E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0542(Multifunctional peptide)
DFBP ID DFBPMUFU0542
Peptide sequence VPW
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 2
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI1827 Chlorella vulgaris (C. vulgaris) Uncharacterized membrane protein ycf78 (P56370)

N.D

Antioxidative peptides
DFBPID Organism Precursor protein Residue position
DFBPANOX0346 Buckwheat Buckwheat protein

N.D

Physical & computational properties
Three-letter amino acid Val-Pro-Trp
Single-letter amino acid VPW
Peptide length 3
Theoretical mass 400.48 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
GRAVY 0.5667
Hydrophilic residue ratio 100%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.2: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18
Source.3: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase
Source.4: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.5: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.6: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3
Source.7: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1
Source.8: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.9: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.10: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.11: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic
Source.12: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.13: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.14: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.15: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.16: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.17: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.18: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.19: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG
Source.20: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.21: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.22: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.23: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.24: DFBPPR1891 ---- Plant proteins ---- Transcription factor MYBS2
Source.25: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.26: DFBPPR2115 ---- Plant proteins ---- E3 ubiquitin-protein ligase SIRP1
Source.27: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.28: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.29: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.30: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.31: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.32: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.33: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.34: DFBPPR2446 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-9
Source.35: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.36: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6
Source.37: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.38: DFBPPR2908 ---- Plant proteins ---- Auxin-responsive protein IAA8
Source.39: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3
Source.40: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.41: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.42: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A
Source.43: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.44: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.45: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.46: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.47: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6
Source.48: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.49: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11
Source.50: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27
Source.51: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.52: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.53: DFBPPR3283 ---- Plant proteins ---- Auxin-responsive protein IAA21
Source.54: DFBPPR3308 ---- Plant proteins ---- Auxin-responsive protein IAA26
Source.55: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.56: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.57: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.58: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38
Source.59: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14
Source.60: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2
Source.61: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.62: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.63: DFBPPR3392 ---- Plant proteins ---- Auxin-responsive protein IAA9
Source.64: DFBPPR3393 ---- Plant proteins ---- Auxin-responsive protein IAA20
Source.65: DFBPPR3394 ---- Plant proteins ---- Auxin-responsive protein IAA7
Source.66: DFBPPR3404 ---- Plant proteins ---- Auxin-responsive protein IAA3
Source.67: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1
Source.68: DFBPPR3411 ---- Plant proteins ---- Auxin-responsive protein IAA15
Source.69: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.70: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.71: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.72: DFBPPR3552 ---- Plant proteins ---- Auxin-responsive protein IAA4
Source.73: DFBPPR3581 ---- Plant proteins ---- Auxin-responsive protein IAA17
Source.74: DFBPPR3594 ---- Plant proteins ---- Auxin-responsive protein IAA10
Source.75: DFBPPR3595 ---- Plant proteins ---- Auxin-responsive protein IAA24
Source.76: DFBPPR3677 ---- Plant proteins ---- Auxin-responsive protein IAA25
Source.77: DFBPPR3692 ---- Plant proteins ---- Protein disulfide isomerase-like 5-1
Source.78: DFBPPR3695 ---- Plant proteins ---- Auxin-responsive protein IAA23
Source.79: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8
Source.80: DFBPPR3743 ---- Plant proteins ---- Putative auxin-responsive protein IAA28
Source.81: DFBPPR3754 ---- Plant proteins ---- Auxin-responsive protein IAA30
Source.82: DFBPPR3782 ---- Plant proteins ---- Auxin-responsive protein IAA16
Source.83: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.84: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22
Source.85: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.86: DFBPPR3849 ---- Plant proteins ---- Auxin-responsive protein IAA13
Source.87: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.88: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.89: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.90: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2
Source.91: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.92: DFBPPR4091 ---- Plant proteins ---- Putative auxin-responsive protein IAA29
Source.93: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1
Source.94: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.95: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1
Source.96: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic
Source.97: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.98: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1
Source.99: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic
Source.100: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.101: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2
Source.102: DFBPPR4930 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.103: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.104: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1
Source.105: DFBPPR5265 ---- Plant proteins ---- Auxin-induced protein AUX22
Source.106: DFBPPR5271 ---- Plant proteins ---- Auxin-induced protein AUX28
Source.107: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1
Source.108: DFBPPR5315 ---- Plant proteins ---- CASP-like protein 1D2
Source.109: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.110: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.111: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.112: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.113: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.114: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.115: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.116: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.117: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.118: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.119: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.120: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.121: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.122: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.123: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.124: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.125: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.126: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.127: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.128: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.129: DFBPPR6321 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.130: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.131: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.132: DFBPPR6389 ---- Plant proteins ---- Auxin-induced protein IAA4
Source.133: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A
Source.134: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B
Source.135: DFBPPR6509 ---- Plant proteins ---- Auxin-induced protein IAA6
Source.136: DFBPPR6571 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.137: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.138: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.139: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.140: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.141: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic
Source.142: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.143: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.144: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.145: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.146: DFBPPR7402 ---- Plant proteins ---- Probable pectinesterase/pectinesterase inhibitor
Source.147: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.148: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein
Source.149: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.150: DFBPPR8390 ---- Plant proteins ---- Galactose-binding lectin
Source.151: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.152: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.153: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.154: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.155: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.156: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.157: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.158: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.159: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO
Source.160: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.161: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.162: DFBPPR16180 ---- Animal proteins ---- Orexin
Source.163: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.164: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.165: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.166: DFBPPR16263 ---- Animal proteins ---- Protein 4.1
Source.167: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.168: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.169: DFBPPR16675 ---- Animal proteins ---- V-type proton ATPase subunit e 1
Source.170: DFBPPR16690 ---- Animal proteins ---- Trefoil factor 3
Source.171: DFBPPR16707 ---- Animal proteins ---- Trefoil factor 2
Source.172: DFBPPR16737 ---- Animal proteins ---- Trefoil factor 1
Source.173: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.174: DFBPPR16822 ---- Animal proteins ---- Kininogen-2
Source.175: DFBPPR16830 ---- Animal proteins ---- Kininogen-1
Source.176: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.177: DFBPPR16876 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.178: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.179: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.180: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.181: DFBPPR17068 ---- Animal proteins ---- Mitogen-activated protein kinase 1
Source.182: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.183: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2
Source.184: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.185: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.186: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase
Source.187: DFBPPR17423 ---- Animal proteins ---- Furin
Source.188: DFBPPR17437 ---- Animal proteins ---- DNA excision repair protein ERCC-1
Source.189: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.190: DFBPPR17490 ---- Animal proteins ---- TIR domain-containing adapter molecule 2
Source.191: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.192: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B
Source.193: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.194: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.195: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.196: DFBPPR17916 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF126
Source.197: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.198: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.199: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.200: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase
Source.201: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.202: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog
Source.203: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.204: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.205: DFBPPR18233 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3
Source.206: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7
Source.207: DFBPPR18427 ---- Animal proteins ---- Cystatin-C
Source.208: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.209: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.210: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5
Source.211: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.212: DFBPPR19158 ---- Animal proteins ---- Tuberoinfundibular peptide of 39 residues
Source.213: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.214: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.215: DFBPPR19284 ---- Animal proteins ---- Protein lifeguard 2
Source.216: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial
Source.217: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase
Source.218: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.219: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.220: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.221: DFBPPR19798 ---- Animal proteins ---- Uricase
Source.222: DFBPPR19801 ---- Animal proteins ---- Outer dense fiber protein 2
Source.223: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.224: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase
Source.225: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.226: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1
Source.227: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.228: DFBPPR20408 ---- Animal proteins ---- Phospholipid scramblase 2
Source.229: DFBPPR20510 ---- Animal proteins ---- Josephin-1
Source.230: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.231: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.232: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.233: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.234: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.235: DFBPPR21187 ---- Animal proteins ---- Plasmolipin
Source.236: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.237: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase
Source.238: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B
Source.239: DFBPPR21323 ---- Animal proteins ---- Trefoil factor 3
Source.240: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.241: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein
Source.242: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.243: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1
Source.244: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8
Source.245: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.246: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10
Source.247: DFBPPR21830 ---- Animal proteins ---- Guanine nucleotide exchange factor for Rab-3A
Source.248: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2
Source.249: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase
Source.250: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like
Source.251: DFBPPR22320 ---- Animal proteins ---- Transmembrane protein 229B
Source.252: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180
Source.253: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.254: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1
Source.255: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A
Source.256: DFBPPR22668 ---- Animal proteins ---- Protein FAM243
Source.257: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog
Source.258: DFBPPR22739 ---- Animal proteins ---- Testis, prostate and placenta-expressed protein
Source.259: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.260: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.261: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.262: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.263: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.264: DFBPPR9074 ---- Animal proteins ---- Trefoil factor 2
Source.265: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.266: DFBPPR9166 ---- Animal proteins ---- Uricase
Source.267: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10
Source.268: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase
Source.269: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase
Source.270: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase
Source.271: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase
Source.272: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase
Source.273: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase
Source.274: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.275: DFBPPR9670 ---- Animal proteins ---- NF-kappa-B inhibitor-like protein 1
Source.276: DFBPPR9702 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.277: DFBPPR9758 ---- Animal proteins ---- Galanin-like peptide
Source.278: DFBPPR9880 ---- Animal proteins ---- Trefoil factor 3
Source.279: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B
Source.280: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.281: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.282: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.283: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.284: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor
Source.285: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase
Source.286: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain
Source.287: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.288: DFBPPR11450 ---- Animal proteins ---- Potassium voltage-gated channel subfamily G member 2
Source.289: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.290: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.291: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.292: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.293: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.294: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.295: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox
Source.296: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.297: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.298: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.299: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.300: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1
Source.301: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.302: DFBPPR12615 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.303: DFBPPR12725 ---- Animal proteins ---- Uricase
Source.304: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.305: DFBPPR12869 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.306: DFBPPR13000 ---- Animal proteins ---- Cystatin-C
Source.307: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5
Source.308: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.309: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.310: DFBPPR13295 ---- Animal proteins ---- Alpha-1-antiproteinase 2
Source.311: DFBPPR13327 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.312: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.313: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.314: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.315: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.316: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.317: DFBPPR13674 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.318: DFBPPR13713 ---- Animal proteins ---- Plasminogen
Source.319: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase
Source.320: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.321: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.322: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase
Source.323: DFBPPR14337 ---- Marine protein ---- Photosystem I iron-sulfur center
Source.324: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.325: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial
Source.326: DFBPPR15041 ---- Microorganism protein ---- Autophagy protein 5
Source.327: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase
Source.328: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2
Source.329: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial
Source.330: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1
Source.331: DFBPPR15316 ---- Microorganism protein ---- Protein URE2
Source.332: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.333: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3
Source.334: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase
Source.335: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.336: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.337: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.338: DFBPPR8032 ---- Plant protein ---- Alpha-amylase inhibitor 1
Source.339: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.340: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.341: DFBPPR8092 ---- Plant protein ---- Alpha-amylase inhibitor 2
Taste proterties & Structure
Bitterness
Bitter taste prediction
SMILES N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=CN2)C1=C2C=CC=C1)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP 8188
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214