Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI0131(ACE-inhibitory peptide)

DFBP ID	DFBPACEI0131
Peptide sequence	AGS
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Ala-Gly-Ser

Single-letter amino acid

AGS

Peptide length

Peptide mass

Experimental mass	Theoretical mass
234 Da	233.22 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

0.13 ± 0.03 mg/mL

pIC₅₀

0.886

GRAVY

0.2000^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal, Marine, Fish
Organism/Source	Smooth hound (Mustelus mustelus)
Precursor protein	Muscle protein hydrolysates
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1 Source.2: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2 Source.3: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25 Source.4: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4 Source.5: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9 Source.6: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.7: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6 Source.8: DFBPPR0840 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 2 Source.9: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14 Source.10: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.11: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2 Source.12: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.13: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.14: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4 Source.15: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase Source.16: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q Source.17: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.18: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1 Source.19: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11 Source.20: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.21: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A Source.22: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog Source.23: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.24: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2 Source.25: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.26: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic Source.27: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.28: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1 Source.29: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.30: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10 Source.31: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1 Source.32: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic Source.33: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.34: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1 Source.35: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5 Source.36: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3 Source.37: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog Source.38: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC Source.39: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.40: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1 Source.41: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1 Source.42: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda Source.43: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1 Source.44: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1 Source.45: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2 Source.46: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1 Source.47: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.48: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.49: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic Source.50: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.51: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2 Source.52: DFBPPR1024 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK4 Source.53: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1 Source.54: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1 Source.55: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.56: DFBPPR1034 ---- Plant proteins ---- bZIP transcription factor 50 Source.57: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1 Source.58: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3 Source.59: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase Source.60: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.61: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial Source.62: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62 Source.63: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2 Source.64: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A Source.65: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1 Source.66: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic Source.67: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7 Source.68: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.69: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL Source.70: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1 Source.71: DFBPPR1097 ---- Plant proteins ---- Thioredoxin M5, chloroplastic Source.72: DFBPPR1103 ---- Plant proteins ---- Villin-2 Source.73: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10 Source.74: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic Source.75: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic Source.76: DFBPPR1116 ---- Plant proteins ---- Polycomb group protein EMF2B Source.77: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.78: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.79: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform Source.80: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1 Source.81: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A Source.82: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.83: DFBPPR1153 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein A Source.84: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.85: DFBPPR1167 ---- Plant proteins ---- Phototropin-2 Source.86: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2 Source.87: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30 Source.88: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.89: DFBPPR1208 ---- Plant proteins ---- RNA polymerase sigma factor sigA Source.90: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2 Source.91: DFBPPR1223 ---- Plant proteins ---- Elicitor-responsive protein 1 Source.92: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic Source.93: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1 Source.94: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28 Source.95: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.96: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.97: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3 Source.98: DFBPPR1257 ---- Plant proteins ---- Transcription factor MYB2 Source.99: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1 Source.100: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.101: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2 Source.102: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase Source.103: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1 Source.104: DFBPPR1281 ---- Plant proteins ---- Arsenate reductase 2.2 Source.105: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D Source.106: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39 Source.107: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic Source.108: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.109: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A Source.110: DFBPPR1311 ---- Plant proteins ---- Synaptonemal complex protein ZEP1 Source.111: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic Source.112: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic Source.113: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14 Source.114: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.115: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.116: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.117: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1 Source.118: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.119: DFBPPR1358 ---- Plant proteins ---- Fructose-bisphosphate aldolase, chloroplastic Source.120: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.121: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F Source.122: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.123: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2 Source.124: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5 Source.125: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic Source.126: DFBPPR1396 ---- Plant proteins ---- Peroxidase 2 Source.127: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.128: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.129: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5 Source.130: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2 Source.131: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.132: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1 Source.133: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2 Source.134: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.135: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.136: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B Source.137: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.138: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156 Source.139: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic Source.140: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3 Source.141: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1 Source.142: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic Source.143: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37 Source.144: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2 Source.145: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.146: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming] Source.147: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.148: DFBPPR1464 ---- Plant proteins ---- Remorin 4.1 Source.149: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1 Source.150: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic Source.151: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase Source.152: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A Source.153: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3 Source.154: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1 Source.155: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2 Source.156: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.157: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4 Source.158: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.159: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial Source.160: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.161: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d Source.162: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15 Source.163: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5 Source.164: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1 Source.165: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3 Source.166: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.167: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.168: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3 Source.169: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.170: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial Source.171: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15 Source.172: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2 Source.173: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.174: DFBPPR1580 ---- Plant proteins ---- Expansin-A4 Source.175: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2 Source.176: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.177: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1 Source.178: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11 Source.179: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.180: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.181: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.182: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.183: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.184: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial Source.185: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.186: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic Source.187: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.188: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.189: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3 Source.190: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.191: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C Source.192: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C Source.193: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.194: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1 Source.195: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A Source.196: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.197: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4 Source.198: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.199: DFBPPR1687 ---- Plant proteins ---- Transcription factor ILI1 Source.200: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.201: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase Source.202: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.203: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic Source.204: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4 Source.205: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.206: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1 Source.207: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic Source.208: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.209: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic Source.210: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2 Source.211: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2 Source.212: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a Source.213: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.214: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial Source.215: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b Source.216: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial Source.217: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1 Source.218: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.219: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.220: DFBPPR1807 ---- Plant proteins ---- Two-component response regulator ORR1 Source.221: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.222: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1 Source.223: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase Source.224: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic Source.225: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.226: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1 Source.227: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic Source.228: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic Source.229: DFBPPR1854 ---- Plant proteins ---- Ferredoxin-1, chloroplastic Source.230: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b Source.231: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A Source.232: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c Source.233: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8 Source.234: DFBPPR1881 ---- Plant proteins ---- Protein TIFY 11d Source.235: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog Source.236: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3 Source.237: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.238: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic Source.239: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.240: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.241: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A Source.242: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.243: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7 Source.244: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2 Source.245: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1 Source.246: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase Source.247: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial Source.248: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.249: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase Source.250: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.251: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.252: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2 Source.253: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.254: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.255: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4 Source.256: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.257: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1 Source.258: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.259: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.260: DFBPPR2013 ---- Plant proteins ---- Laccase-6 Source.261: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1 Source.262: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9 Source.263: DFBPPR2028 ---- Plant proteins ---- Laccase-7 Source.264: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5 Source.265: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B Source.266: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2 Source.267: DFBPPR2048 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ23 Source.268: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19 Source.269: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5 Source.270: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10 Source.271: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176 Source.272: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.273: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C Source.274: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.275: DFBPPR2081 ---- Plant proteins ---- Expansin-A1 Source.276: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic Source.277: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.278: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1 Source.279: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5 Source.280: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.281: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein Source.282: DFBPPR2100 ---- Plant proteins ---- Germin-like protein 1-1 Source.283: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 Source.284: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1 Source.285: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45 Source.286: DFBPPR2122 ---- Plant proteins ---- FAD-linked sulfhydryl oxidase ERV1 Source.287: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C Source.288: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic Source.289: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain Source.290: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.291: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2 Source.292: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic Source.293: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic Source.294: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2 Source.295: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.296: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.297: DFBPPR2176 ---- Plant proteins ---- Expansin-B11 Source.298: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2 Source.299: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase Source.300: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5 Source.301: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37 Source.302: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1 Source.303: DFBPPR2223 ---- Plant proteins ---- Urease Source.304: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.305: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12 Source.306: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial Source.307: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.308: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.309: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6 Source.310: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.311: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3 Source.312: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8 Source.313: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.314: DFBPPR2286 ---- Plant proteins ---- Proteasome subunit alpha type-4-1 Source.315: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14 Source.316: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic Source.317: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7 Source.318: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA Source.319: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase Source.320: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.321: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain Source.322: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2 Source.323: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic Source.324: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3 Source.325: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic Source.326: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b Source.327: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.328: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2 Source.329: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic Source.330: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.331: DFBPPR2353 ---- Plant proteins ---- Expansin-B12 Source.332: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic Source.333: DFBPPR2356 ---- Plant proteins ---- Ubiquitin-like protein-NEDD8-like protein RUB3 Source.334: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB Source.335: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic Source.336: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6 Source.337: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.338: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23 Source.339: DFBPPR2390 ---- Plant proteins ---- Proteasome subunit alpha type-4-2 Source.340: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5 Source.341: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C Source.342: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.343: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B Source.344: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.345: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73 Source.346: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33 Source.347: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic Source.348: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16 Source.349: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A Source.350: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1 Source.351: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase Source.352: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS Source.353: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.354: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6 Source.355: DFBPPR2448 ---- Plant proteins ---- Expansin-A9 Source.356: DFBPPR2457 ---- Plant proteins ---- Proteasome subunit alpha type-4-3 Source.357: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2 Source.358: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1 Source.359: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 Source.360: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.361: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5 Source.362: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900 Source.363: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13 Source.364: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5 Source.365: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1 Source.366: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9 Source.367: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.368: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4 Source.369: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300 Source.370: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c Source.371: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.372: DFBPPR2544 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.373: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1 Source.374: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial Source.375: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.376: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.377: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4 Source.378: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.379: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4 Source.380: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B Source.381: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic Source.382: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9 Source.383: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5 Source.384: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10 Source.385: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.386: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2 Source.387: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4 Source.388: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.389: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b Source.390: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2 Source.391: DFBPPR2653 ---- Plant proteins ---- Putative germin-like protein 12-4 Source.392: DFBPPR2656 ---- Plant proteins ---- Expansin-A15 Source.393: DFBPPR2662 ---- Plant proteins ---- Putative germin-like protein 12-3 Source.394: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8 Source.395: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33 Source.396: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1 Source.397: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein Source.398: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1 Source.399: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase Source.400: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.401: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A Source.402: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16 Source.403: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H Source.404: DFBPPR2712 ---- Plant proteins ---- Expansin-A20 Source.405: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1 Source.406: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.407: DFBPPR2721 ---- Plant proteins ---- Expansin-A18 Source.408: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic Source.409: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit Source.410: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic Source.411: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5 Source.412: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.413: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.414: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.415: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7 Source.416: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25 Source.417: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.418: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3 Source.419: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.420: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA Source.421: DFBPPR2788 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.422: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A Source.423: DFBPPR2796 ---- Plant proteins ---- Protein TIFY 11c Source.424: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.425: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.426: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like Source.427: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a Source.428: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10 Source.429: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.430: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23 Source.431: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2 Source.432: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6 Source.433: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.434: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.435: DFBPPR2851 ---- Plant proteins ---- Non-specific lipid-transfer protein 2B Source.436: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9 Source.437: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53 Source.438: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11 Source.439: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2 Source.440: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.441: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A Source.442: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.443: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2 Source.444: DFBPPR2884 ---- Plant proteins ---- Expansin-B2 Source.445: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1 Source.446: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32 Source.447: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic Source.448: DFBPPR2898 ---- Plant proteins ---- Germin-like protein 12-1 Source.449: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7 Source.450: DFBPPR2900 ---- Plant proteins ---- Expansin-A23 Source.451: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB Source.452: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2 Source.453: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2 Source.454: DFBPPR2910 ---- Plant proteins ---- Expansin-B5 Source.455: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2 Source.456: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.457: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14 Source.458: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1 Source.459: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13 Source.460: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A Source.461: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1 Source.462: DFBPPR2942 ---- Plant proteins ---- Germin-like protein 12-2 Source.463: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27 Source.464: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.465: DFBPPR2948 ---- Plant proteins ---- Expansin-A25 Source.466: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.467: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.468: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2 Source.469: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1 Source.470: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7 Source.471: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3 Source.472: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.473: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19 Source.474: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23 Source.475: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13 Source.476: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like Source.477: DFBPPR3006 ---- Plant proteins ---- 3'(2'),5'-bisphosphate nucleotidase Source.478: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1 Source.479: DFBPPR3015 ---- Plant proteins ---- Expansin-A13 Source.480: DFBPPR3016 ---- Plant proteins ---- Expansin-A29 Source.481: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31 Source.482: DFBPPR3027 ---- Plant proteins ---- Expansin-A31 Source.483: DFBPPR3028 ---- Plant proteins ---- Expansin-A19 Source.484: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15 Source.485: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3 Source.486: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3 Source.487: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1 Source.488: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24 Source.489: DFBPPR3047 ---- Plant proteins ---- Zinc finger protein 36 Source.490: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17 Source.491: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H Source.492: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.493: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2 Source.494: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7 Source.495: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase Source.496: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.497: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E Source.498: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12 Source.499: DFBPPR3102 ---- Plant proteins ---- Expansin-B18 Source.500: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21 Source.501: DFBPPR3106 ---- Plant proteins ---- Protein HIRA Source.502: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28 Source.503: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7 Source.504: DFBPPR3133 ---- Plant proteins ---- Double-stranded RNA-binding protein 8 Source.505: DFBPPR3135 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 1 Source.506: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1 Source.507: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic Source.508: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.509: DFBPPR3148 ---- Plant proteins ---- Growth-regulating factor 8 Source.510: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3 Source.511: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11 Source.512: DFBPPR3166 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.513: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic Source.514: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I Source.515: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1 Source.516: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32 Source.517: DFBPPR3191 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial Source.518: DFBPPR3198 ---- Plant proteins ---- Probable protein phosphatase 2C 59 Source.519: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3 Source.520: DFBPPR3206 ---- Plant proteins ---- Expansin-B15 Source.521: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B Source.522: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2 Source.523: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A Source.524: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic Source.525: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3 Source.526: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.527: DFBPPR3232 ---- Plant proteins ---- Expansin-A28 Source.528: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1 Source.529: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic Source.530: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2 Source.531: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic Source.532: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.533: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B Source.534: DFBPPR3246 ---- Plant proteins ---- Probable histone H2A.7 Source.535: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10 Source.536: DFBPPR3257 ---- Plant proteins ---- Ras-related protein RIC2 Source.537: DFBPPR3260 ---- Plant proteins ---- Probable histone H2A.1 Source.538: DFBPPR3263 ---- Plant proteins ---- N-carbamoylputrescine amidase Source.539: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18 Source.540: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.541: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein Source.542: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18 Source.543: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1 Source.544: DFBPPR3294 ---- Plant proteins ---- Probable histone H2A.3 Source.545: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4 Source.546: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2 Source.547: DFBPPR3311 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 2 Source.548: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13 Source.549: DFBPPR3335 ---- Plant proteins ---- Molybdopterin synthase sulfur carrier subunit Source.550: DFBPPR3336 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic Source.551: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2 Source.552: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase Source.553: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68 Source.554: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22 Source.555: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.556: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2 Source.557: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic Source.558: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R Source.559: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28 Source.560: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6 Source.561: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.562: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2 Source.563: DFBPPR3393 ---- Plant proteins ---- Auxin-responsive protein IAA20 Source.564: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.565: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16 Source.566: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5 Source.567: DFBPPR3417 ---- Plant proteins ---- Protein CutA 1, chloroplastic Source.568: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12 Source.569: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10 Source.570: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1 Source.571: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic Source.572: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49 Source.573: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2 Source.574: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial Source.575: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2 Source.576: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.577: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7 Source.578: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14 Source.579: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1 Source.580: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic Source.581: DFBPPR3485 ---- Plant proteins ---- Auxin-responsive protein IAA31 Source.582: DFBPPR3494 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS32 Source.583: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.584: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N Source.585: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.586: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14 Source.587: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic Source.588: DFBPPR3518 ---- Plant proteins ---- Thioredoxin-like 3-3 Source.589: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56 Source.590: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36 Source.591: DFBPPR3535 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.592: DFBPPR3538 ---- Plant proteins ---- Probable protein phosphatase 2C 7 Source.593: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5 Source.594: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3 Source.595: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2 Source.596: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33 Source.597: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60 Source.598: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600 Source.599: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36 Source.600: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65 Source.601: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8 Source.602: DFBPPR3573 ---- Plant proteins ---- Protein TIFY 5 Source.603: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76 Source.604: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.605: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19 Source.606: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.607: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2 Source.608: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.609: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog Source.610: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3 Source.611: DFBPPR3619 ---- Plant proteins ---- Cyclin-D3-1 Source.612: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L Source.613: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K Source.614: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.615: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2 Source.616: DFBPPR3640 ---- Plant proteins ---- Dof zinc finger protein 1 Source.617: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic Source.618: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic Source.619: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5 Source.620: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C Source.621: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3 Source.622: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J Source.623: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.624: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F Source.625: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14 Source.626: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3 Source.627: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.628: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1 Source.629: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1 Source.630: DFBPPR3713 ---- Plant proteins ---- Probable NADH kinase Source.631: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G Source.632: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3 Source.633: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic Source.634: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64 Source.635: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4 Source.636: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12 Source.637: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71 Source.638: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog Source.639: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.640: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A Source.641: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G Source.642: DFBPPR3782 ---- Plant proteins ---- Auxin-responsive protein IAA16 Source.643: DFBPPR3783 ---- Plant proteins ---- Patatin-like protein 2 Source.644: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D Source.645: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77 Source.646: DFBPPR3798 ---- Plant proteins ---- Actin-related protein 7 Source.647: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.648: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic Source.649: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B Source.650: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6 Source.651: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.652: DFBPPR3810 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.653: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B Source.654: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1 Source.655: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G Source.656: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4 Source.657: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22 Source.658: DFBPPR3834 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS35 Source.659: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C Source.660: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7 Source.661: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29 Source.662: DFBPPR3861 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.663: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1 Source.664: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2 Source.665: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.666: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31 Source.667: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.668: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20 Source.669: DFBPPR3901 ---- Plant proteins ---- Growth-regulating factor 9 Source.670: DFBPPR3902 ---- Plant proteins ---- Probable serine acetyltransferase 5 Source.671: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5 Source.672: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7 Source.673: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.674: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4 Source.675: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.676: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1 Source.677: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2 Source.678: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.679: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2 Source.680: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2 Source.681: DFBPPR3961 ---- Plant proteins ---- Zinc-finger homeodomain protein 8 Source.682: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7 Source.683: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.684: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9 Source.685: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.686: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.687: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J Source.688: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A Source.689: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6 Source.690: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9 Source.691: DFBPPR4005 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.692: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6 Source.693: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic Source.694: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3 Source.695: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4 Source.696: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1 Source.697: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19 Source.698: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein Source.699: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog Source.700: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8 Source.701: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9 Source.702: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase Source.703: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.704: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1 Source.705: DFBPPR4057 ---- Plant proteins ---- Non-specific lipid-transfer protein 2A Source.706: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic Source.707: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.708: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1 Source.709: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D Source.710: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6 Source.711: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.712: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3 Source.713: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8 Source.714: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5 Source.715: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic Source.716: DFBPPR4098 ---- Plant proteins ---- ESCRT-related protein CHMP1 Source.717: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2 Source.718: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95 Source.719: DFBPPR4137 ---- Plant proteins ---- Casparian strip membrane protein 7 Source.720: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2 Source.721: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.722: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.723: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1 Source.724: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H Source.725: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c Source.726: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3 Source.727: DFBPPR4171 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 4 Source.728: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4 Source.729: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16 Source.730: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1 Source.731: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18 Source.732: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1 Source.733: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1 Source.734: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2 Source.735: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22 Source.736: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic Source.737: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4 Source.738: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic Source.739: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1 Source.740: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.741: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.742: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3 Source.743: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1 Source.744: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4 Source.745: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2 Source.746: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D Source.747: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4 Source.748: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.749: DFBPPR4293 ---- Plant proteins ---- Double-stranded RNA-binding protein 7 Source.750: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5 Source.751: DFBPPR4297 ---- Plant proteins ---- Protein translation factor SUI1 homolog Source.752: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10 Source.753: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17 Source.754: DFBPPR4304 ---- Plant proteins ---- Signal recognition particle 14 kDa protein Source.755: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28 Source.756: DFBPPR4318 ---- Plant proteins ---- Golgin-84 Source.757: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11 Source.758: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.759: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.760: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic Source.761: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4 Source.762: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.763: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6 Source.764: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog Source.765: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2 Source.766: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5 Source.767: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7 Source.768: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9 Source.769: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2 Source.770: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.771: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4 Source.772: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.773: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5 Source.774: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.775: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.776: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.777: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic Source.778: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.779: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.780: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.781: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24 Source.782: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1 Source.783: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.784: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.785: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2 Source.786: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog Source.787: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1 Source.788: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.789: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3 Source.790: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63 Source.791: DFBPPR4532 ---- Plant proteins ---- CASP-like protein 1U2 Source.792: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A Source.793: DFBPPR4539 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 3 Source.794: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59 Source.795: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12 Source.796: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3 Source.797: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7 Source.798: DFBPPR4565 ---- Plant proteins ---- CASP-like protein 5B1 Source.799: DFBPPR4566 ---- Plant proteins ---- CASP-like protein 5C1 Source.800: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3 Source.801: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1 Source.802: DFBPPR4570 ---- Plant proteins ---- CASP-like protein 2C1 Source.803: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32 Source.804: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13 Source.805: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2 Source.806: DFBPPR4628 ---- Plant proteins ---- Probable inactive carboxylesterase Os04g0669700 Source.807: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1 Source.808: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700 Source.809: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12 Source.810: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2 Source.811: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic Source.812: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62 Source.813: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1 Source.814: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3 Source.815: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic Source.816: DFBPPR4691 ---- Plant proteins ---- Probable protein ABIL3 Source.817: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B Source.818: DFBPPR4701 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 15 Source.819: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17 Source.820: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.821: DFBPPR4723 ---- Plant proteins ---- Zinc finger A20 domain-containing stress-associated protein 18 Source.822: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19 Source.823: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.824: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1 Source.825: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11 Source.826: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8 Source.827: DFBPPR4758 ---- Plant proteins ---- BURP domain-containing protein 7 Source.828: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31 Source.829: DFBPPR4791 ---- Plant proteins ---- B3 domain-containing protein Os02g0683500 Source.830: DFBPPR4793 ---- Plant proteins ---- B3 domain-containing protein LOC_Os02g10420 Source.831: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200 Source.832: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000 Source.833: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100 Source.834: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55 Source.835: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b Source.836: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500 Source.837: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6 Source.838: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36 Source.839: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56 Source.840: DFBPPR4844 ---- Plant proteins ---- B3 domain-containing protein Os05g0481400 Source.841: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800 Source.842: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600 Source.843: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37 Source.844: DFBPPR4864 ---- Plant proteins ---- Putative B3 domain-containing protein Os11g0625400 Source.845: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog Source.846: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1 Source.847: DFBPPR4871 ---- Plant proteins ---- Putative B3 domain-containing protein Os11g0242900 Source.848: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500 Source.849: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48 Source.850: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4 Source.851: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.852: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5 Source.853: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10 Source.854: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic Source.855: DFBPPR4930 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic Source.856: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7 Source.857: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1 Source.858: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.859: DFBPPR4965 ---- Plant proteins ---- Glycinin G1 Source.860: DFBPPR4973 ---- Plant proteins ---- Glycinin G2 Source.861: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.862: DFBPPR4983 ---- Plant proteins ---- Protein SRC2 Source.863: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.864: DFBPPR4992 ---- Plant proteins ---- Glycinin G3 Source.865: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.866: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic Source.867: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.868: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.869: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1 Source.870: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform Source.871: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform Source.872: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic Source.873: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2 Source.874: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.875: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase Source.876: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2 Source.877: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.878: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.879: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.880: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.881: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1 Source.882: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic Source.883: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.884: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.885: DFBPPR5194 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.886: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.887: DFBPPR5205 ---- Plant proteins ---- Urease Source.888: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic Source.889: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.890: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.891: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase Source.892: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic Source.893: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme Source.894: DFBPPR5243 ---- Plant proteins ---- 50S ribosomal protein L2-A, chloroplastic Source.895: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70 Source.896: DFBPPR5257 ---- Plant proteins ---- 50S ribosomal protein L2-B, chloroplastic Source.897: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8 Source.898: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.899: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2 Source.900: DFBPPR5308 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein Source.901: DFBPPR5344 ---- Plant proteins ---- Nodulin-16 Source.902: DFBPPR5351 ---- Plant proteins ---- 40S ribosomal protein S11 Source.903: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic Source.904: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1 Source.905: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase Source.906: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.907: DFBPPR5393 ---- Plant proteins ---- Endochitinase A Source.908: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8 Source.909: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.910: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3 Source.911: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.912: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.913: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.914: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic Source.915: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase Source.916: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein Source.917: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase Source.918: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.919: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit Source.920: DFBPPR5435 ---- Plant proteins ---- Ferredoxin-1, chloroplastic Source.921: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8 Source.922: DFBPPR5443 ---- Plant proteins ---- Protein BUNDLE SHEATH DEFECTIVE 2, chloroplastic Source.923: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.924: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic Source.925: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2 Source.926: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.927: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.928: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic Source.929: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.930: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic Source.931: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.932: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8 Source.933: DFBPPR5497 ---- Plant proteins ---- Peroxidase 66 Source.934: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.935: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase Source.936: DFBPPR5518 ---- Plant proteins ---- Ferredoxin-2, chloroplastic Source.937: DFBPPR5520 ---- Plant proteins ---- Photosystem II reaction center protein H Source.938: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.939: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.940: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3 Source.941: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic Source.942: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1 Source.943: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic Source.944: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic Source.945: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase Source.946: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.947: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.948: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic Source.949: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3 Source.950: DFBPPR5601 ---- Plant proteins ---- Protein HIRA Source.951: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase Source.952: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.953: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW Source.954: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.955: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1 Source.956: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.957: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.958: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase Source.959: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.960: DFBPPR5642 ---- Plant proteins ---- Zeamatin Source.961: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2 Source.962: DFBPPR5670 ---- Plant proteins ---- Endochitinase B Source.963: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.964: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic Source.965: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.966: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.967: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic Source.968: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.969: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.970: DFBPPR5747 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.971: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1 Source.972: DFBPPR5761 ---- Plant proteins ---- Ferredoxin-6, chloroplastic Source.973: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.974: DFBPPR5769 ---- Plant proteins ---- Ferredoxin-5, chloroplastic Source.975: DFBPPR5772 ---- Plant proteins ---- Eukaryotic translation initiation factor 4E-1 Source.976: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele Source.977: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic Source.978: DFBPPR5796 ---- Plant proteins ---- Shugoshin-1 Source.979: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.980: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.981: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6 Source.982: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.983: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19 Source.984: DFBPPR5853 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.985: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.986: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.987: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein Source.988: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.989: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1 Source.990: DFBPPR5887 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.991: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1 Source.992: DFBPPR5899 ---- Plant proteins ---- Ras-related protein Rab-2-B Source.993: DFBPPR5901 ---- Plant proteins ---- GTP-binding protein YPTM1 Source.994: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.995: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3 Source.996: DFBPPR5906 ---- Plant proteins ---- Ras-related protein Rab-2-A Source.997: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein Source.998: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2 Source.999: DFBPPR5922 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.1000: DFBPPR5925 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic Source.1001: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2 Source.1002: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1003: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A Source.1004: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1 Source.1005: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2 Source.1006: DFBPPR5962 ---- Plant proteins ---- Protein RIK Source.1007: DFBPPR5980 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.1008: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1 Source.1009: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2 Source.1010: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1 Source.1011: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2 Source.1012: DFBPPR6009 ---- Plant proteins ---- CASP-like protein 5C1 Source.1013: DFBPPR6047 ---- Plant proteins ---- CASP-like protein 1D1 Source.1014: DFBPPR6051 ---- Plant proteins ---- CASP-like protein 2C2 Source.1015: DFBPPR6066 ---- Plant proteins ---- Protein translation factor SUI1 homolog Source.1016: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2 Source.1017: DFBPPR6075 ---- Plant proteins ---- MFS18 protein Source.1018: DFBPPR6086 ---- Plant proteins ---- Cell number regulator 5 Source.1019: DFBPPR6102 ---- Plant proteins ---- CASP-like protein 2C3 Source.1020: DFBPPR6109 ---- Plant proteins ---- CASP-like protein 2C1 Source.1021: DFBPPR6120 ---- Plant proteins ---- 40S ribosomal protein S11 Source.1022: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein Source.1023: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5 Source.1024: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.1025: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.1026: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic Source.1027: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.1028: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic Source.1029: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic Source.1030: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.1031: DFBPPR6249 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.1032: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial Source.1033: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase Source.1034: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96 Source.1035: DFBPPR6275 ---- Plant proteins ---- Ferredoxin-1, chloroplastic Source.1036: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.1037: DFBPPR6300 ---- Plant proteins ---- Strigolactone esterase RMS3 Source.1038: DFBPPR6304 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.1039: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic Source.1040: DFBPPR6359 ---- Plant proteins ---- ATP synthase delta chain, chloroplastic Source.1041: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1 Source.1042: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic Source.1043: DFBPPR6368 ---- Plant proteins ---- Provicilin Source.1044: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic Source.1045: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.1046: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic Source.1047: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.1048: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1049: DFBPPR6441 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic Source.1050: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic Source.1051: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase Source.1052: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase Source.1053: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.1054: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW Source.1055: DFBPPR6504 ---- Plant proteins ---- Cysteine proteinase 15A Source.1056: DFBPPR6513 ---- Plant proteins ---- Plastoglobulin-1, chloroplastic Source.1057: DFBPPR6539 ---- Plant proteins ---- Defensin-like protein 230 Source.1058: DFBPPR6545 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.1059: DFBPPR6549 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.1060: DFBPPR6566 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.1061: DFBPPR6567 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.1062: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.1063: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.1064: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic Source.1065: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.1066: DFBPPR6708 ---- Plant proteins ---- Photosystem II reaction center protein H Source.1067: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.1068: DFBPPR6753 ---- Plant proteins ---- Ferredoxin, chloroplastic Source.1069: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.1070: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A Source.1071: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1 Source.1072: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B Source.1073: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1) Source.1074: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B Source.1075: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38) Source.1076: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1077: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1078: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.1079: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.1080: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A Source.1081: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C Source.1082: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1083: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B Source.1084: DFBPPR6830 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.1085: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1086: DFBPPR6846 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.1087: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1088: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.1089: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.1090: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1091: DFBPPR6880 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.1092: DFBPPR6898 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.1093: DFBPPR6957 ---- Plant proteins ---- Protein WIR1B Source.1094: DFBPPR6970 ---- Plant proteins ---- 40S ribosomal protein S29 Source.1095: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.1096: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1 Source.1097: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7 Source.1098: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.1099: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic Source.1100: DFBPPR7050 ---- Plant proteins ---- Lichenase-2 Source.1101: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.1102: DFBPPR7053 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMa Source.1103: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1104: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1105: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.1106: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.1107: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1 Source.1108: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII Source.1109: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic Source.1110: DFBPPR7114 ---- Plant proteins ---- Acyl carrier protein 3, chloroplastic Source.1111: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor Source.1112: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.1113: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1114: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial Source.1115: DFBPPR7134 ---- Plant proteins ---- Photosystem II reaction center protein H Source.1116: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV Source.1117: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic Source.1118: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX Source.1119: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase Source.1120: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1121: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1122: DFBPPR7201 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.1123: DFBPPR7208 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.1124: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.1125: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.1126: DFBPPR7215 ---- Plant proteins ---- Aldose reductase Source.1127: DFBPPR7223 ---- Plant proteins ---- Ferredoxin Source.1128: DFBPPR7231 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.1129: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1 Source.1130: DFBPPR7276 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic Source.1131: DFBPPR7313 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.1132: DFBPPR7351 ---- Plant proteins ---- 23 kDa jasmonate-induced protein Source.1133: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic Source.1134: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic Source.1135: DFBPPR7400 ---- Plant proteins ---- Myrosinase Source.1136: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic Source.1137: DFBPPR7422 ---- Plant proteins ---- Napin-1A Source.1138: DFBPPR7433 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase Source.1139: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.1140: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1 Source.1141: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.1142: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.1143: DFBPPR7463 ---- Plant proteins ---- Oleosin S2-2 Source.1144: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal Source.1145: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.1146: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal Source.1147: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1148: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic Source.1149: DFBPPR7499 ---- Plant proteins ---- Ferredoxin Source.1150: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA Source.1151: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG Source.1152: DFBPPR7539 ---- Plant proteins ---- Metallothionein-like protein LSC54 Source.1153: DFBPPR7594 ---- Milk proteins ---- Lactadherin Source.1154: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase Source.1155: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1 Source.1156: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b Source.1157: DFBPPR7618 ---- Milk proteins ---- Plasminogen Source.1158: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor Source.1159: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.1160: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2 Source.1161: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2 Source.1162: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform Source.1163: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.1164: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1 Source.1165: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1 Source.1166: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor Source.1167: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4 Source.1168: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51 Source.1169: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein Source.1170: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.1171: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein Source.1172: DFBPPR7716 ---- Milk proteins ---- Lingual antimicrobial peptide Source.1173: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.1174: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.1175: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase Source.1176: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta Source.1177: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.1178: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1179: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.1180: DFBPPR8373 ---- Plant proteins ---- Non-specific lipid-transfer protein Source.1181: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase Source.1182: DFBPPR8381 ---- Plant proteins ---- Conglutin-7 Source.1183: DFBPPR8390 ---- Plant proteins ---- Galactose-binding lectin Source.1184: DFBPPR8391 ---- Plant proteins ---- Oleosin Ara h 15.0101 Source.1185: DFBPPR8413 ---- Plant proteins ---- Arachin Ahy-3 Source.1186: DFBPPR8425 ---- Plant proteins ---- Oleosin L Source.1187: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.1188: DFBPPR8438 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.1189: DFBPPR8440 ---- Plant proteins ---- Non-specific lipid-transfer protein 4 Source.1190: DFBPPR8441 ---- Plant proteins ---- Non-specific lipid-transfer protein 6 Source.1191: DFBPPR8443 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.1192: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic Source.1193: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.1194: DFBPPR8461 ---- Plant proteins ---- Photosystem II reaction center protein H Source.1195: DFBPPR8466 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.1196: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1197: DFBPPR8486 ---- Milk proteins ---- Lactadherin Source.1198: DFBPPR8496 ---- Milk proteins ---- Mucin-1 Source.1199: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase Source.1200: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.1201: DFBPPR8511 ---- Milk proteins ---- Transcobalamin-2 Source.1202: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1 Source.1203: DFBPPR15937 ---- Animal proteins ---- Appetite-regulating hormone Source.1204: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1 Source.1205: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.1206: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.1207: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.1208: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.1209: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.1210: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1211: DFBPPR15968 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.1212: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8 Source.1213: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T Source.1214: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.1215: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9 Source.1216: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.1217: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1 Source.1218: DFBPPR16001 ---- Animal proteins ---- Battenin Source.1219: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.1220: DFBPPR16007 ---- Animal proteins ---- Myocilin Source.1221: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.1222: DFBPPR16038 ---- Animal proteins ---- Protein amnionless Source.1223: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta Source.1224: DFBPPR16045 ---- Animal proteins ---- Endoplasmin Source.1225: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.1226: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.1227: DFBPPR16069 ---- Animal proteins ---- T-cell surface glycoprotein CD4 Source.1228: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein Source.1229: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2 Source.1230: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.1231: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2 Source.1232: DFBPPR16094 ---- Animal proteins ---- Mastin Source.1233: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO Source.1234: DFBPPR16103 ---- Animal proteins ---- Laforin Source.1235: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1236: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.1237: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain Source.1238: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C Source.1239: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1240: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.1241: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.1242: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor Source.1243: DFBPPR16135 ---- Animal proteins ---- Gap junction alpha-1 protein Source.1244: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.1245: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3 Source.1246: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase Source.1247: DFBPPR16148 ---- Animal proteins ---- Haptoglobin Source.1248: DFBPPR16155 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.1249: DFBPPR16157 ---- Animal proteins ---- Protein transport protein Sec61 subunit beta Source.1250: DFBPPR16165 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.1251: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.1252: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 Source.1253: DFBPPR16170 ---- Animal proteins ---- Inversin Source.1254: DFBPPR16190 ---- Animal proteins ---- Aprataxin Source.1255: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1 Source.1256: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.1257: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.1258: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator Source.1259: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1 Source.1260: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1 Source.1261: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.1262: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.1263: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1264: DFBPPR16225 ---- Animal proteins ---- C-C motif chemokine 24 Source.1265: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.1266: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog Source.1267: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.1268: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.1269: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.1270: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.1271: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.1272: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4 Source.1273: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.1274: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.1275: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.1276: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68 Source.1277: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.1278: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain Source.1279: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1 Source.1280: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.1281: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4 Source.1282: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4 Source.1283: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein Source.1284: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.1285: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.1286: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.1287: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2 Source.1288: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11 Source.1289: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.1290: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1291: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.1292: DFBPPR16464 ---- Animal proteins ---- Interferon alpha-1/2 Source.1293: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin Source.1294: DFBPPR16484 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain Source.1295: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein Source.1296: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor Source.1297: DFBPPR16517 ---- Animal proteins ---- Cholinesterase Source.1298: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator Source.1299: DFBPPR16538 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 1B Source.1300: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.1301: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.1302: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor Source.1303: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.1304: DFBPPR16572 ---- Animal proteins ---- Gamma-sarcoglycan Source.1305: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3 Source.1306: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2 Source.1307: DFBPPR16598 ---- Animal proteins ---- Keratin, type I cytoskeletal 9 Source.1308: DFBPPR16616 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1 Source.1309: DFBPPR16632 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.1310: DFBPPR16638 ---- Animal proteins ---- Synapsin-1 Source.1311: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.1312: DFBPPR16660 ---- Animal proteins ---- Gamma-crystallin C Source.1313: DFBPPR16679 ---- Animal proteins ---- Mitochondrial uncoupling protein 3 Source.1314: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.1315: DFBPPR16695 ---- Animal proteins ---- UDP-galactose translocator Source.1316: DFBPPR16696 ---- Animal proteins ---- von Hippel-Lindau disease tumor suppressor Source.1317: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.1318: DFBPPR16708 ---- Animal proteins ---- Transmembrane protein 190 Source.1319: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.1320: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252 Source.1321: DFBPPR16715 ---- Animal proteins ---- Submaxillary mucin Source.1322: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.1323: DFBPPR16721 ---- Animal proteins ---- Testin Source.1324: DFBPPR16750 ---- Animal proteins ---- 60S ribosomal protein L23 Source.1325: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10 Source.1326: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor Source.1327: DFBPPR16784 ---- Animal proteins ---- Metallothionein-2 Source.1328: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.1329: DFBPPR16800 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn] Source.1330: DFBPPR16808 ---- Animal proteins ---- Fibroblast growth factor 2 Source.1331: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1332: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X Source.1333: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.1334: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.1335: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor Source.1336: DFBPPR16859 ---- Animal proteins ---- Ubiquitin-like protein ISG15 Source.1337: DFBPPR16872 ---- Animal proteins ---- Oxytocin-neurophysin 1 Source.1338: DFBPPR16877 ---- Animal proteins ---- Peptidoglycan recognition protein 1 Source.1339: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase Source.1340: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.1341: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial Source.1342: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.1343: DFBPPR16903 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate Source.1344: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.1345: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha Source.1346: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV Source.1347: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial Source.1348: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.1349: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.1350: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.1351: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase Source.1352: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.1353: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.1354: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2 Source.1355: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.1356: DFBPPR17046 ---- Animal proteins ---- Appetite-regulating hormone Source.1357: DFBPPR17047 ---- Animal proteins ---- Neuromodulin Source.1358: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.1359: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.1360: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.1361: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1 Source.1362: DFBPPR17085 ---- Animal proteins ---- Cadherin-2 Source.1363: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.1364: DFBPPR17090 ---- Animal proteins ---- Phakinin Source.1365: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.1366: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A Source.1367: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.1368: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.1369: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha Source.1370: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2 Source.1371: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2 Source.1372: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.1373: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.1374: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain Source.1375: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.1376: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.1377: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.1378: DFBPPR17198 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.1379: DFBPPR17256 ---- Animal proteins ---- X-box-binding protein 1 Source.1380: DFBPPR17261 ---- Animal proteins ---- NAD-dependent protein lipoamidase sirtuin-4, mitochondrial Source.1381: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33 Source.1382: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.1383: DFBPPR17274 ---- Animal proteins ---- U8 snoRNA-decapping enzyme Source.1384: DFBPPR17279 ---- Animal proteins ---- Stimulator of interferon genes protein Source.1385: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1 Source.1386: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D Source.1387: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.1388: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1 Source.1389: DFBPPR17313 ---- Animal proteins ---- Exostosin-1 Source.1390: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.1391: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein Source.1392: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1 Source.1393: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1 Source.1394: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1 Source.1395: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.1396: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI Source.1397: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B Source.1398: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112 Source.1399: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.1400: DFBPPR17352 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 2 Source.1401: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N Source.1402: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog Source.1403: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.1404: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2 Source.1405: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10 Source.1406: DFBPPR17391 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-4 Source.1407: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3 Source.1408: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme Source.1409: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2 Source.1410: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.1411: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1 Source.1412: DFBPPR17425 ---- Animal proteins ---- Dynamin-1 Source.1413: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.1414: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.1415: DFBPPR17439 ---- Animal proteins ---- Folliculin Source.1416: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1417: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.1418: DFBPPR17448 ---- Animal proteins ---- Gap junction alpha-1 protein Source.1419: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1420: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1 Source.1421: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.1422: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.1423: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K Source.1424: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase Source.1425: DFBPPR17484 ---- Animal proteins ---- Histone H1.8 Source.1426: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta Source.1427: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4 Source.1428: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.1429: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.1430: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase Source.1431: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein Source.1432: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1 Source.1433: DFBPPR17534 ---- Animal proteins ---- RISC-loading complex subunit TARBP2 Source.1434: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.1435: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial Source.1436: DFBPPR17566 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial Source.1437: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1 Source.1438: DFBPPR17570 ---- Animal proteins ---- Clathrin light chain B Source.1439: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.1440: DFBPPR17580 ---- Animal proteins ---- Insulin-like growth factor-binding protein 5 Source.1441: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.1442: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1443: DFBPPR17626 ---- Animal proteins ---- Elastin Source.1444: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.1445: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.1446: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.1447: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2 Source.1448: DFBPPR17713 ---- Animal proteins ---- Urokinase plasminogen activator surface receptor Source.1449: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B Source.1450: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B Source.1451: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.1452: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme Source.1453: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.1454: DFBPPR17757 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.1455: DFBPPR17762 ---- Animal proteins ---- Chloride intracellular channel protein 4 Source.1456: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.1457: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3 Source.1458: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.1459: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.1460: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial Source.1461: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.1462: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2 Source.1463: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.1464: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial Source.1465: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.1466: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3 Source.1467: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase Source.1468: DFBPPR17865 ---- Animal proteins ---- Protein phosphatase 1A Source.1469: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.1470: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.1471: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 Source.1472: DFBPPR17881 ---- Animal proteins ---- Myoblast determination protein 1 Source.1473: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial Source.1474: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4 Source.1475: DFBPPR17905 ---- Animal proteins ---- DNA endonuclease RBBP8 Source.1476: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A Source.1477: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.1478: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3 Source.1479: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1480: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.1481: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate Source.1482: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.1483: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10 Source.1484: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin Source.1485: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.1486: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.1487: DFBPPR18000 ---- Animal proteins ---- Very-long-chain enoyl-CoA reductase Source.1488: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2 Source.1489: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5 Source.1490: DFBPPR18029 ---- Animal proteins ---- Collagen alpha-3(IV) chain Source.1491: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.1492: DFBPPR18047 ---- Animal proteins ---- ATP synthase F(0) complex subunit C3, mitochondrial Source.1493: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.1494: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12 Source.1495: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.1496: DFBPPR18064 ---- Animal proteins ---- Sperm flagellar protein 1 Source.1497: DFBPPR18067 ---- Animal proteins ---- Metallothionein-1A Source.1498: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.1499: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8 Source.1500: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8 Source.1501: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator Source.1502: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.1503: DFBPPR18088 ---- Animal proteins ---- Aprataxin Source.1504: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.1505: DFBPPR18095 ---- Animal proteins ---- Metallothionein-2 Source.1506: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33 Source.1507: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit Source.1508: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.1509: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.1510: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1 Source.1511: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29 Source.1512: DFBPPR18110 ---- Animal proteins ---- Protein inturned Source.1513: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.1514: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.1515: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.1516: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein Source.1517: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII Source.1518: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.1519: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2 Source.1520: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.1521: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform Source.1522: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5 Source.1523: DFBPPR18208 ---- Animal proteins ---- THO complex subunit 4 Source.1524: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter Source.1525: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2 Source.1526: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.1527: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.1528: DFBPPR18252 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.1529: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7 Source.1530: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.1531: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6 Source.1532: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2 Source.1533: DFBPPR18285 ---- Animal proteins ---- ADP-ribose glycohydrolase OARD1 Source.1534: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20 Source.1535: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C Source.1536: DFBPPR18299 ---- Animal proteins ---- Synapsin-1 Source.1537: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.1538: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2 Source.1539: DFBPPR18326 ---- Animal proteins ---- Metallothionein-1 Source.1540: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor Source.1541: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial Source.1542: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2 Source.1543: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3 Source.1544: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.1545: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.1546: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.1547: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.1548: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z Source.1549: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.1550: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.1551: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.1552: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.1553: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin Source.1554: DFBPPR18447 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease 2 Source.1555: DFBPPR18458 ---- Animal proteins ---- Fatty acid-binding protein, liver Source.1556: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2 Source.1557: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3 Source.1558: DFBPPR18473 ---- Animal proteins ---- Sharpin Source.1559: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial Source.1560: DFBPPR18484 ---- Animal proteins ---- Charged multivesicular body protein 3 Source.1561: DFBPPR18485 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.1562: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7 Source.1563: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor Source.1564: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5 Source.1565: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1 Source.1566: DFBPPR18524 ---- Animal proteins ---- Beta-defensin 5 Source.1567: DFBPPR18526 ---- Animal proteins ---- Beta-defensin 4 Source.1568: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1 Source.1569: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.1570: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1 Source.1571: DFBPPR18556 ---- Animal proteins ---- Transketolase Source.1572: DFBPPR18559 ---- Animal proteins ---- Kinesin-like protein KIF22 Source.1573: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.1574: DFBPPR18593 ---- Animal proteins ---- Pigment epithelium-derived factor Source.1575: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1 Source.1576: DFBPPR18626 ---- Animal proteins ---- Thymidylate synthase Source.1577: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4 Source.1578: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.1579: DFBPPR18700 ---- Animal proteins ---- Beta-defensin 7 Source.1580: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.1581: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.1582: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7 Source.1583: DFBPPR18742 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor II Source.1584: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.1585: DFBPPR18763 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.1586: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50 Source.1587: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1 Source.1588: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3 Source.1589: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4 Source.1590: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4 Source.1591: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav Source.1592: DFBPPR18793 ---- Animal proteins ---- BPI fold-containing family A member 1 Source.1593: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8 Source.1594: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type Source.1595: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5 Source.1596: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1 Source.1597: DFBPPR18812 ---- Animal proteins ---- Vesicle-associated membrane protein 3 Source.1598: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial Source.1599: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.1600: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.1601: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B Source.1602: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.1603: DFBPPR18847 ---- Animal proteins ---- Heme oxygenase 1 Source.1604: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A Source.1605: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.1606: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain Source.1607: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A Source.1608: DFBPPR18868 ---- Animal proteins ---- Haptoglobin Source.1609: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.1610: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.1611: DFBPPR18884 ---- Animal proteins ---- Beta-defensin 3 Source.1612: DFBPPR18885 ---- Animal proteins ---- Beta-defensin 9 Source.1613: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.1614: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4 Source.1615: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED Source.1616: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.1617: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.1618: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108 Source.1619: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2 Source.1620: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.1621: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase Source.1622: DFBPPR18966 ---- Animal proteins ---- Lupus La protein homolog Source.1623: DFBPPR18970 ---- Animal proteins ---- Mitochondrial fission 1 protein Source.1624: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5 Source.1625: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74 Source.1626: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter Source.1627: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746 Source.1628: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D Source.1629: DFBPPR19029 ---- Animal proteins ---- Homeobox protein Hox-B4 Source.1630: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain Source.1631: DFBPPR19037 ---- Animal proteins ---- Transthyretin Source.1632: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.1633: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E Source.1634: DFBPPR19065 ---- Animal proteins ---- Cadherin-6 Source.1635: DFBPPR19073 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 21 Source.1636: DFBPPR19076 ---- Animal proteins ---- Protein MGARP Source.1637: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1 Source.1638: DFBPPR19080 ---- Animal proteins ---- Beta-defensin 11 Source.1639: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1 Source.1640: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2 Source.1641: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain Source.1642: DFBPPR19131 ---- Animal proteins ---- Nectin-4 Source.1643: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2 Source.1644: DFBPPR19172 ---- Animal proteins ---- Persulfide dioxygenase ETHE1, mitochondrial Source.1645: DFBPPR19176 ---- Animal proteins ---- Collagen alpha-2(IV) chain Source.1646: DFBPPR19181 ---- Animal proteins ---- Solute carrier family 25 member 33 Source.1647: DFBPPR19184 ---- Animal proteins ---- Alpha-soluble NSF attachment protein Source.1648: DFBPPR19197 ---- Animal proteins ---- Protein LSM14 homolog A Source.1649: DFBPPR19208 ---- Animal proteins ---- Sushi repeat-containing protein SRPX2 Source.1650: DFBPPR19209 ---- Animal proteins ---- mRNA export factor Source.1651: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6 Source.1652: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha Source.1653: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase Source.1654: DFBPPR19237 ---- Animal proteins ---- Cadherin-18 Source.1655: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.1656: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.1657: DFBPPR19254 ---- Animal proteins ---- Periaxin Source.1658: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3 Source.1659: DFBPPR19264 ---- Animal proteins ---- Claudin-16 Source.1660: DFBPPR19269 ---- Animal proteins ---- HCLS1-associated protein X-1 Source.1661: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33 Source.1662: DFBPPR19287 ---- Animal proteins ---- Rab-like protein 3 Source.1663: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D Source.1664: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1 Source.1665: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.1666: DFBPPR19313 ---- Animal proteins ---- Vitamin K epoxide reductase complex subunit 1 Source.1667: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB Source.1668: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal Source.1669: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1 Source.1670: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD Source.1671: DFBPPR19351 ---- Animal proteins ---- Caveolae-associated protein 3 Source.1672: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.1673: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.1674: DFBPPR19362 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 5 Source.1675: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1 Source.1676: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor Source.1677: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1 Source.1678: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71 Source.1679: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.1680: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.1681: DFBPPR19451 ---- Animal proteins ---- Proline/serine-rich coiled-coil protein 1 Source.1682: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2 Source.1683: DFBPPR19471 ---- Animal proteins ---- Ribosome biogenesis protein WDR12 Source.1684: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.1685: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.1686: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73 Source.1687: DFBPPR19501 ---- Animal proteins ---- CD320 antigen Source.1688: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.1689: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2 Source.1690: DFBPPR19519 ---- Animal proteins ---- DnaJ homolog subfamily C member 24 Source.1691: DFBPPR19522 ---- Animal proteins ---- PCNA-associated factor Source.1692: DFBPPR19525 ---- Animal proteins ---- Tomoregulin-2 Source.1693: DFBPPR19529 ---- Animal proteins ---- Cbp/p300-interacting transactivator 1 Source.1694: DFBPPR19530 ---- Animal proteins ---- Tuftelin Source.1695: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.1696: DFBPPR19538 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial Source.1697: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9 Source.1698: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial Source.1699: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B Source.1700: DFBPPR19574 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit 2 Source.1701: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.1702: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2 Source.1703: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.1704: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2 Source.1705: DFBPPR19617 ---- Animal proteins ---- Suppressor of cytokine signaling 2 Source.1706: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1 Source.1707: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5 Source.1708: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2 Source.1709: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta Source.1710: DFBPPR19627 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain Source.1711: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3 Source.1712: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform Source.1713: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.1714: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2 Source.1715: DFBPPR19675 ---- Animal proteins ---- INO80 complex subunit E Source.1716: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A Source.1717: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.1718: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3 Source.1719: DFBPPR19713 ---- Animal proteins ---- Shadow of prion protein Source.1720: DFBPPR19722 ---- Animal proteins ---- Cdc42 effector protein 1 Source.1721: DFBPPR19724 ---- Animal proteins ---- Lingual antimicrobial peptide Source.1722: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.1723: DFBPPR19735 ---- Animal proteins ---- Complement component C7 Source.1724: DFBPPR19748 ---- Animal proteins ---- 60S ribosomal protein L23 Source.1725: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.1726: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1 Source.1727: DFBPPR19765 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.1728: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1 Source.1729: DFBPPR19768 ---- Animal proteins ---- Peroxynitrite isomerase THAP4 Source.1730: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase Source.1731: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma Source.1732: DFBPPR19794 ---- Animal proteins ---- Bone morphogenetic protein 15 Source.1733: DFBPPR19804 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 2 Source.1734: DFBPPR19810 ---- Animal proteins ---- Seipin Source.1735: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2 Source.1736: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog Source.1737: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial Source.1738: DFBPPR19828 ---- Animal proteins ---- Transmembrane protein 14C Source.1739: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3 Source.1740: DFBPPR19837 ---- Animal proteins ---- Ribonuclease P protein subunit p30 Source.1741: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5 Source.1742: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.1743: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2 Source.1744: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2 Source.1745: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.1746: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.1747: DFBPPR19882 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.1748: DFBPPR19897 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial Source.1749: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase Source.1750: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6 Source.1751: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.1752: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2 Source.1753: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80 Source.1754: DFBPPR19944 ---- Animal proteins ---- Histone H1.0 Source.1755: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40 Source.1756: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14 Source.1757: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z Source.1758: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16 Source.1759: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer Source.1760: DFBPPR20006 ---- Animal proteins ---- Protein Abitram Source.1761: DFBPPR20010 ---- Animal proteins ---- Craniofacial development protein 1 Source.1762: DFBPPR20020 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3 Source.1763: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.1764: DFBPPR20036 ---- Animal proteins ---- Urocortin-3 Source.1765: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta Source.1766: DFBPPR20038 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 20 Source.1767: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1 Source.1768: DFBPPR20058 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2 Source.1769: DFBPPR20061 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8 Source.1770: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein Source.1771: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1 Source.1772: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4 Source.1773: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.1774: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1 Source.1775: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.1776: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2 Source.1777: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C Source.1778: DFBPPR20148 ---- Animal proteins ---- Integrin-linked kinase-associated serine/threonine phosphatase 2C Source.1779: DFBPPR20163 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G6f Source.1780: DFBPPR20167 ---- Animal proteins ---- Protein BANP Source.1781: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta Source.1782: DFBPPR20177 ---- Animal proteins ---- TIMELESS-interacting protein Source.1783: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12 Source.1784: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2 Source.1785: DFBPPR20187 ---- Animal proteins ---- Nitric oxide synthase-interacting protein Source.1786: DFBPPR20197 ---- Animal proteins ---- Ribonuclease P protein subunit p20 Source.1787: DFBPPR20199 ---- Animal proteins ---- Claudin-7 Source.1788: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6 Source.1789: DFBPPR20209 ---- Animal proteins ---- Ran-specific GTPase-activating protein Source.1790: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B Source.1791: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2 Source.1792: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase Source.1793: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3 Source.1794: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1 Source.1795: DFBPPR20254 ---- Animal proteins ---- Leukemia inhibitory factor Source.1796: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1 Source.1797: DFBPPR20261 ---- Animal proteins ---- Protein SCO1 homolog, mitochondrial Source.1798: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial Source.1799: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214 Source.1800: DFBPPR20289 ---- Animal proteins ---- Di-N-acetylchitobiase Source.1801: DFBPPR20301 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 3 Source.1802: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3 Source.1803: DFBPPR20306 ---- Animal proteins ---- Gamma-sarcoglycan Source.1804: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.1805: DFBPPR20312 ---- Animal proteins ---- 39S ribosomal protein L52, mitochondrial Source.1806: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel Source.1807: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.1808: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14 Source.1809: DFBPPR20339 ---- Animal proteins ---- 28S ribosomal protein S23, mitochondrial Source.1810: DFBPPR20356 ---- Animal proteins ---- RNA-binding protein 7 Source.1811: DFBPPR20357 ---- Animal proteins ---- Snurportin-1 Source.1812: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta Source.1813: DFBPPR20364 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3 Source.1814: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4 Source.1815: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.1816: DFBPPR20386 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59 Source.1817: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7 Source.1818: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2 Source.1819: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.1820: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2 Source.1821: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2 Source.1822: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1823: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein Source.1824: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein Source.1825: DFBPPR20432 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 4 Source.1826: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1 Source.1827: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile Source.1828: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1 Source.1829: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1 Source.1830: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10 Source.1831: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102 Source.1832: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42 Source.1833: DFBPPR20536 ---- Animal proteins ---- Trophoblast Kunitz domain protein 1 Source.1834: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6 Source.1835: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A Source.1836: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3 Source.1837: DFBPPR20560 ---- Animal proteins ---- Draxin Source.1838: DFBPPR20564 ---- Animal proteins ---- Ras-related protein Rab-26 Source.1839: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta Source.1840: DFBPPR20591 ---- Animal proteins ---- WD repeat-containing protein 74 Source.1841: DFBPPR20597 ---- Animal proteins ---- Protein FAM162A Source.1842: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1 Source.1843: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2 Source.1844: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56 Source.1845: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10 Source.1846: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog Source.1847: DFBPPR20613 ---- Animal proteins ---- Gamma-crystallin D Source.1848: DFBPPR20633 ---- Animal proteins ---- Transmembrane protein 47 Source.1849: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.1850: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A Source.1851: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.1852: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2 Source.1853: DFBPPR20692 ---- Animal proteins ---- ELMO domain-containing protein 3 Source.1854: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.1855: DFBPPR20700 ---- Animal proteins ---- General transcription factor IIE subunit 1 Source.1856: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial Source.1857: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2 Source.1858: DFBPPR20725 ---- Animal proteins ---- RBPJ-interacting and tubulin-associated protein 1 Source.1859: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11 Source.1860: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1 Source.1861: DFBPPR20754 ---- Animal proteins ---- Transcription factor Maf Source.1862: DFBPPR20760 ---- Animal proteins ---- Beta-defensin C7 Source.1863: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17 Source.1864: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase Source.1865: DFBPPR20806 ---- Animal proteins ---- Transcriptional adapter 1 Source.1866: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13 Source.1867: DFBPPR20816 ---- Animal proteins ---- Ribosomal L1 domain-containing protein 1 Source.1868: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.1869: DFBPPR20829 ---- Animal proteins ---- Phospholipid phosphatase 6 Source.1870: DFBPPR20837 ---- Animal proteins ---- Keratin, type I cytoskeletal 27 Source.1871: DFBPPR20843 ---- Animal proteins ---- ARL14 effector protein Source.1872: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.1873: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial Source.1874: DFBPPR20866 ---- Animal proteins ---- PRKR-interacting protein 1 Source.1875: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1 Source.1876: DFBPPR20885 ---- Animal proteins ---- Zinc transporter ZIP3 Source.1877: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.1878: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.1879: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.1880: DFBPPR20924 ---- Animal proteins ---- Cyclin-dependent kinase 2-associated protein 2 Source.1881: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8 Source.1882: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4 Source.1883: DFBPPR20937 ---- Animal proteins ---- Leucine-rich repeat-containing protein 25 Source.1884: DFBPPR20940 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.1885: DFBPPR20948 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 9 Source.1886: DFBPPR20967 ---- Animal proteins ---- Phosducin-like protein Source.1887: DFBPPR20972 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP11 Source.1888: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5 Source.1889: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.1890: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1 Source.1891: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2 Source.1892: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17 Source.1893: DFBPPR21022 ---- Animal proteins ---- Transmembrane 4 L6 family member 5 Source.1894: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein Source.1895: DFBPPR21038 ---- Animal proteins ---- Sodium channel modifier 1 Source.1896: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28 Source.1897: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter Source.1898: DFBPPR21069 ---- Animal proteins ---- Nuclear transcription factor Y subunit gamma Source.1899: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.1900: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.1901: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6 Source.1902: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43 Source.1903: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein Source.1904: DFBPPR21106 ---- Animal proteins ---- 40S ribosomal protein S10 Source.1905: DFBPPR21108 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.1906: DFBPPR21111 ---- Animal proteins ---- Zinc finger protein-like 1 Source.1907: DFBPPR21116 ---- Animal proteins ---- Suppressor of cytokine signaling 5 Source.1908: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier Source.1909: DFBPPR21166 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1 Source.1910: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.1911: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial Source.1912: DFBPPR21181 ---- Animal proteins ---- Calpastatin Source.1913: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3 Source.1914: DFBPPR21250 ---- Animal proteins ---- Enteric beta-defensin Source.1915: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7 Source.1916: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2 Source.1917: DFBPPR21259 ---- Animal proteins ---- Elongation factor 1-delta Source.1918: DFBPPR21272 ---- Animal proteins ---- Testin Source.1919: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein Source.1920: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1 Source.1921: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3 Source.1922: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15 Source.1923: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein Source.1924: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C Source.1925: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein Source.1926: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.1927: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2 Source.1928: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2 Source.1929: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B Source.1930: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.1931: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1 Source.1932: DFBPPR21396 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM6 homolog Source.1933: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1 Source.1934: DFBPPR21430 ---- Animal proteins ---- Calmodulin regulator protein PCP4 Source.1935: DFBPPR21436 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1A Source.1936: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1 Source.1937: DFBPPR21454 ---- Animal proteins ---- Cyclin-dependent kinase 2-interacting protein Source.1938: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163 Source.1939: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein Source.1940: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.1941: DFBPPR21490 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.1942: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.1943: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1 Source.1944: DFBPPR21526 ---- Animal proteins ---- Interferon alpha-inducible protein 27-like protein 2 Source.1945: DFBPPR21545 ---- Animal proteins ---- Musculoskeletal embryonic nuclear protein 1 Source.1946: DFBPPR21547 ---- Animal proteins ---- Osteoclast-stimulating factor 1 Source.1947: DFBPPR21557 ---- Animal proteins ---- WD repeat-containing protein 55 Source.1948: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1 Source.1949: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A Source.1950: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4 Source.1951: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma Source.1952: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3 Source.1953: DFBPPR21637 ---- Animal proteins ---- 60S acidic ribosomal protein P2 Source.1954: DFBPPR21641 ---- Animal proteins ---- U5 small nuclear ribonucleoprotein 40 kDa protein Source.1955: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein Source.1956: DFBPPR21648 ---- Animal proteins ---- Keratin, type I cytoskeletal 26 Source.1957: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11 Source.1958: DFBPPR21668 ---- Animal proteins ---- Putative deoxyribonuclease TATDN1 Source.1959: DFBPPR21678 ---- Animal proteins ---- Transmembrane protein 35A Source.1960: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1 Source.1961: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.1962: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.1963: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.1964: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15 Source.1965: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2 Source.1966: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8 Source.1967: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1 Source.1968: DFBPPR21754 ---- Animal proteins ---- BLOC-1-related complex subunit 6 Source.1969: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1 Source.1970: DFBPPR21761 ---- Animal proteins ---- NADH dehydrogenase (ubiquinone) complex I, assembly factor 6 Source.1971: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.1972: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.1973: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4 Source.1974: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.1975: DFBPPR21782 ---- Animal proteins ---- Surfactant-associated protein 2 Source.1976: DFBPPR21787 ---- Animal proteins ---- PRA1 family protein 2 Source.1977: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.1978: DFBPPR21806 ---- Animal proteins ---- Keratin, type II cuticular Hb1 Source.1979: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1 Source.1980: DFBPPR21813 ---- Animal proteins ---- Ribosomal RNA processing protein 36 homolog Source.1981: DFBPPR21818 ---- Animal proteins ---- Zinc finger protein 410 Source.1982: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750 Source.1983: DFBPPR21847 ---- Animal proteins ---- Protein Mpv17 Source.1984: DFBPPR21861 ---- Animal proteins ---- Succinate dehydrogenase assembly factor 3, mitochondrial Source.1985: DFBPPR21873 ---- Animal proteins ---- Vitrin Source.1986: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2 Source.1987: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor Source.1988: DFBPPR21891 ---- Animal proteins ---- 39S ribosomal protein L54, mitochondrial Source.1989: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog Source.1990: DFBPPR21920 ---- Animal proteins ---- Protein DPCD Source.1991: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog Source.1992: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1 Source.1993: DFBPPR21945 ---- Animal proteins ---- Dermokine Source.1994: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48 Source.1995: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor Source.1996: DFBPPR21957 ---- Animal proteins ---- LIM domain transcription factor LMO4 Source.1997: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.1998: DFBPPR21981 ---- Animal proteins ---- Polyamine-modulated factor 1 Source.1999: DFBPPR21984 ---- Animal proteins ---- Leucine-rich repeat-containing protein 10 Source.2000: DFBPPR21992 ---- Animal proteins ---- Intraflagellar transport-associated protein Source.2001: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4 Source.2002: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3 Source.2003: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.2004: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma Source.2005: DFBPPR22066 ---- Animal proteins ---- Pyridoxal phosphate homeostasis protein Source.2006: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512 Source.2007: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41 Source.2008: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2 Source.2009: DFBPPR22110 ---- Animal proteins ---- Nucleolar protein 12 Source.2010: DFBPPR22111 ---- Animal proteins ---- Homeobox protein Hox-A5 Source.2011: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein Source.2012: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog Source.2013: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2 Source.2014: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31 Source.2015: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1 Source.2016: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1 Source.2017: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5 Source.2018: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.2019: DFBPPR22199 ---- Animal proteins ---- SCAN domain-containing protein 1 Source.2020: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.2021: DFBPPR22211 ---- Animal proteins ---- Ribonuclease P protein subunit p25-like protein Source.2022: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein Source.2023: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1 Source.2024: DFBPPR22229 ---- Animal proteins ---- Spermatogenesis-associated protein 22 Source.2025: DFBPPR22245 ---- Animal proteins ---- Thyroid transcription factor 1-associated protein 26 Source.2026: DFBPPR22276 ---- Animal proteins ---- Protein MEMO1 Source.2027: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2 Source.2028: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A Source.2029: DFBPPR22312 ---- Animal proteins ---- BolA-like protein 1 Source.2030: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like Source.2031: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2 Source.2032: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7 Source.2033: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B Source.2034: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6 Source.2035: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1 Source.2036: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180 Source.2037: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal Source.2038: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92 Source.2039: DFBPPR22374 ---- Animal proteins ---- Cysteine-rich protein 2 Source.2040: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.2041: DFBPPR22400 ---- Animal proteins ---- Stromal cell-derived factor 2-like protein 1 Source.2042: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog Source.2043: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1 Source.2044: DFBPPR22412 ---- Animal proteins ---- PHD finger protein 20-like protein 1 Source.2045: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2 Source.2046: DFBPPR22450 ---- Animal proteins ---- Leucine-rich single-pass membrane protein 1 Source.2047: DFBPPR22469 ---- Animal proteins ---- Protein FAM136A Source.2048: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1 Source.2049: DFBPPR22478 ---- Animal proteins ---- Trichohyalin-like protein 1 Source.2050: DFBPPR22512 ---- Animal proteins ---- IQ domain-containing protein C Source.2051: DFBPPR22516 ---- Animal proteins ---- Transmembrane protein 141 Source.2052: DFBPPR22526 ---- Animal proteins ---- Testis-expressed protein 29 Source.2053: DFBPPR22529 ---- Animal proteins ---- Purkinje cell protein 4-like protein 1 Source.2054: DFBPPR22536 ---- Animal proteins ---- Suprabasin Source.2055: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.2056: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B Source.2057: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog Source.2058: DFBPPR22587 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog Source.2059: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B Source.2060: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4 Source.2061: DFBPPR22643 ---- Animal proteins ---- Coiled-coil domain-containing protein 157 Source.2062: DFBPPR22657 ---- Animal proteins ---- Protein FAM110D Source.2063: DFBPPR22663 ---- Animal proteins ---- Erythrodihydroneopterin triphosphate synthetase Source.2064: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog Source.2065: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32 Source.2066: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog Source.2067: DFBPPR22690 ---- Animal proteins ---- Proline-rich protein 19 Source.2068: DFBPPR22700 ---- Animal proteins ---- Protein FAM89A Source.2069: DFBPPR22703 ---- Animal proteins ---- Arrestin domain-containing protein 5 Source.2070: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16 Source.2071: DFBPPR22719 ---- Animal proteins ---- Uncharacterized protein C12orf45 homolog Source.2072: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog Source.2073: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2074: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.2075: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase Source.2076: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.2077: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.2078: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2 Source.2079: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1 Source.2080: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.2081: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.2082: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.2083: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.2084: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.2085: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha Source.2086: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1 Source.2087: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.2088: DFBPPR8604 ---- Animal proteins ---- Alpha-synuclein Source.2089: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.2090: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B Source.2091: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.2092: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.2093: DFBPPR8625 ---- Animal proteins ---- Appetite-regulating hormone Source.2094: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.2095: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase Source.2096: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.2097: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein Source.2098: DFBPPR8669 ---- Animal proteins ---- Heme oxygenase 1 Source.2099: DFBPPR8683 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn] Source.2100: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.2101: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1 Source.2102: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.2103: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI Source.2104: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.2105: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase Source.2106: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor Source.2107: DFBPPR8739 ---- Animal proteins ---- Metallothionein-3 Source.2108: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1 Source.2109: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.2110: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase Source.2111: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.2112: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2113: DFBPPR8757 ---- Animal proteins ---- Gap junction alpha-1 protein Source.2114: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.2115: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.2116: DFBPPR8766 ---- Animal proteins ---- Myoblast determination protein 1 Source.2117: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.2118: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.2119: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.2120: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.2121: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.2122: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.2123: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.2124: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.2125: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase Source.2126: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4 Source.2127: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.2128: DFBPPR8846 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6 Source.2129: DFBPPR8865 ---- Animal proteins ---- Haptoglobin Source.2130: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor Source.2131: DFBPPR8898 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.2132: DFBPPR8899 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.2133: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.2134: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.2135: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.2136: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.2137: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.2138: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.2139: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.2140: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.2141: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.2142: DFBPPR9016 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.2143: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.2144: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta Source.2145: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A Source.2146: DFBPPR9058 ---- Animal proteins ---- Metallothionein-2A Source.2147: DFBPPR9062 ---- Animal proteins ---- Methylsterol monooxygenase 1 Source.2148: DFBPPR9064 ---- Animal proteins ---- Metallothionein-1A Source.2149: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.2150: DFBPPR9078 ---- Animal proteins ---- Neurofilament medium polypeptide Source.2151: DFBPPR9087 ---- Animal proteins ---- CD59 glycoprotein Source.2152: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta Source.2153: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.2154: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.2155: DFBPPR9121 ---- Animal proteins ---- Endoplasmin Source.2156: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.2157: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2158: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.2159: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.2160: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.2161: DFBPPR9158 ---- Animal proteins ---- Interferon-stimulated gene 20 kDa protein Source.2162: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.2163: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.2164: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2165: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase Source.2166: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.2167: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.2168: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase Source.2169: DFBPPR9199 ---- Animal proteins ---- 60S ribosomal protein L23 Source.2170: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII Source.2171: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.2172: DFBPPR9221 ---- Animal proteins ---- Catalase Source.2173: DFBPPR9228 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.2174: DFBPPR9235 ---- Animal proteins ---- Apomucin Source.2175: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 Source.2176: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4 Source.2177: DFBPPR9306 ---- Animal proteins ---- Complement component C7 Source.2178: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor Source.2179: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase Source.2180: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1 Source.2181: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1 Source.2182: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.2183: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.2184: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor Source.2185: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein Source.2186: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.2187: DFBPPR9388 ---- Animal proteins ---- Metallothionein-2B Source.2188: DFBPPR9389 ---- Animal proteins ---- Metallothionein-1E Source.2189: DFBPPR9390 ---- Animal proteins ---- Metallothionein-1F Source.2190: DFBPPR9392 ---- Animal proteins ---- mRNA export factor Source.2191: DFBPPR9404 ---- Animal proteins ---- Tryptase Source.2192: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.2193: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.2194: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2 Source.2195: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha Source.2196: DFBPPR9425 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.2197: DFBPPR9428 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.2198: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.2199: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2 Source.2200: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.2201: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.2202: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B Source.2203: DFBPPR9453 ---- Animal proteins ---- Metallothionein-1C Source.2204: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.2205: DFBPPR9496 ---- Animal proteins ---- C-X-C motif chemokine 16 Source.2206: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6 Source.2207: DFBPPR9538 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.2208: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic Source.2209: DFBPPR9551 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3 Source.2210: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2 Source.2211: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1 Source.2212: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.2213: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.2214: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.2215: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.2216: DFBPPR9626 ---- Animal proteins ---- Adenylyl cyclase-associated protein 1 Source.2217: DFBPPR9643 ---- Animal proteins ---- Apolipoprotein M Source.2218: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6 Source.2219: DFBPPR9660 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.2220: DFBPPR9683 ---- Animal proteins ---- Calpastatin Source.2221: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein Source.2222: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.2223: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.2224: DFBPPR9713 ---- Animal proteins ---- Hepcidin Source.2225: DFBPPR9719 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.2226: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2 Source.2227: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial Source.2228: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2229: DFBPPR9762 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.2230: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.2231: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha Source.2232: DFBPPR9791 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.2233: DFBPPR9808 ---- Animal proteins ---- Epidermal growth factor-like protein 8 Source.2234: DFBPPR9814 ---- Animal proteins ---- Testin Source.2235: DFBPPR9818 ---- Animal proteins ---- Calpain-7 Source.2236: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.2237: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2238: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3 Source.2239: DFBPPR9843 ---- Animal proteins ---- P protein Source.2240: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1 Source.2241: DFBPPR9862 ---- Animal proteins ---- Osteoclast-stimulating factor 1 Source.2242: DFBPPR9867 ---- Animal proteins ---- Phostensin Source.2243: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17 Source.2244: DFBPPR9890 ---- Animal proteins ---- 60S acidic ribosomal protein P2 Source.2245: DFBPPR9938 ---- Animal proteins ---- FUN14 domain-containing protein 2 Source.2246: DFBPPR9953 ---- Animal proteins ---- Gallinacin-1 alpha Source.2247: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.2248: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2249: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor Source.2250: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain Source.2251: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.2252: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.2253: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL Source.2254: DFBPPR10004 ---- Animal proteins ---- Spastin Source.2255: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b Source.2256: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16 Source.2257: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.2258: DFBPPR10016 ---- Animal proteins ---- High mobility group protein B2 Source.2259: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog Source.2260: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116 Source.2261: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.2262: DFBPPR10061 ---- Animal proteins ---- Ovocleidin-17 Source.2263: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9 Source.2264: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.2265: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase Source.2266: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type Source.2267: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.2268: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog Source.2269: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.2270: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.2271: DFBPPR10121 ---- Animal proteins ---- Fibroblast growth factor 2 Source.2272: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3 Source.2273: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.2274: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.2275: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1 Source.2276: DFBPPR10142 ---- Animal proteins ---- Calpain-3 Source.2277: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.2278: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.2279: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos Source.2280: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1 Source.2281: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3 Source.2282: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.2283: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.2284: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.2285: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.2286: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5 Source.2287: DFBPPR10222 ---- Animal proteins ---- Podocalyxin Source.2288: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2 Source.2289: DFBPPR10270 ---- Animal proteins ---- Agrin Source.2290: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2 Source.2291: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.2292: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.2293: DFBPPR10298 ---- Animal proteins ---- Caldesmon Source.2294: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.2295: DFBPPR10311 ---- Animal proteins ---- Homeobox protein engrailed-2 Source.2296: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme Source.2297: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.2298: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7 Source.2299: DFBPPR10325 ---- Animal proteins ---- Alpha-crystallin B chain Source.2300: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.2301: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.2302: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.2303: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel Source.2304: DFBPPR10361 ---- Animal proteins ---- Protein HIRA Source.2305: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.2306: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1 Source.2307: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type Source.2308: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2 Source.2309: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.2310: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65 Source.2311: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.2312: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf Source.2313: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1 Source.2314: DFBPPR10401 ---- Animal proteins ---- Heparanase Source.2315: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.2316: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.2317: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.2318: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.2319: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor Source.2320: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.2321: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2 Source.2322: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.2323: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.2324: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3 Source.2325: DFBPPR10459 ---- Animal proteins ---- Reelin Source.2326: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.2327: DFBPPR10467 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.2328: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1 Source.2329: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.2330: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21 Source.2331: DFBPPR10473 ---- Animal proteins ---- Gallinacin-1 Source.2332: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1 Source.2333: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.2334: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein Source.2335: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6 Source.2336: DFBPPR10490 ---- Animal proteins ---- Tudor-interacting repair regulator protein Source.2337: DFBPPR10494 ---- Animal proteins ---- Interferon lambda receptor 1 Source.2338: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.2339: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.2340: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase Source.2341: DFBPPR10535 ---- Animal proteins ---- Protein SPT2 homolog Source.2342: DFBPPR10536 ---- Animal proteins ---- Inhibin beta B chain Source.2343: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C Source.2344: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor Source.2345: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3 Source.2346: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.2347: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.2348: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.2349: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.2350: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.2351: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.2352: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2 Source.2353: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.2354: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein Source.2355: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.2356: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.2357: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit Source.2358: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1 Source.2359: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.2360: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.2361: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog Source.2362: DFBPPR10616 ---- Animal proteins ---- Cholecystokinin Source.2363: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2 Source.2364: DFBPPR10620 ---- Animal proteins ---- Centromere protein T Source.2365: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit Source.2366: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.2367: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.2368: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B Source.2369: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5 Source.2370: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.2371: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1 Source.2372: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.2373: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.2374: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1 Source.2375: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.2376: DFBPPR10703 ---- Animal proteins ---- Tensin Source.2377: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1 Source.2378: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.2379: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2 Source.2380: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.2381: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha Source.2382: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3 Source.2383: DFBPPR10765 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2 Source.2384: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2385: DFBPPR10769 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.2386: DFBPPR10770 ---- Animal proteins ---- Mannose-binding protein Source.2387: DFBPPR10776 ---- Animal proteins ---- GTP cyclohydrolase 1 Source.2388: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe Source.2389: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B Source.2390: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A Source.2391: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.2392: DFBPPR10812 ---- Animal proteins ---- Cadherin-11 Source.2393: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.2394: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain Source.2395: DFBPPR10841 ---- Animal proteins ---- Gallinacin-13 Source.2396: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein Source.2397: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.2398: DFBPPR10851 ---- Animal proteins ---- Wee1-like protein kinase 2 Source.2399: DFBPPR10852 ---- Animal proteins ---- Wee1-like protein kinase 2 Source.2400: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.2401: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.2402: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7 Source.2403: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.2404: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha' Source.2405: DFBPPR10892 ---- Animal proteins ---- Myogenic factor 5 Source.2406: DFBPPR10902 ---- Animal proteins ---- Metallothionein Source.2407: DFBPPR10904 ---- Animal proteins ---- Signal transducing adapter molecule 2 Source.2408: DFBPPR10908 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.2409: DFBPPR10911 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.2410: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1 Source.2411: DFBPPR10925 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.2412: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1 Source.2413: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.2414: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2 Source.2415: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y Source.2416: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like Source.2417: DFBPPR10960 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate Source.2418: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.2419: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1 Source.2420: DFBPPR10987 ---- Animal proteins ---- Charged multivesicular body protein 6 Source.2421: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2 Source.2422: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.2423: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.2424: DFBPPR10996 ---- Animal proteins ---- Semaphorin-4D Source.2425: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D Source.2426: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.2427: DFBPPR11018 ---- Animal proteins ---- Transcriptional coactivator YAP1 Source.2428: DFBPPR11019 ---- Animal proteins ---- Cadherin-4 Source.2429: DFBPPR11024 ---- Animal proteins ---- Gap junction alpha-1 protein Source.2430: DFBPPR11028 ---- Animal proteins ---- Interleukin-6 Source.2431: DFBPPR11035 ---- Animal proteins ---- Protein Dr1 Source.2432: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2 Source.2433: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase Source.2434: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase Source.2435: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5 Source.2436: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.2437: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1 Source.2438: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.2439: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase Source.2440: DFBPPR11094 ---- Animal proteins ---- Transcription factor MafA Source.2441: DFBPPR11099 ---- Animal proteins ---- Acylphosphatase-1 Source.2442: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A Source.2443: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2 Source.2444: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1 Source.2445: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.2446: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1 Source.2447: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1 Source.2448: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B Source.2449: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1 Source.2450: DFBPPR11194 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.2451: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1 Source.2452: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T Source.2453: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2 Source.2454: DFBPPR11219 ---- Animal proteins ---- Cytospin-A Source.2455: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.2456: DFBPPR11226 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K Source.2457: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1 Source.2458: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED Source.2459: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog Source.2460: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1 Source.2461: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6 Source.2462: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.2463: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4 Source.2464: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15 Source.2465: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5 Source.2466: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42 Source.2467: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.2468: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2 Source.2469: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5 Source.2470: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1 Source.2471: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein Source.2472: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6 Source.2473: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2 Source.2474: DFBPPR11317 ---- Animal proteins ---- Dickkopf-related protein 3 Source.2475: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.2476: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.2477: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4 Source.2478: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog Source.2479: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3 Source.2480: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.2481: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.2482: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8 Source.2483: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.2484: DFBPPR11356 ---- Animal proteins ---- Homeobox protein AKR Source.2485: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3 Source.2486: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2 Source.2487: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Source.2488: DFBPPR11376 ---- Animal proteins ---- Lamin-A Source.2489: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.2490: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1 Source.2491: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B Source.2492: DFBPPR11397 ---- Animal proteins ---- Frizzled-3 Source.2493: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1 Source.2494: DFBPPR11407 ---- Animal proteins ---- RAD52 motif-containing protein 1 Source.2495: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.2496: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1 Source.2497: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.2498: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator Source.2499: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48 Source.2500: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.2501: DFBPPR11466 ---- Animal proteins ---- GDNF family receptor alpha-2 Source.2502: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11 Source.2503: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4 Source.2504: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5 Source.2505: DFBPPR11479 ---- Animal proteins ---- Rab-like protein 3 Source.2506: DFBPPR11500 ---- Animal proteins ---- Ovalbumin-related protein X Source.2507: DFBPPR11506 ---- Animal proteins ---- Homeobox protein BarH-like 1b Source.2508: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13 Source.2509: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A Source.2510: DFBPPR11531 ---- Animal proteins ---- Protein AATF Source.2511: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD Source.2512: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2 Source.2513: DFBPPR11548 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.2514: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.2515: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70 Source.2516: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic Source.2517: DFBPPR11567 ---- Animal proteins ---- Ovocalyxin-32 Source.2518: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.2519: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1 Source.2520: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1 Source.2521: DFBPPR11581 ---- Animal proteins ---- PRKR-interacting protein 1 homolog Source.2522: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.2523: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.2524: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4 Source.2525: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43 Source.2526: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.2527: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.2528: DFBPPR11670 ---- Animal proteins ---- Snurportin-1 Source.2529: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1 Source.2530: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1 Source.2531: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog Source.2532: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.2533: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.2534: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.2535: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.2536: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D Source.2537: DFBPPR11722 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.2538: DFBPPR11724 ---- Animal proteins ---- Protein TENP Source.2539: DFBPPR11725 ---- Animal proteins ---- D-dopachrome decarboxylase Source.2540: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61 Source.2541: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa Source.2542: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3 Source.2543: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein Source.2544: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid Source.2545: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.2546: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.2547: DFBPPR11799 ---- Animal proteins ---- Homeobox protein Hox-B5 Source.2548: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1 Source.2549: DFBPPR11810 ---- Animal proteins ---- Homeobox protein BarH-like 1 Source.2550: DFBPPR11812 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.2551: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A Source.2552: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.2553: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1 Source.2554: DFBPPR11822 ---- Animal proteins ---- Inversin Source.2555: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.2556: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein Source.2557: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1 Source.2558: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.2559: DFBPPR11889 ---- Animal proteins ---- Olfactory receptor-like protein COR8 Source.2560: DFBPPR11893 ---- Animal proteins ---- Laminin subunit beta-1 variant Source.2561: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13 Source.2562: DFBPPR11919 ---- Animal proteins ---- Feather keratin 1 Source.2563: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2 Source.2564: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3 Source.2565: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A Source.2566: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8 Source.2567: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog Source.2568: DFBPPR11954 ---- Animal proteins ---- SIN3-HDAC complex-associated factor Source.2569: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.2570: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4 Source.2571: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase Source.2572: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2 Source.2573: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1 Source.2574: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130 Source.2575: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3 Source.2576: DFBPPR11993 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2 Source.2577: DFBPPR11994 ---- Animal proteins ---- Surfeit locus protein 1 Source.2578: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein Source.2579: DFBPPR12017 ---- Animal proteins ---- Zinc finger protein CKR1 Source.2580: DFBPPR12019 ---- Animal proteins ---- Cobalamin trafficking protein CblD Source.2581: DFBPPR12021 ---- Animal proteins ---- DNA repair protein RAD52 homolog Source.2582: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2 Source.2583: DFBPPR12027 ---- Animal proteins ---- Centromere protein L Source.2584: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29 Source.2585: DFBPPR12040 ---- Animal proteins ---- Neurochondrin Source.2586: DFBPPR12042 ---- Animal proteins ---- Mapk-regulated corepressor-interacting protein 1 Source.2587: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog Source.2588: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1 Source.2589: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.2590: DFBPPR12060 ---- Animal proteins ---- Neurobeachin Source.2591: DFBPPR12061 ---- Animal proteins ---- Otoraplin Source.2592: DFBPPR12065 ---- Animal proteins ---- Testin Source.2593: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog Source.2594: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2 Source.2595: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2 Source.2596: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1 Source.2597: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.2598: DFBPPR12143 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 2 Source.2599: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.2600: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.2601: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A Source.2602: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog Source.2603: DFBPPR12175 ---- Animal proteins ---- Ashwin Source.2604: DFBPPR12177 ---- Animal proteins ---- Beta-keratin-related protein Source.2605: DFBPPR12193 ---- Animal proteins ---- Protein FAM122A Source.2606: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.2607: DFBPPR12236 ---- Animal proteins ---- Protein FAM133 Source.2608: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM Source.2609: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.2610: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.2611: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.2612: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.2613: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1 Source.2614: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.2615: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.2616: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.2617: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor Source.2618: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.2619: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.2620: DFBPPR12299 ---- Animal proteins ---- Myocilin Source.2621: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.2622: DFBPPR12307 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn] Source.2623: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2624: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.2625: DFBPPR12324 ---- Animal proteins ---- Androgen receptor Source.2626: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor Source.2627: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.2628: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain Source.2629: DFBPPR12352 ---- Animal proteins ---- Podocalyxin Source.2630: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.2631: DFBPPR12364 ---- Animal proteins ---- Protein Wnt-5a Source.2632: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.2633: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform Source.2634: DFBPPR12371 ---- Animal proteins ---- Y-box-binding protein 1 Source.2635: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.2636: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.2637: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial Source.2638: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2639: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein Source.2640: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.2641: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1 Source.2642: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma Source.2643: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.2644: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor Source.2645: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.2646: DFBPPR12399 ---- Animal proteins ---- Gap junction alpha-1 protein Source.2647: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.2648: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon Source.2649: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.2650: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1 Source.2651: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.2652: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 Source.2653: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N Source.2654: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2655: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein Source.2656: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.2657: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2 Source.2658: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1 Source.2659: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2660: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain Source.2661: DFBPPR12478 ---- Animal proteins ---- Protein phosphatase 1A Source.2662: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator Source.2663: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha Source.2664: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor Source.2665: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase Source.2666: DFBPPR12504 ---- Animal proteins ---- Collagenase 3 Source.2667: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.2668: DFBPPR12514 ---- Animal proteins ---- Transmembrane protein 109 Source.2669: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.2670: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.2671: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.2672: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.2673: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2674: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.2675: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K Source.2676: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.2677: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2 Source.2678: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6 Source.2679: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K Source.2680: DFBPPR12580 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2 Source.2681: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.2682: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.2683: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT Source.2684: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT Source.2685: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S Source.2686: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1 Source.2687: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.2688: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.2689: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11 Source.2690: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin Source.2691: DFBPPR12642 ---- Animal proteins ---- Haptoglobin Source.2692: DFBPPR12643 ---- Animal proteins ---- Haptoglobin Source.2693: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.2694: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.2695: DFBPPR12709 ---- Animal proteins ---- Somatotropin Source.2696: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.2697: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.2698: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.2699: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.2700: DFBPPR12760 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3 Source.2701: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform Source.2702: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3 Source.2703: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6 Source.2704: DFBPPR12770 ---- Animal proteins ---- Filamin-B Source.2705: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.2706: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.2707: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.2708: DFBPPR12807 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.2709: DFBPPR12811 ---- Animal proteins ---- Heme oxygenase 2 Source.2710: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.2711: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.2712: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.2713: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1 Source.2714: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B Source.2715: DFBPPR12882 ---- Animal proteins ---- Parathyroid hormone-related protein Source.2716: DFBPPR12901 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I Source.2717: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.2718: DFBPPR12921 ---- Animal proteins ---- Cytochrome P450 2C30 Source.2719: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.2720: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2721: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter Source.2722: DFBPPR12978 ---- Animal proteins ---- Endothelin-3 Source.2723: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.2724: DFBPPR12988 ---- Animal proteins ---- Calpastatin Source.2725: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.2726: DFBPPR13002 ---- Animal proteins ---- Complement component C8 gamma chain Source.2727: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.2728: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2 Source.2729: DFBPPR13020 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1 Source.2730: DFBPPR13047 ---- Animal proteins ---- Elongation factor 1-delta Source.2731: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2 Source.2732: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2733: DFBPPR13092 ---- Animal proteins ---- Testin Source.2734: DFBPPR13094 ---- Animal proteins ---- Atherin Source.2735: DFBPPR13122 ---- Animal proteins ---- Ig kappa-b9 chain C region Source.2736: DFBPPR13123 ---- Animal proteins ---- Ig kappa-b5 chain C region Source.2737: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.2738: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2739: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2740: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2741: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.2742: DFBPPR13186 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn] Source.2743: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.2744: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.2745: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2 Source.2746: DFBPPR13218 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.2747: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.2748: DFBPPR13243 ---- Animal proteins ---- Metallothionein-1A Source.2749: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.2750: DFBPPR13263 ---- Animal proteins ---- Serotransferrin Source.2751: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.2752: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.2753: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1 Source.2754: DFBPPR13321 ---- Animal proteins ---- Metallothionein-1B Source.2755: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.2756: DFBPPR13337 ---- Animal proteins ---- Calcitonin gene-related peptide 1 Source.2757: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.2758: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.2759: DFBPPR13371 ---- Animal proteins ---- Calcitonin gene-related peptide 2 Source.2760: DFBPPR13372 ---- Animal proteins ---- Sperm histone P2b Source.2761: DFBPPR13401 ---- Animal proteins ---- Sperm histone P2a Source.2762: DFBPPR13405 ---- Animal proteins ---- 60S acidic ribosomal protein P2 Source.2763: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2764: DFBPPR13409 ---- Animal proteins ---- Testin Source.2765: DFBPPR13428 ---- Animal proteins ---- Appetite-regulating hormone Source.2766: DFBPPR13459 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn] Source.2767: DFBPPR13486 ---- Animal proteins ---- Beta-defensin 1 Source.2768: DFBPPR13503 ---- Animal proteins ---- Keratin, type I cytoskeletal 27 Source.2769: DFBPPR13522 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2 Source.2770: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2771: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2 Source.2772: DFBPPR13543 ---- Animal proteins ---- Myoblast determination protein 1 Source.2773: DFBPPR13544 ---- Animal proteins ---- U8 snoRNA-decapping enzyme Source.2774: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase Source.2775: DFBPPR13569 ---- Animal proteins ---- Fibroblast growth factor 2 Source.2776: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein Source.2777: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.2778: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein Source.2779: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2780: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2781: DFBPPR13619 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.2782: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.2783: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor Source.2784: DFBPPR13637 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial Source.2785: DFBPPR13659 ---- Animal proteins ---- Oxytocin-neurophysin 1 Source.2786: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2 Source.2787: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2788: DFBPPR13700 ---- Animal proteins ---- Metallothionein-1A Source.2789: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.2790: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.2791: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.2792: DFBPPR13758 ---- Animal proteins ---- Metallothionein-2 Source.2793: DFBPPR13774 ---- Animal proteins ---- Trophoblast Kunitz domain protein 1 Source.2794: DFBPPR13776 ---- Animal proteins ---- Keratin, type II microfibrillar, component 7C Source.2795: DFBPPR13785 ---- Animal proteins ---- Bone morphogenetic protein 15 Source.2796: DFBPPR13807 ---- Animal proteins ---- Metallothionein-1C Source.2797: DFBPPR13813 ---- Animal proteins ---- Metallothionein-1B Source.2798: DFBPPR13821 ---- Animal proteins ---- Calcitonin Source.2799: DFBPPR13822 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.2800: DFBPPR13831 ---- Animal proteins ---- Beta-defensin 1 Source.2801: DFBPPR13836 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.2802: DFBPPR13853 ---- Animal proteins ---- Keratin, type II microfibrillar, component 5 Source.2803: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.2804: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.2805: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein Source.2806: DFBPPR13900 ---- Animal proteins ---- Keratin, type I cytoskeletal 15 Source.2807: DFBPPR13907 ---- Animal proteins ---- Shadow of prion protein Source.2808: DFBPPR13908 ---- Animal proteins ---- Shadow of prion protein Source.2809: DFBPPR13909 ---- Animal proteins ---- Homeobox protein Hox-C9 Source.2810: DFBPPR13910 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.2811: DFBPPR13918 ---- Animal proteins ---- Testin Source.2812: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.2813: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter Source.2814: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2815: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.2816: DFBPPR13955 ---- Animal proteins ---- Beta-defensin 2 Source.2817: DFBPPR13959 ---- Animal proteins ---- Calpastatin Source.2818: DFBPPR13961 ---- Animal proteins ---- Elongation factor 1-delta Source.2819: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1 Source.2820: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.2821: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.2822: DFBPPR14005 ---- Animal proteins ---- Fish-egg lectin Source.2823: DFBPPR14016 ---- Animal proteins ---- Gonadotropin subunit beta-1 Source.2824: DFBPPR14082 ---- Marine protein ---- Estrogen receptor Source.2825: DFBPPR14112 ---- Marine protein ---- Proteasome subunit beta type-6-A like protein Source.2826: DFBPPR14114 ---- Marine protein ---- Proteasome subunit beta type-6-B like protein Source.2827: DFBPPR14123 ---- Marine protein ---- Albumin 1 Source.2828: DFBPPR14124 ---- Marine protein ---- Albumin 2 Source.2829: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.2830: DFBPPR14157 ---- Marine protein ---- Ribosome biogenesis protein wdr12 Source.2831: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2 Source.2832: DFBPPR14215 ---- Marine protein ---- Protein SMG9 Source.2833: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial Source.2834: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE Source.2835: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.2836: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1 Source.2837: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase Source.2838: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2839: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE Source.2840: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.2841: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein Source.2842: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic Source.2843: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.2844: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog Source.2845: DFBPPR14401 ---- Marine protein ---- 50S ribosomal protein L4, chloroplastic Source.2846: DFBPPR14407 ---- Marine protein ---- Allophycocyanin alpha-B chain Source.2847: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26 Source.2848: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic Source.2849: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic Source.2850: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator Source.2851: DFBPPR14443 ---- Marine protein ---- 30S ribosomal protein S14, chloroplastic Source.2852: DFBPPR14447 ---- Marine protein ---- Protein translocase subunit SecY Source.2853: DFBPPR14538 ---- Marine protein ---- Estrogen receptor Source.2854: DFBPPR14545 ---- Marine protein ---- Ghrelin Source.2855: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor Source.2856: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2 Source.2857: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.2858: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain Source.2859: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain Source.2860: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.2861: DFBPPR14679 ---- Marine protein ---- Otolith matrix protein 1 Source.2862: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64 Source.2863: DFBPPR14753 ---- Marine protein ---- Clotting factor B Source.2864: DFBPPR14754 ---- Marine protein ---- Clotting factor C Source.2865: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit Source.2866: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic Source.2867: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2 Source.2868: DFBPPR14812 ---- Marine protein ---- Alpha-2-macroglobulin homolog Source.2869: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2870: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase Source.2871: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.2872: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.2873: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1 Source.2874: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.2875: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific Source.2876: DFBPPR14929 ---- Microorganism protein ---- Histone H2A Source.2877: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial Source.2878: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1 Source.2879: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1 Source.2880: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1 Source.2881: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.2882: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.2883: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.2884: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like Source.2885: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2 Source.2886: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.2887: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1 Source.2888: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1 Source.2889: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1 Source.2890: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase Source.2891: DFBPPR15014 ---- Microorganism protein ---- AP-1-like transcription factor YAP1 Source.2892: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.2893: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial Source.2894: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase Source.2895: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial Source.2896: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase Source.2897: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2 Source.2898: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1 Source.2899: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1 Source.2900: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13 Source.2901: DFBPPR15090 ---- Microorganism protein ---- Transketolase Source.2902: DFBPPR15093 ---- Microorganism protein ---- Inner kinetochore subunit AME1 Source.2903: DFBPPR15094 ---- Microorganism protein ---- Thioredoxin reductase, mitochondrial Source.2904: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2 Source.2905: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1 Source.2906: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.2907: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase Source.2908: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial Source.2909: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter Source.2910: DFBPPR15158 ---- Microorganism protein ---- DASH complex subunit DAM1 Source.2911: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3 Source.2912: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.2913: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3 Source.2914: DFBPPR15168 ---- Microorganism protein ---- Chromatin modification-related protein YNG2 Source.2915: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.2916: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial Source.2917: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3 Source.2918: DFBPPR15198 ---- Microorganism protein ---- tRNA:m(4)X modification enzyme TRM13 Source.2919: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23 Source.2920: DFBPPR15223 ---- Microorganism protein ---- FK506-binding protein 2 Source.2921: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial Source.2922: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.2923: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20 Source.2924: DFBPPR15267 ---- Microorganism protein ---- Cofilin Source.2925: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7 Source.2926: DFBPPR15279 ---- Microorganism protein ---- Nuclear fusion protein KAR5 Source.2927: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2 Source.2928: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1 Source.2929: DFBPPR15306 ---- Microorganism protein ---- UDP-N-acetylglucosamine transferase subunit ALG14 Source.2930: DFBPPR15309 ---- Microorganism protein ---- Respiratory supercomplex factor 1, mitochondrial Source.2931: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21 Source.2932: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1 Source.2933: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1 Source.2934: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.2935: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1 Source.2936: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2 Source.2937: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial Source.2938: DFBPPR15408 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI3 Source.2939: DFBPPR15415 ---- Microorganism protein ---- Transcription initiation factor TFIID subunit 4 Source.2940: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial Source.2941: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10 Source.2942: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1 Source.2943: DFBPPR15481 ---- Microorganism protein ---- Probable cytosolic iron-sulfur protein assembly protein 1 Source.2944: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46 Source.2945: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1 Source.2946: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54 Source.2947: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1 Source.2948: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1 Source.2949: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23 Source.2950: DFBPPR15540 ---- Microorganism protein ---- Probable intron-encoded endonuclease aI3 Source.2951: DFBPPR15547 ---- Microorganism protein ---- SWR1-complex protein 5 Source.2952: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.2953: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32 Source.2954: DFBPPR15567 ---- Microorganism protein ---- Mating-type protein A2 Source.2955: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1 Source.2956: DFBPPR15597 ---- Microorganism protein ---- DNA damage-binding protein CMR1 Source.2957: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1 Source.2958: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7 Source.2959: DFBPPR15644 ---- Microorganism protein ---- Cytoplasmic dynein intermediate light chain DYN3 Source.2960: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit Source.2961: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2 Source.2962: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3 Source.2963: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8 Source.2964: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2 Source.2965: DFBPPR15730 ---- Microorganism protein ---- Suppressor of hydroxyurea sensitivity protein 2 Source.2966: DFBPPR15746 ---- Microorganism protein ---- Topoisomerase I damage affected protein 11 Source.2967: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111 Source.2968: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3 Source.2969: DFBPPR15797 ---- Microorganism protein ---- Dihydrofolate reductase Source.2970: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase Source.2971: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase Source.2972: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta Source.2973: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase Source.2974: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3 Source.2975: DFBPPR15850 ---- Microorganism protein ---- Histone H2A Source.2976: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.2977: DFBPPR15860 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial Source.2978: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase Source.2979: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase Source.2980: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1 Source.2981: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2 Source.2982: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1 Source.2983: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase Source.2984: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic Source.2985: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.2986: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic Source.2987: DFBPPR7789 ---- Plant protein ---- Thiamine thiazole synthase 2, chloroplastic Source.2988: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2989: DFBPPR7815 ---- Plant protein ---- Photosystem II reaction center protein H Source.2990: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.2991: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.2992: DFBPPR7850 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.2993: DFBPPR7857 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic Source.2994: DFBPPR7861 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic Source.2995: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1 Source.2996: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1 Source.2997: DFBPPR7907 ---- Plant protein ---- CASP-like protein 2C1 Source.2998: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3 Source.2999: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.3000: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.3001: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic Source.3002: DFBPPR7947 ---- Plant protein ---- Legumin type B Source.3003: DFBPPR7956 ---- Plant protein ---- Legumin type B Source.3004: DFBPPR7957 ---- Plant protein ---- Legumin type B Source.3005: DFBPPR7958 ---- Plant protein ---- Legumin type B Source.3006: DFBPPR7964 ---- Plant protein ---- Sucrose synthase Source.3007: DFBPPR7987 ---- Plant protein ---- Antifungal protein ginkbilobin-2 Source.3008: DFBPPR8029 ---- Plant protein ---- Vignain Source.3009: DFBPPR8064 ---- Plant protein ---- Endochitinase PR4 Source.3010: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3011: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.3012: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme Source.3013: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.3014: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.3015: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.3016: DFBPPR8113 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.3017: DFBPPR8121 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.8 Source.3018: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme Source.3019: DFBPPR8130 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic Source.3020: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.3021: DFBPPR8158 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.0 Source.3022: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase Source.3023: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.3024: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3 Source.3025: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.3026: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.3027: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.3028: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3029: DFBPPR8286 ---- Plant protein ---- Oleosin Source.3030: DFBPPR8289 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.3031: DFBPPR8290 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic Source.3032: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.3033: DFBPPR8303 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Link-research Inductive analysis	Link 1: DFBPACEI1573----Cuttlefish (Sepia officinalis)----Cuttlefish muscle protein

Biological/Functional activity & target protein

ACE-inhibitory activity	The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC₅₀ value of 0.13 ± 0.03 mg/mL, and its ACE inhibitory pattern was shown by Lineweaver–Burk plots to be a non-competitive inhibition pattern.
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Non-bitter taste ^prediction

SMILES

N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(CO)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	Hydrolysis with low mocecular weight alkaline protease.

Stability & Cytotoxicity

Peptide stability

Literature report:	The ACE inhibitory activity of the peptide was not affected by in vitro incubation with gastrointestinal proteases (data not shown). This result suggests that the purified peptide may be resistant to digestion in the gastrointestinal tract.
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

Smooth hound muscle is a promising protein source for the production of ACE inhibitory peptides that could be utilized to develop functional foods for prevention of hypertension.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Bougatef, A., Balti, R., Nedjar-Arroume, N., Ravallec, R., Adjé, E.Y., Souissi, N., et al. Evaluation of angiotensin I-converting enzyme (ACE) inhibitory activities of smooth hound (Mustelus mustelus) muscle protein hydrolysates generated by gastrointestinal proteases: identification of the most potent active peptide. European Food Research and Technology. 2010, 231, 127-35. DOI: 10.1007/s00217-010-1260-4
Other literature(s)	N.D
PubDate	2010