E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI0163(ACE-inhibitory peptide)
DFBP ID DFBPACEI0163
Peptide sequence VAP
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Val-Ala-Pro
Single-letter amino acid VAP
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
452 Da 285.34 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 0.00534 mg/mL (or 18.6 uM)
pIC50 2.272
GRAVY 1.4667 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Grass carp
Precursor protein Grass carp protein hydrolysates
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2
Source.2: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1
Source.3: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.4: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.5: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.6: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5
Source.7: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2
Source.8: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.9: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.10: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.11: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18
Source.12: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46
Source.13: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.14: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.15: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.16: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.17: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1
Source.18: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53
Source.19: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.20: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.21: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.22: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.23: DFBPPR0941 ---- Plant proteins ---- Phosphopantothenoylcysteine decarboxylase
Source.24: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.25: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.26: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.27: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.28: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.29: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.30: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.31: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic
Source.32: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.33: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31
Source.34: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.35: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.36: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.37: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.38: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1
Source.39: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.40: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1
Source.41: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5
Source.42: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.43: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24
Source.44: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.45: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.46: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic
Source.47: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4
Source.48: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic
Source.49: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4
Source.50: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.51: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.52: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.53: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6
Source.54: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.55: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.56: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.57: DFBPPR1167 ---- Plant proteins ---- Phototropin-2
Source.58: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30
Source.59: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2
Source.60: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4
Source.61: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1
Source.62: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.63: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15
Source.64: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24
Source.65: DFBPPR1253 ---- Plant proteins ---- Phospholipase A2 homolog 3
Source.66: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.67: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic
Source.68: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1
Source.69: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.70: DFBPPR1271 ---- Plant proteins ---- CBL-interacting protein kinase 23
Source.71: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.72: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.73: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.74: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.75: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1
Source.76: DFBPPR1297 ---- Plant proteins ---- Peroxygenase
Source.77: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.78: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b
Source.79: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.80: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.81: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7
Source.82: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.83: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.84: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12
Source.85: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.86: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.87: DFBPPR1356 ---- Plant proteins ---- Non-symbiotic hemoglobin 1
Source.88: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1
Source.89: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.90: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.91: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.92: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.93: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.94: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.95: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.96: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5
Source.97: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.98: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.99: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.100: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.101: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.102: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.103: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.104: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.105: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.106: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.107: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.108: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b
Source.109: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.110: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.111: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.112: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.113: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.114: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase
Source.115: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.116: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.117: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.118: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase
Source.119: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.120: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.121: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.122: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.123: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6
Source.124: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5
Source.125: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.126: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.127: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19
Source.128: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.129: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9
Source.130: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6
Source.131: DFBPPR1587 ---- Plant proteins ---- CBL-interacting protein kinase 8
Source.132: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.133: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic
Source.134: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7
Source.135: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.136: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.137: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a
Source.138: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.139: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.140: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic
Source.141: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic
Source.142: DFBPPR1658 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 19
Source.143: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.144: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.145: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.146: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.147: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7
Source.148: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.149: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.150: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic
Source.151: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.152: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.153: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.154: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.155: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.156: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.157: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.158: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.159: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2
Source.160: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.161: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.162: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.163: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4
Source.164: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase
Source.165: DFBPPR1806 ---- Plant proteins ---- Laccase-19
Source.166: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.167: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3
Source.168: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1
Source.169: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.170: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1
Source.171: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.172: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.173: DFBPPR1870 ---- Plant proteins ---- Laccase-20
Source.174: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.175: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2
Source.176: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.177: DFBPPR1881 ---- Plant proteins ---- Protein TIFY 11d
Source.178: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.179: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.180: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4
Source.181: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.182: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2
Source.183: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.184: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.185: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.186: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.187: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.188: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.189: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.190: DFBPPR1988 ---- Plant proteins ---- Protein FLORAL ORGAN NUMBER2
Source.191: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.192: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.193: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28
Source.194: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.195: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.196: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.197: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33
Source.198: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a
Source.199: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.200: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.201: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.202: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial
Source.203: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15
Source.204: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.205: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3
Source.206: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.207: DFBPPR2081 ---- Plant proteins ---- Expansin-A1
Source.208: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.209: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.210: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.211: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.212: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.213: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.214: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.215: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.216: DFBPPR2146 ---- Plant proteins ---- Expansin-B4
Source.217: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.218: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.219: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.220: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.221: DFBPPR2175 ---- Plant proteins ---- Expansin-A16
Source.222: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.223: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2
Source.224: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32
Source.225: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.226: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9
Source.227: DFBPPR2237 ---- Plant proteins ---- Probable glutathione S-transferase GSTU1
Source.228: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.229: DFBPPR2242 ---- Plant proteins ---- Expansin-A3
Source.230: DFBPPR2244 ---- Plant proteins ---- Expansin-A6
Source.231: DFBPPR2245 ---- Plant proteins ---- Expansin-A26
Source.232: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30
Source.233: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.234: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29
Source.235: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2
Source.236: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.237: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.238: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.239: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS
Source.240: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.241: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA
Source.242: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.243: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.244: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2
Source.245: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.246: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b
Source.247: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.248: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1
Source.249: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.250: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.251: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.252: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.253: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.254: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23
Source.255: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10
Source.256: DFBPPR2389 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-1
Source.257: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.258: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.259: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5
Source.260: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.261: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.262: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.263: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic
Source.264: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.265: DFBPPR2434 ---- Plant proteins ---- Non-specific lipid transfer protein-like 1
Source.266: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.267: DFBPPR2438 ---- Plant proteins ---- Arabinogalactan protein 1
Source.268: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.269: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6
Source.270: DFBPPR2448 ---- Plant proteins ---- Expansin-A9
Source.271: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.272: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic
Source.273: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.274: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.275: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.276: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.277: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.278: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase
Source.279: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14
Source.280: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic
Source.281: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic
Source.282: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20
Source.283: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.284: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13
Source.285: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9
Source.286: DFBPPR2520 ---- Plant proteins ---- Metallothionein-like protein 4C
Source.287: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.288: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.289: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.290: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c
Source.291: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.292: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta
Source.293: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.294: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a
Source.295: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.296: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic
Source.297: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b
Source.298: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic
Source.299: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.300: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a
Source.301: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1
Source.302: DFBPPR2595 ---- Plant proteins ---- Expansin-B7
Source.303: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.304: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.305: DFBPPR2614 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.306: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.307: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24
Source.308: DFBPPR2636 ---- Plant proteins ---- Expansin-B8
Source.309: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.310: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18
Source.311: DFBPPR2665 ---- Plant proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.312: DFBPPR2671 ---- Plant proteins ---- Proteasome subunit beta type-2
Source.313: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein
Source.314: DFBPPR2676 ---- Plant proteins ---- Expansin-A11
Source.315: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.316: DFBPPR2678 ---- Plant proteins ---- Thioredoxin-like 1-2, chloroplastic
Source.317: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1
Source.318: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1
Source.319: DFBPPR2690 ---- Plant proteins ---- E3 ubiquitin-protein ligase makorin
Source.320: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27
Source.321: DFBPPR2699 ---- Plant proteins ---- Expansin-A8
Source.322: DFBPPR2710 ---- Plant proteins ---- 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase, chloroplastic
Source.323: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.324: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.325: DFBPPR2733 ---- Plant proteins ---- Metallothionein-like protein 1B
Source.326: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.327: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.328: DFBPPR2751 ---- Plant proteins ---- Actin-7
Source.329: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.330: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2
Source.331: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.332: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.333: DFBPPR2763 ---- Plant proteins ---- Actin-1
Source.334: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.335: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.336: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2
Source.337: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2
Source.338: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.339: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.340: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.341: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.342: DFBPPR2859 ---- Plant proteins ---- Proton pump-interactor BIP131
Source.343: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.344: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2
Source.345: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.346: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.347: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.348: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.349: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.350: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27
Source.351: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1
Source.352: DFBPPR2965 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.353: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.354: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3
Source.355: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic
Source.356: DFBPPR2988 ---- Plant proteins ---- Non-symbiotic hemoglobin 2
Source.357: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.358: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.359: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.360: DFBPPR3017 ---- Plant proteins ---- Expansin-A12
Source.361: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.362: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.363: DFBPPR3027 ---- Plant proteins ---- Expansin-A31
Source.364: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.365: DFBPPR3032 ---- Plant proteins ---- 19.0 kDa class II heat shock protein
Source.366: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1
Source.367: DFBPPR3042 ---- Plant proteins ---- Deoxyuridine 5'-triphosphate nucleotidohydrolase
Source.368: DFBPPR3051 ---- Plant proteins ---- Protein YABBY 3
Source.369: DFBPPR3054 ---- Plant proteins ---- Pectinesterase inhibitor 8
Source.370: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.371: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.372: DFBPPR3087 ---- Plant proteins ---- Actin-3
Source.373: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.374: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2
Source.375: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic
Source.376: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20
Source.377: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.378: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.379: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.380: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic
Source.381: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.382: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.383: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.384: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.385: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.386: DFBPPR3277 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor RA16
Source.387: DFBPPR3292 ---- Plant proteins ---- Non-symbiotic hemoglobin 4
Source.388: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.389: DFBPPR3302 ---- Plant proteins ---- Expansin-A21
Source.390: DFBPPR3305 ---- Plant proteins ---- Non-symbiotic hemoglobin 3
Source.391: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5
Source.392: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.393: DFBPPR3323 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL7
Source.394: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3
Source.395: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic
Source.396: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.397: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.398: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.399: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.400: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6
Source.401: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.402: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2
Source.403: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.404: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.405: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.406: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16
Source.407: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27
Source.408: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68
Source.409: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.410: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2
Source.411: DFBPPR3505 ---- Plant proteins ---- Ribosome biogenesis protein WDR12 homolog
Source.412: DFBPPR3506 ---- Plant proteins ---- Growth-regulating factor 12
Source.413: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14
Source.414: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18
Source.415: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.416: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial
Source.417: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.418: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76
Source.419: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.420: DFBPPR3582 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7c
Source.421: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.422: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1
Source.423: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.424: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.425: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.426: DFBPPR3615 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7b
Source.427: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6
Source.428: DFBPPR3624 ---- Plant proteins ---- RNA pseudouridine synthase 4, mitochondrial
Source.429: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.430: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6
Source.431: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.432: DFBPPR3642 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7e
Source.433: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.434: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.435: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.436: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic
Source.437: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.438: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.439: DFBPPR3677 ---- Plant proteins ---- Auxin-responsive protein IAA25
Source.440: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9
Source.441: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.442: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.443: DFBPPR3686 ---- Plant proteins ---- NifU-like protein 1, chloroplastic
Source.444: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.445: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5
Source.446: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.447: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.448: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71
Source.449: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog
Source.450: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.451: DFBPPR3789 ---- Plant proteins ---- Succinate dehydrogenase subunit 5, mitochondrial
Source.452: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.453: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog
Source.454: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.455: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47
Source.456: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.457: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2
Source.458: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1
Source.459: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1
Source.460: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.461: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.462: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11
Source.463: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26
Source.464: DFBPPR3908 ---- Plant proteins ---- Metallothionein-like protein 1A
Source.465: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.466: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.467: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14
Source.468: DFBPPR3937 ---- Plant proteins ---- Zinc-finger homeodomain protein 10
Source.469: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.470: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10
Source.471: DFBPPR3962 ---- Plant proteins ---- Myb-related protein MYBAS2
Source.472: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2
Source.473: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.474: DFBPPR3998 ---- Plant proteins ---- Protein G1-like9
Source.475: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9
Source.476: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7
Source.477: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.478: DFBPPR4013 ---- Plant proteins ---- Zinc-finger homeodomain protein 11
Source.479: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3
Source.480: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1
Source.481: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.482: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.483: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.484: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.485: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.486: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.487: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog
Source.488: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.489: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.490: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8
Source.491: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.492: DFBPPR4104 ---- Plant proteins ---- Casparian strip membrane protein 5
Source.493: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.494: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2
Source.495: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600
Source.496: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7
Source.497: DFBPPR4151 ---- Plant proteins ---- Metallothionein-like protein 4A
Source.498: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.499: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.500: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3
Source.501: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.502: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.503: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4
Source.504: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.505: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.506: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.507: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.508: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600
Source.509: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.510: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2
Source.511: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.512: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.513: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3
Source.514: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4
Source.515: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.516: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.517: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.518: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8
Source.519: DFBPPR4319 ---- Plant proteins ---- Photosystem I reaction center subunit IX
Source.520: DFBPPR4322 ---- Plant proteins ---- Microtubule-associated protein 70-3
Source.521: DFBPPR4328 ---- Plant proteins ---- Metallothionein-like protein 2A
Source.522: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.523: DFBPPR4336 ---- Plant proteins ---- Putative cyclin-F3-2
Source.524: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5
Source.525: DFBPPR4342 ---- Plant proteins ---- Nucleolin 1
Source.526: DFBPPR4348 ---- Plant proteins ---- Probable calcium-binding protein CML11
Source.527: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1
Source.528: DFBPPR4351 ---- Plant proteins ---- Dehydrin Rab25
Source.529: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3
Source.530: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A
Source.531: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.532: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.533: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B
Source.534: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog
Source.535: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E
Source.536: DFBPPR4378 ---- Plant proteins ---- Basic leucine zipper 6
Source.537: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2
Source.538: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.539: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2
Source.540: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.541: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.542: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9
Source.543: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic
Source.544: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.545: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.546: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.547: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.548: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.549: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.550: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.551: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.552: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1
Source.553: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.554: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1
Source.555: DFBPPR4501 ---- Plant proteins ---- Metallothionein-like protein 4B
Source.556: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.557: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme
Source.558: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.559: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.560: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3
Source.561: DFBPPR4574 ---- Plant proteins ---- Cyclin-C1-1
Source.562: DFBPPR4576 ---- Plant proteins ---- Probable calcium-binding protein CML7
Source.563: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.564: DFBPPR4591 ---- Plant proteins ---- Uncharacterized protein ycf76
Source.565: DFBPPR4595 ---- Plant proteins ---- Tubby-like F-box protein 9
Source.566: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.567: DFBPPR4610 ---- Plant proteins ---- Protein LOL3
Source.568: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.569: DFBPPR4625 ---- Plant proteins ---- Actin-depolymerizing factor 2
Source.570: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2
Source.571: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.572: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic
Source.573: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.574: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.575: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.576: DFBPPR4721 ---- Plant proteins ---- Protein YY1
Source.577: DFBPPR4722 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 10
Source.578: DFBPPR4728 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 12
Source.579: DFBPPR4729 ---- Plant proteins ---- Protein PLASTID REDOX INSENSITIVE 2, chloroplastic
Source.580: DFBPPR4737 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 14
Source.581: DFBPPR4744 ---- Plant proteins ---- BURP domain-containing protein 3
Source.582: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.583: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35
Source.584: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.585: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000
Source.586: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.587: DFBPPR4813 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0157700
Source.588: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6
Source.589: DFBPPR4855 ---- Plant proteins ---- B3 domain-containing protein Os03g0184500
Source.590: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.591: DFBPPR4874 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 1
Source.592: DFBPPR4878 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 10
Source.593: DFBPPR4882 ---- Plant proteins ---- Salt stress root protein RS1
Source.594: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.595: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.596: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1
Source.597: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.598: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID
Source.599: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.600: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.601: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.602: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.603: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.604: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.605: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.606: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin
Source.607: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.608: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.609: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.610: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.611: DFBPPR5081 ---- Plant proteins ---- Proteasome subunit alpha type-5
Source.612: DFBPPR5110 ---- Plant proteins ---- Stress-induced protein SAM22
Source.613: DFBPPR5112 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 1, chloroplastic
Source.614: DFBPPR5113 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 4, chloroplastic
Source.615: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.616: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2
Source.617: DFBPPR5178 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.618: DFBPPR5185 ---- Plant proteins ---- Actin-1
Source.619: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.620: DFBPPR5198 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.621: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.622: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70
Source.623: DFBPPR5260 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.624: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.625: DFBPPR5268 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.626: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.627: DFBPPR5283 ---- Plant proteins ---- Actin-3
Source.628: DFBPPR5307 ---- Plant proteins ---- 4-coumarate--CoA ligase 1
Source.629: DFBPPR5310 ---- Plant proteins ---- Photosystem I reaction center subunit IX
Source.630: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.631: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.632: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.633: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.634: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.635: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein
Source.636: DFBPPR5418 ---- Plant proteins ---- Aquaporin PIP1-1
Source.637: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.638: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.639: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.640: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6
Source.641: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2
Source.642: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.643: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial
Source.644: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.645: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2
Source.646: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.647: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.648: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.649: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.650: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase
Source.651: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.652: DFBPPR5520 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.653: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.654: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.655: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.656: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3
Source.657: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.658: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.659: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.660: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.661: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.662: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.663: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.664: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1
Source.665: DFBPPR5625 ---- Plant proteins ---- Dof zinc finger protein MNB1A
Source.666: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.667: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.668: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2
Source.669: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4
Source.670: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.671: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.672: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.673: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.674: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele
Source.675: DFBPPR5796 ---- Plant proteins ---- Shugoshin-1
Source.676: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.677: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.678: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19
Source.679: DFBPPR5841 ---- Plant proteins ---- Actin-1
Source.680: DFBPPR5856 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.681: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1
Source.682: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.683: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.684: DFBPPR5986 ---- Plant proteins ---- Beta-amylase
Source.685: DFBPPR6035 ---- Plant proteins ---- Photosystem I reaction center subunit IX
Source.686: DFBPPR6081 ---- Plant proteins ---- Zein-alpha 19B1
Source.687: DFBPPR6096 ---- Plant proteins ---- Zein-alpha GZ19AB11
Source.688: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.689: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.690: DFBPPR6125 ---- Plant proteins ---- Cell number regulator 3
Source.691: DFBPPR6139 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 3
Source.692: DFBPPR6142 ---- Plant proteins ---- Metallothionein-like protein 1
Source.693: DFBPPR6145 ---- Plant proteins ---- Ninja-family protein 6
Source.694: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.695: DFBPPR6153 ---- Plant proteins ---- Ninja-family protein 8
Source.696: DFBPPR6154 ---- Plant proteins ---- Ninja-family protein 7
Source.697: DFBPPR6190 ---- Plant proteins ---- Unknown protein from spot 32 of 2D-PAGE of etiolated coleoptile
Source.698: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic
Source.699: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.700: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.701: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.702: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase
Source.703: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.704: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.705: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.706: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic
Source.707: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.708: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic
Source.709: DFBPPR6384 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.710: DFBPPR6439 ---- Plant proteins ---- 20 kDa chaperonin, chloroplastic
Source.711: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.712: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a
Source.713: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2
Source.714: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein
Source.715: DFBPPR6518 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.716: DFBPPR6519 ---- Plant proteins ---- Photosystem I reaction center subunit IX
Source.717: DFBPPR6546 ---- Plant proteins ---- Disease resistance response protein Pi49
Source.718: DFBPPR6547 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.719: DFBPPR6550 ---- Plant proteins ---- Actin-3
Source.720: DFBPPR6551 ---- Plant proteins ---- Actin-2
Source.721: DFBPPR6552 ---- Plant proteins ---- Actin-1
Source.722: DFBPPR6566 ---- Plant proteins ---- ABA-responsive protein ABR17
Source.723: DFBPPR6567 ---- Plant proteins ---- ABA-responsive protein ABR17
Source.724: DFBPPR6606 ---- Plant proteins ---- Unknown protein from spot 251 of 2D-PAGE of thylakoid
Source.725: DFBPPR6616 ---- Plant proteins ---- Disease resistance response protein Pi176
Source.726: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.727: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D
Source.728: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic
Source.729: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B
Source.730: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A
Source.731: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.732: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.733: DFBPPR6708 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.734: DFBPPR6717 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM3
Source.735: DFBPPR6730 ---- Plant proteins ---- Abscisic acid-inducible protein kinase
Source.736: DFBPPR6753 ---- Plant proteins ---- Ferredoxin, chloroplastic
Source.737: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.738: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.739: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.740: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.741: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1
Source.742: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic
Source.743: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic
Source.744: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.745: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.746: DFBPPR6821 ---- Plant proteins ---- bZIP transcription factor 1-B
Source.747: DFBPPR6825 ---- Plant proteins ---- bZIP transcription factor 1-D
Source.748: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.749: DFBPPR6827 ---- Plant proteins ---- bZIP transcription factor 1-A
Source.750: DFBPPR6847 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.751: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta
Source.752: DFBPPR6859 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.753: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.754: DFBPPR6943 ---- Plant proteins ---- Photosystem I reaction center subunit IX
Source.755: DFBPPR6963 ---- Plant proteins ---- Metallothionein-like protein 1
Source.756: DFBPPR6978 ---- Plant proteins ---- Cyclic phosphodiesterase
Source.757: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.758: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.759: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd
Source.760: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.761: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.762: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.763: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.764: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.765: DFBPPR7134 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.766: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial
Source.767: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.768: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3
Source.769: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.770: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.771: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.772: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.773: DFBPPR7216 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.774: DFBPPR7233 ---- Plant proteins ---- Photosystem I reaction center subunit IX
Source.775: DFBPPR7240 ---- Plant proteins ---- Agmatine coumaroyltransferase-2
Source.776: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic
Source.777: DFBPPR7276 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic
Source.778: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.779: DFBPPR7340 ---- Plant proteins ---- 40S ribosomal protein S12
Source.780: DFBPPR7346 ---- Plant proteins ---- 60S ribosomal protein L17-2
Source.781: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.782: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.783: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.784: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.785: DFBPPR7453 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain F1, chloroplastic
Source.786: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.787: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.788: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic
Source.789: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2
Source.790: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.791: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.792: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.793: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA
Source.794: DFBPPR7525 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.795: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.796: DFBPPR7618 ---- Milk proteins ---- Plasminogen
Source.797: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.798: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.799: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.800: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1
Source.801: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor
Source.802: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.803: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.804: DFBPPR7668 ---- Milk proteins ---- Beta-casein
Source.805: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.806: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein
Source.807: DFBPPR7689 ---- Milk proteins ---- Alpha-S2-casein
Source.808: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein
Source.809: DFBPPR7701 ---- Milk proteins ---- Alpha-S2-casein
Source.810: DFBPPR7706 ---- Milk proteins ---- Beta-casein
Source.811: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.812: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein
Source.813: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta
Source.814: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.815: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.816: DFBPPR8359 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.817: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.818: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.819: DFBPPR8420 ---- Plant proteins ---- Peroxygenase
Source.820: DFBPPR8442 ---- Plant proteins ---- Non-specific lipid-transfer protein 5
Source.821: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic
Source.822: DFBPPR8461 ---- Plant proteins ---- Photosystem II reaction center protein H
Source.823: DFBPPR8471 ---- Plant proteins ---- Beta-amylase
Source.824: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein
Source.825: DFBPPR8495 ---- Milk proteins ---- Angiogenin-1
Source.826: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.827: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.828: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3
Source.829: DFBPPR15934 ---- Animal proteins ---- Apolipoprotein A-I
Source.830: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.831: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.832: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.833: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.834: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.835: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.836: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.837: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.838: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.839: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.840: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.841: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.842: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.843: DFBPPR16086 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.844: DFBPPR16089 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.845: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.846: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.847: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.848: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.849: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.850: DFBPPR16165 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.851: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.852: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.853: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.854: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.855: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.856: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.857: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.858: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.859: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.860: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.861: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.862: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.863: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.864: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.865: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.866: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.867: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.868: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.869: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.870: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.871: DFBPPR16571 ---- Animal proteins ---- Pro-MCH
Source.872: DFBPPR16600 ---- Animal proteins ---- Ras-related protein Rab-4B
Source.873: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1
Source.874: DFBPPR16642 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.875: DFBPPR16666 ---- Animal proteins ---- Pro-adrenomedullin
Source.876: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4
Source.877: DFBPPR16701 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog
Source.878: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.879: DFBPPR16737 ---- Animal proteins ---- Trefoil factor 1
Source.880: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.881: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.882: DFBPPR16753 ---- Animal proteins ---- Nicolin-1
Source.883: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.884: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.885: DFBPPR16809 ---- Animal proteins ---- Rhodopsin
Source.886: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X
Source.887: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.888: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.889: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.890: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.891: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII
Source.892: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.893: DFBPPR16903 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate
Source.894: DFBPPR16923 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.895: DFBPPR16930 ---- Animal proteins ---- Apolipoprotein A-I
Source.896: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.897: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.898: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.899: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.900: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.901: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.902: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.903: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.904: DFBPPR16985 ---- Animal proteins ---- Filensin
Source.905: DFBPPR16996 ---- Animal proteins ---- Retinol dehydrogenase 5
Source.906: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.907: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.908: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.909: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP
Source.910: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.911: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.912: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.913: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.914: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.915: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.916: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.917: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.918: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta
Source.919: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.920: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.921: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.922: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.923: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.924: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.925: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.926: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.927: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase
Source.928: DFBPPR17256 ---- Animal proteins ---- X-box-binding protein 1
Source.929: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.930: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.931: DFBPPR17273 ---- Animal proteins ---- Integrin-linked protein kinase
Source.932: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.933: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2
Source.934: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.935: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.936: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.937: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.938: DFBPPR17324 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.939: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.940: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.941: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.942: DFBPPR17371 ---- Animal proteins ---- Autophagy protein 5
Source.943: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.944: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.945: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.946: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.947: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.948: DFBPPR17423 ---- Animal proteins ---- Furin
Source.949: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.950: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.951: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.952: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.953: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1
Source.954: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3
Source.955: DFBPPR17467 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.956: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase
Source.957: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.958: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase
Source.959: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.960: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.961: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.962: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase
Source.963: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.964: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein
Source.965: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.966: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6
Source.967: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.968: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1
Source.969: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1
Source.970: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.971: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.972: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.973: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.974: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.975: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.976: DFBPPR17666 ---- Animal proteins ---- Diphosphoinositol polyphosphate phosphohydrolase 3-beta
Source.977: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16
Source.978: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.979: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2
Source.980: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.981: DFBPPR17774 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.982: DFBPPR17776 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.983: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3
Source.984: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.985: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.986: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial
Source.987: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.988: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.989: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.990: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.991: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.992: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial
Source.993: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.994: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.995: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.996: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.997: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.998: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.999: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.1000: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B
Source.1001: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.1002: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase
Source.1003: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.1004: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.1005: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.1006: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.1007: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta
Source.1008: DFBPPR18092 ---- Animal proteins ---- Carbonyl reductase family member 4
Source.1009: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33
Source.1010: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.1011: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23
Source.1012: DFBPPR18118 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 8
Source.1013: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.1014: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3
Source.1015: DFBPPR18125 ---- Animal proteins ---- Serine/threonine-protein kinase VRK1
Source.1016: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1
Source.1017: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.1018: DFBPPR18143 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 7
Source.1019: DFBPPR18146 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 9
Source.1020: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.1021: DFBPPR18171 ---- Animal proteins ---- Anionic trypsin
Source.1022: DFBPPR18191 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-2
Source.1023: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.1024: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.1025: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.1026: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.1027: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.1028: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase
Source.1029: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.1030: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1
Source.1031: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1
Source.1032: DFBPPR18358 ---- Animal proteins ---- Lymphatic vessel endothelial hyaluronic acid receptor 1
Source.1033: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.1034: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.1035: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.1036: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase
Source.1037: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1
Source.1038: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.1039: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.1040: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.1041: DFBPPR18459 ---- Animal proteins ---- Transcription factor AP-1
Source.1042: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1
Source.1043: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.1044: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.1045: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent
Source.1046: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.1047: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.1048: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3
Source.1049: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.1050: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2
Source.1051: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta
Source.1052: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.1053: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.1054: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3
Source.1055: DFBPPR18713 ---- Animal proteins ---- Arginase-1
Source.1056: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor
Source.1057: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase
Source.1058: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.1059: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8
Source.1060: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.1061: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.1062: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2
Source.1063: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase
Source.1064: DFBPPR18853 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor D
Source.1065: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase
Source.1066: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.1067: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.1068: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20
Source.1069: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3
Source.1070: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2
Source.1071: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.1072: DFBPPR18948 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL1
Source.1073: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1
Source.1074: DFBPPR18986 ---- Animal proteins ---- Granzyme A
Source.1075: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase
Source.1076: DFBPPR19004 ---- Animal proteins ---- Histone H1.3
Source.1077: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.1078: DFBPPR19056 ---- Animal proteins ---- Gastrin
Source.1079: DFBPPR19072 ---- Animal proteins ---- Growth/differentiation factor 9
Source.1080: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3
Source.1081: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.1082: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1
Source.1083: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1084: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2
Source.1085: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.1086: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.1087: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5
Source.1088: DFBPPR19153 ---- Animal proteins ---- Copine-6
Source.1089: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2
Source.1090: DFBPPR19162 ---- Animal proteins ---- Macrophage-capping protein
Source.1091: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16
Source.1092: DFBPPR19181 ---- Animal proteins ---- Solute carrier family 25 member 33
Source.1093: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1094: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.1095: DFBPPR19196 ---- Animal proteins ---- Melanoma-derived growth regulatory protein
Source.1096: DFBPPR19198 ---- Animal proteins ---- Cadherin-3
Source.1097: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.1098: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1
Source.1099: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.1100: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.1101: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.1102: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2
Source.1103: DFBPPR19295 ---- Animal proteins ---- 26S proteasome regulatory subunit 7
Source.1104: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.1105: DFBPPR19316 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 2, mitochondrial
Source.1106: DFBPPR19327 ---- Animal proteins ---- DNA repair protein RAD51 homolog 4
Source.1107: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85
Source.1108: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.1109: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor
Source.1110: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.1111: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.1112: DFBPPR19451 ---- Animal proteins ---- Proline/serine-rich coiled-coil protein 1
Source.1113: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20
Source.1114: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.1115: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1
Source.1116: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.1117: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain
Source.1118: DFBPPR19499 ---- Animal proteins ---- Transcription factor MafG
Source.1119: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.1120: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.1121: DFBPPR19549 ---- Animal proteins ---- Mitochondrial RNA pseudouridine synthase RPUSD4
Source.1122: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9
Source.1123: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.1124: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein
Source.1125: DFBPPR19597 ---- Animal proteins ---- Protein HEXIM1
Source.1126: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.1127: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.1128: DFBPPR19656 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1129: DFBPPR19659 ---- Animal proteins ---- 39S ribosomal protein L9, mitochondrial
Source.1130: DFBPPR19663 ---- Animal proteins ---- Synembryn-A
Source.1131: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.1132: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1
Source.1133: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.1134: DFBPPR19752 ---- Animal proteins ---- Chromatin target of PRMT1 protein
Source.1135: DFBPPR19762 ---- Animal proteins ---- Mitochondrial fission factor
Source.1136: DFBPPR19785 ---- Animal proteins ---- Calcyclin-binding protein
Source.1137: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.1138: DFBPPR19799 ---- Animal proteins ---- Migration and invasion enhancer 1
Source.1139: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2
Source.1140: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.1141: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial
Source.1142: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3
Source.1143: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.1144: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.1145: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.1146: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2
Source.1147: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.1148: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.1149: DFBPPR19927 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] flavoprotein 3, mitochondrial
Source.1150: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2
Source.1151: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor
Source.1152: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.1153: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter
Source.1154: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27
Source.1155: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.1156: DFBPPR19992 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm3
Source.1157: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1
Source.1158: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3
Source.1159: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.1160: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4
Source.1161: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.1162: DFBPPR20044 ---- Animal proteins ---- Secernin-1
Source.1163: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein
Source.1164: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1
Source.1165: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.1166: DFBPPR20123 ---- Animal proteins ---- Securin
Source.1167: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.1168: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1
Source.1169: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a
Source.1170: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7
Source.1171: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12
Source.1172: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1
Source.1173: DFBPPR20263 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 54
Source.1174: DFBPPR20273 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT14
Source.1175: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.1176: DFBPPR20304 ---- Animal proteins ---- Nuclear envelope phosphatase-regulatory subunit 1
Source.1177: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14
Source.1178: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.1179: DFBPPR20350 ---- Animal proteins ---- Pinin
Source.1180: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.1181: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.1182: DFBPPR20396 ---- Animal proteins ---- Claudin-5
Source.1183: DFBPPR20409 ---- Animal proteins ---- DNA damage-regulated autophagy modulator protein 2
Source.1184: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein
Source.1185: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.1186: DFBPPR20442 ---- Animal proteins ---- DNA replication complex GINS protein SLD5
Source.1187: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2
Source.1188: DFBPPR20459 ---- Animal proteins ---- Transcription factor MafF
Source.1189: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.1190: DFBPPR20482 ---- Animal proteins ---- Tripartite motif-containing protein 54
Source.1191: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase
Source.1192: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.1193: DFBPPR20530 ---- Animal proteins ---- Protein HEXIM2
Source.1194: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.1195: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3
Source.1196: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4
Source.1197: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta
Source.1198: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16
Source.1199: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6
Source.1200: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.1201: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.1202: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52
Source.1203: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.1204: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein
Source.1205: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.1206: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.1207: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.1208: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease
Source.1209: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.1210: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial
Source.1211: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.1212: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1
Source.1213: DFBPPR20733 ---- Animal proteins ---- Integrator complex subunit 12
Source.1214: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1
Source.1215: DFBPPR20748 ---- Animal proteins ---- Protein ABHD14B
Source.1216: DFBPPR20771 ---- Animal proteins ---- Dynein light chain roadblock-type 1
Source.1217: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.1218: DFBPPR20784 ---- Animal proteins ---- Dynein light chain roadblock-type 2
Source.1219: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171
Source.1220: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.1221: DFBPPR20816 ---- Animal proteins ---- Ribosomal L1 domain-containing protein 1
Source.1222: DFBPPR20868 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.1223: DFBPPR20892 ---- Animal proteins ---- Lysosomal thioesterase PPT2
Source.1224: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.1225: DFBPPR20902 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 2 homolog
Source.1226: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor
Source.1227: DFBPPR20938 ---- Animal proteins ---- Serine protease HTR4
Source.1228: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.1229: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1
Source.1230: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.1231: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.1232: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.1233: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.1234: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.1235: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B
Source.1236: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.1237: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2
Source.1238: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.1239: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.1240: DFBPPR21098 ---- Animal proteins ---- Pre T-cell antigen receptor alpha
Source.1241: DFBPPR21103 ---- Animal proteins ---- F-box only protein 32
Source.1242: DFBPPR21121 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-3
Source.1243: DFBPPR21147 ---- Animal proteins ---- Transmembrane protein 88
Source.1244: DFBPPR21149 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 4
Source.1245: DFBPPR21150 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.1246: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.1247: DFBPPR21183 ---- Animal proteins ---- LIM and cysteine-rich domains protein 1
Source.1248: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal
Source.1249: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.1250: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2
Source.1251: DFBPPR21232 ---- Animal proteins ---- Cerebellin-3
Source.1252: DFBPPR21240 ---- Animal proteins ---- 6-phosphogluconolactonase
Source.1253: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1
Source.1254: DFBPPR21291 ---- Animal proteins ---- 39S ribosomal protein L18, mitochondrial
Source.1255: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.1256: DFBPPR21339 ---- Animal proteins ---- Zinc finger protein 692
Source.1257: DFBPPR21346 ---- Animal proteins ---- Ameloblastin
Source.1258: DFBPPR21350 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.1259: DFBPPR21352 ---- Animal proteins ---- Glutathione peroxidase 7
Source.1260: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.1261: DFBPPR21379 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.1262: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2
Source.1263: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B
Source.1264: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.1265: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog
Source.1266: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C
Source.1267: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2
Source.1268: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3
Source.1269: DFBPPR21536 ---- Animal proteins ---- Alpha-1-acid glycoprotein
Source.1270: DFBPPR21544 ---- Animal proteins ---- General transcription factor IIE subunit 2
Source.1271: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.1272: DFBPPR21589 ---- Animal proteins ---- Dynein regulatory complex protein 10
Source.1273: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.1274: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.1275: DFBPPR21622 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.1276: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.1277: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.1278: DFBPPR21692 ---- Animal proteins ---- Mitotic-spindle organizing protein 2
Source.1279: DFBPPR21693 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 18
Source.1280: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.1281: DFBPPR21717 ---- Animal proteins ---- Transmembrane protein 134
Source.1282: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2
Source.1283: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3
Source.1284: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.1285: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.1286: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.1287: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1
Source.1288: DFBPPR21758 ---- Animal proteins ---- Submaxillary mucin-like protein
Source.1289: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.1290: DFBPPR21787 ---- Animal proteins ---- PRA1 family protein 2
Source.1291: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B
Source.1292: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.1293: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein
Source.1294: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.1295: DFBPPR21923 ---- Animal proteins ---- Endophilin-B2
Source.1296: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1
Source.1297: DFBPPR22053 ---- Animal proteins ---- Protein FAM118B
Source.1298: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.1299: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2
Source.1300: DFBPPR22111 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.1301: DFBPPR22116 ---- Animal proteins ---- CB1 cannabinoid receptor-interacting protein 1
Source.1302: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.1303: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog
Source.1304: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1
Source.1305: DFBPPR22148 ---- Animal proteins ---- Hemogen
Source.1306: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2
Source.1307: DFBPPR22165 ---- Animal proteins ---- Coiled-coil domain-containing protein 106
Source.1308: DFBPPR22210 ---- Animal proteins ---- Peroxisomal membrane protein 4
Source.1309: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.1310: DFBPPR22267 ---- Animal proteins ---- Keratin-associated protein 12-2
Source.1311: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.1312: DFBPPR22300 ---- Animal proteins ---- S100P-binding protein
Source.1313: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2
Source.1314: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.1315: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180
Source.1316: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.1317: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23
Source.1318: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4
Source.1319: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1
Source.1320: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9
Source.1321: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog
Source.1322: DFBPPR22457 ---- Animal proteins ---- Cilia- and flagella-associated protein 97
Source.1323: DFBPPR22470 ---- Animal proteins ---- Coiled-coil domain-containing protein 137
Source.1324: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.1325: DFBPPR22539 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 18
Source.1326: DFBPPR22543 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 3
Source.1327: DFBPPR22563 ---- Animal proteins ---- Methenyltetrahydrofolate synthase domain-containing protein
Source.1328: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.1329: DFBPPR22601 ---- Animal proteins ---- Leukocyte receptor cluster member 1 homolog
Source.1330: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1
Source.1331: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein
Source.1332: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C
Source.1333: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.1334: DFBPPR22690 ---- Animal proteins ---- Proline-rich protein 19
Source.1335: DFBPPR22761 ---- Animal proteins ---- Uncharacterized protein C10orf120 homolog
Source.1336: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.1337: DFBPPR8538 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.1338: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.1339: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.1340: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.1341: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.1342: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.1343: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.1344: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.1345: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.1346: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.1347: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.1348: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.1349: DFBPPR8634 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.1350: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.1351: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.1352: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A
Source.1353: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.1354: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1355: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.1356: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.1357: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.1358: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1359: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.1360: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.1361: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.1362: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.1363: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.1364: DFBPPR8784 ---- Animal proteins ---- Transcription factor AP-1
Source.1365: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.1366: DFBPPR8795 ---- Animal proteins ---- Pro-adrenomedullin
Source.1367: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.1368: DFBPPR8813 ---- Animal proteins ---- Apolipoprotein A-IV
Source.1369: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.1370: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1
Source.1371: DFBPPR8880 ---- Animal proteins ---- Apolipoprotein A-I
Source.1372: DFBPPR8883 ---- Animal proteins ---- Apolipoprotein A-I
Source.1373: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.1374: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B
Source.1375: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.1376: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.1377: DFBPPR8939 ---- Animal proteins ---- Kit ligand
Source.1378: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.1379: DFBPPR8970 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.1380: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.1381: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1382: DFBPPR9012 ---- Animal proteins ---- Orexin
Source.1383: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.1384: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.1385: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1
Source.1386: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.1387: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor
Source.1388: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1389: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A
Source.1390: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6
Source.1391: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.1392: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.1393: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.1394: DFBPPR9216 ---- Animal proteins ---- Netrin-1
Source.1395: DFBPPR9222 ---- Animal proteins ---- Glutathione peroxidase 1
Source.1396: DFBPPR9235 ---- Animal proteins ---- Apomucin
Source.1397: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.1398: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.1399: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1400: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1
Source.1401: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase
Source.1402: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.1403: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.1404: DFBPPR9433 ---- Animal proteins ---- Autophagy protein 5
Source.1405: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.1406: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.1407: DFBPPR9646 ---- Animal proteins ---- Melanin-concentrating hormone receptor 1
Source.1408: DFBPPR9693 ---- Animal proteins ---- LIM and cysteine-rich domains protein 1
Source.1409: DFBPPR9700 ---- Animal proteins ---- Galectin-1
Source.1410: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.1411: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.1412: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.1413: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha
Source.1414: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1
Source.1415: DFBPPR9785 ---- Animal proteins ---- F-box only protein 32
Source.1416: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.1417: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17
Source.1418: DFBPPR9893 ---- Animal proteins ---- MICOS complex subunit MIC13
Source.1419: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.1420: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.1421: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.1422: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1423: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.1424: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain
Source.1425: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b
Source.1426: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src
Source.1427: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.1428: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.1429: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.1430: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.1431: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1432: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.1433: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.1434: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.1435: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.1436: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.1437: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7
Source.1438: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.1439: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8
Source.1440: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.1441: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.1442: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.1443: DFBPPR10178 ---- Animal proteins ---- Homeobox protein SIX3
Source.1444: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.1445: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein
Source.1446: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk
Source.1447: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3
Source.1448: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.1449: DFBPPR10205 ---- Animal proteins ---- Noelin
Source.1450: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.1451: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.1452: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.1453: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1
Source.1454: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2
Source.1455: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.1456: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.1457: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.1458: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.1459: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.1460: DFBPPR10286 ---- Animal proteins ---- Avidin
Source.1461: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.1462: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1463: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.1464: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1
Source.1465: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.1466: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.1467: DFBPPR10341 ---- Animal proteins ---- Brain acid soluble protein 1 homolog
Source.1468: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.1469: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.1470: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.1471: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.1472: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.1473: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.1474: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.1475: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.1476: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.1477: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.1478: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16
Source.1479: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1480: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.1481: DFBPPR10485 ---- Animal proteins ---- LIM domain-binding protein 1
Source.1482: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.1483: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.1484: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.1485: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.1486: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.1487: DFBPPR10550 ---- Animal proteins ---- Flap endonuclease 1
Source.1488: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1
Source.1489: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.1490: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.1491: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.1492: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.1493: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.1494: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.1495: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.1496: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.1497: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.1498: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1499: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1500: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.1501: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.1502: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4
Source.1503: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin
Source.1504: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.1505: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.1506: DFBPPR10761 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-A
Source.1507: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5
Source.1508: DFBPPR10778 ---- Animal proteins ---- Avidin-related protein 2
Source.1509: DFBPPR10794 ---- Animal proteins ---- Zyxin
Source.1510: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.1511: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.1512: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.1513: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha
Source.1514: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.1515: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.1516: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.1517: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.1518: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.1519: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.1520: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.1521: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.1522: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.1523: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.1524: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase
Source.1525: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.1526: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.1527: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor
Source.1528: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.1529: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20
Source.1530: DFBPPR11030 ---- Animal proteins ---- Protein C-ets-2
Source.1531: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.1532: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.1533: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.1534: DFBPPR11047 ---- Animal proteins ---- Nucleolin
Source.1535: DFBPPR11060 ---- Animal proteins ---- Netrin-3
Source.1536: DFBPPR11066 ---- Animal proteins ---- Protein sprouty homolog 2
Source.1537: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.1538: DFBPPR11110 ---- Animal proteins ---- Lamin-B1
Source.1539: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3
Source.1540: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.1541: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta
Source.1542: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1
Source.1543: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.1544: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.1545: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.1546: DFBPPR11254 ---- Animal proteins ---- Intracellular hyaluronan-binding protein 4
Source.1547: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.1548: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.1549: DFBPPR11281 ---- Animal proteins ---- LIM domain-binding protein 2
Source.1550: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.1551: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1552: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.1553: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.1554: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2
Source.1555: DFBPPR11327 ---- Animal proteins ---- Integrin alpha-1
Source.1556: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX
Source.1557: DFBPPR11393 ---- Animal proteins ---- Avidin-related protein 4/5
Source.1558: DFBPPR11398 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.1559: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.1560: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.1561: DFBPPR11434 ---- Animal proteins ---- Homeobox protein SIX6
Source.1562: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.1563: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7
Source.1564: DFBPPR11473 ---- Animal proteins ---- G2/M phase-specific E3 ubiquitin-protein ligase
Source.1565: DFBPPR11475 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-B
Source.1566: DFBPPR11479 ---- Animal proteins ---- Rab-like protein 3
Source.1567: DFBPPR11513 ---- Animal proteins ---- Corepressor interacting with RBPJ 1
Source.1568: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.1569: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2
Source.1570: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.1571: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.1572: DFBPPR11665 ---- Animal proteins ---- Shadow of prion protein
Source.1573: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.1574: DFBPPR11686 ---- Animal proteins ---- Class II histocompatibility antigen, B-L beta chain
Source.1575: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1
Source.1576: DFBPPR11702 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.1577: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.1578: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.1579: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5
Source.1580: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1
Source.1581: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.1582: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.1583: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.1584: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36
Source.1585: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.1586: DFBPPR11879 ---- Animal proteins ---- Nicalin
Source.1587: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.1588: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B
Source.1589: DFBPPR11952 ---- Animal proteins ---- Avidin-related protein 1
Source.1590: DFBPPR11973 ---- Animal proteins ---- Avidin-related protein 3
Source.1591: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.1592: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130
Source.1593: DFBPPR12002 ---- Animal proteins ---- Avidin-related protein 6
Source.1594: DFBPPR12006 ---- Animal proteins ---- Avidin-related protein 7
Source.1595: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.1596: DFBPPR12036 ---- Animal proteins ---- BLOC-1-related complex subunit 5
Source.1597: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.1598: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.1599: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.1600: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme
Source.1601: DFBPPR12095 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1
Source.1602: DFBPPR12106 ---- Animal proteins ---- Ig lambda chain C region
Source.1603: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.1604: DFBPPR12154 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.1605: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1
Source.1606: DFBPPR12180 ---- Animal proteins ---- Arylamine N-acetyltransferase, liver isozyme
Source.1607: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein
Source.1608: DFBPPR12248 ---- Animal proteins ---- Fructose-bisphosphate aldolase A
Source.1609: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.1610: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.1611: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5
Source.1612: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.1613: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.1614: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.1615: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.1616: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.1617: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.1618: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.1619: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1
Source.1620: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.1621: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2
Source.1622: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.1623: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.1624: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1
Source.1625: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.1626: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1627: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.1628: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.1629: DFBPPR12386 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.1630: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.1631: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.1632: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.1633: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.1634: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1635: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.1636: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.1637: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.1638: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.1639: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.1640: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase
Source.1641: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.1642: DFBPPR12511 ---- Animal proteins ---- Serine/threonine-protein kinase 17A
Source.1643: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.1644: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.1645: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.1646: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1647: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.1648: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.1649: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K
Source.1650: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.1651: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5
Source.1652: DFBPPR12615 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.1653: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.1654: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.1655: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.1656: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor
Source.1657: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.1658: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.1659: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.1660: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.1661: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1
Source.1662: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1
Source.1663: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.1664: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.1665: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.1666: DFBPPR12789 ---- Animal proteins ---- CD59 glycoprotein
Source.1667: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.1668: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter
Source.1669: DFBPPR12831 ---- Animal proteins ---- Serine--pyruvate aminotransferase
Source.1670: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.1671: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11
Source.1672: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.1673: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2
Source.1674: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1
Source.1675: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.1676: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.1677: DFBPPR12978 ---- Animal proteins ---- Endothelin-3
Source.1678: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.1679: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.1680: DFBPPR13002 ---- Animal proteins ---- Complement component C8 gamma chain
Source.1681: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein
Source.1682: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.1683: DFBPPR13116 ---- Animal proteins ---- Ig gamma chain C region
Source.1684: DFBPPR13117 ---- Animal proteins ---- Ig kappa-b4 chain C region
Source.1685: DFBPPR13135 ---- Animal proteins ---- Ig kappa-b4 chain C region
Source.1686: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.1687: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1688: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.1689: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain
Source.1690: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.1691: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain
Source.1692: DFBPPR13196 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.1693: DFBPPR13204 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.1694: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.1695: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2
Source.1696: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1697: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1
Source.1698: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.1699: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.1700: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.1701: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.1702: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.1703: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.1704: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9
Source.1705: DFBPPR13549 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.1706: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.1707: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.1708: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.1709: DFBPPR13584 ---- Animal proteins ---- Calpain-3
Source.1710: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1711: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.1712: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1713: DFBPPR13620 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.1714: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.1715: DFBPPR13628 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.1716: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.1717: DFBPPR13678 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1718: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.1719: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1
Source.1720: DFBPPR13690 ---- Animal proteins ---- Angiotensinogen
Source.1721: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.1722: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21
Source.1723: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.1724: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor
Source.1725: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.1726: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9
Source.1727: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.1728: DFBPPR13853 ---- Animal proteins ---- Keratin, type II microfibrillar, component 5
Source.1729: DFBPPR13863 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.1730: DFBPPR13875 ---- Animal proteins ---- Gastrin
Source.1731: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.1732: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.1733: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.1734: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.1735: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.1736: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.1737: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.1738: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.1739: DFBPPR14022 ---- Animal proteins ---- Transcriptional regulator Myc-1
Source.1740: DFBPPR14023 ---- Animal proteins ---- Transcriptional regulator Myc-2
Source.1741: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.1742: DFBPPR14078 ---- Marine protein ---- Histone H1
Source.1743: DFBPPR14123 ---- Marine protein ---- Albumin 1
Source.1744: DFBPPR14124 ---- Marine protein ---- Albumin 2
Source.1745: DFBPPR14140 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.1746: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I
Source.1747: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1
Source.1748: DFBPPR14152 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4L
Source.1749: DFBPPR14163 ---- Marine protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.1750: DFBPPR14257 ---- Marine protein ---- Somatolactin
Source.1751: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.1752: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1753: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.1754: DFBPPR14367 ---- Marine protein ---- Cytochrome f
Source.1755: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.1756: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.1757: DFBPPR14399 ---- Marine protein ---- Allophycocyanin subunit beta-18
Source.1758: DFBPPR14415 ---- Marine protein ---- Photosystem II reaction center protein H
Source.1759: DFBPPR14531 ---- Marine protein ---- Protein PYP1
Source.1760: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.1761: DFBPPR14559 ---- Marine protein ---- Histone H1
Source.1762: DFBPPR14585 ---- Marine protein ---- Hemoglobin subunit alpha-4
Source.1763: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase
Source.1764: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.1765: DFBPPR14659 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4L
Source.1766: DFBPPR14663 ---- Marine protein ---- Transcriptional regulator Myc
Source.1767: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A
Source.1768: DFBPPR14671 ---- Marine protein ---- Toll-interacting protein B
Source.1769: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.1770: DFBPPR14843 ---- Marine protein ---- Cuticle protein AMP5
Source.1771: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233
Source.1772: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.1773: DFBPPR14884 ---- Microorganism protein ---- Negative regulator of the PHO system
Source.1774: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.1775: DFBPPR14908 ---- Microorganism protein ---- Flap endonuclease 1
Source.1776: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.1777: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1
Source.1778: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.1779: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.1780: DFBPPR14935 ---- Microorganism protein ---- Actin
Source.1781: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.1782: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.1783: DFBPPR14961 ---- Microorganism protein ---- Alcohol dehydrogenase 1
Source.1784: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2
Source.1785: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.1786: DFBPPR15002 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.1787: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1
Source.1788: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.1789: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.1790: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial
Source.1791: DFBPPR15045 ---- Microorganism protein ---- Enolase
Source.1792: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.1793: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.1794: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.1795: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.1796: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1
Source.1797: DFBPPR15092 ---- Microorganism protein ---- Alcohol dehydrogenase 3, mitochondrial
Source.1798: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.1799: DFBPPR15105 ---- Microorganism protein ---- Arginase
Source.1800: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial
Source.1801: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.1802: DFBPPR15140 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP6
Source.1803: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase
Source.1804: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3
Source.1805: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.1806: DFBPPR15186 ---- Microorganism protein ---- Alcohol dehydrogenase 2
Source.1807: DFBPPR15198 ---- Microorganism protein ---- tRNA:m(4)X modification enzyme TRM13
Source.1808: DFBPPR15199 ---- Microorganism protein ---- mRNA-capping enzyme subunit alpha
Source.1809: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1
Source.1810: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.1811: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.1812: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3
Source.1813: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.1814: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.1815: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1
Source.1816: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3
Source.1817: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.1818: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.1819: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.1820: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.1821: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2
Source.1822: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.1823: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1
Source.1824: DFBPPR15464 ---- Microorganism protein ---- Pre-rRNA-processing protein PNO1
Source.1825: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.1826: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.1827: DFBPPR15531 ---- Microorganism protein ---- DNA replication complex GINS protein SLD5
Source.1828: DFBPPR15532 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit beta
Source.1829: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase
Source.1830: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.1831: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.1832: DFBPPR15637 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLT11
Source.1833: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit
Source.1834: DFBPPR15663 ---- Microorganism protein ---- Spindle pole component BBP1
Source.1835: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.1836: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.1837: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23
Source.1838: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.1839: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.1840: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.1841: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.1842: DFBPPR15813 ---- Microorganism protein ---- Anthranilate phosphoribosyltransferase
Source.1843: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.1844: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein
Source.1845: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1
Source.1846: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase
Source.1847: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.1848: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.1849: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.1850: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1851: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase
Source.1852: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1853: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1854: DFBPPR7815 ---- Plant protein ---- Photosystem II reaction center protein H
Source.1855: DFBPPR7830 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.1856: DFBPPR7844 ---- Plant protein ---- Actin-1
Source.1857: DFBPPR7896 ---- Plant protein ---- Photosystem I reaction center subunit IX
Source.1858: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2
Source.1859: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic
Source.1860: DFBPPR7961 ---- Plant protein ---- FKBP-type peptidyl-prolyl cis-trans isomerase, chloroplastic
Source.1861: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1862: DFBPPR7993 ---- Plant protein ---- Peroxidase
Source.1863: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1864: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.1865: DFBPPR8106 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.1866: DFBPPR8107 ---- Plant protein ---- Stress-related protein
Source.1867: DFBPPR8108 ---- Plant protein ---- Pathogenesis-related protein 1
Source.1868: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.1869: DFBPPR8141 ---- Plant protein ---- Photosystem I reaction center subunit IX
Source.1870: DFBPPR8150 ---- Plant protein ---- Pathogenesis-related protein 2
Source.1871: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1872: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1873: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1874: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1875: DFBPPR8261 ---- Plant protein ---- Photosystem II reaction center protein H
Source.1876: DFBPPR8276 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.1877: DFBPPR8277 ---- Plant protein ---- Profilin
Source.1878: DFBPPR8326 ---- Plant protein ---- Photosystem I reaction center subunit IX
Link-research
Link 1: DFBPACEI0323----Milk protein----αs1-Casein
Link 2: DFBPACEI1930----Amaranth seed proteins----Amaranth glutelins
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 0.00534 mg/mL (or 18.6 uM), and its ACE inhibitory pattern was shown by Lineweaver–Burk plots to be a competitive inhibition pattern.

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)O
Preparation method
Mode of preparation Enzymatic hydrolysis
Enzyme(s)/starter culture Grass carp was hydrolyzed with Alcalase.
Stability & Cytotoxicity
Peptide stability
Literature report:

The IC50 values showed no impacts of digestive enzymes on ACE-inhibitory activity of VAP, so the results suggest that VAP is stable against gastrointestinal enzymes of pepsin and chymotrypsin.

EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

The purified VAP may be used for therapy of hypertension and admitted orally. The hydrolysate can be used as nutraceutics alone or together with other compounds as functional foods to prevent and/or treat hypertension.

Database cross-references
BIOPEP-UWM [D1] 3521
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Chen J, Wang Y, Zhong Q, Wu Y, Xia W. Purification and characterization of a novel angiotensin-I converting enzyme (ACE) inhibitory peptide derived from enzymatic hydrolysate of grass carp protein. Peptides. 2012 Jan;33(1):52-8.
PMID: 22100519
Other literature(s) [1] Wang S, Lin L M, Wu Y N, et al. Angiotensin I Converting Enzyme (ACE) inhibitory activity and antihypertensive effects of grass carp peptides[J]. Food Science (&) Biotechnology, 2014, 23(5):1661-1666.
PubDate 2012
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214