E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI0116(ACE-inhibitory peptide)
DFBP ID DFBPACEI0116
Peptide sequence AF
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Ala-Phe
Single-letter amino acid AF
Peptide length 2
Peptide mass
Experimental mass Theoretical mass
N.D 236.26 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 165.3 uM, 190 uM [1]
pIC50 -2.218, -2.279
GRAVY 2.3000 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Soybean (salt-free soy sauce)
Precursor protein A powdered sample of salt-free soy sauce
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin
Source.3: DFBPPR0435 ---- Plant protein ---- 22kDa storage protein
Source.4: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein
Source.5: DFBPPR0776 ---- Plant proteins ---- 11S globulin
Source.6: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2
Source.7: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.8: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1
Source.9: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2
Source.10: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog
Source.11: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25
Source.12: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.13: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.14: DFBPPR0820 ---- Plant proteins ---- bZIP transcription factor RISBZ5
Source.15: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.16: DFBPPR0823 ---- Plant proteins ---- bZIP transcription factor RISBZ3
Source.17: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.18: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8
Source.19: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.20: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.21: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5
Source.22: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.23: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2
Source.24: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.25: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.26: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1
Source.27: DFBPPR0840 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 2
Source.28: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A
Source.29: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1
Source.30: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.31: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.32: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14
Source.33: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.34: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.35: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.36: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.37: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1
Source.38: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.39: DFBPPR0854 ---- Plant proteins ---- Lactoylglutathione lyase
Source.40: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.41: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.42: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.43: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.44: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.45: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.46: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18
Source.47: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.48: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.49: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.50: DFBPPR0867 ---- Plant proteins ---- Ras-related protein Rab5A
Source.51: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.52: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.53: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.54: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6
Source.55: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.56: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1
Source.57: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.58: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.59: DFBPPR0879 ---- Plant proteins ---- UDP-arabinopyranose mutase 1
Source.60: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.61: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.62: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.63: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.64: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.65: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8
Source.66: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1
Source.67: DFBPPR0892 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 1
Source.68: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1
Source.69: DFBPPR0894 ---- Plant proteins ---- Serotonin N-acetyltransferase 1, chloroplastic
Source.70: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.71: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11
Source.72: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53
Source.73: DFBPPR0899 ---- Plant proteins ---- Cyclin-dependent kinase A-1
Source.74: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.75: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase
Source.76: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12
Source.77: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.78: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.79: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.80: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.81: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.82: DFBPPR0922 ---- Plant proteins ---- Obg-like ATPase 1
Source.83: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a
Source.84: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1
Source.85: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.86: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.87: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.88: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial
Source.89: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.90: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.91: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.92: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.93: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1
Source.94: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.95: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.96: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.97: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A
Source.98: DFBPPR0944 ---- Plant proteins ---- UDP-arabinopyranose mutase 3
Source.99: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.100: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.101: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.102: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.103: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.104: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1
Source.105: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.106: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5
Source.107: DFBPPR0959 ---- Plant proteins ---- Probable serine/threonine-protein kinase BSK3
Source.108: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein
Source.109: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.110: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3
Source.111: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC
Source.112: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.113: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.114: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3
Source.115: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.116: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.117: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda
Source.118: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.119: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic
Source.120: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.121: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1
Source.122: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1
Source.123: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.124: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic
Source.125: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70
Source.126: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.127: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.128: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21
Source.129: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.130: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185
Source.131: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic
Source.132: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.133: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.134: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.135: DFBPPR0997 ---- Plant proteins ---- Tricin synthase 1
Source.136: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31
Source.137: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.138: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.139: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.140: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.141: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.142: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.143: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.144: DFBPPR1009 ---- Plant proteins ---- SPX domain-containing protein 4
Source.145: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.146: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.147: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.148: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.149: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.150: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.151: DFBPPR1017 ---- Plant proteins ---- Glucosamine 6-phosphate N-acetyltransferase 1
Source.152: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.153: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.154: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.155: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.156: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1
Source.157: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A
Source.158: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.159: DFBPPR1028 ---- Plant proteins ---- Defensin-like protein CAL1
Source.160: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1
Source.161: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1
Source.162: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.163: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP
Source.164: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic
Source.165: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.166: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.167: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.168: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2
Source.169: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.170: DFBPPR1047 ---- Plant proteins ---- Rac-like GTP-binding protein 5
Source.171: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.172: DFBPPR1050 ---- Plant proteins ---- Mitogen-activated protein kinase kinase 1
Source.173: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.174: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5
Source.175: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62
Source.176: DFBPPR1062 ---- Plant proteins ---- Transcription factor LAX PANICLE 1
Source.177: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A
Source.178: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.179: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4
Source.180: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1
Source.181: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1
Source.182: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79
Source.183: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.184: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.185: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.186: DFBPPR1075 ---- Plant proteins ---- Cyclin-dependent kinase A-2
Source.187: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24
Source.188: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.189: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.190: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1
Source.191: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.192: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24
Source.193: DFBPPR1084 ---- Plant proteins ---- Protein AUXIN-REGULATED GENE INVOLVED IN ORGAN SIZE
Source.194: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5
Source.195: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.196: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706
Source.197: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.198: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL
Source.199: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1
Source.200: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.201: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.202: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.203: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.204: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.205: DFBPPR1105 ---- Plant proteins ---- Solanesyl-diphosphate synthase 1, mitochondrial
Source.206: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4
Source.207: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2
Source.208: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.209: DFBPPR1110 ---- Plant proteins ---- Superoxide dismutase [Cu-Zn], chloroplastic
Source.210: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.211: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic
Source.212: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.213: DFBPPR1116 ---- Plant proteins ---- Polycomb group protein EMF2B
Source.214: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.215: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.216: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E
Source.217: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG
Source.218: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4
Source.219: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.220: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic
Source.221: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic
Source.222: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6
Source.223: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.224: DFBPPR1129 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.225: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.226: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.227: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP
Source.228: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13
Source.229: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3
Source.230: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.231: DFBPPR1140 ---- Plant proteins ---- Protein PARTING DANCERS homolog
Source.232: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.233: DFBPPR1142 ---- Plant proteins ---- Calreticulin
Source.234: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13
Source.235: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.236: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.237: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.238: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6
Source.239: DFBPPR1150 ---- Plant proteins ---- Abscisic stress-ripening protein 5
Source.240: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.241: DFBPPR1153 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein A
Source.242: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13
Source.243: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.244: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B
Source.245: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3
Source.246: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.247: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.248: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.249: DFBPPR1167 ---- Plant proteins ---- Phototropin-2
Source.250: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.251: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic
Source.252: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2
Source.253: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic
Source.254: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2
Source.255: DFBPPR1176 ---- Plant proteins ---- Chitinase 12
Source.256: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.257: DFBPPR1180 ---- Plant proteins ---- Anthranilate synthase beta subunit 1, chloroplastic
Source.258: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.259: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3
Source.260: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.261: DFBPPR1207 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.262: DFBPPR1208 ---- Plant proteins ---- RNA polymerase sigma factor sigA
Source.263: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1
Source.264: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog
Source.265: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.266: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.267: DFBPPR1215 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A4, chloroplastic
Source.268: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19
Source.269: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.270: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic
Source.271: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1
Source.272: DFBPPR1224 ---- Plant proteins ---- MADS-box transcription factor 50
Source.273: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.274: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3
Source.275: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b
Source.276: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.277: DFBPPR1244 ---- Plant proteins ---- MADS-box transcription factor 58
Source.278: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.279: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial
Source.280: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15
Source.281: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10
Source.282: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28
Source.283: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.284: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24
Source.285: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.286: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.287: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.288: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.289: DFBPPR1259 ---- Plant proteins ---- Beta-carotene isomerase D27, chloroplastic
Source.290: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.291: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1
Source.292: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.293: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.294: DFBPPR1265 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B1, chloroplastic
Source.295: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.296: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.297: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic
Source.298: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.299: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.300: DFBPPR1271 ---- Plant proteins ---- CBL-interacting protein kinase 23
Source.301: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3
Source.302: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.303: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.304: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.305: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase
Source.306: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1
Source.307: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a
Source.308: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.309: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.310: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.311: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic
Source.312: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.313: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.314: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39
Source.315: DFBPPR1292 ---- Plant proteins ---- Chitinase 3
Source.316: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.317: DFBPPR1294 ---- Plant proteins ---- MADS-box transcription factor 8
Source.318: DFBPPR1297 ---- Plant proteins ---- Peroxygenase
Source.319: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.320: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b
Source.321: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6
Source.322: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22
Source.323: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.324: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.325: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.326: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B
Source.327: DFBPPR1310 ---- Plant proteins ---- Rac-like GTP-binding protein 6
Source.328: DFBPPR1311 ---- Plant proteins ---- Synaptonemal complex protein ZEP1
Source.329: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.330: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.331: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.332: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.333: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2
Source.334: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22
Source.335: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.336: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic
Source.337: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16
Source.338: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1
Source.339: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.340: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.341: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.342: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d
Source.343: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.344: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.345: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.346: DFBPPR1332 ---- Plant proteins ---- Flap endonuclease 1-B
Source.347: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.348: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.349: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.350: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12
Source.351: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1
Source.352: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.353: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14
Source.354: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1
Source.355: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.356: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.357: DFBPPR1346 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 5
Source.358: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.359: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.360: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.361: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.362: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.363: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.364: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.365: DFBPPR1361 ---- Plant proteins ---- Anthranilate synthase beta subunit 2, chloroplastic
Source.366: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.367: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.368: DFBPPR1365 ---- Plant proteins ---- Replication protein A 32 kDa subunit A
Source.369: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.370: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1
Source.371: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.372: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.373: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.374: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.375: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.376: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic
Source.377: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.378: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.379: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2
Source.380: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.381: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.382: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase
Source.383: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.384: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.385: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.386: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2
Source.387: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.388: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.389: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.390: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.391: DFBPPR1393 ---- Plant proteins ---- Serine/threonine-protein kinase Nek6
Source.392: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.393: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic
Source.394: DFBPPR1396 ---- Plant proteins ---- Peroxidase 2
Source.395: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29
Source.396: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.397: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.398: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5
Source.399: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.400: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B
Source.401: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2
Source.402: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.403: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.404: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.405: DFBPPR1409 ---- Plant proteins ---- Flavanone 3-dioxygenase 3
Source.406: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.407: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2
Source.408: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.409: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.410: DFBPPR1415 ---- Plant proteins ---- Rac-like GTP-binding protein 7
Source.411: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.412: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A
Source.413: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.414: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.415: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.416: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.417: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.418: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14
Source.419: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.420: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.421: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.422: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.423: DFBPPR1435 ---- Plant proteins ---- Photosystem II 22 kDa protein 1, chloroplastic
Source.424: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.425: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3
Source.426: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3
Source.427: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.428: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.429: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.430: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.431: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.432: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5
Source.433: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.434: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b
Source.435: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.436: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.437: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.438: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E
Source.439: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.440: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.441: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.442: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c
Source.443: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2
Source.444: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.445: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.446: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.447: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.448: DFBPPR1468 ---- Plant proteins ---- Serotonin N-acetyltransferase 2, chloroplastic
Source.449: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.450: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase
Source.451: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.452: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1
Source.453: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A
Source.454: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.455: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.456: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.457: DFBPPR1477 ---- Plant proteins ---- MADS-box transcription factor 16
Source.458: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.459: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.460: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.461: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.462: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.463: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2
Source.464: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.465: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.466: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.467: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.468: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.469: DFBPPR1491 ---- Plant proteins ---- Rac-like GTP-binding protein 4
Source.470: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.471: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.472: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.473: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.474: DFBPPR1497 ---- Plant proteins ---- Chitinase 1
Source.475: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.476: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein
Source.477: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.478: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.479: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.480: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5
Source.481: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.482: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.483: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.484: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.485: DFBPPR1513 ---- Plant proteins ---- 14-3-3-like protein GF14-F
Source.486: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.487: DFBPPR1515 ---- Plant proteins ---- Serine/threonine-protein kinase Nek3
Source.488: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.489: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.490: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15
Source.491: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.492: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3
Source.493: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5
Source.494: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1
Source.495: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.496: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.497: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39
Source.498: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.499: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.500: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.501: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.502: DFBPPR1537 ---- Plant proteins ---- Zinc transporter 8
Source.503: DFBPPR1538 ---- Plant proteins ---- Heat stress transcription factor A-2e
Source.504: DFBPPR1540 ---- Plant proteins ---- Protein DROOPING LEAF
Source.505: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.506: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.507: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.508: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.509: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.510: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.511: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.512: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148
Source.513: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.514: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2
Source.515: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6
Source.516: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19
Source.517: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.518: DFBPPR1561 ---- Plant proteins ---- Chitinase 4
Source.519: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.520: DFBPPR1563 ---- Plant proteins ---- TPD1 protein homolog 1A
Source.521: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.522: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.523: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.524: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.525: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33
Source.526: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2
Source.527: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9
Source.528: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic
Source.529: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.530: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2
Source.531: DFBPPR1580 ---- Plant proteins ---- Expansin-A4
Source.532: DFBPPR1581 ---- Plant proteins ---- Peroxiredoxin-2C
Source.533: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.534: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.535: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2
Source.536: DFBPPR1587 ---- Plant proteins ---- CBL-interacting protein kinase 8
Source.537: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.538: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.539: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.540: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.541: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.542: DFBPPR1596 ---- Plant proteins ---- Photosystem II 22 kDa protein 2, chloroplastic
Source.543: DFBPPR1597 ---- Plant proteins ---- MADS-box transcription factor 51
Source.544: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.545: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.546: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A
Source.547: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.548: DFBPPR1606 ---- Plant proteins ---- 17.4 kDa class I heat shock protein
Source.549: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.550: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.551: DFBPPR1610 ---- Plant proteins ---- 18.1 kDa class I heat shock protein
Source.552: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2
Source.553: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1
Source.554: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.555: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.556: DFBPPR1615 ---- Plant proteins ---- Phosphatidylinositol:ceramide inositolphosphotransferase
Source.557: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.558: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7
Source.559: DFBPPR1618 ---- Plant proteins ---- Heat stress transcription factor C-1a
Source.560: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.561: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.562: DFBPPR1623 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 2, chloroplastic
Source.563: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71
Source.564: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.565: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic
Source.566: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.567: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.568: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic
Source.569: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a
Source.570: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.571: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.572: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2
Source.573: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.574: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.575: DFBPPR1639 ---- Plant proteins ---- Rac-like GTP-binding protein 2
Source.576: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.577: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.578: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic
Source.579: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.580: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial
Source.581: DFBPPR1647 ---- Plant proteins ---- Rac-like GTP-binding protein 3
Source.582: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.583: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.584: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.585: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic
Source.586: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.587: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.588: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.589: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.590: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.591: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.592: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.593: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1
Source.594: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10
Source.595: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.596: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial
Source.597: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal
Source.598: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.599: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A
Source.600: DFBPPR1671 ---- Plant proteins ---- MADS-box transcription factor 4
Source.601: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.602: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.603: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.604: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic
Source.605: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7
Source.606: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3
Source.607: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.608: DFBPPR1681 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.609: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.610: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.611: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.612: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic
Source.613: DFBPPR1688 ---- Plant proteins ---- UMP-CMP kinase 3
Source.614: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.615: DFBPPR1691 ---- Plant proteins ---- Transcription factor BHLH062
Source.616: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic
Source.617: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.618: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.619: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.620: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.621: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic
Source.622: DFBPPR1702 ---- Plant proteins ---- Glutelin type-A 2
Source.623: DFBPPR1704 ---- Plant proteins ---- RNA-binding protein Y14B
Source.624: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.625: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.626: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a
Source.627: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1
Source.628: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.629: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.630: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic
Source.631: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.632: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.633: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.634: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.635: DFBPPR1723 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.636: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.637: DFBPPR1726 ---- Plant proteins ---- SPX domain-containing protein 1
Source.638: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.639: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.640: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2
Source.641: DFBPPR1733 ---- Plant proteins ---- Xylanase inhibitor protein XIP
Source.642: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.643: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic
Source.644: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1
Source.645: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic
Source.646: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.647: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.648: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.649: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2
Source.650: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.651: DFBPPR1748 ---- Plant proteins ---- 17.7 kDa class I heat shock protein
Source.652: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial
Source.653: DFBPPR1750 ---- Plant proteins ---- Transcription factor IBH1
Source.654: DFBPPR1752 ---- Plant proteins ---- TATA-binding protein 2
Source.655: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.656: DFBPPR1754 ---- Plant proteins ---- Transcription factor BHLH094
Source.657: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic
Source.658: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.659: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.660: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.661: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.662: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1
Source.663: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.664: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2
Source.665: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.666: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial
Source.667: DFBPPR1770 ---- Plant proteins ---- Probable tyrosine-protein phosphatase DSP2
Source.668: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.669: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.670: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1
Source.671: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.672: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.673: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11
Source.674: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3
Source.675: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.676: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.677: DFBPPR1782 ---- Plant proteins ---- Transcription factor BHLH133
Source.678: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A
Source.679: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.680: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.681: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.682: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.683: DFBPPR1790 ---- Plant proteins ---- High-affinity nitrate transporter-activating protein 2.1
Source.684: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.685: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.686: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.687: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.688: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic
Source.689: DFBPPR1798 ---- Plant proteins ---- UMP-CMP kinase 2
Source.690: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4
Source.691: DFBPPR1803 ---- Plant proteins ---- Chitinase 5
Source.692: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.693: DFBPPR1806 ---- Plant proteins ---- Laccase-19
Source.694: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2
Source.695: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial
Source.696: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1
Source.697: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9
Source.698: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2
Source.699: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.700: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.701: DFBPPR1818 ---- Plant proteins ---- Chitinase 9
Source.702: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B
Source.703: DFBPPR1823 ---- Plant proteins ---- Protein YABBY 1
Source.704: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.705: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3
Source.706: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.707: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.708: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.709: DFBPPR1829 ---- Plant proteins ---- Cyclin-dependent kinase B1-1
Source.710: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.711: DFBPPR1831 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 1
Source.712: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3
Source.713: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.714: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5
Source.715: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.716: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.717: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO
Source.718: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.719: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.720: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.721: DFBPPR1847 ---- Plant proteins ---- Amidase 1
Source.722: DFBPPR1848 ---- Plant proteins ---- Chitinase 7
Source.723: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.724: DFBPPR1851 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1
Source.725: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.726: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.727: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.728: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.729: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.730: DFBPPR1863 ---- Plant proteins ---- Chitinase 6
Source.731: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.732: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.733: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.734: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.735: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.736: DFBPPR1870 ---- Plant proteins ---- Laccase-20
Source.737: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17
Source.738: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.739: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4
Source.740: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.741: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8
Source.742: DFBPPR1879 ---- Plant proteins ---- Germin-like protein 1-3
Source.743: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1
Source.744: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.745: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.746: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.747: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.748: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8
Source.749: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.750: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.751: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.752: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4
Source.753: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.754: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1
Source.755: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.756: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.757: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3
Source.758: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.759: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic
Source.760: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic
Source.761: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1
Source.762: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2
Source.763: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6
Source.764: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.765: DFBPPR1912 ---- Plant proteins ---- Expansin-B3
Source.766: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.767: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.768: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial
Source.769: DFBPPR1916 ---- Plant proteins ---- Protein PYRICULARIA ORYZAE RESISTANCE 21
Source.770: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.771: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.772: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.773: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.774: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2
Source.775: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.776: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.777: DFBPPR1933 ---- Plant proteins ---- MADS-box transcription factor 2
Source.778: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3
Source.779: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.780: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.781: DFBPPR1939 ---- Plant proteins ---- Signal peptide peptidase-like 2
Source.782: DFBPPR1941 ---- Plant proteins ---- UMP-CMP kinase 4
Source.783: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA
Source.784: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.785: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.786: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.787: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.788: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.789: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.790: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.791: DFBPPR1952 ---- Plant proteins ---- CBL-interacting protein kinase 1
Source.792: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17
Source.793: DFBPPR1954 ---- Plant proteins ---- Calcineurin B-like protein 4
Source.794: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.795: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.796: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.797: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.798: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.799: DFBPPR1962 ---- Plant proteins ---- Expansin-A2
Source.800: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.801: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5
Source.802: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.803: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.804: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3
Source.805: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.806: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12
Source.807: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.808: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial
Source.809: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.810: DFBPPR1980 ---- Plant proteins ---- Germin-like protein 1-4
Source.811: DFBPPR1981 ---- Plant proteins ---- Signal peptide peptidase 2
Source.812: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.813: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.814: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38
Source.815: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2
Source.816: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.817: DFBPPR1996 ---- Plant proteins ---- Transcription initiation factor IIB
Source.818: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B
Source.819: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4
Source.820: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.821: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b
Source.822: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.823: DFBPPR2003 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic
Source.824: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A
Source.825: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.826: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8
Source.827: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.828: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1
Source.829: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.830: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33
Source.831: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.832: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.833: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.834: DFBPPR2015 ---- Plant proteins ---- 50S ribosomal protein L12, chloroplastic
Source.835: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a
Source.836: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.837: DFBPPR2019 ---- Plant proteins ---- SPX domain-containing protein 5
Source.838: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.839: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1
Source.840: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.841: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.842: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.843: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.844: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.845: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.846: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.847: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5
Source.848: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.849: DFBPPR2035 ---- Plant proteins ---- Glutelin type-A 1
Source.850: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16
Source.851: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.852: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.853: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.854: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial
Source.855: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.856: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1
Source.857: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.858: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11
Source.859: DFBPPR2048 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ23
Source.860: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.861: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15
Source.862: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.863: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.864: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10
Source.865: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.866: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176
Source.867: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.868: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9
Source.869: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5
Source.870: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3
Source.871: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.872: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.873: DFBPPR2063 ---- Plant proteins ---- Non-specific lipid-transfer protein C6
Source.874: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.875: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA
Source.876: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.877: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2
Source.878: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.879: DFBPPR2070 ---- Plant proteins ---- Calmodulin-1
Source.880: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.881: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.882: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.883: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.884: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C
Source.885: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c
Source.886: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1
Source.887: DFBPPR2081 ---- Plant proteins ---- Expansin-A1
Source.888: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9
Source.889: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic
Source.890: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.891: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.892: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.893: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.894: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5
Source.895: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.896: DFBPPR2096 ---- Plant proteins ---- Peroxiredoxin-2E-1, chloroplastic
Source.897: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.898: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.899: DFBPPR2100 ---- Plant proteins ---- Germin-like protein 1-1
Source.900: DFBPPR2101 ---- Plant proteins ---- Cupincin
Source.901: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12
Source.902: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase
Source.903: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.904: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.905: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.906: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.907: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.908: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4
Source.909: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.910: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.911: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.912: DFBPPR2115 ---- Plant proteins ---- E3 ubiquitin-protein ligase SIRP1
Source.913: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1
Source.914: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.915: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.916: DFBPPR2122 ---- Plant proteins ---- FAD-linked sulfhydryl oxidase ERV1
Source.917: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.918: DFBPPR2125 ---- Plant proteins ---- Protein YABBY 5
Source.919: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2
Source.920: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.921: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.922: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.923: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic
Source.924: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.925: DFBPPR2134 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.926: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.927: DFBPPR2138 ---- Plant proteins ---- 17.9 kDa class I heat shock protein
Source.928: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1
Source.929: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.930: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.931: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.932: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic
Source.933: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic
Source.934: DFBPPR2146 ---- Plant proteins ---- Expansin-B4
Source.935: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23
Source.936: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.937: DFBPPR2150 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5A
Source.938: DFBPPR2151 ---- Plant proteins ---- Glutelin type-A 3
Source.939: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.940: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.941: DFBPPR2154 ---- Plant proteins ---- Germin-like protein 8-2
Source.942: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.943: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.944: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.945: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.946: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.947: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.948: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.949: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.950: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.951: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.952: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.953: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.954: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.955: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.956: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.957: DFBPPR2175 ---- Plant proteins ---- Expansin-A16
Source.958: DFBPPR2176 ---- Plant proteins ---- Expansin-B11
Source.959: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11
Source.960: DFBPPR2178 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 2
Source.961: DFBPPR2179 ---- Plant proteins ---- 14-3-3-like protein GF14-C
Source.962: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.963: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.964: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.965: DFBPPR2183 ---- Plant proteins ---- Proteasome subunit beta type-1
Source.966: DFBPPR2184 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic
Source.967: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.968: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.969: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.970: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2
Source.971: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.972: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.973: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.974: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4
Source.975: DFBPPR2195 ---- Plant proteins ---- Signal peptide peptidase 1
Source.976: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.977: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2
Source.978: DFBPPR2199 ---- Plant proteins ---- 18.0 kDa class II heat shock protein
Source.979: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.980: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.981: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.982: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.983: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.984: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16
Source.985: DFBPPR2208 ---- Plant proteins ---- CBL-interacting protein kinase 21
Source.986: DFBPPR2209 ---- Plant proteins ---- Succinate dehydrogenase subunit 4, mitochondrial
Source.987: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32
Source.988: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.989: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.990: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.991: DFBPPR2214 ---- Plant proteins ---- Cyclase-like protein 4
Source.992: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.993: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26
Source.994: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.995: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.996: DFBPPR2223 ---- Plant proteins ---- Urease
Source.997: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9
Source.998: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.999: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like
Source.1000: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1
Source.1001: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.1002: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.1003: DFBPPR2233 ---- Plant proteins ---- Thioredoxin Y, chloroplastic
Source.1004: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.1005: DFBPPR2237 ---- Plant proteins ---- Probable glutathione S-transferase GSTU1
Source.1006: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.1007: DFBPPR2239 ---- Plant proteins ---- Elongation factor 1-alpha
Source.1008: DFBPPR2242 ---- Plant proteins ---- Expansin-A3
Source.1009: DFBPPR2243 ---- Plant proteins ---- WRKY transcription factor WRKY76
Source.1010: DFBPPR2244 ---- Plant proteins ---- Expansin-A6
Source.1011: DFBPPR2245 ---- Plant proteins ---- Expansin-A26
Source.1012: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.1013: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1
Source.1014: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3
Source.1015: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.1016: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30
Source.1017: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.1018: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13
Source.1019: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.1020: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.1021: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.1022: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6
Source.1023: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29
Source.1024: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.1025: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.1026: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2
Source.1027: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.1028: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.1029: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.1030: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.1031: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.1032: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.1033: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3
Source.1034: DFBPPR2279 ---- Plant proteins ---- Thioredoxin-like protein CITRX, chloroplastic
Source.1035: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.1036: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.1037: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.1038: DFBPPR2283 ---- Plant proteins ---- Oleosin 18 kDa
Source.1039: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.1040: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3
Source.1041: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.1042: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3
Source.1043: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.1044: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic
Source.1045: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4
Source.1046: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3
Source.1047: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.1048: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic
Source.1049: DFBPPR2302 ---- Plant proteins ---- Bowman-Birk type bran trypsin inhibitor
Source.1050: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1051: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7
Source.1052: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b
Source.1053: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.1054: DFBPPR2310 ---- Plant proteins ---- Heat stress transcription factor A-3
Source.1055: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5
Source.1056: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.1057: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA
Source.1058: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.1059: DFBPPR2317 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2
Source.1060: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.1061: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2
Source.1062: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2
Source.1063: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.1064: DFBPPR2325 ---- Plant proteins ---- Peroxiredoxin-2E-2, chloroplastic
Source.1065: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3
Source.1066: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.1067: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26
Source.1068: DFBPPR2329 ---- Plant proteins ---- Protein HEADING DATE REPRESSOR 1
Source.1069: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b
Source.1070: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.1071: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4
Source.1072: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.1073: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.1074: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.1075: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.1076: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1
Source.1077: DFBPPR2342 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic
Source.1078: DFBPPR2344 ---- Plant proteins ---- Calcineurin B-like protein 8
Source.1079: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.1080: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.1081: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.1082: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.1083: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.1084: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.1085: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic
Source.1086: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.1087: DFBPPR2358 ---- Plant proteins ---- Germin-like protein 8-11
Source.1088: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.1089: DFBPPR2360 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.1090: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.1091: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.1092: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.1093: DFBPPR2364 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.1094: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.1095: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.1096: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5
Source.1097: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic
Source.1098: DFBPPR2371 ---- Plant proteins ---- Seed allergenic protein RAG1
Source.1099: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.1100: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.1101: DFBPPR2374 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2
Source.1102: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.1103: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6
Source.1104: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.1105: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase
Source.1106: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.1107: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.1108: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23
Source.1109: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100
Source.1110: DFBPPR2387 ---- Plant proteins ---- Chitinase 8
Source.1111: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10
Source.1112: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic
Source.1113: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.1114: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.1115: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.1116: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5
Source.1117: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6
Source.1118: DFBPPR2399 ---- Plant proteins ---- Germin-like protein 5-1
Source.1119: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.1120: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.1121: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.1122: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.1123: DFBPPR2405 ---- Plant proteins ---- Transcription factor BHLH089
Source.1124: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6
Source.1125: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.1126: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3
Source.1127: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B
Source.1128: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.1129: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2
Source.1130: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.1131: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.1132: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2
Source.1133: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.1134: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.1135: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.1136: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1
Source.1137: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic
Source.1138: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.1139: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.1140: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1
Source.1141: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.1142: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.1143: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.1144: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3
Source.1145: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic
Source.1146: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1147: DFBPPR2433 ---- Plant proteins ---- SAP-like protein BP-73
Source.1148: DFBPPR2434 ---- Plant proteins ---- Non-specific lipid transfer protein-like 1
Source.1149: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.1150: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1
Source.1151: DFBPPR2438 ---- Plant proteins ---- Arabinogalactan protein 1
Source.1152: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.1153: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.1154: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain
Source.1155: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1156: DFBPPR2446 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-9
Source.1157: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6
Source.1158: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.1159: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic
Source.1160: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic
Source.1161: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.1162: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial
Source.1163: DFBPPR2454 ---- Plant proteins ---- MADS-box transcription factor 56
Source.1164: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.1165: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.1166: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic
Source.1167: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.1168: DFBPPR2460 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.1169: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1
Source.1170: DFBPPR2462 ---- Plant proteins ---- Arabinogalactan peptide 1
Source.1171: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.1172: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.1173: DFBPPR2468 ---- Plant proteins ---- Germin-like protein 8-3
Source.1174: DFBPPR2469 ---- Plant proteins ---- Germin-like protein 8-4
Source.1175: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2
Source.1176: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial
Source.1177: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.1178: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.1179: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.1180: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.1181: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14
Source.1182: DFBPPR2480 ---- Plant proteins ---- Germin-like protein 8-7
Source.1183: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1
Source.1184: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.1185: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1
Source.1186: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.1187: DFBPPR2485 ---- Plant proteins ---- SKP1-like protein 1
Source.1188: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2
Source.1189: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1
Source.1190: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.1191: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic
Source.1192: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.1193: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic
Source.1194: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.1195: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.1196: DFBPPR2497 ---- Plant proteins ---- Thioredoxin-like protein HCF164, chloroplastic
Source.1197: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20
Source.1198: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.1199: DFBPPR2500 ---- Plant proteins ---- Arabinogalactan peptide 2
Source.1200: DFBPPR2501 ---- Plant proteins ---- Germin-like protein 8-10
Source.1201: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900
Source.1202: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.1203: DFBPPR2504 ---- Plant proteins ---- 14-3-3-like protein GF14-B
Source.1204: DFBPPR2505 ---- Plant proteins ---- Germin-like protein 8-5
Source.1205: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic
Source.1206: DFBPPR2507 ---- Plant proteins ---- Protein YABBY 4
Source.1207: DFBPPR2508 ---- Plant proteins ---- Transcription factor RF2b
Source.1208: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic
Source.1209: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.1210: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13
Source.1211: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1212: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.1213: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.1214: DFBPPR2516 ---- Plant proteins ---- Expansin-B16
Source.1215: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.1216: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.1217: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.1218: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.1219: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.1220: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.1221: DFBPPR2526 ---- Plant proteins ---- Chitinase 10
Source.1222: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.1223: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.1224: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20
Source.1225: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4
Source.1226: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta
Source.1227: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.1228: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c
Source.1229: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.1230: DFBPPR2538 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B5
Source.1231: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.1232: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.1233: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.1234: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta
Source.1235: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1
Source.1236: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.1237: DFBPPR2547 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 3, chloroplastic
Source.1238: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.1239: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a
Source.1240: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.1241: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.1242: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.1243: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.1244: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.1245: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.1246: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic
Source.1247: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4
Source.1248: DFBPPR2562 ---- Plant proteins ---- WUSCHEL-related homeobox 9
Source.1249: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase
Source.1250: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.1251: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.1252: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4
Source.1253: DFBPPR2567 ---- Plant proteins ---- Origin of replication complex subunit 4
Source.1254: DFBPPR2569 ---- Plant proteins ---- MADS-box transcription factor 20
Source.1255: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.1256: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.1257: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.1258: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200
Source.1259: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4
Source.1260: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial
Source.1261: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic
Source.1262: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic
Source.1263: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.1264: DFBPPR2583 ---- Plant proteins ---- Thioredoxin-like 2, chloroplastic
Source.1265: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.1266: DFBPPR2586 ---- Plant proteins ---- Probable protein-S-isoprenylcysteine O-methyltransferase
Source.1267: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.1268: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a
Source.1269: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.1270: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1
Source.1271: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.1272: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.1273: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A
Source.1274: DFBPPR2595 ---- Plant proteins ---- Expansin-B7
Source.1275: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9
Source.1276: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase
Source.1277: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5
Source.1278: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.1279: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5
Source.1280: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1
Source.1281: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.1282: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.1283: DFBPPR2605 ---- Plant proteins ---- Clathrin light chain 2
Source.1284: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.1285: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.1286: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E
Source.1287: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.1288: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2
Source.1289: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57
Source.1290: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.1291: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1
Source.1292: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.1293: DFBPPR2616 ---- Plant proteins ---- Pectinesterase inhibitor 12
Source.1294: DFBPPR2618 ---- Plant proteins ---- Putative eukaryotic initiation factor 4A-2
Source.1295: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.1296: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.1297: DFBPPR2621 ---- Plant proteins ---- Germin-like protein 4-1
Source.1298: DFBPPR2623 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 3
Source.1299: DFBPPR2625 ---- Plant proteins ---- 18.6 kDa class III heat shock protein
Source.1300: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a
Source.1301: DFBPPR2629 ---- Plant proteins ---- Calcineurin B-like protein 1
Source.1302: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34
Source.1303: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.1304: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.1305: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.1306: DFBPPR2636 ---- Plant proteins ---- Expansin-B8
Source.1307: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.1308: DFBPPR2639 ---- Plant proteins ---- Seed allergenic protein RAG2
Source.1309: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.1310: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18
Source.1311: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.1312: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1
Source.1313: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic
Source.1314: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25
Source.1315: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.1316: DFBPPR2648 ---- Plant proteins ---- SKP1-like protein 20
Source.1317: DFBPPR2650 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 2
Source.1318: DFBPPR2651 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL3
Source.1319: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2
Source.1320: DFBPPR2653 ---- Plant proteins ---- Putative germin-like protein 12-4
Source.1321: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.1322: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.1323: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b
Source.1324: DFBPPR2659 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.1325: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.1326: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5
Source.1327: DFBPPR2662 ---- Plant proteins ---- Putative germin-like protein 12-3
Source.1328: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8
Source.1329: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2
Source.1330: DFBPPR2667 ---- Plant proteins ---- Germin-like protein 3-1
Source.1331: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.1332: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.1333: DFBPPR2670 ---- Plant proteins ---- Putative germin-like protein 2-2
Source.1334: DFBPPR2671 ---- Plant proteins ---- Proteasome subunit beta type-2
Source.1335: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein
Source.1336: DFBPPR2673 ---- Plant proteins ---- Expansin-B13
Source.1337: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.1338: DFBPPR2675 ---- Plant proteins ---- Anamorsin homolog 2
Source.1339: DFBPPR2676 ---- Plant proteins ---- Expansin-A11
Source.1340: DFBPPR2678 ---- Plant proteins ---- Thioredoxin-like 1-2, chloroplastic
Source.1341: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.1342: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1
Source.1343: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase
Source.1344: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.1345: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.1346: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.1347: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A
Source.1348: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.1349: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27
Source.1350: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.1351: DFBPPR2698 ---- Plant proteins ---- Proteasome subunit alpha type-6
Source.1352: DFBPPR2699 ---- Plant proteins ---- Expansin-A8
Source.1353: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16
Source.1354: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.1355: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.1356: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.1357: DFBPPR2705 ---- Plant proteins ---- Probable protein phosphatase 2C 72
Source.1358: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.1359: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9
Source.1360: DFBPPR2708 ---- Plant proteins ---- Ras-related protein RGP1
Source.1361: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b
Source.1362: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.1363: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.1364: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.1365: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.1366: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.1367: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20
Source.1368: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B
Source.1369: DFBPPR2724 ---- Plant proteins ---- Putative germin-like protein 8-1
Source.1370: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic
Source.1371: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit
Source.1372: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic
Source.1373: DFBPPR2729 ---- Plant proteins ---- Protein BZR1 homolog 2
Source.1374: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5
Source.1375: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.1376: DFBPPR2732 ---- Plant proteins ---- Small ubiquitin-related modifier 1
Source.1377: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.1378: DFBPPR2736 ---- Plant proteins ---- Ethylene-responsive transcription factor ABI4
Source.1379: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8
Source.1380: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5
Source.1381: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1382: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.1383: DFBPPR2745 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor EL2
Source.1384: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.1385: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7
Source.1386: DFBPPR2748 ---- Plant proteins ---- Secretory carrier-associated membrane protein 6
Source.1387: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.1388: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.1389: DFBPPR2752 ---- Plant proteins ---- Secretory carrier-associated membrane protein 5
Source.1390: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.1391: DFBPPR2754 ---- Plant proteins ---- Adenylate kinase 3
Source.1392: DFBPPR2755 ---- Plant proteins ---- Adenylate kinase 4
Source.1393: DFBPPR2758 ---- Plant proteins ---- Expansin-B17
Source.1394: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9
Source.1395: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.1396: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.1397: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.1398: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.1399: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.1400: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2
Source.1401: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3
Source.1402: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1403: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.1404: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.1405: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.1406: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2
Source.1407: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.1408: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3
Source.1409: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.1410: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2
Source.1411: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2
Source.1412: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.1413: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.1414: DFBPPR2784 ---- Plant proteins ---- Chitinase 11
Source.1415: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.1416: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1417: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.1418: DFBPPR2791 ---- Plant proteins ---- Calcineurin B-like protein 7
Source.1419: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.1420: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1421: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.1422: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.1423: DFBPPR2800 ---- Plant proteins ---- Germin-like protein 8-12
Source.1424: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21
Source.1425: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.1426: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.1427: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.1428: DFBPPR2805 ---- Plant proteins ---- Serine/threonine-protein kinase Nek2
Source.1429: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.1430: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.1431: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1432: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.1433: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.1434: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.1435: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.1436: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.1437: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1
Source.1438: DFBPPR2818 ---- Plant proteins ---- Replication protein A 14 kDa subunit
Source.1439: DFBPPR2819 ---- Plant proteins ---- Squamosa promoter-binding-like protein 4
Source.1440: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.1441: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1
Source.1442: DFBPPR2823 ---- Plant proteins ---- Germin-like protein 8-9
Source.1443: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.1444: DFBPPR2827 ---- Plant proteins ---- Germin-like protein 8-8
Source.1445: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.1446: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2
Source.1447: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.1448: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.1449: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.1450: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.1451: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.1452: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.1453: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.1454: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6
Source.1455: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.1456: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.1457: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.1458: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.1459: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1460: DFBPPR2850 ---- Plant proteins ---- Germin-like protein 8-6
Source.1461: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.1462: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D
Source.1463: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.1464: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9
Source.1465: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.1466: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103
Source.1467: DFBPPR2859 ---- Plant proteins ---- Proton pump-interactor BIP131
Source.1468: DFBPPR2861 ---- Plant proteins ---- Probable aquaporin TIP1-1
Source.1469: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase
Source.1470: DFBPPR2863 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.1471: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.1472: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX
Source.1473: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.1474: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2
Source.1475: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.1476: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.1477: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.1478: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2
Source.1479: DFBPPR2873 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL2
Source.1480: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.1481: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.1482: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.1483: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog
Source.1484: DFBPPR2880 ---- Plant proteins ---- Nuclear cap-binding protein subunit 2
Source.1485: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.1486: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.1487: DFBPPR2883 ---- Plant proteins ---- Expansin-B9
Source.1488: DFBPPR2884 ---- Plant proteins ---- Expansin-B2
Source.1489: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.1490: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32
Source.1491: DFBPPR2888 ---- Plant proteins ---- Expansin-B10
Source.1492: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2
Source.1493: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c
Source.1494: DFBPPR2894 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21A
Source.1495: DFBPPR2895 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21
Source.1496: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.1497: DFBPPR2898 ---- Plant proteins ---- Germin-like protein 12-1
Source.1498: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7
Source.1499: DFBPPR2900 ---- Plant proteins ---- Expansin-A23
Source.1500: DFBPPR2902 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase HRD1
Source.1501: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.1502: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2
Source.1503: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.1504: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.1505: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.1506: DFBPPR2910 ---- Plant proteins ---- Expansin-B5
Source.1507: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.1508: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.1509: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.1510: DFBPPR2914 ---- Plant proteins ---- Glutelin type-D 1
Source.1511: DFBPPR2916 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 1
Source.1512: DFBPPR2917 ---- Plant proteins ---- Two-component response regulator ORR28
Source.1513: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.1514: DFBPPR2920 ---- Plant proteins ---- Putative germin-like protein 2-3
Source.1515: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.1516: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.1517: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.1518: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.1519: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.1520: DFBPPR2928 ---- Plant proteins ---- 18.9 kDa heat shock protein
Source.1521: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4
Source.1522: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14
Source.1523: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.1524: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.1525: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13
Source.1526: DFBPPR2936 ---- Plant proteins ---- Putative germin-like protein 2-1
Source.1527: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.1528: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A
Source.1529: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5
Source.1530: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1
Source.1531: DFBPPR2942 ---- Plant proteins ---- Germin-like protein 12-2
Source.1532: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8
Source.1533: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic
Source.1534: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.1535: DFBPPR2947 ---- Plant proteins ---- Peroxisomal membrane protein 11-5
Source.1536: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic
Source.1537: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1
Source.1538: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1539: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.1540: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40
Source.1541: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.1542: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2
Source.1543: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8
Source.1544: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1
Source.1545: DFBPPR2964 ---- Plant proteins ---- Expansin-A14
Source.1546: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.1547: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7
Source.1548: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.1549: DFBPPR2970 ---- Plant proteins ---- Germin-like protein 1-2
Source.1550: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3
Source.1551: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.1552: DFBPPR2974 ---- Plant proteins ---- Derlin-1
Source.1553: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4
Source.1554: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic
Source.1555: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.1556: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic
Source.1557: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.1558: DFBPPR2982 ---- Plant proteins ---- SKP1-like protein 5
Source.1559: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic
Source.1560: DFBPPR2985 ---- Plant proteins ---- Coatomer subunit delta-3
Source.1561: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic
Source.1562: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog
Source.1563: DFBPPR2992 ---- Plant proteins ---- DnaJ protein ERDJ7
Source.1564: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1
Source.1565: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.1566: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B
Source.1567: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.1568: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.1569: DFBPPR3002 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX20
Source.1570: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13
Source.1571: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a
Source.1572: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.1573: DFBPPR3007 ---- Plant proteins ---- Thioredoxin H2-2
Source.1574: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.1575: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.1576: DFBPPR3011 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG4
Source.1577: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2
Source.1578: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2
Source.1579: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.1580: DFBPPR3017 ---- Plant proteins ---- Expansin-A12
Source.1581: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.1582: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.1583: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.1584: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.1585: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.1586: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3
Source.1587: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1
Source.1588: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.1589: DFBPPR3034 ---- Plant proteins ---- Anamorsin homolog 1
Source.1590: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1
Source.1591: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3
Source.1592: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1
Source.1593: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.1594: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.1595: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic
Source.1596: DFBPPR3044 ---- Plant proteins ---- Thioredoxin-like 4, chloroplastic
Source.1597: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase
Source.1598: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B
Source.1599: DFBPPR3047 ---- Plant proteins ---- Zinc finger protein 36
Source.1600: DFBPPR3048 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL10
Source.1601: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.1602: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2
Source.1603: DFBPPR3051 ---- Plant proteins ---- Protein YABBY 3
Source.1604: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.1605: DFBPPR3054 ---- Plant proteins ---- Pectinesterase inhibitor 8
Source.1606: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.1607: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6
Source.1608: DFBPPR3058 ---- Plant proteins ---- UDP-glucose 4-epimerase 1
Source.1609: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16
Source.1610: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A
Source.1611: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.1612: DFBPPR3063 ---- Plant proteins ---- Profilin-A
Source.1613: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.1614: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial
Source.1615: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.1616: DFBPPR3068 ---- Plant proteins ---- Uroporphyrinogen-III synthase, chloroplastic
Source.1617: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.1618: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial
Source.1619: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.1620: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.1621: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.1622: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.1623: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3
Source.1624: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.1625: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.1626: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.1627: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7
Source.1628: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.1629: DFBPPR3085 ---- Plant proteins ---- Thiamine pyrophosphokinase 3
Source.1630: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.1631: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34
Source.1632: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2
Source.1633: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.1634: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase
Source.1635: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.1636: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.1637: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4
Source.1638: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.1639: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.1640: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.1641: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.1642: DFBPPR3102 ---- Plant proteins ---- Expansin-B18
Source.1643: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.1644: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.1645: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21
Source.1646: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.1647: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1
Source.1648: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28
Source.1649: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial
Source.1650: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.1651: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7
Source.1652: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.1653: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.1654: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.1655: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.1656: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.1657: DFBPPR3130 ---- Plant proteins ---- COP9 signalosome complex subunit 6
Source.1658: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1659: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.1660: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2
Source.1661: DFBPPR3135 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 1
Source.1662: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.1663: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5
Source.1664: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.1665: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.1666: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.1667: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.1668: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3
Source.1669: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B
Source.1670: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.1671: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11
Source.1672: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.1673: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.1674: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2
Source.1675: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic
Source.1676: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3
Source.1677: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.1678: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4
Source.1679: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.1680: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5
Source.1681: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.1682: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.1683: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.1684: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2
Source.1685: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.1686: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.1687: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I
Source.1688: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1
Source.1689: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48
Source.1690: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.1691: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.1692: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1693: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10
Source.1694: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.1695: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300
Source.1696: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27
Source.1697: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.1698: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.1699: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.1700: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3
Source.1701: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1
Source.1702: DFBPPR3198 ---- Plant proteins ---- Probable protein phosphatase 2C 59
Source.1703: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3
Source.1704: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.1705: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3
Source.1706: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.1707: DFBPPR3205 ---- Plant proteins ---- Monothiol glutaredoxin-S3
Source.1708: DFBPPR3206 ---- Plant proteins ---- Expansin-B15
Source.1709: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B
Source.1710: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.1711: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic
Source.1712: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2
Source.1713: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.1714: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.1715: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.1716: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic
Source.1717: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750
Source.1718: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.1719: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4
Source.1720: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1
Source.1721: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1
Source.1722: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.1723: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3
Source.1724: DFBPPR3225 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit M, chloroplastic
Source.1725: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.1726: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain
Source.1727: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1
Source.1728: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37
Source.1729: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.1730: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.1731: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26
Source.1732: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.1733: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.1734: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.1735: DFBPPR3241 ---- Plant proteins ---- Elongation factor 1-delta 2
Source.1736: DFBPPR3242 ---- Plant proteins ---- Peroxisomal membrane protein 11-1
Source.1737: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.1738: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.1739: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.1740: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.1741: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.1742: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.1743: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.1744: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.1745: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.1746: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10
Source.1747: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.1748: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.1749: DFBPPR3257 ---- Plant proteins ---- Ras-related protein RIC2
Source.1750: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3
Source.1751: DFBPPR3263 ---- Plant proteins ---- N-carbamoylputrescine amidase
Source.1752: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.1753: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.1754: DFBPPR3268 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.1755: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.1756: DFBPPR3270 ---- Plant proteins ---- Calmodulin-like protein 1
Source.1757: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein
Source.1758: DFBPPR3273 ---- Plant proteins ---- Dephospho-CoA kinase
Source.1759: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.1760: DFBPPR3277 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor RA16
Source.1761: DFBPPR3278 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 3
Source.1762: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial
Source.1763: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b
Source.1764: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.1765: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.1766: DFBPPR3284 ---- Plant proteins ---- Probable voltage-gated potassium channel subunit beta
Source.1767: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.1768: DFBPPR3286 ---- Plant proteins ---- Expansin-A32
Source.1769: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.1770: DFBPPR3289 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3b
Source.1771: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500
Source.1772: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1
Source.1773: DFBPPR3292 ---- Plant proteins ---- Non-symbiotic hemoglobin 4
Source.1774: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.1775: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.1776: DFBPPR3300 ---- Plant proteins ---- Calcineurin B-like protein 9
Source.1777: DFBPPR3301 ---- Plant proteins ---- 14-3-3-like protein GF14-E
Source.1778: DFBPPR3302 ---- Plant proteins ---- Expansin-A21
Source.1779: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.1780: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.1781: DFBPPR3311 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 2
Source.1782: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1
Source.1783: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1
Source.1784: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.1785: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5
Source.1786: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.1787: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8
Source.1788: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.1789: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.1790: DFBPPR3323 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL7
Source.1791: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3
Source.1792: DFBPPR3326 ---- Plant proteins ---- Thioredoxin H2-1
Source.1793: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9
Source.1794: DFBPPR3328 ---- Plant proteins ---- Putative expansin-A30
Source.1795: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12
Source.1796: DFBPPR3330 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 10
Source.1797: DFBPPR3332 ---- Plant proteins ---- Vacuolar iron transporter homolog 5
Source.1798: DFBPPR3333 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 11
Source.1799: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.1800: DFBPPR3335 ---- Plant proteins ---- Molybdopterin synthase sulfur carrier subunit
Source.1801: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a
Source.1802: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.1803: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8
Source.1804: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.1805: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.1806: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2
Source.1807: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.1808: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.1809: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68
Source.1810: DFBPPR3353 ---- Plant proteins ---- Vacuolar iron transporter homolog 2
Source.1811: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A
Source.1812: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.1813: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6
Source.1814: DFBPPR3357 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein B
Source.1815: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4
Source.1816: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.1817: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.1818: DFBPPR3361 ---- Plant proteins ---- Ras-related protein RIC1
Source.1819: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.1820: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.1821: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.1822: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.1823: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.1824: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.1825: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.1826: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1
Source.1827: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28
Source.1828: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.1829: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.1830: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.1831: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.1832: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.1833: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2
Source.1834: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.1835: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.1836: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.1837: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2
Source.1838: DFBPPR3392 ---- Plant proteins ---- Auxin-responsive protein IAA9
Source.1839: DFBPPR3393 ---- Plant proteins ---- Auxin-responsive protein IAA20
Source.1840: DFBPPR3394 ---- Plant proteins ---- Auxin-responsive protein IAA7
Source.1841: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.1842: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.1843: DFBPPR3397 ---- Plant proteins ---- Probable membrane-associated 30 kDa protein, chloroplastic
Source.1844: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.1845: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.1846: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.1847: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.1848: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2
Source.1849: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1
Source.1850: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9
Source.1851: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5
Source.1852: DFBPPR3411 ---- Plant proteins ---- Auxin-responsive protein IAA15
Source.1853: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2
Source.1854: DFBPPR3414 ---- Plant proteins ---- Seed allergenic protein RA5
Source.1855: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6
Source.1856: DFBPPR3417 ---- Plant proteins ---- Protein CutA 1, chloroplastic
Source.1857: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.1858: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.1859: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.1860: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.1861: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.1862: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.1863: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1
Source.1864: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.1865: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic
Source.1866: DFBPPR3429 ---- Plant proteins ---- Protein BZR1 homolog 3
Source.1867: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2
Source.1868: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3
Source.1869: DFBPPR3434 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.1870: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F
Source.1871: DFBPPR3437 ---- Plant proteins ---- Putative acetyl-coenzyme A carboxylase carboxyl transferase subunit beta-like protein
Source.1872: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.1873: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1
Source.1874: DFBPPR3442 ---- Plant proteins ---- Spermidine synthase 1
Source.1875: DFBPPR3443 ---- Plant proteins ---- Calmodulin-2
Source.1876: DFBPPR3444 ---- Plant proteins ---- Vacuolar iron transporter homolog 3
Source.1877: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.1878: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.1879: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.1880: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.1881: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2
Source.1882: DFBPPR3453 ---- Plant proteins ---- Probable protein phosphatase 2C 44
Source.1883: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.1884: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12
Source.1885: DFBPPR3456 ---- Plant proteins ---- Maturase K
Source.1886: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.1887: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17
Source.1888: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog
Source.1889: DFBPPR3461 ---- Plant proteins ---- 50S ribosomal protein L18, chloroplastic
Source.1890: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1
Source.1891: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.1892: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1
Source.1893: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A
Source.1894: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73
Source.1895: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34
Source.1896: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27
Source.1897: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.1898: DFBPPR3471 ---- Plant proteins ---- Monothiol glutaredoxin-S6
Source.1899: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600
Source.1900: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2
Source.1901: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1
Source.1902: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.1903: DFBPPR3481 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 8
Source.1904: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic
Source.1905: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.1906: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.1907: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B
Source.1908: DFBPPR3490 ---- Plant proteins ---- WUSCHEL-related homeobox 4
Source.1909: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.1910: DFBPPR3492 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 9
Source.1911: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20
Source.1912: DFBPPR3494 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS32
Source.1913: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.1914: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4
Source.1915: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2
Source.1916: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600
Source.1917: DFBPPR3502 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 1
Source.1918: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.1919: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9
Source.1920: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.1921: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.1922: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic
Source.1923: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4
Source.1924: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18
Source.1925: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1
Source.1926: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56
Source.1927: DFBPPR3523 ---- Plant proteins ---- Ubiquitin-like protein ATG12
Source.1928: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4
Source.1929: DFBPPR3525 ---- Plant proteins ---- Outer envelope pore protein 24, chloroplastic
Source.1930: DFBPPR3526 ---- Plant proteins ---- Protein XAP5 CIRCADIAN TIMEKEEPER
Source.1931: DFBPPR3527 ---- Plant proteins ---- Elongation factor 1-delta 1
Source.1932: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2
Source.1933: DFBPPR3530 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL2
Source.1934: DFBPPR3531 ---- Plant proteins ---- Zinc transporter 10
Source.1935: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.1936: DFBPPR3533 ---- Plant proteins ---- Peroxisomal membrane protein 11-4
Source.1937: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial
Source.1938: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.1939: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic
Source.1940: DFBPPR3538 ---- Plant proteins ---- Probable protein phosphatase 2C 7
Source.1941: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2
Source.1942: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.1943: DFBPPR3542 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 2
Source.1944: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3
Source.1945: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.1946: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.1947: DFBPPR3550 ---- Plant proteins ---- NRR repressor homolog 2
Source.1948: DFBPPR3551 ---- Plant proteins ---- Salt stress-induced protein
Source.1949: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8
Source.1950: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic
Source.1951: DFBPPR3557 ---- Plant proteins ---- NRR repressor homolog 3
Source.1952: DFBPPR3558 ---- Plant proteins ---- Probable protein phosphatase 2C 45
Source.1953: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.1954: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.1955: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.1956: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36
Source.1957: DFBPPR3565 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1958: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.1959: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B''
Source.1960: DFBPPR3569 ---- Plant proteins ---- Probable protein phosphatase 2C 58
Source.1961: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.1962: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.1963: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76
Source.1964: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.1965: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3
Source.1966: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5
Source.1967: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.1968: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.1969: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.1970: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.1971: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.1972: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12
Source.1973: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.1974: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2
Source.1975: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.1976: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1
Source.1977: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.1978: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.1979: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3
Source.1980: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.1981: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3
Source.1982: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.1983: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1
Source.1984: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase
Source.1985: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.1986: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6
Source.1987: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.1988: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L
Source.1989: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.1990: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6
Source.1991: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K
Source.1992: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1
Source.1993: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.1994: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1
Source.1995: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.1996: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.1997: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5
Source.1998: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.1999: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.2000: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.2001: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2
Source.2002: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.2003: DFBPPR3639 ---- Plant proteins ---- Calmodulin-3
Source.2004: DFBPPR3640 ---- Plant proteins ---- Dof zinc finger protein 1
Source.2005: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1
Source.2006: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.2007: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.2008: DFBPPR3647 ---- Plant proteins ---- Dof zinc finger protein 2
Source.2009: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.2010: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2
Source.2011: DFBPPR3653 ---- Plant proteins ---- Protein YABBY 7
Source.2012: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.2013: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.2014: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.2015: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.2016: DFBPPR3659 ---- Plant proteins ---- Probable signal peptidase complex subunit 3
Source.2017: DFBPPR3660 ---- Plant proteins ---- Calcineurin B-like protein 5
Source.2018: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9
Source.2019: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3
Source.2020: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J
Source.2021: DFBPPR3664 ---- Plant proteins ---- Calcineurin B-like protein 6
Source.2022: DFBPPR3665 ---- Plant proteins ---- Calcineurin B-like protein 10
Source.2023: DFBPPR3666 ---- Plant proteins ---- Glutelin type-B 5
Source.2024: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.2025: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29
Source.2026: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.2027: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.2028: DFBPPR3674 ---- Plant proteins ---- Putative calmodulin-like protein 2
Source.2029: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.2030: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.2031: DFBPPR3677 ---- Plant proteins ---- Auxin-responsive protein IAA25
Source.2032: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.2033: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.2034: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.2035: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.2036: DFBPPR3687 ---- Plant proteins ---- Two-component response regulator ORR41
Source.2037: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.2038: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.2039: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.2040: DFBPPR3694 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 7
Source.2041: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6
Source.2042: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.2043: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.2044: DFBPPR3700 ---- Plant proteins ---- Protein G1-like3
Source.2045: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.2046: DFBPPR3703 ---- Plant proteins ---- Zinc-finger homeodomain protein 1
Source.2047: DFBPPR3704 ---- Plant proteins ---- Zinc-finger homeodomain protein 2
Source.2048: DFBPPR3705 ---- Plant proteins ---- Protein YABBY 2
Source.2049: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11
Source.2050: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.2051: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15
Source.2052: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.2053: DFBPPR3714 ---- Plant proteins ---- GDT1-like protein 4
Source.2054: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3
Source.2055: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.2056: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.2057: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1
Source.2058: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5
Source.2059: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.2060: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.2061: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.2062: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.2063: DFBPPR3725 ---- Plant proteins ---- 60S ribosomal protein L10a
Source.2064: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2
Source.2065: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1
Source.2066: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic
Source.2067: DFBPPR3732 ---- Plant proteins ---- CASP-like protein 5A1
Source.2068: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8
Source.2069: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3
Source.2070: DFBPPR3737 ---- Plant proteins ---- Probable protein phosphatase 2C 28
Source.2071: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.2072: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900
Source.2073: DFBPPR3741 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.2074: DFBPPR3742 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.2075: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.2076: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2
Source.2077: DFBPPR3747 ---- Plant proteins ---- Cysteine proteinase inhibitor 12
Source.2078: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1
Source.2079: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.2080: DFBPPR3752 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 7
Source.2081: DFBPPR3753 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.2082: DFBPPR3754 ---- Plant proteins ---- Auxin-responsive protein IAA30
Source.2083: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4
Source.2084: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12
Source.2085: DFBPPR3761 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 6
Source.2086: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog
Source.2087: DFBPPR3765 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 1
Source.2088: DFBPPR3767 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 8
Source.2089: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.2090: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.2091: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51
Source.2092: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2
Source.2093: DFBPPR3773 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 3
Source.2094: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.2095: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.2096: DFBPPR3778 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 2
Source.2097: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.2098: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.2099: DFBPPR3781 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 5
Source.2100: DFBPPR3783 ---- Plant proteins ---- Patatin-like protein 2
Source.2101: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.2102: DFBPPR3787 ---- Plant proteins ---- Probable protein phosphatase 2C 55
Source.2103: DFBPPR3789 ---- Plant proteins ---- Succinate dehydrogenase subunit 5, mitochondrial
Source.2104: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1
Source.2105: DFBPPR3793 ---- Plant proteins ---- Coatomer subunit zeta-2
Source.2106: DFBPPR3795 ---- Plant proteins ---- NRR repressor homolog 1
Source.2107: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77
Source.2108: DFBPPR3797 ---- Plant proteins ---- Coatomer subunit zeta-1
Source.2109: DFBPPR3798 ---- Plant proteins ---- Actin-related protein 7
Source.2110: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.2111: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E
Source.2112: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.2113: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.2114: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.2115: DFBPPR3808 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 3, chloroplastic
Source.2116: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.2117: DFBPPR3812 ---- Plant proteins ---- Growth-regulating factor 2
Source.2118: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.2119: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.2120: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2
Source.2121: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.2122: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1
Source.2123: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.2124: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G
Source.2125: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.2126: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.2127: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12
Source.2128: DFBPPR3832 ---- Plant proteins ---- 26.2 kDa heat shock protein, mitochondrial
Source.2129: DFBPPR3834 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS35
Source.2130: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52
Source.2131: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C
Source.2132: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47
Source.2133: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.2134: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2
Source.2135: DFBPPR3842 ---- Plant proteins ---- Probable protein phosphatase 2C 39
Source.2136: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.2137: DFBPPR3844 ---- Plant proteins ---- Probable protein phosphatase 2C 41
Source.2138: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2
Source.2139: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.2140: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78
Source.2141: DFBPPR3849 ---- Plant proteins ---- Auxin-responsive protein IAA13
Source.2142: DFBPPR3850 ---- Plant proteins ---- Probable protein phosphatase 2C 73
Source.2143: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8
Source.2144: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic
Source.2145: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.2146: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66
Source.2147: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57
Source.2148: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.2149: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29
Source.2150: DFBPPR3860 ---- Plant proteins ---- Probable protein phosphatase 2C 62
Source.2151: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1
Source.2152: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1
Source.2153: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic
Source.2154: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.2155: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1
Source.2156: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13
Source.2157: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5
Source.2158: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.2159: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.2160: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.2161: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3
Source.2162: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.2163: DFBPPR3876 ---- Plant proteins ---- Bifunctional nuclease 2
Source.2164: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1
Source.2165: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.2166: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.2167: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20
Source.2168: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.2169: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.2170: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.2171: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.2172: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11
Source.2173: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.2174: DFBPPR3893 ---- Plant proteins ---- Coatomer subunit zeta-3
Source.2175: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2
Source.2176: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.2177: DFBPPR3898 ---- Plant proteins ---- Squamosa promoter-binding-like protein 11
Source.2178: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.2179: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11
Source.2180: DFBPPR3902 ---- Plant proteins ---- Probable serine acetyltransferase 5
Source.2181: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial
Source.2182: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7
Source.2183: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4
Source.2184: DFBPPR3909 ---- Plant proteins ---- LIM domain-containing protein PLIM2b
Source.2185: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.2186: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.2187: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1
Source.2188: DFBPPR3921 ---- Plant proteins ---- Photosystem II reaction center protein M
Source.2189: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.2190: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.2191: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.2192: DFBPPR3927 ---- Plant proteins ---- Basic leucine zipper 2
Source.2193: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.2194: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1
Source.2195: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.2196: DFBPPR3934 ---- Plant proteins ---- Probable calcium-binding protein CML8
Source.2197: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.2198: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14
Source.2199: DFBPPR3938 ---- Plant proteins ---- Calmodulin-like protein 3
Source.2200: DFBPPR3941 ---- Plant proteins ---- KIN17-like protein
Source.2201: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.2202: DFBPPR3943 ---- Plant proteins ---- RNA pseudouridine synthase 7
Source.2203: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.2204: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10
Source.2205: DFBPPR3947 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic
Source.2206: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.2207: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA
Source.2208: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog
Source.2209: DFBPPR3952 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 1
Source.2210: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16
Source.2211: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1
Source.2212: DFBPPR3961 ---- Plant proteins ---- Zinc-finger homeodomain protein 8
Source.2213: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.2214: DFBPPR3964 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 1
Source.2215: DFBPPR3965 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-1, mitochondrial
Source.2216: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.2217: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.2218: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic
Source.2219: DFBPPR3972 ---- Plant proteins ---- Basic leucine zipper 19
Source.2220: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.2221: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.2222: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1
Source.2223: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.2224: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2
Source.2225: DFBPPR3979 ---- Plant proteins ---- Probable uridine nucleosidase 1
Source.2226: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.2227: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.2228: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25
Source.2229: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2
Source.2230: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2
Source.2231: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.2232: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.2233: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500
Source.2234: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27
Source.2235: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.2236: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2
Source.2237: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.2238: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.2239: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.2240: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.2241: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2
Source.2242: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9
Source.2243: DFBPPR4005 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.2244: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7
Source.2245: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.2246: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.2247: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5
Source.2248: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.2249: DFBPPR4014 ---- Plant proteins ---- Probable high-affinity nitrate transporter-activating protein 2.2
Source.2250: DFBPPR4015 ---- Plant proteins ---- GDT1-like protein 3
Source.2251: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic
Source.2252: DFBPPR4017 ---- Plant proteins ---- Protein G1-like4
Source.2253: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.2254: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1
Source.2255: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3
Source.2256: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2
Source.2257: DFBPPR4022 ---- Plant proteins ---- Protein TIFY 11f
Source.2258: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4
Source.2259: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1
Source.2260: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1
Source.2261: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.2262: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.2263: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.2264: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.2265: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog
Source.2266: DFBPPR4033 ---- Plant proteins ---- Urease accessory protein G
Source.2267: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A
Source.2268: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58
Source.2269: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8
Source.2270: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.2271: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.2272: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.2273: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2
Source.2274: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.2275: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6
Source.2276: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69
Source.2277: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta
Source.2278: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.2279: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.2280: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.2281: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.2282: DFBPPR4055 ---- Plant proteins ---- Serpin-ZXB
Source.2283: DFBPPR4056 ---- Plant proteins ---- Probable protein phosphatase 2C 25
Source.2284: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11
Source.2285: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog
Source.2286: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.2287: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1
Source.2288: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog
Source.2289: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C
Source.2290: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.2291: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like
Source.2292: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.2293: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19
Source.2294: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5
Source.2295: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4
Source.2296: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.2297: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.2298: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.2299: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic
Source.2300: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.2301: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B
Source.2302: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8
Source.2303: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8
Source.2304: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.2305: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.2306: DFBPPR4088 ---- Plant proteins ---- Cysteine proteinase inhibitor 10
Source.2307: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.2308: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5
Source.2309: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.2310: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.2311: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.2312: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic
Source.2313: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.2314: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.2315: DFBPPR4101 ---- Plant proteins ---- Succinate dehydrogenase subunit 7, mitochondrial
Source.2316: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3
Source.2317: DFBPPR4104 ---- Plant proteins ---- Casparian strip membrane protein 5
Source.2318: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.2319: DFBPPR4107 ---- Plant proteins ---- Protein PsbN
Source.2320: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2
Source.2321: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2
Source.2322: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43
Source.2323: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.2324: DFBPPR4116 ---- Plant proteins ---- 40S ribosomal protein S4
Source.2325: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2
Source.2326: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33
Source.2327: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1
Source.2328: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.2329: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2
Source.2330: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.2331: DFBPPR4124 ---- Plant proteins ---- Ras-related protein RGP2
Source.2332: DFBPPR4125 ---- Plant proteins ---- Calmodulin-like protein 4
Source.2333: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75
Source.2334: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5
Source.2335: DFBPPR4128 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 2
Source.2336: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.2337: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49
Source.2338: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.2339: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31
Source.2340: DFBPPR4136 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.2341: DFBPPR4137 ---- Plant proteins ---- Casparian strip membrane protein 7
Source.2342: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16
Source.2343: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.2344: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2
Source.2345: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.2346: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.2347: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1
Source.2348: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.2349: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.2350: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6
Source.2351: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1
Source.2352: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1
Source.2353: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.2354: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67
Source.2355: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.2356: DFBPPR4159 ---- Plant proteins ---- Protein YABBY 6
Source.2357: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.2358: DFBPPR4163 ---- Plant proteins ---- Barley B recombinant-like protein A
Source.2359: DFBPPR4164 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 1
Source.2360: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.2361: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.2362: DFBPPR4171 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 4
Source.2363: DFBPPR4174 ---- Plant proteins ---- Mitochondrial intermembrane space import and assembly protein 40 homolog
Source.2364: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.2365: DFBPPR4176 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 3
Source.2366: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.2367: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.2368: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3
Source.2369: DFBPPR4180 ---- Plant proteins ---- Barley B recombinant-like protein B
Source.2370: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.2371: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I
Source.2372: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic
Source.2373: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40
Source.2374: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.2375: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C
Source.2376: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.2377: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH
Source.2378: DFBPPR4192 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic
Source.2379: DFBPPR4193 ---- Plant proteins ---- Peptidyl-tRNA hydrolase, mitochondrial
Source.2380: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.2381: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1
Source.2382: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.2383: DFBPPR4201 ---- Plant proteins ---- Cyclin-D6-1
Source.2384: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.2385: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.2386: DFBPPR4204 ---- Plant proteins ---- CASP-like protein 2B1
Source.2387: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.2388: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.2389: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.2390: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1
Source.2391: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial
Source.2392: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.2393: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1
Source.2394: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.2395: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54
Source.2396: DFBPPR4216 ---- Plant proteins ---- Prolamin PPROL 14P
Source.2397: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.2398: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2
Source.2399: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.2400: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.2401: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22
Source.2402: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.2403: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A
Source.2404: DFBPPR4228 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 2
Source.2405: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic
Source.2406: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1
Source.2407: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4
Source.2408: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.2409: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.2410: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.2411: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1
Source.2412: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H
Source.2413: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.2414: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.2415: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2
Source.2416: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.2417: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.2418: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4
Source.2419: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic
Source.2420: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1
Source.2421: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2
Source.2422: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600
Source.2423: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1
Source.2424: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1
Source.2425: DFBPPR4253 ---- Plant proteins ---- Zinc-finger homeodomain protein 5
Source.2426: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.2427: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.2428: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900
Source.2429: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2
Source.2430: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16
Source.2431: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.2432: DFBPPR4263 ---- Plant proteins ---- Putative protein phosphatase 2C 63
Source.2433: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.2434: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1
Source.2435: DFBPPR4270 ---- Plant proteins ---- CASP-like protein Os03g0196400
Source.2436: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1
Source.2437: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6
Source.2438: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial
Source.2439: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15
Source.2440: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP
Source.2441: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4
Source.2442: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21
Source.2443: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.2444: DFBPPR4284 ---- Plant proteins ---- Protein IN2-1 homolog B
Source.2445: DFBPPR4285 ---- Plant proteins ---- Ribonuclease 3-like protein 1
Source.2446: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.2447: DFBPPR4288 ---- Plant proteins ---- Probable calcium-binding protein CML20
Source.2448: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.2449: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3
Source.2450: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5
Source.2451: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.2452: DFBPPR4297 ---- Plant proteins ---- Protein translation factor SUI1 homolog
Source.2453: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.2454: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like
Source.2455: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10
Source.2456: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B
Source.2457: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1
Source.2458: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28
Source.2459: DFBPPR4310 ---- Plant proteins ---- NAP1-related protein 1
Source.2460: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.2461: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.2462: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1
Source.2463: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.2464: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C
Source.2465: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.2466: DFBPPR4320 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.2467: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1
Source.2468: DFBPPR4324 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.2469: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11
Source.2470: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.2471: DFBPPR4331 ---- Plant proteins ---- 60S ribosomal protein L10-2
Source.2472: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.2473: DFBPPR4333 ---- Plant proteins ---- Putative potassium channel KAT5
Source.2474: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24
Source.2475: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5
Source.2476: DFBPPR4336 ---- Plant proteins ---- Putative cyclin-F3-2
Source.2477: DFBPPR4337 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7 homolog, chloroplastic
Source.2478: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10
Source.2479: DFBPPR4346 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1G
Source.2480: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2
Source.2481: DFBPPR4348 ---- Plant proteins ---- Probable calcium-binding protein CML11
Source.2482: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.2483: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1
Source.2484: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2
Source.2485: DFBPPR4354 ---- Plant proteins ---- Probable calcium-binding protein CML9
Source.2486: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3
Source.2487: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2
Source.2488: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A
Source.2489: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8
Source.2490: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.2491: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.2492: DFBPPR4364 ---- Plant proteins ---- Two-component response regulator ORR42
Source.2493: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.2494: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.2495: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B
Source.2496: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.2497: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.2498: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog
Source.2499: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.2500: DFBPPR4372 ---- Plant proteins ---- NAP1-related protein 2
Source.2501: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4
Source.2502: DFBPPR4376 ---- Plant proteins ---- Probable calcium-binding protein CML13
Source.2503: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.2504: DFBPPR4378 ---- Plant proteins ---- Basic leucine zipper 6
Source.2505: DFBPPR4379 ---- Plant proteins ---- CASP-like protein 1B1
Source.2506: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.2507: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.2508: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.2509: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2
Source.2510: DFBPPR4389 ---- Plant proteins ---- CASP-like protein 5B2
Source.2511: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2
Source.2512: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic
Source.2513: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9
Source.2514: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.2515: DFBPPR4398 ---- Plant proteins ---- 40S ribosomal protein S16
Source.2516: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.2517: DFBPPR4400 ---- Plant proteins ---- Putative calmodulin-like protein 6
Source.2518: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2
Source.2519: DFBPPR4402 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 25
Source.2520: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.2521: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5
Source.2522: DFBPPR4409 ---- Plant proteins ---- 14-3-3-like protein GF14-D
Source.2523: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.2524: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.2525: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6
Source.2526: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.2527: DFBPPR4415 ---- Plant proteins ---- Putative ataxin-3 homolog
Source.2528: DFBPPR4416 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 4
Source.2529: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.2530: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15
Source.2531: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.2532: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.2533: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.2534: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.2535: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9
Source.2536: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic
Source.2537: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog
Source.2538: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.2539: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.2540: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein
Source.2541: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18
Source.2542: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.2543: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.2544: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1
Source.2545: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.2546: DFBPPR4439 ---- Plant proteins ---- Copper transporter 5.1
Source.2547: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.2548: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.2549: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.2550: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.2551: DFBPPR4445 ---- Plant proteins ---- CASP-like protein 4B2
Source.2552: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.2553: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic
Source.2554: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45
Source.2555: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3
Source.2556: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3
Source.2557: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic
Source.2558: DFBPPR4454 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.2559: DFBPPR4455 ---- Plant proteins ---- CASP-like protein 5A2
Source.2560: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13
Source.2561: DFBPPR4457 ---- Plant proteins ---- Probable calcium-binding protein CML28
Source.2562: DFBPPR4458 ---- Plant proteins ---- CASP-like protein 2C2
Source.2563: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1
Source.2564: DFBPPR4461 ---- Plant proteins ---- Probable calcium-binding protein CML18
Source.2565: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.2566: DFBPPR4463 ---- Plant proteins ---- Probable calcium-binding protein CML17
Source.2567: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4
Source.2568: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2
Source.2569: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.2570: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.2571: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15
Source.2572: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.2573: DFBPPR4474 ---- Plant proteins ---- Probable calcium-binding protein CML16
Source.2574: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.2575: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24
Source.2576: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.2577: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.2578: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6
Source.2579: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.2580: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.2581: DFBPPR4482 ---- Plant proteins ---- Probable calcium-binding protein CML30
Source.2582: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.2583: DFBPPR4486 ---- Plant proteins ---- CASP-like protein 4B1
Source.2584: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1
Source.2585: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.2586: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.2587: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.2588: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial
Source.2589: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog
Source.2590: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2
Source.2591: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L
Source.2592: DFBPPR4504 ---- Plant proteins ---- 60S ribosomal protein L10-1
Source.2593: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.2594: DFBPPR4508 ---- Plant proteins ---- Photosystem II stability/assembly factor HCF136, chloroplastic
Source.2595: DFBPPR4509 ---- Plant proteins ---- Putative glycine-rich cell wall structural protein 1
Source.2596: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic
Source.2597: DFBPPR4514 ---- Plant proteins ---- Actin-depolymerizing factor 10
Source.2598: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6
Source.2599: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3
Source.2600: DFBPPR4518 ---- Plant proteins ---- Probable calcium-binding protein CML14
Source.2601: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.2602: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.2603: DFBPPR4522 ---- Plant proteins ---- Probable calcium-binding protein CML25/26
Source.2604: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2
Source.2605: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.2606: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.2607: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6
Source.2608: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.2609: DFBPPR4532 ---- Plant proteins ---- CASP-like protein 1U2
Source.2610: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5
Source.2611: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.2612: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic
Source.2613: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3
Source.2614: DFBPPR4539 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 3
Source.2615: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.2616: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27
Source.2617: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14
Source.2618: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7
Source.2619: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12
Source.2620: DFBPPR4546 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.2621: DFBPPR4547 ---- Plant proteins ---- Probable calcium-binding protein CML31
Source.2622: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog
Source.2623: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.2624: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.2625: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase
Source.2626: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.2627: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.2628: DFBPPR4554 ---- Plant proteins ---- Zinc finger AN1 and C2H2 domain-containing stress-associated protein 16
Source.2629: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.2630: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H
Source.2631: DFBPPR4560 ---- Plant proteins ---- Tubby-like F-box protein 10
Source.2632: DFBPPR4561 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 5
Source.2633: DFBPPR4563 ---- Plant proteins ---- CASP-like protein 4C1
Source.2634: DFBPPR4565 ---- Plant proteins ---- CASP-like protein 5B1
Source.2635: DFBPPR4566 ---- Plant proteins ---- CASP-like protein 5C1
Source.2636: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3
Source.2637: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1
Source.2638: DFBPPR4569 ---- Plant proteins ---- Probable protein ABIL5
Source.2639: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1
Source.2640: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2
Source.2641: DFBPPR4576 ---- Plant proteins ---- Probable calcium-binding protein CML7
Source.2642: DFBPPR4577 ---- Plant proteins ---- Probable calcium-binding protein CML10
Source.2643: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.2644: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32
Source.2645: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3
Source.2646: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.2647: DFBPPR4582 ---- Plant proteins ---- Probable calcium-binding protein CML12
Source.2648: DFBPPR4583 ---- Plant proteins ---- Probable calcium-binding protein CML15
Source.2649: DFBPPR4584 ---- Plant proteins ---- Probable calcium-binding protein CML29
Source.2650: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.2651: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.2652: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.2653: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.2654: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.2655: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21
Source.2656: DFBPPR4595 ---- Plant proteins ---- Tubby-like F-box protein 9
Source.2657: DFBPPR4596 ---- Plant proteins ---- Putative calcium-binding protein CML19
Source.2658: DFBPPR4597 ---- Plant proteins ---- Putative calcium-binding protein CML23
Source.2659: DFBPPR4600 ---- Plant proteins ---- Probable U3 small nucleolar RNA-associated protein 11
Source.2660: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.2661: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2
Source.2662: DFBPPR4604 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 17
Source.2663: DFBPPR4609 ---- Plant proteins ---- BURP domain-containing protein 16
Source.2664: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.2665: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic
Source.2666: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3
Source.2667: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.2668: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3
Source.2669: DFBPPR4623 ---- Plant proteins ---- Actin-depolymerizing factor 11
Source.2670: DFBPPR4625 ---- Plant proteins ---- Actin-depolymerizing factor 2
Source.2671: DFBPPR4628 ---- Plant proteins ---- Probable inactive carboxylesterase Os04g0669700
Source.2672: DFBPPR4631 ---- Plant proteins ---- B3 domain-containing protein Os03g0620500
Source.2673: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.2674: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700
Source.2675: DFBPPR4634 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 9
Source.2676: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43
Source.2677: DFBPPR4636 ---- Plant proteins ---- Putative actin-depolymerizing factor 8
Source.2678: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3
Source.2679: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1
Source.2680: DFBPPR4639 ---- Plant proteins ---- CASP-like protein 4D1
Source.2681: DFBPPR4640 ---- Plant proteins ---- Protein Brevis radix-like 4
Source.2682: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7
Source.2683: DFBPPR4644 ---- Plant proteins ---- Nuclear transport factor 2
Source.2684: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12
Source.2685: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1
Source.2686: DFBPPR4652 ---- Plant proteins ---- Probable protein ABIL1
Source.2687: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7
Source.2688: DFBPPR4654 ---- Plant proteins ---- Cyclin-P3-1
Source.2689: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.2690: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic
Source.2691: DFBPPR4663 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 6
Source.2692: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.2693: DFBPPR4666 ---- Plant proteins ---- Protein IN2-1 homolog A
Source.2694: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62
Source.2695: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1
Source.2696: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.2697: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.2698: DFBPPR4675 ---- Plant proteins ---- Cyclin-P4-1
Source.2699: DFBPPR4676 ---- Plant proteins ---- PP2A regulatory subunit TAP46
Source.2700: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3
Source.2701: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.2702: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.2703: DFBPPR4685 ---- Plant proteins ---- 30S ribosomal protein S31, mitochondrial
Source.2704: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1
Source.2705: DFBPPR4693 ---- Plant proteins ---- Uncharacterized protein ycf68
Source.2706: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B
Source.2707: DFBPPR4696 ---- Plant proteins ---- Uncharacterized protein ycf72
Source.2708: DFBPPR4697 ---- Plant proteins ---- Cyclin-P1-1
Source.2709: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2
Source.2710: DFBPPR4699 ---- Plant proteins ---- Probable GTP-binding protein OBGC2
Source.2711: DFBPPR4702 ---- Plant proteins ---- Uncharacterized protein ycf73
Source.2712: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8
Source.2713: DFBPPR4706 ---- Plant proteins ---- Tubby-like protein 4
Source.2714: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32
Source.2715: DFBPPR4708 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 5
Source.2716: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51
Source.2717: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.2718: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.2719: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11
Source.2720: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.2721: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8
Source.2722: DFBPPR4722 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 10
Source.2723: DFBPPR4723 ---- Plant proteins ---- Zinc finger A20 domain-containing stress-associated protein 18
Source.2724: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.2725: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19
Source.2726: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.2727: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.2728: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.2729: DFBPPR4735 ---- Plant proteins ---- Uncharacterized protein Os08g0218700/LOC_Os08g12160
Source.2730: DFBPPR4736 ---- Plant proteins ---- B3 domain-containing protein Os04g0581400
Source.2731: DFBPPR4737 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 14
Source.2732: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400
Source.2733: DFBPPR4740 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 2
Source.2734: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400
Source.2735: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.2736: DFBPPR4744 ---- Plant proteins ---- BURP domain-containing protein 3
Source.2737: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9
Source.2738: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic
Source.2739: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.2740: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8
Source.2741: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2
Source.2742: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400
Source.2743: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.2744: DFBPPR4757 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 13
Source.2745: DFBPPR4759 ---- Plant proteins ---- 60S ribosomal protein L18a
Source.2746: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21
Source.2747: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35
Source.2748: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1
Source.2749: DFBPPR4764 ---- Plant proteins ---- 14-3-3-like protein GF14-A
Source.2750: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57
Source.2751: DFBPPR4766 ---- Plant proteins ---- 14-3-3-like protein GF14-G
Source.2752: DFBPPR4767 ---- Plant proteins ---- CRS2-like protein, chloroplastic
Source.2753: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700
Source.2754: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1
Source.2755: DFBPPR4774 ---- Plant proteins ---- B3 domain-containing protein Os01g0234100
Source.2756: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.2757: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4
Source.2758: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10
Source.2759: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.2760: DFBPPR4791 ---- Plant proteins ---- B3 domain-containing protein Os02g0683500
Source.2761: DFBPPR4792 ---- Plant proteins ---- B3 domain-containing protein Os03g0212300
Source.2762: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900
Source.2763: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.2764: DFBPPR4797 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 2
Source.2765: DFBPPR4801 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0619850
Source.2766: DFBPPR4805 ---- Plant proteins ---- B3 domain-containing protein Os02g0764100
Source.2767: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800
Source.2768: DFBPPR4807 ---- Plant proteins ---- Protein MEI2-like 6
Source.2769: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2
Source.2770: DFBPPR4809 ---- Plant proteins ---- B3 domain-containing protein Os03g0164300
Source.2771: DFBPPR4812 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 1
Source.2772: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47
Source.2773: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20
Source.2774: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b
Source.2775: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.2776: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500
Source.2777: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000
Source.2778: DFBPPR4832 ---- Plant proteins ---- Protein GOS9
Source.2779: DFBPPR4835 ---- Plant proteins ---- DDRGK domain-containing protein 1
Source.2780: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2
Source.2781: DFBPPR4844 ---- Plant proteins ---- B3 domain-containing protein Os05g0481400
Source.2782: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48
Source.2783: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400
Source.2784: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5
Source.2785: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800
Source.2786: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.2787: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500
Source.2788: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600
Source.2789: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400
Source.2790: DFBPPR4863 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 1
Source.2791: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.2792: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1
Source.2793: DFBPPR4874 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 1
Source.2794: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64
Source.2795: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500
Source.2796: DFBPPR4882 ---- Plant proteins ---- Salt stress root protein RS1
Source.2797: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.2798: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3
Source.2799: DFBPPR4888 ---- Plant proteins ---- bZIP transcription factor RISBZ4
Source.2800: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.2801: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.2802: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.2803: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein
Source.2804: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.2805: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12
Source.2806: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic
Source.2807: DFBPPR4898 ---- Plant proteins ---- Serine racemase
Source.2808: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF
Source.2809: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.2810: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.2811: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5
Source.2812: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase
Source.2813: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3
Source.2814: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1
Source.2815: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.2816: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.2817: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1
Source.2818: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.2819: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2
Source.2820: DFBPPR4915 ---- Plant proteins ---- Chitinase 2
Source.2821: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic
Source.2822: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1
Source.2823: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID
Source.2824: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1
Source.2825: DFBPPR4920 ---- Plant proteins ---- RNA-binding protein Y14A
Source.2826: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.2827: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic
Source.2828: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.2829: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8
Source.2830: DFBPPR4927 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.2831: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.2832: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.2833: DFBPPR4930 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.2834: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.2835: DFBPPR4932 ---- Plant proteins ---- Two-component response regulator ORR30
Source.2836: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7
Source.2837: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2
Source.2838: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.2839: DFBPPR4938 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 2, mitochondrial
Source.2840: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1
Source.2841: DFBPPR4940 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.2842: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.2843: DFBPPR4943 ---- Plant proteins ---- Transcription repressor OFP8
Source.2844: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1
Source.2845: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.2846: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.2847: DFBPPR4947 ---- Plant proteins ---- Putative magnesium transporter MRS2-G
Source.2848: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d
Source.2849: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23
Source.2850: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.2851: DFBPPR4965 ---- Plant proteins ---- Glycinin G1
Source.2852: DFBPPR4966 ---- Plant proteins ---- Glycinin G5
Source.2853: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.2854: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.2855: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.2856: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.2857: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.2858: DFBPPR4973 ---- Plant proteins ---- Glycinin G2
Source.2859: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1
Source.2860: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1
Source.2861: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.2862: DFBPPR4978 ---- Plant proteins ---- 2-hydroxyisoflavanone dehydratase
Source.2863: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.2864: DFBPPR4980 ---- Plant proteins ---- Lactoylglutathione lyase
Source.2865: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1
Source.2866: DFBPPR4984 ---- Plant proteins ---- Histone acetyltransferase TAP1
Source.2867: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1
Source.2868: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.2869: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2870: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.2871: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.2872: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.2873: DFBPPR4992 ---- Plant proteins ---- Glycinin G3
Source.2874: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.2875: DFBPPR4996 ---- Plant proteins ---- Peroxisomal adenine nucleotide carrier 1
Source.2876: DFBPPR4997 ---- Plant proteins ---- P34 probable thiol protease
Source.2877: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial
Source.2878: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.2879: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.2880: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase
Source.2881: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.2882: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.2883: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.2884: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.2885: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.2886: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.2887: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.2888: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.2889: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.2890: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2891: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin
Source.2892: DFBPPR5021 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.2893: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.2894: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.2895: DFBPPR5029 ---- Plant proteins ---- Trypsin inhibitor A
Source.2896: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB
Source.2897: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase
Source.2898: DFBPPR5033 ---- Plant proteins ---- Gamma-glutamyl hydrolase
Source.2899: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.2900: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2
Source.2901: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.2902: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.2903: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2
Source.2904: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.2905: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D
Source.2906: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.2907: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.2908: DFBPPR5045 ---- Plant proteins ---- Leghemoglobin A
Source.2909: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2910: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial
Source.2911: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.2912: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.2913: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.2914: DFBPPR5054 ---- Plant proteins ---- Leghemoglobin C2
Source.2915: DFBPPR5055 ---- Plant proteins ---- TATA-box-binding protein
Source.2916: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.2917: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.2918: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.2919: DFBPPR5061 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2920: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.2921: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2922: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.2923: DFBPPR5066 ---- Plant proteins ---- Leghemoglobin C3
Source.2924: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic
Source.2925: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2926: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.2927: DFBPPR5071 ---- Plant proteins ---- Leghemoglobin C1
Source.2928: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.2929: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2
Source.2930: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.2931: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1
Source.2932: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.2933: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.2934: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.2935: DFBPPR5082 ---- Plant proteins ---- Catalase-4
Source.2936: DFBPPR5084 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.2937: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme
Source.2938: DFBPPR5086 ---- Plant proteins ---- Catalase-3
Source.2939: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2940: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2941: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.2942: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog
Source.2943: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic
Source.2944: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.2945: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.2946: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.2947: DFBPPR5099 ---- Plant proteins ---- Metalloendoproteinase 1
Source.2948: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.2949: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase
Source.2950: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.2951: DFBPPR5105 ---- Plant proteins ---- Probable bifunctional TENA-E protein
Source.2952: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase
Source.2953: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial
Source.2954: DFBPPR5109 ---- Plant proteins ---- Chalcone--flavonone isomerase 1A
Source.2955: DFBPPR5111 ---- Plant proteins ---- Lectin
Source.2956: DFBPPR5114 ---- Plant proteins ---- Proteasome subunit alpha type-6
Source.2957: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic
Source.2958: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2959: DFBPPR5120 ---- Plant proteins ---- 17.3 kDa class I heat shock protein
Source.2960: DFBPPR5121 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic
Source.2961: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2962: DFBPPR5124 ---- Plant proteins ---- Nodulin-26
Source.2963: DFBPPR5126 ---- Plant proteins ---- P24 oleosin isoform A
Source.2964: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.2965: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2
Source.2966: DFBPPR5131 ---- Plant proteins ---- 17.5 kDa class I heat shock protein
Source.2967: DFBPPR5132 ---- Plant proteins ---- 18.5 kDa class I heat shock protein
Source.2968: DFBPPR5135 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-2
Source.2969: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6
Source.2970: DFBPPR5137 ---- Plant proteins ---- Cytochrome f
Source.2971: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.2972: DFBPPR5139 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.2973: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2
Source.2974: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase
Source.2975: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.2976: DFBPPR5143 ---- Plant proteins ---- 17.5 kDa class I heat shock protein
Source.2977: DFBPPR5144 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-A
Source.2978: DFBPPR5146 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.2979: DFBPPR5148 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.2980: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.2981: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2982: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.2983: DFBPPR5157 ---- Plant proteins ---- 17.6 kDa class I heat shock protein
Source.2984: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1
Source.2985: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1
Source.2986: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.2987: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2988: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.2989: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.2990: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1
Source.2991: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.2992: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein
Source.2993: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2994: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.2995: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2996: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6
Source.2997: DFBPPR5177 ---- Plant proteins ---- Anamorsin homolog
Source.2998: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1
Source.2999: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2
Source.3000: DFBPPR5186 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.3001: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.3002: DFBPPR5193 ---- Plant proteins ---- HMG-Y-related protein B
Source.3003: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.3004: DFBPPR5196 ---- Plant proteins ---- Arginase
Source.3005: DFBPPR5197 ---- Plant proteins ---- Nodulin-21
Source.3006: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.3007: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.3008: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.3009: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.3010: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.3011: DFBPPR5205 ---- Plant proteins ---- Urease
Source.3012: DFBPPR5206 ---- Plant proteins ---- Calmodulin-2
Source.3013: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.3014: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.3015: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.3016: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.3017: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.3018: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.3019: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.3020: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic
Source.3021: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3
Source.3022: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase
Source.3023: DFBPPR5226 ---- Plant proteins ---- Chalcone--flavonone isomerase 1
Source.3024: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.3025: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.3026: DFBPPR5231 ---- Plant proteins ---- Casparian strip membrane protein 5
Source.3027: DFBPPR5233 ---- Plant proteins ---- Ras-related protein Rab7
Source.3028: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.3029: DFBPPR5237 ---- Plant proteins ---- Trypsin inhibitor B
Source.3030: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.3031: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.3032: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1
Source.3033: DFBPPR5241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI2
Source.3034: DFBPPR5242 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-1
Source.3035: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.3036: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic
Source.3037: DFBPPR5247 ---- Plant proteins ---- RuBisCO-associated protein
Source.3038: DFBPPR5252 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.3039: DFBPPR5254 ---- Plant proteins ---- Chalcone--flavonone isomerase 3
Source.3040: DFBPPR5255 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-B
Source.3041: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70
Source.3042: DFBPPR5260 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.3043: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.3044: DFBPPR5264 ---- Plant proteins ---- Casparian strip membrane protein 4
Source.3045: DFBPPR5265 ---- Plant proteins ---- Auxin-induced protein AUX22
Source.3046: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.3047: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.3048: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9
Source.3049: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.3050: DFBPPR5278 ---- Plant proteins ---- 40S ribosomal protein SA
Source.3051: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.3052: DFBPPR5281 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.3053: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.3054: DFBPPR5284 ---- Plant proteins ---- CASP-like protein 1E2
Source.3055: DFBPPR5285 ---- Plant proteins ---- CASP-like protein 1E1
Source.3056: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.3057: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.3058: DFBPPR5298 ---- Plant proteins ---- Photosystem II reaction center protein M
Source.3059: DFBPPR5299 ---- Plant proteins ---- Protein PsbN
Source.3060: DFBPPR5301 ---- Plant proteins ---- DNA-binding protein DRP90
Source.3061: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2
Source.3062: DFBPPR5307 ---- Plant proteins ---- 4-coumarate--CoA ligase 1
Source.3063: DFBPPR5308 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein
Source.3064: DFBPPR5309 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.3065: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1
Source.3066: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1
Source.3067: DFBPPR5315 ---- Plant proteins ---- CASP-like protein 1D2
Source.3068: DFBPPR5318 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.3069: DFBPPR5319 ---- Plant proteins ---- Nodulin-22
Source.3070: DFBPPR5320 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.3071: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.3072: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6
Source.3073: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.3074: DFBPPR5324 ---- Plant proteins ---- CASP-like protein 4D1
Source.3075: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.3076: DFBPPR5329 ---- Plant proteins ---- CASP-like protein 2A2
Source.3077: DFBPPR5330 ---- Plant proteins ---- CASP-like protein 2C1
Source.3078: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1
Source.3079: DFBPPR5334 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.3080: DFBPPR5341 ---- Plant proteins ---- HMG1/2-like protein
Source.3081: DFBPPR5345 ---- Plant proteins ---- CASP-like protein 2A1
Source.3082: DFBPPR5347 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.3083: DFBPPR5349 ---- Plant proteins ---- 50S ribosomal protein L32, chloroplastic
Source.3084: DFBPPR5350 ---- Plant proteins ---- Wound-induced protein
Source.3085: DFBPPR5351 ---- Plant proteins ---- 40S ribosomal protein S11
Source.3086: DFBPPR5352 ---- Plant proteins ---- Nodulin-27
Source.3087: DFBPPR5355 ---- Plant proteins ---- Early nodulin-93
Source.3088: DFBPPR5356 ---- Plant proteins ---- Nodulin-23
Source.3089: DFBPPR5358 ---- Plant proteins ---- 14-3-3-like protein D
Source.3090: DFBPPR5360 ---- Plant proteins ---- 14-3-3-like protein A
Source.3091: DFBPPR5361 ---- Plant proteins ---- 14-3-3-like protein B
Source.3092: DFBPPR5362 ---- Plant proteins ---- 14-3-3-like protein C
Source.3093: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.3094: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.3095: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.3096: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.3097: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2
Source.3098: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.3099: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.3100: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.3101: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.3102: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.3103: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.3104: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.3105: DFBPPR5393 ---- Plant proteins ---- Endochitinase A
Source.3106: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.3107: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.3108: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic
Source.3109: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3
Source.3110: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.3111: DFBPPR5401 ---- Plant proteins ---- Profilin-1
Source.3112: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.3113: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1
Source.3114: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.3115: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.3116: DFBPPR5407 ---- Plant proteins ---- Profilin-2
Source.3117: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase
Source.3118: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A
Source.3119: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.3120: DFBPPR5412 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1
Source.3121: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.3122: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.3123: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.3124: DFBPPR5417 ---- Plant proteins ---- Profilin-3
Source.3125: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.3126: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.3127: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.3128: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.3129: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.3130: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit
Source.3131: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2
Source.3132: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic
Source.3133: DFBPPR5432 ---- Plant proteins ---- Expansin-B1
Source.3134: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6
Source.3135: DFBPPR5434 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.3136: DFBPPR5435 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.3137: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.3138: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.3139: DFBPPR5441 ---- Plant proteins ---- Peroxidase 1
Source.3140: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog
Source.3141: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.3142: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.3143: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.3144: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.3145: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial
Source.3146: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.3147: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2
Source.3148: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.3149: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.3150: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2
Source.3151: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial
Source.3152: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.3153: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.3154: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.3155: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3156: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5
Source.3157: DFBPPR5469 ---- Plant proteins ---- Indole-3-glycerol phosphate lyase, chloroplastic
Source.3158: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.3159: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2
Source.3160: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3161: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1
Source.3162: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.3163: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.3164: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.3165: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3
Source.3166: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.3167: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic
Source.3168: DFBPPR5490 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.3169: DFBPPR5494 ---- Plant proteins ---- Peroxidase 70
Source.3170: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.3171: DFBPPR5497 ---- Plant proteins ---- Peroxidase 66
Source.3172: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.3173: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.3174: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.3175: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.3176: DFBPPR5505 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme
Source.3177: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.3178: DFBPPR5508 ---- Plant proteins ---- Expansin-B9
Source.3179: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.3180: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1
Source.3181: DFBPPR5512 ---- Plant proteins ---- Peroxidase 42
Source.3182: DFBPPR5513 ---- Plant proteins ---- Bifunctional TENA2 protein
Source.3183: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.3184: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase
Source.3185: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.3186: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase
Source.3187: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1
Source.3188: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.3189: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.3190: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.3191: DFBPPR5526 ---- Plant proteins ---- Oleosin Zm-II
Source.3192: DFBPPR5529 ---- Plant proteins ---- Aquaporin TIP1-1
Source.3193: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3194: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase
Source.3195: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.3196: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1
Source.3197: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3198: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.3199: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.3200: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.3201: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase
Source.3202: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3
Source.3203: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1
Source.3204: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.3205: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase
Source.3206: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.3207: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.3208: DFBPPR5554 ---- Plant proteins ---- TATA-box-binding protein 1
Source.3209: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10
Source.3210: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic
Source.3211: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.3212: DFBPPR5560 ---- Plant proteins ---- TRIBOA-glucoside O-methyltransferase BX7
Source.3213: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3214: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.3215: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.3216: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.3217: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.3218: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.3219: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.3220: DFBPPR5575 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.3221: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.3222: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.3223: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.3224: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.3225: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.3226: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10
Source.3227: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.3228: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.3229: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain
Source.3230: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.3231: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.3232: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.3233: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6
Source.3234: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3
Source.3235: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.3236: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.3237: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3
Source.3238: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain
Source.3239: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.3240: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.3241: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.3242: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase
Source.3243: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.3244: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.3245: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.3246: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1
Source.3247: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.3248: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.3249: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic
Source.3250: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.3251: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.3252: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9
Source.3253: DFBPPR5626 ---- Plant proteins ---- Single myb histone 6
Source.3254: DFBPPR5627 ---- Plant proteins ---- Expansin-B11
Source.3255: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.3256: DFBPPR5629 ---- Plant proteins ---- TATA-box-binding protein 2
Source.3257: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.3258: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.3259: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.3260: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.3261: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.3262: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.3263: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.3264: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.3265: DFBPPR5650 ---- Plant proteins ---- Enolase 1
Source.3266: DFBPPR5652 ---- Plant proteins ---- Expansin-B10
Source.3267: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.3268: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.3269: DFBPPR5658 ---- Plant proteins ---- Kiwellin-1
Source.3270: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.3271: DFBPPR5661 ---- Plant proteins ---- Albumin b-32
Source.3272: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1
Source.3273: DFBPPR5663 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.3274: DFBPPR5665 ---- Plant proteins ---- Extensin
Source.3275: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic
Source.3276: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3277: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.3278: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.3279: DFBPPR5670 ---- Plant proteins ---- Endochitinase B
Source.3280: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.3281: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6
Source.3282: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.3283: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein
Source.3284: DFBPPR5678 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic
Source.3285: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.3286: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2
Source.3287: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.3288: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.3289: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.3290: DFBPPR5689 ---- Plant proteins ---- Profilin-9
Source.3291: DFBPPR5690 ---- Plant proteins ---- Profilin-7
Source.3292: DFBPPR5691 ---- Plant proteins ---- Profilin-10
Source.3293: DFBPPR5692 ---- Plant proteins ---- Profilin-6
Source.3294: DFBPPR5693 ---- Plant proteins ---- Profilin-11
Source.3295: DFBPPR5694 ---- Plant proteins ---- Profilin-8
Source.3296: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.3297: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3298: DFBPPR5697 ---- Plant proteins ---- Profilin-12
Source.3299: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.3300: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.3301: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.3302: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic
Source.3303: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.3304: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.3305: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.3306: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.3307: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.3308: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.3309: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3
Source.3310: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.3311: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.3312: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.3313: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.3314: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.3315: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.3316: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5
Source.3317: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.3318: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2
Source.3319: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.3320: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase
Source.3321: DFBPPR5728 ---- Plant proteins ---- Calreticulin
Source.3322: DFBPPR5729 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.3323: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3
Source.3324: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.3325: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4
Source.3326: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.3327: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.3328: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.3329: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.3330: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1
Source.3331: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.3332: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.3333: DFBPPR5751 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein 2-B
Source.3334: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.3335: DFBPPR5755 ---- Plant proteins ---- Protein Iojap, chloroplastic
Source.3336: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform
Source.3337: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic
Source.3338: DFBPPR5758 ---- Plant proteins ---- DNA-binding protein MNB1B
Source.3339: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.3340: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.3341: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.3342: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1
Source.3343: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A
Source.3344: DFBPPR5766 ---- Plant proteins ---- MADS-box protein ZMM17
Source.3345: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3346: DFBPPR5769 ---- Plant proteins ---- Ferredoxin-5, chloroplastic
Source.3347: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.3348: DFBPPR5775 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 2
Source.3349: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.3350: DFBPPR5777 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic
Source.3351: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.3352: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.3353: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.3354: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.3355: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.3356: DFBPPR5786 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.3357: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.3358: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele
Source.3359: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.3360: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic
Source.3361: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase
Source.3362: DFBPPR5794 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR2
Source.3363: DFBPPR5795 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.3364: DFBPPR5796 ---- Plant proteins ---- Shugoshin-1
Source.3365: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.3366: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B
Source.3367: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1
Source.3368: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic
Source.3369: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase
Source.3370: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.3371: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase
Source.3372: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.3373: DFBPPR5811 ---- Plant proteins ---- ATP synthase subunit a
Source.3374: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.3375: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3376: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.3377: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.3378: DFBPPR5817 ---- Plant proteins ---- Anamorsin homolog
Source.3379: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2
Source.3380: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic
Source.3381: DFBPPR5820 ---- Plant proteins ---- Protein EGG APPARATUS-1
Source.3382: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic
Source.3383: DFBPPR5822 ---- Plant proteins ---- Elongation factor 1-alpha
Source.3384: DFBPPR5823 ---- Plant proteins ---- Regulatory protein opaque-2
Source.3385: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.3386: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.3387: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.3388: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.3389: DFBPPR5830 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.3390: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.3391: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.3392: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4
Source.3393: DFBPPR5838 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.3394: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19
Source.3395: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3
Source.3396: DFBPPR5845 ---- Plant proteins ---- 14-3-3-like protein GF14-12
Source.3397: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase
Source.3398: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.3399: DFBPPR5851 ---- Plant proteins ---- 22 kDa alpha-zein 4
Source.3400: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.3401: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.3402: DFBPPR5855 ---- Plant proteins ---- 14-3-3-like protein GF14-6
Source.3403: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.3404: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3405: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase
Source.3406: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.3407: DFBPPR5864 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.3408: DFBPPR5866 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.3409: DFBPPR5867 ---- Plant proteins ---- Eukaryotic translation initiation factor 5
Source.3410: DFBPPR5868 ---- Plant proteins ---- 22 kDa alpha-zein 16
Source.3411: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.3412: DFBPPR5871 ---- Plant proteins ---- Cell number regulator 2
Source.3413: DFBPPR5872 ---- Plant proteins ---- 50S ribosomal protein L29, chloroplastic
Source.3414: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.3415: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.3416: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1
Source.3417: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.3418: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.3419: DFBPPR5885 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.3420: DFBPPR5888 ---- Plant proteins ---- 17.0 kDa class II heat shock protein
Source.3421: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1
Source.3422: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL
Source.3423: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.3424: DFBPPR5896 ---- Plant proteins ---- 50 kDa gamma-zein
Source.3425: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.3426: DFBPPR5898 ---- Plant proteins ---- ATP synthase protein MI25
Source.3427: DFBPPR5899 ---- Plant proteins ---- Ras-related protein Rab-2-B
Source.3428: DFBPPR5901 ---- Plant proteins ---- GTP-binding protein YPTM1
Source.3429: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.3430: DFBPPR5903 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.3431: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.3432: DFBPPR5906 ---- Plant proteins ---- Ras-related protein Rab-2-A
Source.3433: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.3434: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1
Source.3435: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.3436: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2
Source.3437: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.3438: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2
Source.3439: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3
Source.3440: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4
Source.3441: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1
Source.3442: DFBPPR5922 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.3443: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4
Source.3444: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.3445: DFBPPR5927 ---- Plant proteins ---- Aquaporin SIP2-1
Source.3446: DFBPPR5931 ---- Plant proteins ---- Glycine-rich RNA-binding, abscisic acid-inducible protein
Source.3447: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2
Source.3448: DFBPPR5934 ---- Plant proteins ---- Aquaporin NIP2-1
Source.3449: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.3450: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.3451: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic
Source.3452: DFBPPR5940 ---- Plant proteins ---- Soluble inorganic pyrophosphatase
Source.3453: DFBPPR5942 ---- Plant proteins ---- GTP-binding protein YPTM2
Source.3454: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3
Source.3455: DFBPPR5945 ---- Plant proteins ---- Calmodulin
Source.3456: DFBPPR5946 ---- Plant proteins ---- Maturase K
Source.3457: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2
Source.3458: DFBPPR5950 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3459: DFBPPR5953 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.3460: DFBPPR5954 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.3461: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2
Source.3462: DFBPPR5957 ---- Plant proteins ---- Protein FLOURY 2
Source.3463: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.3464: DFBPPR5964 ---- Plant proteins ---- IN2-2 protein
Source.3465: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2
Source.3466: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.3467: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6
Source.3468: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.3469: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.3470: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.3471: DFBPPR5981 ---- Plant proteins ---- 17.8 kDa class II heat shock protein
Source.3472: DFBPPR5982 ---- Plant proteins ---- Aquaporin TIP5-1
Source.3473: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7
Source.3474: DFBPPR5987 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic
Source.3475: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2
Source.3476: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1
Source.3477: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1
Source.3478: DFBPPR5994 ---- Plant proteins ---- 17.5 kDa class II heat shock protein
Source.3479: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2
Source.3480: DFBPPR5999 ---- Plant proteins ---- Aquaporin NIP1-1
Source.3481: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2
Source.3482: DFBPPR6003 ---- Plant proteins ---- Aquaporin SIP1-1
Source.3483: DFBPPR6006 ---- Plant proteins ---- Protein IN2-1
Source.3484: DFBPPR6007 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.3485: DFBPPR6009 ---- Plant proteins ---- CASP-like protein 5C1
Source.3486: DFBPPR6011 ---- Plant proteins ---- Photosystem I reaction center subunit III
Source.3487: DFBPPR6014 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.3488: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.3489: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.3490: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.3491: DFBPPR6019 ---- Plant proteins ---- Inactive beta selinene synthase
Source.3492: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3
Source.3493: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.3494: DFBPPR6025 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.3495: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.3496: DFBPPR6029 ---- Plant proteins ---- Zein-alpha PMS2
Source.3497: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.3498: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b
Source.3499: DFBPPR6034 ---- Plant proteins ---- Photosystem II reaction center protein M
Source.3500: DFBPPR6039 ---- Plant proteins ---- Protein PsbN
Source.3501: DFBPPR6041 ---- Plant proteins ---- 22 kDa alpha-zein 14
Source.3502: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1
Source.3503: DFBPPR6044 ---- Plant proteins ---- 40S ribosomal protein S4
Source.3504: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.3505: DFBPPR6047 ---- Plant proteins ---- CASP-like protein 1D1
Source.3506: DFBPPR6048 ---- Plant proteins ---- CASP-like protein 5B1
Source.3507: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1
Source.3508: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3
Source.3509: DFBPPR6054 ---- Plant proteins ---- CASP-like protein 5A3
Source.3510: DFBPPR6055 ---- Plant proteins ---- 14 kDa zinc-binding protein
Source.3511: DFBPPR6057 ---- Plant proteins ---- Zein-alpha PMS1
Source.3512: DFBPPR6058 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.3513: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.3514: DFBPPR6065 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.3515: DFBPPR6066 ---- Plant proteins ---- Protein translation factor SUI1 homolog
Source.3516: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.3517: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2
Source.3518: DFBPPR6072 ---- Plant proteins ---- CASP-like protein 5A2
Source.3519: DFBPPR6075 ---- Plant proteins ---- MFS18 protein
Source.3520: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.3521: DFBPPR6080 ---- Plant proteins ---- Zein-alpha 19A2
Source.3522: DFBPPR6082 ---- Plant proteins ---- Zein-alpha 19D1
Source.3523: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1
Source.3524: DFBPPR6085 ---- Plant proteins ---- Zein-alpha A30
Source.3525: DFBPPR6088 ---- Plant proteins ---- Zein-alpha ZG99
Source.3526: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2
Source.3527: DFBPPR6098 ---- Plant proteins ---- CASP-like protein 5A1
Source.3528: DFBPPR6099 ---- Plant proteins ---- CASP-like protein 16
Source.3529: DFBPPR6100 ---- Plant proteins ---- CASP-like protein 5B2
Source.3530: DFBPPR6103 ---- Plant proteins ---- 60S ribosomal protein L10
Source.3531: DFBPPR6105 ---- Plant proteins ---- CASP-like protein 2U1
Source.3532: DFBPPR6106 ---- Plant proteins ---- Cell number regulator 4
Source.3533: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.3534: DFBPPR6110 ---- Plant proteins ---- Zein-alpha Z4
Source.3535: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1
Source.3536: DFBPPR6113 ---- Plant proteins ---- CASP-like protein 2C4
Source.3537: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.3538: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.3539: DFBPPR6120 ---- Plant proteins ---- 40S ribosomal protein S11
Source.3540: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.3541: DFBPPR6125 ---- Plant proteins ---- Cell number regulator 3
Source.3542: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A
Source.3543: DFBPPR6127 ---- Plant proteins ---- 22 kDa alpha-zein 14
Source.3544: DFBPPR6128 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.3545: DFBPPR6131 ---- Plant proteins ---- Zein-alpha B49
Source.3546: DFBPPR6139 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 3
Source.3547: DFBPPR6140 ---- Plant proteins ---- Uncharacterized protein ycf72
Source.3548: DFBPPR6149 ---- Plant proteins ---- 60S ribosomal protein L17
Source.3549: DFBPPR6151 ---- Plant proteins ---- Uncharacterized protein ycf68
Source.3550: DFBPPR6153 ---- Plant proteins ---- Ninja-family protein 8
Source.3551: DFBPPR6154 ---- Plant proteins ---- Ninja-family protein 7
Source.3552: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1
Source.3553: DFBPPR6160 ---- Plant proteins ---- Ninja-family protein 2
Source.3554: DFBPPR6161 ---- Plant proteins ---- Ninja-family protein 4
Source.3555: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.3556: DFBPPR6163 ---- Plant proteins ---- Ninja-family protein 3
Source.3557: DFBPPR6165 ---- Plant proteins ---- Uncharacterized 33.9 kDa protein in mitochondrial linear 2.3 KB plasmid
Source.3558: DFBPPR6170 ---- Plant proteins ---- Uncharacterized 29 kDa protein in mitochondrial S-1 DNA
Source.3559: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA
Source.3560: DFBPPR6175 ---- Plant proteins ---- 14-3-3-like protein
Source.3561: DFBPPR6179 ---- Plant proteins ---- Unknown protein from spot 75 of 2D-PAGE of etiolated coleoptile
Source.3562: DFBPPR6193 ---- Plant proteins ---- Unknown protein from spot 77 of 2D-PAGE of etiolated coleoptile
Source.3563: DFBPPR6202 ---- Plant proteins ---- Unknown protein from spot 308 of 2D-PAGE of etiolated coleoptile
Source.3564: DFBPPR6203 ---- Plant proteins ---- Unknown protein from spot 984 of 2D-PAGE of etiolated coleoptile
Source.3565: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2
Source.3566: DFBPPR6210 ---- Plant proteins ---- Cysteine synthase
Source.3567: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.3568: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.3569: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic
Source.3570: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic
Source.3571: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.3572: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.3573: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.3574: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.3575: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1
Source.3576: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.3577: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.3578: DFBPPR6228 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.3579: DFBPPR6231 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.3580: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.3581: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3582: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.3583: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.3584: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic
Source.3585: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.3586: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1
Source.3587: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.3588: DFBPPR6241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 1 protein
Source.3589: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.3590: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic
Source.3591: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.3592: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.3593: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.3594: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.3595: DFBPPR6252 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.3596: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.3597: DFBPPR6255 ---- Plant proteins ---- Outer envelope pore protein 24, chloroplastic
Source.3598: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96
Source.3599: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic
Source.3600: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.3601: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.3602: DFBPPR6262 ---- Plant proteins ---- Nodule lectin
Source.3603: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.3604: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.3605: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.3606: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1
Source.3607: DFBPPR6273 ---- Plant proteins ---- Cell division control protein 2 homolog 1
Source.3608: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3609: DFBPPR6275 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.3610: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic
Source.3611: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.3612: DFBPPR6280 ---- Plant proteins ---- Nucleoside diphosphate kinase 2, chloroplastic
Source.3613: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.3614: DFBPPR6282 ---- Plant proteins ---- Rhicadhesin receptor
Source.3615: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.3616: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.3617: DFBPPR6286 ---- Plant proteins ---- Endochitinase A2
Source.3618: DFBPPR6287 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 2 protein
Source.3619: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64
Source.3620: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.3621: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic
Source.3622: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic
Source.3623: DFBPPR6295 ---- Plant proteins ---- Outer envelope pore protein 37, chloroplastic
Source.3624: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.3625: DFBPPR6297 ---- Plant proteins ---- Aminomethyltransferase, mitochondrial
Source.3626: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.3627: DFBPPR6300 ---- Plant proteins ---- Strigolactone esterase RMS3
Source.3628: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.3629: DFBPPR6304 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.3630: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3631: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.3632: DFBPPR6310 ---- Plant proteins ---- Catalase
Source.3633: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.3634: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.3635: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.3636: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic
Source.3637: DFBPPR6317 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 2
Source.3638: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.3639: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.3640: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH
Source.3641: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2
Source.3642: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase
Source.3643: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.3644: DFBPPR6331 ---- Plant proteins ---- Rac-like GTP-binding protein RHO1
Source.3645: DFBPPR6332 ---- Plant proteins ---- Nucleoside diphosphate kinase 1
Source.3646: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.3647: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.3648: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.3649: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3650: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5
Source.3651: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.3652: DFBPPR6346 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.3653: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.3654: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.3655: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.3656: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase
Source.3657: DFBPPR6351 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic
Source.3658: DFBPPR6352 ---- Plant proteins ---- Protein TIC 22, chloroplastic
Source.3659: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.3660: DFBPPR6355 ---- Plant proteins ---- Endochitinase
Source.3661: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.3662: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.3663: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.3664: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1
Source.3665: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.3666: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic
Source.3667: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.3668: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic
Source.3669: DFBPPR6368 ---- Plant proteins ---- Provicilin
Source.3670: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.3671: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.3672: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.3673: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic
Source.3674: DFBPPR6374 ---- Plant proteins ---- 18.1 kDa class I heat shock protein
Source.3675: DFBPPR6377 ---- Plant proteins ---- Lectin
Source.3676: DFBPPR6380 ---- Plant proteins ---- Legumin A
Source.3677: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.3678: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.3679: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.3680: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.3681: DFBPPR6391 ---- Plant proteins ---- Cytochrome b6
Source.3682: DFBPPR6392 ---- Plant proteins ---- Cytochrome f
Source.3683: DFBPPR6393 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.3684: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3
Source.3685: DFBPPR6397 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.3686: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3687: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.3688: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase
Source.3689: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.3690: DFBPPR6406 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase
Source.3691: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.3692: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3693: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.3694: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic
Source.3695: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.3696: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.3697: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.3698: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.3699: DFBPPR6418 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.3700: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.3701: DFBPPR6424 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.3702: DFBPPR6425 ---- Plant proteins ---- Legumin A2
Source.3703: DFBPPR6428 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase, chloroplastic
Source.3704: DFBPPR6430 ---- Plant proteins ---- Legumin J
Source.3705: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha
Source.3706: DFBPPR6443 ---- Plant proteins ---- Disease resistance response protein 206
Source.3707: DFBPPR6444 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.3708: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.3709: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.3710: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.3711: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.3712: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.3713: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.3714: DFBPPR6453 ---- Plant proteins ---- Convicilin
Source.3715: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.3716: DFBPPR6455 ---- Plant proteins ---- Legumin K
Source.3717: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase
Source.3718: DFBPPR6458 ---- Plant proteins ---- Convicilin
Source.3719: DFBPPR6459 ---- Plant proteins ---- Legumin B
Source.3720: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.3721: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA
Source.3722: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.3723: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase
Source.3724: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2
Source.3725: DFBPPR6468 ---- Plant proteins ---- Spermidine synthase 1
Source.3726: DFBPPR6469 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.3727: DFBPPR6470 ---- Plant proteins ---- Vicilin
Source.3728: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.3729: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic
Source.3730: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a
Source.3731: DFBPPR6477 ---- Plant proteins ---- 50S ribosomal protein L15, chloroplastic
Source.3732: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.3733: DFBPPR6479 ---- Plant proteins ---- Non-functional protein STAY-GREEN, chloroplastic
Source.3734: DFBPPR6481 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.3735: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.3736: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.3737: DFBPPR6486 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 1
Source.3738: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.3739: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein
Source.3740: DFBPPR6492 ---- Plant proteins ---- Phospholipid hydroperoxide glutathione peroxidase, chloroplastic
Source.3741: DFBPPR6499 ---- Plant proteins ---- Provicilin
Source.3742: DFBPPR6502 ---- Plant proteins ---- Early light-induced protein, chloroplastic
Source.3743: DFBPPR6504 ---- Plant proteins ---- Cysteine proteinase 15A
Source.3744: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.3745: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.3746: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.3747: DFBPPR6523 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.3748: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.3749: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.3750: DFBPPR6526 ---- Plant proteins ---- Albumin-2
Source.3751: DFBPPR6527 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.3752: DFBPPR6530 ---- Plant proteins ---- Photosystem II reaction center protein M
Source.3753: DFBPPR6531 ---- Plant proteins ---- 2-dehydro-3-deoxyphosphooctonate aldolase
Source.3754: DFBPPR6537 ---- Plant proteins ---- Protein PsbN
Source.3755: DFBPPR6541 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.3756: DFBPPR6542 ---- Plant proteins ---- Maturase K
Source.3757: DFBPPR6547 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.3758: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3759: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3760: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial
Source.3761: DFBPPR6560 ---- Plant proteins ---- 60S ribosomal protein L27
Source.3762: DFBPPR6561 ---- Plant proteins ---- Blue copper protein
Source.3763: DFBPPR6566 ---- Plant proteins ---- ABA-responsive protein ABR17
Source.3764: DFBPPR6567 ---- Plant proteins ---- ABA-responsive protein ABR17
Source.3765: DFBPPR6583 ---- Plant proteins ---- Organ-specific protein P4
Source.3766: DFBPPR6584 ---- Plant proteins ---- Organ-specific protein S2
Source.3767: DFBPPR6586 ---- Plant proteins ---- 60S ribosomal protein L34
Source.3768: DFBPPR6601 ---- Plant proteins ---- Unknown protein from spot 104 of 2D-PAGE of thylakoid
Source.3769: DFBPPR6611 ---- Plant proteins ---- 14-3-3-like protein
Source.3770: DFBPPR6613 ---- Plant proteins ---- Ras-related protein Rab7
Source.3771: DFBPPR6614 ---- Plant proteins ---- Early nodulin-75
Source.3772: DFBPPR6617 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.3773: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3774: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.3775: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.3776: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.3777: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.3778: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.3779: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.3780: DFBPPR6635 ---- Plant proteins ---- Wheatwin-1
Source.3781: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.3782: DFBPPR6639 ---- Plant proteins ---- Puroindoline-A
Source.3783: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.3784: DFBPPR6642 ---- Plant proteins ---- Peroxidase
Source.3785: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D
Source.3786: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.3787: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.3788: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase
Source.3789: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.3790: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.3791: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase
Source.3792: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic
Source.3793: DFBPPR6655 ---- Plant proteins ---- Agglutinin isolectin 1
Source.3794: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.3795: DFBPPR6657 ---- Plant proteins ---- Agglutinin isolectin 2
Source.3796: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.3797: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.3798: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.3799: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.3800: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic
Source.3801: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.3802: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19
Source.3803: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.3804: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B
Source.3805: DFBPPR6679 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.3806: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A
Source.3807: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3
Source.3808: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10
Source.3809: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.3810: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.3811: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic
Source.3812: DFBPPR6694 ---- Plant proteins ---- TATA-box-binding protein 1
Source.3813: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.3814: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3815: DFBPPR6699 ---- Plant proteins ---- TATA-box-binding protein 2
Source.3816: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein
Source.3817: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.3818: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.3819: DFBPPR6703 ---- Plant proteins ---- Wheatwin-2
Source.3820: DFBPPR6705 ---- Plant proteins ---- Calmodulin
Source.3821: DFBPPR6706 ---- Plant proteins ---- Adenine phosphoribosyltransferase 1
Source.3822: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1
Source.3823: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.3824: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.3825: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase
Source.3826: DFBPPR6717 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM3
Source.3827: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.3828: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.3829: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.3830: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.3831: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3832: DFBPPR6735 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.3833: DFBPPR6736 ---- Plant proteins ---- ATP-dependent 6-phosphofructokinase
Source.3834: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53
Source.3835: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase
Source.3836: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.3837: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.3838: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.3839: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.3840: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.3841: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.3842: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.3843: DFBPPR6749 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic
Source.3844: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic
Source.3845: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.3846: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase
Source.3847: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.3848: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.3849: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.3850: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase
Source.3851: DFBPPR6762 ---- Plant proteins ---- Nuclear ribonuclease Z
Source.3852: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.3853: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.3854: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.3855: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1
Source.3856: DFBPPR6769 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1
Source.3857: DFBPPR6771 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic
Source.3858: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3859: DFBPPR6773 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2
Source.3860: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3861: DFBPPR6776 ---- Plant proteins ---- Alpha-amylase inhibitor WDAI-3
Source.3862: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6
Source.3863: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.3864: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A
Source.3865: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.3866: DFBPPR6786 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.3867: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3868: DFBPPR6793 ---- Plant proteins ---- Chymotrypsin inhibitor WCI
Source.3869: DFBPPR6794 ---- Plant proteins ---- Elongation factor 1-alpha
Source.3870: DFBPPR6795 ---- Plant proteins ---- Elongation factor 1-beta
Source.3871: DFBPPR6796 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.3872: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B
Source.3873: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.3874: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B
Source.3875: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38)
Source.3876: DFBPPR6801 ---- Plant proteins ---- Peroxidase
Source.3877: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic
Source.3878: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic
Source.3879: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.3880: DFBPPR6805 ---- Plant proteins ---- Cytochrome f
Source.3881: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.3882: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.3883: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3884: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.3885: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.3886: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A
Source.3887: DFBPPR6819 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.3888: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C
Source.3889: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3890: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.3891: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3892: DFBPPR6834 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain clone 512
Source.3893: DFBPPR6835 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 1, chloroplastic
Source.3894: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3895: DFBPPR6841 ---- Plant proteins ---- Glutathione S-transferase
Source.3896: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.3897: DFBPPR6843 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.3898: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.3899: DFBPPR6847 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.3900: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.3901: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.3902: DFBPPR6856 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 3, chloroplastic
Source.3903: DFBPPR6857 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 2, chloroplastic
Source.3904: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.3905: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.3906: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1
Source.3907: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3908: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.3909: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.3910: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3911: DFBPPR6881 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.3912: DFBPPR6882 ---- Plant proteins ---- Maturase K
Source.3913: DFBPPR6884 ---- Plant proteins ---- Endogenous alpha-amylase/subtilisin inhibitor
Source.3914: DFBPPR6888 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3915: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.3916: DFBPPR6894 ---- Plant proteins ---- Ribosomal protein S7, mitochondrial
Source.3917: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1
Source.3918: DFBPPR6903 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic
Source.3919: DFBPPR6906 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.3920: DFBPPR6918 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.3921: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.3922: DFBPPR6922 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.3923: DFBPPR6923 ---- Plant proteins ---- Avenin-like a1
Source.3924: DFBPPR6926 ---- Plant proteins ---- Photosystem II reaction center protein M
Source.3925: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.3926: DFBPPR6929 ---- Plant proteins ---- Protein PsbN
Source.3927: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin
Source.3928: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5
Source.3929: DFBPPR6951 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.3930: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.3931: DFBPPR6958 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.3932: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2
Source.3933: DFBPPR6961 ---- Plant proteins ---- Avenin-like a2
Source.3934: DFBPPR6964 ---- Plant proteins ---- Avenin-like a3
Source.3935: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6
Source.3936: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7
Source.3937: DFBPPR6971 ---- Plant proteins ---- Avenin-like a7
Source.3938: DFBPPR6973 ---- Plant proteins ---- Avenin-like a6
Source.3939: DFBPPR6980 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.3940: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4
Source.3941: DFBPPR6986 ---- Plant proteins ---- Avenin-like b11
Source.3942: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1
Source.3943: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10
Source.3944: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9
Source.3945: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8
Source.3946: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3
Source.3947: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2
Source.3948: DFBPPR6993 ---- Plant proteins ---- Avenin-like b3
Source.3949: DFBPPR6995 ---- Plant proteins ---- HMG1/2-like protein
Source.3950: DFBPPR6998 ---- Plant proteins ---- Trypsin/alpha-amylase inhibitor CMX1/CMX3
Source.3951: DFBPPR7000 ---- Plant proteins ---- Trypsin/alpha-amylase inhibitor CMX2
Source.3952: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant
Source.3953: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.3954: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.3955: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.3956: DFBPPR7013 ---- Plant proteins ---- Protein MLO
Source.3957: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.3958: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.3959: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic
Source.3960: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase
Source.3961: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.3962: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.3963: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1
Source.3964: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic
Source.3965: DFBPPR7028 ---- Plant proteins ---- Agmatine coumaroyltransferase-1
Source.3966: DFBPPR7029 ---- Plant proteins ---- Trypsin inhibitor CMe
Source.3967: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.3968: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.3969: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic
Source.3970: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3971: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7
Source.3972: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.3973: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.3974: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic
Source.3975: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII
Source.3976: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd
Source.3977: DFBPPR7047 ---- Plant proteins ---- Hordoindoline-A
Source.3978: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase
Source.3979: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.3980: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.3981: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.3982: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3
Source.3983: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.3984: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3985: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.3986: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3987: DFBPPR7063 ---- Plant proteins ---- Glycine-rich RNA-binding protein blt801
Source.3988: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.3989: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3990: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.3991: DFBPPR7068 ---- Plant proteins ---- Peroxidase 2
Source.3992: DFBPPR7070 ---- Plant proteins ---- Red chlorophyll catabolite reductase
Source.3993: DFBPPR7071 ---- Plant proteins ---- Serpin-Z4
Source.3994: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase
Source.3995: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic
Source.3996: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.3997: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.3998: DFBPPR7084 ---- Plant proteins ---- 26 kDa endochitinase 2
Source.3999: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.4000: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.4001: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.4002: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.4003: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic
Source.4004: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.4005: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.4006: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.4007: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4
Source.4008: DFBPPR7098 ---- Plant proteins ---- Acyl carrier protein 2, chloroplastic
Source.4009: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.4010: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2
Source.4011: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.4012: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.4013: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.4014: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.4015: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.4016: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.4017: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4018: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6
Source.4019: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.4020: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.4021: DFBPPR7112 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.4022: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.4023: DFBPPR7114 ---- Plant proteins ---- Acyl carrier protein 3, chloroplastic
Source.4024: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.4025: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.4026: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.4027: DFBPPR7120 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.4028: DFBPPR7121 ---- Plant proteins ---- 26 kDa endochitinase 1
Source.4029: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.4030: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2
Source.4031: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1
Source.4032: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2
Source.4033: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.4034: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A
Source.4035: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3
Source.4036: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.4037: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.4038: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A
Source.4039: DFBPPR7144 ---- Plant proteins ---- L-lactate dehydrogenase B
Source.4040: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.4041: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX
Source.4042: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.4043: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.4044: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.4045: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.4046: DFBPPR7152 ---- Plant proteins ---- ATP synthase subunit c, chloroplastic
Source.4047: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3
Source.4048: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9
Source.4049: DFBPPR7155 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.4050: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.4051: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8
Source.4052: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase
Source.4053: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase
Source.4054: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic
Source.4055: DFBPPR7166 ---- Plant proteins ---- Serine carboxypeptidase II-2
Source.4056: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.4057: DFBPPR7170 ---- Plant proteins ---- Maturase K
Source.4058: DFBPPR7171 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.4059: DFBPPR7172 ---- Plant proteins ---- Barwin
Source.4060: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.4061: DFBPPR7178 ---- Plant proteins ---- Elongation factor 1-alpha
Source.4062: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.4063: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1
Source.4064: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.4065: DFBPPR7184 ---- Plant proteins ---- Root-specific lectin
Source.4066: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.4067: DFBPPR7186 ---- Plant proteins ---- Photosystem I reaction center subunit III, chloroplastic
Source.4068: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.4069: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.4070: DFBPPR7189 ---- Plant proteins ---- Trypsin inhibitor CMc
Source.4071: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha
Source.4072: DFBPPR7191 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.4073: DFBPPR7192 ---- Plant proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.4074: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog
Source.4075: DFBPPR7194 ---- Plant proteins ---- Cytochrome f
Source.4076: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.4077: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.4078: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.4079: DFBPPR7199 ---- Plant proteins ---- Pathogenesis-related protein PRB1-3
Source.4080: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.4081: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain
Source.4082: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.4083: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.4084: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.4085: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.4086: DFBPPR7218 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.4087: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.4088: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.4089: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.4090: DFBPPR7228 ---- Plant proteins ---- Calmodulin
Source.4091: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.4092: DFBPPR7234 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.4093: DFBPPR7235 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD2
Source.4094: DFBPPR7238 ---- Plant proteins ---- Pathogenesis-related protein 1
Source.4095: DFBPPR7239 ---- Plant proteins ---- Pathogenesis-related protein PRB1-2
Source.4096: DFBPPR7240 ---- Plant proteins ---- Agmatine coumaroyltransferase-2
Source.4097: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.4098: DFBPPR7242 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.4099: DFBPPR7247 ---- Plant proteins ---- Photosystem II reaction center protein M
Source.4100: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.4101: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1
Source.4102: DFBPPR7255 ---- Plant proteins ---- Protein PsbN
Source.4103: DFBPPR7258 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV90, chloroplastic
Source.4104: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic
Source.4105: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic
Source.4106: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic
Source.4107: DFBPPR7265 ---- Plant proteins ---- Gamma-hordein-3
Source.4108: DFBPPR7271 ---- Plant proteins ---- Photosystem II reaction center protein Z
Source.4109: DFBPPR7272 ---- Plant proteins ---- Photosystem II 10 kDa polypeptide, chloroplastic
Source.4110: DFBPPR7281 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.4111: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33
Source.4112: DFBPPR7291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.4113: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C
Source.4114: DFBPPR7297 ---- Plant proteins ---- 50S ribosomal protein L20, chloroplastic
Source.4115: DFBPPR7298 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.4116: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3
Source.4117: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4
Source.4118: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2
Source.4119: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6
Source.4120: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7
Source.4121: DFBPPR7311 ---- Plant proteins ---- B1-hordein
Source.4122: DFBPPR7314 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.4123: DFBPPR7317 ---- Plant proteins ---- Horcolin
Source.4124: DFBPPR7319 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.4125: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein
Source.4126: DFBPPR7327 ---- Plant proteins ---- Photosystem I assembly protein Ycf3
Source.4127: DFBPPR7332 ---- Plant proteins ---- 60S ribosomal protein L17-1
Source.4128: DFBPPR7342 ---- Plant proteins ---- 40S ribosomal protein S7
Source.4129: DFBPPR7343 ---- Plant proteins ---- 14-3-3-like protein A
Source.4130: DFBPPR7346 ---- Plant proteins ---- 60S ribosomal protein L17-2
Source.4131: DFBPPR7347 ---- Plant proteins ---- 14-3-3-like protein B
Source.4132: DFBPPR7350 ---- Plant proteins ---- Pathogen-related protein
Source.4133: DFBPPR7351 ---- Plant proteins ---- 23 kDa jasmonate-induced protein
Source.4134: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic
Source.4135: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic
Source.4136: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.4137: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.4138: DFBPPR7402 ---- Plant proteins ---- Probable pectinesterase/pectinesterase inhibitor
Source.4139: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.4140: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.4141: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase
Source.4142: DFBPPR7407 ---- Plant proteins ---- Oleosin-B1
Source.4143: DFBPPR7408 ---- Plant proteins ---- Basic endochitinase CHB4
Source.4144: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic
Source.4145: DFBPPR7410 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.4146: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.4147: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.4148: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.4149: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.4150: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4
Source.4151: DFBPPR7417 ---- Plant proteins ---- Cruciferin
Source.4152: DFBPPR7419 ---- Plant proteins ---- Cytochrome b
Source.4153: DFBPPR7420 ---- Plant proteins ---- Polygalacturonase
Source.4154: DFBPPR7423 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.4155: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic
Source.4156: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.4157: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.4158: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.4159: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.4160: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.4161: DFBPPR7433 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase
Source.4162: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.4163: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.4164: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.4165: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic
Source.4166: DFBPPR7444 ---- Plant proteins ---- Cruciferin BnC2
Source.4167: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1
Source.4168: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1
Source.4169: DFBPPR7449 ---- Plant proteins ---- Oleosin-B2
Source.4170: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.4171: DFBPPR7451 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.4172: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.4173: DFBPPR7453 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain F1, chloroplastic
Source.4174: DFBPPR7456 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.4175: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.4176: DFBPPR7465 ---- Plant proteins ---- Oleosin S1-2
Source.4177: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic
Source.4178: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic
Source.4179: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal
Source.4180: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.4181: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal
Source.4182: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2
Source.4183: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1
Source.4184: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.4185: DFBPPR7477 ---- Plant proteins ---- Endochitinase CH25
Source.4186: DFBPPR7482 ---- Plant proteins ---- Napin
Source.4187: DFBPPR7483 ---- Plant proteins ---- Napin-B
Source.4188: DFBPPR7485 ---- Plant proteins ---- Oleosin Bn-V
Source.4189: DFBPPR7490 ---- Plant proteins ---- Cysteine proteinase COT44
Source.4190: DFBPPR7491 ---- Plant proteins ---- Napin-2
Source.4191: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2
Source.4192: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.4193: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.4194: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.4195: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase
Source.4196: DFBPPR7502 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.4197: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.4198: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION
Source.4199: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.4200: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA
Source.4201: DFBPPR7516 ---- Plant proteins ---- Defensin-like protein 3
Source.4202: DFBPPR7517 ---- Plant proteins ---- Uncharacterized mitochondrial protein ORF138
Source.4203: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A
Source.4204: DFBPPR7523 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.4205: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C
Source.4206: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.4207: DFBPPR7540 ---- Plant proteins ---- Ribosomal protein S14, mitochondrial
Source.4208: DFBPPR7546 ---- Plant proteins ---- 60S ribosomal protein L13-1
Source.4209: DFBPPR7550 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein
Source.4210: DFBPPR7594 ---- Milk proteins ---- Lactadherin
Source.4211: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.4212: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin
Source.4213: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.4214: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.4215: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.4216: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.4217: DFBPPR7604 ---- Milk proteins ---- Zinc transporter 2
Source.4218: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.4219: DFBPPR7608 ---- Milk proteins ---- Kappa-casein
Source.4220: DFBPPR7610 ---- Milk proteins ---- Immunoglobulin heavy constant alpha 2
Source.4221: DFBPPR7611 ---- Milk proteins ---- Clusterin
Source.4222: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.4223: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase
Source.4224: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.4225: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b
Source.4226: DFBPPR7618 ---- Milk proteins ---- Plasminogen
Source.4227: DFBPPR7619 ---- Milk proteins ---- Prolactin-inducible protein
Source.4228: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.4229: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.4230: DFBPPR7622 ---- Milk proteins ---- Mucin-1
Source.4231: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4
Source.4232: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.4233: DFBPPR7625 ---- Milk proteins ---- Leucine-rich alpha-2-glycoprotein
Source.4234: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.4235: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.4236: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain
Source.4237: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein
Source.4238: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.4239: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2
Source.4240: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.4241: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.4242: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2
Source.4243: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.4244: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.4245: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1
Source.4246: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor
Source.4247: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.4248: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.4249: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.4250: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4
Source.4251: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.4252: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.4253: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.4254: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.4255: DFBPPR7667 ---- Milk proteins ---- Lysozyme C, milk isozyme
Source.4256: DFBPPR7668 ---- Milk proteins ---- Beta-casein
Source.4257: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.4258: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein
Source.4259: DFBPPR7680 ---- Milk proteins ---- Alpha-S1-casein
Source.4260: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.4261: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.4262: DFBPPR7685 ---- Milk proteins ---- Alpha-lactalbumin
Source.4263: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin
Source.4264: DFBPPR7692 ---- Milk proteins ---- Beta-casein
Source.4265: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.4266: DFBPPR7696 ---- Milk proteins ---- Uterine milk protein
Source.4267: DFBPPR7697 ---- Milk proteins ---- Alpha-lactalbumin
Source.4268: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B
Source.4269: DFBPPR7700 ---- Milk proteins ---- Beta-casein
Source.4270: DFBPPR7705 ---- Milk proteins ---- Late lactation protein A, LLP-A
Source.4271: DFBPPR7708 ---- Milk proteins ---- Late lactation protein B, LLP-B
Source.4272: DFBPPR7711 ---- Milk proteins ---- Alpha-lactalbumin
Source.4273: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.4274: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.4275: DFBPPR7718 ---- Milk proteins ---- Beta-casein
Source.4276: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.4277: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.4278: DFBPPR7725 ---- Plant proteins ---- Avenin-3
Source.4279: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.4280: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.4281: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.4282: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.4283: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain
Source.4284: DFBPPR7733 ---- Plant proteins ---- 12S seed storage globulin 2
Source.4285: DFBPPR7734 ---- Plant proteins ---- 12S seed storage globulin 1
Source.4286: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.4287: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.4288: DFBPPR7737 ---- Plant proteins ---- Endochitinase
Source.4289: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase
Source.4290: DFBPPR7739 ---- Plant proteins ---- Avenin-E
Source.4291: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase
Source.4292: DFBPPR7744 ---- Plant proteins ---- Maturase K
Source.4293: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta
Source.4294: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.4295: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.4296: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.4297: DFBPPR8193 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMW33
Source.4298: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101
Source.4299: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.4300: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.4301: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP
Source.4302: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B
Source.4303: DFBPPR8210 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.4304: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1
Source.4305: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3
Source.4306: DFBPPR8368 ---- Plant proteins ---- 13S globulin basic chain
Source.4307: DFBPPR8369 ---- Plant proteins ---- Thioredoxin H-type
Source.4308: DFBPPR8370 ---- Plant proteins ---- Maturase K
Source.4309: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.4310: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.4311: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase
Source.4312: DFBPPR8380 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 2
Source.4313: DFBPPR8382 ---- Plant proteins ---- Cationic peroxidase 1
Source.4314: DFBPPR8385 ---- Plant proteins ---- Alpha-methyl-mannoside-specific lectin
Source.4315: DFBPPR8387 ---- Plant proteins ---- Cationic peroxidase 2
Source.4316: DFBPPR8392 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.4317: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3
Source.4318: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2
Source.4319: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1
Source.4320: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B
Source.4321: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17
Source.4322: DFBPPR8413 ---- Plant proteins ---- Arachin Ahy-3
Source.4323: DFBPPR8418 ---- Plant proteins ---- Arachin 25 kDa protein
Source.4324: DFBPPR8419 ---- Plant proteins ---- Arachin 21 kDa protein
Source.4325: DFBPPR8420 ---- Plant proteins ---- Peroxygenase
Source.4326: DFBPPR8421 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase B
Source.4327: DFBPPR8424 ---- Plant proteins ---- Oleosin H1
Source.4328: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.4329: DFBPPR8428 ---- Plant proteins ---- 11S globulin seed storage protein 2
Source.4330: DFBPPR8429 ---- Plant proteins ---- Oleosin H2
Source.4331: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.4332: DFBPPR8434 ---- Plant proteins ---- Lectin
Source.4333: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.4334: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.4335: DFBPPR8445 ---- Plant proteins ---- Maturase K
Source.4336: DFBPPR8449 ---- Plant proteins ---- Basic endochitinase C
Source.4337: DFBPPR8450 ---- Plant proteins ---- Basic endochitinase A
Source.4338: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.4339: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.4340: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.4341: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.4342: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic
Source.4343: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.4344: DFBPPR8458 ---- Plant proteins ---- Catalase
Source.4345: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase
Source.4346: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.4347: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.4348: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.4349: DFBPPR8472 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.4350: DFBPPR8478 ---- Plant proteins ---- 50S ribosomal protein L12-1, chloroplastic
Source.4351: DFBPPR8479 ---- Plant proteins ---- 50S ribosomal protein L12-2, chloroplastic
Source.4352: DFBPPR8480 ---- Plant proteins ---- Protein PsbN
Source.4353: DFBPPR8483 ---- Plant proteins ---- 40S ribosomal protein S7
Source.4354: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein
Source.4355: DFBPPR8486 ---- Milk proteins ---- Lactadherin
Source.4356: DFBPPR8487 ---- Milk proteins ---- Glycosylation-dependent cell adhesion molecule 1
Source.4357: DFBPPR8489 ---- Milk proteins ---- Beta-casein
Source.4358: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.4359: DFBPPR8496 ---- Milk proteins ---- Mucin-1
Source.4360: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.4361: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.4362: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.4363: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4
Source.4364: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.4365: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase
Source.4366: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.4367: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.4368: DFBPPR8508 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.4369: DFBPPR8509 ---- Milk proteins ---- Angiogenin-2
Source.4370: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.4371: DFBPPR8511 ---- Milk proteins ---- Transcobalamin-2
Source.4372: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.4373: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1
Source.4374: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase
Source.4375: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3
Source.4376: DFBPPR8522 ---- Milk proteins ---- Uterine milk protein
Source.4377: DFBPPR8523 ---- Milk proteins ---- Perilipin-2
Source.4378: DFBPPR8526 ---- Milk proteins ---- Protein FAM13A
Source.4379: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.4380: DFBPPR15935 ---- Animal proteins ---- Catalase
Source.4381: DFBPPR15936 ---- Animal proteins ---- Apolipoprotein E
Source.4382: DFBPPR15938 ---- Animal proteins ---- Apolipoprotein A-II
Source.4383: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.4384: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.4385: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.4386: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.4387: DFBPPR15944 ---- Animal proteins ---- Ras-related protein Rab-13
Source.4388: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.4389: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.4390: DFBPPR15947 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.4391: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.4392: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.4393: DFBPPR15952 ---- Animal proteins ---- Galectin-3
Source.4394: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.4395: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.4396: DFBPPR15956 ---- Animal proteins ---- Phospholipase A2
Source.4397: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.4398: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.4399: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.4400: DFBPPR15960 ---- Animal proteins ---- Apolipoprotein A-IV
Source.4401: DFBPPR15961 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.4402: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.4403: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1
Source.4404: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.4405: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4406: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.4407: DFBPPR15973 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 5
Source.4408: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.4409: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8
Source.4410: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.4411: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.4412: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.4413: DFBPPR15982 ---- Animal proteins ---- Triadin
Source.4414: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.4415: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.4416: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2
Source.4417: DFBPPR15989 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.4418: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9
Source.4419: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.4420: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.4421: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1
Source.4422: DFBPPR15995 ---- Animal proteins ---- Ras-related protein Rab-5A
Source.4423: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.4424: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.4425: DFBPPR15998 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.4426: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase
Source.4427: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.4428: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.4429: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.4430: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.4431: DFBPPR16005 ---- Animal proteins ---- Myc proto-oncogene protein
Source.4432: DFBPPR16007 ---- Animal proteins ---- Myocilin
Source.4433: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14
Source.4434: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.4435: DFBPPR16011 ---- Animal proteins ---- Interferon gamma
Source.4436: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.4437: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.4438: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.4439: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.4440: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.4441: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV
Source.4442: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.4443: DFBPPR16025 ---- Animal proteins ---- Transforming protein RhoA
Source.4444: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.4445: DFBPPR16028 ---- Animal proteins ---- Presenilin-1
Source.4446: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.4447: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.4448: DFBPPR16032 ---- Animal proteins ---- Ras-related protein Rab-7a
Source.4449: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.4450: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.4451: DFBPPR16036 ---- Animal proteins ---- Ras-related protein Rab-8A
Source.4452: DFBPPR16038 ---- Animal proteins ---- Protein amnionless
Source.4453: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.4454: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.4455: DFBPPR16042 ---- Animal proteins ---- Caveolin-2
Source.4456: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.4457: DFBPPR16044 ---- Animal proteins ---- High mobility group protein B1
Source.4458: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.4459: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.4460: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2
Source.4461: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.4462: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3
Source.4463: DFBPPR16053 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.4464: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4465: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.4466: DFBPPR16057 ---- Animal proteins ---- Interleukin-8
Source.4467: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type
Source.4468: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor
Source.4469: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.4470: DFBPPR16065 ---- Animal proteins ---- Caspase-3
Source.4471: DFBPPR16066 ---- Animal proteins ---- Coagulation factor IX
Source.4472: DFBPPR16067 ---- Animal proteins ---- CD40 ligand
Source.4473: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.4474: DFBPPR16069 ---- Animal proteins ---- T-cell surface glycoprotein CD4
Source.4475: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1
Source.4476: DFBPPR16071 ---- Animal proteins ---- CD44 antigen
Source.4477: DFBPPR16073 ---- Animal proteins ---- Endothelin-1
Source.4478: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2
Source.4479: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.4480: DFBPPR16078 ---- Animal proteins ---- Ras-related protein Rab-27A
Source.4481: DFBPPR16079 ---- Animal proteins ---- Ras-related protein Rab-10
Source.4482: DFBPPR16080 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1
Source.4483: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.4484: DFBPPR16082 ---- Animal proteins ---- Ras-related protein Rab-9A
Source.4485: DFBPPR16083 ---- Animal proteins ---- Annexin A13
Source.4486: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.4487: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.4488: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.4489: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5
Source.4490: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.4491: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.4492: DFBPPR16093 ---- Animal proteins ---- Menin
Source.4493: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.4494: DFBPPR16096 ---- Animal proteins ---- Protein CLN8
Source.4495: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.4496: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO
Source.4497: DFBPPR16100 ---- Animal proteins ---- Nucleoside diphosphate kinase B
Source.4498: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.4499: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.4500: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.4501: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.4502: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.4503: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.4504: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.4505: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.4506: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.4507: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain
Source.4508: DFBPPR16116 ---- Animal proteins ---- Kit ligand
Source.4509: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.4510: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.4511: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.4512: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4
Source.4513: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.4514: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.4515: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.4516: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.4517: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C
Source.4518: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.4519: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.4520: DFBPPR16135 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.4521: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.4522: DFBPPR16138 ---- Animal proteins ---- Claudin-3
Source.4523: DFBPPR16142 ---- Animal proteins ---- Procathepsin L
Source.4524: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.4525: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.4526: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.4527: DFBPPR16148 ---- Animal proteins ---- Haptoglobin
Source.4528: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.4529: DFBPPR16152 ---- Animal proteins ---- Growth/differentiation factor 8
Source.4530: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6
Source.4531: DFBPPR16156 ---- Animal proteins ---- Ras-related protein Rab-22A
Source.4532: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.4533: DFBPPR16159 ---- Animal proteins ---- Apolipoprotein C-I
Source.4534: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.4535: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.4536: DFBPPR16162 ---- Animal proteins ---- Minor allergen Can f 2
Source.4537: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.4538: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.4539: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.4540: DFBPPR16168 ---- Animal proteins ---- Annexin A2
Source.4541: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.4542: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.4543: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.4544: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.4545: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.4546: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase
Source.4547: DFBPPR16181 ---- Animal proteins ---- Inositol polyphosphate-5-phosphatase A
Source.4548: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.4549: DFBPPR16183 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase
Source.4550: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.4551: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.4552: DFBPPR16191 ---- Animal proteins ---- Somatotropin
Source.4553: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.4554: DFBPPR16194 ---- Animal proteins ---- Signal peptidase complex subunit 3
Source.4555: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.4556: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4557: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.4558: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.4559: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.4560: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1
Source.4561: DFBPPR16204 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.4562: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.4563: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.4564: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.4565: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.4566: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.4567: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.4568: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.4569: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.4570: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.4571: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.4572: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.4573: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.4574: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.4575: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.4576: DFBPPR16224 ---- Animal proteins ---- Uromodulin
Source.4577: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.4578: DFBPPR16227 ---- Animal proteins ---- Myelin proteolipid protein
Source.4579: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.4580: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog
Source.4581: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.4582: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.4583: DFBPPR16237 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.4584: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.4585: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.4586: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.4587: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.4588: DFBPPR16247 ---- Animal proteins ---- Recoverin
Source.4589: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.4590: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.4591: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a
Source.4592: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1
Source.4593: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15
Source.4594: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.4595: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.4596: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4
Source.4597: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4598: DFBPPR16258 ---- Animal proteins ---- Decorin
Source.4599: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.4600: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.4601: DFBPPR16265 ---- Animal proteins ---- Caspase-1
Source.4602: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.4603: DFBPPR16267 ---- Animal proteins ---- Ras-related protein Rab-2A
Source.4604: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.4605: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.4606: DFBPPR16271 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.4607: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1
Source.4608: DFBPPR16277 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase
Source.4609: DFBPPR16279 ---- Animal proteins ---- Galactokinase
Source.4610: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.4611: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68
Source.4612: DFBPPR16282 ---- Animal proteins ---- COMM domain-containing protein 1
Source.4613: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.4614: DFBPPR16285 ---- Animal proteins ---- Chymase
Source.4615: DFBPPR16287 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator
Source.4616: DFBPPR16288 ---- Animal proteins ---- C-C motif chemokine 26
Source.4617: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.4618: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21
Source.4619: DFBPPR16292 ---- Animal proteins ---- Protein unc-119 homolog A
Source.4620: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3
Source.4621: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1
Source.4622: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.4623: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.4624: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.4625: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.4626: DFBPPR16303 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.4627: DFBPPR16304 ---- Animal proteins ---- Cathepsin K
Source.4628: DFBPPR16306 ---- Animal proteins ---- Ras-related protein Rab-25
Source.4629: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41
Source.4630: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.4631: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel
Source.4632: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor
Source.4633: DFBPPR16313 ---- Animal proteins ---- Ras-related protein Rab-5C
Source.4634: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.4635: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.4636: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.4637: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.4638: DFBPPR16323 ---- Animal proteins ---- Aquaporin-2
Source.4639: DFBPPR16324 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2
Source.4640: DFBPPR16325 ---- Animal proteins ---- Peripherin-2
Source.4641: DFBPPR16326 ---- Animal proteins ---- Desmin
Source.4642: DFBPPR16329 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.4643: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.4644: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4
Source.4645: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4
Source.4646: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.4647: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.4648: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype
Source.4649: DFBPPR16345 ---- Animal proteins ---- Interleukin-10
Source.4650: DFBPPR16354 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.4651: DFBPPR16368 ---- Animal proteins ---- Tyrosinase
Source.4652: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.4653: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.4654: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.4655: DFBPPR16429 ---- Animal proteins ---- C-C motif chemokine 4
Source.4656: DFBPPR16435 ---- Animal proteins ---- S-arrestin
Source.4657: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.4658: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.4659: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.4660: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.4661: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6
Source.4662: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.4663: DFBPPR16444 ---- Animal proteins ---- Interleukin-33
Source.4664: DFBPPR16446 ---- Animal proteins ---- Anionic trypsin
Source.4665: DFBPPR16447 ---- Animal proteins ---- Anionic trypsin
Source.4666: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain
Source.4667: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor
Source.4668: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.4669: DFBPPR16458 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.4670: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.4671: DFBPPR16462 ---- Animal proteins ---- Pantetheinase
Source.4672: DFBPPR16464 ---- Animal proteins ---- Interferon alpha-1/2
Source.4673: DFBPPR16465 ---- Animal proteins ---- Myotrophin
Source.4674: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.4675: DFBPPR16467 ---- Animal proteins ---- Opticin
Source.4676: DFBPPR16468 ---- Animal proteins ---- Sodium channel subunit beta-2
Source.4677: DFBPPR16469 ---- Animal proteins ---- Lysozyme C, milk isozyme
Source.4678: DFBPPR16471 ---- Animal proteins ---- Interferon alpha-3
Source.4679: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4
Source.4680: DFBPPR16473 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.4681: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.4682: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.4683: DFBPPR16478 ---- Animal proteins ---- Chymotrypsinogen 2
Source.4684: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.4685: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2
Source.4686: DFBPPR16481 ---- Animal proteins ---- Caspase-12
Source.4687: DFBPPR16483 ---- Animal proteins ---- Neurotensin/neuromedin N
Source.4688: DFBPPR16485 ---- Animal proteins ---- Cathepsin S
Source.4689: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.4690: DFBPPR16489 ---- Animal proteins ---- Lymphotoxin-alpha
Source.4691: DFBPPR16490 ---- Animal proteins ---- Translocon-associated protein subunit beta
Source.4692: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1
Source.4693: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.4694: DFBPPR16497 ---- Animal proteins ---- Interleukin-5
Source.4695: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.4696: DFBPPR16501 ---- Animal proteins ---- F-box/LRR-repeat protein 15
Source.4697: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.4698: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin
Source.4699: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor
Source.4700: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.4701: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.4702: DFBPPR16513 ---- Animal proteins ---- Endothelin-1 receptor
Source.4703: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog
Source.4704: DFBPPR16516 ---- Animal proteins ---- Cytospin-A
Source.4705: DFBPPR16517 ---- Animal proteins ---- Cholinesterase
Source.4706: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.4707: DFBPPR16520 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C
Source.4708: DFBPPR16522 ---- Animal proteins ---- Inducible T-cell costimulator
Source.4709: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.4710: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.4711: DFBPPR16526 ---- Animal proteins ---- Insulin
Source.4712: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.4713: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.4714: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a
Source.4715: DFBPPR16531 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3
Source.4716: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3
Source.4717: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.4718: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4719: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.4720: DFBPPR16544 ---- Animal proteins ---- Interleukin-21
Source.4721: DFBPPR16545 ---- Animal proteins ---- Probable G-protein coupled receptor 83
Source.4722: DFBPPR16546 ---- Animal proteins ---- Apolipoprotein C-III
Source.4723: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein
Source.4724: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.4725: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2
Source.4726: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.4727: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.4728: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.4729: DFBPPR16558 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC
Source.4730: DFBPPR16560 ---- Animal proteins ---- Keratinocyte-associated protein 2
Source.4731: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31
Source.4732: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.4733: DFBPPR16564 ---- Animal proteins ---- Bcl-2-like protein 2
Source.4734: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.4735: DFBPPR16571 ---- Animal proteins ---- Pro-MCH
Source.4736: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.4737: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.4738: DFBPPR16576 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.4739: DFBPPR16578 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.4740: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.4741: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.4742: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein
Source.4743: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2
Source.4744: DFBPPR16587 ---- Animal proteins ---- B-lymphocyte antigen CD20
Source.4745: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.4746: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4
Source.4747: DFBPPR16593 ---- Animal proteins ---- Calcyphosin
Source.4748: DFBPPR16594 ---- Animal proteins ---- Macoilin
Source.4749: DFBPPR16600 ---- Animal proteins ---- Ras-related protein Rab-4B
Source.4750: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.4751: DFBPPR16604 ---- Animal proteins ---- Biglycan
Source.4752: DFBPPR16606 ---- Animal proteins ---- 40S ribosomal protein S18
Source.4753: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.4754: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1
Source.4755: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.4756: DFBPPR16614 ---- Animal proteins ---- Protein S100-A4
Source.4757: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.4758: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1
Source.4759: DFBPPR16621 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.4760: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.4761: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1
Source.4762: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4763: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.4764: DFBPPR16628 ---- Animal proteins ---- Neuroglobin
Source.4765: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.4766: DFBPPR16630 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.4767: DFBPPR16632 ---- Animal proteins ---- Prenylated Rab acceptor protein 1
Source.4768: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7
Source.4769: DFBPPR16637 ---- Animal proteins ---- Thioredoxin
Source.4770: DFBPPR16638 ---- Animal proteins ---- Synapsin-1
Source.4771: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.4772: DFBPPR16642 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.4773: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.4774: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.4775: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.4776: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.4777: DFBPPR16656 ---- Animal proteins ---- 60S ribosomal protein L4
Source.4778: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5
Source.4779: DFBPPR16661 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.4780: DFBPPR16663 ---- Animal proteins ---- Involucrin
Source.4781: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b
Source.4782: DFBPPR16666 ---- Animal proteins ---- Pro-adrenomedullin
Source.4783: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22
Source.4784: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.4785: DFBPPR16676 ---- Animal proteins ---- Olfactory receptor-like protein OLF2
Source.4786: DFBPPR16679 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.4787: DFBPPR16681 ---- Animal proteins ---- Olfactory receptor-like protein OLF3
Source.4788: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.4789: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4
Source.4790: DFBPPR16694 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.4791: DFBPPR16695 ---- Animal proteins ---- UDP-galactose translocator
Source.4792: DFBPPR16698 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-3
Source.4793: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.4794: DFBPPR16701 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog
Source.4795: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.4796: DFBPPR16709 ---- Animal proteins ---- Trafficking protein particle complex subunit 2
Source.4797: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.4798: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.4799: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252
Source.4800: DFBPPR16714 ---- Animal proteins ---- Protein fosB
Source.4801: DFBPPR16718 ---- Animal proteins ---- Zinc finger protein 331
Source.4802: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.4803: DFBPPR16724 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2
Source.4804: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2
Source.4805: DFBPPR16730 ---- Animal proteins ---- RING finger protein 141
Source.4806: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46
Source.4807: DFBPPR16738 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17
Source.4808: DFBPPR16739 ---- Animal proteins ---- Lengsin
Source.4809: DFBPPR16746 ---- Animal proteins ---- Tektin-1
Source.4810: DFBPPR16747 ---- Animal proteins ---- Pleckstrin
Source.4811: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.4812: DFBPPR16749 ---- Animal proteins ---- Keratinocyte differentiation-associated protein
Source.4813: DFBPPR16751 ---- Animal proteins ---- Small integral membrane protein 12
Source.4814: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.4815: DFBPPR16753 ---- Animal proteins ---- Nicolin-1
Source.4816: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10
Source.4817: DFBPPR16759 ---- Animal proteins ---- Ig mu chain C region
Source.4818: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.4819: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.4820: DFBPPR16762 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.4821: DFBPPR16763 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.4822: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.4823: DFBPPR16765 ---- Animal proteins ---- Annexin A1 isoform p37
Source.4824: DFBPPR16766 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.4825: DFBPPR16770 ---- Animal proteins ---- Lysozyme C
Source.4826: DFBPPR16774 ---- Animal proteins ---- Annexin A1 isoform p35
Source.4827: DFBPPR16775 ---- Animal proteins ---- Pinopsin
Source.4828: DFBPPR16777 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.4829: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.4830: DFBPPR16780 ---- Animal proteins ---- Growth/differentiation factor 8
Source.4831: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.4832: DFBPPR16797 ---- Animal proteins ---- Albumin
Source.4833: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.4834: DFBPPR16799 ---- Animal proteins ---- Somatotropin
Source.4835: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.4836: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin
Source.4837: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.4838: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase
Source.4839: DFBPPR16808 ---- Animal proteins ---- Fibroblast growth factor 2
Source.4840: DFBPPR16809 ---- Animal proteins ---- Rhodopsin
Source.4841: DFBPPR16810 ---- Animal proteins ---- Cathepsin B
Source.4842: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.4843: DFBPPR16813 ---- Animal proteins ---- Prolactin
Source.4844: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.4845: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1
Source.4846: DFBPPR16816 ---- Animal proteins ---- Decorin
Source.4847: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4848: DFBPPR16818 ---- Animal proteins ---- ATPase inhibitor, mitochondrial
Source.4849: DFBPPR16819 ---- Animal proteins ---- Hemoglobin subunit beta
Source.4850: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.4851: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.4852: DFBPPR16822 ---- Animal proteins ---- Kininogen-2
Source.4853: DFBPPR16823 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.4854: DFBPPR16824 ---- Animal proteins ---- Insulin-like growth factor II
Source.4855: DFBPPR16826 ---- Animal proteins ---- Phospholipase A2
Source.4856: DFBPPR16827 ---- Animal proteins ---- S-arrestin
Source.4857: DFBPPR16830 ---- Animal proteins ---- Kininogen-1
Source.4858: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.4859: DFBPPR16835 ---- Animal proteins ---- Insulin
Source.4860: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.4861: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein
Source.4862: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.4863: DFBPPR16843 ---- Animal proteins ---- Calmodulin
Source.4864: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.4865: DFBPPR16848 ---- Animal proteins ---- C-C motif chemokine 2
Source.4866: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.4867: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.4868: DFBPPR16852 ---- Animal proteins ---- Cytochrome b
Source.4869: DFBPPR16853 ---- Animal proteins ---- Protein S100-B
Source.4870: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6
Source.4871: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.4872: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor
Source.4873: DFBPPR16858 ---- Animal proteins ---- Thioredoxin-dependent peroxide reductase, mitochondrial
Source.4874: DFBPPR16859 ---- Animal proteins ---- Ubiquitin-like protein ISG15
Source.4875: DFBPPR16861 ---- Animal proteins ---- Adenylate kinase 2, mitochondrial
Source.4876: DFBPPR16863 ---- Animal proteins ---- Biglycan
Source.4877: DFBPPR16864 ---- Animal proteins ---- Protein AMBP
Source.4878: DFBPPR16865 ---- Animal proteins ---- Apolipoprotein E
Source.4879: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B
Source.4880: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.4881: DFBPPR16868 ---- Animal proteins ---- Insulin-like growth factor I
Source.4882: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.4883: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX
Source.4884: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.4885: DFBPPR16872 ---- Animal proteins ---- Oxytocin-neurophysin 1
Source.4886: DFBPPR16873 ---- Animal proteins ---- Cationic trypsin
Source.4887: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.4888: DFBPPR16876 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.4889: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.4890: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.4891: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.4892: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.4893: DFBPPR16887 ---- Animal proteins ---- Pleiotrophin
Source.4894: DFBPPR16888 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.4895: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4896: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.4897: DFBPPR16894 ---- Animal proteins ---- Procathepsin L
Source.4898: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII
Source.4899: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1
Source.4900: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.4901: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.4902: DFBPPR16901 ---- Animal proteins ---- Lens fiber membrane intrinsic protein
Source.4903: DFBPPR16902 ---- Animal proteins ---- Interleukin-8
Source.4904: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.4905: DFBPPR16906 ---- Animal proteins ---- High mobility group protein B1
Source.4906: DFBPPR16907 ---- Animal proteins ---- Acyl carrier protein, mitochondrial
Source.4907: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV
Source.4908: DFBPPR16915 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.4909: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.4910: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.4911: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.4912: DFBPPR16922 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.4913: DFBPPR16923 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.4914: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial
Source.4915: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.4916: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.4917: DFBPPR16928 ---- Animal proteins ---- Endothelin-1
Source.4918: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.4919: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.4920: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.4921: DFBPPR16937 ---- Animal proteins ---- GTP:AMP phosphotransferase AK3, mitochondrial
Source.4922: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.4923: DFBPPR16940 ---- Animal proteins ---- Ras-related protein Rap-1A
Source.4924: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.4925: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.4926: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic
Source.4927: DFBPPR16945 ---- Animal proteins ---- Transforming protein RhoA
Source.4928: DFBPPR16946 ---- Animal proteins ---- Recoverin
Source.4929: DFBPPR16948 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.4930: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.4931: DFBPPR16952 ---- Animal proteins ---- Annexin A2
Source.4932: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.4933: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin
Source.4934: DFBPPR16956 ---- Animal proteins ---- Interleukin-6
Source.4935: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4936: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.4937: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.4938: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.4939: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.4940: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.4941: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.4942: DFBPPR16967 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta
Source.4943: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.4944: DFBPPR16969 ---- Animal proteins ---- Adenosine deaminase
Source.4945: DFBPPR16970 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.4946: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.4947: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.4948: DFBPPR16974 ---- Animal proteins ---- Natriuretic peptides A
Source.4949: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6
Source.4950: DFBPPR16976 ---- Animal proteins ---- Growth/differentiation factor 8
Source.4951: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.4952: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.4953: DFBPPR16979 ---- Animal proteins ---- Aquaporin-1
Source.4954: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3
Source.4955: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.4956: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.4957: DFBPPR16984 ---- Animal proteins ---- Caveolin-2
Source.4958: DFBPPR16985 ---- Animal proteins ---- Filensin
Source.4959: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.4960: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.4961: DFBPPR16991 ---- Animal proteins ---- Osteocalcin
Source.4962: DFBPPR16996 ---- Animal proteins ---- Retinol dehydrogenase 5
Source.4963: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.4964: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.4965: DFBPPR17000 ---- Animal proteins ---- Vimentin
Source.4966: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.4967: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.4968: DFBPPR17004 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.4969: DFBPPR17005 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.4970: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP
Source.4971: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial
Source.4972: DFBPPR17010 ---- Animal proteins ---- Sestrin-2
Source.4973: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2
Source.4974: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1
Source.4975: DFBPPR17013 ---- Animal proteins ---- Presenilin-1
Source.4976: DFBPPR17014 ---- Animal proteins ---- Microtubule-associated proteins 1A/1B light chain 3B
Source.4977: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.4978: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.4979: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase
Source.4980: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.4981: DFBPPR17023 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10
Source.4982: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.4983: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.4984: DFBPPR17027 ---- Animal proteins ---- D(1A) dopamine receptor
Source.4985: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.4986: DFBPPR17029 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.4987: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.4988: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.4989: DFBPPR17035 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1
Source.4990: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.4991: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.4992: DFBPPR17040 ---- Animal proteins ---- Myocilin
Source.4993: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.4994: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.4995: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D
Source.4996: DFBPPR17045 ---- Animal proteins ---- Oxysterols receptor LXR-beta
Source.4997: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.4998: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.4999: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.5000: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.5001: DFBPPR17054 ---- Animal proteins ---- Ras-related C3 botulinum toxin substrate 1
Source.5002: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.5003: DFBPPR17058 ---- Animal proteins ---- Ras-related protein Rab-13
Source.5004: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform
Source.5005: DFBPPR17060 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 1
Source.5006: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.5007: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5
Source.5008: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.5009: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.5010: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.5011: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.5012: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.5013: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2
Source.5014: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21
Source.5015: DFBPPR17076 ---- Animal proteins ---- Ras-related protein Rab-3A
Source.5016: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.5017: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.5018: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.5019: DFBPPR17082 ---- Animal proteins ---- Calbindin
Source.5020: DFBPPR17083 ---- Animal proteins ---- Cyclin-dependent kinase 5 activator 1
Source.5021: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.5022: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.5023: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.5024: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.5025: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.5026: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1
Source.5027: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.5028: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.5029: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1
Source.5030: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.5031: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A
Source.5032: DFBPPR17101 ---- Animal proteins ---- Annexin A5
Source.5033: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.5034: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.5035: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.5036: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.5037: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.5038: DFBPPR17108 ---- Animal proteins ---- Coronin-1A
Source.5039: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.5040: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2
Source.5041: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.5042: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.5043: DFBPPR17113 ---- Animal proteins ---- Calcineurin B homologous protein 1
Source.5044: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.5045: DFBPPR17115 ---- Animal proteins ---- CD44 antigen
Source.5046: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.5047: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2
Source.5048: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.5049: DFBPPR17121 ---- Animal proteins ---- 3-hydroxyacyl-CoA dehydrogenase type-2
Source.5050: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.5051: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.5052: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit
Source.5053: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.5054: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1
Source.5055: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.5056: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.5057: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein
Source.5058: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1
Source.5059: DFBPPR17140 ---- Animal proteins ---- Adiponectin
Source.5060: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2
Source.5061: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.5062: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.5063: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.5064: DFBPPR17158 ---- Animal proteins ---- EH domain-containing protein 1
Source.5065: DFBPPR17159 ---- Animal proteins ---- EH domain-containing protein 1
Source.5066: DFBPPR17160 ---- Animal proteins ---- EH domain-containing protein 1
Source.5067: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor
Source.5068: DFBPPR17164 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.5069: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.5070: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.5071: DFBPPR17167 ---- Animal proteins ---- Calcineurin subunit B type 1
Source.5072: DFBPPR17168 ---- Animal proteins ---- Angiopoietin-1
Source.5073: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.5074: DFBPPR17172 ---- Animal proteins ---- Cartilage oligomeric matrix protein
Source.5075: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.5076: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.5077: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.5078: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.5079: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.5080: DFBPPR17192 ---- Animal proteins ---- Kit ligand
Source.5081: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.5082: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial
Source.5083: DFBPPR17198 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial
Source.5084: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.5085: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.5086: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase
Source.5087: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.5088: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.5089: DFBPPR17245 ---- Animal proteins ---- Ras-related protein Rab-8A
Source.5090: DFBPPR17254 ---- Animal proteins ---- Zinc finger protein SNAI2
Source.5091: DFBPPR17256 ---- Animal proteins ---- X-box-binding protein 1
Source.5092: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35
Source.5093: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.5094: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33
Source.5095: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.5096: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.5097: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.5098: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1
Source.5099: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.5100: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3
Source.5101: DFBPPR17272 ---- Animal proteins ---- Dysbindin
Source.5102: DFBPPR17273 ---- Animal proteins ---- Integrin-linked protein kinase
Source.5103: DFBPPR17274 ---- Animal proteins ---- U8 snoRNA-decapping enzyme
Source.5104: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR
Source.5105: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1
Source.5106: DFBPPR17278 ---- Animal proteins ---- Rho-associated protein kinase 1
Source.5107: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2
Source.5108: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.5109: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.5110: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1
Source.5111: DFBPPR17286 ---- Animal proteins ---- Septin-2
Source.5112: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.5113: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2
Source.5114: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1
Source.5115: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2
Source.5116: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.5117: DFBPPR17296 ---- Animal proteins ---- Dynamin-2
Source.5118: DFBPPR17297 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.5119: DFBPPR17298 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 2
Source.5120: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.5121: DFBPPR17300 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.5122: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.5123: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.5124: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial
Source.5125: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein
Source.5126: DFBPPR17310 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.5127: DFBPPR17311 ---- Animal proteins ---- Nucleoside diphosphate kinase B
Source.5128: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.5129: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.5130: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3
Source.5131: DFBPPR17319 ---- Animal proteins ---- Integrin beta-1-binding protein 1
Source.5132: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase
Source.5133: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.5134: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.5135: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein
Source.5136: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II
Source.5137: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.5138: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.5139: DFBPPR17328 ---- Animal proteins ---- Ras-related protein Rab-5A
Source.5140: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.5141: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.5142: DFBPPR17332 ---- Animal proteins ---- Protein odd-skipped-related 1
Source.5143: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1
Source.5144: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type
Source.5145: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.5146: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.5147: DFBPPR17339 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.5148: DFBPPR17340 ---- Animal proteins ---- Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating
Source.5149: DFBPPR17341 ---- Animal proteins ---- Radixin
Source.5150: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B
Source.5151: DFBPPR17343 ---- Animal proteins ---- Receptor of activated protein C kinase 1
Source.5152: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.5153: DFBPPR17345 ---- Animal proteins ---- Palmitoyl-protein thioesterase 1
Source.5154: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.5155: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.5156: DFBPPR17349 ---- Animal proteins ---- Sialidase-3
Source.5157: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.5158: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.5159: DFBPPR17352 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 2
Source.5160: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.5161: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.5162: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.5163: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.5164: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.5165: DFBPPR17362 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.5166: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H
Source.5167: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.5168: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.5169: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1
Source.5170: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.5171: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.5172: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6
Source.5173: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.5174: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.5175: DFBPPR17376 ---- Animal proteins ---- Flotillin-1
Source.5176: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.5177: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.5178: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.5179: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.5180: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2
Source.5181: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1
Source.5182: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial
Source.5183: DFBPPR17386 ---- Animal proteins ---- Epithelial membrane protein 2
Source.5184: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.5185: DFBPPR17388 ---- Animal proteins ---- Beta-arrestin-2
Source.5186: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.5187: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10
Source.5188: DFBPPR17391 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-4
Source.5189: DFBPPR17392 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.5190: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.5191: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD
Source.5192: DFBPPR17398 ---- Animal proteins ---- DNA-binding protein inhibitor ID-2
Source.5193: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1
Source.5194: DFBPPR17402 ---- Animal proteins ---- High mobility group protein B2
Source.5195: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.5196: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1
Source.5197: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.5198: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.5199: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.5200: DFBPPR17409 ---- Animal proteins ---- Geranylgeranyl pyrophosphate synthase
Source.5201: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.5202: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.5203: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.5204: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.5205: DFBPPR17415 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase 1
Source.5206: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5
Source.5207: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.5208: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.5209: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1
Source.5210: DFBPPR17423 ---- Animal proteins ---- Furin
Source.5211: DFBPPR17425 ---- Animal proteins ---- Dynamin-1
Source.5212: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.5213: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.5214: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.5215: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.5216: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.5217: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5
Source.5218: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.5219: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.5220: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.5221: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.5222: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.5223: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.5224: DFBPPR17443 ---- Animal proteins ---- Beclin-1
Source.5225: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.5226: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.5227: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1
Source.5228: DFBPPR17447 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 5
Source.5229: DFBPPR17448 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.5230: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.5231: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.5232: DFBPPR17453 ---- Animal proteins ---- Calcium and integrin-binding protein 1
Source.5233: DFBPPR17454 ---- Animal proteins ---- Peripherin-2
Source.5234: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.5235: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.5236: DFBPPR17457 ---- Animal proteins ---- 15-hydroxyprostaglandin dehydrogenase [NAD(+)]
Source.5237: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial
Source.5238: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3
Source.5239: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.5240: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.5241: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.5242: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1
Source.5243: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.5244: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase
Source.5245: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.5246: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.5247: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.5248: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2
Source.5249: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.5250: DFBPPR17481 ---- Animal proteins ---- Apolipoprotein C-III
Source.5251: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.5252: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase
Source.5253: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.5254: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.5255: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.5256: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.5257: DFBPPR17491 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.5258: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1
Source.5259: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.5260: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.5261: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.5262: DFBPPR17499 ---- Animal proteins ---- Allograft inflammatory factor 1
Source.5263: DFBPPR17501 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.5264: DFBPPR17504 ---- Animal proteins ---- Duodenase-1
Source.5265: DFBPPR17506 ---- Animal proteins ---- Vasopressin-neurophysin 2-copeptin
Source.5266: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.5267: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.5268: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.5269: DFBPPR17510 ---- Animal proteins ---- Uroplakin-1b
Source.5270: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.5271: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.5272: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.5273: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase
Source.5274: DFBPPR17516 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.5275: DFBPPR17517 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.5276: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase
Source.5277: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.5278: DFBPPR17522 ---- Animal proteins ---- Homer protein homolog 1
Source.5279: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.5280: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.5281: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.5282: DFBPPR17534 ---- Animal proteins ---- RISC-loading complex subunit TARBP2
Source.5283: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.5284: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase
Source.5285: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.5286: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.5287: DFBPPR17541 ---- Animal proteins ---- Sorting nexin-3
Source.5288: DFBPPR17546 ---- Animal proteins ---- Centrin-2
Source.5289: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.5290: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.5291: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog
Source.5292: DFBPPR17555 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial
Source.5293: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1
Source.5294: DFBPPR17561 ---- Animal proteins ---- Aquaporin-4
Source.5295: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.5296: DFBPPR17563 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein A1
Source.5297: DFBPPR17566 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial
Source.5298: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.5299: DFBPPR17570 ---- Animal proteins ---- Clathrin light chain B
Source.5300: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.5301: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta
Source.5302: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.5303: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.5304: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.5305: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.5306: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1
Source.5307: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.5308: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial
Source.5309: DFBPPR17589 ---- Animal proteins ---- Aquaporin-2
Source.5310: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.5311: DFBPPR17592 ---- Animal proteins ---- Claudin-3
Source.5312: DFBPPR17593 ---- Animal proteins ---- Claudin-3
Source.5313: DFBPPR17594 ---- Animal proteins ---- E-selectin
Source.5314: DFBPPR17595 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.5315: DFBPPR17596 ---- Animal proteins ---- [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial
Source.5316: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.5317: DFBPPR17599 ---- Animal proteins ---- Tissue factor
Source.5318: DFBPPR17600 ---- Animal proteins ---- Tissue factor
Source.5319: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor
Source.5320: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.5321: DFBPPR17603 ---- Animal proteins ---- Flavin reductase (NADPH)
Source.5322: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.5323: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.5324: DFBPPR17610 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A2, mitochondrial
Source.5325: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.5326: DFBPPR17614 ---- Animal proteins ---- E3 ubiquitin-protein ligase ARIH1
Source.5327: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.5328: DFBPPR17618 ---- Animal proteins ---- Synaptophysin
Source.5329: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein
Source.5330: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.5331: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.5332: DFBPPR17636 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.5333: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.5334: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.5335: DFBPPR17647 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 1
Source.5336: DFBPPR17648 ---- Animal proteins ---- NAD-capped RNA hydrolase NUDT12
Source.5337: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.5338: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.5339: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1
Source.5340: DFBPPR17663 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 4, mitochondrial
Source.5341: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2
Source.5342: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.5343: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.5344: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.5345: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16
Source.5346: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2
Source.5347: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.5348: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.5349: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L
Source.5350: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.5351: DFBPPR17713 ---- Animal proteins ---- Urokinase plasminogen activator surface receptor
Source.5352: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.5353: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.5354: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B
Source.5355: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B
Source.5356: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.5357: DFBPPR17736 ---- Animal proteins ---- Rho-related GTP-binding protein Rho6
Source.5358: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.5359: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.5360: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1
Source.5361: DFBPPR17740 ---- Animal proteins ---- Fatty acid-binding protein, heart
Source.5362: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.5363: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.5364: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.5365: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.5366: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform
Source.5367: DFBPPR17755 ---- Animal proteins ---- Cerebellin-1
Source.5368: DFBPPR17756 ---- Animal proteins ---- Ras-related protein Rab-3B
Source.5369: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.5370: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.5371: DFBPPR17764 ---- Animal proteins ---- L-selectin
Source.5372: DFBPPR17765 ---- Animal proteins ---- Ras-related protein Rab-27B
Source.5373: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5
Source.5374: DFBPPR17768 ---- Animal proteins ---- Microtubule-associated proteins 1A/1B light chain 3A
Source.5375: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.5376: DFBPPR17774 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.5377: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3
Source.5378: DFBPPR17776 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.5379: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.5380: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.5381: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.5382: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.5383: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C
Source.5384: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.5385: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3
Source.5386: DFBPPR17787 ---- Animal proteins ---- Septin-6
Source.5387: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.5388: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.5389: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.5390: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.5391: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.5392: DFBPPR17797 ---- Animal proteins ---- Caspase-13
Source.5393: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.5394: DFBPPR17800 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13
Source.5395: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.5396: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.5397: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.5398: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1
Source.5399: DFBPPR17807 ---- Animal proteins ---- Opticin
Source.5400: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.5401: DFBPPR17812 ---- Animal proteins ---- Dynein light chain Tctex-type 1
Source.5402: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.5403: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.5404: DFBPPR17815 ---- Animal proteins ---- 40S ribosomal protein SA
Source.5405: DFBPPR17816 ---- Animal proteins ---- Lumican
Source.5406: DFBPPR17817 ---- Animal proteins ---- Peroxiredoxin-2
Source.5407: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.5408: DFBPPR17819 ---- Animal proteins ---- Ras-related protein Rap-1b
Source.5409: DFBPPR17820 ---- Animal proteins ---- Osteomodulin
Source.5410: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.5411: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase
Source.5412: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.5413: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.5414: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.5415: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.5416: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B
Source.5417: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1
Source.5418: DFBPPR17834 ---- Animal proteins ---- Apolipoprotein D
Source.5419: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.5420: DFBPPR17836 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 6
Source.5421: DFBPPR17837 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 L3
Source.5422: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.5423: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13
Source.5424: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.5425: DFBPPR17841 ---- Animal proteins ---- ER lumen protein-retaining receptor 1
Source.5426: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B
Source.5427: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.5428: DFBPPR17846 ---- Animal proteins ---- (Lyso)-N-acylphosphatidylethanolamine lipase
Source.5429: DFBPPR17847 ---- Animal proteins ---- Palmitoyltransferase ZDHHC20
Source.5430: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3
Source.5431: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.5432: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.5433: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.5434: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.5435: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase
Source.5436: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.5437: DFBPPR17858 ---- Animal proteins ---- Calsenilin
Source.5438: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.5439: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.5440: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.5441: DFBPPR17865 ---- Animal proteins ---- Protein phosphatase 1A
Source.5442: DFBPPR17866 ---- Animal proteins ---- PIH1 domain-containing protein 1
Source.5443: DFBPPR17868 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit gamma
Source.5444: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.5445: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.5446: DFBPPR17871 ---- Animal proteins ---- Ras-related protein Rab-11B
Source.5447: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.5448: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.5449: DFBPPR17874 ---- Animal proteins ---- Endonuclease 8-like 2
Source.5450: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.5451: DFBPPR17879 ---- Animal proteins ---- Menin
Source.5452: DFBPPR17880 ---- Animal proteins ---- Apolipoprotein A-IV
Source.5453: DFBPPR17881 ---- Animal proteins ---- Myoblast determination protein 1
Source.5454: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1
Source.5455: DFBPPR17883 ---- Animal proteins ---- Sialidase-1
Source.5456: DFBPPR17884 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase
Source.5457: DFBPPR17885 ---- Animal proteins ---- Serine protease inhibitor Kazal-type 6
Source.5458: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.5459: DFBPPR17888 ---- Animal proteins ---- Cation-dependent mannose-6-phosphate receptor
Source.5460: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.5461: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.5462: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.5463: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.5464: DFBPPR17894 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 9
Source.5465: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.5466: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.5467: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.5468: DFBPPR17899 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.5469: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.5470: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.5471: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB
Source.5472: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.5473: DFBPPR17905 ---- Animal proteins ---- DNA endonuclease RBBP8
Source.5474: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.5475: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.5476: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.5477: DFBPPR17916 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF126
Source.5478: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.5479: DFBPPR17918 ---- Animal proteins ---- Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial
Source.5480: DFBPPR17919 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.5481: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.5482: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3
Source.5483: DFBPPR17923 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.5484: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.5485: DFBPPR17925 ---- Animal proteins ---- Caspase-4
Source.5486: DFBPPR17926 ---- Animal proteins ---- Glutathione S-transferase P
Source.5487: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.5488: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2
Source.5489: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.5490: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.5491: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.5492: DFBPPR17934 ---- Animal proteins ---- RNA-binding motif protein, X chromosome
Source.5493: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.5494: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.5495: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.5496: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.5497: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2
Source.5498: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.5499: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.5500: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.5501: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.5502: DFBPPR17947 ---- Animal proteins ---- Erythropoietin
Source.5503: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.5504: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1
Source.5505: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.5506: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.5507: DFBPPR17953 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.5508: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.5509: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.5510: DFBPPR17959 ---- Animal proteins ---- Atypical chemokine receptor 4
Source.5511: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.5512: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial
Source.5513: DFBPPR17966 ---- Animal proteins ---- Clathrin light chain A
Source.5514: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase
Source.5515: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.5516: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.5517: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.5518: DFBPPR17976 ---- Animal proteins ---- Apoptosis regulator Bcl-2
Source.5519: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.5520: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.5521: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.5522: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.5523: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor
Source.5524: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial
Source.5525: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN
Source.5526: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.5527: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.5528: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B
Source.5529: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.5530: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.5531: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.5532: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase
Source.5533: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.5534: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.5535: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.5536: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.5537: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.5538: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17
Source.5539: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.5540: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.5541: DFBPPR18011 ---- Animal proteins ---- Afamin
Source.5542: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.5543: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.5544: DFBPPR18015 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.5545: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2
Source.5546: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1
Source.5547: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.5548: DFBPPR18022 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial
Source.5549: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.5550: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.5551: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.5552: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.5553: DFBPPR18028 ---- Animal proteins ---- Atlastin-1
Source.5554: DFBPPR18032 ---- Animal proteins ---- Insulin-induced gene 1 protein
Source.5555: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.5556: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.5557: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.5558: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase
Source.5559: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6
Source.5560: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5
Source.5561: DFBPPR18047 ---- Animal proteins ---- ATP synthase F(0) complex subunit C3, mitochondrial
Source.5562: DFBPPR18048 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial
Source.5563: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1
Source.5564: DFBPPR18050 ---- Animal proteins ---- Ras-related protein Rab-7a
Source.5565: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.5566: DFBPPR18054 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 9
Source.5567: DFBPPR18058 ---- Animal proteins ---- Ras-related GTP-binding protein A
Source.5568: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.5569: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.5570: DFBPPR18061 ---- Animal proteins ---- Glutathione S-transferase Mu 1
Source.5571: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.5572: DFBPPR18065 ---- Animal proteins ---- Isopentenyl-diphosphate Delta-isomerase 1
Source.5573: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.5574: DFBPPR18068 ---- Animal proteins ---- Annexin A11
Source.5575: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.5576: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.5577: DFBPPR18071 ---- Animal proteins ---- Fatty acid-binding protein, adipocyte
Source.5578: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.5579: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.5580: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial
Source.5581: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.5582: DFBPPR18078 ---- Animal proteins ---- 14-3-3 protein eta
Source.5583: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8
Source.5584: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.5585: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.5586: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.5587: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.5588: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.5589: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor
Source.5590: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta
Source.5591: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.5592: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33
Source.5593: DFBPPR18100 ---- Animal proteins ---- Derlin-1
Source.5594: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.5595: DFBPPR18103 ---- Animal proteins ---- Basic leucine zipper transcriptional factor ATF-like
Source.5596: DFBPPR18104 ---- Animal proteins ---- Thioredoxin
Source.5597: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.5598: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1
Source.5599: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.5600: DFBPPR18111 ---- Animal proteins ---- Transcriptional adapter 3
Source.5601: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38
Source.5602: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1
Source.5603: DFBPPR18116 ---- Animal proteins ---- Carbonic anhydrase 4
Source.5604: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23
Source.5605: DFBPPR18118 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 8
Source.5606: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.5607: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.5608: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.5609: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.5610: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3
Source.5611: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.5612: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.5613: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.5614: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha
Source.5615: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.5616: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1
Source.5617: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase
Source.5618: DFBPPR18136 ---- Animal proteins ---- Septin-8
Source.5619: DFBPPR18137 ---- Animal proteins ---- Septin-8
Source.5620: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.5621: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1
Source.5622: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.5623: DFBPPR18146 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 9
Source.5624: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain
Source.5625: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.5626: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.5627: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.5628: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.5629: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII
Source.5630: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.5631: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.5632: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.5633: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.5634: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1
Source.5635: DFBPPR18171 ---- Animal proteins ---- Anionic trypsin
Source.5636: DFBPPR18172 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.5637: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.5638: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.5639: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.5640: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.5641: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25
Source.5642: DFBPPR18191 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-2
Source.5643: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.5644: DFBPPR18194 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1
Source.5645: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.5646: DFBPPR18197 ---- Animal proteins ---- Bax inhibitor 1
Source.5647: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.5648: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.5649: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.5650: DFBPPR18213 ---- Animal proteins ---- Transformer-2 protein homolog beta
Source.5651: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.5652: DFBPPR18218 ---- Animal proteins ---- Dual specificity protein phosphatase 6
Source.5653: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.5654: DFBPPR18220 ---- Animal proteins ---- Platelet-activating factor receptor
Source.5655: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.5656: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40
Source.5657: DFBPPR18224 ---- Animal proteins ---- Integral membrane protein 2B
Source.5658: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.5659: DFBPPR18227 ---- Animal proteins ---- Desmin
Source.5660: DFBPPR18228 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.5661: DFBPPR18230 ---- Animal proteins ---- Multivesicular body subunit 12A
Source.5662: DFBPPR18231 ---- Animal proteins ---- Transcription factor jun-B
Source.5663: DFBPPR18234 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.5664: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.5665: DFBPPR18238 ---- Animal proteins ---- Protein odd-skipped-related 2
Source.5666: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3
Source.5667: DFBPPR18241 ---- Animal proteins ---- Seminal plasma protein BSP-30 kDa
Source.5668: DFBPPR18242 ---- Animal proteins ---- Heparanase
Source.5669: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.5670: DFBPPR18246 ---- Animal proteins ---- High mobility group protein B3
Source.5671: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.5672: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase
Source.5673: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.5674: DFBPPR18251 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.5675: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.5676: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.5677: DFBPPR18262 ---- Animal proteins ---- Claudin-1
Source.5678: DFBPPR18263 ---- Animal proteins ---- Neurocalcin-delta
Source.5679: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.5680: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2
Source.5681: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI
Source.5682: DFBPPR18270 ---- Animal proteins ---- Synaptojanin-2-binding protein
Source.5683: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial
Source.5684: DFBPPR18274 ---- Animal proteins ---- Histone deacetylase 8
Source.5685: DFBPPR18275 ---- Animal proteins ---- Enoyl-CoA hydratase, mitochondrial
Source.5686: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.5687: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3
Source.5688: DFBPPR18281 ---- Animal proteins ---- CD63 antigen
Source.5689: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.5690: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.5691: DFBPPR18286 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.5692: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56
Source.5693: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.5694: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.5695: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein
Source.5696: DFBPPR18295 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2
Source.5697: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.5698: DFBPPR18297 ---- Animal proteins ---- Casein kinase I isoform beta
Source.5699: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase
Source.5700: DFBPPR18299 ---- Animal proteins ---- Synapsin-1
Source.5701: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.5702: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.5703: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.5704: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.5705: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.5706: DFBPPR18307 ---- Animal proteins ---- Claudin-4
Source.5707: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain
Source.5708: DFBPPR18310 ---- Animal proteins ---- Serine/arginine-rich splicing factor 7
Source.5709: DFBPPR18311 ---- Animal proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.5710: DFBPPR18312 ---- Animal proteins ---- Interleukin-10
Source.5711: DFBPPR18313 ---- Animal proteins ---- Septin-12
Source.5712: DFBPPR18314 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-B
Source.5713: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.5714: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.5715: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.5716: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.5717: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.5718: DFBPPR18321 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D1
Source.5719: DFBPPR18322 ---- Animal proteins ---- Stomatin-like protein 2, mitochondrial
Source.5720: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.5721: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2
Source.5722: DFBPPR18327 ---- Animal proteins ---- Eukaryotic translation initiation factor 6
Source.5723: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase
Source.5724: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon
Source.5725: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.5726: DFBPPR18332 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.5727: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a
Source.5728: DFBPPR18334 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.5729: DFBPPR18337 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 alpha
Source.5730: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor
Source.5731: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.5732: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2
Source.5733: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.5734: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.5735: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.5736: DFBPPR18353 ---- Animal proteins ---- Lactosylceramide alpha-2,3-sialyltransferase
Source.5737: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.5738: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.5739: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase
Source.5740: DFBPPR18358 ---- Animal proteins ---- Lymphatic vessel endothelial hyaluronic acid receptor 1
Source.5741: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.5742: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3
Source.5743: DFBPPR18363 ---- Animal proteins ---- Spexin
Source.5744: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.5745: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial
Source.5746: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.5747: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.5748: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain
Source.5749: DFBPPR18371 ---- Animal proteins ---- F-actin-capping protein subunit beta
Source.5750: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.5751: DFBPPR18374 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2
Source.5752: DFBPPR18375 ---- Animal proteins ---- Nucleoporin SEH1
Source.5753: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5
Source.5754: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.5755: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.5756: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.5757: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.5758: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1
Source.5759: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.5760: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z
Source.5761: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.5762: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.5763: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.5764: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase
Source.5765: DFBPPR18401 ---- Animal proteins ---- Protrudin
Source.5766: DFBPPR18402 ---- Animal proteins ---- Uromodulin
Source.5767: DFBPPR18403 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.5768: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3
Source.5769: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10
Source.5770: DFBPPR18406 ---- Animal proteins ---- Angiotensinogen
Source.5771: DFBPPR18408 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.5772: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor
Source.5773: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1
Source.5774: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.5775: DFBPPR18415 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-14
Source.5776: DFBPPR18416 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6
Source.5777: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.5778: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.5779: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.5780: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.5781: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.5782: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.5783: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.5784: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16
Source.5785: DFBPPR18432 ---- Animal proteins ---- Vacuole membrane protein 1
Source.5786: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1
Source.5787: DFBPPR18439 ---- Animal proteins ---- Retinol dehydrogenase 12
Source.5788: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.5789: DFBPPR18443 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase
Source.5790: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.5791: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.5792: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.5793: DFBPPR18447 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease 2
Source.5794: DFBPPR18448 ---- Animal proteins ---- Septin-1
Source.5795: DFBPPR18449 ---- Animal proteins ---- Prepronociceptin
Source.5796: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.5797: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.5798: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4
Source.5799: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.5800: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1
Source.5801: DFBPPR18458 ---- Animal proteins ---- Fatty acid-binding protein, liver
Source.5802: DFBPPR18459 ---- Animal proteins ---- Transcription factor AP-1
Source.5803: DFBPPR18460 ---- Animal proteins ---- ATP synthase-coupling factor 6, mitochondrial
Source.5804: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.5805: DFBPPR18462 ---- Animal proteins ---- Serotonin N-acetyltransferase
Source.5806: DFBPPR18464 ---- Animal proteins ---- Regucalcin
Source.5807: DFBPPR18466 ---- Animal proteins ---- Retinoic acid receptor responder protein 2
Source.5808: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.5809: DFBPPR18468 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.5810: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3
Source.5811: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.5812: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1
Source.5813: DFBPPR18473 ---- Animal proteins ---- Sharpin
Source.5814: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.5815: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.5816: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1
Source.5817: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.5818: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.5819: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein
Source.5820: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1
Source.5821: DFBPPR18485 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.5822: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47
Source.5823: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.5824: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.5825: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase
Source.5826: DFBPPR18497 ---- Animal proteins ---- Synaptobrevin homolog YKT6
Source.5827: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.5828: DFBPPR18500 ---- Animal proteins ---- GTP-binding protein Rheb
Source.5829: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.5830: DFBPPR18508 ---- Animal proteins ---- Regakine-1
Source.5831: DFBPPR18509 ---- Animal proteins ---- Hemoglobin fetal subunit beta
Source.5832: DFBPPR18510 ---- Animal proteins ---- Myogenic factor 5
Source.5833: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent
Source.5834: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.5835: DFBPPR18514 ---- Animal proteins ---- Ras-related protein Rab-3C
Source.5836: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit
Source.5837: DFBPPR18516 ---- Animal proteins ---- Galactokinase
Source.5838: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.5839: DFBPPR18520 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.5840: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3
Source.5841: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1
Source.5842: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.5843: DFBPPR18528 ---- Animal proteins ---- 14-3-3 protein sigma
Source.5844: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin
Source.5845: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain
Source.5846: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain
Source.5847: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.5848: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.5849: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.5850: DFBPPR18541 ---- Animal proteins ---- Chromatin modification-related protein MEAF6
Source.5851: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1
Source.5852: DFBPPR18543 ---- Animal proteins ---- Proproteinase E
Source.5853: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu
Source.5854: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.5855: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.5856: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor
Source.5857: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.5858: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1
Source.5859: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.5860: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.5861: DFBPPR18559 ---- Animal proteins ---- Kinesin-like protein KIF22
Source.5862: DFBPPR18564 ---- Animal proteins ---- BRISC and BRCA1-A complex member 1
Source.5863: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4
Source.5864: DFBPPR18570 ---- Animal proteins ---- Prolyl 3-hydroxylase OGFOD1
Source.5865: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.5866: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5
Source.5867: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.5868: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.5869: DFBPPR18578 ---- Animal proteins ---- 5-demethoxyubiquinone hydroxylase, mitochondrial
Source.5870: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.5871: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.5872: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit
Source.5873: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2
Source.5874: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.5875: DFBPPR18592 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.5876: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.5877: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.5878: DFBPPR18597 ---- Animal proteins ---- Telethonin
Source.5879: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.5880: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.5881: DFBPPR18602 ---- Animal proteins ---- Aquaporin-3
Source.5882: DFBPPR18603 ---- Animal proteins ---- Sodium channel subunit beta-4
Source.5883: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1
Source.5884: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.5885: DFBPPR18609 ---- Animal proteins ---- ERO1-like protein alpha
Source.5886: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.5887: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.5888: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial
Source.5889: DFBPPR18614 ---- Animal proteins ---- Beta-enolase
Source.5890: DFBPPR18616 ---- Animal proteins ---- Organic solute transporter subunit alpha
Source.5891: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.5892: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta
Source.5893: DFBPPR18619 ---- Animal proteins ---- Ras-related protein Rab-7b
Source.5894: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.5895: DFBPPR18621 ---- Animal proteins ---- Cytochrome b561
Source.5896: DFBPPR18622 ---- Animal proteins ---- CYFIP-related Rac1 interactor B
Source.5897: DFBPPR18623 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial
Source.5898: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.5899: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.5900: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4
Source.5901: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.5902: DFBPPR18630 ---- Animal proteins ---- Phosphoserine phosphatase
Source.5903: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14
Source.5904: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.5905: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.5906: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4
Source.5907: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.5908: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1
Source.5909: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2
Source.5910: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1
Source.5911: DFBPPR18649 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.5912: DFBPPR18653 ---- Animal proteins ---- Palmitoyltransferase ZDHHC21
Source.5913: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.5914: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial
Source.5915: DFBPPR18698 ---- Animal proteins ---- ATPase GET3
Source.5916: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.5917: DFBPPR18702 ---- Animal proteins ---- E3 ubiquitin-protein ligase E3D
Source.5918: DFBPPR18703 ---- Animal proteins ---- Thialysine N-epsilon-acetyltransferase
Source.5919: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.5920: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.5921: DFBPPR18707 ---- Animal proteins ---- Hepatoma-derived growth factor
Source.5922: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3
Source.5923: DFBPPR18710 ---- Animal proteins ---- Pyridoxine-5'-phosphate oxidase
Source.5924: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.5925: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4
Source.5926: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.5927: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor
Source.5928: DFBPPR18718 ---- Animal proteins ---- Chondroadherin
Source.5929: DFBPPR18720 ---- Animal proteins ---- Protein quaking
Source.5930: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2
Source.5931: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor
Source.5932: DFBPPR18726 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF2
Source.5933: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.5934: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.5935: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.5936: DFBPPR18736 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.5937: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.5938: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.5939: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7
Source.5940: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.5941: DFBPPR18742 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor II
Source.5942: DFBPPR18743 ---- Animal proteins ---- Sperm-egg fusion protein TMEM95
Source.5943: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor
Source.5944: DFBPPR18746 ---- Animal proteins ---- Anamorsin
Source.5945: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1
Source.5946: DFBPPR18748 ---- Animal proteins ---- Ras-related protein Rab-4A
Source.5947: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.5948: DFBPPR18750 ---- Animal proteins ---- Alpha-N-acetylneuraminide alpha-2,8-sialyltransferase
Source.5949: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.5950: DFBPPR18752 ---- Animal proteins ---- Serine/arginine-rich splicing factor 3
Source.5951: DFBPPR18754 ---- Animal proteins ---- Collectin-11
Source.5952: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.5953: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase
Source.5954: DFBPPR18758 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 3
Source.5955: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.5956: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.5957: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3
Source.5958: DFBPPR18766 ---- Animal proteins ---- Negative elongation factor E
Source.5959: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein
Source.5960: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.5961: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9
Source.5962: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.5963: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9
Source.5964: DFBPPR18775 ---- Animal proteins ---- tRNA methyltransferase 10 homolog A
Source.5965: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1
Source.5966: DFBPPR18778 ---- Animal proteins ---- Erlin-2
Source.5967: DFBPPR18783 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-A
Source.5968: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.5969: DFBPPR18785 ---- Animal proteins ---- Protein lin-7 homolog C
Source.5970: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.5971: DFBPPR18787 ---- Animal proteins ---- Rho-related GTP-binding protein RhoU
Source.5972: DFBPPR18788 ---- Animal proteins ---- Ceramide-1-phosphate transfer protein
Source.5973: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav
Source.5974: DFBPPR18791 ---- Animal proteins ---- Small nuclear ribonucleoprotein Sm D2
Source.5975: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba
Source.5976: DFBPPR18795 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C2
Source.5977: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A
Source.5978: DFBPPR18797 ---- Animal proteins ---- UV excision repair protein RAD23 homolog A
Source.5979: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.5980: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.5981: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8
Source.5982: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.5983: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8
Source.5984: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.5985: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.5986: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.5987: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1
Source.5988: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.5989: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.5990: DFBPPR18814 ---- Animal proteins ---- Sulfotransferase 1A1
Source.5991: DFBPPR18815 ---- Animal proteins ---- Pantetheinase
Source.5992: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.5993: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.5994: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.5995: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.5996: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2
Source.5997: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase
Source.5998: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.5999: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.6000: DFBPPR18825 ---- Animal proteins ---- Glutaredoxin-1
Source.6001: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6
Source.6002: DFBPPR18830 ---- Animal proteins ---- Gamma-secretase subunit PEN-2
Source.6003: DFBPPR18831 ---- Animal proteins ---- Peroxiredoxin-1
Source.6004: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.6005: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.6006: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.6007: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B
Source.6008: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.6009: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.6010: DFBPPR18846 ---- Animal proteins ---- Sex-determining region Y protein
Source.6011: DFBPPR18847 ---- Animal proteins ---- Heme oxygenase 1
Source.6012: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.6013: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.6014: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.6015: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.6016: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase
Source.6017: DFBPPR18859 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.6018: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2
Source.6019: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase
Source.6020: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7
Source.6021: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.6022: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A
Source.6023: DFBPPR18868 ---- Animal proteins ---- Haptoglobin
Source.6024: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.6025: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.6026: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.6027: DFBPPR18874 ---- Animal proteins ---- Acyl-protein thioesterase 1
Source.6028: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.6029: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.6030: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.6031: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.6032: DFBPPR18879 ---- Animal proteins ---- Corrinoid adenosyltransferase
Source.6033: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1
Source.6034: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.6035: DFBPPR18896 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.6036: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20
Source.6037: DFBPPR18898 ---- Animal proteins ---- Complexin-3
Source.6038: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.6039: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.6040: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase
Source.6041: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.6042: DFBPPR18904 ---- Animal proteins ---- Protein KASH5
Source.6043: DFBPPR18905 ---- Animal proteins ---- Beta-catenin-interacting protein 1
Source.6044: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.6045: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless
Source.6046: DFBPPR18908 ---- Animal proteins ---- Proteasome subunit alpha type-6
Source.6047: DFBPPR18909 ---- Animal proteins ---- Enolase-phosphatase E1
Source.6048: DFBPPR18910 ---- Animal proteins ---- Aspartyl aminopeptidase
Source.6049: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.6050: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.6051: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3
Source.6052: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.6053: DFBPPR18919 ---- Animal proteins ---- Dual specificity protein phosphatase 18
Source.6054: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11
Source.6055: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.6056: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b
Source.6057: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.6058: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.6059: DFBPPR18927 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 5
Source.6060: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.6061: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.6062: DFBPPR18931 ---- Animal proteins ---- Ficolin-2
Source.6063: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta
Source.6064: DFBPPR18933 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.6065: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108
Source.6066: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.6067: DFBPPR18937 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2-binding protein
Source.6068: DFBPPR18939 ---- Animal proteins ---- Acylpyruvase FAHD1, mitochondrial
Source.6069: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.6070: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2
Source.6071: DFBPPR18945 ---- Animal proteins ---- Stanniocalcin-1
Source.6072: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.6073: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.6074: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3
Source.6075: DFBPPR18951 ---- Animal proteins ---- DNA excision repair protein ERCC-8
Source.6076: DFBPPR18952 ---- Animal proteins ---- Serotransferrin
Source.6077: DFBPPR18955 ---- Animal proteins ---- Lymphotoxin-alpha
Source.6078: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1
Source.6079: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.6080: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase
Source.6081: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.6082: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A
Source.6083: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.6084: DFBPPR18964 ---- Animal proteins ---- Placental prolactin-related protein 1
Source.6085: DFBPPR18966 ---- Animal proteins ---- Lupus La protein homolog
Source.6086: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1
Source.6087: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.6088: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase
Source.6089: DFBPPR18972 ---- Animal proteins ---- Lysozyme-like protein 6
Source.6090: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb
Source.6091: DFBPPR18974 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.6092: DFBPPR18975 ---- Animal proteins ---- Ribosome maturation protein SBDS
Source.6093: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3
Source.6094: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.6095: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.6096: DFBPPR18980 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.6097: DFBPPR18981 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.6098: DFBPPR18984 ---- Animal proteins ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.6099: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase
Source.6100: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.6101: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.6102: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6
Source.6103: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.6104: DFBPPR18993 ---- Animal proteins ---- Dynein regulatory complex protein 1
Source.6105: DFBPPR18994 ---- Animal proteins ---- Breast cancer anti-estrogen resistance protein 3 homolog
Source.6106: DFBPPR18995 ---- Animal proteins ---- Tektin-3
Source.6107: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.6108: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74
Source.6109: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I
Source.6110: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter
Source.6111: DFBPPR19003 ---- Animal proteins ---- Protein lin-7 homolog A
Source.6112: DFBPPR19006 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.6113: DFBPPR19009 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 1
Source.6114: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D
Source.6115: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2
Source.6116: DFBPPR19016 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.6117: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2
Source.6118: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.6119: DFBPPR19022 ---- Animal proteins ---- Spermatogenesis-defective protein 39 homolog
Source.6120: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1
Source.6121: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3
Source.6122: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D
Source.6123: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3
Source.6124: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.6125: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.6126: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.6127: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.6128: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.6129: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11
Source.6130: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.6131: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic
Source.6132: DFBPPR19044 ---- Animal proteins ---- Adenylosuccinate lyase
Source.6133: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1
Source.6134: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.6135: DFBPPR19056 ---- Animal proteins ---- Gastrin
Source.6136: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.6137: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.6138: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.6139: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.6140: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.6141: DFBPPR19065 ---- Animal proteins ---- Cadherin-6
Source.6142: DFBPPR19066 ---- Animal proteins ---- Agouti-signaling protein
Source.6143: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.6144: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1
Source.6145: DFBPPR19069 ---- Animal proteins ---- Small glutamine-rich tetratricopeptide repeat-containing protein alpha
Source.6146: DFBPPR19071 ---- Animal proteins ---- Collectrin
Source.6147: DFBPPR19072 ---- Animal proteins ---- Growth/differentiation factor 9
Source.6148: DFBPPR19073 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 21
Source.6149: DFBPPR19075 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 J2
Source.6150: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1
Source.6151: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3
Source.6152: DFBPPR19082 ---- Animal proteins ---- Protein SCO2 homolog, mitochondrial
Source.6153: DFBPPR19083 ---- Animal proteins ---- UBX domain-containing protein 1
Source.6154: DFBPPR19084 ---- Animal proteins ---- V-type proton ATPase subunit G 1
Source.6155: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.6156: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1
Source.6157: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.6158: DFBPPR19089 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 2
Source.6159: DFBPPR19090 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.6160: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13
Source.6161: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1
Source.6162: DFBPPR19094 ---- Animal proteins ---- C-C motif chemokine 4
Source.6163: DFBPPR19096 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase
Source.6164: DFBPPR19098 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 9
Source.6165: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.6166: DFBPPR19103 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein 70 kDa
Source.6167: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.6168: DFBPPR19105 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein
Source.6169: DFBPPR19106 ---- Animal proteins ---- Natural killer cells antigen CD94
Source.6170: DFBPPR19108 ---- Animal proteins ---- Hepatocyte cell adhesion molecule
Source.6171: DFBPPR19109 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.6172: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B
Source.6173: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.6174: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2
Source.6175: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.6176: DFBPPR19117 ---- Animal proteins ---- Sigma intracellular receptor 2
Source.6177: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.6178: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.6179: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.6180: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.6181: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein
Source.6182: DFBPPR19126 ---- Animal proteins ---- Calpain small subunit 1
Source.6183: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1
Source.6184: DFBPPR19130 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-3 subunit
Source.6185: DFBPPR19131 ---- Animal proteins ---- Nectin-4
Source.6186: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5
Source.6187: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.6188: DFBPPR19137 ---- Animal proteins ---- Serpin H1
Source.6189: DFBPPR19139 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-2
Source.6190: DFBPPR19140 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 5
Source.6191: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8
Source.6192: DFBPPR19143 ---- Animal proteins ---- Mannose-binding protein C
Source.6193: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.6194: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like
Source.6195: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial
Source.6196: DFBPPR19152 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF186
Source.6197: DFBPPR19153 ---- Animal proteins ---- Copine-6
Source.6198: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase
Source.6199: DFBPPR19157 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator
Source.6200: DFBPPR19158 ---- Animal proteins ---- Tuberoinfundibular peptide of 39 residues
Source.6201: DFBPPR19161 ---- Animal proteins ---- Anaphase-promoting complex subunit 11
Source.6202: DFBPPR19162 ---- Animal proteins ---- Macrophage-capping protein
Source.6203: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.6204: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14
Source.6205: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2
Source.6206: DFBPPR19172 ---- Animal proteins ---- Persulfide dioxygenase ETHE1, mitochondrial
Source.6207: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.6208: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3
Source.6209: DFBPPR19181 ---- Animal proteins ---- Solute carrier family 25 member 33
Source.6210: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase
Source.6211: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.6212: DFBPPR19184 ---- Animal proteins ---- Alpha-soluble NSF attachment protein
Source.6213: DFBPPR19186 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.6214: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.6215: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4
Source.6216: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma
Source.6217: DFBPPR19191 ---- Animal proteins ---- Protein unc-119 homolog A
Source.6218: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.6219: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.6220: DFBPPR19196 ---- Animal proteins ---- Melanoma-derived growth regulatory protein
Source.6221: DFBPPR19197 ---- Animal proteins ---- Protein LSM14 homolog A
Source.6222: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5
Source.6223: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial
Source.6224: DFBPPR19202 ---- Animal proteins ---- Zinc finger protein 639
Source.6225: DFBPPR19203 ---- Animal proteins ---- Mitochondrial inner membrane protease subunit 2
Source.6226: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7
Source.6227: DFBPPR19205 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF169
Source.6228: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7
Source.6229: DFBPPR19209 ---- Animal proteins ---- mRNA export factor
Source.6230: DFBPPR19213 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 2
Source.6231: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.6232: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.6233: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.6234: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3
Source.6235: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.6236: DFBPPR19222 ---- Animal proteins ---- Interferon alpha-H
Source.6237: DFBPPR19223 ---- Animal proteins ---- Caveolae-associated protein 4
Source.6238: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1
Source.6239: DFBPPR19228 ---- Animal proteins ---- Myotrophin
Source.6240: DFBPPR19229 ---- Animal proteins ---- Interferon alpha-F
Source.6241: DFBPPR19230 ---- Animal proteins ---- Interferon alpha-G
Source.6242: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase
Source.6243: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1
Source.6244: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial
Source.6245: DFBPPR19237 ---- Animal proteins ---- Cadherin-18
Source.6246: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.6247: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.6248: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.6249: DFBPPR19242 ---- Animal proteins ---- Tryptophan 2,3-dioxygenase
Source.6250: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.6251: DFBPPR19245 ---- Animal proteins ---- Glutamate--cysteine ligase regulatory subunit
Source.6252: DFBPPR19247 ---- Animal proteins ---- Calmegin
Source.6253: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.6254: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.6255: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.6256: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.6257: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B
Source.6258: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.6259: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.6260: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2
Source.6261: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3
Source.6262: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28
Source.6263: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.6264: DFBPPR19263 ---- Animal proteins ---- Proteasome subunit beta type-2
Source.6265: DFBPPR19264 ---- Animal proteins ---- Claudin-16
Source.6266: DFBPPR19266 ---- Animal proteins ---- Ubiquitin/ISG15-conjugating enzyme E2 L6
Source.6267: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.6268: DFBPPR19271 ---- Animal proteins ---- Transcriptional and immune response regulator
Source.6269: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1
Source.6270: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.6271: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1
Source.6272: DFBPPR19284 ---- Animal proteins ---- Protein lifeguard 2
Source.6273: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.6274: DFBPPR19287 ---- Animal proteins ---- Rab-like protein 3
Source.6275: DFBPPR19288 ---- Animal proteins ---- Interferon alpha-C
Source.6276: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.6277: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1
Source.6278: DFBPPR19291 ---- Animal proteins ---- Multicilin
Source.6279: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.6280: DFBPPR19293 ---- Animal proteins ---- Myosin light polypeptide 6
Source.6281: DFBPPR19294 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I
Source.6282: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D
Source.6283: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.6284: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.6285: DFBPPR19301 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF220
Source.6286: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12
Source.6287: DFBPPR19303 ---- Animal proteins ---- Microsomal glutathione S-transferase 1
Source.6288: DFBPPR19304 ---- Animal proteins ---- Retinal cone rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit gamma
Source.6289: DFBPPR19305 ---- Animal proteins ---- Beta-crystallin B3
Source.6290: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.6291: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1
Source.6292: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1
Source.6293: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.6294: DFBPPR19312 ---- Animal proteins ---- Copine-1
Source.6295: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.6296: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47
Source.6297: DFBPPR19316 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 2, mitochondrial
Source.6298: DFBPPR19319 ---- Animal proteins ---- Exopolyphosphatase PRUNE1
Source.6299: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.6300: DFBPPR19322 ---- Animal proteins ---- Interferon alpha-A
Source.6301: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1
Source.6302: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2
Source.6303: DFBPPR19327 ---- Animal proteins ---- DNA repair protein RAD51 homolog 4
Source.6304: DFBPPR19329 ---- Animal proteins ---- CD302 antigen
Source.6305: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85
Source.6306: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.6307: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.6308: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1
Source.6309: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.6310: DFBPPR19339 ---- Animal proteins ---- Peroxiredoxin-4
Source.6311: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.6312: DFBPPR19343 ---- Animal proteins ---- Interferon alpha-inducible protein 6
Source.6313: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9
Source.6314: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.6315: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD
Source.6316: DFBPPR19348 ---- Animal proteins ---- Twinfilin-1
Source.6317: DFBPPR19349 ---- Animal proteins ---- Zinc transporter 3
Source.6318: DFBPPR19350 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.6319: DFBPPR19351 ---- Animal proteins ---- Caveolae-associated protein 3
Source.6320: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.6321: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.6322: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.6323: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.6324: DFBPPR19361 ---- Animal proteins ---- Retinol dehydrogenase 14
Source.6325: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1
Source.6326: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.6327: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.6328: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.6329: DFBPPR19368 ---- Animal proteins ---- Prion-like protein doppel
Source.6330: DFBPPR19372 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.6331: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.6332: DFBPPR19375 ---- Animal proteins ---- ATPase family AAA domain-containing protein 1
Source.6333: DFBPPR19376 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, testis-specific
Source.6334: DFBPPR19380 ---- Animal proteins ---- Proteasome subunit alpha type-3
Source.6335: DFBPPR19382 ---- Animal proteins ---- Arrestin-C
Source.6336: DFBPPR19384 ---- Animal proteins ---- Complement component C9
Source.6337: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2
Source.6338: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.6339: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129
Source.6340: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.6341: DFBPPR19395 ---- Animal proteins ---- Ras-related protein Rab-5C
Source.6342: DFBPPR19396 ---- Animal proteins ---- SAM and SH3 domain-containing protein 3
Source.6343: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein
Source.6344: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18
Source.6345: DFBPPR19399 ---- Animal proteins ---- UBX domain-containing protein 6
Source.6346: DFBPPR19401 ---- Animal proteins ---- Small integral membrane protein 20
Source.6347: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.6348: DFBPPR19404 ---- Animal proteins ---- Microfibril-associated glycoprotein 4
Source.6349: DFBPPR19406 ---- Animal proteins ---- [3-methyl-2-oxobutanoate dehydrogenase [lipoamide]] kinase, mitochondrial
Source.6350: DFBPPR19409 ---- Animal proteins ---- Hyaluronan-binding protein 2
Source.6351: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F
Source.6352: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.6353: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.6354: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.6355: DFBPPR19416 ---- Animal proteins ---- Gamma-glutamyl hydrolase
Source.6356: DFBPPR19417 ---- Animal proteins ---- L-xylulose reductase
Source.6357: DFBPPR19418 ---- Animal proteins ---- Pterin-4-alpha-carbinolamine dehydratase
Source.6358: DFBPPR19419 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.6359: DFBPPR19420 ---- Animal proteins ---- Peripheral myelin protein 22
Source.6360: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2
Source.6361: DFBPPR19427 ---- Animal proteins ---- Probable tRNA(His) guanylyltransferase
Source.6362: DFBPPR19429 ---- Animal proteins ---- Protein Spindly
Source.6363: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70
Source.6364: DFBPPR19434 ---- Animal proteins ---- Interferon alpha-B
Source.6365: DFBPPR19435 ---- Animal proteins ---- Interferon alpha-D
Source.6366: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor
Source.6367: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59
Source.6368: DFBPPR19442 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit G
Source.6369: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.6370: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.6371: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2
Source.6372: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.6373: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.6374: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.6375: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.6376: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.6377: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2
Source.6378: DFBPPR19459 ---- Animal proteins ---- UV excision repair protein RAD23 homolog B
Source.6379: DFBPPR19460 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase NIMA-interacting 4
Source.6380: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.6381: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.6382: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.6383: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137
Source.6384: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.6385: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1
Source.6386: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.6387: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.6388: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.6389: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.6390: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.6391: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.6392: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase
Source.6393: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13
Source.6394: DFBPPR19484 ---- Animal proteins ---- Protein lin-7 homolog B
Source.6395: DFBPPR19486 ---- Animal proteins ---- Probable dimethyladenosine transferase
Source.6396: DFBPPR19488 ---- Animal proteins ---- Placental prolactin-related protein 3
Source.6397: DFBPPR19489 ---- Animal proteins ---- Keratocan
Source.6398: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.6399: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.6400: DFBPPR19494 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 1
Source.6401: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.6402: DFBPPR19496 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.6403: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73
Source.6404: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.6405: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72
Source.6406: DFBPPR19503 ---- Animal proteins ---- DCN1-like protein 5
Source.6407: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.6408: DFBPPR19505 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein N
Source.6409: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.6410: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.6411: DFBPPR19512 ---- Animal proteins ---- Centrin-1
Source.6412: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2
Source.6413: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.6414: DFBPPR19516 ---- Animal proteins ---- Protein phosphatase 1L
Source.6415: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.6416: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2
Source.6417: DFBPPR19519 ---- Animal proteins ---- DnaJ homolog subfamily C member 24
Source.6418: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.6419: DFBPPR19525 ---- Animal proteins ---- Tomoregulin-2
Source.6420: DFBPPR19526 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase E
Source.6421: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A
Source.6422: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.6423: DFBPPR19530 ---- Animal proteins ---- Tuftelin
Source.6424: DFBPPR19531 ---- Animal proteins ---- Interferon omega-1
Source.6425: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase
Source.6426: DFBPPR19535 ---- Animal proteins ---- Probable 18S rRNA (guanine-N(7))-methyltransferase
Source.6427: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3
Source.6428: DFBPPR19539 ---- Animal proteins ---- MICOS complex subunit MIC19
Source.6429: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.6430: DFBPPR19546 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 1, mitochondrial
Source.6431: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3
Source.6432: DFBPPR19548 ---- Animal proteins ---- Reticulophagy regulator 1
Source.6433: DFBPPR19550 ---- Animal proteins ---- Coatomer subunit zeta-1
Source.6434: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.6435: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.6436: DFBPPR19557 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.6437: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9
Source.6438: DFBPPR19559 ---- Animal proteins ---- CCN family member 2
Source.6439: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.6440: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.6441: DFBPPR19563 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit K
Source.6442: DFBPPR19565 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 4
Source.6443: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.6444: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.6445: DFBPPR19568 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin
Source.6446: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.6447: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.6448: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.6449: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.6450: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.6451: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.6452: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial
Source.6453: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.6454: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.6455: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2
Source.6456: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.6457: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1
Source.6458: DFBPPR19585 ---- Animal proteins ---- Interferon alpha-1
Source.6459: DFBPPR19586 ---- Animal proteins ---- Uridine-cytidine kinase 1
Source.6460: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C
Source.6461: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2
Source.6462: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1
Source.6463: DFBPPR19592 ---- Animal proteins ---- Ras-related protein Rab-18
Source.6464: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.6465: DFBPPR19594 ---- Animal proteins ---- CDGSH iron-sulfur domain-containing protein 1
Source.6466: DFBPPR19595 ---- Animal proteins ---- CDGSH iron-sulfur domain-containing protein 1
Source.6467: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin
Source.6468: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.6469: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein
Source.6470: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.6471: DFBPPR19607 ---- Animal proteins ---- Obg-like ATPase 1
Source.6472: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.6473: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2
Source.6474: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase
Source.6475: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.6476: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.6477: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5
Source.6478: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.6479: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS
Source.6480: DFBPPR19621 ---- Animal proteins ---- Aspartoacylase
Source.6481: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1
Source.6482: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2
Source.6483: DFBPPR19629 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide FF
Source.6484: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.6485: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase
Source.6486: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25
Source.6487: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.6488: DFBPPR19640 ---- Animal proteins ---- Prolargin
Source.6489: DFBPPR19642 ---- Animal proteins ---- Agouti-related protein
Source.6490: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.6491: DFBPPR19645 ---- Animal proteins ---- Barrier-to-autointegration factor
Source.6492: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial
Source.6493: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.6494: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase
Source.6495: DFBPPR19656 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.6496: DFBPPR19657 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.6497: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.6498: DFBPPR19659 ---- Animal proteins ---- 39S ribosomal protein L9, mitochondrial
Source.6499: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.6500: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator
Source.6501: DFBPPR19664 ---- Animal proteins ---- Protein OS-9
Source.6502: DFBPPR19665 ---- Animal proteins ---- Thioredoxin, mitochondrial
Source.6503: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1
Source.6504: DFBPPR19667 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 2
Source.6505: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.6506: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.6507: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein
Source.6508: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.6509: DFBPPR19678 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 5
Source.6510: DFBPPR19680 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.6511: DFBPPR19683 ---- Animal proteins ---- COMM domain-containing protein 1
Source.6512: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.6513: DFBPPR19687 ---- Animal proteins ---- Cytochrome b ascorbate-dependent protein 3
Source.6514: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.6515: DFBPPR19689 ---- Animal proteins ---- Ecto-ADP-ribosyltransferase 5
Source.6516: DFBPPR19693 ---- Animal proteins ---- Type 2 lactosamine alpha-2,3-sialyltransferase
Source.6517: DFBPPR19695 ---- Animal proteins ---- Protein UXT
Source.6518: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.6519: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3
Source.6520: DFBPPR19701 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.6521: DFBPPR19702 ---- Animal proteins ---- Placental prolactin-related protein 4
Source.6522: DFBPPR19703 ---- Animal proteins ---- Claudin-10
Source.6523: DFBPPR19704 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29
Source.6524: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.6525: DFBPPR19707 ---- Animal proteins ---- Neurotensin/neuromedin N
Source.6526: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.6527: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.6528: DFBPPR19711 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 2
Source.6529: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205
Source.6530: DFBPPR19715 ---- Animal proteins ---- Chorionic somatomammotropin hormone 2
Source.6531: DFBPPR19716 ---- Animal proteins ---- Proteasome subunit beta type-1
Source.6532: DFBPPR19717 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM14
Source.6533: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.6534: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4
Source.6535: DFBPPR19725 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 1
Source.6536: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2
Source.6537: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.6538: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.6539: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.6540: DFBPPR19738 ---- Animal proteins ---- Translocator protein
Source.6541: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1
Source.6542: DFBPPR19744 ---- Animal proteins ---- Placental prolactin-related protein 2
Source.6543: DFBPPR19745 ---- Animal proteins ---- Collectin-46
Source.6544: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase
Source.6545: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3
Source.6546: DFBPPR19751 ---- Animal proteins ---- Glucosamine-6-phosphate isomerase 1
Source.6547: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2
Source.6548: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase
Source.6549: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1
Source.6550: DFBPPR19756 ---- Animal proteins ---- Ras-related protein Rab-1B
Source.6551: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1
Source.6552: DFBPPR19758 ---- Animal proteins ---- MICOS complex subunit MIC25
Source.6553: DFBPPR19760 ---- Animal proteins ---- Protein phosphatase 1K, mitochondrial
Source.6554: DFBPPR19761 ---- Animal proteins ---- N-chimaerin
Source.6555: DFBPPR19762 ---- Animal proteins ---- Mitochondrial fission factor
Source.6556: DFBPPR19763 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.6557: DFBPPR19764 ---- Animal proteins ---- Bcl-2-like protein 2
Source.6558: DFBPPR19765 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.6559: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1
Source.6560: DFBPPR19767 ---- Animal proteins ---- F-box/LRR-repeat protein 15
Source.6561: DFBPPR19768 ---- Animal proteins ---- Peroxynitrite isomerase THAP4
Source.6562: DFBPPR19769 ---- Animal proteins ---- Septin-14
Source.6563: DFBPPR19771 ---- Animal proteins ---- Rho-related GTP-binding protein RhoH
Source.6564: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase
Source.6565: DFBPPR19773 ---- Animal proteins ---- KRR1 small subunit processome component homolog
Source.6566: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.6567: DFBPPR19777 ---- Animal proteins ---- Translin
Source.6568: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.6569: DFBPPR19781 ---- Animal proteins ---- Secretory carrier-associated membrane protein 5
Source.6570: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A
Source.6571: DFBPPR19786 ---- Animal proteins ---- Chorionic somatomammotropin hormone 1
Source.6572: DFBPPR19788 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.6573: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.6574: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4
Source.6575: DFBPPR19791 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif protein 1
Source.6576: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.6577: DFBPPR19798 ---- Animal proteins ---- Uricase
Source.6578: DFBPPR19799 ---- Animal proteins ---- Migration and invasion enhancer 1
Source.6579: DFBPPR19800 ---- Animal proteins ---- Microsomal glutathione S-transferase 3
Source.6580: DFBPPR19801 ---- Animal proteins ---- Outer dense fiber protein 2
Source.6581: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1
Source.6582: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.6583: DFBPPR19809 ---- Animal proteins ---- Hippocalcin-like protein 4
Source.6584: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.6585: DFBPPR19815 ---- Animal proteins ---- V-type proton ATPase subunit E 1
Source.6586: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog
Source.6587: DFBPPR19818 ---- Animal proteins ---- Protein YIPF6
Source.6588: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.6589: DFBPPR19820 ---- Animal proteins ---- Septin-10
Source.6590: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.6591: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.6592: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.6593: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.6594: DFBPPR19830 ---- Animal proteins ---- Sesquipedalian-2
Source.6595: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3
Source.6596: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.6597: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.6598: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2
Source.6599: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.6600: DFBPPR19837 ---- Animal proteins ---- Ribonuclease P protein subunit p30
Source.6601: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.6602: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.6603: DFBPPR19844 ---- Animal proteins ---- Prosalusin
Source.6604: DFBPPR19845 ---- Animal proteins ---- Beta-soluble NSF attachment protein
Source.6605: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C
Source.6606: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.6607: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.6608: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.6609: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase
Source.6610: DFBPPR19858 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A
Source.6611: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B
Source.6612: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2
Source.6613: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2
Source.6614: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.6615: DFBPPR19863 ---- Animal proteins ---- Dihydropteridine reductase
Source.6616: DFBPPR19864 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B
Source.6617: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.6618: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.6619: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.6620: DFBPPR19870 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.6621: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.6622: DFBPPR19875 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 26A
Source.6623: DFBPPR19876 ---- Animal proteins ---- Placenta-expressed transcript 1 protein
Source.6624: DFBPPR19877 ---- Animal proteins ---- Histone H3-like centromeric protein A
Source.6625: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14
Source.6626: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.6627: DFBPPR19882 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.6628: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.6629: DFBPPR19884 ---- Animal proteins ---- Activator of basal transcription 1
Source.6630: DFBPPR19890 ---- Animal proteins ---- Protein N-terminal glutamine amidohydrolase
Source.6631: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta
Source.6632: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60
Source.6633: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6
Source.6634: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic
Source.6635: DFBPPR19905 ---- Animal proteins ---- Complement component C6
Source.6636: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.6637: DFBPPR19909 ---- Animal proteins ---- Probable C->U-editing enzyme APOBEC-2
Source.6638: DFBPPR19911 ---- Animal proteins ---- Guided entry of tail-anchored proteins factor 1
Source.6639: DFBPPR19912 ---- Animal proteins ---- GrpE protein homolog 1, mitochondrial
Source.6640: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial
Source.6641: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.6642: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.6643: DFBPPR19920 ---- Animal proteins ---- Proteasome subunit alpha type-7
Source.6644: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.6645: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3
Source.6646: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.6647: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.6648: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase
Source.6649: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1
Source.6650: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2
Source.6651: DFBPPR19935 ---- Animal proteins ---- Reticulon-3
Source.6652: DFBPPR19938 ---- Animal proteins ---- Serine/threonine-protein phosphatase CPPED1
Source.6653: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform
Source.6654: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7
Source.6655: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80
Source.6656: DFBPPR19944 ---- Animal proteins ---- Histone H1.0
Source.6657: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B
Source.6658: DFBPPR19948 ---- Animal proteins ---- Tensin-4
Source.6659: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial
Source.6660: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2
Source.6661: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.6662: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.6663: DFBPPR19957 ---- Animal proteins ---- Gap junction beta-2 protein
Source.6664: DFBPPR19958 ---- Animal proteins ---- 60S ribosomal protein L10
Source.6665: DFBPPR19959 ---- Animal proteins ---- Complement C1q subcomponent subunit B
Source.6666: DFBPPR19960 ---- Animal proteins ---- 60S ribosomal protein L24
Source.6667: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14
Source.6668: DFBPPR19964 ---- Animal proteins ---- MKI67 FHA domain-interacting nucleolar phosphoprotein
Source.6669: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2
Source.6670: DFBPPR19970 ---- Animal proteins ---- 14-3-3 protein gamma
Source.6671: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z
Source.6672: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.6673: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor
Source.6674: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.6675: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27
Source.6676: DFBPPR19979 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein
Source.6677: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1
Source.6678: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.6679: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7
Source.6680: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2
Source.6681: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20
Source.6682: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein
Source.6683: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.6684: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3
Source.6685: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.6686: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1
Source.6687: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase
Source.6688: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein
Source.6689: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer
Source.6690: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.6691: DFBPPR20007 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETMAR
Source.6692: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3
Source.6693: DFBPPR20010 ---- Animal proteins ---- Craniofacial development protein 1
Source.6694: DFBPPR20011 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM17
Source.6695: DFBPPR20012 ---- Animal proteins ---- Zinc transporter ZIP12
Source.6696: DFBPPR20013 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit gamma
Source.6697: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.6698: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.6699: DFBPPR20017 ---- Animal proteins ---- Lysoplasmalogenase
Source.6700: DFBPPR20020 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.6701: DFBPPR20021 ---- Animal proteins ---- Neugrin
Source.6702: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.6703: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7
Source.6704: DFBPPR20026 ---- Animal proteins ---- Mitochondrial ribosome-associated GTPase 1
Source.6705: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12
Source.6706: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.6707: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.6708: DFBPPR20030 ---- Animal proteins ---- Calumenin
Source.6709: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4
Source.6710: DFBPPR20032 ---- Animal proteins ---- Annexin A9
Source.6711: DFBPPR20033 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 9
Source.6712: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta
Source.6713: DFBPPR20038 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 20
Source.6714: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.6715: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.6716: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase
Source.6717: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1
Source.6718: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1
Source.6719: DFBPPR20044 ---- Animal proteins ---- Secernin-1
Source.6720: DFBPPR20047 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 11B
Source.6721: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.6722: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase
Source.6723: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1
Source.6724: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.6725: DFBPPR20055 ---- Animal proteins ---- Myelin protein zero-like protein 1
Source.6726: DFBPPR20058 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2
Source.6727: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.6728: DFBPPR20062 ---- Animal proteins ---- 39S ribosomal protein L20, mitochondrial
Source.6729: DFBPPR20063 ---- Animal proteins ---- Histone H2B subacrosomal variant
Source.6730: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.6731: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.6732: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26
Source.6733: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4
Source.6734: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase
Source.6735: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1
Source.6736: DFBPPR20076 ---- Animal proteins ---- General transcription factor IIF subunit 2
Source.6737: DFBPPR20078 ---- Animal proteins ---- Ragulator complex protein LAMTOR2
Source.6738: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.6739: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B
Source.6740: DFBPPR20081 ---- Animal proteins ---- ADP-ribosylation factor-related protein 1
Source.6741: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1
Source.6742: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1
Source.6743: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47
Source.6744: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.6745: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.6746: DFBPPR20090 ---- Animal proteins ---- Cytochrome P450 2A
Source.6747: DFBPPR20091 ---- Animal proteins ---- Carboxypeptidase O
Source.6748: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.6749: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6
Source.6750: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1
Source.6751: DFBPPR20099 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit WDR4
Source.6752: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1
Source.6753: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.6754: DFBPPR20103 ---- Animal proteins ---- Protein MAL2
Source.6755: DFBPPR20105 ---- Animal proteins ---- Poly(U)-specific endoribonuclease
Source.6756: DFBPPR20106 ---- Animal proteins ---- Visinin-like protein 1
Source.6757: DFBPPR20109 ---- Animal proteins ---- Ovarian cancer G-protein coupled receptor 1
Source.6758: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.6759: DFBPPR20112 ---- Animal proteins ---- Proteasome assembly chaperone 1
Source.6760: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2
Source.6761: DFBPPR20126 ---- Animal proteins ---- 39S ribosomal protein L44, mitochondrial
Source.6762: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase
Source.6763: DFBPPR20130 ---- Animal proteins ---- Stathmin
Source.6764: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.6765: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.6766: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.6767: DFBPPR20143 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C
Source.6768: DFBPPR20144 ---- Animal proteins ---- Destrin
Source.6769: DFBPPR20146 ---- Animal proteins ---- Syntaxin-binding protein 6
Source.6770: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1
Source.6771: DFBPPR20149 ---- Animal proteins ---- Flotillin-2
Source.6772: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.6773: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.6774: DFBPPR20160 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.6775: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog
Source.6776: DFBPPR20164 ---- Animal proteins ---- Glucosamine-6-phosphate isomerase 2
Source.6777: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2
Source.6778: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1
Source.6779: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1
Source.6780: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.6781: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.6782: DFBPPR20176 ---- Animal proteins ---- Wiskott-Aldrich syndrome protein family member 2
Source.6783: DFBPPR20178 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.6784: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase
Source.6785: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.6786: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.6787: DFBPPR20182 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.6788: DFBPPR20183 ---- Animal proteins ---- Mitochondrial intermembrane space import and assembly protein 40
Source.6789: DFBPPR20184 ---- Animal proteins ---- Centromere protein H
Source.6790: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7
Source.6791: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.6792: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.6793: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.6794: DFBPPR20195 ---- Animal proteins ---- GSK3B-interacting protein
Source.6795: DFBPPR20198 ---- Animal proteins ---- Calcium-binding protein 2
Source.6796: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.6797: DFBPPR20201 ---- Animal proteins ---- PDZ and LIM domain protein 7
Source.6798: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial
Source.6799: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial
Source.6800: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.6801: DFBPPR20208 ---- Animal proteins ---- Myeloid leukemia factor 1
Source.6802: DFBPPR20210 ---- Animal proteins ---- Exonuclease V
Source.6803: DFBPPR20214 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.6804: DFBPPR20215 ---- Animal proteins ---- Caspase-3
Source.6805: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator
Source.6806: DFBPPR20217 ---- Animal proteins ---- Cytochrome c oxidase assembly factor 8
Source.6807: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1
Source.6808: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.6809: DFBPPR20221 ---- Animal proteins ---- CD99 antigen-like protein 2
Source.6810: DFBPPR20224 ---- Animal proteins ---- Sclerostin
Source.6811: DFBPPR20226 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.6812: DFBPPR20227 ---- Animal proteins ---- 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline decarboxylase
Source.6813: DFBPPR20228 ---- Animal proteins ---- Keratin, type II cytoskeletal 7
Source.6814: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.6815: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase
Source.6816: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2
Source.6817: DFBPPR20240 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.6818: DFBPPR20241 ---- Animal proteins ---- Ras-related protein Rab-8B
Source.6819: DFBPPR20242 ---- Animal proteins ---- Coactosin-like protein
Source.6820: DFBPPR20243 ---- Animal proteins ---- Tissue factor pathway inhibitor 2
Source.6821: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.6822: DFBPPR20245 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial
Source.6823: DFBPPR20247 ---- Animal proteins ---- Claudin-15
Source.6824: DFBPPR20250 ---- Animal proteins ---- General transcription factor IIH subunit 5
Source.6825: DFBPPR20252 ---- Animal proteins ---- Myosin regulatory light chain 2, ventricular/cardiac muscle isoform
Source.6826: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A
Source.6827: DFBPPR20254 ---- Animal proteins ---- Leukemia inhibitory factor
Source.6828: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2
Source.6829: DFBPPR20256 ---- Animal proteins ---- Leukocyte surface antigen CD53
Source.6830: DFBPPR20257 ---- Animal proteins ---- Targeting protein for Xklp2
Source.6831: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1
Source.6832: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79
Source.6833: DFBPPR20261 ---- Animal proteins ---- Protein SCO1 homolog, mitochondrial
Source.6834: DFBPPR20269 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor
Source.6835: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.6836: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2
Source.6837: DFBPPR20274 ---- Animal proteins ---- Phospholipase A1 member A
Source.6838: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.6839: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1
Source.6840: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.6841: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.6842: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2
Source.6843: DFBPPR20282 ---- Animal proteins ---- SOSS complex subunit B2
Source.6844: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.6845: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.6846: DFBPPR20286 ---- Animal proteins ---- Nuclear transcription factor Y subunit beta
Source.6847: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.6848: DFBPPR20288 ---- Animal proteins ---- Golgi phosphoprotein 3-like
Source.6849: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein
Source.6850: DFBPPR20293 ---- Animal proteins ---- Cytosolic arginine sensor for mTORC1 subunit 1
Source.6851: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN
Source.6852: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.6853: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.6854: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator
Source.6855: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3
Source.6856: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial
Source.6857: DFBPPR20304 ---- Animal proteins ---- Nuclear envelope phosphatase-regulatory subunit 1
Source.6858: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.6859: DFBPPR20319 ---- Animal proteins ---- Protein pelota homolog
Source.6860: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2
Source.6861: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.6862: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.6863: DFBPPR20323 ---- Animal proteins ---- Myosin light chain 3
Source.6864: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial
Source.6865: DFBPPR20328 ---- Animal proteins ---- 40S ribosomal protein S23
Source.6866: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.6867: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27
Source.6868: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase
Source.6869: DFBPPR20332 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.6870: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14
Source.6871: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.6872: DFBPPR20337 ---- Animal proteins ---- CST complex subunit STN1
Source.6873: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.6874: DFBPPR20339 ---- Animal proteins ---- 28S ribosomal protein S23, mitochondrial
Source.6875: DFBPPR20340 ---- Animal proteins ---- Peripherin
Source.6876: DFBPPR20345 ---- Animal proteins ---- DnaJ homolog subfamily B member 14
Source.6877: DFBPPR20346 ---- Animal proteins ---- Serpin B6
Source.6878: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.6879: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein
Source.6880: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.6881: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.6882: DFBPPR20356 ---- Animal proteins ---- RNA-binding protein 7
Source.6883: DFBPPR20358 ---- Animal proteins ---- 39S ribosomal protein L34, mitochondrial
Source.6884: DFBPPR20359 ---- Animal proteins ---- Glutathione S-transferase theta-1
Source.6885: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C
Source.6886: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.6887: DFBPPR20362 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase
Source.6888: DFBPPR20365 ---- Animal proteins ---- Interleukin-21
Source.6889: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein
Source.6890: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial
Source.6891: DFBPPR20371 ---- Animal proteins ---- Vesicle-associated membrane protein 4
Source.6892: DFBPPR20372 ---- Animal proteins ---- WASH complex subunit 3
Source.6893: DFBPPR20373 ---- Animal proteins ---- Calcineurin subunit B type 2
Source.6894: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56
Source.6895: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.6896: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4
Source.6897: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.6898: DFBPPR20379 ---- Animal proteins ---- Protein yippee-like 5
Source.6899: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha
Source.6900: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog
Source.6901: DFBPPR20383 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 7, mitochondrial
Source.6902: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.6903: DFBPPR20387 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.6904: DFBPPR20388 ---- Animal proteins ---- SOSS complex subunit C
Source.6905: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.6906: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.6907: DFBPPR20392 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1
Source.6908: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2
Source.6909: DFBPPR20395 ---- Animal proteins ---- GDP-fucose transporter 1
Source.6910: DFBPPR20396 ---- Animal proteins ---- Claudin-5
Source.6911: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.6912: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.6913: DFBPPR20401 ---- Animal proteins ---- Bystin
Source.6914: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.6915: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.6916: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma
Source.6917: DFBPPR20409 ---- Animal proteins ---- DNA damage-regulated autophagy modulator protein 2
Source.6918: DFBPPR20411 ---- Animal proteins ---- Transmembrane protein 106A
Source.6919: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4
Source.6920: DFBPPR20413 ---- Animal proteins ---- 10 kDa heat shock protein, mitochondrial
Source.6921: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.6922: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.6923: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.6924: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor
Source.6925: DFBPPR20422 ---- Animal proteins ---- WD repeat-containing protein 61
Source.6926: DFBPPR20424 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF170
Source.6927: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.6928: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein
Source.6929: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase
Source.6930: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog
Source.6931: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog
Source.6932: DFBPPR20432 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 4
Source.6933: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1
Source.6934: DFBPPR20434 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 1
Source.6935: DFBPPR20435 ---- Animal proteins ---- Leucine-rich glioma-inactivated protein 1
Source.6936: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.6937: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2
Source.6938: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.6939: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4
Source.6940: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.6941: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.6942: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3
Source.6943: DFBPPR20453 ---- Animal proteins ---- Cysteine dioxygenase type 1
Source.6944: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.6945: DFBPPR20458 ---- Animal proteins ---- Putative transcription factor Ovo-like 1
Source.6946: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1
Source.6947: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1
Source.6948: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79
Source.6949: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C
Source.6950: DFBPPR20465 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.6951: DFBPPR20466 ---- Animal proteins ---- Ribonuclease P protein subunit p38
Source.6952: DFBPPR20467 ---- Animal proteins ---- Tetranectin
Source.6953: DFBPPR20471 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.6954: DFBPPR20475 ---- Animal proteins ---- Replication factor C subunit 3
Source.6955: DFBPPR20476 ---- Animal proteins ---- Translocon-associated protein subunit beta
Source.6956: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.6957: DFBPPR20478 ---- Animal proteins ---- Macoilin
Source.6958: DFBPPR20479 ---- Animal proteins ---- Ribonuclease P protein subunit p29
Source.6959: DFBPPR20485 ---- Animal proteins ---- Beta-crystallin A2
Source.6960: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase
Source.6961: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein
Source.6962: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.6963: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.6964: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.6965: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2
Source.6966: DFBPPR20501 ---- Animal proteins ---- 28S ribosomal protein S2, mitochondrial
Source.6967: DFBPPR20504 ---- Animal proteins ---- 28S ribosomal protein S18c, mitochondrial
Source.6968: DFBPPR20506 ---- Animal proteins ---- Akirin-2
Source.6969: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.6970: DFBPPR20510 ---- Animal proteins ---- Josephin-1
Source.6971: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.6972: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29
Source.6973: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial
Source.6974: DFBPPR20515 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 2
Source.6975: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1
Source.6976: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42
Source.6977: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.6978: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.6979: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36
Source.6980: DFBPPR20524 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A
Source.6981: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.6982: DFBPPR20531 ---- Animal proteins ---- Myozenin-2
Source.6983: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.6984: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.6985: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.6986: DFBPPR20538 ---- Animal proteins ---- Signal peptidase complex subunit 3
Source.6987: DFBPPR20539 ---- Animal proteins ---- Regulator of G-protein signaling 16
Source.6988: DFBPPR20540 ---- Animal proteins ---- Structure-specific endonuclease subunit SLX1
Source.6989: DFBPPR20541 ---- Animal proteins ---- Lambda-crystallin homolog
Source.6990: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.6991: DFBPPR20544 ---- Animal proteins ---- 28S ribosomal protein S34, mitochondrial
Source.6992: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.6993: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230
Source.6994: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6
Source.6995: DFBPPR20549 ---- Animal proteins ---- PDZ and LIM domain protein 1
Source.6996: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.6997: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3
Source.6998: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4
Source.6999: DFBPPR20555 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.7000: DFBPPR20556 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.7001: DFBPPR20557 ---- Animal proteins ---- Asporin
Source.7002: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial
Source.7003: DFBPPR20561 ---- Animal proteins ---- Protein cornichon homolog 1
Source.7004: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.7005: DFBPPR20564 ---- Animal proteins ---- Ras-related protein Rab-26
Source.7006: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1
Source.7007: DFBPPR20568 ---- Animal proteins ---- Phenazine biosynthesis-like domain-containing protein
Source.7008: DFBPPR20569 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 10
Source.7009: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.7010: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.7011: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta
Source.7012: DFBPPR20574 ---- Animal proteins ---- Transmembrane protein 201
Source.7013: DFBPPR20577 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor-interacting protein
Source.7014: DFBPPR20578 ---- Animal proteins ---- Protein rogdi homolog
Source.7015: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3
Source.7016: DFBPPR20580 ---- Animal proteins ---- BET1-like protein
Source.7017: DFBPPR20581 ---- Animal proteins ---- Membrane magnesium transporter 1
Source.7018: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.7019: DFBPPR20584 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 5-like protein
Source.7020: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related
Source.7021: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.7022: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3
Source.7023: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16
Source.7024: DFBPPR20594 ---- Animal proteins ---- Vitamin D-binding protein
Source.7025: DFBPPR20595 ---- Animal proteins ---- LHFPL tetraspan subfamily member 4 protein
Source.7026: DFBPPR20597 ---- Animal proteins ---- Protein FAM162A
Source.7027: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.7028: DFBPPR20604 ---- Animal proteins ---- Phosphoinositide-3-kinase-interacting protein 1
Source.7029: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.7030: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.7031: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10
Source.7032: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.7033: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2
Source.7034: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.7035: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase
Source.7036: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.7037: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.7038: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.7039: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2
Source.7040: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1
Source.7041: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5
Source.7042: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2
Source.7043: DFBPPR20624 ---- Animal proteins ---- SUN domain-containing protein 3
Source.7044: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.7045: DFBPPR20626 ---- Animal proteins ---- Melanocortin receptor 5
Source.7046: DFBPPR20627 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.7047: DFBPPR20633 ---- Animal proteins ---- Transmembrane protein 47
Source.7048: DFBPPR20634 ---- Animal proteins ---- GDNF family receptor alpha-2
Source.7049: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.7050: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52
Source.7051: DFBPPR20645 ---- Animal proteins ---- Eukaryotic translation initiation factor 1
Source.7052: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial
Source.7053: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91
Source.7054: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.7055: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa
Source.7056: DFBPPR20656 ---- Animal proteins ---- Protein archease
Source.7057: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.7058: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.7059: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain
Source.7060: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein
Source.7061: DFBPPR20664 ---- Animal proteins ---- General transcription factor IIH subunit 2
Source.7062: DFBPPR20666 ---- Animal proteins ---- Tektin-2
Source.7063: DFBPPR20667 ---- Animal proteins ---- 39S ribosomal protein L13, mitochondrial
Source.7064: DFBPPR20668 ---- Animal proteins ---- BLOC-1-related complex subunit 5
Source.7065: DFBPPR20669 ---- Animal proteins ---- D site-binding protein
Source.7066: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.7067: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.7068: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease
Source.7069: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.7070: DFBPPR20683 ---- Animal proteins ---- Kinetochore protein Spc25
Source.7071: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.7072: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10
Source.7073: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11
Source.7074: DFBPPR20692 ---- Animal proteins ---- ELMO domain-containing protein 3
Source.7075: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.7076: DFBPPR20695 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 28 homolog
Source.7077: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog
Source.7078: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11
Source.7079: DFBPPR20699 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 31
Source.7080: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial
Source.7081: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1
Source.7082: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.7083: DFBPPR20711 ---- Animal proteins ---- Transcription elongation factor, mitochondrial
Source.7084: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.7085: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2
Source.7086: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3
Source.7087: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase
Source.7088: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21
Source.7089: DFBPPR20721 ---- Animal proteins ---- Myomesin-1
Source.7090: DFBPPR20724 ---- Animal proteins ---- Exportin-2
Source.7091: DFBPPR20726 ---- Animal proteins ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.7092: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.7093: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2
Source.7094: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11
Source.7095: DFBPPR20733 ---- Animal proteins ---- Integrator complex subunit 12
Source.7096: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.7097: DFBPPR20740 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 6
Source.7098: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.7099: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1
Source.7100: DFBPPR20747 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7B
Source.7101: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.7102: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7
Source.7103: DFBPPR20756 ---- Animal proteins ---- Myosin regulatory light chain 12B
Source.7104: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9
Source.7105: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45
Source.7106: DFBPPR20759 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform
Source.7107: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2
Source.7108: DFBPPR20762 ---- Animal proteins ---- Mucosal pentraxin
Source.7109: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein
Source.7110: DFBPPR20766 ---- Animal proteins ---- Torsin-2A
Source.7111: DFBPPR20769 ---- Animal proteins ---- Coiled-coil domain-containing protein 69
Source.7112: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.7113: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.7114: DFBPPR20775 ---- Animal proteins ---- Colipase
Source.7115: DFBPPR20776 ---- Animal proteins ---- C4b-binding protein beta chain
Source.7116: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2
Source.7117: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15
Source.7118: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.7119: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial
Source.7120: DFBPPR20785 ---- Animal proteins ---- Ribosomal protein 63, mitochondrial
Source.7121: DFBPPR20791 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 13
Source.7122: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17
Source.7123: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial
Source.7124: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6
Source.7125: DFBPPR20795 ---- Animal proteins ---- Four and a half LIM domains protein 3
Source.7126: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.7127: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.7128: DFBPPR20800 ---- Animal proteins ---- Augurin
Source.7129: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171
Source.7130: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.7131: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.7132: DFBPPR20805 ---- Animal proteins ---- Regulator of G-protein signaling 2
Source.7133: DFBPPR20806 ---- Animal proteins ---- Transcriptional adapter 1
Source.7134: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2
Source.7135: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.7136: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148
Source.7137: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216
Source.7138: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.7139: DFBPPR20815 ---- Animal proteins ---- Translation initiation factor IF-3, mitochondrial
Source.7140: DFBPPR20817 ---- Animal proteins ---- 60S ribosomal protein L3
Source.7141: DFBPPR20818 ---- Animal proteins ---- Protein-lysine N-methyltransferase EEF2KMT
Source.7142: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.7143: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase
Source.7144: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.7145: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.7146: DFBPPR20829 ---- Animal proteins ---- Phospholipid phosphatase 6
Source.7147: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12
Source.7148: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24
Source.7149: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.7150: DFBPPR20837 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.7151: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2
Source.7152: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3
Source.7153: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1
Source.7154: DFBPPR20844 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.7155: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9
Source.7156: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.7157: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.7158: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.7159: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.7160: DFBPPR20851 ---- Animal proteins ---- Fucose mutarotase
Source.7161: DFBPPR20853 ---- Animal proteins ---- Hemopexin
Source.7162: DFBPPR20855 ---- Animal proteins ---- Diphthine methyl ester synthase
Source.7163: DFBPPR20857 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.7164: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial
Source.7165: DFBPPR20859 ---- Animal proteins ---- Trafficking protein particle complex subunit 4
Source.7166: DFBPPR20860 ---- Animal proteins ---- Vesicle-associated membrane protein 5
Source.7167: DFBPPR20861 ---- Animal proteins ---- Zinc finger protein 135
Source.7168: DFBPPR20862 ---- Animal proteins ---- Leucine carboxyl methyltransferase 1
Source.7169: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta
Source.7170: DFBPPR20868 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.7171: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2
Source.7172: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1
Source.7173: DFBPPR20871 ---- Animal proteins ---- Iron-sulfur cluster assembly 2 homolog, mitochondrial
Source.7174: DFBPPR20872 ---- Animal proteins ---- Transmembrane protein 150C
Source.7175: DFBPPR20875 ---- Animal proteins ---- Protein tweety homolog 1
Source.7176: DFBPPR20878 ---- Animal proteins ---- Protein SMG9
Source.7177: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1
Source.7178: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237
Source.7179: DFBPPR20885 ---- Animal proteins ---- Zinc transporter ZIP3
Source.7180: DFBPPR20888 ---- Animal proteins ---- Translocon-associated protein subunit delta
Source.7181: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1
Source.7182: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein
Source.7183: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.7184: DFBPPR20896 ---- Animal proteins ---- Ribonuclease H2 subunit B
Source.7185: DFBPPR20898 ---- Animal proteins ---- Transaldolase
Source.7186: DFBPPR20899 ---- Animal proteins ---- Centrosomal protein kizuna
Source.7187: DFBPPR20900 ---- Animal proteins ---- F-box/LRR-repeat protein 12
Source.7188: DFBPPR20902 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 2 homolog
Source.7189: DFBPPR20903 ---- Animal proteins ---- 40S ribosomal protein S3a
Source.7190: DFBPPR20904 ---- Animal proteins ---- Zinc finger protein 143
Source.7191: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3
Source.7192: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor
Source.7193: DFBPPR20908 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27
Source.7194: DFBPPR20910 ---- Animal proteins ---- Dynein regulatory complex subunit 2
Source.7195: DFBPPR20911 ---- Animal proteins ---- 40S ribosomal protein S20
Source.7196: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668
Source.7197: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.7198: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.7199: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.7200: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.7201: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.7202: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.7203: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1
Source.7204: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta
Source.7205: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial
Source.7206: DFBPPR20930 ---- Animal proteins ---- Centromere protein U
Source.7207: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A
Source.7208: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial
Source.7209: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4
Source.7210: DFBPPR20935 ---- Animal proteins ---- Peroxisomal membrane protein 11A
Source.7211: DFBPPR20936 ---- Animal proteins ---- Transmembrane protein 18
Source.7212: DFBPPR20939 ---- Animal proteins ---- Kv channel-interacting protein 4
Source.7213: DFBPPR20940 ---- Animal proteins ---- Prenylated Rab acceptor protein 1
Source.7214: DFBPPR20941 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC1
Source.7215: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A
Source.7216: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.7217: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1
Source.7218: DFBPPR20948 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 9
Source.7219: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2
Source.7220: DFBPPR20952 ---- Animal proteins ---- Phosphatidate cytidylyltransferase, mitochondrial
Source.7221: DFBPPR20954 ---- Animal proteins ---- Secretagogin
Source.7222: DFBPPR20957 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial
Source.7223: DFBPPR20958 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial
Source.7224: DFBPPR20959 ---- Animal proteins ---- Janus kinase and microtubule-interacting protein 1
Source.7225: DFBPPR20961 ---- Animal proteins ---- Tetraspanin-17
Source.7226: DFBPPR20962 ---- Animal proteins ---- Protein unc-50 homolog
Source.7227: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.7228: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.7229: DFBPPR20967 ---- Animal proteins ---- Phosducin-like protein
Source.7230: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.7231: DFBPPR20974 ---- Animal proteins ---- Short-chain dehydrogenase/reductase 3
Source.7232: DFBPPR20976 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.7233: DFBPPR20979 ---- Animal proteins ---- V-type proton ATPase 21 kDa proteolipid subunit
Source.7234: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5
Source.7235: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.7236: DFBPPR20984 ---- Animal proteins ---- Neuroglobin
Source.7237: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.7238: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1
Source.7239: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7
Source.7240: DFBPPR20989 ---- Animal proteins ---- Ubiquinone biosynthesis protein COQ9, mitochondrial
Source.7241: DFBPPR20991 ---- Animal proteins ---- Arfaptin-2
Source.7242: DFBPPR20995 ---- Animal proteins ---- Zinc finger protein 181
Source.7243: DFBPPR20996 ---- Animal proteins ---- Tripartite motif-containing protein 44
Source.7244: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821
Source.7245: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1
Source.7246: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2
Source.7247: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha
Source.7248: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.7249: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.7250: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.7251: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1
Source.7252: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase
Source.7253: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor
Source.7254: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A
Source.7255: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.7256: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17
Source.7257: DFBPPR21021 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.7258: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein
Source.7259: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.7260: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein
Source.7261: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B
Source.7262: DFBPPR21030 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit C
Source.7263: DFBPPR21031 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial
Source.7264: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial
Source.7265: DFBPPR21036 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.7266: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.7267: DFBPPR21041 ---- Animal proteins ---- Cytokine-inducible SH2-containing protein
Source.7268: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.7269: DFBPPR21043 ---- Animal proteins ---- Modulator of macroautophagy TMEM150B
Source.7270: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.7271: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10
Source.7272: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48
Source.7273: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.7274: DFBPPR21051 ---- Animal proteins ---- SH2 domain-containing protein 1A
Source.7275: DFBPPR21053 ---- Animal proteins ---- V-type proton ATPase subunit D
Source.7276: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.7277: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.7278: DFBPPR21056 ---- Animal proteins ---- Ras-like protein family member 11B
Source.7279: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2
Source.7280: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.7281: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.7282: DFBPPR21060 ---- Animal proteins ---- Signal peptidase complex subunit 1
Source.7283: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.7284: DFBPPR21068 ---- Animal proteins ---- 40S ribosomal protein S5
Source.7285: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.7286: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.7287: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein
Source.7288: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A
Source.7289: DFBPPR21080 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim22
Source.7290: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial
Source.7291: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6
Source.7292: DFBPPR21087 ---- Animal proteins ---- Claudin-11
Source.7293: DFBPPR21089 ---- Animal proteins ---- 39S ribosomal protein L11, mitochondrial
Source.7294: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.7295: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1
Source.7296: DFBPPR21098 ---- Animal proteins ---- Pre T-cell antigen receptor alpha
Source.7297: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7
Source.7298: DFBPPR21100 ---- Animal proteins ---- Cochlin
Source.7299: DFBPPR21103 ---- Animal proteins ---- F-box only protein 32
Source.7300: DFBPPR21104 ---- Animal proteins ---- Keratinocyte-associated protein 2
Source.7301: DFBPPR21105 ---- Animal proteins ---- Calcipressin-3
Source.7302: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.7303: DFBPPR21110 ---- Animal proteins ---- Pro-adrenomedullin
Source.7304: DFBPPR21111 ---- Animal proteins ---- Zinc finger protein-like 1
Source.7305: DFBPPR21112 ---- Animal proteins ---- TBC1 domain family member 7
Source.7306: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.7307: DFBPPR21115 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor-like protein
Source.7308: DFBPPR21120 ---- Animal proteins ---- Intraflagellar transport protein 46 homolog
Source.7309: DFBPPR21121 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-3
Source.7310: DFBPPR21123 ---- Animal proteins ---- 39S ribosomal protein L14, mitochondrial
Source.7311: DFBPPR21124 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.7312: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial
Source.7313: DFBPPR21130 ---- Animal proteins ---- Transmembrane protein 17
Source.7314: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.7315: DFBPPR21135 ---- Animal proteins ---- Vesicle transport protein GOT1B
Source.7316: DFBPPR21136 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.7317: DFBPPR21137 ---- Animal proteins ---- Thioredoxin domain-containing protein 12
Source.7318: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2
Source.7319: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.7320: DFBPPR21147 ---- Animal proteins ---- Transmembrane protein 88
Source.7321: DFBPPR21148 ---- Animal proteins ---- 40S ribosomal protein S18
Source.7322: DFBPPR21150 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.7323: DFBPPR21151 ---- Animal proteins ---- Zinc finger protein 350
Source.7324: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel
Source.7325: DFBPPR21155 ---- Animal proteins ---- Cyclin-H
Source.7326: DFBPPR21156 ---- Animal proteins ---- Transmembrane gamma-carboxyglutamic acid protein 1
Source.7327: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.7328: DFBPPR21159 ---- Animal proteins ---- Origin recognition complex subunit 4
Source.7329: DFBPPR21164 ---- Animal proteins ---- Probable cytosolic iron-sulfur protein assembly protein CIAO1
Source.7330: DFBPPR21165 ---- Animal proteins ---- Protein canopy homolog 3
Source.7331: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.7332: DFBPPR21169 ---- Animal proteins ---- GA-binding protein subunit beta-2
Source.7333: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A
Source.7334: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial
Source.7335: DFBPPR21173 ---- Animal proteins ---- Sorting nexin-11
Source.7336: DFBPPR21175 ---- Animal proteins ---- Adenosine receptor A3
Source.7337: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase
Source.7338: DFBPPR21177 ---- Animal proteins ---- Ran guanine nucleotide release factor
Source.7339: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5
Source.7340: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173
Source.7341: DFBPPR21184 ---- Animal proteins ---- Kinetochore protein Spc24
Source.7342: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2
Source.7343: DFBPPR21187 ---- Animal proteins ---- Plasmolipin
Source.7344: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22
Source.7345: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.7346: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1
Source.7347: DFBPPR21193 ---- Animal proteins ---- Protein Wnt-16
Source.7348: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin
Source.7349: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1
Source.7350: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog
Source.7351: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase
Source.7352: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1
Source.7353: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog
Source.7354: DFBPPR21210 ---- Animal proteins ---- T-cell receptor-associated transmembrane adapter 1
Source.7355: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9
Source.7356: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1
Source.7357: DFBPPR21218 ---- Animal proteins ---- B-cell receptor-associated protein 29
Source.7358: DFBPPR21219 ---- Animal proteins ---- Zinc finger CCHC-type and RNA-binding motif-containing protein 1
Source.7359: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1
Source.7360: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.7361: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2
Source.7362: DFBPPR21226 ---- Animal proteins ---- GPN-loop GTPase 2
Source.7363: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.7364: DFBPPR21229 ---- Animal proteins ---- Neurexophilin-2
Source.7365: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase
Source.7366: DFBPPR21232 ---- Animal proteins ---- Cerebellin-3
Source.7367: DFBPPR21233 ---- Animal proteins ---- 60S ribosomal protein L10a
Source.7368: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4
Source.7369: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231
Source.7370: DFBPPR21239 ---- Animal proteins ---- Coordinator of PRMT5 and differentiation stimulator
Source.7371: DFBPPR21240 ---- Animal proteins ---- 6-phosphogluconolactonase
Source.7372: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.7373: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal
Source.7374: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5
Source.7375: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial
Source.7376: DFBPPR21251 ---- Animal proteins ---- B9 domain-containing protein 2
Source.7377: DFBPPR21252 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 3
Source.7378: DFBPPR21253 ---- Animal proteins ---- Sorting nexin-8
Source.7379: DFBPPR21254 ---- Animal proteins ---- Zinc finger protein 567
Source.7380: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7
Source.7381: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.7382: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2
Source.7383: DFBPPR21259 ---- Animal proteins ---- Elongation factor 1-delta
Source.7384: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1
Source.7385: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B
Source.7386: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1
Source.7387: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.7388: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.7389: DFBPPR21268 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40 homolog
Source.7390: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4
Source.7391: DFBPPR21274 ---- Animal proteins ---- 39S ribosomal protein L48, mitochondrial
Source.7392: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.7393: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.7394: DFBPPR21278 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 2
Source.7395: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen
Source.7396: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6
Source.7397: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.7398: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2
Source.7399: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.7400: DFBPPR21290 ---- Animal proteins ---- Metaxin-1
Source.7401: DFBPPR21291 ---- Animal proteins ---- 39S ribosomal protein L18, mitochondrial
Source.7402: DFBPPR21293 ---- Animal proteins ---- IST1 homolog
Source.7403: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.7404: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1
Source.7405: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3
Source.7406: DFBPPR21300 ---- Animal proteins ---- Trafficking protein particle complex subunit 2
Source.7407: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial
Source.7408: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1
Source.7409: DFBPPR21313 ---- Animal proteins ---- Zinc finger protein 184
Source.7410: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein
Source.7411: DFBPPR21315 ---- Animal proteins ---- PCNA-interacting partner
Source.7412: DFBPPR21317 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.7413: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.7414: DFBPPR21322 ---- Animal proteins ---- Zinc finger protein 227
Source.7415: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115
Source.7416: DFBPPR21325 ---- Animal proteins ---- Translocon-associated protein subunit gamma
Source.7417: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4
Source.7418: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34
Source.7419: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.7420: DFBPPR21332 ---- Animal proteins ---- ER membrane protein complex subunit 4
Source.7421: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.7422: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.7423: DFBPPR21335 ---- Animal proteins ---- Coiled-coil domain-containing protein 124
Source.7424: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein
Source.7425: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial
Source.7426: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C
Source.7427: DFBPPR21342 ---- Animal proteins ---- G kinase-anchoring protein 1
Source.7428: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein
Source.7429: DFBPPR21346 ---- Animal proteins ---- Ameloblastin
Source.7430: DFBPPR21347 ---- Animal proteins ---- Zinc finger protein 397
Source.7431: DFBPPR21348 ---- Animal proteins ---- Transmembrane protein 204
Source.7432: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.7433: DFBPPR21351 ---- Animal proteins ---- Protein kish-A
Source.7434: DFBPPR21352 ---- Animal proteins ---- Glutathione peroxidase 7
Source.7435: DFBPPR21353 ---- Animal proteins ---- Zinc finger protein OZF
Source.7436: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3
Source.7437: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.7438: DFBPPR21356 ---- Animal proteins ---- Sideroflexin-2
Source.7439: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3
Source.7440: DFBPPR21358 ---- Animal proteins ---- Myosin light chain 1/3, skeletal muscle isoform
Source.7441: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1
Source.7442: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.7443: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.7444: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.7445: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24
Source.7446: DFBPPR21367 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB11
Source.7447: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.7448: DFBPPR21369 ---- Animal proteins ---- Protein MIS12 homolog
Source.7449: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.7450: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.7451: DFBPPR21372 ---- Animal proteins ---- Zinc finger protein 420
Source.7452: DFBPPR21373 ---- Animal proteins ---- Zinc finger protein 2
Source.7453: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D
Source.7454: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4
Source.7455: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2
Source.7456: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B
Source.7457: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4
Source.7458: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.7459: DFBPPR21389 ---- Animal proteins ---- N-terminal EF-hand calcium-binding protein 3
Source.7460: DFBPPR21397 ---- Animal proteins ---- Leucine zipper transcription factor-like protein 1
Source.7461: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.7462: DFBPPR21399 ---- Animal proteins ---- Trafficking protein particle complex subunit 6A
Source.7463: DFBPPR21400 ---- Animal proteins ---- Replication initiator 1
Source.7464: DFBPPR21402 ---- Animal proteins ---- Pyridoxal phosphate phosphatase PHOSPHO2
Source.7465: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein
Source.7466: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.7467: DFBPPR21407 ---- Animal proteins ---- Ribosome biogenesis protein BRX1 homolog
Source.7468: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog
Source.7469: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A
Source.7470: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like
Source.7471: DFBPPR21411 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 1
Source.7472: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.7473: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.7474: DFBPPR21417 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1
Source.7475: DFBPPR21418 ---- Animal proteins ---- Angiopoietin-related protein 1
Source.7476: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C
Source.7477: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.7478: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B
Source.7479: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1
Source.7480: DFBPPR21435 ---- Animal proteins ---- ETS-related transcription factor Elf-5
Source.7481: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B
Source.7482: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1
Source.7483: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8
Source.7484: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2
Source.7485: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4
Source.7486: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.7487: DFBPPR21449 ---- Animal proteins ---- Magnesium transporter NIPA2
Source.7488: DFBPPR21451 ---- Animal proteins ---- Nurim
Source.7489: DFBPPR21455 ---- Animal proteins ---- Apolipoprotein C-IV
Source.7490: DFBPPR21456 ---- Animal proteins ---- Fatty acid-binding protein, intestinal
Source.7491: DFBPPR21457 ---- Animal proteins ---- Zinc finger protein 330
Source.7492: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.7493: DFBPPR21460 ---- Animal proteins ---- SREBP regulating gene protein
Source.7494: DFBPPR21462 ---- Animal proteins ---- Vesicle transport protein GOT1A
Source.7495: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.7496: DFBPPR21465 ---- Animal proteins ---- Probable RNA-binding protein EIF1AD
Source.7497: DFBPPR21466 ---- Animal proteins ---- Trafficking protein particle complex subunit 2-like protein
Source.7498: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.7499: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3
Source.7500: DFBPPR21469 ---- Animal proteins ---- Probable glutathione peroxidase 8
Source.7501: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.7502: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.7503: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.7504: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.7505: DFBPPR21474 ---- Animal proteins ---- m-AAA protease-interacting protein 1, mitochondrial
Source.7506: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1
Source.7507: DFBPPR21479 ---- Animal proteins ---- Pentraxin-related protein PTX3
Source.7508: DFBPPR21480 ---- Animal proteins ---- WD repeat and FYVE domain-containing protein 1
Source.7509: DFBPPR21481 ---- Animal proteins ---- EF-hand domain-containing protein D2
Source.7510: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.7511: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8
Source.7512: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8
Source.7513: DFBPPR21486 ---- Animal proteins ---- Caspase recruitment domain-containing protein 19
Source.7514: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.7515: DFBPPR21489 ---- Animal proteins ---- Pre-mRNA-splicing factor 18
Source.7516: DFBPPR21491 ---- Animal proteins ---- CUE domain-containing protein 2
Source.7517: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.7518: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47
Source.7519: DFBPPR21498 ---- Animal proteins ---- Alanyl-tRNA editing protein Aarsd1
Source.7520: DFBPPR21499 ---- Animal proteins ---- Barrier-to-autointegration factor-like protein
Source.7521: DFBPPR21500 ---- Animal proteins ---- Docking protein 2
Source.7522: DFBPPR21501 ---- Animal proteins ---- Peroxisomal biogenesis factor 3
Source.7523: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.7524: DFBPPR21503 ---- Animal proteins ---- Sideroflexin-3
Source.7525: DFBPPR21504 ---- Animal proteins ---- Ribonuclease P protein subunit p40
Source.7526: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3
Source.7527: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1
Source.7528: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.7529: DFBPPR21509 ---- Animal proteins ---- Myoneurin
Source.7530: DFBPPR21512 ---- Animal proteins ---- Membrane protein FAM174B
Source.7531: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2
Source.7532: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase
Source.7533: DFBPPR21520 ---- Animal proteins ---- LYR motif-containing protein 4
Source.7534: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1
Source.7535: DFBPPR21526 ---- Animal proteins ---- Interferon alpha-inducible protein 27-like protein 2
Source.7536: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2
Source.7537: DFBPPR21528 ---- Animal proteins ---- Vasculin
Source.7538: DFBPPR21529 ---- Animal proteins ---- Integrator complex subunit 11
Source.7539: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2
Source.7540: DFBPPR21531 ---- Animal proteins ---- 60S ribosomal protein L13
Source.7541: DFBPPR21532 ---- Animal proteins ---- Transmembrane protein 225
Source.7542: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19
Source.7543: DFBPPR21535 ---- Animal proteins ---- Gastrotropin
Source.7544: DFBPPR21536 ---- Animal proteins ---- Alpha-1-acid glycoprotein
Source.7545: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8
Source.7546: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.7547: DFBPPR21543 ---- Animal proteins ---- COX assembly mitochondrial protein homolog
Source.7548: DFBPPR21544 ---- Animal proteins ---- General transcription factor IIE subunit 2
Source.7549: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22
Source.7550: DFBPPR21551 ---- Animal proteins ---- Suppressor of cytokine signaling 4
Source.7551: DFBPPR21552 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 3
Source.7552: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.7553: DFBPPR21554 ---- Animal proteins ---- Transcription factor 23
Source.7554: DFBPPR21555 ---- Animal proteins ---- Zinc finger and SCAN domain-containing protein 26
Source.7555: DFBPPR21557 ---- Animal proteins ---- WD repeat-containing protein 55
Source.7556: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39
Source.7557: DFBPPR21560 ---- Animal proteins ---- Sperm equatorial segment protein 1
Source.7558: DFBPPR21561 ---- Animal proteins ---- Vesicle-trafficking protein SEC22c
Source.7559: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3
Source.7560: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1
Source.7561: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.7562: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3
Source.7563: DFBPPR21570 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40B
Source.7564: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2
Source.7565: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.7566: DFBPPR21574 ---- Animal proteins ---- Parvalbumin alpha
Source.7567: DFBPPR21575 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 6
Source.7568: DFBPPR21578 ---- Animal proteins ---- Calcium-binding protein 5
Source.7569: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.7570: DFBPPR21584 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.7571: DFBPPR21586 ---- Animal proteins ---- Cyclin-C
Source.7572: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.7573: DFBPPR21590 ---- Animal proteins ---- Rhombotin-1
Source.7574: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.7575: DFBPPR21595 ---- Animal proteins ---- Complement C5a anaphylatoxin
Source.7576: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2
Source.7577: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.7578: DFBPPR21599 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC
Source.7579: DFBPPR21601 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 2
Source.7580: DFBPPR21604 ---- Animal proteins ---- Zinc finger protein 345
Source.7581: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1
Source.7582: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.7583: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.7584: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.7585: DFBPPR21617 ---- Animal proteins ---- Proteasome assembly chaperone 3
Source.7586: DFBPPR21618 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.7587: DFBPPR21619 ---- Animal proteins ---- CBY1-interacting BAR domain-containing protein 2
Source.7588: DFBPPR21620 ---- Animal proteins ---- Claudin-12
Source.7589: DFBPPR21622 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.7590: DFBPPR21623 ---- Animal proteins ---- Notchless protein homolog 1
Source.7591: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.7592: DFBPPR21627 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 gamma
Source.7593: DFBPPR21629 ---- Animal proteins ---- Annexin A3
Source.7594: DFBPPR21636 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP3
Source.7595: DFBPPR21639 ---- Animal proteins ---- Elongator complex protein 4
Source.7596: DFBPPR21641 ---- Animal proteins ---- U5 small nuclear ribonucleoprotein 40 kDa protein
Source.7597: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44
Source.7598: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6
Source.7599: DFBPPR21645 ---- Animal proteins ---- Proteasome activator complex subunit 1
Source.7600: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1
Source.7601: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein
Source.7602: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11
Source.7603: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial
Source.7604: DFBPPR21663 ---- Animal proteins ---- Trafficking protein particle complex subunit 6B
Source.7605: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.7606: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.7607: DFBPPR21670 ---- Animal proteins ---- V-type proton ATPase subunit E 2
Source.7608: DFBPPR21671 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog
Source.7609: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10
Source.7610: DFBPPR21674 ---- Animal proteins ---- Leucine-rich repeat-containing protein 3B
Source.7611: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1
Source.7612: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like
Source.7613: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like
Source.7614: DFBPPR21691 ---- Animal proteins ---- Protein LRATD1
Source.7615: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1
Source.7616: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.7617: DFBPPR21697 ---- Animal proteins ---- UDP-galactose translocator
Source.7618: DFBPPR21699 ---- Animal proteins ---- Transmembrane protein 208
Source.7619: DFBPPR21701 ---- Animal proteins ---- Prefoldin subunit 1
Source.7620: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.7621: DFBPPR21707 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim23
Source.7622: DFBPPR21709 ---- Animal proteins ---- PEST proteolytic signal-containing nuclear protein
Source.7623: DFBPPR21711 ---- Animal proteins ---- Hydrolethalus syndrome protein 1 homolog
Source.7624: DFBPPR21712 ---- Animal proteins ---- Serpin E3
Source.7625: DFBPPR21713 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2
Source.7626: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.7627: DFBPPR21717 ---- Animal proteins ---- Transmembrane protein 134
Source.7628: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2
Source.7629: DFBPPR21720 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.7630: DFBPPR21722 ---- Animal proteins ---- Protein DDI1 homolog 1
Source.7631: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3
Source.7632: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.7633: DFBPPR21727 ---- Animal proteins ---- 39S ribosomal protein L1, mitochondrial
Source.7634: DFBPPR21728 ---- Animal proteins ---- Galectin-9
Source.7635: DFBPPR21729 ---- Animal proteins ---- Zinc transporter 4
Source.7636: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2
Source.7637: DFBPPR21732 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1
Source.7638: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.7639: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7
Source.7640: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1
Source.7641: DFBPPR21737 ---- Animal proteins ---- C-type lectin domain family 1 member A
Source.7642: DFBPPR21738 ---- Animal proteins ---- Bcl-2-related protein A1
Source.7643: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15
Source.7644: DFBPPR21741 ---- Animal proteins ---- Meiotic nuclear division protein 1 homolog
Source.7645: DFBPPR21742 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.7646: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.7647: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.7648: DFBPPR21750 ---- Animal proteins ---- 14-3-3 protein theta
Source.7649: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10
Source.7650: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.7651: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1
Source.7652: DFBPPR21761 ---- Animal proteins ---- NADH dehydrogenase (ubiquinone) complex I, assembly factor 6
Source.7653: DFBPPR21763 ---- Animal proteins ---- Protein GOLM2
Source.7654: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25
Source.7655: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.7656: DFBPPR21766 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 12
Source.7657: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.7658: DFBPPR21768 ---- Animal proteins ---- Tektin-4
Source.7659: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4
Source.7660: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.7661: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.7662: DFBPPR21779 ---- Animal proteins ---- Serpin B8
Source.7663: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1
Source.7664: DFBPPR21789 ---- Animal proteins ---- Protein kish-B
Source.7665: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.7666: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2
Source.7667: DFBPPR21793 ---- Animal proteins ---- Dynein light chain Tctex-type protein 2B
Source.7668: DFBPPR21794 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 8
Source.7669: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.7670: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44
Source.7671: DFBPPR21800 ---- Animal proteins ---- Carbonic anhydrase-related protein 10
Source.7672: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.7673: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.7674: DFBPPR21806 ---- Animal proteins ---- Keratin, type II cuticular Hb1
Source.7675: DFBPPR21807 ---- Animal proteins ---- Lysine-rich nucleolar protein 1
Source.7676: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.7677: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1
Source.7678: DFBPPR21810 ---- Animal proteins ---- Regulator of G-protein signaling 4
Source.7679: DFBPPR21811 ---- Animal proteins ---- Coiled-coil domain-containing protein 89
Source.7680: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.7681: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.7682: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11
Source.7683: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein
Source.7684: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526
Source.7685: DFBPPR21824 ---- Animal proteins ---- Transcription factor Spi-C
Source.7686: DFBPPR21826 ---- Animal proteins ---- RING finger protein 141
Source.7687: DFBPPR21828 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 11
Source.7688: DFBPPR21833 ---- Animal proteins ---- Keratin, type II cuticular Hb3
Source.7689: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1
Source.7690: DFBPPR21836 ---- Animal proteins ---- Potassium channel regulatory protein
Source.7691: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750
Source.7692: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B
Source.7693: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.7694: DFBPPR21842 ---- Animal proteins ---- Transmembrane protein 14A
Source.7695: DFBPPR21843 ---- Animal proteins ---- Tektin-1
Source.7696: DFBPPR21844 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1
Source.7697: DFBPPR21846 ---- Animal proteins ---- Izumo sperm-egg fusion protein 3
Source.7698: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.7699: DFBPPR21853 ---- Animal proteins ---- F-box/LRR-repeat protein 14
Source.7700: DFBPPR21856 ---- Animal proteins ---- Protein FAM32A
Source.7701: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2
Source.7702: DFBPPR21858 ---- Animal proteins ---- Chromatin complexes subunit BAP18
Source.7703: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B
Source.7704: DFBPPR21860 ---- Animal proteins ---- Succinate dehydrogenase assembly factor 1, mitochondrial
Source.7705: DFBPPR21863 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 3
Source.7706: DFBPPR21864 ---- Animal proteins ---- Arpin
Source.7707: DFBPPR21865 ---- Animal proteins ---- Transcription factor EC
Source.7708: DFBPPR21869 ---- Animal proteins ---- Centromere protein O
Source.7709: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.7710: DFBPPR21871 ---- Animal proteins ---- Serpin B10
Source.7711: DFBPPR21872 ---- Animal proteins ---- 40S ribosomal protein S19
Source.7712: DFBPPR21873 ---- Animal proteins ---- Vitrin
Source.7713: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.7714: DFBPPR21878 ---- Animal proteins ---- Statherin
Source.7715: DFBPPR21881 ---- Animal proteins ---- THUMP domain-containing protein 1
Source.7716: DFBPPR21884 ---- Animal proteins ---- Calcium-binding protein 39
Source.7717: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.7718: DFBPPR21887 ---- Animal proteins ---- Cyclin-G1
Source.7719: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor
Source.7720: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6
Source.7721: DFBPPR21893 ---- Animal proteins ---- Somatomedin-B and thrombospondin type-1 domain-containing protein
Source.7722: DFBPPR21895 ---- Animal proteins ---- Epithelial membrane protein 3
Source.7723: DFBPPR21898 ---- Animal proteins ---- Junctional sarcoplasmic reticulum protein 1
Source.7724: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1
Source.7725: DFBPPR21901 ---- Animal proteins ---- Calcyphosin
Source.7726: DFBPPR21902 ---- Animal proteins ---- Centromere protein N
Source.7727: DFBPPR21903 ---- Animal proteins ---- Inactive serine protease 35
Source.7728: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein
Source.7729: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.7730: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2
Source.7731: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog
Source.7732: DFBPPR21914 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 13
Source.7733: DFBPPR21915 ---- Animal proteins ---- Tetraspanin-13
Source.7734: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6
Source.7735: DFBPPR21917 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 2
Source.7736: DFBPPR21919 ---- Animal proteins ---- Ras-like protein family member 12
Source.7737: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.7738: DFBPPR21922 ---- Animal proteins ---- Sideroflexin-4
Source.7739: DFBPPR21926 ---- Animal proteins ---- N-acetyltransferase 14
Source.7740: DFBPPR21927 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase-interacting protein
Source.7741: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.7742: DFBPPR21931 ---- Animal proteins ---- Oocyte-secreted protein 1
Source.7743: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11
Source.7744: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2
Source.7745: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2
Source.7746: DFBPPR21938 ---- Animal proteins ---- Protein RER1
Source.7747: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.7748: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.7749: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein
Source.7750: DFBPPR21945 ---- Animal proteins ---- Dermokine
Source.7751: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414
Source.7752: DFBPPR21947 ---- Animal proteins ---- rRNA-processing protein UTP23 homolog
Source.7753: DFBPPR21948 ---- Animal proteins ---- Selenoprotein F
Source.7754: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7
Source.7755: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6
Source.7756: DFBPPR21953 ---- Animal proteins ---- Clusterin-like protein 1
Source.7757: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.7758: DFBPPR21956 ---- Animal proteins ---- DNA replication complex GINS protein PSF3
Source.7759: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.7760: DFBPPR21959 ---- Animal proteins ---- DDB1- and CUL4-associated factor 16
Source.7761: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.7762: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3
Source.7763: DFBPPR21964 ---- Animal proteins ---- Protein yippee-like 3
Source.7764: DFBPPR21966 ---- Animal proteins ---- DNA replication complex GINS protein PSF1
Source.7765: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10
Source.7766: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1
Source.7767: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1
Source.7768: DFBPPR21971 ---- Animal proteins ---- Chemokine-like protein TAFA-5
Source.7769: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.7770: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog
Source.7771: DFBPPR21977 ---- Animal proteins ---- Protein ARV1
Source.7772: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.7773: DFBPPR21982 ---- Animal proteins ---- Protein MAK16 homolog
Source.7774: DFBPPR21984 ---- Animal proteins ---- Leucine-rich repeat-containing protein 10
Source.7775: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14
Source.7776: DFBPPR21992 ---- Animal proteins ---- Intraflagellar transport-associated protein
Source.7777: DFBPPR21993 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.7778: DFBPPR21995 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 2
Source.7779: DFBPPR21996 ---- Animal proteins ---- Shieldin complex subunit 1
Source.7780: DFBPPR21998 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.7781: DFBPPR22000 ---- Animal proteins ---- Protein LDOC1
Source.7782: DFBPPR22001 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.7783: DFBPPR22005 ---- Animal proteins ---- Transmembrane protein 81
Source.7784: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.7785: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1
Source.7786: DFBPPR22010 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21E
Source.7787: DFBPPR22012 ---- Animal proteins ---- GRB2-related adapter protein
Source.7788: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4
Source.7789: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3
Source.7790: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5
Source.7791: DFBPPR22022 ---- Animal proteins ---- SRA stem-loop-interacting RNA-binding protein, mitochondrial
Source.7792: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.7793: DFBPPR22025 ---- Animal proteins ---- Putative deoxyribonuclease TATDN3
Source.7794: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2
Source.7795: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.7796: DFBPPR22028 ---- Animal proteins ---- Endonuclease/exonuclease/phosphatase family domain-containing protein 1
Source.7797: DFBPPR22031 ---- Animal proteins ---- KxDL motif-containing protein 1
Source.7798: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4
Source.7799: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.7800: DFBPPR22038 ---- Animal proteins ---- Kelch domain-containing protein 3
Source.7801: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2
Source.7802: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12
Source.7803: DFBPPR22044 ---- Animal proteins ---- Transgelin-2
Source.7804: DFBPPR22045 ---- Animal proteins ---- PRELI domain containing protein 3B
Source.7805: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2
Source.7806: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.7807: DFBPPR22048 ---- Animal proteins ---- Regulated endocrine-specific protein 18
Source.7808: DFBPPR22051 ---- Animal proteins ---- Cilia- and flagella-associated protein HOATZ
Source.7809: DFBPPR22054 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.7810: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3
Source.7811: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase
Source.7812: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6
Source.7813: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma
Source.7814: DFBPPR22059 ---- Animal proteins ---- Immediate early response 3-interacting protein 1
Source.7815: DFBPPR22065 ---- Animal proteins ---- 60S ribosomal protein L10-like
Source.7816: DFBPPR22067 ---- Animal proteins ---- Microfibril-associated glycoprotein 3
Source.7817: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.7818: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.7819: DFBPPR22070 ---- Animal proteins ---- Maturin
Source.7820: DFBPPR22073 ---- Animal proteins ---- C2 calcium-dependent domain-containing protein 4A
Source.7821: DFBPPR22074 ---- Animal proteins ---- Golgi apparatus membrane protein TVP23 homolog B
Source.7822: DFBPPR22075 ---- Animal proteins ---- GTP-binding protein 8
Source.7823: DFBPPR22077 ---- Animal proteins ---- 39S ribosomal protein L21, mitochondrial
Source.7824: DFBPPR22078 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 4
Source.7825: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9
Source.7826: DFBPPR22082 ---- Animal proteins ---- Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 2 protein
Source.7827: DFBPPR22084 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 49
Source.7828: DFBPPR22086 ---- Animal proteins ---- Trafficking protein particle complex subunit 1
Source.7829: DFBPPR22087 ---- Animal proteins ---- RNA-binding protein PNO1
Source.7830: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7
Source.7831: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1
Source.7832: DFBPPR22091 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.7833: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.7834: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.7835: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41
Source.7836: DFBPPR22097 ---- Animal proteins ---- Ester hydrolase C11orf54 homolog
Source.7837: DFBPPR22100 ---- Animal proteins ---- Centromere protein M
Source.7838: DFBPPR22101 ---- Animal proteins ---- DNA polymerase epsilon subunit 4
Source.7839: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.7840: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2
Source.7841: DFBPPR22104 ---- Animal proteins ---- Leptin receptor overlapping transcript-like 1
Source.7842: DFBPPR22105 ---- Animal proteins ---- Centromere protein L
Source.7843: DFBPPR22107 ---- Animal proteins ---- TLD domain-containing protein 2
Source.7844: DFBPPR22108 ---- Animal proteins ---- SH3 domain-containing YSC84-like protein 1
Source.7845: DFBPPR22109 ---- Animal proteins ---- Host cell factor C1 regulator 1
Source.7846: DFBPPR22111 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.7847: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein
Source.7848: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6
Source.7849: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.7850: DFBPPR22120 ---- Animal proteins ---- Outer dense fiber protein 4
Source.7851: DFBPPR22121 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.7852: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog
Source.7853: DFBPPR22127 ---- Animal proteins ---- Tumor protein p53-inducible protein 11
Source.7854: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2
Source.7855: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.7856: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1
Source.7857: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2
Source.7858: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48
Source.7859: DFBPPR22141 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 1
Source.7860: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2
Source.7861: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1
Source.7862: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B
Source.7863: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.7864: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein
Source.7865: DFBPPR22149 ---- Animal proteins ---- Putative peptidyl-tRNA hydrolase PTRHD1
Source.7866: DFBPPR22150 ---- Animal proteins ---- Transmembrane protein 213
Source.7867: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1
Source.7868: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11
Source.7869: DFBPPR22153 ---- Animal proteins ---- Leucine-rich repeat-containing protein 3
Source.7870: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.7871: DFBPPR22156 ---- Animal proteins ---- Cell division cycle protein 123 homolog
Source.7872: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1
Source.7873: DFBPPR22159 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 24
Source.7874: DFBPPR22160 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.7875: DFBPPR22161 ---- Animal proteins ---- 39S ribosomal protein L53, mitochondrial
Source.7876: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.7877: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2
Source.7878: DFBPPR22165 ---- Animal proteins ---- Coiled-coil domain-containing protein 106
Source.7879: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.7880: DFBPPR22168 ---- Animal proteins ---- Transmembrane protein 182
Source.7881: DFBPPR22169 ---- Animal proteins ---- Transmembrane protein 256
Source.7882: DFBPPR22175 ---- Animal proteins ---- Small integral membrane protein 11A
Source.7883: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3
Source.7884: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.7885: DFBPPR22180 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17
Source.7886: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.7887: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.7888: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial
Source.7889: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.7890: DFBPPR22190 ---- Animal proteins ---- Protein NKG7
Source.7891: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.7892: DFBPPR22199 ---- Animal proteins ---- SCAN domain-containing protein 1
Source.7893: DFBPPR22202 ---- Animal proteins ---- Protein FMC1 homolog
Source.7894: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.7895: DFBPPR22206 ---- Animal proteins ---- Promotilin
Source.7896: DFBPPR22208 ---- Animal proteins ---- Protein yippee-like 2
Source.7897: DFBPPR22209 ---- Animal proteins ---- Transmembrane protein 147
Source.7898: DFBPPR22210 ---- Animal proteins ---- Peroxisomal membrane protein 4
Source.7899: DFBPPR22213 ---- Animal proteins ---- Protein TEX261
Source.7900: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.7901: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.7902: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein
Source.7903: DFBPPR22218 ---- Animal proteins ---- Galectin-4
Source.7904: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.7905: DFBPPR22226 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 2
Source.7906: DFBPPR22227 ---- Animal proteins ---- Tetraspanin-8
Source.7907: DFBPPR22229 ---- Animal proteins ---- Spermatogenesis-associated protein 22
Source.7908: DFBPPR22232 ---- Animal proteins ---- Transmembrane protein 176A
Source.7909: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5
Source.7910: DFBPPR22234 ---- Animal proteins ---- COMM domain-containing protein 3
Source.7911: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300
Source.7912: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.7913: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.7914: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.7915: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.7916: DFBPPR22244 ---- Animal proteins ---- THAP domain-containing protein 3
Source.7917: DFBPPR22245 ---- Animal proteins ---- Thyroid transcription factor 1-associated protein 26
Source.7918: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3
Source.7919: DFBPPR22252 ---- Animal proteins ---- Glutamine amidotransferase-like class 1 domain-containing protein 1
Source.7920: DFBPPR22253 ---- Animal proteins ---- Inhibitory synaptic factor 1
Source.7921: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34
Source.7922: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.7923: DFBPPR22262 ---- Animal proteins ---- Tetraspanin-18
Source.7924: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog
Source.7925: DFBPPR22266 ---- Animal proteins ---- Vexin
Source.7926: DFBPPR22269 ---- Animal proteins ---- Protein preY, mitochondrial
Source.7927: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.7928: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B
Source.7929: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40
Source.7930: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.7931: DFBPPR22282 ---- Animal proteins ---- Optic atrophy 3 protein homolog
Source.7932: DFBPPR22286 ---- Animal proteins ---- Oxidoreductase NAD-binding domain-containing protein 1
Source.7933: DFBPPR22287 ---- Animal proteins ---- BAG family molecular chaperone regulator 5
Source.7934: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B
Source.7935: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.7936: DFBPPR22299 ---- Animal proteins ---- Tetraspanin-31
Source.7937: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B
Source.7938: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A
Source.7939: DFBPPR22308 ---- Animal proteins ---- Mitochondrial pyruvate carrier-like protein
Source.7940: DFBPPR22309 ---- Animal proteins ---- Spermatogenesis-associated protein 9
Source.7941: DFBPPR22311 ---- Animal proteins ---- Calcium-binding and spermatid-specific protein 1
Source.7942: DFBPPR22313 ---- Animal proteins ---- Nucleolar protein 16
Source.7943: DFBPPR22314 ---- Animal proteins ---- TM2 domain-containing protein 2
Source.7944: DFBPPR22317 ---- Animal proteins ---- Translation machinery-associated protein 7
Source.7945: DFBPPR22318 ---- Animal proteins ---- Transmembrane protein 218
Source.7946: DFBPPR22321 ---- Animal proteins ---- Solute carrier family 25 member 35
Source.7947: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.7948: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70
Source.7949: DFBPPR22329 ---- Animal proteins ---- Coiled-coil domain-containing protein 172
Source.7950: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.7951: DFBPPR22332 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 3
Source.7952: DFBPPR22334 ---- Animal proteins ---- Protein HP-25 homolog 1
Source.7953: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.7954: DFBPPR22337 ---- Animal proteins ---- Uncharacterized protein CLBA1
Source.7955: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.7956: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2
Source.7957: DFBPPR22342 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog
Source.7958: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.7959: DFBPPR22345 ---- Animal proteins ---- Small muscular protein
Source.7960: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog
Source.7961: DFBPPR22349 ---- Animal proteins ---- PHD finger protein 11
Source.7962: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80
Source.7963: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.7964: DFBPPR22352 ---- Animal proteins ---- Protein C19orf12 homolog
Source.7965: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.7966: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180
Source.7967: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.7968: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.7969: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein
Source.7970: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23
Source.7971: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4
Source.7972: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4
Source.7973: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase
Source.7974: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92
Source.7975: DFBPPR22373 ---- Animal proteins ---- 60S ribosomal protein L3-like
Source.7976: DFBPPR22379 ---- Animal proteins ---- Ribosomal biogenesis factor
Source.7977: DFBPPR22380 ---- Animal proteins ---- G patch domain-containing protein 4
Source.7978: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.7979: DFBPPR22386 ---- Animal proteins ---- DPY30 domain-containing protein 2
Source.7980: DFBPPR22388 ---- Animal proteins ---- Oxidative stress-responsive serine-rich protein 1
Source.7981: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1
Source.7982: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.7983: DFBPPR22393 ---- Animal proteins ---- PDZ domain-containing protein GIPC2
Source.7984: DFBPPR22394 ---- Animal proteins ---- RNA-binding Raly-like protein
Source.7985: DFBPPR22395 ---- Animal proteins ---- UPF0524 protein C3orf70 homolog
Source.7986: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10
Source.7987: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.7988: DFBPPR22398 ---- Animal proteins ---- Protein NDRG3
Source.7989: DFBPPR22399 ---- Animal proteins ---- Transgelin-3
Source.7990: DFBPPR22400 ---- Animal proteins ---- Stromal cell-derived factor 2-like protein 1
Source.7991: DFBPPR22401 ---- Animal proteins ---- Zinc finger protein 474
Source.7992: DFBPPR22403 ---- Animal proteins ---- Heat shock protein beta-9
Source.7993: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9
Source.7994: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog
Source.7995: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1
Source.7996: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5
Source.7997: DFBPPR22413 ---- Animal proteins ---- Protein LSM12 homolog
Source.7998: DFBPPR22414 ---- Animal proteins ---- Protein C10
Source.7999: DFBPPR22415 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.8000: DFBPPR22417 ---- Animal proteins ---- Spermatogenesis-associated protein 46
Source.8001: DFBPPR22418 ---- Animal proteins ---- Transmembrane protein 160
Source.8002: DFBPPR22419 ---- Animal proteins ---- Prolyl-tRNA synthetase associated domain-containing protein 1
Source.8003: DFBPPR22421 ---- Animal proteins ---- Placenta-specific protein 9
Source.8004: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B
Source.8005: DFBPPR22424 ---- Animal proteins ---- Transmembrane protein 243
Source.8006: DFBPPR22425 ---- Animal proteins ---- Protein THEM6
Source.8007: DFBPPR22429 ---- Animal proteins ---- Coiled-coil domain-containing protein 107
Source.8008: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186
Source.8009: DFBPPR22434 ---- Animal proteins ---- UPF0692 protein C19orf54 homolog
Source.8010: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein
Source.8011: DFBPPR22438 ---- Animal proteins ---- Transmembrane 4 L6 family member 18
Source.8012: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3
Source.8013: DFBPPR22440 ---- Animal proteins ---- PDZK1-interacting protein 1
Source.8014: DFBPPR22441 ---- Animal proteins ---- Isochorismatase domain-containing protein 2
Source.8015: DFBPPR22443 ---- Animal proteins ---- Stromal cell-derived factor 2
Source.8016: DFBPPR22446 ---- Animal proteins ---- Tektin-5
Source.8017: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2
Source.8018: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9
Source.8019: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2
Source.8020: DFBPPR22457 ---- Animal proteins ---- Cilia- and flagella-associated protein 97
Source.8021: DFBPPR22459 ---- Animal proteins ---- SCP2 sterol-binding domain-containing protein 1
Source.8022: DFBPPR22462 ---- Animal proteins ---- Protein FAM76A
Source.8023: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2
Source.8024: DFBPPR22464 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 13
Source.8025: DFBPPR22470 ---- Animal proteins ---- Coiled-coil domain-containing protein 137
Source.8026: DFBPPR22471 ---- Animal proteins ---- Protein shisa-like-2B
Source.8027: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.8028: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.8029: DFBPPR22475 ---- Animal proteins ---- Small integral membrane protein 12
Source.8030: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.8031: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3
Source.8032: DFBPPR22480 ---- Animal proteins ---- Coiled-coil domain-containing protein 70
Source.8033: DFBPPR22481 ---- Animal proteins ---- Uncharacterized protein FAM241A
Source.8034: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144
Source.8035: DFBPPR22487 ---- Animal proteins ---- Keratinocyte-associated protein 3
Source.8036: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.8037: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183
Source.8038: DFBPPR22500 ---- Animal proteins ---- Ubiquitin domain-containing protein 1
Source.8039: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.8040: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2
Source.8041: DFBPPR22505 ---- Animal proteins ---- Protein HP-20 homolog
Source.8042: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101
Source.8043: DFBPPR22511 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 2
Source.8044: DFBPPR22513 ---- Animal proteins ---- Transmembrane protein 234
Source.8045: DFBPPR22514 ---- Animal proteins ---- Transmembrane protein 205
Source.8046: DFBPPR22515 ---- Animal proteins ---- Small integral membrane protein 8
Source.8047: DFBPPR22516 ---- Animal proteins ---- Transmembrane protein 141
Source.8048: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15
Source.8049: DFBPPR22519 ---- Animal proteins ---- Transmembrane protein 248
Source.8050: DFBPPR22520 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 2
Source.8051: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1
Source.8052: DFBPPR22523 ---- Animal proteins ---- Leucine-rich repeat-containing protein 42
Source.8053: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8
Source.8054: DFBPPR22526 ---- Animal proteins ---- Testis-expressed protein 29
Source.8055: DFBPPR22528 ---- Animal proteins ---- Transmembrane protein 251
Source.8056: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9
Source.8057: DFBPPR22533 ---- Animal proteins ---- Coiled-coil domain-containing protein 160
Source.8058: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.8059: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53
Source.8060: DFBPPR22541 ---- Animal proteins ---- Protein FAM177A1
Source.8061: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B
Source.8062: DFBPPR22543 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 3
Source.8063: DFBPPR22546 ---- Animal proteins ---- ADP-ribosylation factor-like protein 15
Source.8064: DFBPPR22547 ---- Animal proteins ---- Actin-related protein T2
Source.8065: DFBPPR22548 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 1
Source.8066: DFBPPR22552 ---- Animal proteins ---- Protein AMN1 homolog
Source.8067: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2
Source.8068: DFBPPR22555 ---- Animal proteins ---- Bcl-2-like protein 15
Source.8069: DFBPPR22556 ---- Animal proteins ---- Protein maestro
Source.8070: DFBPPR22557 ---- Animal proteins ---- Ataxin-7-like protein 1
Source.8071: DFBPPR22558 ---- Animal proteins ---- Transmembrane protein 187
Source.8072: DFBPPR22560 ---- Animal proteins ---- Mesenteric estrogen-dependent adipogenesis protein
Source.8073: DFBPPR22563 ---- Animal proteins ---- Methenyltetrahydrofolate synthase domain-containing protein
Source.8074: DFBPPR22568 ---- Animal proteins ---- Small integral membrane protein 5
Source.8075: DFBPPR22569 ---- Animal proteins ---- Testis-expressed sequence 37 protein
Source.8076: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1
Source.8077: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.8078: DFBPPR22573 ---- Animal proteins ---- UPF0461 protein C5orf24 homolog
Source.8079: DFBPPR22576 ---- Animal proteins ---- UPF0547 protein C16orf87 homolog
Source.8080: DFBPPR22581 ---- Animal proteins ---- UPF0690 protein C1orf52 homolog
Source.8081: DFBPPR22582 ---- Animal proteins ---- SH3 domain-binding glutamic acid-rich-like protein
Source.8082: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.8083: DFBPPR22587 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog
Source.8084: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19
Source.8085: DFBPPR22595 ---- Animal proteins ---- Transmembrane protein 268
Source.8086: DFBPPR22596 ---- Animal proteins ---- Ubiquitin domain-containing protein 2
Source.8087: DFBPPR22597 ---- Animal proteins ---- Methyltransferase-like 26
Source.8088: DFBPPR22599 ---- Animal proteins ---- Tetratricopeptide repeat protein 9C
Source.8089: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.8090: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B
Source.8091: DFBPPR22605 ---- Animal proteins ---- Transmembrane protein 254
Source.8092: DFBPPR22606 ---- Animal proteins ---- WD repeat-containing protein 53
Source.8093: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128
Source.8094: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4
Source.8095: DFBPPR22613 ---- Animal proteins ---- Coiled-coil domain-containing protein 71
Source.8096: DFBPPR22614 ---- Animal proteins ---- Protein FAM81B
Source.8097: DFBPPR22616 ---- Animal proteins ---- Jhy protein homolog
Source.8098: DFBPPR22617 ---- Animal proteins ---- SNRPN upstream reading frame protein
Source.8099: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42
Source.8100: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72
Source.8101: DFBPPR22622 ---- Animal proteins ---- Coiled-coil domain-containing glutamate-rich protein 1
Source.8102: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164
Source.8103: DFBPPR22626 ---- Animal proteins ---- Transmembrane protein 253
Source.8104: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B
Source.8105: DFBPPR22633 ---- Animal proteins ---- Transmembrane protein 270
Source.8106: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175
Source.8107: DFBPPR22641 ---- Animal proteins ---- LIM domain only protein 3
Source.8108: DFBPPR22643 ---- Animal proteins ---- Coiled-coil domain-containing protein 157
Source.8109: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.8110: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog
Source.8111: DFBPPR22649 ---- Animal proteins ---- IQ domain-containing protein F5
Source.8112: DFBPPR22651 ---- Animal proteins ---- Spermatogenesis-associated protein 2-like protein
Source.8113: DFBPPR22652 ---- Animal proteins ---- PX domain-containing protein 1
Source.8114: DFBPPR22659 ---- Animal proteins ---- Testis-expressed protein 35
Source.8115: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog
Source.8116: DFBPPR22666 ---- Animal proteins ---- Uncharacterized protein C12orf50 homolog
Source.8117: DFBPPR22667 ---- Animal proteins ---- Uncharacterized protein C17orf78 homolog
Source.8118: DFBPPR22669 ---- Animal proteins ---- Uncharacterized protein C5orf46 homolog
Source.8119: DFBPPR22673 ---- Animal proteins ---- Uncharacterized protein C7orf61 homolog
Source.8120: DFBPPR22674 ---- Animal proteins ---- PDZ domain-containing protein 9
Source.8121: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.8122: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein
Source.8123: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32
Source.8124: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog
Source.8125: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C
Source.8126: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.8127: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1
Source.8128: DFBPPR22690 ---- Animal proteins ---- Proline-rich protein 19
Source.8129: DFBPPR22693 ---- Animal proteins ---- Cysteine-rich DPF motif domain-containing protein 1
Source.8130: DFBPPR22696 ---- Animal proteins ---- Protein FAM228B
Source.8131: DFBPPR22698 ---- Animal proteins ---- Protein FAM228A
Source.8132: DFBPPR22703 ---- Animal proteins ---- Arrestin domain-containing protein 5
Source.8133: DFBPPR22704 ---- Animal proteins ---- Uncharacterized protein C17orf64 homolog
Source.8134: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28
Source.8135: DFBPPR22706 ---- Animal proteins ---- Uncharacterized protein C3orf38 homolog
Source.8136: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1
Source.8137: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16
Source.8138: DFBPPR22712 ---- Animal proteins ---- Protein FAM71D
Source.8139: DFBPPR22714 ---- Animal proteins ---- Protein FAM71E1
Source.8140: DFBPPR22717 ---- Animal proteins ---- FANCD2 opposite strand protein
Source.8141: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11
Source.8142: DFBPPR22720 ---- Animal proteins ---- UPF0739 protein C1orf74 homolog
Source.8143: DFBPPR22721 ---- Animal proteins ---- Uncharacterized protein KIAA1143 homolog
Source.8144: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog
Source.8145: DFBPPR22725 ---- Animal proteins ---- Uncharacterized protein C4orf46 homolog
Source.8146: DFBPPR22727 ---- Animal proteins ---- Uncharacterized protein C6orf163 homolog
Source.8147: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog
Source.8148: DFBPPR22729 ---- Animal proteins ---- UPF0538 protein C2orf76 homolog
Source.8149: DFBPPR22731 ---- Animal proteins ---- Uncharacterized protein C12orf54 homolog
Source.8150: DFBPPR22734 ---- Animal proteins ---- Uncharacterized protein C1orf226 homolog
Source.8151: DFBPPR22737 ---- Animal proteins ---- UPF0705 protein C11orf49 homolog
Source.8152: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog
Source.8153: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein
Source.8154: DFBPPR22746 ---- Animal proteins ---- Uncharacterized protein C1orf146 homolog
Source.8155: DFBPPR22753 ---- Animal proteins ---- Uncharacterized protein C3orf26 homolog
Source.8156: DFBPPR22756 ---- Animal proteins ---- Uncharacterized protein C1orf189 homolog
Source.8157: DFBPPR22757 ---- Animal proteins ---- Uncharacterized protein CXorf65 homolog
Source.8158: DFBPPR22758 ---- Animal proteins ---- Uncharacterized protein C14orf28 homolog
Source.8159: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.8160: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.8161: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.8162: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.8163: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.8164: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.8165: DFBPPR8537 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.8166: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase
Source.8167: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.8168: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.8169: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.8170: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.8171: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.8172: DFBPPR8546 ---- Animal proteins ---- Insulin
Source.8173: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.8174: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.8175: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.8176: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.8177: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.8178: DFBPPR8553 ---- Animal proteins ---- Protein AMBP
Source.8179: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.8180: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein
Source.8181: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.8182: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6
Source.8183: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial
Source.8184: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.8185: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.8186: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.8187: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.8188: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.8189: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.8190: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.8191: DFBPPR8570 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.8192: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.8193: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.8194: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1
Source.8195: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.8196: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.8197: DFBPPR8577 ---- Animal proteins ---- Nectin-1
Source.8198: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.8199: DFBPPR8582 ---- Animal proteins ---- Interferon gamma
Source.8200: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.8201: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.8202: DFBPPR8590 ---- Animal proteins ---- Phospholipid hydroperoxide glutathione peroxidase
Source.8203: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.8204: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.8205: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.8206: DFBPPR8598 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 5
Source.8207: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha
Source.8208: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.8209: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.8210: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1
Source.8211: DFBPPR8607 ---- Animal proteins ---- Prolactin
Source.8212: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.8213: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.8214: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B
Source.8215: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.8216: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.8217: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.8218: DFBPPR8616 ---- Animal proteins ---- Pleiotrophin
Source.8219: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.8220: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.8221: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.8222: DFBPPR8623 ---- Animal proteins ---- High mobility group protein B1
Source.8223: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1
Source.8224: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.8225: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.8226: DFBPPR8629 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 1
Source.8227: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.8228: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.8229: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.8230: DFBPPR8634 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.8231: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor
Source.8232: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.8233: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.8234: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.8235: DFBPPR8639 ---- Animal proteins ---- Mannose-binding protein A
Source.8236: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.8237: DFBPPR8643 ---- Animal proteins ---- Phospholipase A2, major isoenzyme
Source.8238: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.8239: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.8240: DFBPPR8647 ---- Animal proteins ---- Beclin-1
Source.8241: DFBPPR8649 ---- Animal proteins ---- Acrosin
Source.8242: DFBPPR8650 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.8243: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.8244: DFBPPR8654 ---- Animal proteins ---- DNA-binding protein inhibitor ID-2
Source.8245: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A
Source.8246: DFBPPR8657 ---- Animal proteins ---- Annexin A2
Source.8247: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.8248: DFBPPR8663 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.8249: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.8250: DFBPPR8667 ---- Animal proteins ---- High mobility group protein B2
Source.8251: DFBPPR8669 ---- Animal proteins ---- Heme oxygenase 1
Source.8252: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.8253: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1
Source.8254: DFBPPR8674 ---- Animal proteins ---- Calpain-3
Source.8255: DFBPPR8675 ---- Animal proteins ---- Receptor of activated protein C kinase 1
Source.8256: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.8257: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1
Source.8258: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.8259: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.8260: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.8261: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.8262: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.8263: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.8264: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.8265: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.8266: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.8267: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1
Source.8268: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.8269: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.8270: DFBPPR8697 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.8271: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.8272: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.8273: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.8274: DFBPPR8704 ---- Animal proteins ---- Myc proto-oncogene protein
Source.8275: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.8276: DFBPPR8707 ---- Animal proteins ---- Flotillin-1
Source.8277: DFBPPR8708 ---- Animal proteins ---- Macrophage migration inhibitory factor
Source.8278: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.8279: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.8280: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.8281: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.8282: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.8283: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2
Source.8284: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.8285: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.8286: DFBPPR8718 ---- Animal proteins ---- Ras-related protein Rab-27A
Source.8287: DFBPPR8721 ---- Animal proteins ---- NF-kappa-B inhibitor alpha
Source.8288: DFBPPR8722 ---- Animal proteins ---- Ras-related protein Rab-5A
Source.8289: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.8290: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9
Source.8291: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.8292: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.8293: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1
Source.8294: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.8295: DFBPPR8730 ---- Animal proteins ---- Phosphoacetylglucosamine mutase
Source.8296: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.8297: DFBPPR8733 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial
Source.8298: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H
Source.8299: DFBPPR8736 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1
Source.8300: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.8301: DFBPPR8738 ---- Animal proteins ---- Interleukin-8
Source.8302: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.8303: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.8304: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.8305: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.8306: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.8307: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.8308: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.8309: DFBPPR8750 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.8310: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.8311: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.8312: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.8313: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I
Source.8314: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.8315: DFBPPR8757 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.8316: DFBPPR8758 ---- Animal proteins ---- Caveolin-2
Source.8317: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.8318: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.8319: DFBPPR8766 ---- Animal proteins ---- Myoblast determination protein 1
Source.8320: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.8321: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.8322: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase
Source.8323: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.8324: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.8325: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.8326: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.8327: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.8328: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.8329: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.8330: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.8331: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.8332: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain
Source.8333: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.8334: DFBPPR8784 ---- Animal proteins ---- Transcription factor AP-1
Source.8335: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.8336: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain
Source.8337: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.8338: DFBPPR8792 ---- Animal proteins ---- Plasminogen
Source.8339: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.8340: DFBPPR8795 ---- Animal proteins ---- Pro-adrenomedullin
Source.8341: DFBPPR8797 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.8342: DFBPPR8800 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.8343: DFBPPR8803 ---- Animal proteins ---- Fatty acid-binding protein, adipocyte
Source.8344: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase
Source.8345: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.8346: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.8347: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.8348: DFBPPR8812 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2
Source.8349: DFBPPR8813 ---- Animal proteins ---- Apolipoprotein A-IV
Source.8350: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.8351: DFBPPR8816 ---- Animal proteins ---- 40S ribosomal protein SA
Source.8352: DFBPPR8817 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.8353: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.8354: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.8355: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.8356: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.8357: DFBPPR8822 ---- Animal proteins ---- Apolipoprotein E
Source.8358: DFBPPR8825 ---- Animal proteins ---- Optineurin
Source.8359: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase
Source.8360: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.8361: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.8362: DFBPPR8832 ---- Animal proteins ---- Ras-related protein Rab-3A
Source.8363: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5
Source.8364: DFBPPR8836 ---- Animal proteins ---- Myogenin
Source.8365: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance
Source.8366: DFBPPR8838 ---- Animal proteins ---- Cathepsin K
Source.8367: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.8368: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4
Source.8369: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.8370: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1
Source.8371: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.8372: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.8373: DFBPPR8851 ---- Animal proteins ---- Vimentin
Source.8374: DFBPPR8852 ---- Animal proteins ---- Vimentin
Source.8375: DFBPPR8854 ---- Animal proteins ---- Vimentin
Source.8376: DFBPPR8855 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.8377: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.8378: DFBPPR8857 ---- Animal proteins ---- Allograft inflammatory factor 1
Source.8379: DFBPPR8860 ---- Animal proteins ---- Nucleoside diphosphate kinase B
Source.8380: DFBPPR8861 ---- Animal proteins ---- Colipase
Source.8381: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide
Source.8382: DFBPPR8865 ---- Animal proteins ---- Haptoglobin
Source.8383: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.8384: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2
Source.8385: DFBPPR8869 ---- Animal proteins ---- Muscarinic acetylcholine receptor M1
Source.8386: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.8387: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.8388: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.8389: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B
Source.8390: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.8391: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.8392: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.8393: DFBPPR8897 ---- Animal proteins ---- Cytochrome b
Source.8394: DFBPPR8899 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.8395: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1
Source.8396: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.8397: DFBPPR8904 ---- Animal proteins ---- Osteopontin
Source.8398: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.8399: DFBPPR8906 ---- Animal proteins ---- Sialidase-1
Source.8400: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.8401: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.8402: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.8403: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.8404: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.8405: DFBPPR8922 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.8406: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.8407: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.8408: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.8409: DFBPPR8932 ---- Animal proteins ---- ATPase inhibitor, mitochondrial
Source.8410: DFBPPR8933 ---- Animal proteins ---- ATPase inhibitor, mitochondrial
Source.8411: DFBPPR8939 ---- Animal proteins ---- Kit ligand
Source.8412: DFBPPR8940 ---- Animal proteins ---- Hemoglobin subunit beta
Source.8413: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.8414: DFBPPR8951 ---- Animal proteins ---- ERO1-like protein alpha
Source.8415: DFBPPR8952 ---- Animal proteins ---- ERO1-like protein alpha
Source.8416: DFBPPR8966 ---- Animal proteins ---- Calpain small subunit 1
Source.8417: DFBPPR8970 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.8418: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.8419: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.8420: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.8421: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.8422: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.8423: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1
Source.8424: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.8425: DFBPPR8989 ---- Animal proteins ---- Interleukin-1 beta
Source.8426: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.8427: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3
Source.8428: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component
Source.8429: DFBPPR9005 ---- Animal proteins ---- Protein amnionless
Source.8430: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.8431: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.8432: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.8433: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.8434: DFBPPR9015 ---- Animal proteins ---- Serotransferrin
Source.8435: DFBPPR9016 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial
Source.8436: DFBPPR9017 ---- Animal proteins ---- Mannose-binding protein C
Source.8437: DFBPPR9019 ---- Animal proteins ---- Inositol monophosphatase 1
Source.8438: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.8439: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.8440: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.8441: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.8442: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.8443: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.8444: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.8445: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.8446: DFBPPR9036 ---- Animal proteins ---- Antimicrobial peptide NK-lysin
Source.8447: DFBPPR9039 ---- Animal proteins ---- Desmin
Source.8448: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.8449: DFBPPR9042 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.8450: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase
Source.8451: DFBPPR9044 ---- Animal proteins ---- Albumin
Source.8452: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3
Source.8453: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80
Source.8454: DFBPPR9049 ---- Animal proteins ---- Integral membrane protein 2B
Source.8455: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.8456: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A
Source.8457: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.8458: DFBPPR9056 ---- Animal proteins ---- Protein S100-A11
Source.8459: DFBPPR9057 ---- Animal proteins ---- Phospholipase A2, minor isoenzyme
Source.8460: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf
Source.8461: DFBPPR9061 ---- Animal proteins ---- Caspase-1
Source.8462: DFBPPR9065 ---- Animal proteins ---- GTPase NRas
Source.8463: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1
Source.8464: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.8465: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.8466: DFBPPR9069 ---- Animal proteins ---- E-selectin
Source.8467: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.8468: DFBPPR9073 ---- Animal proteins ---- Vitronectin
Source.8469: DFBPPR9078 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.8470: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor
Source.8471: DFBPPR9081 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.8472: DFBPPR9082 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.8473: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.8474: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.8475: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.8476: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta
Source.8477: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.8478: DFBPPR9092 ---- Animal proteins ---- Galanin peptides
Source.8479: DFBPPR9093 ---- Animal proteins ---- Hemopexin
Source.8480: DFBPPR9094 ---- Animal proteins ---- Aquaporin-5
Source.8481: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.8482: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1
Source.8483: DFBPPR9098 ---- Animal proteins ---- Gastrotropin
Source.8484: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.8485: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.8486: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.8487: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.8488: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.8489: DFBPPR9107 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.8490: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.8491: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.8492: DFBPPR9113 ---- Animal proteins ---- Prophenin and tritrpticin precursor
Source.8493: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.8494: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.8495: DFBPPR9116 ---- Animal proteins ---- Cathepsin B
Source.8496: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.8497: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase
Source.8498: DFBPPR9121 ---- Animal proteins ---- Endoplasmin
Source.8499: DFBPPR9124 ---- Animal proteins ---- Myosin light polypeptide 6
Source.8500: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.8501: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase
Source.8502: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.8503: DFBPPR9131 ---- Animal proteins ---- Cytochrome P450 2C42
Source.8504: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.8505: DFBPPR9134 ---- Animal proteins ---- Ras-related protein Rab-14
Source.8506: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.8507: DFBPPR9137 ---- Animal proteins ---- Microsomal glutathione S-transferase 1
Source.8508: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.8509: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6
Source.8510: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.8511: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1
Source.8512: DFBPPR9143 ---- Animal proteins ---- NKG2-D type II integral membrane protein
Source.8513: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor
Source.8514: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.8515: DFBPPR9151 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.8516: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.8517: DFBPPR9154 ---- Animal proteins ---- Interleukin-6
Source.8518: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.8519: DFBPPR9162 ---- Animal proteins ---- Thioredoxin
Source.8520: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.8521: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.8522: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.8523: DFBPPR9166 ---- Animal proteins ---- Uricase
Source.8524: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.8525: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.8526: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein
Source.8527: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.8528: DFBPPR9171 ---- Animal proteins ---- Sorbin and SH3 domain-containing protein 2
Source.8529: DFBPPR9175 ---- Animal proteins ---- Regulator of G-protein signaling 2
Source.8530: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.8531: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.8532: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.8533: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.8534: DFBPPR9185 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.8535: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10
Source.8536: DFBPPR9188 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain
Source.8537: DFBPPR9192 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.8538: DFBPPR9194 ---- Animal proteins ---- Arginase-1
Source.8539: DFBPPR9195 ---- Animal proteins ---- Sex-determining region Y protein
Source.8540: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.8541: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.8542: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.8543: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.8544: DFBPPR9202 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2B
Source.8545: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.8546: DFBPPR9204 ---- Animal proteins ---- T-cell surface glycoprotein CD1a
Source.8547: DFBPPR9205 ---- Animal proteins ---- Pulmonary surfactant-associated protein D
Source.8548: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10
Source.8549: DFBPPR9207 ---- Animal proteins ---- Beta-enolase
Source.8550: DFBPPR9208 ---- Animal proteins ---- Uteroferrin-associated protein
Source.8551: DFBPPR9209 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.8552: DFBPPR9210 ---- Animal proteins ---- 40S ribosomal protein S23
Source.8553: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1
Source.8554: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.8555: DFBPPR9215 ---- Animal proteins ---- Phosphomevalonate kinase
Source.8556: DFBPPR9216 ---- Animal proteins ---- Netrin-1
Source.8557: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII
Source.8558: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.8559: DFBPPR9221 ---- Animal proteins ---- Catalase
Source.8560: DFBPPR9222 ---- Animal proteins ---- Glutathione peroxidase 1
Source.8561: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.8562: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.8563: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.8564: DFBPPR9228 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.8565: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta
Source.8566: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10
Source.8567: DFBPPR9231 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1
Source.8568: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.8569: DFBPPR9234 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2
Source.8570: DFBPPR9236 ---- Animal proteins ---- Radixin
Source.8571: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.8572: DFBPPR9239 ---- Animal proteins ---- Prophenin-2
Source.8573: DFBPPR9241 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.8574: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B
Source.8575: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29
Source.8576: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.8577: DFBPPR9249 ---- Animal proteins ---- 5-hydroxytryptamine receptor 4
Source.8578: DFBPPR9251 ---- Animal proteins ---- Methionine-R-sulfoxide reductase B1
Source.8579: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor
Source.8580: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.8581: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.8582: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.8583: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase
Source.8584: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.8585: DFBPPR9263 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.8586: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.8587: DFBPPR9265 ---- Animal proteins ---- Pantetheinase
Source.8588: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase
Source.8589: DFBPPR9269 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.8590: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.8591: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.8592: DFBPPR9273 ---- Animal proteins ---- C-C motif chemokine 4
Source.8593: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase
Source.8594: DFBPPR9275 ---- Animal proteins ---- Hemoglobin subunit epsilon
Source.8595: DFBPPR9276 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.8596: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.8597: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.8598: DFBPPR9294 ---- Animal proteins ---- 60S ribosomal protein L10
Source.8599: DFBPPR9296 ---- Animal proteins ---- Transcobalamin-1
Source.8600: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4
Source.8601: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.8602: DFBPPR9302 ---- Animal proteins ---- Agouti-signaling protein
Source.8603: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2
Source.8604: DFBPPR9304 ---- Animal proteins ---- Peroxiredoxin-2
Source.8605: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.8606: DFBPPR9307 ---- Animal proteins ---- Epididymal sperm-binding protein 1
Source.8607: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.8608: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.8609: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.8610: DFBPPR9314 ---- Animal proteins ---- Regucalcin
Source.8611: DFBPPR9316 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.8612: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.8613: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.8614: DFBPPR9323 ---- Animal proteins ---- Lymphotoxin-alpha
Source.8615: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.8616: DFBPPR9327 ---- Animal proteins ---- Multicilin
Source.8617: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor
Source.8618: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase
Source.8619: DFBPPR9337 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.8620: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.8621: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.8622: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.8623: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin
Source.8624: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1
Source.8625: DFBPPR9347 ---- Animal proteins ---- C-reactive protein
Source.8626: DFBPPR9349 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.8627: DFBPPR9350 ---- Animal proteins ---- RNA-binding protein 4B
Source.8628: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.8629: DFBPPR9354 ---- Animal proteins ---- D(1A) dopamine receptor
Source.8630: DFBPPR9355 ---- Animal proteins ---- Agouti-related protein
Source.8631: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.8632: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.8633: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.8634: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.8635: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein
Source.8636: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.8637: DFBPPR9366 ---- Animal proteins ---- Decorin
Source.8638: DFBPPR9368 ---- Animal proteins ---- Myosin-11
Source.8639: DFBPPR9369 ---- Animal proteins ---- Nuclear receptor subfamily 6 group A member 1
Source.8640: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.8641: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.8642: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.8643: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor
Source.8644: DFBPPR9377 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.8645: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.8646: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1
Source.8647: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase
Source.8648: DFBPPR9385 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.8649: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D
Source.8650: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4
Source.8651: DFBPPR9392 ---- Animal proteins ---- mRNA export factor
Source.8652: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.8653: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.8654: DFBPPR9399 ---- Animal proteins ---- High affinity copper uptake protein 1
Source.8655: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.8656: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.8657: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase
Source.8658: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase
Source.8659: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase
Source.8660: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.8661: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.8662: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.8663: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2
Source.8664: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase
Source.8665: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.8666: DFBPPR9420 ---- Animal proteins ---- B1 bradykinin receptor
Source.8667: DFBPPR9421 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.8668: DFBPPR9422 ---- Animal proteins ---- C-C motif chemokine 25
Source.8669: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.8670: DFBPPR9427 ---- Animal proteins ---- Protein quaking
Source.8671: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59
Source.8672: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59
Source.8673: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.8674: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.8675: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.8676: DFBPPR9444 ---- Animal proteins ---- Calcitonin gene-related peptide
Source.8677: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.8678: DFBPPR9447 ---- Animal proteins ---- Myosin light chain 4
Source.8679: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.8680: DFBPPR9456 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.8681: DFBPPR9459 ---- Animal proteins ---- Glutaredoxin-1
Source.8682: DFBPPR9461 ---- Animal proteins ---- CCN family member 2
Source.8683: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.8684: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.8685: DFBPPR9484 ---- Animal proteins ---- Macoilin
Source.8686: DFBPPR9485 ---- Animal proteins ---- Destrin
Source.8687: DFBPPR9487 ---- Animal proteins ---- Troponin C, slow skeletal and cardiac muscles
Source.8688: DFBPPR9494 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin
Source.8689: DFBPPR9495 ---- Animal proteins ---- Complement factor B
Source.8690: DFBPPR9501 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.8691: DFBPPR9502 ---- Animal proteins ---- Endothelin-1 receptor
Source.8692: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1
Source.8693: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2
Source.8694: DFBPPR9506 ---- Animal proteins ---- 40S ribosomal protein S18
Source.8695: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.8696: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa
Source.8697: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.8698: DFBPPR9511 ---- Animal proteins ---- Cholinesterase
Source.8699: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.8700: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24
Source.8701: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.8702: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.8703: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a
Source.8704: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1
Source.8705: DFBPPR9525 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.8706: DFBPPR9527 ---- Animal proteins ---- Nuclear factor 1
Source.8707: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25
Source.8708: DFBPPR9531 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.8709: DFBPPR9536 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial
Source.8710: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.8711: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.8712: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase
Source.8713: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.8714: DFBPPR9544 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.8715: DFBPPR9546 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1E
Source.8716: DFBPPR9547 ---- Animal proteins ---- Ras-related protein Rab-1B
Source.8717: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha
Source.8718: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.8719: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2
Source.8720: DFBPPR9554 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.8721: DFBPPR9557 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.8722: DFBPPR9558 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.8723: DFBPPR9559 ---- Animal proteins ---- CD302 antigen
Source.8724: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C
Source.8725: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.8726: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1
Source.8727: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.8728: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3
Source.8729: DFBPPR9569 ---- Animal proteins ---- Myelin proteolipid protein
Source.8730: DFBPPR9570 ---- Animal proteins ---- Gastrokine-1
Source.8731: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.8732: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase
Source.8733: DFBPPR9577 ---- Animal proteins ---- Stathmin
Source.8734: DFBPPR9578 ---- Animal proteins ---- Biglycan
Source.8735: DFBPPR9579 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial
Source.8736: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.8737: DFBPPR9585 ---- Animal proteins ---- Uterine plasmin/trypsin inhibitor
Source.8738: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.8739: DFBPPR9589 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A
Source.8740: DFBPPR9590 ---- Animal proteins ---- Bax inhibitor 1
Source.8741: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.8742: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin
Source.8743: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.8744: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.8745: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.8746: DFBPPR9607 ---- Animal proteins ---- F-actin-capping protein subunit beta
Source.8747: DFBPPR9608 ---- Animal proteins ---- Interleukin-21
Source.8748: DFBPPR9609 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.8749: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.8750: DFBPPR9612 ---- Animal proteins ---- 40S ribosomal protein S20
Source.8751: DFBPPR9614 ---- Animal proteins ---- Myosin regulatory light chain 2, atrial isoform
Source.8752: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.8753: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.8754: DFBPPR9627 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.8755: DFBPPR9628 ---- Animal proteins ---- Mineralocorticoid receptor
Source.8756: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.8757: DFBPPR9633 ---- Animal proteins ---- Claudin-17
Source.8758: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.8759: DFBPPR9635 ---- Animal proteins ---- Cytochrome b561
Source.8760: DFBPPR9636 ---- Animal proteins ---- D-aspartate oxidase
Source.8761: DFBPPR9637 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.8762: DFBPPR9639 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase
Source.8763: DFBPPR9643 ---- Animal proteins ---- Apolipoprotein M
Source.8764: DFBPPR9644 ---- Animal proteins ---- Lambda-crystallin homolog
Source.8765: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.8766: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6
Source.8767: DFBPPR9656 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.8768: DFBPPR9658 ---- Animal proteins ---- Melanocortin receptor 5
Source.8769: DFBPPR9659 ---- Animal proteins ---- Placenta-expressed transcript 1 protein
Source.8770: DFBPPR9661 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial
Source.8771: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.8772: DFBPPR9664 ---- Animal proteins ---- Perilipin-2
Source.8773: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.8774: DFBPPR9671 ---- Animal proteins ---- S-arrestin
Source.8775: DFBPPR9672 ---- Animal proteins ---- Elongation factor 1-beta
Source.8776: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.8777: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.8778: DFBPPR9681 ---- Animal proteins ---- Complement C5a anaphylatoxin
Source.8779: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase
Source.8780: DFBPPR9684 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.8781: DFBPPR9686 ---- Animal proteins ---- Fatty acid-binding protein, heart
Source.8782: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1
Source.8783: DFBPPR9689 ---- Animal proteins ---- G-protein coupled receptor 4
Source.8784: DFBPPR9690 ---- Animal proteins ---- Zinc transporter SLC39A7
Source.8785: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein
Source.8786: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta
Source.8787: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.8788: DFBPPR9698 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.8789: DFBPPR9699 ---- Animal proteins ---- Angiopoietin-1
Source.8790: DFBPPR9700 ---- Animal proteins ---- Galectin-1
Source.8791: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.8792: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.8793: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.8794: DFBPPR9712 ---- Animal proteins ---- Signal peptidase complex subunit 1
Source.8795: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.8796: DFBPPR9715 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27
Source.8797: DFBPPR9718 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.8798: DFBPPR9721 ---- Animal proteins ---- WAP four-disulfide core domain protein 2
Source.8799: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.8800: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.8801: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.8802: DFBPPR9728 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein
Source.8803: DFBPPR9729 ---- Animal proteins ---- Secretagogin
Source.8804: DFBPPR9730 ---- Animal proteins ---- Urotensin-2
Source.8805: DFBPPR9731 ---- Animal proteins ---- Cerebellin-1
Source.8806: DFBPPR9734 ---- Animal proteins ---- Replication termination factor 2
Source.8807: DFBPPR9736 ---- Animal proteins ---- Metaxin-1
Source.8808: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.8809: DFBPPR9741 ---- Animal proteins ---- Syndecan-4
Source.8810: DFBPPR9744 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 14B
Source.8811: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.8812: DFBPPR9752 ---- Animal proteins ---- GPN-loop GTPase 2
Source.8813: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.8814: DFBPPR9762 ---- Animal proteins ---- Prenylated Rab acceptor protein 1
Source.8815: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform
Source.8816: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.8817: DFBPPR9765 ---- Animal proteins ---- Promotilin
Source.8818: DFBPPR9768 ---- Animal proteins ---- Protein canopy homolog 3
Source.8819: DFBPPR9772 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.8820: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha
Source.8821: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.8822: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1
Source.8823: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15
Source.8824: DFBPPR9784 ---- Animal proteins ---- Translocator protein
Source.8825: DFBPPR9785 ---- Animal proteins ---- F-box only protein 32
Source.8826: DFBPPR9789 ---- Animal proteins ---- Calsequestrin-2
Source.8827: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.8828: DFBPPR9796 ---- Animal proteins ---- Arrestin-C
Source.8829: DFBPPR9803 ---- Animal proteins ---- 60S ribosomal protein L3
Source.8830: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.8831: DFBPPR9805 ---- Animal proteins ---- Fatty acid-binding protein, intestinal
Source.8832: DFBPPR9806 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.8833: DFBPPR9807 ---- Animal proteins ---- Galectin-4
Source.8834: DFBPPR9813 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.8835: DFBPPR9815 ---- Animal proteins ---- Eukaryotic translation initiation factor 1b
Source.8836: DFBPPR9816 ---- Animal proteins ---- Metaxin-2
Source.8837: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.8838: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.8839: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1
Source.8840: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.8841: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.8842: DFBPPR9834 ---- Animal proteins ---- Interferon-related developmental regulator 1
Source.8843: DFBPPR9839 ---- Animal proteins ---- Nurim
Source.8844: DFBPPR9841 ---- Animal proteins ---- Interleukin-10
Source.8845: DFBPPR9843 ---- Animal proteins ---- P protein
Source.8846: DFBPPR9848 ---- Animal proteins ---- Nicotinamide N-methyltransferase
Source.8847: DFBPPR9852 ---- Animal proteins ---- Trafficking protein particle complex subunit 2
Source.8848: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.8849: DFBPPR9857 ---- Animal proteins ---- Cytochrome c oxidase subunit 6C
Source.8850: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.8851: DFBPPR9866 ---- Animal proteins ---- SH2 domain-containing protein 1A
Source.8852: DFBPPR9868 ---- Animal proteins ---- Integrin beta-1-binding protein 2
Source.8853: DFBPPR9869 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.8854: DFBPPR9872 ---- Animal proteins ---- Transmembrane protein 14A
Source.8855: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.8856: DFBPPR9874 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1
Source.8857: DFBPPR9875 ---- Animal proteins ---- Fatty acid-binding protein, liver
Source.8858: DFBPPR9877 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.8859: DFBPPR9878 ---- Animal proteins ---- Selenoprotein F
Source.8860: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17
Source.8861: DFBPPR9883 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.8862: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1
Source.8863: DFBPPR9886 ---- Animal proteins ---- 60S ribosomal protein L10a
Source.8864: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.8865: DFBPPR9898 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.8866: DFBPPR9902 ---- Animal proteins ---- 40S ribosomal protein S19
Source.8867: DFBPPR9903 ---- Animal proteins ---- Cyclin-G1
Source.8868: DFBPPR9906 ---- Animal proteins ---- Tetraspanin-9
Source.8869: DFBPPR9913 ---- Animal proteins ---- PRELI domain containing protein 3B
Source.8870: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2
Source.8871: DFBPPR9916 ---- Animal proteins ---- Proteasome activator complex subunit 1
Source.8872: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.8873: DFBPPR9923 ---- Animal proteins ---- Small muscular protein
Source.8874: DFBPPR9926 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.8875: DFBPPR9927 ---- Animal proteins ---- Protein BTG3
Source.8876: DFBPPR9931 ---- Animal proteins ---- PDZK1-interacting protein 1
Source.8877: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.8878: DFBPPR9940 ---- Animal proteins ---- Neuronatin
Source.8879: DFBPPR9941 ---- Animal proteins ---- 60S ribosomal protein L7-like 1
Source.8880: DFBPPR9942 ---- Animal proteins ---- Proline-rich protein 3
Source.8881: DFBPPR9943 ---- Animal proteins ---- Transmembrane protein 251
Source.8882: DFBPPR9949 ---- Animal proteins ---- Coiled-coil domain-containing protein 127
Source.8883: DFBPPR9953 ---- Animal proteins ---- Gallinacin-1 alpha
Source.8884: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.8885: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.8886: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.8887: DFBPPR9957 ---- Animal proteins ---- Ovoinhibitor
Source.8888: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase
Source.8889: DFBPPR9961 ---- Animal proteins ---- Somatotropin
Source.8890: DFBPPR9966 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.8891: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.8892: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin
Source.8893: DFBPPR9973 ---- Animal proteins ---- High mobility group protein B1
Source.8894: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.8895: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.8896: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.8897: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.8898: DFBPPR9980 ---- Animal proteins ---- Cathelicidin-1
Source.8899: DFBPPR9982 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.8900: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.8901: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput
Source.8902: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.8903: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.8904: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.8905: DFBPPR9989 ---- Animal proteins ---- VIP peptides
Source.8906: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.8907: DFBPPR9992 ---- Animal proteins ---- Receptor of activated protein C kinase 1
Source.8908: DFBPPR9993 ---- Animal proteins ---- Ovalbumin
Source.8909: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.8910: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.8911: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.8912: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.8913: DFBPPR9999 ---- Animal proteins ---- Apoptosis regulator Bcl-2
Source.8914: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.8915: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.8916: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1
Source.8917: DFBPPR10007 ---- Animal proteins ---- Protein Wnt-1
Source.8918: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b
Source.8919: DFBPPR10009 ---- Animal proteins ---- Transthyretin
Source.8920: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.8921: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16
Source.8922: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src
Source.8923: DFBPPR10014 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13
Source.8924: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.8925: DFBPPR10016 ---- Animal proteins ---- High mobility group protein B2
Source.8926: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx
Source.8927: DFBPPR10020 ---- Animal proteins ---- PDZ and LIM domain protein 7
Source.8928: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.8929: DFBPPR10024 ---- Animal proteins ---- Myosin light polypeptide 6
Source.8930: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.8931: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.8932: DFBPPR10028 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.8933: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B
Source.8934: DFBPPR10030 ---- Animal proteins ---- Calbindin
Source.8935: DFBPPR10031 ---- Animal proteins ---- Calcineurin B homologous protein 1
Source.8936: DFBPPR10032 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.8937: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.8938: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.8939: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.8940: DFBPPR10037 ---- Animal proteins ---- Leptin
Source.8941: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A
Source.8942: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.8943: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.8944: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.8945: DFBPPR10045 ---- Animal proteins ---- Albumin
Source.8946: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.8947: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.8948: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.8949: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.8950: DFBPPR10052 ---- Animal proteins ---- Protein Wnt-11
Source.8951: DFBPPR10054 ---- Animal proteins ---- Kit ligand
Source.8952: DFBPPR10055 ---- Animal proteins ---- Protein Wnt-3a
Source.8953: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.8954: DFBPPR10057 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.8955: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.8956: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4
Source.8957: DFBPPR10061 ---- Animal proteins ---- Ovocleidin-17
Source.8958: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.8959: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.8960: DFBPPR10067 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.8961: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9
Source.8962: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.8963: DFBPPR10070 ---- Animal proteins ---- Vesicle-associated membrane protein 7
Source.8964: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase
Source.8965: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1
Source.8966: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.8967: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.8968: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.8969: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.8970: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor
Source.8971: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2
Source.8972: DFBPPR10082 ---- Animal proteins ---- Pinopsin
Source.8973: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.8974: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.8975: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.8976: DFBPPR10088 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.8977: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.8978: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.8979: DFBPPR10092 ---- Animal proteins ---- Retinol-binding protein 4
Source.8980: DFBPPR10093 ---- Animal proteins ---- Beta-nerve growth factor
Source.8981: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.8982: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.8983: DFBPPR10097 ---- Animal proteins ---- Ras-related protein Rab-10
Source.8984: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1
Source.8985: DFBPPR10100 ---- Animal proteins ---- STIP1 homology and U box-containing protein 1
Source.8986: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.8987: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.8988: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.8989: DFBPPR10107 ---- Animal proteins ---- Ovomucoid
Source.8990: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7
Source.8991: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase
Source.8992: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.8993: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.8994: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.8995: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.8996: DFBPPR10121 ---- Animal proteins ---- Fibroblast growth factor 2
Source.8997: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3
Source.8998: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.8999: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.9000: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.9001: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1
Source.9002: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1
Source.9003: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.9004: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.9005: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.9006: DFBPPR10136 ---- Animal proteins ---- Annexin A2
Source.9007: DFBPPR10137 ---- Animal proteins ---- Growth/differentiation factor 8
Source.9008: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor
Source.9009: DFBPPR10139 ---- Animal proteins ---- Cytochrome b
Source.9010: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.9011: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5
Source.9012: DFBPPR10142 ---- Animal proteins ---- Calpain-3
Source.9013: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.9014: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.9015: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.9016: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.9017: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.9018: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.9019: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor
Source.9020: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.9021: DFBPPR10154 ---- Animal proteins ---- Glutathione S-transferase 2
Source.9022: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.9023: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5
Source.9024: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog
Source.9025: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1
Source.9026: DFBPPR10160 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.9027: DFBPPR10161 ---- Animal proteins ---- High mobility group protein B3
Source.9028: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.9029: DFBPPR10163 ---- Animal proteins ---- Annexin A6
Source.9030: DFBPPR10164 ---- Animal proteins ---- Insulin-like growth factor II
Source.9031: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8
Source.9032: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.9033: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1
Source.9034: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.9035: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.9036: DFBPPR10171 ---- Animal proteins ---- Heterochromatin-associated protein MENT
Source.9037: DFBPPR10172 ---- Animal proteins ---- Basic helix-loop-helix transcription factor scleraxis
Source.9038: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.9039: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2
Source.9040: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.9041: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5
Source.9042: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.9043: DFBPPR10178 ---- Animal proteins ---- Homeobox protein SIX3
Source.9044: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20
Source.9045: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.9046: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.9047: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1
Source.9048: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.9049: DFBPPR10184 ---- Animal proteins ---- LIM/homeobox protein Lhx1
Source.9050: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.9051: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1
Source.9052: DFBPPR10187 ---- Animal proteins ---- Myogenin
Source.9053: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein
Source.9054: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2
Source.9055: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.9056: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk
Source.9057: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.9058: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.9059: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.9060: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.9061: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.9062: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.9063: DFBPPR10205 ---- Animal proteins ---- Noelin
Source.9064: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.9065: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.9066: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.9067: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.9068: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4
Source.9069: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5
Source.9070: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1
Source.9071: DFBPPR10215 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.9072: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.9073: DFBPPR10218 ---- Animal proteins ---- Occludin
Source.9074: DFBPPR10219 ---- Animal proteins ---- Presenilin-1
Source.9075: DFBPPR10220 ---- Animal proteins ---- Paxillin
Source.9076: DFBPPR10221 ---- Animal proteins ---- Blood vessel epicardial substance
Source.9077: DFBPPR10222 ---- Animal proteins ---- Podocalyxin
Source.9078: DFBPPR10223 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.9079: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.9080: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1
Source.9081: DFBPPR10226 ---- Animal proteins ---- GTPase HRas
Source.9082: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11
Source.9083: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.9084: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.9085: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3
Source.9086: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.9087: DFBPPR10235 ---- Animal proteins ---- Fibroblast growth factor 8
Source.9088: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.9089: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2
Source.9090: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.9091: DFBPPR10240 ---- Animal proteins ---- Cerberus
Source.9092: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.9093: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.9094: DFBPPR10243 ---- Animal proteins ---- Core histone macro-H2A.1
Source.9095: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.9096: DFBPPR10247 ---- Animal proteins ---- Actin filament-associated protein 1
Source.9097: DFBPPR10248 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B
Source.9098: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.9099: DFBPPR10252 ---- Animal proteins ---- Indian hedgehog protein
Source.9100: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1
Source.9101: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.9102: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6
Source.9103: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.9104: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.9105: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.9106: DFBPPR10260 ---- Animal proteins ---- F-actin-capping protein subunit beta isoforms 1 and 2
Source.9107: DFBPPR10261 ---- Animal proteins ---- Cadherin-13
Source.9108: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1
Source.9109: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.9110: DFBPPR10267 ---- Animal proteins ---- Gephyrin
Source.9111: DFBPPR10268 ---- Animal proteins ---- CD166 antigen
Source.9112: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1
Source.9113: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.9114: DFBPPR10271 ---- Animal proteins ---- Cadherin-7
Source.9115: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2
Source.9116: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.9117: DFBPPR10274 ---- Animal proteins ---- CCN family member 1
Source.9118: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.9119: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.9120: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.9121: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.9122: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6
Source.9123: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.9124: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.9125: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.9126: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.9127: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.9128: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2
Source.9129: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP
Source.9130: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.9131: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.9132: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.9133: DFBPPR10298 ---- Animal proteins ---- Caldesmon
Source.9134: DFBPPR10299 ---- Animal proteins ---- Myoblast determination protein 1 homolog
Source.9135: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.9136: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2
Source.9137: DFBPPR10302 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.9138: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.9139: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.9140: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1
Source.9141: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.9142: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.9143: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.9144: DFBPPR10311 ---- Animal proteins ---- Homeobox protein engrailed-2
Source.9145: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.9146: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP
Source.9147: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.9148: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.9149: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.9150: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1
Source.9151: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.9152: DFBPPR10322 ---- Animal proteins ---- Peroxiredoxin-1
Source.9153: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7
Source.9154: DFBPPR10327 ---- Animal proteins ---- Proheparin-binding EGF-like growth factor
Source.9155: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.9156: DFBPPR10331 ---- Animal proteins ---- Calcineurin B homologous protein 3
Source.9157: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.9158: DFBPPR10333 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.9159: DFBPPR10335 ---- Animal proteins ---- RNA-binding protein with multiple splicing 2
Source.9160: DFBPPR10336 ---- Animal proteins ---- Rho-related GTP-binding protein RhoC
Source.9161: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.9162: DFBPPR10339 ---- Animal proteins ---- Osteocalcin
Source.9163: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.9164: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1
Source.9165: DFBPPR10344 ---- Animal proteins ---- Centromere protein W
Source.9166: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.9167: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.9168: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.9169: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.9170: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.9171: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2
Source.9172: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.9173: DFBPPR10361 ---- Animal proteins ---- Protein HIRA
Source.9174: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.9175: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.9176: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR
Source.9177: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24
Source.9178: DFBPPR10368 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.9179: DFBPPR10369 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.9180: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.9181: DFBPPR10376 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.9182: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.9183: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.9184: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.9185: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.9186: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.9187: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.9188: DFBPPR10391 ---- Animal proteins ---- Annexin A5
Source.9189: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65
Source.9190: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.9191: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf
Source.9192: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.9193: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.9194: DFBPPR10400 ---- Animal proteins ---- Serotonin N-acetyltransferase
Source.9195: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.9196: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.9197: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.9198: DFBPPR10405 ---- Animal proteins ---- Ras-related protein Rab-8A
Source.9199: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.9200: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.9201: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.9202: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.9203: DFBPPR10412 ---- Animal proteins ---- Dysbindin
Source.9204: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.9205: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.9206: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.9207: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5
Source.9208: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin
Source.9209: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.9210: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.9211: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.9212: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.9213: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10
Source.9214: DFBPPR10427 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle major isoform
Source.9215: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.9216: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.9217: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.9218: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.9219: DFBPPR10436 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.9220: DFBPPR10441 ---- Animal proteins ---- Laminin subunit beta-1
Source.9221: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.9222: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2
Source.9223: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.9224: DFBPPR10447 ---- Animal proteins ---- Plastin-1
Source.9225: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.9226: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.9227: DFBPPR10451 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.9228: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.9229: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.9230: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.9231: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.9232: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.9233: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.9234: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.9235: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.9236: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.9237: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.9238: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.9239: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.9240: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.9241: DFBPPR10473 ---- Animal proteins ---- Gallinacin-1
Source.9242: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.9243: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.9244: DFBPPR10480 ---- Animal proteins ---- Cathepsin D
Source.9245: DFBPPR10481 ---- Animal proteins ---- Syndecan-3
Source.9246: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.9247: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.9248: DFBPPR10484 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.9249: DFBPPR10485 ---- Animal proteins ---- LIM domain-binding protein 1
Source.9250: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2
Source.9251: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6
Source.9252: DFBPPR10491 ---- Animal proteins ---- Neuronal calcium sensor 1
Source.9253: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.9254: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.9255: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.9256: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.9257: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.9258: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.9259: DFBPPR10505 ---- Animal proteins ---- DNA-binding protein Ikaros
Source.9260: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2
Source.9261: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.9262: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.9263: DFBPPR10515 ---- Animal proteins ---- Cathelicidin-2
Source.9264: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.9265: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.9266: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.9267: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.9268: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.9269: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase
Source.9270: DFBPPR10525 ---- Animal proteins ---- Thyroid hormone receptor beta
Source.9271: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2
Source.9272: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.9273: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.9274: DFBPPR10530 ---- Animal proteins ---- Osteopontin
Source.9275: DFBPPR10531 ---- Animal proteins ---- Serpin H1
Source.9276: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase
Source.9277: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.9278: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.9279: DFBPPR10535 ---- Animal proteins ---- Protein SPT2 homolog
Source.9280: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.9281: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.9282: DFBPPR10541 ---- Animal proteins ---- Glypican-1
Source.9283: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor
Source.9284: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3
Source.9285: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.9286: DFBPPR10546 ---- Animal proteins ---- Calmodulin
Source.9287: DFBPPR10548 ---- Animal proteins ---- Syndecan-4
Source.9288: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.9289: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1
Source.9290: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.9291: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.9292: DFBPPR10557 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 1
Source.9293: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.9294: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.9295: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.9296: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2
Source.9297: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.9298: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.9299: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.9300: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.9301: DFBPPR10570 ---- Animal proteins ---- Protein atonal homolog 7
Source.9302: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.9303: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b
Source.9304: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.9305: DFBPPR10574 ---- Animal proteins ---- Stathmin-2
Source.9306: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.9307: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase
Source.9308: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.9309: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.9310: DFBPPR10582 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B'
Source.9311: DFBPPR10584 ---- Animal proteins ---- Nuclear distribution protein nudE homolog 1
Source.9312: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin
Source.9313: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.9314: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.9315: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase
Source.9316: DFBPPR10592 ---- Animal proteins ---- Ras-related protein Rab-14
Source.9317: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6
Source.9318: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit
Source.9319: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.9320: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.9321: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain
Source.9322: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.9323: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.9324: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.9325: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.9326: DFBPPR10605 ---- Animal proteins ---- Elastin
Source.9327: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.9328: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.9329: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D
Source.9330: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.9331: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.9332: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX
Source.9333: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.9334: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6
Source.9335: DFBPPR10619 ---- Animal proteins ---- Adenosine receptor A2b
Source.9336: DFBPPR10620 ---- Animal proteins ---- Centromere protein T
Source.9337: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1
Source.9338: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin
Source.9339: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.9340: DFBPPR10624 ---- Animal proteins ---- 40S ribosomal protein SA
Source.9341: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.9342: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.9343: DFBPPR10629 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.9344: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.9345: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase
Source.9346: DFBPPR10634 ---- Animal proteins ---- Procathepsin L
Source.9347: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.9348: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.9349: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.9350: DFBPPR10643 ---- Animal proteins ---- Sclerostin domain-containing protein 1
Source.9351: DFBPPR10644 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.9352: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5
Source.9353: DFBPPR10646 ---- Animal proteins ---- Netrin-1
Source.9354: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.9355: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.9356: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.9357: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.9358: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1
Source.9359: DFBPPR10656 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.9360: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.9361: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.9362: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.9363: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.9364: DFBPPR10662 ---- Animal proteins ---- CCN family member 3
Source.9365: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase
Source.9366: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.9367: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.9368: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.9369: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3
Source.9370: DFBPPR10670 ---- Animal proteins ---- Interferon lambda-3
Source.9371: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.9372: DFBPPR10672 ---- Animal proteins ---- Nibrin
Source.9373: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.9374: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein
Source.9375: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4
Source.9376: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin
Source.9377: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.9378: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.9379: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.9380: DFBPPR10686 ---- Animal proteins ---- Collectin-11
Source.9381: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.9382: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.9383: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.9384: DFBPPR10691 ---- Animal proteins ---- Beclin-1
Source.9385: DFBPPR10692 ---- Animal proteins ---- Protein Wnt-9a
Source.9386: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.9387: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.9388: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.9389: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2
Source.9390: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.9391: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.9392: DFBPPR10701 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.9393: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.9394: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.9395: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2
Source.9396: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.9397: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.9398: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.9399: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.9400: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.9401: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.9402: DFBPPR10715 ---- Animal proteins ---- Lumican
Source.9403: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.9404: DFBPPR10718 ---- Animal proteins ---- Myosin light chain 1, skeletal muscle isoform
Source.9405: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.9406: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog
Source.9407: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.9408: DFBPPR10724 ---- Animal proteins ---- Insulin-induced gene 1 protein
Source.9409: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2
Source.9410: DFBPPR10726 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.9411: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.9412: DFBPPR10731 ---- Animal proteins ---- Protein cereblon
Source.9413: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.9414: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.9415: DFBPPR10737 ---- Animal proteins ---- Programmed cell death protein 10
Source.9416: DFBPPR10739 ---- Animal proteins ---- Transcription factor SOX-14
Source.9417: DFBPPR10740 ---- Animal proteins ---- Cryptic protein
Source.9418: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.9419: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.9420: DFBPPR10744 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.9421: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.9422: DFBPPR10746 ---- Animal proteins ---- P2Y purinoceptor 1
Source.9423: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.9424: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.9425: DFBPPR10749 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.9426: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.9427: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4
Source.9428: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.9429: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase
Source.9430: DFBPPR10760 ---- Animal proteins ---- Fatty acid-binding protein, liver
Source.9431: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.9432: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.9433: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.9434: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.9435: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.9436: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.9437: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.9438: DFBPPR10780 ---- Animal proteins ---- Caspase-2
Source.9439: DFBPPR10782 ---- Animal proteins ---- Vesicle-trafficking protein SEC22b
Source.9440: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.9441: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe
Source.9442: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase
Source.9443: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.9444: DFBPPR10794 ---- Animal proteins ---- Zyxin
Source.9445: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.9446: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12
Source.9447: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.9448: DFBPPR10799 ---- Animal proteins ---- Adenylosuccinate lyase
Source.9449: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1
Source.9450: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.9451: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.9452: DFBPPR10806 ---- Animal proteins ---- Cathelicidin-3
Source.9453: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.9454: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.9455: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.9456: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.9457: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.9458: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.9459: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain
Source.9460: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.9461: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha
Source.9462: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.9463: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.9464: DFBPPR10826 ---- Animal proteins ---- Cofilin-2
Source.9465: DFBPPR10836 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.9466: DFBPPR10837 ---- Animal proteins ---- GTPase NRas
Source.9467: DFBPPR10839 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2
Source.9468: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.9469: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5
Source.9470: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1
Source.9471: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.9472: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.9473: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A
Source.9474: DFBPPR10849 ---- Animal proteins ---- Fatty acid-binding protein, brain
Source.9475: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.9476: DFBPPR10851 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.9477: DFBPPR10852 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.9478: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.9479: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.9480: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.9481: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26
Source.9482: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.9483: DFBPPR10860 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.9484: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.9485: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.9486: DFBPPR10866 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.9487: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11
Source.9488: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.9489: DFBPPR10871 ---- Animal proteins ---- Carnosine N-methyltransferase 2
Source.9490: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.9491: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.9492: DFBPPR10875 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.9493: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.9494: DFBPPR10878 ---- Animal proteins ---- Zinc finger protein DPF3
Source.9495: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain
Source.9496: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.9497: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.9498: DFBPPR10885 ---- Animal proteins ---- Pepsin A
Source.9499: DFBPPR10887 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.9500: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.9501: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.9502: DFBPPR10891 ---- Animal proteins ---- Hepatocyte nuclear factor 1-alpha
Source.9503: DFBPPR10892 ---- Animal proteins ---- Myogenic factor 5
Source.9504: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain
Source.9505: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.9506: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.9507: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.9508: DFBPPR10897 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.9509: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.9510: DFBPPR10903 ---- Animal proteins ---- Myosin light chain 3, skeletal muscle isoform
Source.9511: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.9512: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12
Source.9513: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.9514: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1
Source.9515: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.9516: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.9517: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1
Source.9518: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3
Source.9519: DFBPPR10923 ---- Animal proteins ---- Ras-related protein Rab-5B
Source.9520: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.9521: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2
Source.9522: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.9523: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.9524: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48
Source.9525: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1
Source.9526: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.9527: DFBPPR10934 ---- Animal proteins ---- Glutathione S-transferase theta-1
Source.9528: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.9529: DFBPPR10938 ---- Animal proteins ---- Serine/threonine-protein kinase mos
Source.9530: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.9531: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.9532: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2
Source.9533: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.9534: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.9535: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.9536: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.9537: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.9538: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2
Source.9539: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y
Source.9540: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor
Source.9541: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like
Source.9542: DFBPPR10954 ---- Animal proteins ---- Protein max
Source.9543: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta
Source.9544: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta
Source.9545: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type
Source.9546: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.9547: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.9548: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.9549: DFBPPR10965 ---- Animal proteins ---- Nuclear factor 1 X-type
Source.9550: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.9551: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2
Source.9552: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1
Source.9553: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo
Source.9554: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.9555: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.9556: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.9557: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.9558: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.9559: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.9560: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20
Source.9561: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8
Source.9562: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase
Source.9563: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.9564: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1
Source.9565: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.9566: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.9567: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.9568: DFBPPR10995 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.9569: DFBPPR10996 ---- Animal proteins ---- Semaphorin-4D
Source.9570: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.9571: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.9572: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1
Source.9573: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3
Source.9574: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein
Source.9575: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.9576: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.9577: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.9578: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase
Source.9579: DFBPPR11007 ---- Animal proteins ---- Anamorsin
Source.9580: DFBPPR11008 ---- Animal proteins ---- Homeobox protein NANOG
Source.9581: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.9582: DFBPPR11011 ---- Animal proteins ---- Epigen
Source.9583: DFBPPR11012 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.9584: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.9585: DFBPPR11015 ---- Animal proteins ---- Myeloid protein 1
Source.9586: DFBPPR11016 ---- Animal proteins ---- Protein lin-7 homolog C
Source.9587: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.9588: DFBPPR11020 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 2
Source.9589: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor
Source.9590: DFBPPR11023 ---- Animal proteins ---- 43 kDa receptor-associated protein of the synapse
Source.9591: DFBPPR11024 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.9592: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.9593: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu
Source.9594: DFBPPR11027 ---- Animal proteins ---- Ras-related protein Rab-18
Source.9595: DFBPPR11028 ---- Animal proteins ---- Interleukin-6
Source.9596: DFBPPR11029 ---- Animal proteins ---- Myelin proteolipid protein
Source.9597: DFBPPR11030 ---- Animal proteins ---- Protein C-ets-2
Source.9598: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.9599: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.9600: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.9601: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.9602: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.9603: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1
Source.9604: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.9605: DFBPPR11042 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.9606: DFBPPR11043 ---- Animal proteins ---- Centromere protein H
Source.9607: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.9608: DFBPPR11047 ---- Animal proteins ---- Nucleolin
Source.9609: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.9610: DFBPPR11051 ---- Animal proteins ---- Signal peptidase complex subunit 3
Source.9611: DFBPPR11052 ---- Animal proteins ---- Protein cornichon homolog 2
Source.9612: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase
Source.9613: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.9614: DFBPPR11055 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.9615: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13
Source.9616: DFBPPR11057 ---- Animal proteins ---- Calcitonin gene-related peptide
Source.9617: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.9618: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.9619: DFBPPR11060 ---- Animal proteins ---- Netrin-3
Source.9620: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2
Source.9621: DFBPPR11062 ---- Animal proteins ---- Regucalcin
Source.9622: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.9623: DFBPPR11067 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.9624: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein
Source.9625: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1
Source.9626: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.9627: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.9628: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.9629: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.9630: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.9631: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.9632: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1
Source.9633: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1
Source.9634: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.9635: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2
Source.9636: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.9637: DFBPPR11090 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.9638: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.9639: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1
Source.9640: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.9641: DFBPPR11098 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.9642: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin
Source.9643: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A
Source.9644: DFBPPR11103 ---- Animal proteins ---- Ribosome maturation protein SBDS
Source.9645: DFBPPR11104 ---- Animal proteins ---- Importin subunit alpha-5
Source.9646: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.9647: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1
Source.9648: DFBPPR11108 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial
Source.9649: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.9650: DFBPPR11112 ---- Animal proteins ---- Protein quaking
Source.9651: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.9652: DFBPPR11115 ---- Animal proteins ---- Eyes absent homolog 1
Source.9653: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.9654: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.9655: DFBPPR11119 ---- Animal proteins ---- Homeobox protein Nkx-2.5
Source.9656: DFBPPR11121 ---- Animal proteins ---- Lysosomal amino acid transporter 1 homolog
Source.9657: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14
Source.9658: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.9659: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta
Source.9660: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.9661: DFBPPR11126 ---- Animal proteins ---- Parvalbumin, thymic
Source.9662: DFBPPR11127 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform
Source.9663: DFBPPR11128 ---- Animal proteins ---- Ras-related protein Rap-1b
Source.9664: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1
Source.9665: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit
Source.9666: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.9667: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.9668: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.9669: DFBPPR11139 ---- Animal proteins ---- Homeobox protein Hox-A7
Source.9670: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1
Source.9671: DFBPPR11142 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.9672: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.9673: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain
Source.9674: DFBPPR11145 ---- Animal proteins ---- Chromatin assembly factor 1 subunit B
Source.9675: DFBPPR11146 ---- Animal proteins ---- Formin
Source.9676: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.9677: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog
Source.9678: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein
Source.9679: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.9680: DFBPPR11155 ---- Animal proteins ---- Stathmin
Source.9681: DFBPPR11156 ---- Animal proteins ---- Pterin-4-alpha-carbinolamine dehydratase
Source.9682: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.9683: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1
Source.9684: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.9685: DFBPPR11164 ---- Animal proteins ---- Nuclear transcription factor Y subunit beta
Source.9686: DFBPPR11165 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF185
Source.9687: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta
Source.9688: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.9689: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.9690: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta
Source.9691: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.9692: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2
Source.9693: DFBPPR11176 ---- Animal proteins ---- Zinc finger protein Gfi-1b
Source.9694: DFBPPR11177 ---- Animal proteins ---- Gallinacin-11
Source.9695: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein
Source.9696: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1
Source.9697: DFBPPR11181 ---- Animal proteins ---- Serine/arginine-rich splicing factor 1
Source.9698: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1
Source.9699: DFBPPR11183 ---- Animal proteins ---- Trypsin II-P29
Source.9700: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta
Source.9701: DFBPPR11187 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.9702: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.9703: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22
Source.9704: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.9705: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.9706: DFBPPR11193 ---- Animal proteins ---- Gallinacin-8
Source.9707: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.9708: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.9709: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.9710: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1
Source.9711: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.9712: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.9713: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha
Source.9714: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1
Source.9715: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.9716: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.9717: DFBPPR11212 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.9718: DFBPPR11213 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.9719: DFBPPR11215 ---- Animal proteins ---- Zinc finger protein PLAG1
Source.9720: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.9721: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2
Source.9722: DFBPPR11219 ---- Animal proteins ---- Cytospin-A
Source.9723: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.9724: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.9725: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38
Source.9726: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.9727: DFBPPR11226 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.9728: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.9729: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2
Source.9730: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.9731: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.9732: DFBPPR11233 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.9733: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase
Source.9734: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.9735: DFBPPR11241 ---- Animal proteins ---- Lymphocyte antigen 6E
Source.9736: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.9737: DFBPPR11243 ---- Animal proteins ---- Epiphycan
Source.9738: DFBPPR11245 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.9739: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.9740: DFBPPR11247 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 3
Source.9741: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.9742: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.9743: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.9744: DFBPPR11253 ---- Animal proteins ---- Peripherin-2
Source.9745: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1
Source.9746: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.9747: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.9748: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.9749: DFBPPR11263 ---- Animal proteins ---- Obg-like ATPase 1
Source.9750: DFBPPR11264 ---- Animal proteins ---- Charged multivesicular body protein 7
Source.9751: DFBPPR11265 ---- Animal proteins ---- Integral membrane protein 2B
Source.9752: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.9753: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B
Source.9754: DFBPPR11268 ---- Animal proteins ---- Myotrophin
Source.9755: DFBPPR11269 ---- Animal proteins ---- Anosmin-1
Source.9756: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.9757: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4
Source.9758: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3
Source.9759: DFBPPR11274 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.9760: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.9761: DFBPPR11277 ---- Animal proteins ---- Abasic site processing protein HMCES
Source.9762: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.9763: DFBPPR11279 ---- Animal proteins ---- Zinc finger protein neuro-d4
Source.9764: DFBPPR11281 ---- Animal proteins ---- LIM domain-binding protein 2
Source.9765: DFBPPR11282 ---- Animal proteins ---- Ras-related protein Rab-5C
Source.9766: DFBPPR11283 ---- Animal proteins ---- Centromere protein U
Source.9767: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.9768: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.9769: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein
Source.9770: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.9771: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.9772: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4
Source.9773: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.9774: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.9775: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.9776: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.9777: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.9778: DFBPPR11306 ---- Animal proteins ---- Transcription factor 15
Source.9779: DFBPPR11309 ---- Animal proteins ---- Antimicrobial peptide CHP1
Source.9780: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.9781: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog
Source.9782: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3
Source.9783: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2
Source.9784: DFBPPR11317 ---- Animal proteins ---- Dickkopf-related protein 3
Source.9785: DFBPPR11318 ---- Animal proteins ---- Chromatin modification-related protein MEAF6
Source.9786: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2
Source.9787: DFBPPR11321 ---- Animal proteins ---- Transcription factor 4
Source.9788: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.9789: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.9790: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15
Source.9791: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8
Source.9792: DFBPPR11327 ---- Animal proteins ---- Integrin alpha-1
Source.9793: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2
Source.9794: DFBPPR11329 ---- Animal proteins ---- Bone sialoprotein 2
Source.9795: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1
Source.9796: DFBPPR11334 ---- Animal proteins ---- Heme oxygenase 1
Source.9797: DFBPPR11335 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.9798: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3
Source.9799: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.9800: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2
Source.9801: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.9802: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.9803: DFBPPR11345 ---- Animal proteins ---- LIM/homeobox protein LMX-1.2
Source.9804: DFBPPR11346 ---- Animal proteins ---- Diencephalon/mesencephalon homeobox protein 1
Source.9805: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.9806: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10
Source.9807: DFBPPR11352 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.9808: DFBPPR11353 ---- Animal proteins ---- Low molecular weight phosphotyrosine protein phosphatase
Source.9809: DFBPPR11354 ---- Animal proteins ---- Centromere protein O
Source.9810: DFBPPR11355 ---- Animal proteins ---- Collectin-10
Source.9811: DFBPPR11356 ---- Animal proteins ---- Homeobox protein AKR
Source.9812: DFBPPR11359 ---- Animal proteins ---- Mesogenin-1
Source.9813: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47
Source.9814: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.9815: DFBPPR11364 ---- Animal proteins ---- Interleukin-18
Source.9816: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.9817: DFBPPR11366 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.9818: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2
Source.9819: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX
Source.9820: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1
Source.9821: DFBPPR11373 ---- Animal proteins ---- Decorin
Source.9822: DFBPPR11375 ---- Animal proteins ---- Transcription factor E2F1
Source.9823: DFBPPR11377 ---- Animal proteins ---- UBX domain-containing protein 2B
Source.9824: DFBPPR11379 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2
Source.9825: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.9826: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.9827: DFBPPR11387 ---- Animal proteins ---- Amphiphysin
Source.9828: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7
Source.9829: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.9830: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B
Source.9831: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A
Source.9832: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.9833: DFBPPR11401 ---- Animal proteins ---- Inhibitor of growth protein 3
Source.9834: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.9835: DFBPPR11403 ---- Animal proteins ---- Destrin
Source.9836: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner
Source.9837: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1
Source.9838: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.9839: DFBPPR11407 ---- Animal proteins ---- RAD52 motif-containing protein 1
Source.9840: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.9841: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF
Source.9842: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1
Source.9843: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.9844: DFBPPR11415 ---- Animal proteins ---- Elongation factor Tu, mitochondrial
Source.9845: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.9846: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231
Source.9847: DFBPPR11419 ---- Animal proteins ---- Glutathione S-transferase
Source.9848: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.9849: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.9850: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.9851: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.9852: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1
Source.9853: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5
Source.9854: DFBPPR11434 ---- Animal proteins ---- Homeobox protein SIX6
Source.9855: DFBPPR11435 ---- Animal proteins ---- Eyes absent homolog 3
Source.9856: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.9857: DFBPPR11437 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.9858: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.9859: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator
Source.9860: DFBPPR11444 ---- Animal proteins ---- Troponin T, cardiac muscle isoforms
Source.9861: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.9862: DFBPPR11448 ---- Animal proteins ---- Pterin-4-alpha-carbinolamine dehydratase 2
Source.9863: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7
Source.9864: DFBPPR11450 ---- Animal proteins ---- Potassium voltage-gated channel subfamily G member 2
Source.9865: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1
Source.9866: DFBPPR11452 ---- Animal proteins ---- Paired mesoderm homeobox protein 2
Source.9867: DFBPPR11454 ---- Animal proteins ---- Calcium release-activated calcium channel protein 1
Source.9868: DFBPPR11455 ---- Animal proteins ---- Growth factor receptor-bound protein 2
Source.9869: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin
Source.9870: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.9871: DFBPPR11466 ---- Animal proteins ---- GDNF family receptor alpha-2
Source.9872: DFBPPR11468 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.9873: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog
Source.9874: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11
Source.9875: DFBPPR11473 ---- Animal proteins ---- G2/M phase-specific E3 ubiquitin-protein ligase
Source.9876: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.9877: DFBPPR11476 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.9878: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5
Source.9879: DFBPPR11479 ---- Animal proteins ---- Rab-like protein 3
Source.9880: DFBPPR11480 ---- Animal proteins ---- Cytochrome P450 1A2
Source.9881: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9
Source.9882: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein
Source.9883: DFBPPR11484 ---- Animal proteins ---- Prolactin
Source.9884: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.9885: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1
Source.9886: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase
Source.9887: DFBPPR11488 ---- Animal proteins ---- Ras-related protein Rab-2A
Source.9888: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1
Source.9889: DFBPPR11490 ---- Animal proteins ---- Twinfilin-2
Source.9890: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog
Source.9891: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10
Source.9892: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L
Source.9893: DFBPPR11495 ---- Animal proteins ---- Calretinin
Source.9894: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7
Source.9895: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.9896: DFBPPR11498 ---- Animal proteins ---- Troponin C, slow skeletal and cardiac muscles
Source.9897: DFBPPR11499 ---- Animal proteins ---- Myosin regulatory light chain 2B, cardiac muscle isoform
Source.9898: DFBPPR11500 ---- Animal proteins ---- Ovalbumin-related protein X
Source.9899: DFBPPR11502 ---- Animal proteins ---- Transcription factor GATA-4
Source.9900: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2
Source.9901: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.9902: DFBPPR11506 ---- Animal proteins ---- Homeobox protein BarH-like 1b
Source.9903: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog
Source.9904: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.9905: DFBPPR11512 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.9906: DFBPPR11514 ---- Animal proteins ---- Homeobox protein Hox-D11
Source.9907: DFBPPR11518 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.9908: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.9909: DFBPPR11521 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1
Source.9910: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.9911: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A
Source.9912: DFBPPR11525 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.9913: DFBPPR11526 ---- Animal proteins ---- Fibromodulin
Source.9914: DFBPPR11527 ---- Animal proteins ---- Myosin regulatory light chain 2A, cardiac muscle isoform
Source.9915: DFBPPR11528 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 29
Source.9916: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.9917: DFBPPR11531 ---- Animal proteins ---- Protein AATF
Source.9918: DFBPPR11532 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle minor isoform
Source.9919: DFBPPR11533 ---- Animal proteins ---- Mimecan
Source.9920: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.9921: DFBPPR11537 ---- Animal proteins ---- Regulator of G-protein signaling 20
Source.9922: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.9923: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.9924: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein
Source.9925: DFBPPR11548 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.9926: DFBPPR11549 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C
Source.9927: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.9928: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.9929: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.9930: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.9931: DFBPPR11556 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.9932: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog
Source.9933: DFBPPR11562 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.9934: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.9935: DFBPPR11565 ---- Animal proteins ---- Eyes absent homolog 4
Source.9936: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic
Source.9937: DFBPPR11567 ---- Animal proteins ---- Ovocalyxin-32
Source.9938: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein
Source.9939: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.9940: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.9941: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein
Source.9942: DFBPPR11575 ---- Animal proteins ---- Myosin light chain 1, cardiac muscle
Source.9943: DFBPPR11578 ---- Animal proteins ---- Lymphocyte antigen 86
Source.9944: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.9945: DFBPPR11584 ---- Animal proteins ---- NF-kappa-B inhibitor alpha
Source.9946: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.9947: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.9948: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622
Source.9949: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.9950: DFBPPR11590 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.9951: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein
Source.9952: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.9953: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.9954: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.9955: DFBPPR11599 ---- Animal proteins ---- Homeobox protein Hox-A9
Source.9956: DFBPPR11600 ---- Animal proteins ---- Hyccin
Source.9957: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.9958: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.9959: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.9960: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.9961: DFBPPR11606 ---- Animal proteins ---- 60S ribosomal protein L13
Source.9962: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.9963: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.9964: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.9965: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.9966: DFBPPR11614 ---- Animal proteins ---- Beta-crystallin B3
Source.9967: DFBPPR11615 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.9968: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.9969: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8
Source.9970: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2
Source.9971: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3
Source.9972: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.9973: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2
Source.9974: DFBPPR11630 ---- Animal proteins ---- Protein kish-A
Source.9975: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.9976: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.9977: DFBPPR11634 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.9978: DFBPPR11635 ---- Animal proteins ---- Cochlin
Source.9979: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.9980: DFBPPR11637 ---- Animal proteins ---- 2-oxoglutarate and iron-dependent oxygenase JMJD4
Source.9981: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.9982: DFBPPR11641 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.9983: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.9984: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4
Source.9985: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.9986: DFBPPR11646 ---- Animal proteins ---- Frizzled-9
Source.9987: DFBPPR11647 ---- Animal proteins ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.9988: DFBPPR11648 ---- Animal proteins ---- Mineralocorticoid receptor
Source.9989: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.9990: DFBPPR11655 ---- Animal proteins ---- 60S ribosomal protein L10
Source.9991: DFBPPR11656 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.9992: DFBPPR11657 ---- Animal proteins ---- Protein BTG1
Source.9993: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43
Source.9994: DFBPPR11659 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.9995: DFBPPR11660 ---- Animal proteins ---- Cathepsin K
Source.9996: DFBPPR11664 ---- Animal proteins ---- Swi5-dependent recombination DNA repair protein 1 homolog
Source.9997: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2
Source.9998: DFBPPR11667 ---- Animal proteins ---- Heme transporter HRG1
Source.9999: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.10000: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.10001: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1
Source.10002: DFBPPR11673 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4
Source.10003: DFBPPR11677 ---- Animal proteins ---- SOSS complex subunit C
Source.10004: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.10005: DFBPPR11684 ---- Animal proteins ---- 14-3-3 protein theta
Source.10006: DFBPPR11687 ---- Animal proteins ---- Antithrombin-III
Source.10007: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1
Source.10008: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1
Source.10009: DFBPPR11695 ---- Animal proteins ---- Sodium/bile acid cotransporter 7
Source.10010: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit
Source.10011: DFBPPR11698 ---- Animal proteins ---- NADH-cytochrome b5 reductase 2
Source.10012: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit
Source.10013: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.10014: DFBPPR11702 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.10015: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.10016: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.10017: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.10018: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.10019: DFBPPR11715 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.10020: DFBPPR11719 ---- Animal proteins ---- Protein RER1
Source.10021: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D
Source.10022: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A
Source.10023: DFBPPR11723 ---- Animal proteins ---- Visinin
Source.10024: DFBPPR11724 ---- Animal proteins ---- Protein TENP
Source.10025: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor
Source.10026: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1
Source.10027: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta
Source.10028: DFBPPR11730 ---- Animal proteins ---- Proteasome subunit alpha type-7
Source.10029: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi
Source.10030: DFBPPR11734 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.10031: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3
Source.10032: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial
Source.10033: DFBPPR11738 ---- Animal proteins ---- Ensconsin
Source.10034: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.10035: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.10036: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.10037: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.10038: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.10039: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.10040: DFBPPR11754 ---- Animal proteins ---- Neurocalcin-delta
Source.10041: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3
Source.10042: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38
Source.10043: DFBPPR11758 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17B
Source.10044: DFBPPR11759 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.10045: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6
Source.10046: DFBPPR11762 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.10047: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.10048: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1
Source.10049: DFBPPR11769 ---- Animal proteins ---- Cytokine-inducible SH2-containing protein
Source.10050: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.10051: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.10052: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4
Source.10053: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.10054: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.10055: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.10056: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen
Source.10057: DFBPPR11782 ---- Animal proteins ---- Trafficking protein particle complex subunit 3
Source.10058: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2
Source.10059: DFBPPR11786 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.10060: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2
Source.10061: DFBPPR11789 ---- Animal proteins ---- NF-kappa-B inhibitor-interacting Ras-like protein 2
Source.10062: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1
Source.10063: DFBPPR11795 ---- Animal proteins ---- Class E basic helix-loop-helix protein 22
Source.10064: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4
Source.10065: DFBPPR11797 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2-binding protein
Source.10066: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3
Source.10067: DFBPPR11799 ---- Animal proteins ---- Homeobox protein Hox-B5
Source.10068: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5
Source.10069: DFBPPR11801 ---- Animal proteins ---- Homeobox protein SAX-1
Source.10070: DFBPPR11802 ---- Animal proteins ---- Transmembrane protein 17
Source.10071: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91
Source.10072: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.10073: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.10074: DFBPPR11814 ---- Animal proteins ---- Centromere protein R
Source.10075: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.10076: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.10077: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.10078: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.10079: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1
Source.10080: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.10081: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36
Source.10082: DFBPPR11824 ---- Animal proteins ---- DDB1- and CUL4-associated factor 13
Source.10083: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.10084: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.10085: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B
Source.10086: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.10087: DFBPPR11831 ---- Animal proteins ---- Protein lin-28 homolog B
Source.10088: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.10089: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7
Source.10090: DFBPPR11834 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3
Source.10091: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein
Source.10092: DFBPPR11837 ---- Animal proteins ---- Protein FAM210A
Source.10093: DFBPPR11838 ---- Animal proteins ---- Enhancer of mRNA-decapping protein 3
Source.10094: DFBPPR11840 ---- Animal proteins ---- RELT-like protein 1
Source.10095: DFBPPR11841 ---- Animal proteins ---- Trafficking protein particle complex subunit 2
Source.10096: DFBPPR11842 ---- Animal proteins ---- Homeobox protein ANF-1
Source.10097: DFBPPR11843 ---- Animal proteins ---- Visinin-like protein 1
Source.10098: DFBPPR11844 ---- Animal proteins ---- Integrator complex subunit 11
Source.10099: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17
Source.10100: DFBPPR11847 ---- Animal proteins ---- Borealin-2
Source.10101: DFBPPR11848 ---- Animal proteins ---- Parvalbumin, muscle
Source.10102: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9
Source.10103: DFBPPR11851 ---- Animal proteins ---- Borealin
Source.10104: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase
Source.10105: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.10106: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.10107: DFBPPR11858 ---- Animal proteins ---- WD repeat-containing protein 82
Source.10108: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.10109: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.10110: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3
Source.10111: DFBPPR11864 ---- Animal proteins ---- Radixin
Source.10112: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog
Source.10113: DFBPPR11869 ---- Animal proteins ---- BH3-interacting domain death agonist
Source.10114: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.10115: DFBPPR11871 ---- Animal proteins ---- RAD51-associated protein 1
Source.10116: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.10117: DFBPPR11874 ---- Animal proteins ---- Serum response factor
Source.10118: DFBPPR11875 ---- Animal proteins ---- WD repeat-containing protein 61
Source.10119: DFBPPR11876 ---- Animal proteins ---- Terminal nucleotidyltransferase 5C
Source.10120: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region
Source.10121: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.10122: DFBPPR11879 ---- Animal proteins ---- Nicalin
Source.10123: DFBPPR11880 ---- Animal proteins ---- Deleted in azoospermia-like
Source.10124: DFBPPR11881 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.10125: DFBPPR11882 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A
Source.10126: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.10127: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.10128: DFBPPR11885 ---- Animal proteins ---- ELL-associated factor 2
Source.10129: DFBPPR11886 ---- Animal proteins ---- Olfactory receptor-like protein COR9
Source.10130: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.10131: DFBPPR11889 ---- Animal proteins ---- Olfactory receptor-like protein COR8
Source.10132: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8
Source.10133: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.10134: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like
Source.10135: DFBPPR11894 ---- Animal proteins ---- Centromere protein K
Source.10136: DFBPPR11896 ---- Animal proteins ---- Sentan
Source.10137: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.10138: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.10139: DFBPPR11900 ---- Animal proteins ---- Calcipressin-3
Source.10140: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8
Source.10141: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2
Source.10142: DFBPPR11903 ---- Animal proteins ---- SREBP regulating gene protein
Source.10143: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B
Source.10144: DFBPPR11906 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 1
Source.10145: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9
Source.10146: DFBPPR11908 ---- Animal proteins ---- Centrosomal protein kizuna
Source.10147: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A
Source.10148: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.10149: DFBPPR11911 ---- Animal proteins ---- NmrA-like family domain-containing protein 1
Source.10150: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13
Source.10151: DFBPPR11913 ---- Animal proteins ---- Bcl-2-related ovarian killer protein
Source.10152: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3
Source.10153: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.10154: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19
Source.10155: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.10156: DFBPPR11928 ---- Animal proteins ---- Cyclin-C
Source.10157: DFBPPR11929 ---- Animal proteins ---- Probable RNA-binding protein EIF1AD
Source.10158: DFBPPR11931 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 20
Source.10159: DFBPPR11932 ---- Animal proteins ---- 14-3-3 protein zeta
Source.10160: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.10161: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2
Source.10162: DFBPPR11936 ---- Animal proteins ---- Acyl-CoA-binding protein
Source.10163: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7
Source.10164: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.10165: DFBPPR11940 ---- Animal proteins ---- Calmodulin, striated muscle
Source.10166: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3
Source.10167: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.10168: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.10169: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.10170: DFBPPR11949 ---- Animal proteins ---- Spindle assembly abnormal protein 6 homolog
Source.10171: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.10172: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.10173: DFBPPR11953 ---- Animal proteins ---- Protein NEL
Source.10174: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2
Source.10175: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1
Source.10176: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.10177: DFBPPR11958 ---- Animal proteins ---- Homeobox protein engrailed-1
Source.10178: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.10179: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein
Source.10180: DFBPPR11962 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.10181: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.10182: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.10183: DFBPPR11966 ---- Animal proteins ---- Protein CREG1
Source.10184: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4
Source.10185: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.10186: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.10187: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2
Source.10188: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.10189: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.10190: DFBPPR11982 ---- Animal proteins ---- Transcription termination factor 3, mitochondrial
Source.10191: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4
Source.10192: DFBPPR11985 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.10193: DFBPPR11987 ---- Animal proteins ---- NEDD4-binding protein 3 homolog
Source.10194: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.10195: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.10196: DFBPPR11992 ---- Animal proteins ---- Craniofacial development protein 1
Source.10197: DFBPPR11994 ---- Animal proteins ---- Surfeit locus protein 1
Source.10198: DFBPPR11995 ---- Animal proteins ---- Protein orai-2
Source.10199: DFBPPR11997 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC
Source.10200: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.10201: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.10202: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein
Source.10203: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.10204: DFBPPR12015 ---- Animal proteins ---- Homeobox protein Hox-D1
Source.10205: DFBPPR12017 ---- Animal proteins ---- Zinc finger protein CKR1
Source.10206: DFBPPR12019 ---- Animal proteins ---- Cobalamin trafficking protein CblD
Source.10207: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.10208: DFBPPR12021 ---- Animal proteins ---- DNA repair protein RAD52 homolog
Source.10209: DFBPPR12022 ---- Animal proteins ---- Regulator of G-protein signaling 4
Source.10210: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2
Source.10211: DFBPPR12027 ---- Animal proteins ---- Centromere protein L
Source.10212: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5
Source.10213: DFBPPR12030 ---- Animal proteins ---- Transmembrane protein 208
Source.10214: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.10215: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2
Source.10216: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.10217: DFBPPR12035 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.10218: DFBPPR12036 ---- Animal proteins ---- BLOC-1-related complex subunit 5
Source.10219: DFBPPR12039 ---- Animal proteins ---- Protein GOLM2
Source.10220: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.10221: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.10222: DFBPPR12042 ---- Animal proteins ---- Mapk-regulated corepressor-interacting protein 1
Source.10223: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.10224: DFBPPR12050 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1
Source.10225: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24
Source.10226: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.10227: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.10228: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.10229: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.10230: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.10231: DFBPPR12063 ---- Animal proteins ---- Centromere protein M
Source.10232: DFBPPR12066 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1
Source.10233: DFBPPR12067 ---- Animal proteins ---- Transcription factor EC
Source.10234: DFBPPR12068 ---- Animal proteins ---- Serine/arginine repetitive matrix protein 1
Source.10235: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.10236: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.10237: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9
Source.10238: DFBPPR12075 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.10239: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.10240: DFBPPR12077 ---- Animal proteins ---- Eukaryotic translation initiation factor 1
Source.10241: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129
Source.10242: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.10243: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.10244: DFBPPR12081 ---- Animal proteins ---- 14-3-3 protein gamma
Source.10245: DFBPPR12083 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.10246: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.10247: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme
Source.10248: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121
Source.10249: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.10250: DFBPPR12091 ---- Animal proteins ---- Neurofibromin
Source.10251: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.10252: DFBPPR12093 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial
Source.10253: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.10254: DFBPPR12095 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.10255: DFBPPR12096 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 4
Source.10256: DFBPPR12102 ---- Animal proteins ---- Nuclear envelope integral membrane protein 2
Source.10257: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.10258: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2
Source.10259: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.10260: DFBPPR12110 ---- Animal proteins ---- Myosin light chain, embryonic
Source.10261: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1
Source.10262: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.10263: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21
Source.10264: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.10265: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.10266: DFBPPR12123 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.10267: DFBPPR12124 ---- Animal proteins ---- RNA-binding protein PNO1
Source.10268: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.10269: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.10270: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.10271: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.10272: DFBPPR12137 ---- Animal proteins ---- Homeobox protein CHOX-7
Source.10273: DFBPPR12138 ---- Animal proteins ---- Protein LZIC
Source.10274: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6
Source.10275: DFBPPR12141 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.10276: DFBPPR12143 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 2
Source.10277: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23
Source.10278: DFBPPR12145 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1-like
Source.10279: DFBPPR12146 ---- Animal proteins ---- Transmembrane protein adipocyte-associated 1 homolog
Source.10280: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.10281: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3
Source.10282: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1
Source.10283: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.10284: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.10285: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A
Source.10286: DFBPPR12154 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.10287: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.10288: DFBPPR12156 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.10289: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.10290: DFBPPR12160 ---- Animal proteins ---- Transmembrane protein 229B
Source.10291: DFBPPR12163 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.10292: DFBPPR12164 ---- Animal proteins ---- Neo-calmodulin
Source.10293: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.10294: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog
Source.10295: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1
Source.10296: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.10297: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.10298: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.10299: DFBPPR12190 ---- Animal proteins ---- Transmembrane protein 251
Source.10300: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.10301: DFBPPR12195 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.10302: DFBPPR12198 ---- Animal proteins ---- RING finger protein 141
Source.10303: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B
Source.10304: DFBPPR12200 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 1
Source.10305: DFBPPR12202 ---- Animal proteins ---- Protein chibby homolog 2
Source.10306: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.10307: DFBPPR12207 ---- Animal proteins ---- WD repeat, SAM and U-box domain-containing protein 1
Source.10308: DFBPPR12208 ---- Animal proteins ---- Protein FAM76A
Source.10309: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180
Source.10310: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.10311: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11
Source.10312: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.10313: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.10314: DFBPPR12219 ---- Animal proteins ---- PHD finger protein 20-like protein 1
Source.10315: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174
Source.10316: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein
Source.10317: DFBPPR12225 ---- Animal proteins ---- Coiled-coil domain-containing protein 50
Source.10318: DFBPPR12226 ---- Animal proteins ---- Protein DGCR6
Source.10319: DFBPPR12230 ---- Animal proteins ---- Orofacial cleft 1 candidate gene 1 protein homolog
Source.10320: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10
Source.10321: DFBPPR12232 ---- Animal proteins ---- SUZ domain-containing protein 1
Source.10322: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.10323: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.10324: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.10325: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.10326: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.10327: DFBPPR12240 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog
Source.10328: DFBPPR12242 ---- Animal proteins ---- Protein LSM12 homolog
Source.10329: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.10330: DFBPPR12244 ---- Animal proteins ---- Cysteine-rich DPF motif domain-containing protein 1
Source.10331: DFBPPR12246 ---- Animal proteins ---- Uncharacterized protein KIAA1143 homolog
Source.10332: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.10333: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.10334: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.10335: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1
Source.10336: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.10337: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2
Source.10338: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.10339: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1
Source.10340: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.10341: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2
Source.10342: DFBPPR12259 ---- Animal proteins ---- Lambda-crystallin
Source.10343: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase
Source.10344: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.10345: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.10346: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1
Source.10347: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.10348: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.10349: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5
Source.10350: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1
Source.10351: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.10352: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.10353: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.10354: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.10355: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.10356: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1
Source.10357: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.10358: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1
Source.10359: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.10360: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.10361: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.10362: DFBPPR12287 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.10363: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.10364: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.10365: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.10366: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.10367: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3
Source.10368: DFBPPR12296 ---- Animal proteins ---- Neprilysin
Source.10369: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.10370: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.10371: DFBPPR12299 ---- Animal proteins ---- Myocilin
Source.10372: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.10373: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.10374: DFBPPR12303 ---- Animal proteins ---- Histidine-rich glycoprotein
Source.10375: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.10376: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.10377: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.10378: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.10379: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.10380: DFBPPR12314 ---- Animal proteins ---- Annexin A1
Source.10381: DFBPPR12315 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.10382: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.10383: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.10384: DFBPPR12318 ---- Animal proteins ---- Endothelin-1
Source.10385: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.10386: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.10387: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5
Source.10388: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor
Source.10389: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type
Source.10390: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type
Source.10391: DFBPPR12329 ---- Animal proteins ---- Natriuretic peptides A
Source.10392: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1
Source.10393: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.10394: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.10395: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.10396: DFBPPR12336 ---- Animal proteins ---- Apolipoprotein D
Source.10397: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E
Source.10398: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.10399: DFBPPR12339 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.10400: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.10401: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.10402: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.10403: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2
Source.10404: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.10405: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.10406: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.10407: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.10408: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain
Source.10409: DFBPPR12353 ---- Animal proteins ---- Cytochrome P450 2E1
Source.10410: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.10411: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.10412: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.10413: DFBPPR12358 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 1
Source.10414: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.10415: DFBPPR12361 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.10416: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.10417: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.10418: DFBPPR12364 ---- Animal proteins ---- Protein Wnt-5a
Source.10419: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.10420: DFBPPR12366 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10
Source.10421: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.10422: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.10423: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform
Source.10424: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1
Source.10425: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.10426: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.10427: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.10428: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.10429: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.10430: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.10431: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.10432: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.10433: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.10434: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1
Source.10435: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma
Source.10436: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.10437: DFBPPR12386 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.10438: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1
Source.10439: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.10440: DFBPPR12389 ---- Animal proteins ---- Clusterin
Source.10441: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.10442: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.10443: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.10444: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.10445: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1
Source.10446: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.10447: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase
Source.10448: DFBPPR12399 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.10449: DFBPPR12400 ---- Animal proteins ---- RNA-binding protein 4
Source.10450: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.10451: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.10452: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.10453: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4
Source.10454: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.10455: DFBPPR12408 ---- Animal proteins ---- Vitronectin
Source.10456: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.10457: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.10458: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.10459: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.10460: DFBPPR12414 ---- Animal proteins ---- Adenylate kinase isoenzyme 1
Source.10461: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.10462: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1
Source.10463: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.10464: DFBPPR12418 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.10465: DFBPPR12419 ---- Animal proteins ---- Phospholipase A2
Source.10466: DFBPPR12420 ---- Animal proteins ---- Serum paraoxonase/lactonase 3
Source.10467: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.10468: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.10469: DFBPPR12425 ---- Animal proteins ---- Beta-enolase
Source.10470: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A
Source.10471: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.10472: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.10473: DFBPPR12429 ---- Animal proteins ---- Apolipoprotein A-I
Source.10474: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.10475: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.10476: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.10477: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.10478: DFBPPR12441 ---- Animal proteins ---- Triadin
Source.10479: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.10480: DFBPPR12445 ---- Animal proteins ---- Hemoglobin subunit beta-1/2
Source.10481: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.10482: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.10483: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.10484: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.10485: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.10486: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.10487: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.10488: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.10489: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.10490: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.10491: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.10492: DFBPPR12457 ---- Animal proteins ---- Aldo-keto reductase family 1 member D1
Source.10493: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.10494: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.10495: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.10496: DFBPPR12461 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.10497: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.10498: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.10499: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.10500: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.10501: DFBPPR12469 ---- Animal proteins ---- Hemopexin
Source.10502: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.10503: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.10504: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.10505: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2
Source.10506: DFBPPR12475 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.10507: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.10508: DFBPPR12478 ---- Animal proteins ---- Protein phosphatase 1A
Source.10509: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.10510: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.10511: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.10512: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.10513: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.10514: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.10515: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.10516: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle
Source.10517: DFBPPR12489 ---- Animal proteins ---- Monocyte differentiation antigen CD14
Source.10518: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.10519: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.10520: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.10521: DFBPPR12497 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.10522: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.10523: DFBPPR12502 ---- Animal proteins ---- Fibroblast growth factor 2
Source.10524: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.10525: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3
Source.10526: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.10527: DFBPPR12507 ---- Animal proteins ---- Cathepsin K
Source.10528: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.10529: DFBPPR12511 ---- Animal proteins ---- Serine/threonine-protein kinase 17A
Source.10530: DFBPPR12512 ---- Animal proteins ---- Carbonic anhydrase 4
Source.10531: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.10532: DFBPPR12514 ---- Animal proteins ---- Transmembrane protein 109
Source.10533: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.10534: DFBPPR12517 ---- Animal proteins ---- 5-formyltetrahydrofolate cyclo-ligase
Source.10535: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.10536: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.10537: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.10538: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.10539: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.10540: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.10541: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.10542: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.10543: DFBPPR12536 ---- Animal proteins ---- Albumin
Source.10544: DFBPPR12539 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1
Source.10545: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.10546: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.10547: DFBPPR12542 ---- Animal proteins ---- Decorin
Source.10548: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.10549: DFBPPR12545 ---- Animal proteins ---- Galectin-3
Source.10550: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.10551: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.10552: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.10553: DFBPPR12551 ---- Animal proteins ---- C-reactive protein
Source.10554: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.10555: DFBPPR12554 ---- Animal proteins ---- Ras-related protein Rab-7a
Source.10556: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.10557: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2
Source.10558: DFBPPR12560 ---- Animal proteins ---- Calumenin
Source.10559: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.10560: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1
Source.10561: DFBPPR12564 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.10562: DFBPPR12567 ---- Animal proteins ---- Calpain small subunit 1
Source.10563: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.10564: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.10565: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2
Source.10566: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.10567: DFBPPR12573 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.10568: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.10569: DFBPPR12575 ---- Animal proteins ---- CD63 antigen
Source.10570: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.10571: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.10572: DFBPPR12580 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2
Source.10573: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.10574: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.10575: DFBPPR12585 ---- Animal proteins ---- Calmodulin
Source.10576: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.10577: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1
Source.10578: DFBPPR12591 ---- Animal proteins ---- Annexin A11
Source.10579: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.10580: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.10581: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.10582: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5
Source.10583: DFBPPR12610 ---- Animal proteins ---- Cyclin-dependent kinase 14
Source.10584: DFBPPR12613 ---- Animal proteins ---- Glutathione peroxidase 1
Source.10585: DFBPPR12614 ---- Animal proteins ---- Interleukin-6
Source.10586: DFBPPR12615 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.10587: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.10588: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.10589: DFBPPR12624 ---- Animal proteins ---- Heparin cofactor 2
Source.10590: DFBPPR12632 ---- Animal proteins ---- Caveolin-2
Source.10591: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.10592: DFBPPR12634 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.10593: DFBPPR12636 ---- Animal proteins ---- Complement component C9
Source.10594: DFBPPR12637 ---- Animal proteins ---- Thioredoxin
Source.10595: DFBPPR12638 ---- Animal proteins ---- Thioredoxin
Source.10596: DFBPPR12649 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.10597: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.10598: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5
Source.10599: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.10600: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.10601: DFBPPR12657 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.10602: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.10603: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.10604: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5
Source.10605: DFBPPR12662 ---- Animal proteins ---- Interferon gamma
Source.10606: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.10607: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.10608: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.10609: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.10610: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor
Source.10611: DFBPPR12681 ---- Animal proteins ---- Myosin-7
Source.10612: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase
Source.10613: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4
Source.10614: DFBPPR12691 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.10615: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.10616: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.10617: DFBPPR12707 ---- Animal proteins ---- Pro-opiomelanocortin
Source.10618: DFBPPR12709 ---- Animal proteins ---- Somatotropin
Source.10619: DFBPPR12710 ---- Animal proteins ---- Endoplasmin
Source.10620: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.10621: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1
Source.10622: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.10623: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16
Source.10624: DFBPPR12722 ---- Animal proteins ---- Myelin proteolipid protein
Source.10625: DFBPPR12723 ---- Animal proteins ---- Glutathione S-transferase alpha I
Source.10626: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8
Source.10627: DFBPPR12725 ---- Animal proteins ---- Uricase
Source.10628: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.10629: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.10630: DFBPPR12728 ---- Animal proteins ---- Cytochrome b
Source.10631: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.10632: DFBPPR12731 ---- Animal proteins ---- Cholinesterase
Source.10633: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.10634: DFBPPR12733 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 2
Source.10635: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.10636: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.10637: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.10638: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1
Source.10639: DFBPPR12745 ---- Animal proteins ---- Ras-related protein Rab-25
Source.10640: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.10641: DFBPPR12751 ---- Animal proteins ---- Glutathione S-transferase Mu 1
Source.10642: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta
Source.10643: DFBPPR12759 ---- Animal proteins ---- Interleukin-1 beta
Source.10644: DFBPPR12760 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.10645: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3
Source.10646: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6
Source.10647: DFBPPR12768 ---- Animal proteins ---- Pepsin-3
Source.10648: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.10649: DFBPPR12770 ---- Animal proteins ---- Filamin-B
Source.10650: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.10651: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.10652: DFBPPR12775 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.10653: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3
Source.10654: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.10655: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.10656: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.10657: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.10658: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.10659: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.10660: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.10661: DFBPPR12791 ---- Animal proteins ---- C-C motif chemokine 2
Source.10662: DFBPPR12792 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.10663: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.10664: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.10665: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.10666: DFBPPR12805 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.10667: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.10668: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.10669: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.10670: DFBPPR12811 ---- Animal proteins ---- Heme oxygenase 2
Source.10671: DFBPPR12812 ---- Animal proteins ---- Hemoglobin subunit gamma
Source.10672: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.10673: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter
Source.10674: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.10675: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor
Source.10676: DFBPPR12819 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.10677: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B
Source.10678: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.10679: DFBPPR12823 ---- Animal proteins ---- Pepsin F
Source.10680: DFBPPR12825 ---- Animal proteins ---- Bleomycin hydrolase
Source.10681: DFBPPR12829 ---- Animal proteins ---- Glutathione S-transferase Yc
Source.10682: DFBPPR12831 ---- Animal proteins ---- Serine--pyruvate aminotransferase
Source.10683: DFBPPR12832 ---- Animal proteins ---- Secretin receptor
Source.10684: DFBPPR12833 ---- Animal proteins ---- Cullin-5
Source.10685: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor
Source.10686: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.10687: DFBPPR12837 ---- Animal proteins ---- Tissue factor pathway inhibitor
Source.10688: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.10689: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.10690: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.10691: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.10692: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1
Source.10693: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain
Source.10694: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.10695: DFBPPR12853 ---- Animal proteins ---- Insulin
Source.10696: DFBPPR12854 ---- Animal proteins ---- D(1A) dopamine receptor
Source.10697: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.10698: DFBPPR12856 ---- Animal proteins ---- Leupaxin
Source.10699: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.10700: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11
Source.10701: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.10702: DFBPPR12864 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.10703: DFBPPR12865 ---- Animal proteins ---- Sperm surface protein Sp17
Source.10704: DFBPPR12869 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.10705: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.10706: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin
Source.10707: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.10708: DFBPPR12879 ---- Animal proteins ---- Endothelin-2
Source.10709: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.10710: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.10711: DFBPPR12884 ---- Animal proteins ---- Extracellular superoxide dismutase [Cu-Zn]
Source.10712: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase
Source.10713: DFBPPR12889 ---- Animal proteins ---- Myosin regulatory light chain 2, ventricular/cardiac muscle isoform
Source.10714: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D
Source.10715: DFBPPR12894 ---- Animal proteins ---- Parvalbumin alpha
Source.10716: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.10717: DFBPPR12898 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.10718: DFBPPR12899 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein
Source.10719: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.10720: DFBPPR12901 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I
Source.10721: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.10722: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.10723: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.10724: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.10725: DFBPPR12909 ---- Animal proteins ---- Antimicrobial protein CAP18
Source.10726: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6
Source.10727: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.10728: DFBPPR12913 ---- Animal proteins ---- 15 kDa protein A
Source.10729: DFBPPR12914 ---- Animal proteins ---- Lipase member H
Source.10730: DFBPPR12916 ---- Animal proteins ---- Hemoglobin subunit epsilon
Source.10731: DFBPPR12921 ---- Animal proteins ---- Cytochrome P450 2C30
Source.10732: DFBPPR12922 ---- Animal proteins ---- 15 kDa protein B
Source.10733: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.10734: DFBPPR12925 ---- Animal proteins ---- Methylmalonic aciduria type A homolog, mitochondrial
Source.10735: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2
Source.10736: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1
Source.10737: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C
Source.10738: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.10739: DFBPPR12939 ---- Animal proteins ---- Gastrotropin
Source.10740: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.10741: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.10742: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.10743: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.10744: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein
Source.10745: DFBPPR12950 ---- Animal proteins ---- Vitamin D-binding protein
Source.10746: DFBPPR12951 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1
Source.10747: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.10748: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.10749: DFBPPR12959 ---- Animal proteins ---- Keratin, type I cytoskeletal 12
Source.10750: DFBPPR12960 ---- Animal proteins ---- Synaptophysin-like protein 2
Source.10751: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3
Source.10752: DFBPPR12962 ---- Animal proteins ---- Coronin-1B
Source.10753: DFBPPR12963 ---- Animal proteins ---- Adenosine receptor A3
Source.10754: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.10755: DFBPPR12969 ---- Animal proteins ---- Prolactin
Source.10756: DFBPPR12970 ---- Animal proteins ---- Protein S100-B
Source.10757: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.10758: DFBPPR12975 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.10759: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.10760: DFBPPR12980 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.10761: DFBPPR12984 ---- Animal proteins ---- Prolactin-inducible protein homolog
Source.10762: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.10763: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.10764: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.10765: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1
Source.10766: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.10767: DFBPPR12993 ---- Animal proteins ---- Tumor protein D52
Source.10768: DFBPPR12995 ---- Animal proteins ---- Alpha-1-acid glycoprotein
Source.10769: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1
Source.10770: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.10771: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.10772: DFBPPR13002 ---- Animal proteins ---- Complement component C8 gamma chain
Source.10773: DFBPPR13003 ---- Animal proteins ---- Calcyphosin
Source.10774: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.10775: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.10776: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.10777: DFBPPR13014 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.10778: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2
Source.10779: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein
Source.10780: DFBPPR13017 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.10781: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2
Source.10782: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.10783: DFBPPR13026 ---- Animal proteins ---- Homeobox expressed in ES cells 1
Source.10784: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.10785: DFBPPR13028 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.10786: DFBPPR13033 ---- Animal proteins ---- Neuroglobin
Source.10787: DFBPPR13034 ---- Animal proteins ---- Sarcospan
Source.10788: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.10789: DFBPPR13039 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit beta-5
Source.10790: DFBPPR13042 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.10791: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein
Source.10792: DFBPPR13046 ---- Animal proteins ---- Heat shock protein HSP 90
Source.10793: DFBPPR13047 ---- Animal proteins ---- Elongation factor 1-delta
Source.10794: DFBPPR13048 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 1
Source.10795: DFBPPR13049 ---- Animal proteins ---- Alpha-S1-casein
Source.10796: DFBPPR13056 ---- Animal proteins ---- V-type proton ATPase subunit D
Source.10797: DFBPPR13058 ---- Animal proteins ---- Anion exchange transporter
Source.10798: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2
Source.10799: DFBPPR13069 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP alpha-1 chain
Source.10800: DFBPPR13070 ---- Animal proteins ---- Beta-crystallin A2
Source.10801: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.10802: DFBPPR13083 ---- Animal proteins ---- Promotilin
Source.10803: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog
Source.10804: DFBPPR13086 ---- Animal proteins ---- RING finger protein 207
Source.10805: DFBPPR13089 ---- Animal proteins ---- 14-3-3 protein theta
Source.10806: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.10807: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236
Source.10808: DFBPPR13094 ---- Animal proteins ---- Atherin
Source.10809: DFBPPR13095 ---- Animal proteins ---- Regulator of G-protein signaling 4
Source.10810: DFBPPR13097 ---- Animal proteins ---- Lumican
Source.10811: DFBPPR13098 ---- Animal proteins ---- Epithelial membrane protein 1
Source.10812: DFBPPR13100 ---- Animal proteins ---- Lengsin
Source.10813: DFBPPR13103 ---- Animal proteins ---- T-cell receptor beta chain C region
Source.10814: DFBPPR13112 ---- Animal proteins ---- Ig heavy chain V-A1 region BS-5
Source.10815: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.10816: DFBPPR13118 ---- Animal proteins ---- Ig kappa-B5 chain V region 2699
Source.10817: DFBPPR13127 ---- Animal proteins ---- Ig kappa chain V region 3381
Source.10818: DFBPPR13129 ---- Animal proteins ---- Ig kappa chain V region 3374
Source.10819: DFBPPR13130 ---- Animal proteins ---- Ig kappa chain V region AH80-5
Source.10820: DFBPPR13134 ---- Animal proteins ---- Ig kappa chain V region 120
Source.10821: DFBPPR13138 ---- Animal proteins ---- SNRPN upstream reading frame protein
Source.10822: DFBPPR13142 ---- Animal proteins ---- Phospholipase A2
Source.10823: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.10824: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.10825: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.10826: DFBPPR13146 ---- Animal proteins ---- Interferon gamma
Source.10827: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.10828: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1
Source.10829: DFBPPR13152 ---- Animal proteins ---- Interleukin-4
Source.10830: DFBPPR13154 ---- Animal proteins ---- Annexin A1
Source.10831: DFBPPR13158 ---- Animal proteins ---- C-C motif chemokine 2
Source.10832: DFBPPR13159 ---- Animal proteins ---- Tumor necrosis factor
Source.10833: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.10834: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.10835: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor
Source.10836: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.10837: DFBPPR13166 ---- Animal proteins ---- CD44 antigen
Source.10838: DFBPPR13167 ---- Animal proteins ---- Natriuretic peptides A
Source.10839: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.10840: DFBPPR13169 ---- Animal proteins ---- High mobility group protein B1
Source.10841: DFBPPR13170 ---- Animal proteins ---- Carbonic anhydrase 1
Source.10842: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.10843: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2
Source.10844: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase
Source.10845: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase
Source.10846: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.10847: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2
Source.10848: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.10849: DFBPPR13182 ---- Animal proteins ---- Insulin-like growth factor II
Source.10850: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.10851: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.10852: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A
Source.10853: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.10854: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.10855: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.10856: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.10857: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11
Source.10858: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.10859: DFBPPR13195 ---- Animal proteins ---- Albumin
Source.10860: DFBPPR13196 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.10861: DFBPPR13197 ---- Animal proteins ---- Caveolin-2
Source.10862: DFBPPR13200 ---- Animal proteins ---- Interleukin-23 subunit alpha
Source.10863: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.10864: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.10865: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.10866: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23
Source.10867: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2
Source.10868: DFBPPR13213 ---- Animal proteins ---- Seminal plasma protein HSP-1
Source.10869: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.10870: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.10871: DFBPPR13219 ---- Animal proteins ---- Kit ligand
Source.10872: DFBPPR13220 ---- Animal proteins ---- Latherin
Source.10873: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.10874: DFBPPR13222 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.10875: DFBPPR13223 ---- Animal proteins ---- Caspase-1
Source.10876: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.10877: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.10878: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.10879: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.10880: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.10881: DFBPPR13237 ---- Animal proteins ---- Thioredoxin
Source.10882: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2
Source.10883: DFBPPR13239 ---- Animal proteins ---- T-cell surface antigen CD2
Source.10884: DFBPPR13240 ---- Animal proteins ---- Decorin
Source.10885: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.10886: DFBPPR13242 ---- Animal proteins ---- E-selectin
Source.10887: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B
Source.10888: DFBPPR13245 ---- Animal proteins ---- Somatotropin
Source.10889: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.10890: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.10891: DFBPPR13256 ---- Animal proteins ---- Interleukin-1 beta
Source.10892: DFBPPR13257 ---- Animal proteins ---- Prolactin
Source.10893: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.10894: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.10895: DFBPPR13262 ---- Animal proteins ---- Gastrin
Source.10896: DFBPPR13263 ---- Animal proteins ---- Serotransferrin
Source.10897: DFBPPR13265 ---- Animal proteins ---- Gasdermin-E
Source.10898: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.10899: DFBPPR13267 ---- Animal proteins ---- Interferon beta
Source.10900: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.10901: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.10902: DFBPPR13270 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein
Source.10903: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.10904: DFBPPR13273 ---- Animal proteins ---- Growth/differentiation factor 8
Source.10905: DFBPPR13274 ---- Animal proteins ---- Aquaporin-2
Source.10906: DFBPPR13275 ---- Animal proteins ---- Interleukin-6
Source.10907: DFBPPR13276 ---- Animal proteins ---- Protein quaking
Source.10908: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.10909: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.10910: DFBPPR13280 ---- Animal proteins ---- Oxytocin-neurophysin 1
Source.10911: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.10912: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.10913: DFBPPR13284 ---- Animal proteins ---- Interleukin-8
Source.10914: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.10915: DFBPPR13286 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor
Source.10916: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.10917: DFBPPR13288 ---- Animal proteins ---- Eotaxin
Source.10918: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.10919: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.10920: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein
Source.10921: DFBPPR13295 ---- Animal proteins ---- Alpha-1-antiproteinase 2
Source.10922: DFBPPR13296 ---- Animal proteins ---- Complement component C9
Source.10923: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1
Source.10924: DFBPPR13300 ---- Animal proteins ---- Sex-determining region Y protein
Source.10925: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.10926: DFBPPR13305 ---- Animal proteins ---- Cytochrome b
Source.10927: DFBPPR13308 ---- Animal proteins ---- Interleukin-10
Source.10928: DFBPPR13309 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.10929: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.10930: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.10931: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.10932: DFBPPR13319 ---- Animal proteins ---- Ferritin heavy chain
Source.10933: DFBPPR13322 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.10934: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.10935: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha
Source.10936: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.10937: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.10938: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.10939: DFBPPR13343 ---- Animal proteins ---- Interferon omega-1
Source.10940: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.10941: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.10942: DFBPPR13355 ---- Animal proteins ---- Nuclear transcription factor Y subunit beta
Source.10943: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.10944: DFBPPR13362 ---- Animal proteins ---- Biglycan
Source.10945: DFBPPR13363 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.10946: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.10947: DFBPPR13371 ---- Animal proteins ---- Calcitonin gene-related peptide 2
Source.10948: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.10949: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein
Source.10950: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.10951: DFBPPR13385 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.10952: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.10953: DFBPPR13387 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.10954: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.10955: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.10956: DFBPPR13393 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.10957: DFBPPR13394 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.10958: DFBPPR13396 ---- Animal proteins ---- Regulator of G-protein signaling 1
Source.10959: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.10960: DFBPPR13404 ---- Animal proteins ---- Peripheral myelin protein 22
Source.10961: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.10962: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.10963: DFBPPR13420 ---- Animal proteins ---- Small integral membrane protein 12
Source.10964: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.10965: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.10966: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.10967: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2
Source.10968: DFBPPR13436 ---- Animal proteins ---- Transmembrane protein 147
Source.10969: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.10970: DFBPPR13438 ---- Animal proteins ---- Growth/differentiation factor 8
Source.10971: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.10972: DFBPPR13443 ---- Animal proteins ---- Kit ligand
Source.10973: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.10974: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.10975: DFBPPR13447 ---- Animal proteins ---- Insulin-like growth factor I
Source.10976: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.10977: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.10978: DFBPPR13452 ---- Animal proteins ---- Interleukin-6
Source.10979: DFBPPR13455 ---- Animal proteins ---- Glutathione S-transferase P
Source.10980: DFBPPR13456 ---- Animal proteins ---- Galectin-1
Source.10981: DFBPPR13460 ---- Animal proteins ---- RNA-binding protein 3
Source.10982: DFBPPR13464 ---- Animal proteins ---- Interferon tau
Source.10983: DFBPPR13465 ---- Animal proteins ---- Hemoglobin fetal subunit beta
Source.10984: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.10985: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.10986: DFBPPR13469 ---- Animal proteins ---- Cytochrome b
Source.10987: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein
Source.10988: DFBPPR13473 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.10989: DFBPPR13474 ---- Animal proteins ---- Hemoglobin subunit epsilon-1
Source.10990: DFBPPR13475 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.10991: DFBPPR13477 ---- Animal proteins ---- Prolactin
Source.10992: DFBPPR13478 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor
Source.10993: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3
Source.10994: DFBPPR13481 ---- Animal proteins ---- Somatotropin
Source.10995: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.10996: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.10997: DFBPPR13498 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.10998: DFBPPR13503 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.10999: DFBPPR13504 ---- Animal proteins ---- Platelet-activating factor receptor
Source.11000: DFBPPR13506 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.11001: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9
Source.11002: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.11003: DFBPPR13517 ---- Animal proteins ---- 40S ribosomal protein S18
Source.11004: DFBPPR13522 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2
Source.11005: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin
Source.11006: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.11007: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.11008: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.11009: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2
Source.11010: DFBPPR13538 ---- Animal proteins ---- Apolipoprotein E
Source.11011: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.11012: DFBPPR13540 ---- Animal proteins ---- Somatotropin
Source.11013: DFBPPR13543 ---- Animal proteins ---- Myoblast determination protein 1
Source.11014: DFBPPR13544 ---- Animal proteins ---- U8 snoRNA-decapping enzyme
Source.11015: DFBPPR13545 ---- Animal proteins ---- Prolactin
Source.11016: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.11017: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.11018: DFBPPR13549 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.11019: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1
Source.11020: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.11021: DFBPPR13555 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.11022: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.11023: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.11024: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1
Source.11025: DFBPPR13564 ---- Animal proteins ---- Calmodulin
Source.11026: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.11027: DFBPPR13566 ---- Animal proteins ---- Calcium and integrin-binding protein 1
Source.11028: DFBPPR13567 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.11029: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.11030: DFBPPR13569 ---- Animal proteins ---- Fibroblast growth factor 2
Source.11031: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.11032: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36
Source.11033: DFBPPR13574 ---- Animal proteins ---- Serotonin N-acetyltransferase
Source.11034: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2
Source.11035: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.11036: DFBPPR13577 ---- Animal proteins ---- Interleukin-6
Source.11037: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.11038: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein
Source.11039: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.11040: DFBPPR13583 ---- Animal proteins ---- Caveolin-2
Source.11041: DFBPPR13584 ---- Animal proteins ---- Calpain-3
Source.11042: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.11043: DFBPPR13587 ---- Animal proteins ---- Aquaporin-1
Source.11044: DFBPPR13589 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.11045: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.11046: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.11047: DFBPPR13592 ---- Animal proteins ---- Natriuretic peptides A
Source.11048: DFBPPR13593 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.11049: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.11050: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.11051: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.11052: DFBPPR13598 ---- Animal proteins ---- Interleukin-8
Source.11053: DFBPPR13601 ---- Animal proteins ---- Cathepsin B
Source.11054: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.11055: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.11056: DFBPPR13606 ---- Animal proteins ---- Estrogen receptor
Source.11057: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.11058: DFBPPR13611 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.11059: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.11060: DFBPPR13613 ---- Animal proteins ---- Phospholipase A2
Source.11061: DFBPPR13614 ---- Animal proteins ---- Insulin-like growth factor II
Source.11062: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.11063: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.11064: DFBPPR13619 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial
Source.11065: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.11066: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta
Source.11067: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.11068: DFBPPR13628 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.11069: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.11070: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.11071: DFBPPR13631 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.11072: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.11073: DFBPPR13633 ---- Animal proteins ---- Interferon tau-2
Source.11074: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.11075: DFBPPR13637 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial
Source.11076: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.11077: DFBPPR13640 ---- Animal proteins ---- Growth/differentiation factor 8
Source.11078: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.11079: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2
Source.11080: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.11081: DFBPPR13645 ---- Animal proteins ---- Interferon tau-6
Source.11082: DFBPPR13646 ---- Animal proteins ---- Procathepsin L
Source.11083: DFBPPR13652 ---- Animal proteins ---- Interleukin-3
Source.11084: DFBPPR13653 ---- Animal proteins ---- Interferon tau-11
Source.11085: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.11086: DFBPPR13656 ---- Animal proteins ---- Thioredoxin
Source.11087: DFBPPR13659 ---- Animal proteins ---- Oxytocin-neurophysin 1
Source.11088: DFBPPR13660 ---- Animal proteins ---- 40S ribosomal protein SA
Source.11089: DFBPPR13662 ---- Animal proteins ---- Aquaporin-2
Source.11090: DFBPPR13663 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial
Source.11091: DFBPPR13664 ---- Animal proteins ---- Interleukin-10
Source.11092: DFBPPR13665 ---- Animal proteins ---- Kit ligand
Source.11093: DFBPPR13666 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.11094: DFBPPR13668 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.11095: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2
Source.11096: DFBPPR13672 ---- Animal proteins ---- Annexin A2
Source.11097: DFBPPR13673 ---- Animal proteins ---- Insulin-like growth factor I
Source.11098: DFBPPR13674 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.11099: DFBPPR13675 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.11100: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.11101: DFBPPR13678 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.11102: DFBPPR13679 ---- Animal proteins ---- Interferon tau-3
Source.11103: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.11104: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.11105: DFBPPR13683 ---- Animal proteins ---- 14-3-3 protein sigma
Source.11106: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.11107: DFBPPR13690 ---- Animal proteins ---- Angiotensinogen
Source.11108: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.11109: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III
Source.11110: DFBPPR13694 ---- Animal proteins ---- Interferon tau-1
Source.11111: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.11112: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.11113: DFBPPR13705 ---- Animal proteins ---- Galectin-1
Source.11114: DFBPPR13706 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.11115: DFBPPR13708 ---- Animal proteins ---- Renin
Source.11116: DFBPPR13711 ---- Animal proteins ---- Coagulation factor IX
Source.11117: DFBPPR13712 ---- Animal proteins ---- Cytochrome b
Source.11118: DFBPPR13719 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.11119: DFBPPR13720 ---- Animal proteins ---- Interferon tau-10
Source.11120: DFBPPR13722 ---- Animal proteins ---- Insulin
Source.11121: DFBPPR13726 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.11122: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.11123: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.11124: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.11125: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase
Source.11126: DFBPPR13732 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.11127: DFBPPR13733 ---- Animal proteins ---- Keratin-associated protein 8-1
Source.11128: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.11129: DFBPPR13735 ---- Animal proteins ---- Thyroid hormone receptor beta
Source.11130: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.11131: DFBPPR13742 ---- Animal proteins ---- Interferon tau-5
Source.11132: DFBPPR13743 ---- Animal proteins ---- Interferon tau-9
Source.11133: DFBPPR13744 ---- Animal proteins ---- Interferon tau-8
Source.11134: DFBPPR13745 ---- Animal proteins ---- Interferon tau-7
Source.11135: DFBPPR13747 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.11136: DFBPPR13748 ---- Animal proteins ---- Interferon tau-4
Source.11137: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.11138: DFBPPR13750 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, cytosolic
Source.11139: DFBPPR13752 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.11140: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.11141: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.11142: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.11143: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21
Source.11144: DFBPPR13759 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.11145: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.11146: DFBPPR13761 ---- Animal proteins ---- Gap junction beta-2 protein
Source.11147: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A
Source.11148: DFBPPR13764 ---- Animal proteins ---- Mast cell protease 1A
Source.11149: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.11150: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor
Source.11151: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.11152: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.11153: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9
Source.11154: DFBPPR13776 ---- Animal proteins ---- Keratin, type II microfibrillar, component 7C
Source.11155: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.11156: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.11157: DFBPPR13783 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.11158: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.11159: DFBPPR13786 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit gamma
Source.11160: DFBPPR13788 ---- Animal proteins ---- Albumin
Source.11161: DFBPPR13791 ---- Animal proteins ---- Cholinesterase
Source.11162: DFBPPR13793 ---- Animal proteins ---- Decorin
Source.11163: DFBPPR13794 ---- Animal proteins ---- Inhibin alpha chain
Source.11164: DFBPPR13796 ---- Animal proteins ---- Prion-like protein doppel
Source.11165: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor
Source.11166: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6
Source.11167: DFBPPR13800 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.11168: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4
Source.11169: DFBPPR13803 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.11170: DFBPPR13804 ---- Animal proteins ---- Calcium and integrin-binding family member 2
Source.11171: DFBPPR13806 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.11172: DFBPPR13811 ---- Animal proteins ---- 14-3-3 protein gamma
Source.11173: DFBPPR13815 ---- Animal proteins ---- Mast cell protease 2
Source.11174: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1
Source.11175: DFBPPR13819 ---- Animal proteins ---- Aquaporin-5
Source.11176: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.11177: DFBPPR13821 ---- Animal proteins ---- Calcitonin
Source.11178: DFBPPR13823 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.11179: DFBPPR13826 ---- Animal proteins ---- Translocator protein
Source.11180: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3
Source.11181: DFBPPR13834 ---- Animal proteins ---- Biglycan
Source.11182: DFBPPR13836 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.11183: DFBPPR13838 ---- Animal proteins ---- Endothelin-1
Source.11184: DFBPPR13840 ---- Animal proteins ---- Cytochrome b561
Source.11185: DFBPPR13843 ---- Animal proteins ---- 60S ribosomal protein L10
Source.11186: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein
Source.11187: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor
Source.11188: DFBPPR13853 ---- Animal proteins ---- Keratin, type II microfibrillar, component 5
Source.11189: DFBPPR13854 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.11190: DFBPPR13855 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor
Source.11191: DFBPPR13856 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.11192: DFBPPR13857 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.11193: DFBPPR13859 ---- Animal proteins ---- Hemoglobin fetal subunit beta
Source.11194: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin
Source.11195: DFBPPR13861 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.11196: DFBPPR13863 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.11197: DFBPPR13865 ---- Animal proteins ---- C-C chemokine receptor type 9
Source.11198: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor
Source.11199: DFBPPR13875 ---- Animal proteins ---- Gastrin
Source.11200: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.11201: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.11202: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.11203: DFBPPR13885 ---- Animal proteins ---- Mast cell protease 3
Source.11204: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1
Source.11205: DFBPPR13888 ---- Animal proteins ---- Calcitonin gene-related peptide
Source.11206: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.11207: DFBPPR13892 ---- Animal proteins ---- Melanocortin receptor 5
Source.11208: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.11209: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.11210: DFBPPR13901 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.11211: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.11212: DFBPPR13913 ---- Animal proteins ---- Bombesin receptor subtype-3
Source.11213: DFBPPR13916 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.11214: DFBPPR13917 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.11215: DFBPPR13923 ---- Animal proteins ---- CCAAT/enhancer-binding protein epsilon
Source.11216: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.11217: DFBPPR13927 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.11218: DFBPPR13933 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.11219: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.11220: DFBPPR13937 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.11221: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.11222: DFBPPR13944 ---- Animal proteins ---- Hippocalcin-like protein 1
Source.11223: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.11224: DFBPPR13948 ---- Animal proteins ---- Calcium and integrin-binding family member 4
Source.11225: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.11226: DFBPPR13953 ---- Animal proteins ---- Tetraspanin-9
Source.11227: DFBPPR13961 ---- Animal proteins ---- Elongation factor 1-delta
Source.11228: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.11229: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B
Source.11230: DFBPPR13987 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.11231: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.11232: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.11233: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.11234: DFBPPR13993 ---- Animal proteins ---- Insulin
Source.11235: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.11236: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.11237: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.11238: DFBPPR14002 ---- Animal proteins ---- Cytochrome b
Source.11239: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.11240: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.11241: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase
Source.11242: DFBPPR14007 ---- Animal proteins ---- Cystatin
Source.11243: DFBPPR14009 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.11244: DFBPPR14010 ---- Animal proteins ---- GTPase KRas
Source.11245: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.11246: DFBPPR14017 ---- Animal proteins ---- Ependymin
Source.11247: DFBPPR14018 ---- Animal proteins ---- Ras-related protein Rap-1b
Source.11248: DFBPPR14019 ---- Animal proteins ---- Vimentin
Source.11249: DFBPPR14020 ---- Animal proteins ---- Parvalbumin alpha
Source.11250: DFBPPR14024 ---- Animal proteins ---- Gamma-crystallin S
Source.11251: DFBPPR14026 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.11252: DFBPPR14028 ---- Animal proteins ---- Myofibril-bound serine protease
Source.11253: DFBPPR14035 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.11254: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.11255: DFBPPR14037 ---- Animal proteins ---- Parvalbumin beta
Source.11256: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.11257: DFBPPR14043 ---- Animal proteins ---- Prolactin
Source.11258: DFBPPR14044 ---- Animal proteins ---- Transcription factor jun-B
Source.11259: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.11260: DFBPPR14054 ---- Animal proteins ---- Pro-neuropeptide Y
Source.11261: DFBPPR14059 ---- Animal proteins ---- Beta-2-microglobulin
Source.11262: DFBPPR14062 ---- Animal proteins ---- Alpha-1-antitrypsin homolog
Source.11263: DFBPPR14066 ---- Animal proteins ---- 27 kDa antibacterial protein
Source.11264: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1
Source.11265: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.11266: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36
Source.11267: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.11268: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.11269: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.11270: DFBPPR14081 ---- Marine protein ---- Beta-enolase
Source.11271: DFBPPR14082 ---- Marine protein ---- Estrogen receptor
Source.11272: DFBPPR14083 ---- Marine protein ---- RING-box protein 1
Source.11273: DFBPPR14085 ---- Marine protein ---- Hemoglobin subunit beta
Source.11274: DFBPPR14086 ---- Marine protein ---- Hemoglobin subunit alpha
Source.11275: DFBPPR14090 ---- Marine protein ---- Trypsin-3
Source.11276: DFBPPR14091 ---- Marine protein ---- 40S ribosomal protein SA
Source.11277: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.11278: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha
Source.11279: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C
Source.11280: DFBPPR14099 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.11281: DFBPPR14100 ---- Marine protein ---- Cytochrome b
Source.11282: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.11283: DFBPPR14102 ---- Marine protein ---- Anamorsin-B
Source.11284: DFBPPR14104 ---- Marine protein ---- Anamorsin-A
Source.11285: DFBPPR14106 ---- Marine protein ---- Thyroid hormone receptor alpha
Source.11286: DFBPPR14107 ---- Marine protein ---- E3 ubiquitin-protein ligase rnf146
Source.11287: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A
Source.11288: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.11289: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183
Source.11290: DFBPPR14115 ---- Marine protein ---- Adenylate kinase 2, mitochondrial
Source.11291: DFBPPR14117 ---- Marine protein ---- Ferritin, middle subunit
Source.11292: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.11293: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.11294: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin
Source.11295: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.11296: DFBPPR14123 ---- Marine protein ---- Albumin 1
Source.11297: DFBPPR14124 ---- Marine protein ---- Albumin 2
Source.11298: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.11299: DFBPPR14128 ---- Marine protein ---- F-box/LRR-repeat protein 15
Source.11300: DFBPPR14129 ---- Marine protein ---- Methylthioribulose-1-phosphate dehydratase
Source.11301: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase
Source.11302: DFBPPR14132 ---- Marine protein ---- Calumenin-A
Source.11303: DFBPPR14133 ---- Marine protein ---- Calumenin-B
Source.11304: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.11305: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.11306: DFBPPR14140 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.11307: DFBPPR14141 ---- Marine protein ---- Ependymin-2
Source.11308: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I
Source.11309: DFBPPR14144 ---- Marine protein ---- Spindle and kinetochore-associated protein 2
Source.11310: DFBPPR14146 ---- Marine protein ---- ATP synthase subunit a
Source.11311: DFBPPR14147 ---- Marine protein ---- Parvalbumin beta 2
Source.11312: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein
Source.11313: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.11314: DFBPPR14152 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4L
Source.11315: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.11316: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.11317: DFBPPR14161 ---- Marine protein ---- GTPase Era, mitochondrial
Source.11318: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog
Source.11319: DFBPPR14163 ---- Marine protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.11320: DFBPPR14164 ---- Marine protein ---- Ragulator complex protein LAMTOR2
Source.11321: DFBPPR14166 ---- Marine protein ---- Draxin-A
Source.11322: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.11323: DFBPPR14168 ---- Marine protein ---- Transcription and mRNA export factor ENY2-2
Source.11324: DFBPPR14169 ---- Marine protein ---- Transcription and mRNA export factor ENY2-1
Source.11325: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator
Source.11326: DFBPPR14175 ---- Marine protein ---- Draxin-B
Source.11327: DFBPPR14176 ---- Marine protein ---- Serine palmitoyltransferase small subunit A
Source.11328: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein
Source.11329: DFBPPR14178 ---- Marine protein ---- Hepcidin-1
Source.11330: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.11331: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein
Source.11332: DFBPPR14185 ---- Marine protein ---- Parvalbumin beta 1
Source.11333: DFBPPR14187 ---- Marine protein ---- Secreted phosphoprotein 24
Source.11334: DFBPPR14189 ---- Marine protein ---- Protein Flattop
Source.11335: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.11336: DFBPPR14193 ---- Marine protein ---- ER membrane protein complex subunit 4
Source.11337: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog
Source.11338: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein
Source.11339: DFBPPR14198 ---- Marine protein ---- Trafficking protein particle complex subunit 2-like protein
Source.11340: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.11341: DFBPPR14201 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-B
Source.11342: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein
Source.11343: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.11344: DFBPPR14205 ---- Marine protein ---- Intraflagellar transport protein 43 homolog A
Source.11345: DFBPPR14206 ---- Marine protein ---- Intraflagellar transport protein 43 homolog B
Source.11346: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a
Source.11347: DFBPPR14210 ---- Marine protein ---- Tetraspanin-9
Source.11348: DFBPPR14212 ---- Marine protein ---- Proline-rich nuclear receptor coactivator 2
Source.11349: DFBPPR14213 ---- Marine protein ---- Electron transfer flavoprotein regulatory factor 1
Source.11350: DFBPPR14215 ---- Marine protein ---- Protein SMG9
Source.11351: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial
Source.11352: DFBPPR14222 ---- Marine protein ---- Neuropeptide-like protein C4orf48 homolog
Source.11353: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1
Source.11354: DFBPPR14224 ---- Marine protein ---- Costars family protein ABRACL
Source.11355: DFBPPR14227 ---- Marine protein ---- LYR motif-containing protein 4B
Source.11356: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain
Source.11357: DFBPPR14238 ---- Marine protein ---- Insulin
Source.11358: DFBPPR14240 ---- Marine protein ---- Otolin-1
Source.11359: DFBPPR14241 ---- Marine protein ---- Cystatin
Source.11360: DFBPPR14242 ---- Marine protein ---- Cytochrome b
Source.11361: DFBPPR14250 ---- Marine protein ---- Vasotocin-neurophysin VT 2
Source.11362: DFBPPR14251 ---- Marine protein ---- Isotocin-neurophysin IT 1
Source.11363: DFBPPR14257 ---- Marine protein ---- Somatolactin
Source.11364: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.11365: DFBPPR14263 ---- Marine protein ---- ATP synthase subunit a
Source.11366: DFBPPR14264 ---- Marine protein ---- Glycoprotein hormones alpha chain
Source.11367: DFBPPR14267 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 2, mitochondrial
Source.11368: DFBPPR14268 ---- Marine protein ---- Cytochrome c oxidase subunit 6C-1
Source.11369: DFBPPR14285 ---- Marine protein ---- C-phycocyanin beta chain
Source.11370: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.11371: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.11372: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.11373: DFBPPR14294 ---- Marine protein ---- ATP synthase subunit c, chloroplastic
Source.11374: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.11375: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE
Source.11376: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.11377: DFBPPR14306 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.11378: DFBPPR14310 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.11379: DFBPPR14312 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.11380: DFBPPR14314 ---- Marine protein ---- Probable ATP-dependent transporter ycf16
Source.11381: DFBPPR14320 ---- Marine protein ---- Photosystem I assembly protein Ycf3
Source.11382: DFBPPR14321 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.11383: DFBPPR14325 ---- Marine protein ---- Uncharacterized protein ycf20
Source.11384: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase
Source.11385: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1
Source.11386: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.11387: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.11388: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.11389: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain
Source.11390: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.11391: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.11392: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein
Source.11393: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH
Source.11394: DFBPPR14342 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.11395: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.11396: DFBPPR14346 ---- Marine protein ---- R-phycoerythrin alpha chain
Source.11397: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N
Source.11398: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.11399: DFBPPR14350 ---- Marine protein ---- 3-oxoacyl-[acyl-carrier-protein] synthase 3
Source.11400: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.11401: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI
Source.11402: DFBPPR14353 ---- Marine protein ---- Cytochrome c6
Source.11403: DFBPPR14355 ---- Marine protein ---- ATP synthase subunit c, chloroplastic
Source.11404: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha
Source.11405: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'
Source.11406: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.11407: DFBPPR14363 ---- Marine protein ---- Putative peroxiredoxin ycf42
Source.11408: DFBPPR14364 ---- Marine protein ---- Ribulose bisphosphate carboxylase small chain
Source.11409: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE
Source.11410: DFBPPR14367 ---- Marine protein ---- Cytochrome f
Source.11411: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain
Source.11412: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.11413: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.11414: DFBPPR14373 ---- Marine protein ---- Cytochrome b6
Source.11415: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.11416: DFBPPR14378 ---- Marine protein ---- Probable replicative DNA helicase
Source.11417: DFBPPR14379 ---- Marine protein ---- Elongation factor 1-alpha
Source.11418: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta
Source.11419: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.11420: DFBPPR14386 ---- Marine protein ---- R-phycoerythrin beta chain
Source.11421: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic
Source.11422: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.11423: DFBPPR14392 ---- Marine protein ---- Prenyl transferase
Source.11424: DFBPPR14393 ---- Marine protein ---- Ribonuclease E/G-like protein
Source.11425: DFBPPR14396 ---- Marine protein ---- Tryptophan synthase alpha chain
Source.11426: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic
Source.11427: DFBPPR14398 ---- Marine protein ---- 30S ribosomal protein S7, chloroplastic
Source.11428: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha
Source.11429: DFBPPR14408 ---- Marine protein ---- Cytochrome b6-f complex subunit 6
Source.11430: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26
Source.11431: DFBPPR14411 ---- Marine protein ---- 50S ribosomal protein L22, chloroplastic
Source.11432: DFBPPR14417 ---- Marine protein ---- Histidine--tRNA ligase, chloroplastic
Source.11433: DFBPPR14419 ---- Marine protein ---- Photosystem II reaction center protein K
Source.11434: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.11435: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.11436: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator
Source.11437: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III
Source.11438: DFBPPR14437 ---- Marine protein ---- 30S ribosomal protein S3, chloroplastic
Source.11439: DFBPPR14447 ---- Marine protein ---- Protein translocase subunit SecY
Source.11440: DFBPPR14451 ---- Marine protein ---- Protein PsbN
Source.11441: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.11442: DFBPPR14465 ---- Marine protein ---- 50S ribosomal protein L16, chloroplastic
Source.11443: DFBPPR14467 ---- Marine protein ---- 30S ribosomal protein S20, chloroplastic
Source.11444: DFBPPR14474 ---- Marine protein ---- Probable ATP-dependent transporter ycf16
Source.11445: DFBPPR14486 ---- Marine protein ---- Putative transport permease ycf38
Source.11446: DFBPPR14487 ---- Marine protein ---- Chloroplast envelope membrane protein
Source.11447: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46
Source.11448: DFBPPR14499 ---- Marine protein ---- Photosystem I assembly protein Ycf3
Source.11449: DFBPPR14504 ---- Marine protein ---- Probable ABC transporter permease protein ycf63
Source.11450: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.11451: DFBPPR14508 ---- Marine protein ---- Uncharacterized tatC-like protein ycf43
Source.11452: DFBPPR14509 ---- Marine protein ---- Uncharacterized protein ycf37
Source.11453: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60
Source.11454: DFBPPR14520 ---- Marine protein ---- Uncharacterized protein ycf23
Source.11455: DFBPPR14522 ---- Marine protein ---- Uncharacterized protein ycf20
Source.11456: DFBPPR14529 ---- Marine protein ---- Uncharacterized protein ycf22
Source.11457: DFBPPR14531 ---- Marine protein ---- Protein PYP1
Source.11458: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.11459: DFBPPR14534 ---- Marine protein ---- Uncharacterized protein ORF62
Source.11460: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2
Source.11461: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.11462: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1
Source.11463: DFBPPR14543 ---- Marine protein ---- Pro-opiomelanocortin A
Source.11464: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3
Source.11465: DFBPPR14548 ---- Marine protein ---- Mineralocorticoid receptor
Source.11466: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.11467: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor
Source.11468: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2
Source.11469: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.11470: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.11471: DFBPPR14561 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.11472: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.11473: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.11474: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta
Source.11475: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.11476: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain
Source.11477: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.11478: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.11479: DFBPPR14574 ---- Marine protein ---- Hemoglobin subunit beta-4
Source.11480: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.11481: DFBPPR14579 ---- Marine protein ---- Hemoglobin subunit alpha-1
Source.11482: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.11483: DFBPPR14581 ---- Marine protein ---- Interferon alpha/beta receptor 2
Source.11484: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.11485: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible
Source.11486: DFBPPR14590 ---- Marine protein ---- Cytochrome b
Source.11487: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.11488: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b
Source.11489: DFBPPR14596 ---- Marine protein ---- Parvalbumin beta 2
Source.11490: DFBPPR14597 ---- Marine protein ---- Parvalbumin beta 1
Source.11491: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2
Source.11492: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a
Source.11493: DFBPPR14604 ---- Marine protein ---- Anamorsin
Source.11494: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.11495: DFBPPR14606 ---- Marine protein ---- Myoblast determination protein 1 homolog 1
Source.11496: DFBPPR14610 ---- Marine protein ---- Osteocalcin 2a
Source.11497: DFBPPR14611 ---- Marine protein ---- Osteocalcin 2b
Source.11498: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha
Source.11499: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1
Source.11500: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.11501: DFBPPR14618 ---- Marine protein ---- Ependymin-1
Source.11502: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.11503: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase
Source.11504: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.11505: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.11506: DFBPPR14628 ---- Marine protein ---- C-type natriuretic peptide 1
Source.11507: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1
Source.11508: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a
Source.11509: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein
Source.11510: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3
Source.11511: DFBPPR14642 ---- Marine protein ---- Peroxiredoxin
Source.11512: DFBPPR14645 ---- Marine protein ---- Ependymin-2
Source.11513: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2
Source.11514: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.11515: DFBPPR14650 ---- Marine protein ---- Thyroid hormone receptor alpha
Source.11516: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.11517: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.11518: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.11519: DFBPPR14659 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4L
Source.11520: DFBPPR14660 ---- Marine protein ---- Otolin-1
Source.11521: DFBPPR14661 ---- Marine protein ---- Myoblast determination protein 1 homolog 2
Source.11522: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.11523: DFBPPR14666 ---- Marine protein ---- High mobility group-T protein
Source.11524: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A
Source.11525: DFBPPR14670 ---- Marine protein ---- Fatty acid-binding protein, heart
Source.11526: DFBPPR14671 ---- Marine protein ---- Toll-interacting protein B
Source.11527: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.11528: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor
Source.11529: DFBPPR14679 ---- Marine protein ---- Otolith matrix protein 1
Source.11530: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2
Source.11531: DFBPPR14695 ---- Marine protein ---- C-type natriuretic peptide 2
Source.11532: DFBPPR14698 ---- Marine protein ---- Cystatin
Source.11533: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.11534: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13
Source.11535: DFBPPR14704 ---- Marine protein ---- Selenoprotein F
Source.11536: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.11537: DFBPPR14706 ---- Marine protein ---- 14-3-3 protein beta/alpha-1
Source.11538: DFBPPR14707 ---- Marine protein ---- 14-3-3 protein beta/alpha-2
Source.11539: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.11540: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.11541: DFBPPR14714 ---- Marine protein ---- 14-3-3 protein gamma-2
Source.11542: DFBPPR14715 ---- Marine protein ---- 14-3-3 protein gamma-1
Source.11543: DFBPPR14716 ---- Marine protein ---- Secreted phosphoprotein 24
Source.11544: DFBPPR14729 ---- Marine protein ---- Protein LEG1 homolog
Source.11545: DFBPPR14735 ---- Marine protein ---- Salmocidin-1
Source.11546: DFBPPR14740 ---- Marine protein ---- DNA damage-inducible transcript 4-like protein
Source.11547: DFBPPR14741 ---- Marine protein ---- Arrestin red cell isoform 3
Source.11548: DFBPPR14742 ---- Marine protein ---- Arrestin red cell isoform 2
Source.11549: DFBPPR14743 ---- Marine protein ---- Arrestin red cell isoform 1
Source.11550: DFBPPR14745 ---- Marine protein ---- Parvalbumin beta 2
Source.11551: DFBPPR14746 ---- Marine protein ---- Parvalbumin beta 1
Source.11552: DFBPPR14747 ---- Marine protein ---- Parvalbumin beta 3
Source.11553: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.11554: DFBPPR14750 ---- Marine protein ---- Parvalbumin beta
Source.11555: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme
Source.11556: DFBPPR14753 ---- Marine protein ---- Clotting factor B
Source.11557: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.11558: DFBPPR14758 ---- Marine protein ---- Techylectin-5B
Source.11559: DFBPPR14761 ---- Marine protein ---- Intracellular coagulation inhibitor 2
Source.11560: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.11561: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.11562: DFBPPR14775 ---- Marine protein ---- Troponin C
Source.11563: DFBPPR14777 ---- Marine protein ---- Tachystatin-C
Source.11564: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.11565: DFBPPR14782 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.11566: DFBPPR14783 ---- Marine protein ---- Enolase
Source.11567: DFBPPR14784 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.11568: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.11569: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain
Source.11570: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain
Source.11571: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.11572: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.11573: DFBPPR14800 ---- Marine protein ---- Crustacyanin-A1 subunit
Source.11574: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.11575: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit
Source.11576: DFBPPR14804 ---- Marine protein ---- Crustacyanin-C1 subunit
Source.11577: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.11578: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.11579: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.11580: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.11581: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1
Source.11582: DFBPPR14814 ---- Marine protein ---- Superoxide dismutase [Mn], mitochondrial
Source.11583: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3
Source.11584: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2
Source.11585: DFBPPR14820 ---- Marine protein ---- Troponin C, isoform 1
Source.11586: DFBPPR14821 ---- Marine protein ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1
Source.11587: DFBPPR14829 ---- Marine protein ---- Crustacean calcium-binding protein 23
Source.11588: DFBPPR14832 ---- Marine protein ---- Troponin C, isoform 2B
Source.11589: DFBPPR14833 ---- Marine protein ---- Troponin C, isoform 2A
Source.11590: DFBPPR14837 ---- Marine protein ---- Hemocyanin subunit 6
Source.11591: DFBPPR14853 ---- Marine protein ---- Sarcoplasmic calcium-binding protein 1
Source.11592: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.11593: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.11594: DFBPPR14857 ---- Marine protein ---- Hemoglobin anodic subunit alpha
Source.11595: DFBPPR14858 ---- Marine protein ---- Hemoglobin cathodic subunit alpha
Source.11596: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.11597: DFBPPR14861 ---- Marine protein ---- Cytochrome b
Source.11598: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.11599: DFBPPR14871 ---- Marine protein ---- Troponin C, skeletal muscle
Source.11600: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.11601: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1
Source.11602: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.11603: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.11604: DFBPPR14884 ---- Microorganism protein ---- Negative regulator of the PHO system
Source.11605: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.11606: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.11607: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1
Source.11608: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.11609: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.11610: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.11611: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.11612: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.11613: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase
Source.11614: DFBPPR14897 ---- Microorganism protein ---- Calmodulin
Source.11615: DFBPPR14898 ---- Microorganism protein ---- Transcription factor IIIB 70 kDa subunit
Source.11616: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.11617: DFBPPR14900 ---- Microorganism protein ---- Ethanol acetyltransferase 1
Source.11618: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.11619: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.11620: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.11621: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.11622: DFBPPR14906 ---- Microorganism protein ---- Autophagy-related protein 8
Source.11623: DFBPPR14907 ---- Microorganism protein ---- Adenylyltransferase and sulfurtransferase UBA4
Source.11624: DFBPPR14909 ---- Microorganism protein ---- ATPase GET3
Source.11625: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.11626: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.11627: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.11628: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.11629: DFBPPR14916 ---- Microorganism protein ---- Putative lipase ATG15
Source.11630: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase
Source.11631: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1
Source.11632: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific
Source.11633: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific
Source.11634: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.11635: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.11636: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase
Source.11637: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.11638: DFBPPR14931 ---- Microorganism protein ---- E3 ubiquitin-protein ligase BRE1
Source.11639: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.11640: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial
Source.11641: DFBPPR14935 ---- Microorganism protein ---- Actin
Source.11642: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.11643: DFBPPR14938 ---- Microorganism protein ---- Inosine triphosphate pyrophosphatase
Source.11644: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1
Source.11645: DFBPPR14941 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP5
Source.11646: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4
Source.11647: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1
Source.11648: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.11649: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.11650: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.11651: DFBPPR14951 ---- Microorganism protein ---- Octanoyltransferase, mitochondrial
Source.11652: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.11653: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase
Source.11654: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1
Source.11655: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2
Source.11656: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1
Source.11657: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1
Source.11658: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.11659: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2
Source.11660: DFBPPR14964 ---- Microorganism protein ---- Arginine biosynthesis bifunctional protein ArgJ, mitochondrial
Source.11661: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.11662: DFBPPR14968 ---- Microorganism protein ---- Small COPII coat GTPase SAR1
Source.11663: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase
Source.11664: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.11665: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.11666: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit
Source.11667: DFBPPR14975 ---- Microorganism protein ---- Inner kinetochore subunit CTF19
Source.11668: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like
Source.11669: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.11670: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3
Source.11671: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.11672: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.11673: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.11674: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial
Source.11675: DFBPPR14990 ---- Microorganism protein ---- Nuclear distribution protein PAC1
Source.11676: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.11677: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.11678: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial
Source.11679: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase
Source.11680: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.11681: DFBPPR14998 ---- Microorganism protein ---- Galactokinase
Source.11682: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial
Source.11683: DFBPPR15002 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.11684: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16
Source.11685: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.11686: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8
Source.11687: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1
Source.11688: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase
Source.11689: DFBPPR15010 ---- Microorganism protein ---- N-acetyltransferase ECO1
Source.11690: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b
Source.11691: DFBPPR15013 ---- Microorganism protein ---- Inorganic pyrophosphatase
Source.11692: DFBPPR15014 ---- Microorganism protein ---- AP-1-like transcription factor YAP1
Source.11693: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase
Source.11694: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.11695: DFBPPR15018 ---- Microorganism protein ---- Sorting nexin-4
Source.11696: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial
Source.11697: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4
Source.11698: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1
Source.11699: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase
Source.11700: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein
Source.11701: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2
Source.11702: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.11703: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.11704: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.11705: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial
Source.11706: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.11707: DFBPPR15036 ---- Microorganism protein ---- ATP synthase subunit gamma, mitochondrial
Source.11708: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.11709: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2
Source.11710: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.11711: DFBPPR15041 ---- Microorganism protein ---- Autophagy protein 5
Source.11712: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase
Source.11713: DFBPPR15046 ---- Microorganism protein ---- Histone acetyltransferase type B catalytic subunit
Source.11714: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1
Source.11715: DFBPPR15048 ---- Microorganism protein ---- 3-ketodihydrosphingosine reductase TSC10
Source.11716: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.11717: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1
Source.11718: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9
Source.11719: DFBPPR15055 ---- Microorganism protein ---- DNA damage-inducible protein 1
Source.11720: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2
Source.11721: DFBPPR15058 ---- Microorganism protein ---- DNA repair and recombination protein RAD52
Source.11722: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.11723: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1
Source.11724: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1
Source.11725: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.11726: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.11727: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.11728: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial
Source.11729: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1
Source.11730: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1
Source.11731: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4
Source.11732: DFBPPR15076 ---- Microorganism protein ---- Fe-S cluster assembly protein DRE2
Source.11733: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.11734: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.11735: DFBPPR15080 ---- Microorganism protein ---- Dimethyladenosine transferase
Source.11736: DFBPPR15082 ---- Microorganism protein ---- Cytochrome c
Source.11737: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.11738: DFBPPR15090 ---- Microorganism protein ---- Transketolase
Source.11739: DFBPPR15092 ---- Microorganism protein ---- Alcohol dehydrogenase 3, mitochondrial
Source.11740: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1
Source.11741: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.11742: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1
Source.11743: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase
Source.11744: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.11745: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.11746: DFBPPR15102 ---- Microorganism protein ---- Signal peptidase complex catalytic subunit SEC11
Source.11747: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5
Source.11748: DFBPPR15106 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.11749: DFBPPR15107 ---- Microorganism protein ---- Calcineurin subunit B
Source.11750: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.11751: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.11752: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.11753: DFBPPR15111 ---- Microorganism protein ---- mRNA cap guanine-N7 methyltransferase
Source.11754: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28
Source.11755: DFBPPR15113 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 1
Source.11756: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.11757: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase
Source.11758: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10
Source.11759: DFBPPR15118 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC2
Source.11760: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.11761: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1
Source.11762: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.11763: DFBPPR15131 ---- Microorganism protein ---- tRNA (guanine(9)-N1)-methyltransferase
Source.11764: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial
Source.11765: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.11766: DFBPPR15135 ---- Microorganism protein ---- Protein transport protein SEC22
Source.11767: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.11768: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase
Source.11769: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase
Source.11770: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.11771: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4
Source.11772: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40
Source.11773: DFBPPR15146 ---- Microorganism protein ---- DNA polymerase epsilon subunit D
Source.11774: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.11775: DFBPPR15149 ---- Microorganism protein ---- Dynein light chain 1, cytoplasmic
Source.11776: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.11777: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.11778: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase
Source.11779: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.11780: DFBPPR15157 ---- Microorganism protein ---- DASH complex subunit DAD2
Source.11781: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3
Source.11782: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.11783: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3
Source.11784: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2
Source.11785: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.11786: DFBPPR15169 ---- Microorganism protein ---- Protein VTS1
Source.11787: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.11788: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.11789: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1
Source.11790: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3
Source.11791: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.11792: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.11793: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial
Source.11794: DFBPPR15180 ---- Microorganism protein ---- Protein ROT1
Source.11795: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.11796: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C
Source.11797: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3
Source.11798: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3
Source.11799: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.11800: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8
Source.11801: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.11802: DFBPPR15203 ---- Microorganism protein ---- Ubiquitin-like protein ATG12
Source.11803: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.11804: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.11805: DFBPPR15210 ---- Microorganism protein ---- Mating-type protein ALPHA1
Source.11806: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17
Source.11807: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.11808: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1
Source.11809: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.11810: DFBPPR15216 ---- Microorganism protein ---- Golgi to ER traffic protein 1
Source.11811: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1
Source.11812: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1
Source.11813: DFBPPR15220 ---- Microorganism protein ---- Spindle assembly checkpoint component MAD1
Source.11814: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial
Source.11815: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial
Source.11816: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase
Source.11817: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2
Source.11818: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4
Source.11819: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.11820: DFBPPR15234 ---- Microorganism protein ---- V-type proton ATPase 16 kDa proteolipid subunit 2
Source.11821: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5
Source.11822: DFBPPR15236 ---- Microorganism protein ---- Protein PBN1
Source.11823: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.11824: DFBPPR15239 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 9
Source.11825: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3
Source.11826: DFBPPR15250 ---- Microorganism protein ---- DNA replication regulator SLD2
Source.11827: DFBPPR15253 ---- Microorganism protein ---- Orotate phosphoribosyltransferase
Source.11828: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.11829: DFBPPR15256 ---- Microorganism protein ---- SEC14 cytosolic factor
Source.11830: DFBPPR15258 ---- Microorganism protein ---- Invertase
Source.11831: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.11832: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4
Source.11833: DFBPPR15264 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX1
Source.11834: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.11835: DFBPPR15267 ---- Microorganism protein ---- Cofilin
Source.11836: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.11837: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.11838: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7
Source.11839: DFBPPR15275 ---- Microorganism protein ---- Exocyst complex protein EXO70
Source.11840: DFBPPR15277 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 20
Source.11841: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.11842: DFBPPR15279 ---- Microorganism protein ---- Nuclear fusion protein KAR5
Source.11843: DFBPPR15282 ---- Microorganism protein ---- Peroxisomal biogenesis factor 3
Source.11844: DFBPPR15283 ---- Microorganism protein ---- Diphthine methyl ester synthase
Source.11845: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1
Source.11846: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2
Source.11847: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9
Source.11848: DFBPPR15291 ---- Microorganism protein ---- mRNA-capping enzyme subunit beta
Source.11849: DFBPPR15292 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.11850: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.11851: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.11852: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter
Source.11853: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1
Source.11854: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7
Source.11855: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21
Source.11856: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.11857: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.11858: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.11859: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5
Source.11860: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.11861: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.11862: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial
Source.11863: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10
Source.11864: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10
Source.11865: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.11866: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2
Source.11867: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3
Source.11868: DFBPPR15332 ---- Microorganism protein ---- GDP-mannose transporter
Source.11869: DFBPPR15333 ---- Microorganism protein ---- GDP-mannose transporter
Source.11870: DFBPPR15334 ---- Microorganism protein ---- Probable kinetochore protein NUF2
Source.11871: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18
Source.11872: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.11873: DFBPPR15343 ---- Microorganism protein ---- Protein BIG1
Source.11874: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial
Source.11875: DFBPPR15350 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 7
Source.11876: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.11877: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase
Source.11878: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.11879: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.11880: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.11881: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase
Source.11882: DFBPPR15366 ---- Microorganism protein ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1
Source.11883: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.11884: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.11885: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.11886: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.11887: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial
Source.11888: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase
Source.11889: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5
Source.11890: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.11891: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1
Source.11892: DFBPPR15379 ---- Microorganism protein ---- General transcription and DNA repair factor IIH subunit TFB2
Source.11893: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.11894: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.11895: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.11896: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.11897: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.11898: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.11899: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.11900: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase
Source.11901: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2
Source.11902: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1
Source.11903: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41
Source.11904: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1
Source.11905: DFBPPR15404 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM10
Source.11906: DFBPPR15406 ---- Microorganism protein ---- Leucine carboxyl methyltransferase 1
Source.11907: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.11908: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2
Source.11909: DFBPPR15411 ---- Microorganism protein ---- GPI-anchored wall transfer protein 1
Source.11910: DFBPPR15412 ---- Microorganism protein ---- DNA repair protein RAD59
Source.11911: DFBPPR15413 ---- Microorganism protein ---- U1 small nuclear ribonucleoprotein component SNU71
Source.11912: DFBPPR15416 ---- Microorganism protein ---- Protein SOP4
Source.11913: DFBPPR15417 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM16
Source.11914: DFBPPR15421 ---- Microorganism protein ---- Cytochrome c lysine N-methyltransferase 1
Source.11915: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.11916: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.11917: DFBPPR15426 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit TRM82
Source.11918: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial
Source.11919: DFBPPR15430 ---- Microorganism protein ---- Exportin-T
Source.11920: DFBPPR15431 ---- Microorganism protein ---- RNA exonuclease 3
Source.11921: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3
Source.11922: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101
Source.11923: DFBPPR15435 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit GAR1
Source.11924: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase
Source.11925: DFBPPR15441 ---- Microorganism protein ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.11926: DFBPPR15444 ---- Microorganism protein ---- Monopolar spindle protein 2
Source.11927: DFBPPR15445 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM22
Source.11928: DFBPPR15447 ---- Microorganism protein ---- Genetic interactor of prohibitins 3, mitochondrial
Source.11929: DFBPPR15449 ---- Microorganism protein ---- Increased recombination centers protein 22
Source.11930: DFBPPR15451 ---- Microorganism protein ---- GrpE protein homolog, mitochondrial
Source.11931: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase
Source.11932: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.11933: DFBPPR15455 ---- Microorganism protein ---- Putative tyrosine-protein phosphatase OCA1
Source.11934: DFBPPR15457 ---- Microorganism protein ---- Ribosome biogenesis protein RLP24
Source.11935: DFBPPR15458 ---- Microorganism protein ---- Mitochondrial glycine transporter
Source.11936: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.11937: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1
Source.11938: DFBPPR15462 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM21
Source.11939: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.11940: DFBPPR15464 ---- Microorganism protein ---- Pre-rRNA-processing protein PNO1
Source.11941: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.11942: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10
Source.11943: DFBPPR15470 ---- Microorganism protein ---- Protein BUR2
Source.11944: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3
Source.11945: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1
Source.11946: DFBPPR15475 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC21
Source.11947: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.11948: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.11949: DFBPPR15486 ---- Microorganism protein ---- Transcription factor IWS1
Source.11950: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.11951: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.11952: DFBPPR15491 ---- Microorganism protein ---- Acyl-protein thioesterase 1
Source.11953: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.11954: DFBPPR15496 ---- Microorganism protein ---- Cell division cycle protein 123
Source.11955: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62
Source.11956: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.11957: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.11958: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5
Source.11959: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1
Source.11960: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.11961: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.11962: DFBPPR15508 ---- Microorganism protein ---- RNA polymerase II transcription factor B subunit 3
Source.11963: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1
Source.11964: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.11965: DFBPPR15515 ---- Microorganism protein ---- Tethering factor for nuclear proteasome STS1
Source.11966: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14
Source.11967: DFBPPR15519 ---- Microorganism protein ---- Mitochondrial genome maintenance protein MGM101
Source.11968: DFBPPR15522 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 3
Source.11969: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10
Source.11970: DFBPPR15526 ---- Microorganism protein ---- Telomere replication protein EST3
Source.11971: DFBPPR15530 ---- Microorganism protein ---- Translationally-controlled tumor protein homolog
Source.11972: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23
Source.11973: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.11974: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase
Source.11975: DFBPPR15540 ---- Microorganism protein ---- Probable intron-encoded endonuclease aI3
Source.11976: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.11977: DFBPPR15543 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 7
Source.11978: DFBPPR15545 ---- Microorganism protein ---- Ubiquinone biosynthesis protein COQ4, mitochondrial
Source.11979: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase
Source.11980: DFBPPR15548 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 25
Source.11981: DFBPPR15549 ---- Microorganism protein ---- Probable kinetochore protein SPC25
Source.11982: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.11983: DFBPPR15551 ---- Microorganism protein ---- Mitochondrial morphogenesis protein SLD7
Source.11984: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1
Source.11985: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.11986: DFBPPR15559 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC26
Source.11987: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.11988: DFBPPR15561 ---- Microorganism protein ---- Ribosome biogenesis protein SLX9
Source.11989: DFBPPR15563 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 1
Source.11990: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.11991: DFBPPR15567 ---- Microorganism protein ---- Mating-type protein A2
Source.11992: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1
Source.11993: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1
Source.11994: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.11995: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta
Source.11996: DFBPPR15584 ---- Microorganism protein ---- 40S ribosomal protein S1
Source.11997: DFBPPR15586 ---- Microorganism protein ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.11998: DFBPPR15587 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 3
Source.11999: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.12000: DFBPPR15589 ---- Microorganism protein ---- Spindle pole body component KRE28
Source.12001: DFBPPR15597 ---- Microorganism protein ---- DNA damage-binding protein CMR1
Source.12002: DFBPPR15598 ---- Microorganism protein ---- 54S ribosomal protein L4, mitochondrial
Source.12003: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2
Source.12004: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase
Source.12005: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1
Source.12006: DFBPPR15608 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP2
Source.12007: DFBPPR15609 ---- Microorganism protein ---- Shugoshin
Source.12008: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2
Source.12009: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.12010: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.12011: DFBPPR15617 ---- Microorganism protein ---- Cap-associated protein CAF20
Source.12012: DFBPPR15621 ---- Microorganism protein ---- Spore membrane assembly protein 2
Source.12013: DFBPPR15622 ---- Microorganism protein ---- Mitochondrial zinc maintenance protein 1, mitochondrial
Source.12014: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.12015: DFBPPR15626 ---- Microorganism protein ---- Nucleolar protein 12
Source.12016: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.12017: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4
Source.12018: DFBPPR15634 ---- Microorganism protein ---- Hsp70 nucleotide exchange factor FES1
Source.12019: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7
Source.12020: DFBPPR15636 ---- Microorganism protein ---- ATP synthase subunit d, mitochondrial
Source.12021: DFBPPR15638 ---- Microorganism protein ---- ATP-dependent kinase YFH7
Source.12022: DFBPPR15639 ---- Microorganism protein ---- Nucleolar protein 16
Source.12023: DFBPPR15644 ---- Microorganism protein ---- Cytoplasmic dynein intermediate light chain DYN3
Source.12024: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial
Source.12025: DFBPPR15648 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 2
Source.12026: DFBPPR15649 ---- Microorganism protein ---- Protein TAR1
Source.12027: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3
Source.12028: DFBPPR15655 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP18
Source.12029: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11
Source.12030: DFBPPR15658 ---- Microorganism protein ---- Protein DSE1
Source.12031: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.12032: DFBPPR15663 ---- Microorganism protein ---- Spindle pole component BBP1
Source.12033: DFBPPR15669 ---- Microorganism protein ---- Serine palmitoyltransferase-regulating protein TSC3
Source.12034: DFBPPR15670 ---- Microorganism protein ---- Imidazoleglycerol-phosphate dehydratase
Source.12035: DFBPPR15671 ---- Microorganism protein ---- Outer spore wall protein 5
Source.12036: DFBPPR15674 ---- Microorganism protein ---- DNA polymerase epsilon subunit C
Source.12037: DFBPPR15677 ---- Microorganism protein ---- Ribosome-recycling factor, mitochondrial
Source.12038: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.12039: DFBPPR15680 ---- Microorganism protein ---- Protein SYM1
Source.12040: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21
Source.12041: DFBPPR15682 ---- Microorganism protein ---- Protein YIM1
Source.12042: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4
Source.12043: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8
Source.12044: DFBPPR15686 ---- Microorganism protein ---- Polyadenylation factor subunit 2
Source.12045: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2
Source.12046: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3
Source.12047: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1
Source.12048: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3
Source.12049: DFBPPR15696 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 1
Source.12050: DFBPPR15697 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 2
Source.12051: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.12052: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.12053: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.12054: DFBPPR15702 ---- Microorganism protein ---- Protein FYV4, mitochondrial
Source.12055: DFBPPR15703 ---- Microorganism protein ---- Pre-mRNA-processing protein 45
Source.12056: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4
Source.12057: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial
Source.12058: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial
Source.12059: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial
Source.12060: DFBPPR15722 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 18, mitochondrial
Source.12061: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.12062: DFBPPR15725 ---- Microorganism protein ---- Protein DML1
Source.12063: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.12064: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase
Source.12065: DFBPPR15730 ---- Microorganism protein ---- Suppressor of hydroxyurea sensitivity protein 2
Source.12066: DFBPPR15731 ---- Microorganism protein ---- Protein SOM1, mitochondrial
Source.12067: DFBPPR15732 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 6, mitochondrial
Source.12068: DFBPPR15739 ---- Microorganism protein ---- Long chronological lifespan protein 2
Source.12069: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21
Source.12070: DFBPPR15741 ---- Microorganism protein ---- Increased recombination centers protein 19
Source.12071: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1
Source.12072: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8
Source.12073: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5
Source.12074: DFBPPR15750 ---- Microorganism protein ---- 60S ribosomal protein L24
Source.12075: DFBPPR15752 ---- Microorganism protein ---- Protein HRI1
Source.12076: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog
Source.12077: DFBPPR15754 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 24, mitochondrial
Source.12078: DFBPPR15756 ---- Microorganism protein ---- Inheritance of peroxisomes protein 1
Source.12079: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86
Source.12080: DFBPPR15760 ---- Microorganism protein ---- 40S ribosomal protein S16
Source.12081: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1
Source.12082: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6
Source.12083: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.12084: DFBPPR15769 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 11
Source.12085: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111
Source.12086: DFBPPR15771 ---- Microorganism protein ---- Required for respiratory growth protein 1, mitochondrial
Source.12087: DFBPPR15772 ---- Microorganism protein ---- Topoisomerase I damage affected protein 2
Source.12088: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1
Source.12089: DFBPPR15775 ---- Microorganism protein ---- Increased recombination centers protein 6
Source.12090: DFBPPR15785 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 7
Source.12091: DFBPPR15786 ---- Microorganism protein ---- Stationary phase protein 4
Source.12092: DFBPPR15787 ---- Microorganism protein ---- Required for respiratory growth protein 7, mitochondrial
Source.12093: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.12094: DFBPPR15793 ---- Microorganism protein ---- Uncharacterized protein KLLA0D02464g
Source.12095: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase
Source.12096: DFBPPR15796 ---- Microorganism protein ---- Folylpolyglutamate synthase
Source.12097: DFBPPR15797 ---- Microorganism protein ---- Dihydrofolate reductase
Source.12098: DFBPPR15798 ---- Microorganism protein ---- HPr kinase/phosphorylase
Source.12099: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.12100: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.12101: DFBPPR15803 ---- Microorganism protein ---- Galactokinase
Source.12102: DFBPPR15804 ---- Microorganism protein ---- Thymidylate synthase
Source.12103: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase
Source.12104: DFBPPR15807 ---- Microorganism protein ---- PTS system sorbose-specific EIIB component
Source.12105: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.12106: DFBPPR15809 ---- Microorganism protein ---- PTS system sorbose-specific EIIA component
Source.12107: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.12108: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.12109: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta
Source.12110: DFBPPR15813 ---- Microorganism protein ---- Anthranilate phosphoribosyltransferase
Source.12111: DFBPPR15814 ---- Microorganism protein ---- Amidophosphoribosyltransferase
Source.12112: DFBPPR15816 ---- Microorganism protein ---- Tyrosine recombinase XerD
Source.12113: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component
Source.12114: DFBPPR15818 ---- Microorganism protein ---- PTS system sorbose-specific EIID component
Source.12115: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.12116: DFBPPR15821 ---- Microorganism protein ---- Inosose dehydratase
Source.12117: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.12118: DFBPPR15823 ---- Microorganism protein ---- Tryptophan synthase alpha chain
Source.12119: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase
Source.12120: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase
Source.12121: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.12122: DFBPPR15827 ---- Microorganism protein ---- HTH-type transcriptional regulator GalR
Source.12123: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT
Source.12124: DFBPPR15830 ---- Microorganism protein ---- Indole-3-glycerol phosphate synthase
Source.12125: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.12126: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.12127: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.12128: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.12129: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase
Source.12130: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3
Source.12131: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase
Source.12132: DFBPPR15845 ---- Microorganism protein ---- Calmodulin
Source.12133: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2
Source.12134: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase
Source.12135: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.12136: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4
Source.12137: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.12138: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.12139: DFBPPR15856 ---- Microorganism protein ---- Laccase-2
Source.12140: DFBPPR15857 ---- Microorganism protein ---- Laccase-1
Source.12141: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase
Source.12142: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.12143: DFBPPR15865 ---- Microorganism protein ---- Hydrophobin-1
Source.12144: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase
Source.12145: DFBPPR15867 ---- Microorganism protein ---- Superoxide dismutase [Mn], mitochondrial
Source.12146: DFBPPR15868 ---- Microorganism protein ---- Thymidylate synthase
Source.12147: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.12148: DFBPPR15871 ---- Microorganism protein ---- Aldehyde dehydrogenase
Source.12149: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.12150: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.12151: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.12152: DFBPPR15882 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.12153: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1
Source.12154: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase
Source.12155: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1
Source.12156: DFBPPR0005 ---- Plant protein ---- Farnesyl pyrophosphate synthase 2
Source.12157: DFBPPR0006 ---- Plant protein ---- Beta-hexosaminidase
Source.12158: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.12159: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.12160: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.12161: DFBPPR0014 ---- Plant protein ---- Isoaspartyl peptidase/L-asparaginase
Source.12162: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4
Source.12163: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase
Source.12164: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase
Source.12165: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.12166: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.12167: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.12168: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.12169: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.12170: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.12171: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.12172: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.12173: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.12174: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.12175: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.12176: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B
Source.12177: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase
Source.12178: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.12179: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase
Source.12180: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.12181: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase
Source.12182: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.12183: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial
Source.12184: DFBPPR7781 ---- Plant protein ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.12185: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.12186: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.12187: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3
Source.12188: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase
Source.12189: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.12190: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.12191: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.12192: DFBPPR7794 ---- Plant protein ---- Cytochrome b6
Source.12193: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.12194: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.12195: DFBPPR7798 ---- Plant protein ---- ATP synthase subunit c, chloroplastic
Source.12196: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.12197: DFBPPR7801 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.12198: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.12199: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.12200: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.12201: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.12202: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2
Source.12203: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.12204: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.12205: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.12206: DFBPPR7812 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.12207: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.12208: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.12209: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.12210: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.12211: DFBPPR7822 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.12212: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.12213: DFBPPR7826 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-2
Source.12214: DFBPPR7827 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-1
Source.12215: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.12216: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.12217: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.12218: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.12219: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.12220: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.12221: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.12222: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.12223: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2
Source.12224: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.12225: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a
Source.12226: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.12227: DFBPPR7856 ---- Plant protein ---- Maturase K
Source.12228: DFBPPR7860 ---- Plant protein ---- CASP-like protein 1C1
Source.12229: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.12230: DFBPPR7866 ---- Plant protein ---- Photosystem II reaction center protein K
Source.12231: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1
Source.12232: DFBPPR7873 ---- Plant protein ---- Casparian strip membrane protein 4
Source.12233: DFBPPR7875 ---- Plant protein ---- CASP-like protein 4B1
Source.12234: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.12235: DFBPPR7879 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.12236: DFBPPR7881 ---- Plant protein ---- 50S ribosomal protein L20, chloroplastic
Source.12237: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1
Source.12238: DFBPPR7885 ---- Plant protein ---- Photosystem II reaction center protein M
Source.12239: DFBPPR7886 ---- Plant protein ---- Protein PsbN
Source.12240: DFBPPR7888 ---- Plant protein ---- Photosystem II reaction center protein Z
Source.12241: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1
Source.12242: DFBPPR7891 ---- Plant protein ---- CASP-like protein 1B1
Source.12243: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1
Source.12244: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1
Source.12245: DFBPPR7894 ---- Plant protein ---- CASP-like protein 2C2
Source.12246: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1
Source.12247: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1
Source.12248: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2
Source.12249: DFBPPR7908 ---- Plant protein ---- CASP-like protein 2U1
Source.12250: DFBPPR7909 ---- Plant protein ---- CASP-like protein 2D1
Source.12251: DFBPPR7910 ---- Plant protein ---- Glycine-rich RNA-binding protein 2
Source.12252: DFBPPR7911 ---- Plant protein ---- Glycine-rich RNA-binding protein 1
Source.12253: DFBPPR7912 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.12254: DFBPPR7913 ---- Plant protein ---- CASP-like protein 1U4
Source.12255: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.12256: DFBPPR7917 ---- Plant protein ---- CASP-like protein 4D1
Source.12257: DFBPPR7918 ---- Plant protein ---- CASP-like protein 1U1
Source.12258: DFBPPR7920 ---- Plant protein ---- Photosystem I assembly protein Ycf3
Source.12259: DFBPPR7924 ---- Plant protein ---- Kafirin PSKR2
Source.12260: DFBPPR7925 ---- Plant protein ---- Kafirin PGK1
Source.12261: DFBPPR7926 ---- Plant protein ---- Kafirin PSK8
Source.12262: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.12263: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.12264: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.12265: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.12266: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.12267: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.12268: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.12269: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.12270: DFBPPR7941 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial
Source.12271: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.12272: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1
Source.12273: DFBPPR7947 ---- Plant protein ---- Legumin type B
Source.12274: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.12275: DFBPPR7949 ---- Plant protein ---- Cytochrome f
Source.12276: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP
Source.12277: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.12278: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha
Source.12279: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1
Source.12280: DFBPPR7956 ---- Plant protein ---- Legumin type B
Source.12281: DFBPPR7957 ---- Plant protein ---- Legumin type B
Source.12282: DFBPPR7958 ---- Plant protein ---- Legumin type B
Source.12283: DFBPPR7960 ---- Plant protein ---- Vicilin
Source.12284: DFBPPR7963 ---- Plant protein ---- Leghemoglobin 29
Source.12285: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.12286: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1
Source.12287: DFBPPR7966 ---- Plant protein ---- GTP-binding nuclear protein Ran/TC4
Source.12288: DFBPPR7967 ---- Plant protein ---- Plastocyanin
Source.12289: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92
Source.12290: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87
Source.12291: DFBPPR7973 ---- Plant protein ---- Maturase K
Source.12292: DFBPPR7977 ---- Plant protein ---- Ribosomal protein S14, mitochondrial
Source.12293: DFBPPR7978 ---- Plant protein ---- 50S ribosomal protein L32, chloroplastic
Source.12294: DFBPPR7981 ---- Plant protein ---- HMG1/2-like protein
Source.12295: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1
Source.12296: DFBPPR7983 ---- Plant protein ---- 14-3-3-like protein B
Source.12297: DFBPPR7984 ---- Plant protein ---- 14-3-3-like protein A
Source.12298: DFBPPR7987 ---- Plant protein ---- Antifungal protein ginkbilobin-2
Source.12299: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.12300: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.12301: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.12302: DFBPPR7994 ---- Plant protein ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic
Source.12303: DFBPPR7998 ---- Plant protein ---- Antifungal protein ginkbilobin-1
Source.12304: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1
Source.12305: DFBPPR8000 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.12306: DFBPPR8002 ---- Plant protein ---- Plastocyanin
Source.12307: DFBPPR8006 ---- Plant protein ---- Protein PsbN
Source.12308: DFBPPR8007 ---- Plant protein ---- Maturase K
Source.12309: DFBPPR8008 ---- Plant protein ---- CASP-like protein 5A2
Source.12310: DFBPPR8009 ---- Plant protein ---- CASP-like protein 5B1
Source.12311: DFBPPR8012 ---- Plant protein ---- CASP-like protein 5A1
Source.12312: DFBPPR8013 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.12313: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.12314: DFBPPR8028 ---- Plant protein ---- Polygalacturonase inhibitor 2
Source.12315: DFBPPR8029 ---- Plant protein ---- Vignain
Source.12316: DFBPPR8030 ---- Plant protein ---- Arcelin-5A
Source.12317: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.12318: DFBPPR8032 ---- Plant protein ---- Alpha-amylase inhibitor 1
Source.12319: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.12320: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.12321: DFBPPR8037 ---- Plant protein ---- Arcelin-1
Source.12322: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.12323: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.12324: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.12325: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.12326: DFBPPR8045 ---- Plant protein ---- Polygalacturonase inhibitor 1
Source.12327: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.12328: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.12329: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.12330: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.12331: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.12332: DFBPPR8054 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin
Source.12333: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.12334: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha
Source.12335: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.12336: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.12337: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2
Source.12338: DFBPPR8062 ---- Plant protein ---- Polygalacturonase inhibitor 3
Source.12339: DFBPPR8063 ---- Plant protein ---- Leghemoglobin A
Source.12340: DFBPPR8064 ---- Plant protein ---- Endochitinase PR4
Source.12341: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.12342: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3
Source.12343: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.12344: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.12345: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.12346: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.12347: DFBPPR8073 ---- Plant protein ---- Arcelin-5B
Source.12348: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.12349: DFBPPR8077 ---- Plant protein ---- ATP synthase subunit c, chloroplastic
Source.12350: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1
Source.12351: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme
Source.12352: DFBPPR8080 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.12353: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1
Source.12354: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.12355: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase
Source.12356: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.12357: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.12358: DFBPPR8087 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.12359: DFBPPR8091 ---- Plant protein ---- Cytochrome f
Source.12360: DFBPPR8092 ---- Plant protein ---- Alpha-amylase inhibitor 2
Source.12361: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.12362: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1
Source.12363: DFBPPR8096 ---- Plant protein ---- Erythroagglutinating phytohemagglutinin
Source.12364: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.12365: DFBPPR8098 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.12366: DFBPPR8099 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.12367: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.12368: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.12369: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.12370: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.12371: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.12372: DFBPPR8110 ---- Plant protein ---- Leghemoglobin
Source.12373: DFBPPR8114 ---- Plant protein ---- Arcelin-2
Source.12374: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.12375: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.12376: DFBPPR8119 ---- Plant protein ---- Chalcone--flavonone isomerase
Source.12377: DFBPPR8122 ---- Plant protein ---- Arcelin-4
Source.12378: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.12379: DFBPPR8125 ---- Plant protein ---- Eukaryotic translation initiation factor 5
Source.12380: DFBPPR8127 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.12381: DFBPPR8139 ---- Plant protein ---- Photosystem II reaction center protein M
Source.12382: DFBPPR8142 ---- Plant protein ---- Protein PsbN
Source.12383: DFBPPR8146 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.12384: DFBPPR8154 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.12385: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.12386: DFBPPR8159 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.12387: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial
Source.12388: DFBPPR8163 ---- Plant protein ---- Photosystem I assembly protein Ycf3
Source.12389: DFBPPR8165 ---- Plant protein ---- 50S ribosomal protein L32, chloroplastic
Source.12390: DFBPPR8167 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin
Source.12391: DFBPPR8170 ---- Plant protein ---- Putative alpha-amylase inhibitor
Source.12392: DFBPPR8212 ---- Plant protein ---- Trypsin inhibitor 1
Source.12393: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.12394: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase
Source.12395: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.12396: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase
Source.12397: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase
Source.12398: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase
Source.12399: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.12400: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1
Source.12401: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.12402: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.12403: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.12404: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.12405: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase
Source.12406: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.12407: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.12408: DFBPPR8232 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial
Source.12409: DFBPPR8235 ---- Plant protein ---- Catalase
Source.12410: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.12411: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.12412: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.12413: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.12414: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3
Source.12415: DFBPPR8244 ---- Plant protein ---- ATP synthase subunit c, chloroplastic
Source.12416: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.12417: DFBPPR8247 ---- Plant protein ---- Nucleoside diphosphate kinase
Source.12418: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.12419: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.12420: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.12421: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.12422: DFBPPR8252 ---- Plant protein ---- NADH-ubiquinone oxidoreductase chain 3
Source.12423: DFBPPR8255 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.12424: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.12425: DFBPPR8264 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.12426: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.12427: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.12428: DFBPPR8271 ---- Plant protein ---- Cytochrome b6
Source.12429: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.12430: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.12431: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.12432: DFBPPR8279 ---- Plant protein ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.12433: DFBPPR8281 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.12434: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.12435: DFBPPR8284 ---- Plant protein ---- Calmodulin
Source.12436: DFBPPR8285 ---- Plant protein ---- 26S proteasome regulatory subunit 6B homolog
Source.12437: DFBPPR8291 ---- Plant protein ---- 2S seed storage protein
Source.12438: DFBPPR8295 ---- Plant protein ---- Probable phospholipid hydroperoxide glutathione peroxidase
Source.12439: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.12440: DFBPPR8301 ---- Plant protein ---- Photosystem II reaction center protein K
Source.12441: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5
Source.12442: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.12443: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3
Source.12444: DFBPPR8314 ---- Plant protein ---- Maturase K
Source.12445: DFBPPR8315 ---- Plant protein ---- Photosystem II reaction center protein M
Source.12446: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.12447: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1
Source.12448: DFBPPR8321 ---- Plant protein ---- Protein PsbN
Source.12449: DFBPPR8324 ---- Plant protein ---- Photosystem II reaction center protein Z
Source.12450: DFBPPR8332 ---- Plant protein ---- Glutathione peroxidase 1
Source.12451: DFBPPR8343 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.12452: DFBPPR8344 ---- Plant protein ---- Cytochrome c oxidase subunit 5C-1
Source.12453: DFBPPR8345 ---- Plant protein ---- Cytochrome c oxidase subunit 5C-2
Source.12454: DFBPPR8349 ---- Plant protein ---- Photosystem I assembly protein Ycf3
Source.12455: DFBPPR8355 ---- Plant protein ---- 14-3-3-like protein
Link-research
Link 1: DFBPACEI1232----Soybean and Wheat----Soy sauce
Link 2: DFBPACEI1360----Wheat----Wheat germ hydrolysates
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide exhibited Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 165.3 μM (or 190 μM [1]).

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O
Preparation method
Mode of preparation Fermentation
Enzyme(s)/starter culture Fermented with Aspergillus oryzae fermentation of soybean in the absence of salt.
Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
BIOPEP-UWM [D1] 7583, 8759
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Zhu XL, Watanabe K, Shiraishi K, Ueki T, Noda Y, Matsui T, Matsumoto K. Identification of ACE-inhibitory peptides in salt-free soy sauce that are transportable across caco-2 cell monolayers. Peptides. 2008 Mar;29(3):338-44.
PMID: 18160180
Other literature(s)

[1] Cheung, H.S., et al., Binding of peptide substrates and inhibitors of angiotensin-converting enzyme. Importance of the COOH-terminal dipeptide sequence. J Biol Chem, 1980. 255(2): p. 401-7.

PubDate 2008
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214