E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI0461(ACE-inhibitory peptide)
DFBP ID DFBPACEI0461
Peptide sequence AVP
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity PEP-inhibitory activity [D1], Multifunctional activity [D2]
Calculated physicochemical properties
Three-letter amino acid Ala-Val-Pro
Single-letter amino acid AVP
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 285.34 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 340 uM
pIC50 -2.531
GRAVY 1.4667 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Milk protein
Precursor protein β-Casein
Residue position

f(177-179)

Precursor protein(s) search
Source.1: DFBPPR0810 ---- Plant proteins ---- APETALA2-like protein 1
Source.2: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog
Source.3: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2
Source.4: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8
Source.5: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic
Source.6: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1
Source.7: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.8: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.9: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.10: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.11: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.12: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.13: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.14: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.15: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.16: DFBPPR0900 ---- Plant proteins ---- GTPase activating protein 1
Source.17: DFBPPR0901 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 2
Source.18: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.19: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.20: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.21: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.22: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.23: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.24: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5
Source.25: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3
Source.26: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50
Source.27: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.28: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.29: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.30: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.31: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75
Source.32: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.33: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.34: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.35: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.36: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.37: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.38: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.39: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1
Source.40: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP
Source.41: DFBPPR1047 ---- Plant proteins ---- Rac-like GTP-binding protein 5
Source.42: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.43: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4
Source.44: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1
Source.45: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.46: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.47: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.48: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1
Source.49: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.50: DFBPPR1097 ---- Plant proteins ---- Thioredoxin M5, chloroplastic
Source.51: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.52: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.53: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.54: DFBPPR1140 ---- Plant proteins ---- Protein PARTING DANCERS homolog
Source.55: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.56: DFBPPR1158 ---- Plant proteins ---- Cysteine and histidine-rich domain-containing protein RAR1
Source.57: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.58: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23
Source.59: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2
Source.60: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.61: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4
Source.62: DFBPPR1219 ---- Plant proteins ---- Guanylate kinase 2, chloroplastic/mitochondrial
Source.63: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.64: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.65: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.66: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.67: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.68: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.69: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.70: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic
Source.71: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22
Source.72: DFBPPR1310 ---- Plant proteins ---- Rac-like GTP-binding protein 6
Source.73: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic
Source.74: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.75: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1
Source.76: DFBPPR1346 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 5
Source.77: DFBPPR1358 ---- Plant proteins ---- Fructose-bisphosphate aldolase, chloroplastic
Source.78: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.79: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.80: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase
Source.81: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.82: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.83: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.84: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.85: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.86: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2
Source.87: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.88: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2
Source.89: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.90: DFBPPR1427 ---- Plant proteins ---- Probable esterase D14L
Source.91: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3
Source.92: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.93: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.94: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.95: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.96: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.97: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.98: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.99: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.100: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.101: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3
Source.102: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.103: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.104: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein
Source.105: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.106: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.107: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.108: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.109: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.110: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.111: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial
Source.112: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3
Source.113: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF
Source.114: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.115: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.116: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.117: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.118: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.119: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.120: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic
Source.121: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.122: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.123: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.124: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.125: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.126: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.127: DFBPPR1658 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 19
Source.128: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1
Source.129: DFBPPR1675 ---- Plant proteins ---- Protein LSD1
Source.130: DFBPPR1676 ---- Plant proteins ---- MADS-box transcription factor 55
Source.131: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.132: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.133: DFBPPR1696 ---- Plant proteins ---- Phytosulfokines 2
Source.134: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1
Source.135: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic
Source.136: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.137: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic
Source.138: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic
Source.139: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.140: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.141: DFBPPR1750 ---- Plant proteins ---- Transcription factor IBH1
Source.142: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic
Source.143: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.144: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.145: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial
Source.146: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.147: DFBPPR1796 ---- Plant proteins ---- Fibrillin protein 5 homolog
Source.148: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.149: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1
Source.150: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.151: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3
Source.152: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.153: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.154: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1
Source.155: DFBPPR1841 ---- Plant proteins ---- SPX domain-containing protein 2
Source.156: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO
Source.157: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.158: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.159: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.160: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.161: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.162: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.163: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.164: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.165: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.166: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.167: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.168: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.169: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.170: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.171: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.172: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.173: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.174: DFBPPR1980 ---- Plant proteins ---- Germin-like protein 1-4
Source.175: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b
Source.176: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.177: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.178: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.179: DFBPPR2015 ---- Plant proteins ---- 50S ribosomal protein L12, chloroplastic
Source.180: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.181: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.182: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.183: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1
Source.184: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.185: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.186: DFBPPR2045 ---- Plant proteins ---- Expansin-A5
Source.187: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.188: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.189: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA
Source.190: DFBPPR2076 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-2
Source.191: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5
Source.192: DFBPPR2096 ---- Plant proteins ---- Peroxiredoxin-2E-1, chloroplastic
Source.193: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.194: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4
Source.195: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.196: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.197: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23
Source.198: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.199: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.200: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.201: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.202: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.203: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.204: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.205: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.206: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.207: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.208: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.209: DFBPPR2223 ---- Plant proteins ---- Urease
Source.210: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.211: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like
Source.212: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.213: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.214: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.215: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3
Source.216: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.217: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.218: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic
Source.219: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7
Source.220: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.221: DFBPPR2319 ---- Plant proteins ---- Thioredoxin M2, chloroplastic
Source.222: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.223: DFBPPR2325 ---- Plant proteins ---- Peroxiredoxin-2E-2, chloroplastic
Source.224: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b
Source.225: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.226: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1
Source.227: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400
Source.228: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial
Source.229: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.230: DFBPPR2352 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-4
Source.231: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic
Source.232: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.233: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.234: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.235: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.236: DFBPPR2368 ---- Plant proteins ---- Thioredoxin M1, chloroplastic
Source.237: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic
Source.238: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.239: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.240: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.241: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1
Source.242: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1
Source.243: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.244: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.245: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.246: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic
Source.247: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25
Source.248: DFBPPR2485 ---- Plant proteins ---- SKP1-like protein 1
Source.249: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic
Source.250: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.251: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.252: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta
Source.253: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300
Source.254: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c
Source.255: DFBPPR2540 ---- Plant proteins ---- 23.2 kDa heat shock protein
Source.256: DFBPPR2547 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 3, chloroplastic
Source.257: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.258: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.259: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.260: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.261: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.262: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4
Source.263: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.264: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.265: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b
Source.266: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.267: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.268: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A
Source.269: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.270: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5
Source.271: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.272: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.273: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2
Source.274: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.275: DFBPPR2621 ---- Plant proteins ---- Germin-like protein 4-1
Source.276: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.277: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24
Source.278: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.279: DFBPPR2678 ---- Plant proteins ---- Thioredoxin-like 1-2, chloroplastic
Source.280: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1
Source.281: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16
Source.282: DFBPPR2712 ---- Plant proteins ---- Expansin-A20
Source.283: DFBPPR2714 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.284: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77
Source.285: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.286: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.287: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.288: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.289: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.290: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.291: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2
Source.292: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3
Source.293: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.294: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2
Source.295: DFBPPR2783 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.296: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a
Source.297: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.298: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.299: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.300: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.301: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.302: DFBPPR2819 ---- Plant proteins ---- Squamosa promoter-binding-like protein 4
Source.303: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1
Source.304: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.305: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.306: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.307: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.308: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.309: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.310: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.311: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.312: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2
Source.313: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.314: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.315: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.316: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1
Source.317: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.318: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.319: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.320: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1
Source.321: DFBPPR2988 ---- Plant proteins ---- Non-symbiotic hemoglobin 2
Source.322: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.323: DFBPPR3028 ---- Plant proteins ---- Expansin-A19
Source.324: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1
Source.325: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.326: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.327: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2
Source.328: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.329: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.330: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.331: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.332: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.333: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.334: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2
Source.335: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.336: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.337: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2
Source.338: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.339: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.340: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.341: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B
Source.342: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20
Source.343: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.344: DFBPPR3164 ---- Plant proteins ---- Cysteine proteinase inhibitor 2
Source.345: DFBPPR3167 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.346: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1
Source.347: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.348: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.349: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A
Source.350: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.351: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.352: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.353: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.354: DFBPPR3262 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic
Source.355: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic
Source.356: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.357: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.358: DFBPPR3271 ---- Plant proteins ---- Eukaryotic translation initiation factor NCBP
Source.359: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500
Source.360: DFBPPR3305 ---- Plant proteins ---- Non-symbiotic hemoglobin 3
Source.361: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.362: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1
Source.363: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.364: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8
Source.365: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.366: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic
Source.367: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68
Source.368: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A
Source.369: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.370: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2
Source.371: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.372: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.373: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5
Source.374: DFBPPR3421 ---- Plant proteins ---- Cyanate hydratase
Source.375: DFBPPR3430 ---- Plant proteins ---- Dehydrin DHN1
Source.376: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2
Source.377: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.378: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.379: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.380: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.381: DFBPPR3471 ---- Plant proteins ---- Monothiol glutaredoxin-S6
Source.382: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2
Source.383: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic
Source.384: DFBPPR3483 ---- Plant proteins ---- Glutaredoxin-C5
Source.385: DFBPPR3488 ---- Plant proteins ---- GATA transcription factor 19
Source.386: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.387: DFBPPR3505 ---- Plant proteins ---- Ribosome biogenesis protein WDR12 homolog
Source.388: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18
Source.389: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56
Source.390: DFBPPR3527 ---- Plant proteins ---- Elongation factor 1-delta 1
Source.391: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial
Source.392: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.393: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.394: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.395: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.396: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.397: DFBPPR3578 ---- Plant proteins ---- Glutaredoxin-C13
Source.398: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.399: DFBPPR3591 ---- Plant proteins ---- Probable adenylate kinase 7, mitochondrial
Source.400: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1
Source.401: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.402: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.403: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.404: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.405: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5
Source.406: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.407: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.408: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2
Source.409: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J
Source.410: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic
Source.411: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.412: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.413: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.414: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.415: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.416: DFBPPR3701 ---- Plant proteins ---- Non-specific lipid-transfer protein C4
Source.417: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.418: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2
Source.419: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1
Source.420: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.421: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1
Source.422: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.423: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1
Source.424: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.425: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71
Source.426: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.427: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.428: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.429: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.430: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.431: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.432: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D
Source.433: DFBPPR3787 ---- Plant proteins ---- Probable protein phosphatase 2C 55
Source.434: DFBPPR3791 ---- Plant proteins ---- Putative glutaredoxin-C12
Source.435: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E
Source.436: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6
Source.437: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4
Source.438: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.439: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.440: DFBPPR3832 ---- Plant proteins ---- 26.2 kDa heat shock protein, mitochondrial
Source.441: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29
Source.442: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic
Source.443: DFBPPR3871 ---- Plant proteins ---- Putative glutaredoxin-C11
Source.444: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1
Source.445: DFBPPR3882 ---- Plant proteins ---- Squamosa promoter-binding-like protein 7
Source.446: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.447: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20
Source.448: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11
Source.449: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.450: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.451: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.452: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.453: DFBPPR3941 ---- Plant proteins ---- KIN17-like protein
Source.454: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.455: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial
Source.456: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog
Source.457: DFBPPR3959 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.458: DFBPPR3961 ---- Plant proteins ---- Zinc-finger homeodomain protein 8
Source.459: DFBPPR3965 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-1, mitochondrial
Source.460: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic
Source.461: DFBPPR3972 ---- Plant proteins ---- Basic leucine zipper 19
Source.462: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.463: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.464: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.465: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.466: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25
Source.467: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.468: DFBPPR4006 ---- Plant proteins ---- Glutaredoxin-C7
Source.469: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.470: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5
Source.471: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.472: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.473: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.474: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.475: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.476: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.477: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.478: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3
Source.479: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.480: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.481: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33
Source.482: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3
Source.483: DFBPPR4134 ---- Plant proteins ---- Glutaredoxin-C1
Source.484: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600
Source.485: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.486: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H
Source.487: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.488: DFBPPR4170 ---- Plant proteins ---- CMP-sialic acid transporter 3
Source.489: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.490: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4
Source.491: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.492: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1
Source.493: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.494: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic
Source.495: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1
Source.496: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15
Source.497: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.498: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3
Source.499: DFBPPR4293 ---- Plant proteins ---- Double-stranded RNA-binding protein 7
Source.500: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11
Source.501: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase
Source.502: DFBPPR4342 ---- Plant proteins ---- Nucleolin 1
Source.503: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.504: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A
Source.505: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8
Source.506: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B
Source.507: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.508: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.509: DFBPPR4388 ---- Plant proteins ---- Class II metallothionein-like protein 1A
Source.510: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic
Source.511: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.512: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.513: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.514: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9
Source.515: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic
Source.516: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.517: DFBPPR4440 ---- Plant proteins ---- 50S ribosomal protein L32, chloroplastic
Source.518: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.519: DFBPPR4458 ---- Plant proteins ---- CASP-like protein 2C2
Source.520: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1
Source.521: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.522: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.523: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.524: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.525: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic
Source.526: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.527: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.528: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.529: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59
Source.530: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase
Source.531: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.532: DFBPPR4584 ---- Plant proteins ---- Probable calcium-binding protein CML29
Source.533: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.534: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39
Source.535: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3
Source.536: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.537: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.538: DFBPPR4620 ---- Plant proteins ---- Protein LOL1
Source.539: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.540: DFBPPR4640 ---- Plant proteins ---- Protein Brevis radix-like 4
Source.541: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.542: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.543: DFBPPR4675 ---- Plant proteins ---- Cyclin-P4-1
Source.544: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3
Source.545: DFBPPR4694 ---- Plant proteins ---- Putative protein ABIL2
Source.546: DFBPPR4696 ---- Plant proteins ---- Uncharacterized protein ycf72
Source.547: DFBPPR4713 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 14
Source.548: DFBPPR4718 ---- Plant proteins ---- Protein TIFY 8
Source.549: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.550: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.551: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.552: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.553: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.554: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1
Source.555: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31
Source.556: DFBPPR4801 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0619850
Source.557: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000
Source.558: DFBPPR4807 ---- Plant proteins ---- Protein MEI2-like 6
Source.559: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.560: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20
Source.561: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.562: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1
Source.563: DFBPPR4838 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 4
Source.564: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200
Source.565: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500
Source.566: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400
Source.567: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.568: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.569: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.570: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.571: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12
Source.572: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.573: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1
Source.574: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic
Source.575: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.576: DFBPPR4932 ---- Plant proteins ---- Two-component response regulator ORR30
Source.577: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1
Source.578: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I
Source.579: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.580: DFBPPR4965 ---- Plant proteins ---- Glycinin G1
Source.581: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.582: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.583: DFBPPR4973 ---- Plant proteins ---- Glycinin G2
Source.584: DFBPPR4981 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.585: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1
Source.586: DFBPPR4992 ---- Plant proteins ---- Glycinin G3
Source.587: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial
Source.588: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.589: DFBPPR5012 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.590: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.591: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.592: DFBPPR5021 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.593: DFBPPR5024 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase catalytic chain, chloroplastic
Source.594: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic
Source.595: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.596: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.597: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial
Source.598: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic
Source.599: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.600: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.601: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme
Source.602: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.603: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.604: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial
Source.605: DFBPPR5109 ---- Plant proteins ---- Chalcone--flavonone isomerase 1A
Source.606: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7
Source.607: DFBPPR5127 ---- Plant proteins ---- Pathogenesis-related protein 10
Source.608: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.609: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.610: DFBPPR5192 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.611: DFBPPR5193 ---- Plant proteins ---- HMG-Y-related protein B
Source.612: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.613: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.614: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.615: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.616: DFBPPR5226 ---- Plant proteins ---- Chalcone--flavonone isomerase 1
Source.617: DFBPPR5233 ---- Plant proteins ---- Ras-related protein Rab7
Source.618: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70
Source.619: DFBPPR5278 ---- Plant proteins ---- 40S ribosomal protein SA
Source.620: DFBPPR5290 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.621: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1
Source.622: DFBPPR5349 ---- Plant proteins ---- 50S ribosomal protein L32, chloroplastic
Source.623: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.624: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.625: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.626: DFBPPR5412 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1
Source.627: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.628: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.629: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.630: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.631: DFBPPR5429 ---- Plant proteins ---- HMG-Y-related protein A
Source.632: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2
Source.633: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.634: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.635: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.636: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.637: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.638: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.639: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.640: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic
Source.641: DFBPPR5505 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme
Source.642: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.643: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.644: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1
Source.645: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic
Source.646: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.647: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic
Source.648: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.649: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.650: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.651: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.652: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.653: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.654: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.655: DFBPPR5596 ---- Plant proteins ---- Serine--glyoxylate aminotransferase
Source.656: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.657: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.658: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.659: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.660: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.661: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.662: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.663: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.664: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.665: DFBPPR5650 ---- Plant proteins ---- Enolase 1
Source.666: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.667: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.668: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.669: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.670: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.671: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.672: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.673: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.674: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.675: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.676: DFBPPR5755 ---- Plant proteins ---- Protein Iojap, chloroplastic
Source.677: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.678: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.679: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.680: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase
Source.681: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.682: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.683: DFBPPR5850 ---- Plant proteins ---- ATP synthase subunit epsilon, mitochondrial
Source.684: DFBPPR5853 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.685: DFBPPR5867 ---- Plant proteins ---- Eukaryotic translation initiation factor 5
Source.686: DFBPPR5871 ---- Plant proteins ---- Cell number regulator 2
Source.687: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1
Source.688: DFBPPR5882 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.689: DFBPPR5922 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.690: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.691: DFBPPR5937 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.692: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1
Source.693: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.694: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2
Source.695: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2
Source.696: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.697: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1
Source.698: DFBPPR6049 ---- Plant proteins ---- Probable non-specific lipid-transfer protein 2
Source.699: DFBPPR6057 ---- Plant proteins ---- Zein-alpha PMS1
Source.700: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.701: DFBPPR6086 ---- Plant proteins ---- Cell number regulator 5
Source.702: DFBPPR6089 ---- Plant proteins ---- Cell number regulator 6
Source.703: DFBPPR6091 ---- Plant proteins ---- 50S ribosomal protein L32, chloroplastic
Source.704: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2
Source.705: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.706: DFBPPR6113 ---- Plant proteins ---- CASP-like protein 2C4
Source.707: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.708: DFBPPR6140 ---- Plant proteins ---- Uncharacterized protein ycf72
Source.709: DFBPPR6144 ---- Plant proteins ---- EC protein homolog
Source.710: DFBPPR6159 ---- Plant proteins ---- MFS14 protein
Source.711: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.712: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.713: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.714: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1
Source.715: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.716: DFBPPR6257 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.717: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.718: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64
Source.719: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.720: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH
Source.721: DFBPPR6331 ---- Plant proteins ---- Rac-like GTP-binding protein RHO1
Source.722: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.723: DFBPPR6358 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.724: DFBPPR6376 ---- Plant proteins ---- Chlorophyll a-b binding protein 22, chloroplastic
Source.725: DFBPPR6380 ---- Plant proteins ---- Legumin A
Source.726: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.727: DFBPPR6386 ---- Plant proteins ---- ATP synthase subunit delta', mitochondrial
Source.728: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic
Source.729: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.730: DFBPPR6425 ---- Plant proteins ---- Legumin A2
Source.731: DFBPPR6429 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.732: DFBPPR6441 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic
Source.733: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic
Source.734: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2
Source.735: DFBPPR6486 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 1
Source.736: DFBPPR6522 ---- Plant proteins ---- Elongation factor G, chloroplastic
Source.737: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.738: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.739: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.740: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.741: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.742: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.743: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.744: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.745: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.746: DFBPPR6687 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.747: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.748: DFBPPR6697 ---- Plant proteins ---- Non-specific lipid-transfer protein 2G
Source.749: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.750: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.751: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase
Source.752: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.753: DFBPPR6765 ---- Plant proteins ---- Non-specific lipid-transfer protein
Source.754: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.755: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1
Source.756: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.757: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1
Source.758: DFBPPR6795 ---- Plant proteins ---- Elongation factor 1-beta
Source.759: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a
Source.760: DFBPPR6812 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.761: DFBPPR6828 ---- Plant proteins ---- Non-specific lipid-transfer protein 2P
Source.762: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.763: DFBPPR6871 ---- Plant proteins ---- EC protein I/II
Source.764: DFBPPR6874 ---- Plant proteins ---- Dehydrin COR410
Source.765: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.766: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1
Source.767: DFBPPR6913 ---- Plant proteins ---- EC protein III
Source.768: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin
Source.769: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.770: DFBPPR6955 ---- Plant proteins ---- Protein WIR1A
Source.771: DFBPPR6957 ---- Plant proteins ---- Protein WIR1B
Source.772: DFBPPR6962 ---- Plant proteins ---- Dehydrin Rab15
Source.773: DFBPPR6981 ---- Plant proteins ---- 50S ribosomal protein L32, chloroplastic
Source.774: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.775: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant
Source.776: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.777: DFBPPR7015 ---- Plant proteins ---- Phytepsin
Source.778: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.779: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.780: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.781: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII
Source.782: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.783: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.784: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.785: DFBPPR7068 ---- Plant proteins ---- Peroxidase 2
Source.786: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase
Source.787: DFBPPR7076 ---- Plant proteins ---- Acyl carrier protein 1, chloroplastic
Source.788: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic
Source.789: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.790: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.791: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.792: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.793: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.794: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.795: DFBPPR7114 ---- Plant proteins ---- Acyl carrier protein 3, chloroplastic
Source.796: DFBPPR7139 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.797: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial
Source.798: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A
Source.799: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.800: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8
Source.801: DFBPPR7189 ---- Plant proteins ---- Trypsin inhibitor CMc
Source.802: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog
Source.803: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.804: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.805: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.806: DFBPPR7242 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.807: DFBPPR7254 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.808: DFBPPR7276 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic
Source.809: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.810: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6
Source.811: DFBPPR7324 ---- Plant proteins ---- Antifungal protein S
Source.812: DFBPPR7329 ---- Plant proteins ---- 50S ribosomal protein L32, chloroplastic
Source.813: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.814: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.815: DFBPPR7410 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.816: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.817: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.818: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic
Source.819: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic
Source.820: DFBPPR7451 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.821: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4
Source.822: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.823: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA
Source.824: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.825: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.826: DFBPPR7605 ---- Milk proteins ---- Beta-casein
Source.827: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.828: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase
Source.829: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein
Source.830: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2
Source.831: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1
Source.832: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.833: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.834: DFBPPR7663 ---- Milk proteins ---- Kappa-casein
Source.835: DFBPPR7676 ---- Milk proteins ---- Kappa-casein
Source.836: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.837: DFBPPR7692 ---- Milk proteins ---- Beta-casein
Source.838: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.839: DFBPPR7695 ---- Milk proteins ---- Kappa-casein
Source.840: DFBPPR7700 ---- Milk proteins ---- Beta-casein
Source.841: DFBPPR7718 ---- Milk proteins ---- Beta-casein
Source.842: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.843: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.844: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.845: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.846: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.847: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.848: DFBPPR8413 ---- Plant proteins ---- Arachin Ahy-3
Source.849: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.850: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.851: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase
Source.852: DFBPPR8464 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.853: DFBPPR8489 ---- Milk proteins ---- Beta-casein
Source.854: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.855: DFBPPR8494 ---- Milk proteins ---- Alpha-S2-casein
Source.856: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A
Source.857: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.858: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1
Source.859: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.860: DFBPPR15960 ---- Animal proteins ---- Apolipoprotein A-IV
Source.861: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.862: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.863: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.864: DFBPPR15982 ---- Animal proteins ---- Triadin
Source.865: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.866: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.867: DFBPPR15998 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.868: DFBPPR16006 ---- Animal proteins ---- Leptin
Source.869: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.870: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.871: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.872: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.873: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.874: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor
Source.875: DFBPPR16066 ---- Animal proteins ---- Coagulation factor IX
Source.876: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5
Source.877: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.878: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO
Source.879: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.880: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3
Source.881: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.882: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.883: DFBPPR16180 ---- Animal proteins ---- Orexin
Source.884: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.885: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.886: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.887: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.888: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.889: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.890: DFBPPR16227 ---- Animal proteins ---- Myelin proteolipid protein
Source.891: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.892: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.893: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.894: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.895: DFBPPR16271 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.896: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin
Source.897: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.898: DFBPPR16317 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.899: DFBPPR16318 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.900: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.901: DFBPPR16324 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2
Source.902: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.903: DFBPPR16336 ---- Animal proteins ---- Colipase
Source.904: DFBPPR16354 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.905: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.906: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.907: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.908: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.909: DFBPPR16478 ---- Animal proteins ---- Chymotrypsinogen 2
Source.910: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.911: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.912: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.913: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein
Source.914: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin
Source.915: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.916: DFBPPR16604 ---- Animal proteins ---- Biglycan
Source.917: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.918: DFBPPR16695 ---- Animal proteins ---- UDP-galactose translocator
Source.919: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.920: DFBPPR16739 ---- Animal proteins ---- Lengsin
Source.921: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.922: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.923: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.924: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.925: DFBPPR16838 ---- Animal proteins ---- Leptin
Source.926: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein
Source.927: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.928: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.929: DFBPPR16863 ---- Animal proteins ---- Biglycan
Source.930: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B
Source.931: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.932: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX
Source.933: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.934: DFBPPR16915 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.935: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.936: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.937: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.938: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.939: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.940: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.941: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic
Source.942: DFBPPR16950 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.943: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.944: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.945: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.946: DFBPPR16974 ---- Animal proteins ---- Natriuretic peptides A
Source.947: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3
Source.948: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.949: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.950: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.951: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.952: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.953: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.954: DFBPPR17029 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.955: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.956: DFBPPR17031 ---- Animal proteins ---- Aurora kinase A
Source.957: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.958: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.959: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform
Source.960: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.961: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.962: DFBPPR17070 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF168
Source.963: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21
Source.964: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.965: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.966: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.967: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.968: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.969: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1
Source.970: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog
Source.971: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.972: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.973: DFBPPR17187 ---- Animal proteins ---- Ribonuclease K6
Source.974: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1
Source.975: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.976: DFBPPR17296 ---- Animal proteins ---- Dynamin-2
Source.977: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1
Source.978: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.979: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.980: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase
Source.981: DFBPPR17339 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.982: DFBPPR17352 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 2
Source.983: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.984: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.985: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1
Source.986: DFBPPR17388 ---- Animal proteins ---- Beta-arrestin-2
Source.987: DFBPPR17399 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.988: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.989: DFBPPR17425 ---- Animal proteins ---- Dynamin-1
Source.990: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.991: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.992: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.993: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.994: DFBPPR17505 ---- Animal proteins ---- Cytochrome c oxidase subunit 8B, mitochondrial
Source.995: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.996: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase
Source.997: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.998: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E
Source.999: DFBPPR17534 ---- Animal proteins ---- RISC-loading complex subunit TARBP2
Source.1000: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6
Source.1001: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase
Source.1002: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5
Source.1003: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4
Source.1004: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.1005: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.1006: DFBPPR17574 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.1007: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein
Source.1008: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.1009: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.1010: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.1011: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16
Source.1012: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.1013: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.1014: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3
Source.1015: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.1016: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.1017: DFBPPR17782 ---- Animal proteins ---- Ras GTPase-activating protein-binding protein 1
Source.1018: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.1019: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.1020: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.1021: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.1022: DFBPPR17808 ---- Animal proteins ---- N-alpha-acetyltransferase 60
Source.1023: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.1024: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.1025: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.1026: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1027: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.1028: DFBPPR17855 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.1029: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.1030: DFBPPR17871 ---- Animal proteins ---- Ras-related protein Rab-11B
Source.1031: DFBPPR17874 ---- Animal proteins ---- Endonuclease 8-like 2
Source.1032: DFBPPR17879 ---- Animal proteins ---- Menin
Source.1033: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.1034: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.1035: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.1036: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial
Source.1037: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.1038: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.1039: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.1040: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.1041: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial
Source.1042: DFBPPR17974 ---- Animal proteins ---- Mimecan
Source.1043: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.1044: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase
Source.1045: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.1046: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5
Source.1047: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.1048: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.1049: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.1050: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.1051: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.1052: DFBPPR18094 ---- Animal proteins ---- Neutrophil cytosol factor 1
Source.1053: DFBPPR18100 ---- Animal proteins ---- Derlin-1
Source.1054: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.1055: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.1056: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.1057: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.1058: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1
Source.1059: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.1060: DFBPPR18162 ---- Animal proteins ---- Renin receptor
Source.1061: DFBPPR18174 ---- Animal proteins ---- Interferon-inducible double-stranded RNA-dependent protein kinase activator A
Source.1062: DFBPPR18216 ---- Animal proteins ---- Collectin-12
Source.1063: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.1064: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.1065: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.1066: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4
Source.1067: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1
Source.1068: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.1069: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.1070: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3
Source.1071: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.1072: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56
Source.1073: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.1074: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase
Source.1075: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.1076: DFBPPR18308 ---- Animal proteins ---- Chymotrypsinogen A
Source.1077: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.1078: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.1079: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.1080: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.1081: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.1082: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.1083: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.1084: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.1085: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5
Source.1086: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.1087: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.1088: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase
Source.1089: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain
Source.1090: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.1091: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.1092: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.1093: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.1094: DFBPPR18432 ---- Animal proteins ---- Vacuole membrane protein 1
Source.1095: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.1096: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor
Source.1097: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.1098: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1
Source.1099: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.1100: DFBPPR18513 ---- Animal proteins ---- Placenta growth factor
Source.1101: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin
Source.1102: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.1103: DFBPPR18540 ---- Animal proteins ---- Fibroblast growth factor-binding protein 1
Source.1104: DFBPPR18543 ---- Animal proteins ---- Proproteinase E
Source.1105: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.1106: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.1107: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.1108: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2
Source.1109: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.1110: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.1111: DFBPPR18614 ---- Animal proteins ---- Beta-enolase
Source.1112: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.1113: DFBPPR18630 ---- Animal proteins ---- Phosphoserine phosphatase
Source.1114: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial
Source.1115: DFBPPR18719 ---- Animal proteins ---- A-kinase anchor protein 5
Source.1116: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.1117: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.1118: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3
Source.1119: DFBPPR18759 ---- Animal proteins ---- Neuronal-specific septin-3
Source.1120: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9
Source.1121: DFBPPR18775 ---- Animal proteins ---- tRNA methyltransferase 10 homolog A
Source.1122: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.1123: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.1124: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8
Source.1125: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.1126: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1
Source.1127: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.1128: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.1129: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.1130: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.1131: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1132: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.1133: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.1134: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.1135: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.1136: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.1137: DFBPPR18909 ---- Animal proteins ---- Enolase-phosphatase E1
Source.1138: DFBPPR18920 ---- Animal proteins ---- Profilin-1
Source.1139: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.1140: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.1141: DFBPPR18948 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL1
Source.1142: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.1143: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.1144: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.1145: DFBPPR18980 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.1146: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase
Source.1147: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6
Source.1148: DFBPPR18998 ---- Animal proteins ---- E3 ubiquitin-protein ligase ZNRF1
Source.1149: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I
Source.1150: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746
Source.1151: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D
Source.1152: DFBPPR19013 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3
Source.1153: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2
Source.1154: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3
Source.1155: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.1156: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1
Source.1157: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.1158: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1
Source.1159: DFBPPR19096 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase
Source.1160: DFBPPR19099 ---- Animal proteins ---- Dr1-associated corepressor
Source.1161: DFBPPR19108 ---- Animal proteins ---- Hepatocyte cell adhesion molecule
Source.1162: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein
Source.1163: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5
Source.1164: DFBPPR19152 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF186
Source.1165: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2
Source.1166: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14
Source.1167: DFBPPR19172 ---- Animal proteins ---- Persulfide dioxygenase ETHE1, mitochondrial
Source.1168: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone
Source.1169: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.1170: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2
Source.1171: DFBPPR19203 ---- Animal proteins ---- Mitochondrial inner membrane protease subunit 2
Source.1172: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.1173: DFBPPR19224 ---- Animal proteins ---- Fetuin-B
Source.1174: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha
Source.1175: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.1176: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.1177: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.1178: DFBPPR19261 ---- Animal proteins ---- Transcription factor ETV6
Source.1179: DFBPPR19284 ---- Animal proteins ---- Protein lifeguard 2
Source.1180: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1
Source.1181: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.1182: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.1183: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial
Source.1184: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.1185: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.1186: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.1187: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor
Source.1188: DFBPPR19385 ---- Animal proteins ---- Cathelicidin-5
Source.1189: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2
Source.1190: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.1191: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129
Source.1192: DFBPPR19391 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein A
Source.1193: DFBPPR19399 ---- Animal proteins ---- UBX domain-containing protein 6
Source.1194: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1
Source.1195: DFBPPR19430 ---- Animal proteins ---- Aryl-hydrocarbon-interacting protein-like 1
Source.1196: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59
Source.1197: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.1198: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3
Source.1199: DFBPPR19451 ---- Animal proteins ---- Proline/serine-rich coiled-coil protein 1
Source.1200: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.1201: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.1202: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.1203: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.1204: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.1205: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.1206: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.1207: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2
Source.1208: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.1209: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.1210: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.1211: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.1212: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.1213: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3
Source.1214: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.1215: DFBPPR19561 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.1216: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.1217: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.1218: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.1219: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.1220: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2
Source.1221: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.1222: DFBPPR19602 ---- Animal proteins ---- Dynactin subunit 3
Source.1223: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.1224: DFBPPR19653 ---- Animal proteins ---- Chymotrypsinogen B
Source.1225: DFBPPR19656 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1226: DFBPPR19659 ---- Animal proteins ---- 39S ribosomal protein L9, mitochondrial
Source.1227: DFBPPR19665 ---- Animal proteins ---- Thioredoxin, mitochondrial
Source.1228: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.1229: DFBPPR19675 ---- Animal proteins ---- INO80 complex subunit E
Source.1230: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2
Source.1231: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor
Source.1232: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.1233: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.1234: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10
Source.1235: DFBPPR19765 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.1236: DFBPPR19768 ---- Animal proteins ---- Peroxynitrite isomerase THAP4
Source.1237: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.1238: DFBPPR19796 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.1239: DFBPPR19807 ---- Animal proteins ---- Spermine synthase
Source.1240: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L
Source.1241: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma
Source.1242: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein
Source.1243: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.1244: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.1245: DFBPPR19854 ---- Animal proteins ---- Nuclear migration protein nudC
Source.1246: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2
Source.1247: DFBPPR19870 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.1248: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta
Source.1249: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor
Source.1250: DFBPPR19948 ---- Animal proteins ---- Tensin-4
Source.1251: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2
Source.1252: DFBPPR20006 ---- Animal proteins ---- Protein Abitram
Source.1253: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3
Source.1254: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit
Source.1255: DFBPPR20010 ---- Animal proteins ---- Craniofacial development protein 1
Source.1256: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7
Source.1257: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.1258: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.1259: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.1260: DFBPPR20047 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 11B
Source.1261: DFBPPR20072 ---- Animal proteins ---- Adenine phosphoribosyltransferase
Source.1262: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1
Source.1263: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.1264: DFBPPR20167 ---- Animal proteins ---- Protein BANP
Source.1265: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.1266: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.1267: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.1268: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.1269: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan
Source.1270: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.1271: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial
Source.1272: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.1273: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial
Source.1274: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.1275: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27
Source.1276: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.1277: DFBPPR20354 ---- Animal proteins ---- Single-strand selective monofunctional uracil DNA glycosylase
Source.1278: DFBPPR20357 ---- Animal proteins ---- Snurportin-1
Source.1279: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial
Source.1280: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.1281: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.1282: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.1283: DFBPPR20401 ---- Animal proteins ---- Bystin
Source.1284: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.1285: DFBPPR20408 ---- Animal proteins ---- Phospholipid scramblase 2
Source.1286: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5
Source.1287: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.1288: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2
Source.1289: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29
Source.1290: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1
Source.1291: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42
Source.1292: DFBPPR20524 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A
Source.1293: DFBPPR20531 ---- Animal proteins ---- Myozenin-2
Source.1294: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.1295: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230
Source.1296: DFBPPR20549 ---- Animal proteins ---- PDZ and LIM domain protein 1
Source.1297: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1
Source.1298: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein
Source.1299: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.1300: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2
Source.1301: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial
Source.1302: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain
Source.1303: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5
Source.1304: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.1305: DFBPPR20690 ---- Animal proteins ---- Neurotrimin
Source.1306: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.1307: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog
Source.1308: DFBPPR20721 ---- Animal proteins ---- Myomesin-1
Source.1309: DFBPPR20729 ---- Animal proteins ---- 60S ribosomal protein L6
Source.1310: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11
Source.1311: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.1312: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.1313: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1
Source.1314: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7
Source.1315: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2
Source.1316: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein
Source.1317: DFBPPR20775 ---- Animal proteins ---- Colipase
Source.1318: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.1319: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.1320: DFBPPR20832 ---- Animal proteins ---- Metalloproteinase inhibitor 4
Source.1321: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9
Source.1322: DFBPPR20857 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.1323: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial
Source.1324: DFBPPR20866 ---- Animal proteins ---- PRKR-interacting protein 1
Source.1325: DFBPPR20875 ---- Animal proteins ---- Protein tweety homolog 1
Source.1326: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1
Source.1327: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1
Source.1328: DFBPPR20887 ---- Animal proteins ---- UAP56-interacting factor
Source.1329: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1
Source.1330: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor
Source.1331: DFBPPR20909 ---- Animal proteins ---- Macrophage immunometabolism regulator
Source.1332: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.1333: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.1334: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial
Source.1335: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A
Source.1336: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4
Source.1337: DFBPPR20938 ---- Animal proteins ---- Serine protease HTR4
Source.1338: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1
Source.1339: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.1340: DFBPPR20975 ---- Animal proteins ---- 39S ribosomal protein L2, mitochondrial
Source.1341: DFBPPR20978 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim10 B
Source.1342: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.1343: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.1344: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.1345: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17
Source.1346: DFBPPR21023 ---- Animal proteins ---- Ribosome biogenesis protein NSA2 homolog
Source.1347: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.1348: DFBPPR21026 ---- Animal proteins ---- Fetal and adult testis-expressed transcript protein homolog
Source.1349: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.1350: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.1351: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein
Source.1352: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.1353: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4
Source.1354: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7
Source.1355: DFBPPR21100 ---- Animal proteins ---- Cochlin
Source.1356: DFBPPR21106 ---- Animal proteins ---- 40S ribosomal protein S10
Source.1357: DFBPPR21116 ---- Animal proteins ---- Suppressor of cytokine signaling 5
Source.1358: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6
Source.1359: DFBPPR21166 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1
Source.1360: DFBPPR21173 ---- Animal proteins ---- Sorting nexin-11
Source.1361: DFBPPR21181 ---- Animal proteins ---- Calpastatin
Source.1362: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173
Source.1363: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal
Source.1364: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22
Source.1365: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1
Source.1366: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin
Source.1367: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4
Source.1368: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.1369: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3
Source.1370: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4
Source.1371: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.1372: DFBPPR21323 ---- Animal proteins ---- Trefoil factor 3
Source.1373: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115
Source.1374: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.1375: DFBPPR21335 ---- Animal proteins ---- Coiled-coil domain-containing protein 124
Source.1376: DFBPPR21339 ---- Animal proteins ---- Zinc finger protein 692
Source.1377: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial
Source.1378: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein
Source.1379: DFBPPR21346 ---- Animal proteins ---- Ameloblastin
Source.1380: DFBPPR21350 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.1381: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1
Source.1382: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.1383: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.1384: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.1385: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.1386: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3
Source.1387: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2
Source.1388: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A
Source.1389: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.1390: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.1391: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84
Source.1392: DFBPPR21433 ---- Animal proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.1393: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.1394: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.1395: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.1396: DFBPPR21477 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 35
Source.1397: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein
Source.1398: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8
Source.1399: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8
Source.1400: DFBPPR21500 ---- Animal proteins ---- Docking protein 2
Source.1401: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.1402: DFBPPR21526 ---- Animal proteins ---- Interferon alpha-inducible protein 27-like protein 2
Source.1403: DFBPPR21552 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 3
Source.1404: DFBPPR21554 ---- Animal proteins ---- Transcription factor 23
Source.1405: DFBPPR21565 ---- Animal proteins ---- Insulin-like growth factor-binding protein-like 1
Source.1406: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2
Source.1407: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1408: DFBPPR21601 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 2
Source.1409: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.1410: DFBPPR21661 ---- Animal proteins ---- Arginine/serine-rich coiled-coil protein 2
Source.1411: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.1412: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1
Source.1413: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.1414: DFBPPR21697 ---- Animal proteins ---- UDP-galactose translocator
Source.1415: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.1416: DFBPPR21727 ---- Animal proteins ---- 39S ribosomal protein L1, mitochondrial
Source.1417: DFBPPR21749 ---- Animal proteins ---- Protein CUSTOS
Source.1418: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1
Source.1419: DFBPPR21763 ---- Animal proteins ---- Protein GOLM2
Source.1420: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4
Source.1421: DFBPPR21795 ---- Animal proteins ---- CCAAT/enhancer-binding protein gamma
Source.1422: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.1423: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like
Source.1424: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.1425: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.1426: DFBPPR21827 ---- Animal proteins ---- LETM1 domain-containing protein 1
Source.1427: DFBPPR21830 ---- Animal proteins ---- Guanine nucleotide exchange factor for Rab-3A
Source.1428: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein
Source.1429: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2
Source.1430: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor
Source.1431: DFBPPR21892 ---- Animal proteins ---- COMM domain-containing protein 9
Source.1432: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1
Source.1433: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.1434: DFBPPR21934 ---- Animal proteins ---- Transcription elongation factor A protein-like 8
Source.1435: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein
Source.1436: DFBPPR21953 ---- Animal proteins ---- Clusterin-like protein 1
Source.1437: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.1438: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein
Source.1439: DFBPPR21991 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC7-like
Source.1440: DFBPPR21999 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 3
Source.1441: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog
Source.1442: DFBPPR22028 ---- Animal proteins ---- Endonuclease/exonuclease/phosphatase family domain-containing protein 1
Source.1443: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3
Source.1444: DFBPPR22066 ---- Animal proteins ---- Pyridoxal phosphate homeostasis protein
Source.1445: DFBPPR22082 ---- Animal proteins ---- Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 2 protein
Source.1446: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512
Source.1447: DFBPPR22099 ---- Animal proteins ---- Beta-centractin
Source.1448: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1
Source.1449: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.1450: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein
Source.1451: DFBPPR22148 ---- Animal proteins ---- Hemogen
Source.1452: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11
Source.1453: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.1454: DFBPPR22166 ---- Animal proteins ---- Nucleosome assembly protein 1-like 5
Source.1455: DFBPPR22169 ---- Animal proteins ---- Transmembrane protein 256
Source.1456: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.1457: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.1458: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial
Source.1459: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.1460: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.1461: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.1462: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.1463: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.1464: DFBPPR22244 ---- Animal proteins ---- THAP domain-containing protein 3
Source.1465: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34
Source.1466: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog
Source.1467: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40
Source.1468: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.1469: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B
Source.1470: DFBPPR22292 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial
Source.1471: DFBPPR22310 ---- Animal proteins ---- B-cell CLL/lymphoma 7 protein family member B
Source.1472: DFBPPR22312 ---- Animal proteins ---- BolA-like protein 1
Source.1473: DFBPPR22313 ---- Animal proteins ---- Nucleolar protein 16
Source.1474: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like
Source.1475: DFBPPR22320 ---- Animal proteins ---- Transmembrane protein 229B
Source.1476: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.1477: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2
Source.1478: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.1479: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4
Source.1480: DFBPPR22387 ---- Animal proteins ---- Sterile alpha motif domain-containing protein 5
Source.1481: DFBPPR22407 ---- Animal proteins ---- TSSK6-activating co-chaperone protein
Source.1482: DFBPPR22431 ---- Animal proteins ---- BolA-like protein 3
Source.1483: DFBPPR22459 ---- Animal proteins ---- SCP2 sterol-binding domain-containing protein 1
Source.1484: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.1485: DFBPPR22512 ---- Animal proteins ---- IQ domain-containing protein C
Source.1486: DFBPPR22513 ---- Animal proteins ---- Transmembrane protein 234
Source.1487: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15
Source.1488: DFBPPR22526 ---- Animal proteins ---- Testis-expressed protein 29
Source.1489: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B
Source.1490: DFBPPR22546 ---- Animal proteins ---- ADP-ribosylation factor-like protein 15
Source.1491: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1
Source.1492: DFBPPR22564 ---- Animal proteins ---- cAMP-dependent protein kinase inhibitor gamma
Source.1493: DFBPPR22574 ---- Animal proteins ---- Uncharacterized protein C1orf54 homolog
Source.1494: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.1495: DFBPPR22587 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog
Source.1496: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B
Source.1497: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4
Source.1498: DFBPPR22616 ---- Animal proteins ---- Jhy protein homolog
Source.1499: DFBPPR22635 ---- Animal proteins ---- Translation machinery-associated protein 16
Source.1500: DFBPPR22662 ---- Animal proteins ---- Uncharacterized protein C11orf94 homolog
Source.1501: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein
Source.1502: DFBPPR22690 ---- Animal proteins ---- Proline-rich protein 19
Source.1503: DFBPPR22698 ---- Animal proteins ---- Protein FAM228A
Source.1504: DFBPPR22714 ---- Animal proteins ---- Protein FAM71E1
Source.1505: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11
Source.1506: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog
Source.1507: DFBPPR22736 ---- Animal proteins ---- Uncharacterized protein C16orf71 homolog
Source.1508: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog
Source.1509: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein
Source.1510: DFBPPR8531 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.1511: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1512: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.1513: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase
Source.1514: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1515: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1516: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.1517: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1518: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.1519: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.1520: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.1521: DFBPPR8588 ---- Animal proteins ---- Leptin
Source.1522: DFBPPR8590 ---- Animal proteins ---- Phospholipid hydroperoxide glutathione peroxidase
Source.1523: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.1524: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha
Source.1525: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.1526: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B
Source.1527: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.1528: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.1529: DFBPPR8631 ---- Animal proteins ---- D-amino-acid oxidase
Source.1530: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.1531: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A
Source.1532: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1
Source.1533: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.1534: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.1535: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.1536: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1537: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.1538: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.1539: DFBPPR8697 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.1540: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.1541: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.1542: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.1543: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1544: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.1545: DFBPPR8744 ---- Animal proteins ---- Fibroblast growth factor 9
Source.1546: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.1547: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.1548: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.1549: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.1550: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.1551: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.1552: DFBPPR8787 ---- Animal proteins ---- Cathepsin D
Source.1553: DFBPPR8811 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.1554: DFBPPR8823 ---- Animal proteins ---- Sodium/potassium ATPase inhibitor SPAI-2
Source.1555: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.1556: DFBPPR8861 ---- Animal proteins ---- Colipase
Source.1557: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B
Source.1558: DFBPPR8904 ---- Animal proteins ---- Osteopontin
Source.1559: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.1560: DFBPPR8906 ---- Animal proteins ---- Sialidase-1
Source.1561: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.1562: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.1563: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.1564: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.1565: DFBPPR8991 ---- Animal proteins ---- Cholecystokinin
Source.1566: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain
Source.1567: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain
Source.1568: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain
Source.1569: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.1570: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.1571: DFBPPR9042 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.1572: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.1573: DFBPPR9070 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.1574: DFBPPR9087 ---- Animal proteins ---- CD59 glycoprotein
Source.1575: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.1576: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1577: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6
Source.1578: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.1579: DFBPPR9149 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.1580: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.1581: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.1582: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.1583: DFBPPR9207 ---- Animal proteins ---- Beta-enolase
Source.1584: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.1585: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.1586: DFBPPR9244 ---- Animal proteins ---- Krueppel-like factor 9
Source.1587: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.1588: DFBPPR9254 ---- Animal proteins ---- Complement factor D
Source.1589: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.1590: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1591: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase
Source.1592: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.1593: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.1594: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1595: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.1596: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.1597: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein
Source.1598: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4
Source.1599: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.1600: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.1601: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.1602: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.1603: DFBPPR9569 ---- Animal proteins ---- Myelin proteolipid protein
Source.1604: DFBPPR9578 ---- Animal proteins ---- Biglycan
Source.1605: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.1606: DFBPPR9589 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A
Source.1607: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.1608: DFBPPR9806 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.1609: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.1610: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.1611: DFBPPR9848 ---- Animal proteins ---- Nicotinamide N-methyltransferase
Source.1612: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.1613: DFBPPR9867 ---- Animal proteins ---- Phostensin
Source.1614: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.1615: DFBPPR9880 ---- Animal proteins ---- Trefoil factor 3
Source.1616: DFBPPR9922 ---- Animal proteins ---- cAMP-dependent protein kinase inhibitor gamma
Source.1617: DFBPPR9931 ---- Animal proteins ---- PDZK1-interacting protein 1
Source.1618: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.1619: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.1620: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1621: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.1622: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.1623: DFBPPR9989 ---- Animal proteins ---- VIP peptides
Source.1624: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.1625: DFBPPR10037 ---- Animal proteins ---- Leptin
Source.1626: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.1627: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.1628: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.1629: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.1630: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.1631: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.1632: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.1633: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2
Source.1634: DFBPPR10088 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.1635: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.1636: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.1637: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.1638: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1
Source.1639: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5
Source.1640: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.1641: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.1642: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.1643: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.1644: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.1645: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk
Source.1646: DFBPPR10195 ---- Animal proteins ---- SUMO-conjugating enzyme UBC9
Source.1647: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.1648: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.1649: DFBPPR10202 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.1650: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.1651: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.1652: DFBPPR10220 ---- Animal proteins ---- Paxillin
Source.1653: DFBPPR10222 ---- Animal proteins ---- Podocalyxin
Source.1654: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1
Source.1655: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11
Source.1656: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein
Source.1657: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.1658: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1
Source.1659: DFBPPR10247 ---- Animal proteins ---- Actin filament-associated protein 1
Source.1660: DFBPPR10250 ---- Animal proteins ---- Macrophage migration inhibitory factor
Source.1661: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.1662: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.1663: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.1664: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.1665: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.1666: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.1667: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.1668: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1669: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.1670: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.1671: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.1672: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.1673: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.1674: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.1675: DFBPPR10368 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1676: DFBPPR10369 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1677: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.1678: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2
Source.1679: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.1680: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65
Source.1681: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.1682: DFBPPR10400 ---- Animal proteins ---- Serotonin N-acetyltransferase
Source.1683: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.1684: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.1685: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1686: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.1687: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin
Source.1688: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.1689: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.1690: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.1691: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.1692: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.1693: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.1694: DFBPPR10490 ---- Animal proteins ---- Tudor-interacting repair regulator protein
Source.1695: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.1696: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1697: DFBPPR10531 ---- Animal proteins ---- Serpin H1
Source.1698: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.1699: DFBPPR10535 ---- Animal proteins ---- Protein SPT2 homolog
Source.1700: DFBPPR10536 ---- Animal proteins ---- Inhibin beta B chain
Source.1701: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.1702: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.1703: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.1704: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.1705: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.1706: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.1707: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.1708: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.1709: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.1710: DFBPPR10605 ---- Animal proteins ---- Elastin
Source.1711: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.1712: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX
Source.1713: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.1714: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.1715: DFBPPR10637 ---- Animal proteins ---- CTD small phosphatase-like protein
Source.1716: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5
Source.1717: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.1718: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.1719: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.1720: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.1721: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.1722: DFBPPR10665 ---- Animal proteins ---- Mitochondrial fission regulator 1
Source.1723: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3
Source.1724: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.1725: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.1726: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.1727: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.1728: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.1729: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.1730: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.1731: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.1732: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.1733: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.1734: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.1735: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein
Source.1736: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1737: DFBPPR10769 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.1738: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.1739: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.1740: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.1741: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain
Source.1742: DFBPPR10783 ---- Animal proteins ---- Fructose-bisphosphate aldolase C
Source.1743: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase
Source.1744: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.1745: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.1746: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.1747: DFBPPR10805 ---- Animal proteins ---- Interferon type A1/A2
Source.1748: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.1749: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.1750: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1751: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.1752: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.1753: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.1754: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.1755: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.1756: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.1757: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.1758: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.1759: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.1760: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1
Source.1761: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2
Source.1762: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.1763: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.1764: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase
Source.1765: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.1766: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.1767: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.1768: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.1769: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.1770: DFBPPR11028 ---- Animal proteins ---- Interleukin-6
Source.1771: DFBPPR11029 ---- Animal proteins ---- Myelin proteolipid protein
Source.1772: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.1773: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.1774: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.1775: DFBPPR11047 ---- Animal proteins ---- Nucleolin
Source.1776: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.1777: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1
Source.1778: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.1779: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.1780: DFBPPR11102 ---- Animal proteins ---- Interferon type A3
Source.1781: DFBPPR11104 ---- Animal proteins ---- Importin subunit alpha-5
Source.1782: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.1783: DFBPPR11119 ---- Animal proteins ---- Homeobox protein Nkx-2.5
Source.1784: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog
Source.1785: DFBPPR11152 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.1786: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.1787: DFBPPR11165 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF185
Source.1788: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.1789: DFBPPR11177 ---- Animal proteins ---- Gallinacin-11
Source.1790: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1
Source.1791: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.1792: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.1793: DFBPPR11218 ---- Animal proteins ---- Pancreatic hormone
Source.1794: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.1795: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase
Source.1796: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.1797: DFBPPR11243 ---- Animal proteins ---- Epiphycan
Source.1798: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.1799: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.1800: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.1801: DFBPPR11255 ---- Animal proteins ---- Beta-crystallin A3
Source.1802: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.1803: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5
Source.1804: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.1805: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.1806: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.1807: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein
Source.1808: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4
Source.1809: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.1810: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.1811: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.1812: DFBPPR11314 ---- Animal proteins ---- Multivesicular body subunit 12A
Source.1813: DFBPPR11320 ---- Animal proteins ---- Nucleoporin NUP42
Source.1814: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.1815: DFBPPR11377 ---- Animal proteins ---- UBX domain-containing protein 2B
Source.1816: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.1817: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF
Source.1818: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1
Source.1819: DFBPPR11456 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-2
Source.1820: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.1821: DFBPPR11466 ---- Animal proteins ---- GDNF family receptor alpha-2
Source.1822: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11
Source.1823: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.1824: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9
Source.1825: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog
Source.1826: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.1827: DFBPPR11514 ---- Animal proteins ---- Homeobox protein Hox-D11
Source.1828: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.1829: DFBPPR11533 ---- Animal proteins ---- Mimecan
Source.1830: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.1831: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.1832: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.1833: DFBPPR11561 ---- Animal proteins ---- Microtubule-associated protein 6 homolog
Source.1834: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein
Source.1835: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1
Source.1836: DFBPPR11579 ---- Animal proteins ---- Actin-related protein 6
Source.1837: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3
Source.1838: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.1839: DFBPPR11663 ---- Animal proteins ---- Limbic system-associated membrane protein
Source.1840: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1
Source.1841: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.1842: DFBPPR11717 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.1843: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A
Source.1844: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3
Source.1845: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.1846: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.1847: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.1848: DFBPPR11801 ---- Animal proteins ---- Homeobox protein SAX-1
Source.1849: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.1850: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.1851: DFBPPR11836 ---- Animal proteins ---- Gallinacin-14
Source.1852: DFBPPR11868 ---- Animal proteins ---- Apoptosis inhibitor 5
Source.1853: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.1854: DFBPPR11880 ---- Animal proteins ---- Deleted in azoospermia-like
Source.1855: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.1856: DFBPPR11885 ---- Animal proteins ---- ELL-associated factor 2
Source.1857: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.1858: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.1859: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.1860: DFBPPR11959 ---- Animal proteins ---- Deubiquitinase OTUD6B
Source.1861: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.1862: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.1863: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130
Source.1864: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.1865: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog
Source.1866: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal
Source.1867: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.1868: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.1869: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.1870: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.1871: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.1872: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.1873: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2
Source.1874: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.1875: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.1876: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme
Source.1877: DFBPPR12102 ---- Animal proteins ---- Nuclear envelope integral membrane protein 2
Source.1878: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.1879: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A
Source.1880: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.1881: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5
Source.1882: DFBPPR12171 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-3
Source.1883: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.1884: DFBPPR12194 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-10
Source.1885: DFBPPR12203 ---- Animal proteins ---- Small acidic protein
Source.1886: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40
Source.1887: DFBPPR12207 ---- Animal proteins ---- WD repeat, SAM and U-box domain-containing protein 1
Source.1888: DFBPPR12216 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial
Source.1889: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.1890: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.1891: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.1892: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.1893: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.1894: DFBPPR12329 ---- Animal proteins ---- Natriuretic peptides A
Source.1895: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.1896: DFBPPR12361 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.1897: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.1898: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.1899: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.1900: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.1901: DFBPPR12425 ---- Animal proteins ---- Beta-enolase
Source.1902: DFBPPR12439 ---- Animal proteins ---- Tissue factor
Source.1903: DFBPPR12441 ---- Animal proteins ---- Triadin
Source.1904: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.1905: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1906: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.1907: DFBPPR12476 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.1908: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.1909: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.1910: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.1911: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.1912: DFBPPR12543 ---- Animal proteins ---- Serine/threonine-protein phosphatase 5
Source.1913: DFBPPR12573 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1914: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.1915: DFBPPR12588 ---- Animal proteins ---- Phosphoserine aminotransferase
Source.1916: DFBPPR12591 ---- Animal proteins ---- Annexin A11
Source.1917: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.1918: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.1919: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.1920: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.1921: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.1922: DFBPPR12722 ---- Animal proteins ---- Myelin proteolipid protein
Source.1923: DFBPPR12739 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3
Source.1924: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.1925: DFBPPR12759 ---- Animal proteins ---- Interleukin-1 beta
Source.1926: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1927: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.1928: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.1929: DFBPPR12805 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.1930: DFBPPR12817 ---- Animal proteins ---- Cathepsin E
Source.1931: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B
Source.1932: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor
Source.1933: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.1934: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11
Source.1935: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.1936: DFBPPR12877 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.1937: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.1938: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.1939: DFBPPR12930 ---- Animal proteins ---- Kappa-casein
Source.1940: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.1941: DFBPPR12938 ---- Animal proteins ---- D-amino-acid oxidase
Source.1942: DFBPPR12940 ---- Animal proteins ---- Interleukin-4
Source.1943: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.1944: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.1945: DFBPPR12988 ---- Animal proteins ---- Calpastatin
Source.1946: DFBPPR12992 ---- Animal proteins ---- Mimecan
Source.1947: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2
Source.1948: DFBPPR13053 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.1949: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.1950: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236
Source.1951: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.1952: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1953: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.1954: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.1955: DFBPPR13156 ---- Animal proteins ---- Leptin
Source.1956: DFBPPR13170 ---- Animal proteins ---- Carbonic anhydrase 1
Source.1957: DFBPPR13200 ---- Animal proteins ---- Interleukin-23 subunit alpha
Source.1958: DFBPPR13211 ---- Animal proteins ---- Colipase B
Source.1959: DFBPPR13216 ---- Animal proteins ---- Colipase A
Source.1960: DFBPPR13233 ---- Animal proteins ---- Fibronectin
Source.1961: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.1962: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2
Source.1963: DFBPPR13242 ---- Animal proteins ---- E-selectin
Source.1964: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B
Source.1965: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.1966: DFBPPR13256 ---- Animal proteins ---- Interleukin-1 beta
Source.1967: DFBPPR13263 ---- Animal proteins ---- Serotransferrin
Source.1968: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1969: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.1970: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.1971: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain
Source.1972: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein
Source.1973: DFBPPR13302 ---- Animal proteins ---- Endothelin-2
Source.1974: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.1975: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1976: DFBPPR13362 ---- Animal proteins ---- Biglycan
Source.1977: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.1978: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.1979: DFBPPR13379 ---- Animal proteins ---- Alpha-1-antiproteinase 1
Source.1980: DFBPPR13381 ---- Animal proteins ---- Alpha-1-antiproteinase 3
Source.1981: DFBPPR13399 ---- Animal proteins ---- Beta-2-microglobulin
Source.1982: DFBPPR13424 ---- Animal proteins ---- Leptin
Source.1983: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.1984: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.1985: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1986: DFBPPR13516 ---- Animal proteins ---- Keratin-associated protein 11-1
Source.1987: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1988: DFBPPR13541 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.1989: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.1990: DFBPPR13592 ---- Animal proteins ---- Natriuretic peptides A
Source.1991: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.1992: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1993: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.1994: DFBPPR13678 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1995: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1996: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.1997: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.1998: DFBPPR13782 ---- Animal proteins ---- BMP and activin membrane-bound inhibitor homolog
Source.1999: DFBPPR13788 ---- Animal proteins ---- Albumin
Source.2000: DFBPPR13802 ---- Animal proteins ---- Pancreatic prohormone
Source.2001: DFBPPR13834 ---- Animal proteins ---- Biglycan
Source.2002: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.2003: DFBPPR13895 ---- Animal proteins ---- Elastin
Source.2004: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.2005: DFBPPR13917 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.2006: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.2007: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.2008: DFBPPR13959 ---- Animal proteins ---- Calpastatin
Source.2009: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.2010: DFBPPR14002 ---- Animal proteins ---- Cytochrome b
Source.2011: DFBPPR14007 ---- Animal proteins ---- Cystatin
Source.2012: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a
Source.2013: DFBPPR14009 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2014: DFBPPR14063 ---- Animal proteins ---- Homeobox protein Hox-B1
Source.2015: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.2016: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.2017: DFBPPR14081 ---- Marine protein ---- Beta-enolase
Source.2018: DFBPPR14091 ---- Marine protein ---- 40S ribosomal protein SA
Source.2019: DFBPPR14100 ---- Marine protein ---- Cytochrome b
Source.2020: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A
Source.2021: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.2022: DFBPPR14120 ---- Marine protein ---- Thyrotropin subunit beta
Source.2023: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase
Source.2024: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.2025: DFBPPR14144 ---- Marine protein ---- Spindle and kinetochore-associated protein 2
Source.2026: DFBPPR14146 ---- Marine protein ---- ATP synthase subunit a
Source.2027: DFBPPR14178 ---- Marine protein ---- Hepcidin-1
Source.2028: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein
Source.2029: DFBPPR14191 ---- Marine protein ---- THAP domain-containing protein 1
Source.2030: DFBPPR14211 ---- Marine protein ---- WASH complex subunit 3
Source.2031: DFBPPR14241 ---- Marine protein ---- Cystatin
Source.2032: DFBPPR14242 ---- Marine protein ---- Cytochrome b
Source.2033: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.2034: DFBPPR14271 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.2035: DFBPPR14366 ---- Marine protein ---- Thioredoxin
Source.2036: DFBPPR14373 ---- Marine protein ---- Cytochrome b6
Source.2037: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.2038: DFBPPR14402 ---- Marine protein ---- 50S ribosomal protein L3, chloroplastic
Source.2039: DFBPPR14414 ---- Marine protein ---- Cytochrome b6-f complex subunit 4
Source.2040: DFBPPR14505 ---- Marine protein ---- 50S ribosomal protein L32, chloroplastic
Source.2041: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24
Source.2042: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.2043: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.2044: DFBPPR14587 ---- Marine protein ---- Thyrotropin subunit beta
Source.2045: DFBPPR14590 ---- Marine protein ---- Cytochrome b
Source.2046: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a
Source.2047: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.2048: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein
Source.2049: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.2050: DFBPPR14660 ---- Marine protein ---- Otolin-1
Source.2051: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2
Source.2052: DFBPPR14698 ---- Marine protein ---- Cystatin
Source.2053: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.2054: DFBPPR14741 ---- Marine protein ---- Arrestin red cell isoform 3
Source.2055: DFBPPR14742 ---- Marine protein ---- Arrestin red cell isoform 2
Source.2056: DFBPPR14743 ---- Marine protein ---- Arrestin red cell isoform 1
Source.2057: DFBPPR14771 ---- Marine protein ---- L-cystatin
Source.2058: DFBPPR14783 ---- Marine protein ---- Enolase
Source.2059: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain
Source.2060: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.2061: DFBPPR14861 ---- Marine protein ---- Cytochrome b
Source.2062: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1
Source.2063: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial
Source.2064: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.2065: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.2066: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1
Source.2067: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2
Source.2068: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2
Source.2069: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.2070: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit
Source.2071: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.2072: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase
Source.2073: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial
Source.2074: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8
Source.2075: DFBPPR15013 ---- Microorganism protein ---- Inorganic pyrophosphatase
Source.2076: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase
Source.2077: DFBPPR15058 ---- Microorganism protein ---- DNA repair and recombination protein RAD52
Source.2078: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.2079: DFBPPR15080 ---- Microorganism protein ---- Dimethyladenosine transferase
Source.2080: DFBPPR15094 ---- Microorganism protein ---- Thioredoxin reductase, mitochondrial
Source.2081: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.2082: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.2083: DFBPPR15146 ---- Microorganism protein ---- DNA polymerase epsilon subunit D
Source.2084: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.2085: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.2086: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.2087: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.2088: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.2089: DFBPPR15221 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.2090: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.2091: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.2092: DFBPPR15276 ---- Microorganism protein ---- Guanine nucleotide-binding protein subunit gamma
Source.2093: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2
Source.2094: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.2095: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.2096: DFBPPR15332 ---- Microorganism protein ---- GDP-mannose transporter
Source.2097: DFBPPR15333 ---- Microorganism protein ---- GDP-mannose transporter
Source.2098: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18
Source.2099: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.2100: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1
Source.2101: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.2102: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3
Source.2103: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.2104: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6
Source.2105: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.2106: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1
Source.2107: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.2108: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.2109: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1
Source.2110: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.2111: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2
Source.2112: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.2113: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.2114: DFBPPR15629 ---- Microorganism protein ---- Transcription activator MSS11
Source.2115: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4
Source.2116: DFBPPR15667 ---- Microorganism protein ---- 60S ribosomal protein L25
Source.2117: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.2118: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.2119: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23
Source.2120: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.2121: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3
Source.2122: DFBPPR15788 ---- Microorganism protein ---- Maintenance of telomere capping protein 2
Source.2123: DFBPPR15823 ---- Microorganism protein ---- Tryptophan synthase alpha chain
Source.2124: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.2125: DFBPPR15843 ---- Microorganism protein ---- Polyphenol oxidase 3
Source.2126: DFBPPR15864 ---- Microorganism protein ---- Hydrophobin-3
Source.2127: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4
Source.2128: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.2129: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.2130: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.2131: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.2132: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3
Source.2133: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic
Source.2134: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.2135: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.2136: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.2137: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.2138: DFBPPR7823 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.2139: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.2140: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a
Source.2141: DFBPPR7836 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic
Source.2142: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.2143: DFBPPR7868 ---- Plant protein ---- Alpha-amylase inhibitor 4
Source.2144: DFBPPR7875 ---- Plant protein ---- CASP-like protein 4B1
Source.2145: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1
Source.2146: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1
Source.2147: DFBPPR7894 ---- Plant protein ---- CASP-like protein 2C2
Source.2148: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.2149: DFBPPR7922 ---- Plant protein ---- 50S ribosomal protein L32, chloroplastic
Source.2150: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.2151: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.2152: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.2153: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.2154: DFBPPR7936 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase, chloroplastic
Source.2155: DFBPPR7997 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.2156: DFBPPR8002 ---- Plant protein ---- Plastocyanin
Source.2157: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.2158: DFBPPR8053 ---- Plant protein ---- Ferritin, chloroplastic
Source.2159: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.2160: DFBPPR8128 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic
Source.2161: DFBPPR8165 ---- Plant protein ---- 50S ribosomal protein L32, chloroplastic
Source.2162: DFBPPR8270 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.2163: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.2164: DFBPPR8306 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic
Source.2165: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1
Source.2166: DFBPPR8342 ---- Plant protein ---- Non-specific lipid-transfer protein
Source.2167: DFBPPR8350 ---- Plant protein ---- 50S ribosomal protein L32, chloroplastic
Link-research
Link 1: DFBPACEI1904----Amaranth seed proteins----Amaranth glutelins
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide exhibited moderate Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 340 μM.

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O
Preparation method
Mode of preparation

Synthesis

Enzyme(s)/starter culture

Chemical synthesis of peptides was carried out by the liquid phase method using DMF as a solvent with DCC and HOBt as coupling reagents.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
DFBP
[D1] DFBPPEPI0086
[D2] DFBPMUFU0123
BIOPEP-UWM [D3] 3370
APD [D4] -
BioPepDB [D5] -
MBPDB [D6] -
Reference(s)
Primary literature Maruyama, S., Mitachi, H., Tanaka, H., Tomizuka, N., Suzuki, H. Studies on the Active Site and Antihypertensive Activity of Angiotensin I-Converting Enzyme Inhibitors Derived from Casein. Agricultural and Biological Chemistry. 2014, 51, 1581-6.
Other literature(s)

[1] Casokinins as bioactive peptides in the primary strucure of casein. In: Food proteins, structure and functionality ed Schwenke K.D., Mothes R., VCh, Weinheim - New York - Basel - Cambridge - Tokyo, pp 67-75.
[2] Ap D L R, Montoya A B, Martã-Nez-Cuevas P, et al. Tryptic amaranth glutelin digests induce endothelial nitric oxide production through inhibition of ACE: antihypertensive role of amaranth peptides[J]. Nitric Oxide, 2010, 23(2):106-111.

PubDate 2014
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214