E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0726(Multifunctional peptide)
DFBP ID DFBPMUFU0726
Peptide sequence YPY
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 3
DPP IV-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPDPIV0042 Bovine milk protein κ-Casein

f(58-60)

α-Glucosidase inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPALGL0023 Sardine Muscle protein hydrolyzates N.D
Opioid peptides
DFBPID Organism Precursor protein Residue position
DFBPOPIO0134 Human milk protein κ-Casein f(31-33)
DFBPOPIO0135 Bovine milk protein κ-Casein f(61-63)
Physical & computational properties
Three-letter amino acid Tyr-Pro-Tyr
Single-letter amino acid YPY
Peptide length 3
Theoretical mass 441.48 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.87 c
GRAVY -1.4000
Hydrophilic residue ratio 33.33%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic
Source.2: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.3: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.4: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.5: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.6: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.7: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1
Source.8: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.9: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.10: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.11: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.12: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.13: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.14: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.15: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.16: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4
Source.17: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39
Source.18: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.19: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.20: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.21: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.22: DFBPPR1916 ---- Plant proteins ---- Protein PYRICULARIA ORYZAE RESISTANCE 21
Source.23: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2
Source.24: DFBPPR1996 ---- Plant proteins ---- Transcription initiation factor IIB
Source.25: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3
Source.26: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.27: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.28: DFBPPR2159 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.29: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.30: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.31: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.32: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.33: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3
Source.34: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.35: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.36: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.37: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.38: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain
Source.39: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2
Source.40: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.41: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.42: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.43: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9
Source.44: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.45: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.46: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.47: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.48: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit
Source.49: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.50: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.51: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.52: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain
Source.53: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.54: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.55: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.56: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.57: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.58: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.59: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.60: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.61: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1
Source.62: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic
Source.63: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3
Source.64: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.65: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.66: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.67: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP
Source.68: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5
Source.69: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.70: DFBPPR4607 ---- Plant proteins ---- Protein LOL2
Source.71: DFBPPR4610 ---- Plant proteins ---- Protein LOL3
Source.72: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.73: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.74: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9
Source.75: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.76: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.77: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500
Source.78: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.79: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.80: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.81: DFBPPR4997 ---- Plant proteins ---- P34 probable thiol protease
Source.82: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.83: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.84: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.85: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.86: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.87: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.88: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.89: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.90: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.91: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.92: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.93: DFBPPR5122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.94: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.95: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.96: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.97: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.98: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.99: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.100: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase
Source.101: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.102: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3
Source.103: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9
Source.104: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.105: DFBPPR5661 ---- Plant proteins ---- Albumin b-32
Source.106: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.107: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein
Source.108: DFBPPR5741 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.109: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform
Source.110: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1
Source.111: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.112: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.113: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2
Source.114: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.115: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.116: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.117: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.118: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.119: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.120: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.121: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.122: DFBPPR6538 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.123: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.124: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.125: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.126: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.127: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa
Source.128: DFBPPR6733 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.129: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.130: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.131: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A
Source.132: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.133: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.134: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2
Source.135: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.136: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.137: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII
Source.138: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.139: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.140: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.141: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.142: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.143: DFBPPR7133 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.144: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV
Source.145: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.146: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.147: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain
Source.148: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.149: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.150: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.151: DFBPPR7490 ---- Plant proteins ---- Cysteine proteinase COT44
Source.152: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.153: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A
Source.154: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C
Source.155: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.156: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein
Source.157: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.158: DFBPPR7608 ---- Milk proteins ---- Kappa-casein
Source.159: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4
Source.160: DFBPPR7637 ---- Milk proteins ---- Perilipin-2
Source.161: DFBPPR7668 ---- Milk proteins ---- Beta-casein
Source.162: DFBPPR7686 ---- Milk proteins ---- Kappa-casein
Source.163: DFBPPR7689 ---- Milk proteins ---- Alpha-S2-casein
Source.164: DFBPPR7695 ---- Milk proteins ---- Kappa-casein
Source.165: DFBPPR7715 ---- Milk proteins ---- Kappa-casein
Source.166: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.167: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.168: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.169: DFBPPR8492 ---- Milk proteins ---- Kappa-casein
Source.170: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4
Source.171: DFBPPR8523 ---- Milk proteins ---- Perilipin-2
Source.172: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.173: DFBPPR16082 ---- Animal proteins ---- Ras-related protein Rab-9A
Source.174: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.175: DFBPPR16086 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.176: DFBPPR16093 ---- Animal proteins ---- Menin
Source.177: DFBPPR16142 ---- Animal proteins ---- Procathepsin L
Source.178: DFBPPR16181 ---- Animal proteins ---- Inositol polyphosphate-5-phosphatase A
Source.179: DFBPPR16190 ---- Animal proteins ---- Aprataxin
Source.180: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.181: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.182: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.183: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.184: DFBPPR16304 ---- Animal proteins ---- Cathepsin K
Source.185: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.186: DFBPPR16462 ---- Animal proteins ---- Pantetheinase
Source.187: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.188: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.189: DFBPPR16485 ---- Animal proteins ---- Cathepsin S
Source.190: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.191: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.192: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.193: DFBPPR16745 ---- Animal proteins ---- Ig kappa chain V region GOM
Source.194: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.195: DFBPPR16894 ---- Animal proteins ---- Procathepsin L
Source.196: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.197: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H
Source.198: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.199: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.200: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.201: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E
Source.202: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5
Source.203: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.204: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.205: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C
Source.206: DFBPPR17849 ---- Animal proteins ---- Fibromodulin
Source.207: DFBPPR17879 ---- Animal proteins ---- Menin
Source.208: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.209: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.210: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.211: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial
Source.212: DFBPPR18088 ---- Animal proteins ---- Aprataxin
Source.213: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit
Source.214: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.215: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.216: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.217: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.218: DFBPPR18464 ---- Animal proteins ---- Regucalcin
Source.219: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.220: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.221: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1
Source.222: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.223: DFBPPR18566 ---- Animal proteins ---- Cytochrome c oxidase subunit 5A, mitochondrial
Source.224: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.225: DFBPPR18720 ---- Animal proteins ---- Protein quaking
Source.226: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.227: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.228: DFBPPR18815 ---- Animal proteins ---- Pantetheinase
Source.229: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B
Source.230: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.231: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb
Source.232: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3
Source.233: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.234: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.235: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.236: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.237: DFBPPR19264 ---- Animal proteins ---- Claudin-16
Source.238: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.239: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.240: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.241: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain
Source.242: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.243: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.244: DFBPPR19738 ---- Animal proteins ---- Translocator protein
Source.245: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1
Source.246: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.247: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.248: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial
Source.249: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform
Source.250: DFBPPR20011 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM17
Source.251: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2
Source.252: DFBPPR20212 ---- Animal proteins ---- Outer dense fiber protein 1
Source.253: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.254: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.255: DFBPPR20369 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 1
Source.256: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.257: DFBPPR20744 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.258: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.259: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2
Source.260: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.261: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.262: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.263: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.264: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.265: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.266: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.267: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B
Source.268: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4
Source.269: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform
Source.270: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.271: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3
Source.272: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like
Source.273: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.274: DFBPPR21878 ---- Animal proteins ---- Statherin
Source.275: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog
Source.276: DFBPPR21976 ---- Animal proteins ---- COMM domain-containing protein 6
Source.277: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.278: DFBPPR22072 ---- Animal proteins ---- Brain protein I3
Source.279: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor
Source.280: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2
Source.281: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.282: DFBPPR22428 ---- Animal proteins ---- Cysteine-rich and transmembrane domain-containing protein 1
Source.283: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.284: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.285: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6
Source.286: DFBPPR8538 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.287: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.288: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.289: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1
Source.290: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H
Source.291: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.292: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.293: DFBPPR8838 ---- Animal proteins ---- Cathepsin K
Source.294: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.295: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3
Source.296: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.297: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.298: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.299: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.300: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B
Source.301: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.302: DFBPPR9314 ---- Animal proteins ---- Regucalcin
Source.303: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.304: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4
Source.305: DFBPPR9427 ---- Animal proteins ---- Protein quaking
Source.306: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.307: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.308: DFBPPR9664 ---- Animal proteins ---- Perilipin-2
Source.309: DFBPPR9688 ---- Animal proteins ---- Outer dense fiber protein 1
Source.310: DFBPPR9784 ---- Animal proteins ---- Translocator protein
Source.311: DFBPPR9838 ---- Animal proteins ---- Transcription factor PU.1
Source.312: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.313: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.314: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.315: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.316: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.317: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.318: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.319: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase
Source.320: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24
Source.321: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.322: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A
Source.323: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.324: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.325: DFBPPR10634 ---- Animal proteins ---- Procathepsin L
Source.326: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.327: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.328: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.329: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.330: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.331: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.332: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4
Source.333: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.334: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A
Source.335: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.336: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.337: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C
Source.338: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.339: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.340: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.341: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1
Source.342: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.343: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1
Source.344: DFBPPR11112 ---- Animal proteins ---- Protein quaking
Source.345: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4
Source.346: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.347: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3
Source.348: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.349: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.350: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.351: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.352: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.353: DFBPPR11660 ---- Animal proteins ---- Cathepsin K
Source.354: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.355: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38
Source.356: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B
Source.357: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog
Source.358: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1
Source.359: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.360: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.361: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.362: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.363: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2
Source.364: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.365: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.366: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.367: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.368: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.369: DFBPPR12507 ---- Animal proteins ---- Cathepsin K
Source.370: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.371: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20
Source.372: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.373: DFBPPR12968 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.374: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog
Source.375: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.376: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1
Source.377: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.378: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.379: DFBPPR13276 ---- Animal proteins ---- Protein quaking
Source.380: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.381: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.382: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.383: DFBPPR13549 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.384: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.385: DFBPPR13646 ---- Animal proteins ---- Procathepsin L
Source.386: DFBPPR13826 ---- Animal proteins ---- Translocator protein
Source.387: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A
Source.388: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.389: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.390: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.391: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.392: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.393: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.394: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46
Source.395: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor
Source.396: DFBPPR14587 ---- Marine protein ---- Thyrotropin subunit beta
Source.397: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1
Source.398: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3
Source.399: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2
Source.400: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233
Source.401: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.402: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific
Source.403: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase
Source.404: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.405: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2
Source.406: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.407: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.408: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.409: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4
Source.410: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase
Source.411: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.412: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.413: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.414: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80
Source.415: DFBPPR15519 ---- Microorganism protein ---- Mitochondrial genome maintenance protein MGM101
Source.416: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3
Source.417: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial
Source.418: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.419: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.420: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.421: DFBPPR7795 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.422: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.423: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.424: DFBPPR8029 ---- Plant protein ---- Vignain
Source.425: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.426: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.427: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.428: DFBPPR8066 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.429: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform
Source.430: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.431: DFBPPR8236 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.432: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.433: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Taste proterties & Structure
Bitterness
Bitter taste prediction
SMILES N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP 8617, 9550
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214