
Source.2153: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.2154: DFBPPR19364 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 3
Source.2155: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.2156: DFBPPR19380 ---- Animal proteins ---- Proteasome subunit alpha type-3
Source.2157: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.2158: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.2159: DFBPPR19395 ---- Animal proteins ---- Ras-related protein Rab-5C
Source.2160: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18
Source.2161: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F
Source.2162: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.2163: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1
Source.2164: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.2165: DFBPPR19419 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.2166: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1
Source.2167: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2
Source.2168: DFBPPR19425 ---- Animal proteins ---- Microfibrillar-associated protein 5
Source.2169: DFBPPR19427 ---- Animal proteins ---- Probable tRNA(His) guanylyltransferase
Source.2170: DFBPPR19431 ---- Animal proteins ---- Aminoacyl tRNA synthase complex-interacting multifunctional protein 2
Source.2171: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70
Source.2172: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.2173: DFBPPR19468 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 2
Source.2174: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1
Source.2175: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.2176: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.2177: DFBPPR19488 ---- Animal proteins ---- Placental prolactin-related protein 3
Source.2178: DFBPPR19494 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 1
Source.2179: DFBPPR19506 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.2180: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase
Source.2181: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.2182: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.2183: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.2184: DFBPPR19519 ---- Animal proteins ---- DnaJ homolog subfamily C member 24
Source.2185: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.2186: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.2187: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.2188: DFBPPR19559 ---- Animal proteins ---- CCN family member 2
Source.2189: DFBPPR19561 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.2190: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.2191: DFBPPR19568 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin
Source.2192: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2193: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.2194: DFBPPR19575 ---- Animal proteins ---- Acylphosphatase-2
Source.2195: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial
Source.2196: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.2197: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2
Source.2198: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C
Source.2199: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.2200: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4
Source.2201: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.2202: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase
Source.2203: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.2204: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.2205: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta
Source.2206: DFBPPR19627 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain
Source.2207: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase
Source.2208: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.2209: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.2210: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase
Source.2211: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator
Source.2212: DFBPPR19668 ---- Animal proteins ---- Calicin
Source.2213: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.2214: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein
Source.2215: DFBPPR19680 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.2216: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor
Source.2217: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.2218: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.2219: DFBPPR19702 ---- Animal proteins ---- Placental prolactin-related protein 4
Source.2220: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.2221: DFBPPR19715 ---- Animal proteins ---- Chorionic somatomammotropin hormone 2
Source.2222: DFBPPR19716 ---- Animal proteins ---- Proteasome subunit beta type-1
Source.2223: DFBPPR19725 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 1
Source.2224: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.2225: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.2226: DFBPPR19740 ---- Animal proteins ---- Sin3 histone deacetylase corepressor complex component SDS3
Source.2227: DFBPPR19744 ---- Animal proteins ---- Placental prolactin-related protein 2
Source.2228: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3
Source.2229: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2
Source.2230: DFBPPR19761 ---- Animal proteins ---- N-chimaerin
Source.2231: DFBPPR19762 ---- Animal proteins ---- Mitochondrial fission factor
Source.2232: DFBPPR19769 ---- Animal proteins ---- Septin-14
Source.2233: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.2234: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.2235: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.2236: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.2237: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4
Source.2238: DFBPPR19800 ---- Animal proteins ---- Microsomal glutathione S-transferase 3
Source.2239: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.2240: DFBPPR19809 ---- Animal proteins ---- Hippocalcin-like protein 4
Source.2241: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.2242: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L
Source.2243: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma
Source.2244: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.2245: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.2246: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein
Source.2247: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.2248: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.2249: DFBPPR19834 ---- Animal proteins ---- Harmonin
Source.2250: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2
Source.2251: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.2252: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial
Source.2253: DFBPPR19845 ---- Animal proteins ---- Beta-soluble NSF attachment protein
Source.2254: DFBPPR19854 ---- Animal proteins ---- Nuclear migration protein nudC
Source.2255: DFBPPR19855 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.2256: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase
Source.2257: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B
Source.2258: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2
Source.2259: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.2260: DFBPPR19870 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.2261: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial
Source.2262: DFBPPR19904 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 30
Source.2263: DFBPPR19905 ---- Animal proteins ---- Complement component C6
Source.2264: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2265: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial
Source.2266: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.2267: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.2268: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.2269: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.2270: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3
Source.2271: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.2272: DFBPPR19928 ---- Animal proteins ---- Interferon beta-1
Source.2273: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1
Source.2274: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor
Source.2275: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7
Source.2276: DFBPPR19949 ---- Animal proteins ---- Syndecan-2
Source.2277: DFBPPR19957 ---- Animal proteins ---- Gap junction beta-2 protein
Source.2278: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter
Source.2279: DFBPPR19972 ---- Animal proteins ---- Prefoldin subunit 5
Source.2280: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27
Source.2281: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.2282: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.2283: DFBPPR19990 ---- Animal proteins ---- Synaptonemal complex protein 3
Source.2284: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1
Source.2285: DFBPPR20002 ---- Animal proteins ---- Regulator of microtubule dynamics protein 2
Source.2286: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.2287: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3
Source.2288: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit
Source.2289: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7
Source.2290: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12
Source.2291: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.2292: DFBPPR20030 ---- Animal proteins ---- Calumenin
Source.2293: DFBPPR20033 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 9
Source.2294: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase
Source.2295: DFBPPR20047 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 11B
Source.2296: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.2297: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.2298: DFBPPR20063 ---- Animal proteins ---- Histone H2B subacrosomal variant
Source.2299: DFBPPR20067 ---- Animal proteins ---- Glutaredoxin-2, mitochondrial
Source.2300: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4
Source.2301: DFBPPR20078 ---- Animal proteins ---- Ragulator complex protein LAMTOR2
Source.2302: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B
Source.2303: DFBPPR20081 ---- Animal proteins ---- ADP-ribosylation factor-related protein 1
Source.2304: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.2305: DFBPPR20091 ---- Animal proteins ---- Carboxypeptidase O
Source.2306: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.2307: DFBPPR20106 ---- Animal proteins ---- Visinin-like protein 1
Source.2308: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.2309: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.2310: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.2311: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6
Source.2312: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1
Source.2313: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.2314: DFBPPR20155 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF181
Source.2315: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.2316: DFBPPR20186 ---- Animal proteins ---- Transmembrane protein 98
Source.2317: DFBPPR20199 ---- Animal proteins ---- Claudin-7
Source.2318: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.2319: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.2320: DFBPPR20217 ---- Animal proteins ---- Cytochrome c oxidase assembly factor 8
Source.2321: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.2322: DFBPPR20226 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.2323: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2
Source.2324: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3
Source.2325: DFBPPR20243 ---- Animal proteins ---- Tissue factor pathway inhibitor 2
Source.2326: DFBPPR20249 ---- Animal proteins ---- Ras-related protein Rab-30
Source.2327: DFBPPR20251 ---- Animal proteins ---- Follistatin-related protein 3
Source.2328: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1
Source.2329: DFBPPR20261 ---- Animal proteins ---- Protein SCO1 homolog, mitochondrial
Source.2330: DFBPPR20265 ---- Animal proteins ---- Histone-lysine N-methyltransferase EZH1
Source.2331: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.2332: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1
Source.2333: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.2334: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN
Source.2335: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator
Source.2336: DFBPPR20307 ---- Animal proteins ---- Ras-related protein Rab-6B
Source.2337: DFBPPR20309 ---- Animal proteins ---- Cell death activator CIDE-3
Source.2338: DFBPPR20314 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC3
Source.2339: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.2340: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial
Source.2341: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27
Source.2342: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase
Source.2343: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1
Source.2344: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.2345: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.2346: DFBPPR20362 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase
Source.2347: DFBPPR20364 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3
Source.2348: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1
Source.2349: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial
Source.2350: DFBPPR20374 ---- Animal proteins ---- 5'-deoxynucleotidase HDDC2
Source.2351: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.2352: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog
Source.2353: DFBPPR20393 ---- Animal proteins ---- Putative nuclease HARBI1
Source.2354: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.2355: DFBPPR20401 ---- Animal proteins ---- Bystin
Source.2356: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma
Source.2357: DFBPPR20424 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF170
Source.2358: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.2359: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2
Source.2360: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1
Source.2361: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1
Source.2362: DFBPPR20465 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.2363: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.2364: DFBPPR20471 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.2365: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.2366: DFBPPR20489 ---- Animal proteins ---- Translocon-associated protein subunit alpha
Source.2367: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.2368: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.2369: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial
Source.2370: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.2371: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.2372: DFBPPR20555 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.2373: DFBPPR20556 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.2374: DFBPPR20574 ---- Animal proteins ---- Transmembrane protein 201
Source.2375: DFBPPR20577 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor-interacting protein
Source.2376: DFBPPR20581 ---- Animal proteins ---- Membrane magnesium transporter 1
Source.2377: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3
Source.2378: DFBPPR20590 ---- Animal proteins ---- POU domain class 2-associating factor 1
Source.2379: DFBPPR20594 ---- Animal proteins ---- Vitamin D-binding protein
Source.2380: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.2381: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6
Source.2382: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.2383: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.2384: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2
Source.2385: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.2386: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2
Source.2387: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.2388: DFBPPR20626 ---- Animal proteins ---- Melanocortin receptor 5
Source.2389: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.2390: DFBPPR20647 ---- Animal proteins ---- Annexin A8
Source.2391: DFBPPR20648 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM22 homolog
Source.2392: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.2393: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.2394: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.2395: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.2396: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease
Source.2397: DFBPPR20676 ---- Animal proteins ---- Myelin protein zero-like protein 2
Source.2398: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14
Source.2399: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5
Source.2400: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10
Source.2401: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.2402: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12
Source.2403: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.2404: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog
Source.2405: DFBPPR20705 ---- Animal proteins ---- Anaphase-promoting complex subunit 10
Source.2406: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1
Source.2407: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.2408: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.2409: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase
Source.2410: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1
Source.2411: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial
Source.2412: DFBPPR20726 ---- Animal proteins ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.2413: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.2414: DFBPPR20729 ---- Animal proteins ---- 60S ribosomal protein L6
Source.2415: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2
Source.2416: DFBPPR20735 ---- Animal proteins ---- Microtubule-associated tumor suppressor 1 homolog
Source.2417: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.2418: DFBPPR20740 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 6
Source.2419: DFBPPR20748 ---- Animal proteins ---- Protein ABHD14B
Source.2420: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog
Source.2421: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33
Source.2422: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7
Source.2423: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9
Source.2424: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.2425: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2
Source.2426: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15
Source.2427: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.2428: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.2429: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171
Source.2430: DFBPPR20806 ---- Animal proteins ---- Transcriptional adapter 1
Source.2431: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2
Source.2432: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.2433: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2
Source.2434: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.2435: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.2436: DFBPPR20856 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim10
Source.2437: DFBPPR20857 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.2438: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1
Source.2439: DFBPPR20872 ---- Animal proteins ---- Transmembrane protein 150C
Source.2440: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1
Source.2441: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.2442: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.2443: DFBPPR20919 ---- Animal proteins ---- Protein cornichon homolog 4
Source.2444: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.2445: DFBPPR20928 ---- Animal proteins ---- Nuclear envelope integral membrane protein 1
Source.2446: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14
Source.2447: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.2448: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.2449: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.2450: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1
Source.2451: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7
Source.2452: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.2453: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase
Source.2454: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.2455: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.2456: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.2457: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein
Source.2458: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.2459: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10
Source.2460: DFBPPR21064 ---- Animal proteins ---- Ribosome production factor 2 homolog
Source.2461: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C
Source.2462: DFBPPR21067 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.2463: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.2464: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A
Source.2465: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6
Source.2466: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor
Source.2467: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7
Source.2468: DFBPPR21102 ---- Animal proteins ---- Gamma-glutamylcyclotransferase
Source.2469: DFBPPR21103 ---- Animal proteins ---- F-box only protein 32
Source.2470: DFBPPR21104 ---- Animal proteins ---- Keratinocyte-associated protein 2
Source.2471: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.2472: DFBPPR21112 ---- Animal proteins ---- TBC1 domain family member 7
Source.2473: DFBPPR21117 ---- Animal proteins ---- Spindlin-2
Source.2474: DFBPPR21132 ---- Animal proteins ---- Regulator of G-protein signaling 7-binding protein
Source.2475: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.2476: DFBPPR21155 ---- Animal proteins ---- Cyclin-H
Source.2477: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.2478: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial
Source.2479: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5
Source.2480: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1
Source.2481: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1
Source.2482: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase
Source.2483: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1
Source.2484: DFBPPR21205 ---- Animal proteins ---- ATP synthase mitochondrial F1 complex assembly factor 2
Source.2485: DFBPPR21212 ---- Animal proteins ---- Tropomodulin-4
Source.2486: DFBPPR21215 ---- Animal proteins ---- Origin recognition complex subunit 6
Source.2487: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.2488: DFBPPR21241 ---- Animal proteins ---- Cytochrome b-245 chaperone 1
Source.2489: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3
Source.2490: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1
Source.2491: DFBPPR21263 ---- Animal proteins ---- Enhancer of rudimentary homolog
Source.2492: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.2493: DFBPPR21272 ---- Animal proteins ---- Testin
Source.2494: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.2495: DFBPPR21300 ---- Animal proteins ---- Trafficking protein particle complex subunit 2
Source.2496: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4
Source.2497: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.2498: DFBPPR21321 ---- Animal proteins ---- Zinc finger matrin-type protein 3
Source.2499: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.2500: DFBPPR21332 ---- Animal proteins ---- ER membrane protein complex subunit 4
Source.2501: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial
Source.2502: DFBPPR21345 ---- Animal proteins ---- XIAP-associated factor 1
Source.2503: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.2504: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.2505: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3
Source.2506: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18
Source.2507: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.2508: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.2509: DFBPPR21381 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A-related protein, mitochondrial
Source.2510: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2
Source.2511: DFBPPR21391 ---- Animal proteins ---- Prolactin-inducible protein homolog
Source.2512: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1
Source.2513: DFBPPR21394 ---- Animal proteins ---- Elongin-C
Source.2514: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog
Source.2515: DFBPPR21418 ---- Animal proteins ---- Angiopoietin-related protein 1
Source.2516: DFBPPR21426 ---- Animal proteins ---- ORM1-like protein 3
Source.2517: DFBPPR21433 ---- Animal proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.2518: DFBPPR21449 ---- Animal proteins ---- Magnesium transporter NIPA2
Source.2519: DFBPPR21454 ---- Animal proteins ---- Cyclin-dependent kinase 2-interacting protein
Source.2520: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.2521: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.2522: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3
Source.2523: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.2524: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8
Source.2525: DFBPPR21479 ---- Animal proteins ---- Pentraxin-related protein PTX3
Source.2526: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial
Source.2527: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1
Source.2528: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1
Source.2529: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1
Source.2530: DFBPPR21520 ---- Animal proteins ---- LYR motif-containing protein 4
Source.2531: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.2532: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22
Source.2533: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.2534: DFBPPR21560 ---- Animal proteins ---- Sperm equatorial segment protein 1
Source.2535: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3
Source.2536: DFBPPR21576 ---- Animal proteins ---- Signal recognition particle 19 kDa protein
Source.2537: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.2538: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.2539: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma
Source.2540: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.2541: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3
Source.2542: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork
Source.2543: DFBPPR21618 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.2544: DFBPPR21620 ---- Animal proteins ---- Claudin-12
Source.2545: DFBPPR21625 ---- Animal proteins ---- 40S ribosomal protein S24
Source.2546: DFBPPR21630 ---- Animal proteins ---- Maspardin
Source.2547: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44
Source.2548: DFBPPR21648 ---- Animal proteins ---- Keratin, type I cytoskeletal 26
Source.2549: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial
Source.2550: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8
Source.2551: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.2552: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10
Source.2553: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1
Source.2554: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.2555: DFBPPR21701 ---- Animal proteins ---- Prefoldin subunit 1
Source.2556: DFBPPR21710 ---- Animal proteins ---- Differentially expressed in FDCP 8 homolog
Source.2557: DFBPPR21712 ---- Animal proteins ---- Serpin E3
Source.2558: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.2559: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2
Source.2560: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.2561: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1
Source.2562: DFBPPR21754 ---- Animal proteins ---- BLOC-1-related complex subunit 6
Source.2563: DFBPPR21755 ---- Animal proteins ---- ELMO domain-containing protein 2
Source.2564: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25
Source.2565: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.2566: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.2567: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like
Source.2568: DFBPPR21800 ---- Animal proteins ---- Carbonic anhydrase-related protein 10
Source.2569: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.2570: DFBPPR21805 ---- Animal proteins ---- 60S ribosomal protein L19
Source.2571: DFBPPR21815 ---- Animal proteins ---- ORM1-like protein 2
Source.2572: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2
Source.2573: DFBPPR21827 ---- Animal proteins ---- LETM1 domain-containing protein 1
Source.2574: DFBPPR21831 ---- Animal proteins ---- MAPK regulated corepressor interacting protein 2
Source.2575: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein
Source.2576: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.2577: DFBPPR21851 ---- Animal proteins ---- TSC22 domain family protein 1
Source.2578: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.2579: DFBPPR21881 ---- Animal proteins ---- THUMP domain-containing protein 1
Source.2580: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein
Source.2581: DFBPPR21911 ---- Animal proteins ---- ORM1-like protein 1
Source.2582: DFBPPR21914 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 13
Source.2583: DFBPPR21931 ---- Animal proteins ---- Oocyte-secreted protein 1
Source.2584: DFBPPR21938 ---- Animal proteins ---- Protein RER1
Source.2585: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.2586: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15
Source.2587: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial
Source.2588: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10
Source.2589: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1
Source.2590: DFBPPR21998 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.2591: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.2592: DFBPPR22011 ---- Animal proteins ---- 40S ribosomal protein S12
Source.2593: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3
Source.2594: DFBPPR22016 ---- Animal proteins ---- Telomere repeats-binding bouquet formation protein 2
Source.2595: DFBPPR22017 ---- Animal proteins ---- 39S ribosomal protein L35, mitochondrial
Source.2596: DFBPPR22038 ---- Animal proteins ---- Kelch domain-containing protein 3
Source.2597: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12
Source.2598: DFBPPR22050 ---- Animal proteins ---- Protein lin-37 homolog
Source.2599: DFBPPR22051 ---- Animal proteins ---- Cilia- and flagella-associated protein HOATZ
Source.2600: DFBPPR22054 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.2601: DFBPPR22082 ---- Animal proteins ---- Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 2 protein
Source.2602: DFBPPR22086 ---- Animal proteins ---- Trafficking protein particle complex subunit 1
Source.2603: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.2604: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog
Source.2605: DFBPPR22132 ---- Animal proteins ---- 60S ribosomal protein L18a
Source.2606: DFBPPR22148 ---- Animal proteins ---- Hemogen
Source.2607: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.2608: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.2609: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.2610: DFBPPR22186 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 2
Source.2611: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.2612: DFBPPR22196 ---- Animal proteins ---- Bladder cancer-associated protein
Source.2613: DFBPPR22200 ---- Animal proteins ---- Profilin-4
Source.2614: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.2615: DFBPPR22210 ---- Animal proteins ---- Peroxisomal membrane protein 4
Source.2616: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.2617: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.2618: DFBPPR22224 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 3
Source.2619: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.2620: DFBPPR22234 ---- Animal proteins ---- COMM domain-containing protein 3
Source.2621: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.2622: DFBPPR22248 ---- Animal proteins ---- rRNA-processing protein FCF1 homolog
Source.2623: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.2624: DFBPPR22257 ---- Animal proteins ---- TLC domain-containing protein 5
Source.2625: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.2626: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial
Source.2627: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40
Source.2628: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.2629: DFBPPR22285 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1-interacting protein 2
Source.2630: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.2631: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B
Source.2632: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like
Source.2633: DFBPPR22320 ---- Animal proteins ---- Transmembrane protein 229B
Source.2634: DFBPPR22321 ---- Animal proteins ---- Solute carrier family 25 member 35
Source.2635: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.2636: DFBPPR22332 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 3
Source.2637: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63
Source.2638: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.2639: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein
Source.2640: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase
Source.2641: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.2642: DFBPPR22388 ---- Animal proteins ---- Oxidative stress-responsive serine-rich protein 1
Source.2643: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9
Source.2644: DFBPPR22407 ---- Animal proteins ---- TSSK6-activating co-chaperone protein
Source.2645: DFBPPR22411 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 2
Source.2646: DFBPPR22415 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.2647: DFBPPR22420 ---- Animal proteins ---- Small integral membrane protein 19
Source.2648: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B
Source.2649: DFBPPR22431 ---- Animal proteins ---- BolA-like protein 3
Source.2650: DFBPPR22469 ---- Animal proteins ---- Protein FAM136A
Source.2651: DFBPPR22481 ---- Animal proteins ---- Uncharacterized protein FAM241A
Source.2652: DFBPPR22492 ---- Animal proteins ---- SAYSvFN domain-containing protein 1
Source.2653: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.2654: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183
Source.2655: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101
Source.2656: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1
Source.2657: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.2658: DFBPPR22539 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 18
Source.2659: DFBPPR22544 ---- Animal proteins ---- SH3 domain-binding glutamic acid-rich-like protein 2
Source.2660: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.2661: DFBPPR22574 ---- Animal proteins ---- Uncharacterized protein C1orf54 homolog
Source.2662: DFBPPR22590 ---- Animal proteins ---- Transmembrane protein 267
Source.2663: DFBPPR22597 ---- Animal proteins ---- Methyltransferase-like 26
Source.2664: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13
Source.2665: DFBPPR22611 ---- Animal proteins ---- Coiled-coil domain-containing protein 105
Source.2666: DFBPPR22615 ---- Animal proteins ---- Coiled-coil domain-containing protein 54
Source.2667: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B
Source.2668: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1
Source.2669: DFBPPR22637 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 61
Source.2670: DFBPPR22679 ---- Animal proteins ---- MORN repeat-containing protein 3
Source.2671: DFBPPR22694 ---- Animal proteins ---- Testis-specific gene 13 protein
Source.2672: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16
Source.2673: DFBPPR22721 ---- Animal proteins ---- Uncharacterized protein KIAA1143 homolog
Source.2674: DFBPPR22727 ---- Animal proteins ---- Uncharacterized protein C6orf163 homolog
Source.2675: DFBPPR22745 ---- Animal proteins ---- Uncharacterized protein C3orf14 homolog
Source.2676: DFBPPR22762 ---- Animal proteins ---- Uncharacterized protein C6orf136 homolog
Source.2677: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.2678: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2679: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.2680: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.2681: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.2682: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.2683: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.2684: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.2685: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2686: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.2687: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.2688: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6
Source.2689: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.2690: DFBPPR8577 ---- Animal proteins ---- Nectin-1
Source.2691: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.2692: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.2693: DFBPPR8592 ---- Animal proteins ---- Interleukin-18
Source.2694: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.2695: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1
Source.2696: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.2697: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.2698: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.2699: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.2700: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.2701: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.2702: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor
Source.2703: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.2704: DFBPPR8639 ---- Animal proteins ---- Mannose-binding protein A
Source.2705: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1
Source.2706: DFBPPR8642 ---- Animal proteins ---- Major prion protein
Source.2707: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.2708: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.2709: DFBPPR8649 ---- Animal proteins ---- Acrosin
Source.2710: DFBPPR8657 ---- Animal proteins ---- Annexin A2
Source.2711: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2712: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.2713: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1
Source.2714: DFBPPR8674 ---- Animal proteins ---- Calpain-3
Source.2715: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.2716: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.2717: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.2718: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.2719: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.2720: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.2721: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.2722: DFBPPR8722 ---- Animal proteins ---- Ras-related protein Rab-5A
Source.2723: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9
Source.2724: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.2725: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1
Source.2726: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.2727: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.2728: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H
Source.2729: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2730: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.2731: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.2732: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.2733: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.2734: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I
Source.2735: DFBPPR8763 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit
Source.2736: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase
Source.2737: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.2738: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.2739: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.2740: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain
Source.2741: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain
Source.2742: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.2743: DFBPPR8795 ---- Animal proteins ---- Pro-adrenomedullin
Source.2744: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.2745: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase
Source.2746: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.2747: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.2748: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.2749: DFBPPR8811 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.2750: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.2751: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.2752: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.2753: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase
Source.2754: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase
Source.2755: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.2756: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.2757: DFBPPR8832 ---- Animal proteins ---- Ras-related protein Rab-3A
Source.2758: DFBPPR8838 ---- Animal proteins ---- Cathepsin K
Source.2759: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.2760: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1
Source.2761: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.2762: DFBPPR8855 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.2763: DFBPPR8857 ---- Animal proteins ---- Allograft inflammatory factor 1
Source.2764: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2765: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.2766: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.2767: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.2768: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.2769: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.2770: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.2771: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.2772: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.2773: DFBPPR8966 ---- Animal proteins ---- Calpain small subunit 1
Source.2774: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.2775: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.2776: DFBPPR8982 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta
Source.2777: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.2778: DFBPPR9019 ---- Animal proteins ---- Inositol monophosphatase 1
Source.2779: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.2780: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.2781: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.2782: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.2783: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.2784: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.2785: DFBPPR9033 ---- Animal proteins ---- Interleukin-2
Source.2786: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80
Source.2787: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.2788: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.2789: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2790: DFBPPR9082 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.2791: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta
Source.2792: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1
Source.2793: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.2794: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.2795: DFBPPR9107 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.2796: DFBPPR9110 ---- Animal proteins ---- Insulin-like growth factor I
Source.2797: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.2798: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.2799: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.2800: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6
Source.2801: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.2802: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.2803: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.2804: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor
Source.2805: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.2806: DFBPPR9148 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1
Source.2807: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.2808: DFBPPR9156 ---- Animal proteins ---- Diamine acetyltransferase 1
Source.2809: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.2810: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.2811: DFBPPR9171 ---- Animal proteins ---- Sorbin and SH3 domain-containing protein 2
Source.2812: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.2813: DFBPPR9181 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.2814: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.2815: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein
Source.2816: DFBPPR9195 ---- Animal proteins ---- Sex-determining region Y protein
Source.2817: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.2818: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.2819: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.2820: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.2821: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1
Source.2822: DFBPPR9216 ---- Animal proteins ---- Netrin-1
Source.2823: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.2824: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.2825: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.2826: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta
Source.2827: DFBPPR9236 ---- Animal proteins ---- Radixin
Source.2828: DFBPPR9240 ---- Animal proteins ---- Thyrotropin subunit beta
Source.2829: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.2830: DFBPPR9257 ---- Animal proteins ---- Ribonuclease 4
Source.2831: DFBPPR9258 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.2832: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.2833: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase
Source.2834: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.2835: DFBPPR9265 ---- Animal proteins ---- Pantetheinase
Source.2836: DFBPPR9269 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.2837: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.2838: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase
Source.2839: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.2840: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.2841: DFBPPR9298 ---- Animal proteins ---- Melanocortin receptor 4
Source.2842: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase
Source.2843: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.2844: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.2845: DFBPPR9314 ---- Animal proteins ---- Regucalcin
Source.2846: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.2847: DFBPPR9331 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.2848: DFBPPR9337 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.2849: DFBPPR9338 ---- Animal proteins ---- SPARC
Source.2850: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.2851: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1
Source.2852: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1
Source.2853: DFBPPR9349 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.2854: DFBPPR9350 ---- Animal proteins ---- RNA-binding protein 4B
Source.2855: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.2856: DFBPPR9363 ---- Animal proteins ---- Moesin
Source.2857: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.2858: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.2859: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.2860: DFBPPR9377 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.2861: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.2862: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1
Source.2863: DFBPPR9382 ---- Animal proteins ---- Proteasome subunit beta type-4
Source.2864: DFBPPR9384 ---- Animal proteins ---- Interferon epsilon
Source.2865: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4
Source.2866: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.2867: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2868: DFBPPR9427 ---- Animal proteins ---- Protein quaking
Source.2869: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2
Source.2870: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.2871: DFBPPR9461 ---- Animal proteins ---- CCN family member 2
Source.2872: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.2873: DFBPPR9494 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin
Source.2874: DFBPPR9495 ---- Animal proteins ---- Complement factor B
Source.2875: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2
Source.2876: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.2877: DFBPPR9512 ---- Animal proteins ---- Acylphosphatase-2
Source.2878: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.2879: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.2880: DFBPPR9532 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.2881: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6
Source.2882: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.2883: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase
Source.2884: DFBPPR9544 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.2885: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic
Source.2886: DFBPPR9546 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1E
Source.2887: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.2888: DFBPPR9569 ---- Animal proteins ---- Myelin proteolipid protein
Source.2889: DFBPPR9602 ---- Animal proteins ---- Gastrin-releasing peptide
Source.2890: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2891: DFBPPR9625 ---- Animal proteins ---- HORMA domain-containing protein 1
Source.2892: DFBPPR9628 ---- Animal proteins ---- Mineralocorticoid receptor
Source.2893: DFBPPR9637 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.2894: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.2895: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1
Source.2896: DFBPPR9658 ---- Animal proteins ---- Melanocortin receptor 5
Source.2897: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2898: DFBPPR9684 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.2899: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.2900: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.2901: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.2902: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.2903: DFBPPR9785 ---- Animal proteins ---- F-box only protein 32
Source.2904: DFBPPR9788 ---- Animal proteins ---- ATP synthase-coupling factor 6, mitochondrial
Source.2905: DFBPPR9791 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.2906: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2
Source.2907: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.2908: DFBPPR9814 ---- Animal proteins ---- Testin
Source.2909: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.2910: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.2911: DFBPPR9834 ---- Animal proteins ---- Interferon-related developmental regulator 1
Source.2912: DFBPPR9843 ---- Animal proteins ---- P protein
Source.2913: DFBPPR9852 ---- Animal proteins ---- Trafficking protein particle complex subunit 2
Source.2914: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.2915: DFBPPR9883 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.2916: DFBPPR9895 ---- Animal proteins ---- 40S ribosomal protein S12
Source.2917: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.2918: DFBPPR9927 ---- Animal proteins ---- Protein BTG3
Source.2919: DFBPPR9959 ---- Animal proteins ---- Interferon gamma
Source.2920: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.2921: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.2922: DFBPPR9987 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein
Source.2923: DFBPPR9991 ---- Animal proteins ---- Insulin-like growth factor I
Source.2924: DFBPPR9993 ---- Animal proteins ---- Ovalbumin
Source.2925: DFBPPR9996 ---- Animal proteins ---- Riboflavin-binding protein
Source.2926: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.2927: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2928: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain
Source.2929: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.2930: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16
Source.2931: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.2932: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2
Source.2933: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.2934: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B
Source.2935: DFBPPR10030 ---- Animal proteins ---- Calbindin
Source.2936: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.2937: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A
Source.2938: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.2939: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.2940: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.2941: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.2942: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.2943: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9
Source.2944: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase
Source.2945: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.2946: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2947: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2
Source.2948: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.2949: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.2950: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2
Source.2951: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.2952: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2953: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.2954: DFBPPR10098 ---- Animal proteins ---- Mucin-6
Source.2955: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2956: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7
Source.2957: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2
Source.2958: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.2959: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.2960: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.2961: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.2962: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3
Source.2963: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.2964: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.2965: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.2966: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase
Source.2967: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1
Source.2968: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.2969: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase
Source.2970: DFBPPR10136 ---- Animal proteins ---- Annexin A2
Source.2971: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor
Source.2972: DFBPPR10142 ---- Animal proteins ---- Calpain-3
Source.2973: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.2974: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.2975: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.2976: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.2977: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.2978: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog
Source.2979: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.2980: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.2981: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.2982: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.2983: DFBPPR10170 ---- Animal proteins ---- Drebrin
Source.2984: DFBPPR10171 ---- Animal proteins ---- Heterochromatin-associated protein MENT
Source.2985: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.2986: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.2987: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5
Source.2988: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.2989: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.2990: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.2991: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.2992: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.2993: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.2994: DFBPPR10205 ---- Animal proteins ---- Noelin
Source.2995: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.2996: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1
Source.2997: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11
Source.2998: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein
Source.2999: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.3000: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3
Source.3001: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.3002: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.3003: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1
Source.3004: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.3005: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.3006: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.3007: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.3008: DFBPPR10271 ---- Animal proteins ---- Cadherin-7
Source.3009: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.3010: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.3011: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3012: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6
Source.3013: DFBPPR10288 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.3014: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.3015: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.3016: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.3017: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.3018: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.3019: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2
Source.3020: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.3021: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1
Source.3022: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.3023: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.3024: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.3025: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1
Source.3026: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.3027: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7
Source.3028: DFBPPR10329 ---- Animal proteins ---- Activity-regulated cytoskeleton-associated protein
Source.3029: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.3030: DFBPPR10331 ---- Animal proteins ---- Calcineurin B homologous protein 3
Source.3031: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.3032: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.3033: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.3034: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.3035: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase
Source.3036: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.3037: DFBPPR10361 ---- Animal proteins ---- Protein HIRA
Source.3038: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.3039: DFBPPR10366 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.3040: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.3041: DFBPPR10376 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.3042: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.3043: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.3044: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.3045: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.3046: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.3047: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.3048: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.3049: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.3050: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.3051: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.3052: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5
Source.3053: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.3054: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.3055: DFBPPR10427 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle major isoform
Source.3056: DFBPPR10428 ---- Animal proteins ---- Polycomb complex protein BMI-1
Source.3057: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.3058: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.3059: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.3060: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.3061: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c
Source.3062: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.3063: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.3064: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.3065: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.3066: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.3067: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.3068: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.3069: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.3070: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.3071: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.3072: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.3073: DFBPPR10485 ---- Animal proteins ---- LIM domain-binding protein 1
Source.3074: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.3075: DFBPPR10494 ---- Animal proteins ---- Interferon lambda receptor 1
Source.3076: DFBPPR10495 ---- Animal proteins ---- Y-box-binding protein 1
Source.3077: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.3078: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.3079: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.3080: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon
Source.3081: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.3082: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.3083: DFBPPR10505 ---- Animal proteins ---- DNA-binding protein Ikaros
Source.3084: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta
Source.3085: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.3086: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.3087: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.3088: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.3089: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.3090: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.3091: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.3092: DFBPPR10541 ---- Animal proteins ---- Glypican-1
Source.3093: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3
Source.3094: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1
Source.3095: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.3096: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.3097: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.3098: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.3099: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.3100: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.3101: DFBPPR10584 ---- Animal proteins ---- Nuclear distribution protein nudE homolog 1
Source.3102: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.3103: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6
Source.3104: DFBPPR10594 ---- Animal proteins ---- Aromatase
Source.3105: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit
Source.3106: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.3107: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain
Source.3108: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.3109: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D
Source.3110: DFBPPR10611 ---- Animal proteins ---- Inhibitor of growth protein 4
Source.3111: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.3112: DFBPPR10613 ---- Animal proteins ---- Diamine acetyltransferase 1
Source.3113: DFBPPR10616 ---- Animal proteins ---- Cholecystokinin
Source.3114: DFBPPR10619 ---- Animal proteins ---- Adenosine receptor A2b
Source.3115: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin
Source.3116: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.3117: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.3118: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.3119: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai
Source.3120: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.3121: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.3122: DFBPPR10646 ---- Animal proteins ---- Netrin-1
Source.3123: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.3124: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.3125: DFBPPR10656 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.3126: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.3127: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.3128: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.3129: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3
Source.3130: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin
Source.3131: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.3132: DFBPPR10686 ---- Animal proteins ---- Collectin-11
Source.3133: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.3134: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.3135: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.3136: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.3137: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.3138: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.3139: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.3140: DFBPPR10715 ---- Animal proteins ---- Lumican
Source.3141: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.3142: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog
Source.3143: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.3144: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.3145: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.3146: DFBPPR10731 ---- Animal proteins ---- Protein cereblon
Source.3147: DFBPPR10733 ---- Animal proteins ---- Ras-related protein Rab-6A
Source.3148: DFBPPR10734 ---- Animal proteins ---- Homeobox protein Hox-B4
Source.3149: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.3150: DFBPPR10737 ---- Animal proteins ---- Programmed cell death protein 10
Source.3151: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.3152: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.3153: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.3154: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4
Source.3155: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein
Source.3156: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.3157: DFBPPR10758 ---- Animal proteins ---- Tubulin-specific chaperone A
Source.3158: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.3159: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.3160: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3161: DFBPPR10770 ---- Animal proteins ---- Mannose-binding protein
Source.3162: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3163: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3164: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3165: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5
Source.3166: DFBPPR10785 ---- Animal proteins ---- Cytochrome b5
Source.3167: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12
Source.3168: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1
Source.3169: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.3170: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.3171: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.3172: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.3173: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.3174: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.3175: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.3176: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.3177: DFBPPR10839 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2
Source.3178: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5
Source.3179: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.3180: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.3181: DFBPPR10851 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.3182: DFBPPR10852 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.3183: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.3184: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26
Source.3185: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.3186: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.3187: DFBPPR10875 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.3188: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.3189: DFBPPR10878 ---- Animal proteins ---- Zinc finger protein DPF3
Source.3190: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.3191: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain
Source.3192: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.3193: DFBPPR10887 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.3194: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.3195: DFBPPR10900 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.3196: DFBPPR10904 ---- Animal proteins ---- Signal transducing adapter molecule 2
Source.3197: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.3198: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.3199: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.3200: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.3201: DFBPPR10923 ---- Animal proteins ---- Ras-related protein Rab-5B
Source.3202: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.3203: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.3204: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1
Source.3205: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.3206: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2
Source.3207: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.3208: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type
Source.3209: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.3210: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.3211: DFBPPR10965 ---- Animal proteins ---- Nuclear factor 1 X-type
Source.3212: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.3213: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.3214: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog
Source.3215: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.3216: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.3217: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.3218: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8
Source.3219: DFBPPR10995 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.3220: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.3221: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.3222: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.3223: DFBPPR11029 ---- Animal proteins ---- Myelin proteolipid protein
Source.3224: DFBPPR11030 ---- Animal proteins ---- Protein C-ets-2
Source.3225: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.3226: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.3227: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.3228: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.3229: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.3230: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.3231: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.3232: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2
Source.3233: DFBPPR11062 ---- Animal proteins ---- Regucalcin
Source.3234: DFBPPR11067 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.3235: DFBPPR11069 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.3236: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1
Source.3237: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.3238: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.3239: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.3240: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1
Source.3241: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1
Source.3242: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.3243: DFBPPR11112 ---- Animal proteins ---- Protein quaking
Source.3244: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.3245: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14
Source.3246: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1
Source.3247: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.3248: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain
Source.3249: DFBPPR11148 ---- Animal proteins ---- Pro-thyrotropin-releasing hormone
Source.3250: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3251: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog
Source.3252: DFBPPR11151 ---- Animal proteins ---- SPARC
Source.3253: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.3254: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.3255: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.3256: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.3257: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.3258: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.3259: DFBPPR11199 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.3260: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.3261: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha
Source.3262: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1
Source.3263: DFBPPR11205 ---- Animal proteins ---- Protein 4.1
Source.3264: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.3265: DFBPPR11211 ---- Animal proteins ---- Acylphosphatase-2
Source.3266: DFBPPR11212 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.3267: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.3268: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2
Source.3269: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2
Source.3270: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.3271: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2
Source.3272: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.3273: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.3274: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.3275: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2
Source.3276: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.3277: DFBPPR11243 ---- Animal proteins ---- Epiphycan
Source.3278: DFBPPR11244 ---- Animal proteins ---- Frizzled-6
Source.3279: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.3280: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.3281: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.3282: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.3283: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6
Source.3284: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.3285: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.3286: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.3287: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3
Source.3288: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.3289: DFBPPR11279 ---- Animal proteins ---- Zinc finger protein neuro-d4
Source.3290: DFBPPR11282 ---- Animal proteins ---- Ras-related protein Rab-5C
Source.3291: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.3292: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein
Source.3293: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.3294: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.3295: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.3296: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.3297: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2
Source.3298: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.3299: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.3300: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6
Source.3301: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog
Source.3302: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2
Source.3303: DFBPPR11318 ---- Animal proteins ---- Chromatin modification-related protein MEAF6
Source.3304: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.3305: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8
Source.3306: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2
Source.3307: DFBPPR11329 ---- Animal proteins ---- Bone sialoprotein 2
Source.3308: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.3309: DFBPPR11346 ---- Animal proteins ---- Diencephalon/mesencephalon homeobox protein 1
Source.3310: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase
Source.3311: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4
Source.3312: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.3313: DFBPPR11364 ---- Animal proteins ---- Interleukin-18
Source.3314: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1
Source.3315: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.3316: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1
Source.3317: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.3318: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7
Source.3319: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.3320: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.3321: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1
Source.3322: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.3323: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.3324: DFBPPR11411 ---- Animal proteins ---- Zinc finger protein ubi-d4
Source.3325: DFBPPR11412 ---- Animal proteins ---- Hyaluronan synthase 3
Source.3326: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.3327: DFBPPR11419 ---- Animal proteins ---- Glutathione S-transferase
Source.3328: DFBPPR11432 ---- Animal proteins ---- Homeobox protein Hox-D9
Source.3329: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3330: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator
Source.3331: DFBPPR11450 ---- Animal proteins ---- Potassium voltage-gated channel subfamily G member 2
Source.3332: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46
Source.3333: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.3334: DFBPPR11464 ---- Animal proteins ---- Homeobox protein Hox-D10
Source.3335: DFBPPR11466 ---- Animal proteins ---- GDNF family receptor alpha-2
Source.3336: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog
Source.3337: DFBPPR11472 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein
Source.3338: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.3339: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5
Source.3340: DFBPPR11480 ---- Animal proteins ---- Cytochrome P450 1A2
Source.3341: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.3342: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase
Source.3343: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7
Source.3344: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.3345: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog
Source.3346: DFBPPR11513 ---- Animal proteins ---- Corepressor interacting with RBPJ 1
Source.3347: DFBPPR11514 ---- Animal proteins ---- Homeobox protein Hox-D11
Source.3348: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3349: DFBPPR11526 ---- Animal proteins ---- Fibromodulin
Source.3350: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.3351: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD
Source.3352: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.3353: DFBPPR11541 ---- Animal proteins ---- Tetraspanin-12
Source.3354: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.3355: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.3356: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.3357: DFBPPR11557 ---- Animal proteins ---- Regulator of G-protein signaling 17
Source.3358: DFBPPR11558 ---- Animal proteins ---- Nuclear migration protein nudC
Source.3359: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.3360: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.3361: DFBPPR11567 ---- Animal proteins ---- Ovocalyxin-32
Source.3362: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.3363: DFBPPR11579 ---- Animal proteins ---- Actin-related protein 6
Source.3364: DFBPPR11584 ---- Animal proteins ---- NF-kappa-B inhibitor alpha
Source.3365: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.3366: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein
Source.3367: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.3368: DFBPPR11599 ---- Animal proteins ---- Homeobox protein Hox-A9
Source.3369: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.3370: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.3371: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.3372: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8
Source.3373: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3374: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5
Source.3375: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.3376: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.3377: DFBPPR11641 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.3378: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.3379: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4
Source.3380: DFBPPR11647 ---- Animal proteins ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.3381: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.3382: DFBPPR11659 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.3383: DFBPPR11660 ---- Animal proteins ---- Cathepsin K
Source.3384: DFBPPR11664 ---- Animal proteins ---- Swi5-dependent recombination DNA repair protein 1 homolog
Source.3385: DFBPPR11667 ---- Animal proteins ---- Heme transporter HRG1
Source.3386: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit
Source.3387: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.3388: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.3389: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.3390: DFBPPR11715 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.3391: DFBPPR11719 ---- Animal proteins ---- Protein RER1
Source.3392: DFBPPR11722 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain
Source.3393: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.3394: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.3395: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.3396: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein
Source.3397: DFBPPR11754 ---- Animal proteins ---- Neurocalcin-delta
Source.3398: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein
Source.3399: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6
Source.3400: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.3401: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1
Source.3402: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.3403: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.3404: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4
Source.3405: DFBPPR11782 ---- Animal proteins ---- Trafficking protein particle complex subunit 3
Source.3406: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2
Source.3407: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B
Source.3408: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3
Source.3409: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5
Source.3410: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91
Source.3411: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.3412: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.3413: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.3414: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.3415: DFBPPR11828 ---- Animal proteins ---- Spindlin-Z
Source.3416: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.3417: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.3418: DFBPPR11841 ---- Animal proteins ---- Trafficking protein particle complex subunit 2
Source.3419: DFBPPR11843 ---- Animal proteins ---- Visinin-like protein 1
Source.3420: DFBPPR11856 ---- Animal proteins ---- Spindlin-W
Source.3421: DFBPPR11863 ---- Animal proteins ---- Purpurin
Source.3422: DFBPPR11864 ---- Animal proteins ---- Radixin
Source.3423: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.3424: DFBPPR11873 ---- Animal proteins ---- Ligand-dependent nuclear receptor corepressor-like protein
Source.3425: DFBPPR11874 ---- Animal proteins ---- Serum response factor
Source.3426: DFBPPR11876 ---- Animal proteins ---- Terminal nucleotidyltransferase 5C
Source.3427: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.3428: DFBPPR11895 ---- Animal proteins ---- 40S ribosomal protein S12
Source.3429: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.3430: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.3431: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3
Source.3432: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.3433: DFBPPR11931 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 20
Source.3434: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.3435: DFBPPR11954 ---- Animal proteins ---- SIN3-HDAC complex-associated factor
Source.3436: DFBPPR11959 ---- Animal proteins ---- Deubiquitinase OTUD6B
Source.3437: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.3438: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.3439: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.3440: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1
Source.3441: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.3442: DFBPPR11987 ---- Animal proteins ---- NEDD4-binding protein 3 homolog
Source.3443: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.3444: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.3445: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.3446: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.3447: DFBPPR12016 ---- Animal proteins ---- ORM1-like protein 2
Source.3448: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.3449: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.3450: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2
Source.3451: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.3452: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.3453: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.3454: DFBPPR12060 ---- Animal proteins ---- Neurobeachin
Source.3455: DFBPPR12065 ---- Animal proteins ---- Testin
Source.3456: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.3457: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme
Source.3458: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.3459: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.3460: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.3461: DFBPPR12122 ---- Animal proteins ---- Fibroblast growth factor-binding protein 2
Source.3462: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.3463: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.3464: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23
Source.3465: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.3466: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.3467: DFBPPR12160 ---- Animal proteins ---- Transmembrane protein 229B
Source.3468: DFBPPR12163 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.3469: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.3470: DFBPPR12195 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.3471: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180
Source.3472: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.3473: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein
Source.3474: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2
Source.3475: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68
Source.3476: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10
Source.3477: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.3478: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.3479: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.3480: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.3481: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2
Source.3482: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1
Source.3483: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.3484: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.3485: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.3486: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.3487: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.3488: DFBPPR12278 ---- Animal proteins ---- Major prion protein
Source.3489: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.3490: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.3491: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1
Source.3492: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.3493: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.3494: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.3495: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.3496: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.3497: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.3498: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.3499: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.3500: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.3501: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.3502: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5
Source.3503: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.3504: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor
Source.3505: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type
Source.3506: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1
Source.3507: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.3508: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3509: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.3510: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2
Source.3511: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.3512: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.3513: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.3514: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.3515: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.3516: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.3517: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.3518: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform
Source.3519: DFBPPR12371 ---- Animal proteins ---- Y-box-binding protein 1
Source.3520: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.3521: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.3522: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.3523: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.3524: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1
Source.3525: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma
Source.3526: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.3527: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.3528: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.3529: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.3530: DFBPPR12400 ---- Animal proteins ---- RNA-binding protein 4
Source.3531: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.3532: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.3533: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.3534: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.3535: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.3536: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1
Source.3537: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase
Source.3538: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.3539: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3540: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.3541: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.3542: DFBPPR12436 ---- Animal proteins ---- Cytochrome b5
Source.3543: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.3544: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.3545: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.3546: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1
Source.3547: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.3548: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.3549: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.3550: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.3551: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.3552: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3553: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.3554: DFBPPR12461 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.3555: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.3556: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.3557: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.3558: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.3559: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.3560: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.3561: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.3562: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.3563: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.3564: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.3565: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.3566: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.3567: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.3568: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.3569: DFBPPR12507 ---- Animal proteins ---- Cathepsin K
Source.3570: DFBPPR12508 ---- Animal proteins ---- Interleukin-2
Source.3571: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.3572: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.3573: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.3574: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII
Source.3575: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.3576: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.3577: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.3578: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.3579: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.3580: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.3581: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.3582: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.3583: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.3584: DFBPPR12552 ---- Animal proteins ---- Acylphosphatase-2
Source.3585: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.3586: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.3587: DFBPPR12560 ---- Animal proteins ---- Calumenin
Source.3588: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1
Source.3589: DFBPPR12564 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.3590: DFBPPR12567 ---- Animal proteins ---- Calpain small subunit 1
Source.3591: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.3592: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.3593: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.3594: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.3595: DFBPPR12591 ---- Animal proteins ---- Annexin A11
Source.3596: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20
Source.3597: DFBPPR12614 ---- Animal proteins ---- Interleukin-6
Source.3598: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.3599: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.3600: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.3601: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.3602: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12
Source.3603: DFBPPR12630 ---- Animal proteins ---- Insulin-like growth factor I
Source.3604: DFBPPR12649 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.3605: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.3606: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.3607: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor
Source.3608: DFBPPR12680 ---- Animal proteins ---- Tubulin-specific chaperone A
Source.3609: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3610: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3611: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.3612: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1
Source.3613: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.3614: DFBPPR12722 ---- Animal proteins ---- Myelin proteolipid protein
Source.3615: DFBPPR12723 ---- Animal proteins ---- Glutathione S-transferase alpha I
Source.3616: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.3617: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.3618: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.3619: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.3620: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14
Source.3621: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.3622: DFBPPR12762 ---- Animal proteins ---- SPARC
Source.3623: DFBPPR12768 ---- Animal proteins ---- Pepsin-3
Source.3624: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.3625: DFBPPR12770 ---- Animal proteins ---- Filamin-B
Source.3626: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.3627: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.3628: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.3629: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.3630: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.3631: DFBPPR12792 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.3632: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.3633: DFBPPR12796 ---- Animal proteins ---- Caspase-3
Source.3634: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.3635: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.3636: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.3637: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.3638: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.3639: DFBPPR12829 ---- Animal proteins ---- Glutathione S-transferase Yc
Source.3640: DFBPPR12831 ---- Animal proteins ---- Serine--pyruvate aminotransferase
Source.3641: DFBPPR12832 ---- Animal proteins ---- Secretin receptor
Source.3642: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.3643: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.3644: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.3645: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain
Source.3646: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.3647: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.3648: DFBPPR12866 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.3649: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.3650: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase
Source.3651: DFBPPR12892 ---- Animal proteins ---- Translocon-associated protein subunit alpha
Source.3652: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.3653: DFBPPR12898 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.3654: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.3655: DFBPPR12914 ---- Animal proteins ---- Lipase member H
Source.3656: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C
Source.3657: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.3658: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.3659: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.3660: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.3661: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.3662: DFBPPR12975 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.3663: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.3664: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.3665: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.3666: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.3667: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.3668: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2
Source.3669: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.3670: DFBPPR13036 ---- Animal proteins ---- Gamma-crystallin S
Source.3671: DFBPPR13054 ---- Animal proteins ---- Relaxin-like protein SQ10
Source.3672: DFBPPR13062 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.3673: DFBPPR13080 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.3674: DFBPPR13090 ---- Animal proteins ---- Annexin A8
Source.3675: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.3676: DFBPPR13092 ---- Animal proteins ---- Testin
Source.3677: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3678: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1
Source.3679: DFBPPR13153 ---- Animal proteins ---- Interleukin-18
Source.3680: DFBPPR13154 ---- Animal proteins ---- Annexin A1
Source.3681: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3682: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3683: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2
Source.3684: DFBPPR13174 ---- Animal proteins ---- Clusterin
Source.3685: DFBPPR13176 ---- Animal proteins ---- Aromatase
Source.3686: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase
Source.3687: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.3688: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.3689: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.3690: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.3691: DFBPPR13222 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.3692: DFBPPR13223 ---- Animal proteins ---- Caspase-1
Source.3693: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.3694: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3695: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.3696: DFBPPR13251 ---- Animal proteins ---- Cytochrome b5
Source.3697: DFBPPR13256 ---- Animal proteins ---- Interleukin-1 beta
Source.3698: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.3699: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.3700: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.3701: DFBPPR13276 ---- Animal proteins ---- Protein quaking
Source.3702: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.3703: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a
Source.3704: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.3705: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.3706: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.3707: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.3708: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.3709: DFBPPR13309 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.3710: DFBPPR13310 ---- Animal proteins ---- Thyrotropin subunit beta
Source.3711: DFBPPR13313 ---- Animal proteins ---- Insulin-like growth factor I
Source.3712: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.3713: DFBPPR13324 ---- Animal proteins ---- Acylphosphatase-2
Source.3714: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha
Source.3715: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.3716: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.3717: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.3718: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.3719: DFBPPR13363 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3720: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.3721: DFBPPR13370 ---- Animal proteins ---- Interleukin-2
Source.3722: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.3723: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.3724: DFBPPR13385 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3725: DFBPPR13393 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.3726: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.3727: DFBPPR13409 ---- Animal proteins ---- Testin
Source.3728: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3729: DFBPPR13433 ---- Animal proteins ---- Major prion protein
Source.3730: DFBPPR13434 ---- Animal proteins ---- Aromatase
Source.3731: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.3732: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.3733: DFBPPR13447 ---- Animal proteins ---- Insulin-like growth factor I
Source.3734: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.3735: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3736: DFBPPR13469 ---- Animal proteins ---- Cytochrome b
Source.3737: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3
Source.3738: DFBPPR13483 ---- Animal proteins ---- Interleukin-18
Source.3739: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1
Source.3740: DFBPPR13498 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3741: DFBPPR13506 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3742: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.3743: DFBPPR13512 ---- Animal proteins ---- Interleukin-2
Source.3744: DFBPPR13530 ---- Animal proteins ---- Major prion protein
Source.3745: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3746: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2
Source.3747: DFBPPR13542 ---- Animal proteins ---- Pyridoxal kinase
Source.3748: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3749: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3750: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1
Source.3751: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.3752: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.3753: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.3754: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.3755: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.3756: DFBPPR13584 ---- Animal proteins ---- Calpain-3
Source.3757: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3758: DFBPPR13587 ---- Animal proteins ---- Aquaporin-1
Source.3759: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.3760: DFBPPR13593 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.3761: DFBPPR13600 ---- Animal proteins ---- Glucocorticoid receptor
Source.3762: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.3763: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.3764: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta
Source.3765: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.3766: DFBPPR13637 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial
Source.3767: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2
Source.3768: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.3769: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.3770: DFBPPR13672 ---- Animal proteins ---- Annexin A2
Source.3771: DFBPPR13673 ---- Animal proteins ---- Insulin-like growth factor I
Source.3772: DFBPPR13675 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.3773: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic
Source.3774: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.3775: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.3776: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.3777: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III
Source.3778: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.3779: DFBPPR13712 ---- Animal proteins ---- Cytochrome b
Source.3780: DFBPPR13726 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.3781: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.3782: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.3783: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.3784: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3785: DFBPPR13739 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain
Source.3786: DFBPPR13750 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, cytosolic
Source.3787: DFBPPR13755 ---- Animal proteins ---- Aromatase
Source.3788: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.3789: DFBPPR13761 ---- Animal proteins ---- Gap junction beta-2 protein
Source.3790: DFBPPR13763 ---- Animal proteins ---- Interleukin-2
Source.3791: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.3792: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3793: DFBPPR13782 ---- Animal proteins ---- BMP and activin membrane-bound inhibitor homolog
Source.3794: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.3795: DFBPPR13806 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.3796: DFBPPR13823 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.3797: DFBPPR13840 ---- Animal proteins ---- Cytochrome b561
Source.3798: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3
Source.3799: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1
Source.3800: DFBPPR13854 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.3801: DFBPPR13856 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.3802: DFBPPR13857 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.3803: DFBPPR13865 ---- Animal proteins ---- C-C chemokine receptor type 9
Source.3804: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.3805: DFBPPR13892 ---- Animal proteins ---- Melanocortin receptor 5
Source.3806: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.3807: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.3808: DFBPPR13909 ---- Animal proteins ---- Homeobox protein Hox-C9
Source.3809: DFBPPR13912 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.3810: DFBPPR13915 ---- Animal proteins ---- Gastrin-releasing peptide
Source.3811: DFBPPR13917 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.3812: DFBPPR13918 ---- Animal proteins ---- Testin
Source.3813: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.3814: DFBPPR13944 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.3815: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.3816: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.3817: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.3818: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.3819: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.3820: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.3821: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.3822: DFBPPR14005 ---- Animal proteins ---- Fish-egg lectin
Source.3823: DFBPPR14007 ---- Animal proteins ---- Cystatin
Source.3824: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.3825: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3826: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3827: DFBPPR14052 ---- Animal proteins ---- Insulin-like growth factor I, adult form
Source.3828: DFBPPR14055 ---- Animal proteins ---- Insulin-like growth factor I, juvenile form
Source.3829: DFBPPR14056 ---- Animal proteins ---- Gamma-crystallin M3
Source.3830: DFBPPR14060 ---- Animal proteins ---- Gamma-crystallin M2
Source.3831: DFBPPR14062 ---- Animal proteins ---- Alpha-1-antitrypsin homolog
Source.3832: DFBPPR14063 ---- Animal proteins ---- Homeobox protein Hox-B1
Source.3833: DFBPPR14064 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.3834: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36
Source.3835: DFBPPR14089 ---- Marine protein ---- Flap endonuclease 1
Source.3836: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.3837: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha
Source.3838: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C
Source.3839: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.3840: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A
Source.3841: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.3842: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.3843: DFBPPR14132 ---- Marine protein ---- Calumenin-A
Source.3844: DFBPPR14133 ---- Marine protein ---- Calumenin-B
Source.3845: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I
Source.3846: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1
Source.3847: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein
Source.3848: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.3849: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog
Source.3850: DFBPPR14163 ---- Marine protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.3851: DFBPPR14164 ---- Marine protein ---- Ragulator complex protein LAMTOR2
Source.3852: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.3853: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator
Source.3854: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.3855: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein
Source.3856: DFBPPR14193 ---- Marine protein ---- ER membrane protein complex subunit 4
Source.3857: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog
Source.3858: DFBPPR14197 ---- Marine protein ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.3859: DFBPPR14215 ---- Marine protein ---- Protein SMG9
Source.3860: DFBPPR14218 ---- Marine protein ---- 60S ribosomal protein L18a
Source.3861: DFBPPR14226 ---- Marine protein ---- LYR motif-containing protein 4A
Source.3862: DFBPPR14227 ---- Marine protein ---- LYR motif-containing protein 4B
Source.3863: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain
Source.3864: DFBPPR14235 ---- Marine protein ---- Calcitonin-1
Source.3865: DFBPPR14239 ---- Marine protein ---- Gonadotropin subunit beta-1
Source.3866: DFBPPR14288 ---- Marine protein ---- Allophycocyanin beta chain
Source.3867: DFBPPR14289 ---- Marine protein ---- Allophycocyanin alpha chain
Source.3868: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.3869: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.3870: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.3871: DFBPPR14314 ---- Marine protein ---- Probable ATP-dependent transporter ycf16
Source.3872: DFBPPR14326 ---- Marine protein ---- Allophycocyanin alpha chain
Source.3873: DFBPPR14327 ---- Marine protein ---- Allophycocyanin beta chain
Source.3874: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3875: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.3876: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3877: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.3878: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B
Source.3879: DFBPPR14342 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.3880: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic
Source.3881: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.3882: DFBPPR14364 ---- Marine protein ---- Ribulose bisphosphate carboxylase small chain
Source.3883: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.3884: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.3885: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic
Source.3886: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase
Source.3887: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.3888: DFBPPR14401 ---- Marine protein ---- 50S ribosomal protein L4, chloroplastic
Source.3889: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha
Source.3890: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.3891: DFBPPR14407 ---- Marine protein ---- Allophycocyanin alpha-B chain
Source.3892: DFBPPR14417 ---- Marine protein ---- Histidine--tRNA ligase, chloroplastic
Source.3893: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.3894: DFBPPR14439 ---- Marine protein ---- 50S ribosomal protein L5, chloroplastic
Source.3895: DFBPPR14472 ---- Marine protein ---- Photosystem I reaction center subunit XI
Source.3896: DFBPPR14473 ---- Marine protein ---- Photosystem II reaction center Psb28 protein
Source.3897: DFBPPR14488 ---- Marine protein ---- Putative cytochrome c-type biogenesis protein DbsD-like
Source.3898: DFBPPR14504 ---- Marine protein ---- Probable ABC transporter permease protein ycf63
Source.3899: DFBPPR14520 ---- Marine protein ---- Uncharacterized protein ycf23
Source.3900: DFBPPR14526 ---- Marine protein ---- Uncharacterized protein ycf91
Source.3901: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.3902: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.3903: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.3904: DFBPPR14548 ---- Marine protein ---- Mineralocorticoid receptor
Source.3905: DFBPPR14557 ---- Marine protein ---- Interferon a3
Source.3906: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.3907: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.3908: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.3909: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.3910: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.3911: DFBPPR14583 ---- Marine protein ---- Insulin-like growth factor I
Source.3912: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros
Source.3913: DFBPPR14587 ---- Marine protein ---- Thyrotropin subunit beta
Source.3914: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible
Source.3915: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b
Source.3916: DFBPPR14602 ---- Marine protein ---- Proteasome subunit beta type-3
Source.3917: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.3918: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing]
Source.3919: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha
Source.3920: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.3921: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.3922: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1
Source.3923: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a
Source.3924: DFBPPR14634 ---- Marine protein ---- Neuroglobin-2
Source.3925: DFBPPR14656 ---- Marine protein ---- Neuroglobin-1
Source.3926: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme
Source.3927: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I
Source.3928: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.3929: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.3930: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.3931: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.3932: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.3933: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.3934: DFBPPR14756 ---- Marine protein ---- Clotting factor G beta subunit
Source.3935: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.3936: DFBPPR14758 ---- Marine protein ---- Techylectin-5B
Source.3937: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.3938: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.3939: DFBPPR14783 ---- Marine protein ---- Enolase
Source.3940: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.3941: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain
Source.3942: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain
Source.3943: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.3944: DFBPPR14796 ---- Marine protein ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.3945: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase
Source.3946: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.3947: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.3948: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.3949: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1
Source.3950: DFBPPR14821 ---- Marine protein ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1
Source.3951: DFBPPR14853 ---- Marine protein ---- Sarcoplasmic calcium-binding protein 1
Source.3952: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.3953: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3954: DFBPPR14873 ---- Marine protein ---- Somatolactin
Source.3955: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1
Source.3956: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.3957: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.3958: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.3959: DFBPPR14898 ---- Microorganism protein ---- Transcription factor IIIB 70 kDa subunit
Source.3960: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.3961: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.3962: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.3963: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.3964: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.3965: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.3966: DFBPPR14919 ---- Microorganism protein ---- Transcription elongation factor SPT4
Source.3967: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.3968: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18
Source.3969: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.3970: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1
Source.3971: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.3972: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.3973: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.3974: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2
Source.3975: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27
Source.3976: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.3977: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.3978: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase
Source.3979: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.3980: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like
Source.3981: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.3982: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.3983: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial
Source.3984: DFBPPR14989 ---- Microorganism protein ---- cAMP-dependent protein kinase regulatory subunit
Source.3985: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.3986: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.3987: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.3988: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.3989: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b
Source.3990: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase
Source.3991: DFBPPR15014 ---- Microorganism protein ---- AP-1-like transcription factor YAP1
Source.3992: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.3993: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein
Source.3994: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.3995: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.3996: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase
Source.3997: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase
Source.3998: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9
Source.3999: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.4000: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1
Source.4001: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.4002: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.4003: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial
Source.4004: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1
Source.4005: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1
Source.4006: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.4007: DFBPPR15079 ---- Microorganism protein ---- Autophagy-related protein 3
Source.4008: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.4009: DFBPPR15087 ---- Microorganism protein ---- Transcriptional activator HAP3
Source.4010: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1
Source.4011: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.4012: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1
Source.4013: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase
Source.4014: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.4015: DFBPPR15105 ---- Microorganism protein ---- Arginase
Source.4016: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.4017: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.4018: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.4019: DFBPPR15111 ---- Microorganism protein ---- mRNA cap guanine-N7 methyltransferase
Source.4020: DFBPPR15113 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 1
Source.4021: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.4022: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10
Source.4023: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1
Source.4024: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial
Source.4025: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1
Source.4026: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear
Source.4027: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase
Source.4028: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.4029: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase
Source.4030: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.4031: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3
Source.4032: DFBPPR15169 ---- Microorganism protein ---- Protein VTS1
Source.4033: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.4034: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.4035: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.4036: DFBPPR15180 ---- Microorganism protein ---- Protein ROT1
Source.4037: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.4038: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3
Source.4039: DFBPPR15189 ---- Microorganism protein ---- Inner kinetochore subunit NKP2
Source.4040: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal
Source.4041: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17
Source.4042: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.4043: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1
Source.4044: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial
Source.4045: DFBPPR15226 ---- Microorganism protein ---- GPI mannosyltransferase 4
Source.4046: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2
Source.4047: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.4048: DFBPPR15240 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-B
Source.4049: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3
Source.4050: DFBPPR15242 ---- Microorganism protein ---- Golgi to ER traffic protein 2
Source.4051: DFBPPR15256 ---- Microorganism protein ---- SEC14 cytosolic factor
Source.4052: DFBPPR15257 ---- Microorganism protein ---- Ribosome biogenesis protein YTM1
Source.4053: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.4054: DFBPPR15268 ---- Microorganism protein ---- Diphthamide biosynthesis protein 3
Source.4055: DFBPPR15275 ---- Microorganism protein ---- Exocyst complex protein EXO70
Source.4056: DFBPPR15279 ---- Microorganism protein ---- Nuclear fusion protein KAR5
Source.4057: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2
Source.4058: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9
Source.4059: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.4060: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.4061: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter
Source.4062: DFBPPR15298 ---- Microorganism protein ---- tRNA(His) guanylyltransferase
Source.4063: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1
Source.4064: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.4065: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.4066: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1
Source.4067: DFBPPR15316 ---- Microorganism protein ---- Protein URE2
Source.4068: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial
Source.4069: DFBPPR15322 ---- Microorganism protein ---- Sorting nexin-3
Source.4070: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10
Source.4071: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10
Source.4072: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18
Source.4073: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3
Source.4074: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase
Source.4075: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase
Source.4076: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.4077: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.4078: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.4079: DFBPPR15383 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 17
Source.4080: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.4081: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.4082: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.4083: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.4084: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2
Source.4085: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1
Source.4086: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.4087: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2
Source.4088: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.4089: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.4090: DFBPPR15430 ---- Microorganism protein ---- Exportin-T
Source.4091: DFBPPR15431 ---- Microorganism protein ---- RNA exonuclease 3
Source.4092: DFBPPR15447 ---- Microorganism protein ---- Genetic interactor of prohibitins 3, mitochondrial
Source.4093: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase
Source.4094: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.4095: DFBPPR15458 ---- Microorganism protein ---- Mitochondrial glycine transporter
Source.4096: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.4097: DFBPPR15462 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM21
Source.4098: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.4099: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10
Source.4100: DFBPPR15470 ---- Microorganism protein ---- Protein BUR2
Source.4101: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3
Source.4102: DFBPPR15476 ---- Microorganism protein ---- Mitochondrial inner membrane i-AAA protease complex subunit MGR1
Source.4103: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.4104: DFBPPR15490 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit NOP10
Source.4105: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1
Source.4106: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.4107: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.4108: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3
Source.4109: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.4110: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase
Source.4111: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.4112: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.4113: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1
Source.4114: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.4115: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1
Source.4116: DFBPPR15602 ---- Microorganism protein ---- Helper of Tim protein 13
Source.4117: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase
Source.4118: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1
Source.4119: DFBPPR15605 ---- Microorganism protein ---- Ribosome biogenesis protein NSA2
Source.4120: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.4121: DFBPPR15616 ---- Microorganism protein ---- Chromatin modification-related protein EAF5
Source.4122: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.4123: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.4124: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.4125: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4
Source.4126: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial
Source.4127: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.4128: DFBPPR15656 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC25
Source.4129: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11
Source.4130: DFBPPR15658 ---- Microorganism protein ---- Protein DSE1
Source.4131: DFBPPR15663 ---- Microorganism protein ---- Spindle pole component BBP1
Source.4132: DFBPPR15675 ---- Microorganism protein ---- DNA replication complex GINS protein PSF1
Source.4133: DFBPPR15680 ---- Microorganism protein ---- Protein SYM1
Source.4134: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21
Source.4135: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4
Source.4136: DFBPPR15693 ---- Microorganism protein ---- Restriction of telomere capping protein 4
Source.4137: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.4138: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.4139: DFBPPR15714 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 39, mitochondrial
Source.4140: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial
Source.4141: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.4142: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.4143: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3
Source.4144: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2
Source.4145: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.4146: DFBPPR15741 ---- Microorganism protein ---- Increased recombination centers protein 19
Source.4147: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1
Source.4148: DFBPPR15744 ---- Microorganism protein ---- Peroxisomal membrane protein PEX21
Source.4149: DFBPPR15746 ---- Microorganism protein ---- Topoisomerase I damage affected protein 11
Source.4150: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6
Source.4151: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.4152: DFBPPR15766 ---- Microorganism protein ---- Protein ATC1/LIC4
Source.4153: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5
Source.4154: DFBPPR15780 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 8
Source.4155: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3
Source.4156: DFBPPR15788 ---- Microorganism protein ---- Maintenance of telomere capping protein 2
Source.4157: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.4158: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.4159: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.4160: DFBPPR15816 ---- Microorganism protein ---- Tyrosine recombinase XerD
Source.4161: DFBPPR15818 ---- Microorganism protein ---- PTS system sorbose-specific EIID component
Source.4162: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.4163: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase
Source.4164: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.4165: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.4166: DFBPPR15840 ---- Microorganism protein ---- Protein RecA
Source.4167: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3
Source.4168: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2
Source.4169: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.4170: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.4171: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase
Source.4172: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase
Source.4173: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.4174: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.4175: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase
Source.4176: DFBPPR15886 ---- Microorganism protein ---- Capsid protein
Source.4177: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.4178: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase
Source.4179: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.4180: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.4181: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.4182: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.4183: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.4184: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.4185: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase
Source.4186: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4187: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.4188: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3
Source.4189: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.4190: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.4191: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.4192: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.4193: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.4194: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.4195: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2
Source.4196: DFBPPR7813 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1
Source.4197: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.4198: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.4199: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.4200: DFBPPR7834 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase homolog 2
Source.4201: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a
Source.4202: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.4203: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.4204: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.4205: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.4206: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.4207: DFBPPR7844 ---- Plant protein ---- Actin-1
Source.4208: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.4209: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.4210: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.4211: DFBPPR7856 ---- Plant protein ---- Maturase K
Source.4212: DFBPPR7858 ---- Plant protein ---- 30S ribosomal protein S18, chloroplastic
Source.4213: DFBPPR7860 ---- Plant protein ---- CASP-like protein 1C1
Source.4214: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1
Source.4215: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.4216: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic
Source.4217: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.4218: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.4219: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.4220: DFBPPR7973 ---- Plant protein ---- Maturase K
Source.4221: DFBPPR7976 ---- Plant protein ---- Metallothionein-like protein type 2
Source.4222: DFBPPR7986 ---- Plant protein ---- Uncharacterized mitochondrial protein ORF154
Source.4223: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.4224: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.4225: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B
Source.4226: DFBPPR8013 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.4227: DFBPPR8029 ---- Plant protein ---- Vignain
Source.4228: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.4229: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.4230: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.4231: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.4232: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.4233: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4234: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha
Source.4235: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.4236: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.4237: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.4238: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.4239: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.4240: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme
Source.4241: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.4242: DFBPPR8101 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha
Source.4243: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.4244: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.4245: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.4246: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.4247: DFBPPR8144 ---- Plant protein ---- Maturase K
Source.4248: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.4249: DFBPPR8160 ---- Plant protein ---- 230 kDa cell wall protein
Source.4250: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.4251: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4252: DFBPPR8228 ---- Plant protein ---- Albumin-8
Source.4253: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.4254: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.4255: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.4256: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.4257: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.4258: DFBPPR8266 ---- Plant protein ---- Putative ATP synthase protein YMF19
Source.4259: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.4260: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.4261: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.4262: DFBPPR8296 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic
Source.4263: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.4264: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.4265: DFBPPR8309 ---- Plant protein ---- 30S ribosomal protein S8, chloroplastic
Source.4266: DFBPPR8314 ---- Plant protein ---- Maturase K
Source.4267: DFBPPR8341 ---- Plant protein ---- Cysteine proteinase inhibitor A
Taste proterties & Structure
Bitterness
Bitter taste prediction
SMILES N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP 3388, 8090, 8838
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214