DFBP ID - DFBPACEI0453(ACE-inhibitory peptide) |
DFBP ID |
DFBPACEI0453 |
Peptide sequence |
LKL |
Type |
Native peptide |
Peptide/Function name |
ACE-inhibitory peptide |
|
Function-activity relationship |
Main bioactivity |
ACE-inhibitory activity |
Otheir bioactivity |
N.D |
|
Calculated physicochemical properties |
Three-letter amino acid |
Leu-Lys-Leu |
Single-letter amino acid |
LKL |
Peptide length |
3 |
Peptide mass |
Experimental mass |
Theoretical mass |
N.D |
372.50 Da c |
|
Net charge |
0.00 c |
Isoelectric point (pI) |
10.04 c |
IC50 |
188 uM |
pIC50 |
-2.274 |
GRAVY |
1.2333 c |
Hydrophilic residue ratio |
66.67% c |
Peptide calculator |
|
|
Biological/Functional activity & target protein |
ACE-inhibitory activity |
The peptide exhibited strong Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50
value of 188 uM. |
Specific target protein(s) |
Specific Target Protein(s): Angiotensin-converting enzyme |
|
Taste properties & Structure |
Bitterness |
Literature report |
N.D |
Bitter prediction tools |
Bitter taste prediction |
|
SMILES |
N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CC(C)C)C(=O)O |
|
Preparation method |
Mode of preparation |
Enzymatic hydrolysis
|
Enzyme(s)/starter culture |
The peptide was isolated from a peptic hydrolyzate of heated sardine muscle.
|
|
Stability & Cytotoxicity |
Peptide stability |
|
Peptide cytotoxicity |
|
|
Additional information |
Additional information |
N.D |
|
Database cross-references |
|
|
|
|
Reference(s) |
Primary literature |
Ukeda, H., Matsuda, H., Osajima, K., Matsufuji, H., Matsui, T., Osajima, Y. Peptides from Peptic Hydrolyzate of Heated Sardine Meat That Inhibit Angiotensin I Converting Enzyme. Journal of the agricultural chemical society of Japan. 1992, 66, 25-9.
|
Other literature(s) |
N.D |
PubDate |
1992 |
|