Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI0056(ACE-inhibitory peptide)

DFBP ID	DFBPACEI0056
Peptide sequence	PFP
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Pro-Phe-Pro

Single-letter amino acid

PFP

Peptide length

Peptide mass

Experimental mass	Theoretical mass
360.1 Da	359.42 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

144.4 uM

pIC₅₀

-2.16

GRAVY

-0.1333^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Spanish cheeses (Manchego), Ovine milk
Precursor protein	α_s1-Casein
Residue position	f(27-29)
Precursor protein(s) search	Source.1: DFBPPR0379 ---- Plant protein ---- Alpha-gliadin Source.2: DFBPPR0380 ---- Plant protein ---- Alpha-gliadin Source.3: DFBPPR0381 ---- Plant protein ---- Alpha-gliadin Source.4: DFBPPR0382 ---- Plant protein ---- Alpha-gliadin Source.5: DFBPPR0383 ---- Plant protein ---- Alpha-gliadin Source.6: DFBPPR0384 ---- Plant protein ---- Alpha-gliadin Source.7: DFBPPR0385 ---- Plant protein ---- Alpha-gliadin Source.8: DFBPPR0389 ---- Plant protein ---- Alpha-gliadin Source.9: DFBPPR0390 ---- Plant protein ---- B3144=ALPHA-gliadin derived CELIAC active peptide Source.10: DFBPPR0391 ---- Plant protein ---- B3143=ALPHA-gliadin derived CELIAC active peptide Source.11: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2 Source.12: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1 Source.13: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.14: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4 Source.15: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.16: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2 Source.17: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1 Source.18: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1 Source.19: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10 Source.20: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1 Source.21: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.22: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1 Source.23: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79 Source.24: DFBPPR1102 ---- Plant proteins ---- APETALA2-like protein 3 Source.25: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E Source.26: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3 Source.27: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2 Source.28: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic Source.29: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.30: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C Source.31: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.32: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D Source.33: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B Source.34: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A Source.35: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain Source.36: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain Source.37: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.38: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.39: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4 Source.40: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.41: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.42: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase Source.43: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain Source.44: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b Source.45: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.46: DFBPPR1468 ---- Plant proteins ---- Serotonin N-acetyltransferase 2, chloroplastic Source.47: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic Source.48: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1 Source.49: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein Source.50: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.51: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A Source.52: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3 Source.53: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53 Source.54: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3 Source.55: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148 Source.56: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19 Source.57: DFBPPR1557 ---- Plant proteins ---- WRKY transcription factor WRKY51 Source.58: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain Source.59: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic Source.60: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic Source.61: DFBPPR1604 ---- Plant proteins ---- Putative bifunctional dihydrofolate reductase-thymidylate synthase Source.62: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.63: DFBPPR1618 ---- Plant proteins ---- Heat stress transcription factor C-1a Source.64: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.65: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain Source.66: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain Source.67: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic Source.68: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG Source.69: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase Source.70: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4 Source.71: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2 Source.72: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain Source.73: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.74: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1 Source.75: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial Source.76: DFBPPR1806 ---- Plant proteins ---- Laccase-19 Source.77: DFBPPR1810 ---- Plant proteins ---- Shaggy-related protein kinase GSK4 Source.78: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog Source.79: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.80: DFBPPR1839 ---- Plant proteins ---- Laccase-24 Source.81: DFBPPR1843 ---- Plant proteins ---- Laccase-13 Source.82: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.83: DFBPPR1853 ---- Plant proteins ---- Laccase-4 Source.84: DFBPPR1861 ---- Plant proteins ---- Laccase-25 Source.85: DFBPPR1865 ---- Plant proteins ---- Laccase-22 Source.86: DFBPPR1870 ---- Plant proteins ---- Laccase-20 Source.87: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8 Source.88: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11 Source.89: DFBPPR1882 ---- Plant proteins ---- Laccase-12 Source.90: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.91: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3 Source.92: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.93: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.94: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic Source.95: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.96: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1 Source.97: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.98: DFBPPR2013 ---- Plant proteins ---- Laccase-6 Source.99: DFBPPR2028 ---- Plant proteins ---- Laccase-7 Source.100: DFBPPR2033 ---- Plant proteins ---- Laccase-2 Source.101: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5 Source.102: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.103: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA Source.104: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6 Source.105: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1 Source.106: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain Source.107: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2 Source.108: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic Source.109: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic Source.110: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.111: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase Source.112: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9 Source.113: DFBPPR2247 ---- Plant proteins ---- Phytochrome C Source.114: DFBPPR2302 ---- Plant proteins ---- Bowman-Birk type bran trypsin inhibitor Source.115: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic Source.116: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic Source.117: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic Source.118: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.119: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30 Source.120: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100 Source.121: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7 Source.122: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33 Source.123: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5 Source.124: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6 Source.125: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d Source.126: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A Source.127: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial Source.128: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c Source.129: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial Source.130: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.131: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial Source.132: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a Source.133: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.134: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.135: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10 Source.136: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.137: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1 Source.138: DFBPPR2634 ---- Plant proteins ---- 16.0 kDa heat shock protein, peroxisomal Source.139: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.140: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25 Source.141: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.142: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B Source.143: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.144: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2 Source.145: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2 Source.146: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2 Source.147: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.148: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3 Source.149: DFBPPR2985 ---- Plant proteins ---- Coatomer subunit delta-3 Source.150: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17 Source.151: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7 Source.152: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic Source.153: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2 Source.154: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.155: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18 Source.156: DFBPPR3288 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 2 Source.157: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4 Source.158: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18 Source.159: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3 Source.160: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial Source.161: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic Source.162: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.163: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2 Source.164: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1 Source.165: DFBPPR3434 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic Source.166: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F Source.167: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76 Source.168: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4 Source.169: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic Source.170: DFBPPR3531 ---- Plant proteins ---- Zinc transporter 10 Source.171: DFBPPR3557 ---- Plant proteins ---- NRR repressor homolog 3 Source.172: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.173: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.174: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2 Source.175: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase Source.176: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic Source.177: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9 Source.178: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6 Source.179: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.180: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900 Source.181: DFBPPR3827 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic Source.182: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2 Source.183: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29 Source.184: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.185: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20 Source.186: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.187: DFBPPR3927 ---- Plant proteins ---- Basic leucine zipper 2 Source.188: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16 Source.189: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4 Source.190: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2 Source.191: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95 Source.192: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600 Source.193: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16 Source.194: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2 Source.195: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10 Source.196: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4 Source.197: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1 Source.198: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4 Source.199: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic Source.200: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE Source.201: DFBPPR4253 ---- Plant proteins ---- Zinc-finger homeodomain protein 5 Source.202: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B Source.203: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A Source.204: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4 Source.205: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10 Source.206: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5 Source.207: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.208: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.209: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.210: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1 Source.211: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2 Source.212: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic Source.213: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3 Source.214: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4 Source.215: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2 Source.216: DFBPPR4609 ---- Plant proteins ---- BURP domain-containing protein 16 Source.217: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43 Source.218: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1 Source.219: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7 Source.220: DFBPPR4696 ---- Plant proteins ---- Uncharacterized protein ycf72 Source.221: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700 Source.222: DFBPPR4776 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 3 Source.223: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47 Source.224: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.225: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3 Source.226: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2 Source.227: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase Source.228: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2 Source.229: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2 Source.230: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650 Source.231: DFBPPR4967 ---- Plant proteins ---- Beta-amylase Source.232: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1 Source.233: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.234: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1 Source.235: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform Source.236: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform Source.237: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2 Source.238: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2 Source.239: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.240: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase Source.241: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2 Source.242: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain Source.243: DFBPPR5074 ---- Plant proteins ---- Phytochrome B Source.244: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.245: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain Source.246: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain Source.247: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1 Source.248: DFBPPR5120 ---- Plant proteins ---- 17.3 kDa class I heat shock protein Source.249: DFBPPR5132 ---- Plant proteins ---- 18.5 kDa class I heat shock protein Source.250: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1 Source.251: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.252: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum Source.253: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3 Source.254: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.255: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2 Source.256: DFBPPR5342 ---- Plant proteins ---- Nodulin-44 Source.257: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.258: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.259: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial Source.260: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.261: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase Source.262: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9 Source.263: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8 Source.264: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.265: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1 Source.266: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase Source.267: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.268: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B Source.269: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A Source.270: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.271: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic Source.272: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1 Source.273: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.274: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1 Source.275: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain Source.276: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.277: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain Source.278: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain Source.279: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain Source.280: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain Source.281: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain Source.282: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain Source.283: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.284: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2 Source.285: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.286: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain Source.287: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.288: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase Source.289: DFBPPR5986 ---- Plant proteins ---- Beta-amylase Source.290: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.291: DFBPPR6140 ---- Plant proteins ---- Uncharacterized protein ycf72 Source.292: DFBPPR6164 ---- Plant proteins ---- Oil body-associated protein 2B Source.293: DFBPPR6174 ---- Plant proteins ---- Oil body-associated protein 2A Source.294: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.295: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase Source.296: DFBPPR6262 ---- Plant proteins ---- Nodule lectin Source.297: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic Source.298: DFBPPR6339 ---- Plant proteins ---- Phytochrome A Source.299: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase Source.300: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain Source.301: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain Source.302: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain Source.303: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.304: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.305: DFBPPR6441 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic Source.306: DFBPPR6444 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.307: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.308: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.309: DFBPPR6614 ---- Plant proteins ---- Early nodulin-75 Source.310: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase Source.311: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.312: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase Source.313: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic Source.314: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.315: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3 Source.316: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain Source.317: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain Source.318: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain Source.319: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain Source.320: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain Source.321: DFBPPR6752 ---- Plant proteins ---- Probable non-specific lipid-transfer protein 3 Source.322: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17 Source.323: DFBPPR6835 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 1, chloroplastic Source.324: DFBPPR6853 ---- Plant proteins ---- Alpha/beta-gliadin MM1 Source.325: DFBPPR6856 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 3, chloroplastic Source.326: DFBPPR6858 ---- Plant proteins ---- Glutenin, low molecular weight subunit 1D1 Source.327: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1 Source.328: DFBPPR6890 ---- Plant proteins ---- Glutenin, low molecular weight subunit PTDUCD1 Source.329: DFBPPR6930 ---- Plant proteins ---- Alpha/beta-gliadin Source.330: DFBPPR6934 ---- Plant proteins ---- Alpha/beta-gliadin clone PW1215 Source.331: DFBPPR6936 ---- Plant proteins ---- Alpha/beta-gliadin A-II Source.332: DFBPPR6937 ---- Plant proteins ---- Alpha/beta-gliadin A-IV Source.333: DFBPPR6938 ---- Plant proteins ---- Alpha/beta-gliadin clone PW8142 Source.334: DFBPPR6939 ---- Plant proteins ---- Alpha/beta-gliadin A-V Source.335: DFBPPR6940 ---- Plant proteins ---- Alpha/beta-gliadin A-III Source.336: DFBPPR6941 ---- Plant proteins ---- Alpha/beta-gliadin A-I Source.337: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5 Source.338: DFBPPR6960 ---- Plant proteins ---- Gamma-gliadin Source.339: DFBPPR6962 ---- Plant proteins ---- Dehydrin Rab15 Source.340: DFBPPR6965 ---- Plant proteins ---- Gamma-gliadin B Source.341: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6 Source.342: DFBPPR6967 ---- Plant proteins ---- Gamma-gliadin Source.343: DFBPPR6968 ---- Plant proteins ---- Gamma-gliadin Source.344: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7 Source.345: DFBPPR6975 ---- Plant proteins ---- Gamma-gliadin Source.346: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4 Source.347: DFBPPR6986 ---- Plant proteins ---- Avenin-like b11 Source.348: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10 Source.349: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9 Source.350: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8 Source.351: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2 Source.352: DFBPPR6993 ---- Plant proteins ---- Avenin-like b3 Source.353: DFBPPR7004 ---- Plant proteins ---- Uncharacterized 16 kDa protein in middle repetitive insertion sequence WIS1 Source.354: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme Source.355: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.356: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase Source.357: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.358: DFBPPR7022 ---- Plant proteins ---- Alpha-amylase inhibitor BMAI-1 Source.359: DFBPPR7043 ---- Plant proteins ---- Beta-amylase Source.360: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.361: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.362: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain Source.363: DFBPPR7156 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.364: DFBPPR7160 ---- Plant proteins ---- Alpha-amylase type B isozyme Source.365: DFBPPR7253 ---- Plant proteins ---- Non-specific lipid-transfer protein 3 Source.366: DFBPPR7265 ---- Plant proteins ---- Gamma-hordein-3 Source.367: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33 Source.368: DFBPPR7311 ---- Plant proteins ---- B1-hordein Source.369: DFBPPR7315 ---- Plant proteins ---- Gamma-hordein-1 Source.370: DFBPPR7318 ---- Plant proteins ---- B3-hordein Source.371: DFBPPR7333 ---- Plant proteins ---- C-hordein Source.372: DFBPPR7334 ---- Plant proteins ---- C-hordein Source.373: DFBPPR7335 ---- Plant proteins ---- C-hordein Source.374: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1 Source.375: DFBPPR7454 ---- Plant proteins ---- Peptide methionine sulfoxide reductase Source.376: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2 Source.377: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1 Source.378: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein Source.379: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.380: DFBPPR7622 ---- Milk proteins ---- Mucin-1 Source.381: DFBPPR7649 ---- Milk proteins ---- Cadherin-1 Source.382: DFBPPR7654 ---- Milk proteins ---- Kallikrein-12 Source.383: DFBPPR7662 ---- Milk proteins ---- Alpha-S1-casein Source.384: DFBPPR7668 ---- Milk proteins ---- Beta-casein Source.385: DFBPPR7681 ---- Milk proteins ---- Beta-casein Source.386: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein Source.387: DFBPPR7692 ---- Milk proteins ---- Beta-casein Source.388: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein Source.389: DFBPPR7700 ---- Milk proteins ---- Beta-casein Source.390: DFBPPR7704 ---- Milk proteins ---- Whey acidic protein (tWAP) Source.391: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein Source.392: DFBPPR7718 ---- Milk proteins ---- Beta-casein Source.393: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.394: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.395: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5 Source.396: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain Source.397: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1 Source.398: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2 Source.399: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.400: DFBPPR8471 ---- Plant proteins ---- Beta-amylase Source.401: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein Source.402: DFBPPR8489 ---- Milk proteins ---- Beta-casein Source.403: DFBPPR8496 ---- Milk proteins ---- Mucin-1 Source.404: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.405: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2 Source.406: DFBPPR15963 ---- Animal proteins ---- Cadherin-1 Source.407: DFBPPR15974 ---- Animal proteins ---- Androgen receptor Source.408: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.409: DFBPPR16066 ---- Animal proteins ---- Coagulation factor IX Source.410: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1 Source.411: DFBPPR16072 ---- Animal proteins ---- Clusterin Source.412: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2 Source.413: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5 Source.414: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.415: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1 Source.416: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.417: DFBPPR16194 ---- Animal proteins ---- Signal peptidase complex subunit 3 Source.418: DFBPPR16230 ---- Animal proteins ---- Survival motor neuron protein Source.419: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta Source.420: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.421: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1 Source.422: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.423: DFBPPR16294 ---- Animal proteins ---- Signal peptidase complex subunit 2 Source.424: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1 Source.425: DFBPPR16299 ---- Animal proteins ---- Odontogenic ameloblast-associated protein Source.426: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.427: DFBPPR16324 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2 Source.428: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.429: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.430: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4 Source.431: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator Source.432: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.433: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.434: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8 Source.435: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3 Source.436: DFBPPR16714 ---- Animal proteins ---- Protein fosB Source.437: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46 Source.438: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10 Source.439: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.440: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1 Source.441: DFBPPR16841 ---- Animal proteins ---- Peroxiredoxin-6 Source.442: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX Source.443: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase Source.444: DFBPPR16948 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.445: DFBPPR16981 ---- Animal proteins ---- Clusterin Source.446: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.447: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha Source.448: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform Source.449: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.450: DFBPPR17085 ---- Animal proteins ---- Cadherin-2 Source.451: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.452: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1 Source.453: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1 Source.454: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1 Source.455: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A Source.456: DFBPPR17121 ---- Animal proteins ---- 3-hydroxyacyl-CoA dehydrogenase type-2 Source.457: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein Source.458: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.459: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1 Source.460: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.461: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2 Source.462: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112 Source.463: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.464: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.465: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.466: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1 Source.467: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.468: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.469: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1 Source.470: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.471: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4 Source.472: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.473: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.474: DFBPPR17542 ---- Animal proteins ---- Acetylcholine receptor subunit beta Source.475: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4 Source.476: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.477: DFBPPR17626 ---- Animal proteins ---- Elastin Source.478: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A Source.479: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.480: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.481: DFBPPR17820 ---- Animal proteins ---- Osteomodulin Source.482: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B Source.483: DFBPPR17847 ---- Animal proteins ---- Palmitoyltransferase ZDHHC20 Source.484: DFBPPR17861 ---- Animal proteins ---- 3-hydroxyanthranilate 3,4-dioxygenase Source.485: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.486: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain Source.487: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain Source.488: DFBPPR17905 ---- Animal proteins ---- DNA endonuclease RBBP8 Source.489: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein Source.490: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.491: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.492: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.493: DFBPPR17944 ---- Animal proteins ---- P-selectin Source.494: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.495: DFBPPR17962 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1 Source.496: DFBPPR17968 ---- Animal proteins ---- Cathelicidin-2 Source.497: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2 Source.498: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7 Source.499: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase Source.500: DFBPPR18033 ---- Animal proteins ---- Cathelicidin-3 Source.501: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2 Source.502: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit Source.503: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.504: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23 Source.505: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog Source.506: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1 Source.507: DFBPPR18241 ---- Animal proteins ---- Seminal plasma protein BSP-30 kDa Source.508: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.509: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2 Source.510: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.511: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2 Source.512: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3 Source.513: DFBPPR18371 ---- Animal proteins ---- F-actin-capping protein subunit beta Source.514: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.515: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z Source.516: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase Source.517: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6 Source.518: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.519: DFBPPR18487 ---- Animal proteins ---- Odontogenic ameloblast-associated protein Source.520: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7 Source.521: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1 Source.522: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.523: DFBPPR18626 ---- Animal proteins ---- Thymidylate synthase Source.524: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2 Source.525: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.526: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor Source.527: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3 Source.528: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7 Source.529: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav Source.530: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type Source.531: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain Source.532: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2 Source.533: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor Source.534: DFBPPR18986 ---- Animal proteins ---- Granzyme A Source.535: DFBPPR18998 ---- Animal proteins ---- E3 ubiquitin-protein ligase ZNRF1 Source.536: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I Source.537: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746 Source.538: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3 Source.539: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2 Source.540: DFBPPR19058 ---- Animal proteins ---- Phosphatidylserine decarboxylase proenzyme, mitochondrial Source.541: DFBPPR19072 ---- Animal proteins ---- Growth/differentiation factor 9 Source.542: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase Source.543: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein Source.544: DFBPPR19127 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H Source.545: DFBPPR19140 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 5 Source.546: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like Source.547: DFBPPR19162 ---- Animal proteins ---- Macrophage-capping protein Source.548: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2 Source.549: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.550: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4 Source.551: DFBPPR19224 ---- Animal proteins ---- Fetuin-B Source.552: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase Source.553: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.554: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5 Source.555: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1 Source.556: DFBPPR19299 ---- Animal proteins ---- Annexin A7 Source.557: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.558: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain Source.559: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2 Source.560: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.561: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.562: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.563: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF Source.564: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.565: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.566: DFBPPR19514 ---- Animal proteins ---- tRNA (cytosine(38)-C(5))-methyltransferase Source.567: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.568: DFBPPR19538 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial Source.569: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase Source.570: DFBPPR19554 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4 Source.571: DFBPPR19559 ---- Animal proteins ---- CCN family member 2 Source.572: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B Source.573: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7 Source.574: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS Source.575: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1 Source.576: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial Source.577: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform Source.578: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator Source.579: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase Source.580: DFBPPR19675 ---- Animal proteins ---- INO80 complex subunit E Source.581: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A Source.582: DFBPPR19701 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.583: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain Source.584: DFBPPR19773 ---- Animal proteins ---- KRR1 small subunit processome component homolog Source.585: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1 Source.586: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.587: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein Source.588: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.589: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain Source.590: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.591: DFBPPR19890 ---- Animal proteins ---- Protein N-terminal glutamine amidohydrolase Source.592: DFBPPR19893 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3 Source.593: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.594: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.595: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1 Source.596: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.597: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.598: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5 Source.599: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.600: DFBPPR20038 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 20 Source.601: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1 Source.602: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.603: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1 Source.604: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1 Source.605: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta Source.606: DFBPPR20177 ---- Animal proteins ---- TIMELESS-interacting protein Source.607: DFBPPR20254 ---- Animal proteins ---- Leukemia inhibitory factor Source.608: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2 Source.609: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4 Source.610: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial Source.611: DFBPPR20317 ---- Animal proteins ---- Cadherin-13 Source.612: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa Source.613: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.614: DFBPPR20354 ---- Animal proteins ---- Single-strand selective monofunctional uracil DNA glycosylase Source.615: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10 Source.616: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.617: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial Source.618: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial Source.619: DFBPPR20432 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 4 Source.620: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog Source.621: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8 Source.622: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79 Source.623: DFBPPR20470 ---- Animal proteins ---- Orexigenic neuropeptide QRFP Source.624: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial Source.625: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1 Source.626: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6 Source.627: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1 Source.628: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein Source.629: DFBPPR20538 ---- Animal proteins ---- Signal peptidase complex subunit 3 Source.630: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4 Source.631: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related Source.632: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi Source.633: DFBPPR20594 ---- Animal proteins ---- Vitamin D-binding protein Source.634: DFBPPR20598 ---- Animal proteins ---- Oncostatin-M Source.635: DFBPPR20637 ---- Animal proteins ---- Mitochondrial mRNA pseudouridine synthase RPUSD3 Source.636: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14 Source.637: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5 Source.638: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.639: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog Source.640: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1 Source.641: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha Source.642: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17 Source.643: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7 Source.644: DFBPPR20853 ---- Animal proteins ---- Hemopexin Source.645: DFBPPR20863 ---- Animal proteins ---- LIM and senescent cell antigen-like-containing domain protein 2 Source.646: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1 Source.647: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668 Source.648: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1 Source.649: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4 Source.650: DFBPPR20963 ---- Animal proteins ---- Protein kintoun Source.651: DFBPPR21030 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit C Source.652: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial Source.653: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574 Source.654: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7 Source.655: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3 Source.656: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2 Source.657: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.658: DFBPPR21098 ---- Animal proteins ---- Pre T-cell antigen receptor alpha Source.659: DFBPPR21116 ---- Animal proteins ---- Suppressor of cytokine signaling 5 Source.660: DFBPPR21156 ---- Animal proteins ---- Transmembrane gamma-carboxyglutamic acid protein 1 Source.661: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B Source.662: DFBPPR21290 ---- Animal proteins ---- Metaxin-1 Source.663: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15 Source.664: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2 Source.665: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D Source.666: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4 Source.667: DFBPPR21401 ---- Animal proteins ---- THAP domain-containing protein 5 Source.668: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1 Source.669: DFBPPR21416 ---- Animal proteins ---- 39S ribosomal protein L32, mitochondrial Source.670: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1 Source.671: DFBPPR21474 ---- Animal proteins ---- m-AAA protease-interacting protein 1, mitochondrial Source.672: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.673: DFBPPR21551 ---- Animal proteins ---- Suppressor of cytokine signaling 4 Source.674: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.675: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A Source.676: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.677: DFBPPR21624 ---- Animal proteins ---- Docking protein 1 Source.678: DFBPPR21706 ---- Animal proteins ---- Small membrane A-kinase anchor protein Source.679: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic Source.680: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2 Source.681: DFBPPR21721 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor C2 Source.682: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1 Source.683: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1 Source.684: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4 Source.685: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.686: DFBPPR21785 ---- Animal proteins ---- Spermatogenesis-associated protein 19, mitochondrial Source.687: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.688: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7 Source.689: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1 Source.690: DFBPPR21845 ---- Animal proteins ---- PAK4-inhibitor INKA2 Source.691: DFBPPR21850 ---- Animal proteins ---- GATA zinc finger domain-containing protein 1 Source.692: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5 Source.693: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14 Source.694: DFBPPR21884 ---- Animal proteins ---- Calcium-binding protein 39 Source.695: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1 Source.696: DFBPPR21941 ---- Animal proteins ---- MOB kinase activator 3A Source.697: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14 Source.698: DFBPPR22000 ---- Animal proteins ---- Protein LDOC1 Source.699: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase Source.700: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5 Source.701: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9 Source.702: DFBPPR22096 ---- Animal proteins ---- MOB kinase activator 3B Source.703: DFBPPR22133 ---- Animal proteins ---- MOB kinase activator 3C Source.704: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3 Source.705: DFBPPR22183 ---- Animal proteins ---- Retrotransposon Gag-like protein 8 Source.706: DFBPPR22210 ---- Animal proteins ---- Peroxisomal membrane protein 4 Source.707: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2 Source.708: DFBPPR22224 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 3 Source.709: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40 Source.710: DFBPPR22297 ---- Animal proteins ---- Histatherin Source.711: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like Source.712: DFBPPR22334 ---- Animal proteins ---- Protein HP-25 homolog 1 Source.713: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog Source.714: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein Source.715: DFBPPR22378 ---- Animal proteins ---- Coiled-coil domain-containing protein 86 Source.716: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5 Source.717: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1 Source.718: DFBPPR22493 ---- Animal proteins ---- PC-esterase domain-containing protein 1B Source.719: DFBPPR22560 ---- Animal proteins ---- Mesenteric estrogen-dependent adipogenesis protein Source.720: DFBPPR22592 ---- Animal proteins ---- Protein FAM167A Source.721: DFBPPR22701 ---- Animal proteins ---- Fibronectin type III domain-containing protein 8 Source.722: DFBPPR22754 ---- Animal proteins ---- Uncharacterized protein C1orf158 homolog Source.723: DFBPPR22762 ---- Animal proteins ---- Uncharacterized protein C6orf136 homolog Source.724: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.725: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.726: DFBPPR8564 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1 Source.727: DFBPPR8570 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.728: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.729: DFBPPR8580 ---- Animal proteins ---- Aldo-keto reductase family 1 member B1 Source.730: DFBPPR8585 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4 Source.731: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1 Source.732: DFBPPR8612 ---- Animal proteins ---- Peroxiredoxin-6 Source.733: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3 Source.734: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor Source.735: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1 Source.736: DFBPPR8710 ---- Animal proteins ---- Leptin receptor Source.737: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.738: DFBPPR8734 ---- Animal proteins ---- Clusterin Source.739: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2 Source.740: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.741: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.742: DFBPPR8812 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2 Source.743: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.744: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1 Source.745: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.746: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.747: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1 Source.748: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain Source.749: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf Source.750: DFBPPR9061 ---- Animal proteins ---- Caspase-1 Source.751: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1 Source.752: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.753: DFBPPR9113 ---- Animal proteins ---- Prophenin and tritrpticin precursor Source.754: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.755: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.756: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein Source.757: DFBPPR9172 ---- Animal proteins ---- Protein N-terminal asparagine amidohydrolase Source.758: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6 Source.759: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10 Source.760: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.761: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.762: DFBPPR9239 ---- Animal proteins ---- Prophenin-2 Source.763: DFBPPR9244 ---- Animal proteins ---- Krueppel-like factor 9 Source.764: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor Source.765: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.766: DFBPPR9420 ---- Animal proteins ---- B1 bradykinin receptor Source.767: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain Source.768: DFBPPR9461 ---- Animal proteins ---- CCN family member 2 Source.769: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.770: DFBPPR9553 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3 Source.771: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.772: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2 Source.773: DFBPPR9627 ---- Animal proteins ---- Odontogenic ameloblast-associated protein Source.774: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor Source.775: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase Source.776: DFBPPR9736 ---- Animal proteins ---- Metaxin-1 Source.777: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1 Source.778: DFBPPR9843 ---- Animal proteins ---- P protein Source.779: DFBPPR9885 ---- Animal proteins ---- B-cell CLL/lymphoma 9 protein Source.780: DFBPPR9942 ---- Animal proteins ---- Proline-rich protein 3 Source.781: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.782: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL Source.783: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor Source.784: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2 Source.785: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.786: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1 Source.787: DFBPPR10066 ---- Animal proteins ---- Peroxiredoxin-6 Source.788: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type Source.789: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.790: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.791: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog Source.792: DFBPPR10170 ---- Animal proteins ---- Drebrin Source.793: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.794: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5 Source.795: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1 Source.796: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein Source.797: DFBPPR10261 ---- Animal proteins ---- Cadherin-13 Source.798: DFBPPR10267 ---- Animal proteins ---- Gephyrin Source.799: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.800: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.801: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme Source.802: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.803: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2 Source.804: DFBPPR10368 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.805: DFBPPR10369 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.806: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog Source.807: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.808: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2 Source.809: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor Source.810: DFBPPR10549 ---- Animal proteins ---- Interferon type B Source.811: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.812: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.813: DFBPPR10653 ---- Animal proteins ---- Contactin-1 Source.814: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain Source.815: DFBPPR10662 ---- Animal proteins ---- CCN family member 3 Source.816: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain Source.817: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1 Source.818: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain Source.819: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3 Source.820: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1 Source.821: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.822: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.823: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.824: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain Source.825: DFBPPR10794 ---- Animal proteins ---- Zyxin Source.826: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1 Source.827: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain Source.828: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2 Source.829: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.830: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain Source.831: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1 Source.832: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.833: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain Source.834: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2 Source.835: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2 Source.836: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1 Source.837: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain Source.838: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.839: DFBPPR11012 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6 Source.840: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.841: DFBPPR11015 ---- Animal proteins ---- Myeloid protein 1 Source.842: DFBPPR11019 ---- Animal proteins ---- Cadherin-4 Source.843: DFBPPR11032 ---- Animal proteins ---- B-cadherin Source.844: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1 Source.845: DFBPPR11051 ---- Animal proteins ---- Signal peptidase complex subunit 3 Source.846: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2 Source.847: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D Source.848: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1 Source.849: DFBPPR11229 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H Source.850: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4 Source.851: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.852: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1 Source.853: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2 Source.854: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.855: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.856: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1 Source.857: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.858: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Source.859: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A Source.860: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator Source.861: DFBPPR11456 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-2 Source.862: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.863: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4 Source.864: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A Source.865: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2 Source.866: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1 Source.867: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein Source.868: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3 Source.869: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2 Source.870: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.871: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2 Source.872: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.873: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.874: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D Source.875: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi Source.876: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1 Source.877: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2 Source.878: DFBPPR11801 ---- Animal proteins ---- Homeobox protein SAX-1 Source.879: DFBPPR11812 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.880: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.881: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.882: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B Source.883: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3 Source.884: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59 Source.885: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A Source.886: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.887: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7 Source.888: DFBPPR12017 ---- Animal proteins ---- Zinc finger protein CKR1 Source.889: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9 Source.890: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14 Source.891: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C Source.892: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.893: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5 Source.894: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein Source.895: DFBPPR12248 ---- Animal proteins ---- Fructose-bisphosphate aldolase A Source.896: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.897: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.898: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.899: DFBPPR12303 ---- Animal proteins ---- Histidine-rich glycoprotein Source.900: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.901: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2 Source.902: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.903: DFBPPR12352 ---- Animal proteins ---- Podocalyxin Source.904: DFBPPR12353 ---- Animal proteins ---- Cytochrome P450 2E1 Source.905: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.906: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.907: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.908: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.909: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 Source.910: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.911: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6 Source.912: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.913: DFBPPR12469 ---- Animal proteins ---- Hemopexin Source.914: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII Source.915: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2 Source.916: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.917: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.918: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.919: DFBPPR12591 ---- Animal proteins ---- Annexin A11 Source.920: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20 Source.921: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5 Source.922: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.923: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4 Source.924: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16 Source.925: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1 Source.926: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.927: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor Source.928: DFBPPR12790 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 4 Source.929: DFBPPR12856 ---- Animal proteins ---- Leupaxin Source.930: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.931: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B Source.932: DFBPPR12950 ---- Animal proteins ---- Vitamin D-binding protein Source.933: DFBPPR12983 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial Source.934: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form Source.935: DFBPPR13067 ---- Animal proteins ---- Beta-casein Source.936: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1 Source.937: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form Source.938: DFBPPR13119 ---- Animal proteins ---- Ig alpha chain C region Source.939: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.940: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.941: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3 Source.942: DFBPPR13261 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1 Source.943: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.944: DFBPPR13350 ---- Animal proteins ---- Carbohydrate-binding protein AWN Source.945: DFBPPR13463 ---- Animal proteins ---- Cathelicidin-2 Source.946: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9 Source.947: DFBPPR13550 ---- Animal proteins ---- Corticotropin-releasing factor-binding protein Source.948: DFBPPR13560 ---- Animal proteins ---- P-selectin Source.949: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1 Source.950: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6 Source.951: DFBPPR13651 ---- Animal proteins ---- Clusterin Source.952: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor Source.953: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.954: DFBPPR13704 ---- Animal proteins ---- Osteopontin Source.955: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.956: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9 Source.957: DFBPPR13874 ---- Animal proteins ---- Cathelicidin-2 Source.958: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein Source.959: DFBPPR13895 ---- Animal proteins ---- Elastin Source.960: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.961: DFBPPR14019 ---- Animal proteins ---- Vimentin Source.962: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.963: DFBPPR14099 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88 Source.964: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase Source.965: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5 Source.966: DFBPPR14145 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit H Source.967: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.968: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator Source.969: DFBPPR14191 ---- Marine protein ---- THAP domain-containing protein 1 Source.970: DFBPPR14257 ---- Marine protein ---- Somatolactin Source.971: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.972: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N Source.973: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain Source.974: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.975: DFBPPR14606 ---- Marine protein ---- Myoblast determination protein 1 homolog 1 Source.976: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.977: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88 Source.978: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.979: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.980: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain Source.981: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2 Source.982: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase Source.983: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase Source.984: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1 Source.985: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial Source.986: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit Source.987: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1 Source.988: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial Source.989: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase Source.990: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase Source.991: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3 Source.992: DFBPPR15089 ---- Microorganism protein ---- F-actin-capping protein subunit beta Source.993: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1 Source.994: DFBPPR15148 ---- Microorganism protein ---- Riboflavin kinase Source.995: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.996: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing] Source.997: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.998: DFBPPR15243 ---- Microorganism protein ---- Coupling of ubiquitin conjugation to ER degradation protein 1 Source.999: DFBPPR15251 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP38 Source.1000: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1 Source.1001: DFBPPR15275 ---- Microorganism protein ---- Exocyst complex protein EXO70 Source.1002: DFBPPR15299 ---- Microorganism protein ---- Histone chaperone RTT106 Source.1003: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog Source.1004: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.1005: DFBPPR15421 ---- Microorganism protein ---- Cytochrome c lysine N-methyltransferase 1 Source.1006: DFBPPR15515 ---- Microorganism protein ---- Tethering factor for nuclear proteasome STS1 Source.1007: DFBPPR15594 ---- Microorganism protein ---- Pre-mRNA polyadenylation factor FIP1 Source.1008: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13 Source.1009: DFBPPR15649 ---- Microorganism protein ---- Protein TAR1 Source.1010: DFBPPR15703 ---- Microorganism protein ---- Pre-mRNA-processing protein 45 Source.1011: DFBPPR15722 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 18, mitochondrial Source.1012: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2 Source.1013: DFBPPR15739 ---- Microorganism protein ---- Long chronological lifespan protein 2 Source.1014: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain Source.1015: DFBPPR15868 ---- Microorganism protein ---- Thymidylate synthase Source.1016: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase Source.1017: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain Source.1018: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain Source.1019: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase Source.1020: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase Source.1021: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic Source.1022: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic Source.1023: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase Source.1024: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3 Source.1025: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.1026: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.1027: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.1028: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1 Source.1029: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase Source.1030: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1 Source.1031: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.1032: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase Source.1033: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase Source.1034: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1035: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic Source.1036: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Link-research Inductive analysis	Link 1: DFBPACEI0298----Spanish cheeses (Manchego), Ovine milk----β-Casein

Biological/Functional activity & target protein

ACE-inhibitory activity	The peptide exhibited Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC₅₀ value of 144.4 μM.
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N1[C@@]([H])(CCC1)C(=O)O

Preparation method

Mode of preparation	Preparation of water-soluble-extract (WSE).
Enzyme(s)/starter culture	The WSEs were fractionated by passing them through a membrane with a molecular weight cut-off 1000 Da at 5 ◦C in a stirred-cell type ultrafiltration module, under a pressure of 3 bars applied with nitrogen (no enzyme).

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

N.D

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Gómez-Ruiz, J.Á., Taborda, G., Amigo, L., Recio, I., Ramos, M. Identification of ACE-inhibitory peptides in different Spanish cheeses by tandem mass spectrometry. European Food Research and Technology. 2006, 223, 595-601. DOI: 10.1007/s00217-005-0238-0
Other literature(s)	[1] Park Y W. Bioactive Components in Milk and Dairy Products[M]. 2009.
PubDate	2006