E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0502(Multifunctional peptide)
DFBP ID DFBPMUFU0502
Peptide sequence VWP
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 2
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI0942 Rice Rice protein hydrolysates

N.D

Antihypertensive peptides
DFBPID Organism Precursor protein Residue position
DFBPANHY0958 Rice Rice protein hydrolysates

N.D

Physical & computational properties
Three-letter amino acid Val-Trp-Pro
Single-letter amino acid VWP
Peptide length 3
Theoretical mass 400.48 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
GRAVY 0.5667
Hydrophilic residue ratio 100%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0820 ---- Plant proteins ---- bZIP transcription factor RISBZ5
Source.2: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.3: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1
Source.4: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.5: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9
Source.6: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.7: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.8: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3
Source.9: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.10: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.11: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.12: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.13: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.14: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.15: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.16: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15
Source.17: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.18: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial
Source.19: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.20: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1
Source.21: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.22: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.23: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.24: DFBPPR1916 ---- Plant proteins ---- Protein PYRICULARIA ORYZAE RESISTANCE 21
Source.25: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8
Source.26: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.27: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.28: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.29: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.30: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6
Source.31: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.32: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1
Source.33: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic
Source.34: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.35: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.36: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.37: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37
Source.38: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.39: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1
Source.40: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.41: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.42: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.43: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.44: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36
Source.45: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1
Source.46: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31
Source.47: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.48: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2
Source.49: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.50: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.51: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.52: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.53: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.54: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.55: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein
Source.56: DFBPPR4679 ---- Plant proteins ---- Thaumatin-like protein
Source.57: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.58: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.59: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.60: DFBPPR5112 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 1, chloroplastic
Source.61: DFBPPR5113 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 4, chloroplastic
Source.62: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.63: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.64: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.65: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.66: DFBPPR5625 ---- Plant proteins ---- Dof zinc finger protein MNB1A
Source.67: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.68: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.69: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.70: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.71: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.72: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.73: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.74: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.75: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic
Source.76: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic
Source.77: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.78: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.79: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.80: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic
Source.81: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.82: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic
Source.83: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic
Source.84: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.85: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.86: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.87: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.88: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.89: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.90: DFBPPR7323 ---- Plant proteins ---- Antifungal protein R
Source.91: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.92: DFBPPR7453 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain F1, chloroplastic
Source.93: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.94: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.95: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4
Source.96: DFBPPR7746 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 2
Source.97: DFBPPR7747 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 1
Source.98: DFBPPR7748 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 3
Source.99: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.100: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.101: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.102: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.103: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.104: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.105: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.106: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.107: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.108: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2
Source.109: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.110: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor
Source.111: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.112: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31
Source.113: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.114: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.115: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.116: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.117: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.118: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.119: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.120: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2
Source.121: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.122: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.123: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.124: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.125: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.126: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1
Source.127: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.128: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.129: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.130: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.131: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.132: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.133: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.134: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.135: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.136: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.137: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8
Source.138: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.139: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.140: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.141: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial
Source.142: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.143: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.144: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.145: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.146: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20
Source.147: DFBPPR19604 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21C
Source.148: DFBPPR19873 ---- Animal proteins ---- Syntaxin-8
Source.149: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7
Source.150: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2
Source.151: DFBPPR20017 ---- Animal proteins ---- Lysoplasmalogenase
Source.152: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26
Source.153: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.154: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.155: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.156: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.157: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.158: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein
Source.159: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.160: DFBPPR20560 ---- Animal proteins ---- Draxin
Source.161: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.162: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6
Source.163: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.164: DFBPPR21203 ---- Animal proteins ---- Nuclear protein 2
Source.165: DFBPPR21291 ---- Animal proteins ---- 39S ribosomal protein L18, mitochondrial
Source.166: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115
Source.167: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.168: DFBPPR21644 ---- Animal proteins ---- Mpv17-like protein 2
Source.169: DFBPPR21773 ---- Animal proteins ---- Isoamyl acetate-hydrolyzing esterase 1 homolog
Source.170: DFBPPR21818 ---- Animal proteins ---- Zinc finger protein 410
Source.171: DFBPPR22010 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21E
Source.172: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.173: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.174: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.175: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.176: DFBPPR22245 ---- Animal proteins ---- Thyroid transcription factor 1-associated protein 26
Source.177: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.178: DFBPPR22375 ---- Animal proteins ---- Mth938 domain-containing protein
Source.179: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.180: DFBPPR22726 ---- Animal proteins ---- Uncharacterized protein C16orf90 homolog
Source.181: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein
Source.182: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.183: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.184: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.185: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.186: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog
Source.187: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.188: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase
Source.189: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.190: DFBPPR9221 ---- Animal proteins ---- Catalase
Source.191: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.192: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.193: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.194: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.195: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24
Source.196: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25
Source.197: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1
Source.198: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase
Source.199: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein
Source.200: DFBPPR9767 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6
Source.201: DFBPPR9980 ---- Animal proteins ---- Cathelicidin-1
Source.202: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.203: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.204: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.205: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.206: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1
Source.207: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.208: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1
Source.209: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.210: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.211: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.212: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.213: DFBPPR10892 ---- Animal proteins ---- Myogenic factor 5
Source.214: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.215: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.216: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.217: DFBPPR11090 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.218: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.219: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.220: DFBPPR11146 ---- Animal proteins ---- Formin
Source.221: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.222: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.223: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.224: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.225: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein
Source.226: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.227: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.228: DFBPPR11958 ---- Animal proteins ---- Homeobox protein engrailed-1
Source.229: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.230: DFBPPR12019 ---- Animal proteins ---- Cobalamin trafficking protein CblD
Source.231: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.232: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.233: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.234: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.235: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.236: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.237: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.238: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.239: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.240: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5
Source.241: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.242: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1
Source.243: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.244: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.245: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.246: DFBPPR12896 ---- Animal proteins ---- T-lymphocyte activation antigen CD80
Source.247: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.248: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.249: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.250: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.251: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha
Source.252: DFBPPR13369 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.253: DFBPPR13546 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.254: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21
Source.255: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.256: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.257: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36
Source.258: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.259: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein
Source.260: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.261: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.262: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.263: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.264: DFBPPR15122 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.265: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3
Source.266: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.267: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1
Source.268: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2
Source.269: DFBPPR15680 ---- Microorganism protein ---- Protein SYM1
Source.270: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.271: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.272: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein
Source.273: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.274: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.275: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3
Source.276: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.277: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2
Source.278: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.279: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.280: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.281: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.282: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.283: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.284: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Taste proterties & Structure
Bitterness
Bitter taste prediction
SMILES N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=CN2)C1=C2C=CC=C1)C(=O)N1[C@@]([H])(CCC1)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP 8420
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214