E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI0486(ACE-inhibitory peptide)
DFBP ID DFBPACEI0486
Peptide sequence MF
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Met-Phe
Single-letter amino acid MF
Peptide length 2
Peptide mass
Experimental mass Theoretical mass
N.D 296.38 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 44.7 uM
pIC50 -1.65
GRAVY 2.3500 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal, Marine, Fish
Organism/Source Sardine muscle
Precursor protein Muscle protein
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein
Source.3: DFBPPR0748 ---- Plant proteins ---- Agglutinin
Source.4: DFBPPR0776 ---- Plant proteins ---- 11S globulin
Source.5: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.6: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.7: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.8: DFBPPR0823 ---- Plant proteins ---- bZIP transcription factor RISBZ3
Source.9: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.10: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8
Source.11: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5
Source.12: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.13: DFBPPR0833 ---- Plant proteins ---- Allene oxide cyclase, chloroplastic
Source.14: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.15: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1
Source.16: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1
Source.17: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.18: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.19: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.20: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.21: DFBPPR0854 ---- Plant proteins ---- Lactoylglutathione lyase
Source.22: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.23: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.24: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.25: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.26: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.27: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1
Source.28: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.29: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.30: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.31: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.32: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.33: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8
Source.34: DFBPPR0894 ---- Plant proteins ---- Serotonin N-acetyltransferase 1, chloroplastic
Source.35: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.36: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12
Source.37: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.38: DFBPPR0914 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.39: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.40: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.41: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.42: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.43: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1
Source.44: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.45: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.46: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial
Source.47: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.48: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial
Source.49: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.50: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.51: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.52: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.53: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.54: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A
Source.55: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.56: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.57: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1
Source.58: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.59: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog
Source.60: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9
Source.61: DFBPPR0971 ---- Plant proteins ---- Protein STAR1
Source.62: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda
Source.63: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7
Source.64: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.65: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.66: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70
Source.67: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.68: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21
Source.69: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.70: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1
Source.71: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.72: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.73: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.74: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.75: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.76: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.77: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.78: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.79: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A
Source.80: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform
Source.81: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1
Source.82: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.83: DFBPPR1041 ---- Plant proteins ---- Histidine-containing phosphotransfer protein 1
Source.84: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.85: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2
Source.86: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.87: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56
Source.88: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.89: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.90: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.91: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1
Source.92: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.93: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24
Source.94: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.95: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.96: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1
Source.97: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51
Source.98: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.99: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24
Source.100: DFBPPR1086 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 46
Source.101: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706
Source.102: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1
Source.103: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.104: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic
Source.105: DFBPPR1097 ---- Plant proteins ---- Thioredoxin M5, chloroplastic
Source.106: DFBPPR1101 ---- Plant proteins ---- Histidine-containing phosphotransfer protein 2
Source.107: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.108: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.109: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.110: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic
Source.111: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.112: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.113: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13
Source.114: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.115: DFBPPR1142 ---- Plant proteins ---- Calreticulin
Source.116: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.117: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.118: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.119: DFBPPR1158 ---- Plant proteins ---- Cysteine and histidine-rich domain-containing protein RAR1
Source.120: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B
Source.121: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.122: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.123: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.124: DFBPPR1179 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 1, mitochondrial
Source.125: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.126: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3
Source.127: DFBPPR1207 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.128: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1
Source.129: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.130: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19
Source.131: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.132: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15
Source.133: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.134: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15
Source.135: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.136: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.137: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.138: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.139: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.140: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.141: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3
Source.142: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.143: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase
Source.144: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1
Source.145: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.146: DFBPPR1283 ---- Plant proteins ---- Arsenate reductase 2.1
Source.147: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.148: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.149: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39
Source.150: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.151: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic
Source.152: DFBPPR1301 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.153: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22
Source.154: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.155: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.156: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B
Source.157: DFBPPR1311 ---- Plant proteins ---- Synaptonemal complex protein ZEP1
Source.158: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.159: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.160: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2
Source.161: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22
Source.162: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.163: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16
Source.164: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.165: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.166: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.167: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.168: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1
Source.169: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.170: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.171: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1
Source.172: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14
Source.173: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.174: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.175: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.176: DFBPPR1356 ---- Plant proteins ---- Non-symbiotic hemoglobin 1
Source.177: DFBPPR1358 ---- Plant proteins ---- Fructose-bisphosphate aldolase, chloroplastic
Source.178: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.179: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.180: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.181: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic
Source.182: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.183: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.184: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.185: DFBPPR1393 ---- Plant proteins ---- Serine/threonine-protein kinase Nek6
Source.186: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.187: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.188: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.189: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.190: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.191: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.192: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A
Source.193: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.194: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.195: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.196: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.197: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.198: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.199: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3
Source.200: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.201: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3
Source.202: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.203: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.204: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.205: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.206: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2
Source.207: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.208: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.209: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.210: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.211: DFBPPR1477 ---- Plant proteins ---- MADS-box transcription factor 16
Source.212: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.213: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.214: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.215: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.216: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.217: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.218: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.219: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein
Source.220: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.221: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.222: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6
Source.223: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.224: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.225: DFBPPR1537 ---- Plant proteins ---- Zinc transporter 8
Source.226: DFBPPR1538 ---- Plant proteins ---- Heat stress transcription factor A-2e
Source.227: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.228: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.229: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.230: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2
Source.231: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.232: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.233: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.234: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.235: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.236: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.237: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF
Source.238: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.239: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2
Source.240: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.241: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.242: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11
Source.243: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.244: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.245: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.246: DFBPPR1604 ---- Plant proteins ---- Putative bifunctional dihydrofolate reductase-thymidylate synthase
Source.247: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.248: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.249: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2
Source.250: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.251: DFBPPR1620 ---- Plant proteins ---- MADS-box transcription factor 29
Source.252: DFBPPR1623 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 2, chloroplastic
Source.253: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.254: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71
Source.255: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.256: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.257: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic
Source.258: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.259: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.260: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.261: DFBPPR1647 ---- Plant proteins ---- Rac-like GTP-binding protein 3
Source.262: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.263: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.264: DFBPPR1651 ---- Plant proteins ---- Protein KTI12 homolog
Source.265: DFBPPR1658 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 19
Source.266: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial
Source.267: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.268: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic
Source.269: DFBPPR1681 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.270: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.271: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.272: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.273: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG
Source.274: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2
Source.275: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.276: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.277: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.278: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic
Source.279: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.280: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.281: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.282: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.283: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.284: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.285: DFBPPR1733 ---- Plant proteins ---- Xylanase inhibitor protein XIP
Source.286: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.287: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.288: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.289: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.290: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.291: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.292: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic
Source.293: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.294: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.295: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.296: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial
Source.297: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.298: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.299: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.300: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A
Source.301: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.302: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.303: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.304: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.305: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.306: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase
Source.307: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.308: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2
Source.309: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial
Source.310: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5
Source.311: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a
Source.312: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B
Source.313: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.314: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.315: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.316: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1
Source.317: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO
Source.318: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.319: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.320: DFBPPR1847 ---- Plant proteins ---- Amidase 1
Source.321: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.322: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.323: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.324: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.325: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.326: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8
Source.327: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.328: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1
Source.329: DFBPPR1889 ---- Plant proteins ---- Laccase-18
Source.330: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8
Source.331: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.332: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.333: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.334: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.335: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1
Source.336: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.337: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1
Source.338: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2
Source.339: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.340: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial
Source.341: DFBPPR1924 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.342: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.343: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2
Source.344: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.345: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial
Source.346: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.347: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.348: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.349: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.350: DFBPPR1948 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5B
Source.351: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.352: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.353: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.354: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.355: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.356: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.357: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.358: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.359: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A
Source.360: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.361: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.362: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B
Source.363: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4
Source.364: DFBPPR2003 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic
Source.365: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A
Source.366: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.367: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.368: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1
Source.369: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.370: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.371: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.372: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.373: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.374: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1
Source.375: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.376: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.377: DFBPPR2026 ---- Plant proteins ---- Proteasome subunit alpha type-5
Source.378: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5
Source.379: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16
Source.380: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.381: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.382: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.383: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11
Source.384: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.385: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15
Source.386: DFBPPR2051 ---- Plant proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase
Source.387: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.388: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.389: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.390: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.391: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.392: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA
Source.393: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.394: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.395: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.396: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.397: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.398: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9
Source.399: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.400: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.401: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.402: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.403: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12
Source.404: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.405: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4
Source.406: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.407: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.408: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2
Source.409: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.410: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.411: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.412: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.413: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.414: DFBPPR2137 ---- Plant proteins ---- Metallothionein-like protein 2C
Source.415: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.416: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic
Source.417: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23
Source.418: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.419: DFBPPR2150 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5A
Source.420: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.421: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.422: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.423: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.424: DFBPPR2159 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.425: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.426: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.427: DFBPPR2163 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.428: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.429: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.430: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.431: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.432: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.433: DFBPPR2175 ---- Plant proteins ---- Expansin-A16
Source.434: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.435: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.436: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.437: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.438: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2
Source.439: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.440: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.441: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.442: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1
Source.443: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.444: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2
Source.445: DFBPPR2199 ---- Plant proteins ---- 18.0 kDa class II heat shock protein
Source.446: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.447: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.448: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.449: DFBPPR2209 ---- Plant proteins ---- Succinate dehydrogenase subunit 4, mitochondrial
Source.450: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.451: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.452: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26
Source.453: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.454: DFBPPR2220 ---- Plant proteins ---- Expansin-A7
Source.455: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.456: DFBPPR2223 ---- Plant proteins ---- Urease
Source.457: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.458: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6
Source.459: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.460: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9
Source.461: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.462: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1
Source.463: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30
Source.464: DFBPPR2252 ---- Plant proteins ---- MADS-box transcription factor 21
Source.465: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial
Source.466: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.467: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.468: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.469: DFBPPR2260 ---- Plant proteins ---- Succinate dehydrogenase subunit 3-1, mitochondrial
Source.470: DFBPPR2261 ---- Plant proteins ---- Succinate dehydrogenase subunit 3-2, mitochondrial
Source.471: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6
Source.472: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.473: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.474: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.475: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8
Source.476: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.477: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.478: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.479: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS
Source.480: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B
Source.481: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.482: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3
Source.483: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.484: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4
Source.485: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.486: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic
Source.487: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b
Source.488: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5
Source.489: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.490: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA
Source.491: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b
Source.492: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.493: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.494: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.495: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.496: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.497: DFBPPR2357 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-6
Source.498: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.499: DFBPPR2360 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.500: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.501: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.502: DFBPPR2364 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.503: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.504: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.505: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5
Source.506: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.507: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.508: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.509: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.510: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10
Source.511: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22
Source.512: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.513: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B
Source.514: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2
Source.515: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.516: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.517: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2
Source.518: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.519: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.520: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33
Source.521: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.522: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.523: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3
Source.524: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.525: DFBPPR2436 ---- Plant proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3
Source.526: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1
Source.527: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2
Source.528: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.529: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.530: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.531: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.532: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic
Source.533: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.534: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial
Source.535: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.536: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.537: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.538: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25
Source.539: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.540: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase
Source.541: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.542: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14
Source.543: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1
Source.544: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.545: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2
Source.546: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.547: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.548: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.549: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20
Source.550: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.551: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.552: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.553: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.554: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.555: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.556: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4
Source.557: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.558: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.559: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.560: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta
Source.561: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.562: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.563: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.564: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.565: DFBPPR2555 ---- Plant proteins ---- Elicitor-responsive protein 3
Source.566: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.567: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4
Source.568: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase
Source.569: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.570: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial
Source.571: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.572: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.573: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic
Source.574: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.575: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.576: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.577: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.578: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.579: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.580: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.581: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2
Source.582: DFBPPR2618 ---- Plant proteins ---- Putative eukaryotic initiation factor 4A-2
Source.583: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.584: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.585: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.586: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1
Source.587: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic
Source.588: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25
Source.589: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.590: DFBPPR2650 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 2
Source.591: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic
Source.592: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b
Source.593: DFBPPR2659 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.594: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.595: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.596: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.597: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.598: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.599: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.600: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1
Source.601: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase
Source.602: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1
Source.603: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.604: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.605: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16
Source.606: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.607: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9
Source.608: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.609: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A
Source.610: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.611: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.612: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.613: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.614: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.615: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.616: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.617: DFBPPR2751 ---- Plant proteins ---- Actin-7
Source.618: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700
Source.619: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.620: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.621: DFBPPR2763 ---- Plant proteins ---- Actin-1
Source.622: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.623: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2
Source.624: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.625: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3
Source.626: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.627: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.628: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.629: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3
Source.630: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2
Source.631: DFBPPR2783 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.632: DFBPPR2784 ---- Plant proteins ---- Chitinase 11
Source.633: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.634: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.635: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.636: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.637: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21
Source.638: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.639: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.640: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.641: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1
Source.642: DFBPPR2818 ---- Plant proteins ---- Replication protein A 14 kDa subunit
Source.643: DFBPPR2819 ---- Plant proteins ---- Squamosa promoter-binding-like protein 4
Source.644: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.645: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3
Source.646: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.647: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.648: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.649: DFBPPR2836 ---- Plant proteins ---- Two-component response regulator ORR12
Source.650: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.651: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.652: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.653: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.654: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.655: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.656: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.657: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.658: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.659: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.660: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.661: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.662: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2
Source.663: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7
Source.664: DFBPPR2902 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase HRD1
Source.665: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2
Source.666: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.667: DFBPPR2908 ---- Plant proteins ---- Auxin-responsive protein IAA8
Source.668: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.669: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.670: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.671: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.672: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.673: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.674: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.675: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13
Source.676: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.677: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A
Source.678: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1
Source.679: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic
Source.680: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1
Source.681: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic
Source.682: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.683: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.684: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40
Source.685: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2
Source.686: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.687: DFBPPR2970 ---- Plant proteins ---- Germin-like protein 1-2
Source.688: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3
Source.689: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.690: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.691: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.692: DFBPPR2982 ---- Plant proteins ---- SKP1-like protein 5
Source.693: DFBPPR2985 ---- Plant proteins ---- Coatomer subunit delta-3
Source.694: DFBPPR2988 ---- Plant proteins ---- Non-symbiotic hemoglobin 2
Source.695: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.696: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1
Source.697: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog
Source.698: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.699: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.700: DFBPPR3007 ---- Plant proteins ---- Thioredoxin H2-2
Source.701: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.702: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2
Source.703: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.704: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.705: DFBPPR3036 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2b
Source.706: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.707: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.708: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B
Source.709: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.710: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.711: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1
Source.712: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A
Source.713: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.714: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5
Source.715: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial
Source.716: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.717: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.718: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.719: DFBPPR3075 ---- Plant proteins ---- Thiamine pyrophosphokinase 2
Source.720: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1
Source.721: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.722: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.723: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7
Source.724: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.725: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.726: DFBPPR3087 ---- Plant proteins ---- Actin-3
Source.727: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.728: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.729: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.730: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.731: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.732: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.733: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.734: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.735: DFBPPR3108 ---- Plant proteins ---- Thioredoxin H4-2
Source.736: DFBPPR3111 ---- Plant proteins ---- Thioredoxin H4-1
Source.737: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial
Source.738: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.739: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.740: DFBPPR3123 ---- Plant proteins ---- Probable mitochondrial import receptor subunit TOM20
Source.741: DFBPPR3124 ---- Plant proteins ---- Two-component response regulator ORR8
Source.742: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.743: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.744: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4
Source.745: DFBPPR3130 ---- Plant proteins ---- COP9 signalosome complex subunit 6
Source.746: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.747: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.748: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5
Source.749: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.750: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.751: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.752: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.753: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.754: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11
Source.755: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.756: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.757: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.758: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.759: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.760: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2
Source.761: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.762: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.763: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.764: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.765: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27
Source.766: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.767: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1
Source.768: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3
Source.769: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.770: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B
Source.771: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.772: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.773: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.774: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.775: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.776: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750
Source.777: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.778: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4
Source.779: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1
Source.780: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3
Source.781: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.782: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.783: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.784: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic
Source.785: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.786: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.787: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.788: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.789: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.790: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b
Source.791: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.792: DFBPPR3283 ---- Plant proteins ---- Auxin-responsive protein IAA21
Source.793: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.794: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1
Source.795: DFBPPR3293 ---- Plant proteins ---- Protein-ribulosamine 3-kinase, chloroplastic
Source.796: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4
Source.797: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.798: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.799: DFBPPR3302 ---- Plant proteins ---- Expansin-A21
Source.800: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.801: DFBPPR3306 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3a
Source.802: DFBPPR3308 ---- Plant proteins ---- Auxin-responsive protein IAA26
Source.803: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1
Source.804: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.805: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5
Source.806: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13
Source.807: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.808: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.809: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.810: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9
Source.811: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.812: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a
Source.813: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.814: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.815: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.816: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.817: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.818: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.819: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.820: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic
Source.821: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.822: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.823: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.824: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.825: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.826: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1
Source.827: DFBPPR3374 ---- Plant proteins ---- Auxin-responsive protein IAA19
Source.828: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1
Source.829: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.830: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14
Source.831: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.832: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2
Source.833: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.834: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.835: DFBPPR3392 ---- Plant proteins ---- Auxin-responsive protein IAA9
Source.836: DFBPPR3393 ---- Plant proteins ---- Auxin-responsive protein IAA20
Source.837: DFBPPR3394 ---- Plant proteins ---- Auxin-responsive protein IAA7
Source.838: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.839: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.840: DFBPPR3400 ---- Plant proteins ---- Auxin-responsive protein IAA12
Source.841: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.842: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.843: DFBPPR3404 ---- Plant proteins ---- Auxin-responsive protein IAA3
Source.844: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1
Source.845: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.846: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2
Source.847: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1
Source.848: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9
Source.849: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5
Source.850: DFBPPR3411 ---- Plant proteins ---- Auxin-responsive protein IAA15
Source.851: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.852: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.853: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.854: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1
Source.855: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.856: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2
Source.857: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.858: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.859: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.860: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.861: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.862: DFBPPR3456 ---- Plant proteins ---- Maturase K
Source.863: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16
Source.864: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600
Source.865: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14
Source.866: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.867: DFBPPR3485 ---- Plant proteins ---- Auxin-responsive protein IAA31
Source.868: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.869: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4
Source.870: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600
Source.871: DFBPPR3502 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 1
Source.872: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.873: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.874: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.875: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4
Source.876: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18
Source.877: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6
Source.878: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic
Source.879: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2
Source.880: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2
Source.881: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.882: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3
Source.883: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.884: DFBPPR3550 ---- Plant proteins ---- NRR repressor homolog 2
Source.885: DFBPPR3552 ---- Plant proteins ---- Auxin-responsive protein IAA4
Source.886: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.887: DFBPPR3554 ---- Plant proteins ---- GTP-binding nuclear protein Ran-3
Source.888: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.889: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76
Source.890: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.891: DFBPPR3581 ---- Plant proteins ---- Auxin-responsive protein IAA17
Source.892: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.893: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.894: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.895: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.896: DFBPPR3594 ---- Plant proteins ---- Auxin-responsive protein IAA10
Source.897: DFBPPR3595 ---- Plant proteins ---- Auxin-responsive protein IAA24
Source.898: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.899: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3
Source.900: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.901: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1
Source.902: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.903: DFBPPR3617 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog
Source.904: DFBPPR3619 ---- Plant proteins ---- Cyclin-D3-1
Source.905: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6
Source.906: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K
Source.907: DFBPPR3624 ---- Plant proteins ---- RNA pseudouridine synthase 4, mitochondrial
Source.908: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1
Source.909: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1
Source.910: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.911: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6
Source.912: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.913: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.914: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.915: DFBPPR3651 ---- Plant proteins ---- 19 kDa globulin
Source.916: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.917: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.918: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.919: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9
Source.920: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J
Source.921: DFBPPR3664 ---- Plant proteins ---- Calcineurin B-like protein 6
Source.922: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.923: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41
Source.924: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.925: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.926: DFBPPR3677 ---- Plant proteins ---- Auxin-responsive protein IAA25
Source.927: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.928: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.929: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.930: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.931: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.932: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.933: DFBPPR3695 ---- Plant proteins ---- Auxin-responsive protein IAA23
Source.934: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39
Source.935: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.936: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.937: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.938: DFBPPR3705 ---- Plant proteins ---- Protein YABBY 2
Source.939: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2
Source.940: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1
Source.941: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.942: DFBPPR3714 ---- Plant proteins ---- GDT1-like protein 4
Source.943: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.944: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.945: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.946: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.947: DFBPPR3728 ---- Plant proteins ---- 10 kDa prolamin
Source.948: DFBPPR3732 ---- Plant proteins ---- CASP-like protein 5A1
Source.949: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.950: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8
Source.951: DFBPPR3737 ---- Plant proteins ---- Probable protein phosphatase 2C 28
Source.952: DFBPPR3745 ---- Plant proteins ---- Protein FERTILITY RESTORER RF2, mitochondrial
Source.953: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2
Source.954: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.955: DFBPPR3754 ---- Plant proteins ---- Auxin-responsive protein IAA30
Source.956: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4
Source.957: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12
Source.958: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.959: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.960: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.961: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.962: DFBPPR3782 ---- Plant proteins ---- Auxin-responsive protein IAA16
Source.963: DFBPPR3783 ---- Plant proteins ---- Patatin-like protein 2
Source.964: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.965: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D
Source.966: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1
Source.967: DFBPPR3797 ---- Plant proteins ---- Coatomer subunit zeta-1
Source.968: DFBPPR3798 ---- Plant proteins ---- Actin-related protein 7
Source.969: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B
Source.970: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.971: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog
Source.972: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1
Source.973: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.974: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22
Source.975: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.976: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C
Source.977: DFBPPR3849 ---- Plant proteins ---- Auxin-responsive protein IAA13
Source.978: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8
Source.979: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66
Source.980: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.981: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.982: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.983: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.984: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.985: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11
Source.986: DFBPPR3893 ---- Plant proteins ---- Coatomer subunit zeta-3
Source.987: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1
Source.988: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.989: DFBPPR3898 ---- Plant proteins ---- Squamosa promoter-binding-like protein 11
Source.990: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.991: DFBPPR3901 ---- Plant proteins ---- Growth-regulating factor 9
Source.992: DFBPPR3914 ---- Plant proteins ---- Derlin-2
Source.993: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.994: DFBPPR3927 ---- Plant proteins ---- Basic leucine zipper 2
Source.995: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.996: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.997: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14
Source.998: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog
Source.999: DFBPPR3952 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 1
Source.1000: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic
Source.1001: DFBPPR3960 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.1002: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.1003: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.1004: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.1005: DFBPPR3972 ---- Plant proteins ---- Basic leucine zipper 19
Source.1006: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.1007: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.1008: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.1009: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25
Source.1010: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2
Source.1011: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2
Source.1012: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.1013: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27
Source.1014: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.1015: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.1016: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.1017: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.1018: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6
Source.1019: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.1020: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5
Source.1021: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.1022: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.1023: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3
Source.1024: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2
Source.1025: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.1026: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.1027: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.1028: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.1029: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog
Source.1030: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58
Source.1031: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.1032: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.1033: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.1034: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.1035: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase
Source.1036: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69
Source.1037: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.1038: DFBPPR4056 ---- Plant proteins ---- Probable protein phosphatase 2C 25
Source.1039: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.1040: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.1041: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.1042: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5
Source.1043: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.1044: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3
Source.1045: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.1046: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.1047: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic
Source.1048: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.1049: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.1050: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic
Source.1051: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.1052: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.1053: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2
Source.1054: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2
Source.1055: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.1056: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.1057: DFBPPR4129 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 1
Source.1058: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.1059: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.1060: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31
Source.1061: DFBPPR4137 ---- Plant proteins ---- Casparian strip membrane protein 7
Source.1062: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.1063: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.1064: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.1065: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7
Source.1066: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.1067: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6
Source.1068: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H
Source.1069: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.1070: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.1071: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.1072: DFBPPR4168 ---- Plant proteins ---- Protein FERTILITY RESTORER RF2, mitochondrial
Source.1073: DFBPPR4170 ---- Plant proteins ---- CMP-sialic acid transporter 3
Source.1074: DFBPPR4171 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 4
Source.1075: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I
Source.1076: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.1077: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.1078: DFBPPR4201 ---- Plant proteins ---- Cyclin-D6-1
Source.1079: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.1080: DFBPPR4207 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 4B
Source.1081: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.1082: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.1083: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.1084: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54
Source.1085: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.1086: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4
Source.1087: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4
Source.1088: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.1089: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3
Source.1090: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.1091: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.1092: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2
Source.1093: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.1094: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.1095: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900
Source.1096: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.1097: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.1098: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3
Source.1099: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3
Source.1100: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21
Source.1101: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.1102: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.1103: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.1104: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.1105: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1
Source.1106: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5
Source.1107: DFBPPR4311 ---- Plant proteins ---- WUSCHEL-related homeobox 6
Source.1108: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.1109: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1
Source.1110: DFBPPR4322 ---- Plant proteins ---- Microtubule-associated protein 70-3
Source.1111: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11
Source.1112: DFBPPR4333 ---- Plant proteins ---- Putative potassium channel KAT5
Source.1113: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10
Source.1114: DFBPPR4341 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1J
Source.1115: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2
Source.1116: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.1117: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.1118: DFBPPR4372 ---- Plant proteins ---- NAP1-related protein 2
Source.1119: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.1120: DFBPPR4378 ---- Plant proteins ---- Basic leucine zipper 6
Source.1121: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.1122: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.1123: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.1124: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5
Source.1125: DFBPPR4389 ---- Plant proteins ---- CASP-like protein 5B2
Source.1126: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.1127: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.1128: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.1129: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2
Source.1130: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.1131: DFBPPR4405 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 4A
Source.1132: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.1133: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.1134: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.1135: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.1136: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.1137: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9
Source.1138: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.1139: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18
Source.1140: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1
Source.1141: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.1142: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.1143: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.1144: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic
Source.1145: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45
Source.1146: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3
Source.1147: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13
Source.1148: DFBPPR4457 ---- Plant proteins ---- Probable calcium-binding protein CML28
Source.1149: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.1150: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.1151: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.1152: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.1153: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.1154: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6
Source.1155: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.1156: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.1157: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.1158: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4
Source.1159: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.1160: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.1161: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic
Source.1162: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic
Source.1163: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6
Source.1164: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.1165: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.1166: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.1167: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic
Source.1168: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.1169: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.1170: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14
Source.1171: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7
Source.1172: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12
Source.1173: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.1174: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.1175: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.1176: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F
Source.1177: DFBPPR4560 ---- Plant proteins ---- Tubby-like F-box protein 10
Source.1178: DFBPPR4565 ---- Plant proteins ---- CASP-like protein 5B1
Source.1179: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1
Source.1180: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2
Source.1181: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.1182: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.1183: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.1184: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.1185: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.1186: DFBPPR4591 ---- Plant proteins ---- Uncharacterized protein ycf76
Source.1187: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21
Source.1188: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39
Source.1189: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.1190: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.1191: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.1192: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.1193: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3
Source.1194: DFBPPR4631 ---- Plant proteins ---- B3 domain-containing protein Os03g0620500
Source.1195: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700
Source.1196: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43
Source.1197: DFBPPR4644 ---- Plant proteins ---- Nuclear transport factor 2
Source.1198: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.1199: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.1200: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.1201: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.1202: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.1203: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.1204: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8
Source.1205: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32
Source.1206: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.1207: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51
Source.1208: DFBPPR4714 ---- Plant proteins ---- B3 domain-containing protein Os06g0107800
Source.1209: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11
Source.1210: DFBPPR4718 ---- Plant proteins ---- Protein TIFY 8
Source.1211: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.1212: DFBPPR4722 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 10
Source.1213: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.1214: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.1215: DFBPPR4736 ---- Plant proteins ---- B3 domain-containing protein Os04g0581400
Source.1216: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400
Source.1217: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400
Source.1218: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9
Source.1219: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.1220: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.1221: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9
Source.1222: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21
Source.1223: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57
Source.1224: DFBPPR4767 ---- Plant proteins ---- CRS2-like protein, chloroplastic
Source.1225: DFBPPR4775 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.1226: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4
Source.1227: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10
Source.1228: DFBPPR4791 ---- Plant proteins ---- B3 domain-containing protein Os02g0683500
Source.1229: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000
Source.1230: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100
Source.1231: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.1232: DFBPPR4813 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0157700
Source.1233: DFBPPR4819 ---- Plant proteins ---- B3 domain-containing protein Os08g0324300
Source.1234: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56
Source.1235: DFBPPR4848 ---- Plant proteins ---- B3 domain-containing protein Os02g0455800
Source.1236: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400
Source.1237: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37
Source.1238: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.1239: DFBPPR4868 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0325100
Source.1240: DFBPPR4869 ---- Plant proteins ---- Putative B3 domain-containing protein LOC_Os07g12820
Source.1241: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1
Source.1242: DFBPPR4874 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 1
Source.1243: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.1244: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3
Source.1245: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.1246: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.1247: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.1248: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic
Source.1249: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF
Source.1250: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.1251: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3
Source.1252: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1
Source.1253: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.1254: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.1255: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1
Source.1256: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.1257: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.1258: DFBPPR4927 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.1259: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.1260: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.1261: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.1262: DFBPPR4965 ---- Plant proteins ---- Glycinin G1
Source.1263: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.1264: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.1265: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.1266: DFBPPR4973 ---- Plant proteins ---- Glycinin G2
Source.1267: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.1268: DFBPPR4980 ---- Plant proteins ---- Lactoylglutathione lyase
Source.1269: DFBPPR4984 ---- Plant proteins ---- Histone acetyltransferase TAP1
Source.1270: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1
Source.1271: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.1272: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1273: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.1274: DFBPPR4992 ---- Plant proteins ---- Glycinin G3
Source.1275: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1276: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.1277: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.1278: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1279: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.1280: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.1281: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.1282: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.1283: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1284: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic
Source.1285: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.1286: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.1287: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2
Source.1288: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1289: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.1290: DFBPPR5043 ---- Plant proteins ---- Flap endonuclease 1
Source.1291: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.1292: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1293: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.1294: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.1295: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.1296: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1297: DFBPPR5060 ---- Plant proteins ---- Ferritin-4, chloroplastic
Source.1298: DFBPPR5061 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.1299: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.1300: DFBPPR5068 ---- Plant proteins ---- Ferritin-3, chloroplastic
Source.1301: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1302: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2
Source.1303: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.1304: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.1305: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.1306: DFBPPR5079 ---- Plant proteins ---- Albumin-1
Source.1307: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.1308: DFBPPR5081 ---- Plant proteins ---- Proteasome subunit alpha type-5
Source.1309: DFBPPR5082 ---- Plant proteins ---- Catalase-4
Source.1310: DFBPPR5086 ---- Plant proteins ---- Catalase-3
Source.1311: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1312: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1313: DFBPPR5091 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.1314: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog
Source.1315: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.1316: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.1317: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase
Source.1318: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial
Source.1319: DFBPPR5112 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 1, chloroplastic
Source.1320: DFBPPR5113 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 4, chloroplastic
Source.1321: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1322: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.1323: DFBPPR5122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.1324: DFBPPR5124 ---- Plant proteins ---- Nodulin-26
Source.1325: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.1326: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.1327: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2
Source.1328: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6
Source.1329: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase
Source.1330: DFBPPR5148 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.1331: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1332: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.1333: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1
Source.1334: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1335: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1336: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1337: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.1338: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1339: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1340: DFBPPR5185 ---- Plant proteins ---- Actin-1
Source.1341: DFBPPR5186 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.1342: DFBPPR5187 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.1343: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum
Source.1344: DFBPPR5194 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.1345: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.1346: DFBPPR5205 ---- Plant proteins ---- Urease
Source.1347: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.1348: DFBPPR5212 ---- Plant proteins ---- Small ribosomal subunit protein S13, mitochondrial
Source.1349: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1350: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.1351: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9
Source.1352: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.1353: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic
Source.1354: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.1355: DFBPPR5223 ---- Plant proteins ---- Stem 28 kDa glycoprotein
Source.1356: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase
Source.1357: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.1358: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1359: DFBPPR5231 ---- Plant proteins ---- Casparian strip membrane protein 5
Source.1360: DFBPPR5235 ---- Plant proteins ---- DNA-directed RNA polymerase II subunit RPB7
Source.1361: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1362: DFBPPR5250 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.1363: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.1364: DFBPPR5265 ---- Plant proteins ---- Auxin-induced protein AUX22
Source.1365: DFBPPR5271 ---- Plant proteins ---- Auxin-induced protein AUX28
Source.1366: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.1367: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9
Source.1368: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.1369: DFBPPR5283 ---- Plant proteins ---- Actin-3
Source.1370: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.1371: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6
Source.1372: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.1373: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1
Source.1374: DFBPPR5368 ---- Plant proteins ---- Desiccation protectant protein Lea14 homolog
Source.1375: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.1376: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.1377: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2
Source.1378: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.1379: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.1380: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.1381: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.1382: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.1383: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1
Source.1384: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase
Source.1385: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A
Source.1386: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.1387: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.1388: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.1389: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.1390: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1391: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1
Source.1392: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit
Source.1393: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2
Source.1394: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic
Source.1395: DFBPPR5437 ---- Plant proteins ---- Exopolygalacturonase
Source.1396: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.1397: DFBPPR5442 ---- Plant proteins ---- GRF-interacting factor 1
Source.1398: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.1399: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.1400: DFBPPR5452 ---- Plant proteins ---- Casein kinase II subunit alpha
Source.1401: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial
Source.1402: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2
Source.1403: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1404: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1405: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial
Source.1406: DFBPPR5472 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic
Source.1407: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1408: DFBPPR5474 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.1409: DFBPPR5476 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.1410: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.1411: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.1412: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic
Source.1413: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic
Source.1414: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1415: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.1416: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.1417: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.1418: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.1419: DFBPPR5528 ---- Plant proteins ---- Exopolygalacturonase
Source.1420: DFBPPR5531 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.1421: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1422: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase
Source.1423: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.1424: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1
Source.1425: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.1426: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B
Source.1427: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A
Source.1428: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.1429: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10
Source.1430: DFBPPR5560 ---- Plant proteins ---- TRIBOA-glucoside O-methyltransferase BX7
Source.1431: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.1432: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1433: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.1434: DFBPPR5568 ---- Plant proteins ---- Microtubule-binding protein TANGLED1
Source.1435: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.1436: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.1437: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.1438: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3
Source.1439: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.1440: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.1441: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1442: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.1443: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1
Source.1444: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1
Source.1445: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.1446: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain
Source.1447: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.1448: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3
Source.1449: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain
Source.1450: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.1451: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.1452: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.1453: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1
Source.1454: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1455: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.1456: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.1457: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic
Source.1458: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.1459: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1460: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.1461: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.1462: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1463: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.1464: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.1465: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.1466: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.1467: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic
Source.1468: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1469: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1470: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.1471: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.1472: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.1473: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.1474: DFBPPR5702 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.1475: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.1476: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.1477: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.1478: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.1479: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.1480: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.1481: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.1482: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1483: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1484: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.1485: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.1486: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.1487: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.1488: DFBPPR5741 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.1489: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1
Source.1490: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.1491: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2
Source.1492: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.1493: DFBPPR5753 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.1494: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform
Source.1495: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1496: DFBPPR5766 ---- Plant proteins ---- MADS-box protein ZMM17
Source.1497: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1
Source.1498: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1499: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2
Source.1500: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.1501: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.1502: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.1503: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1504: DFBPPR5786 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.1505: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B
Source.1506: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1
Source.1507: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase
Source.1508: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.1509: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1510: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1511: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic
Source.1512: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.1513: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4
Source.1514: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.1515: DFBPPR5838 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.1516: DFBPPR5841 ---- Plant proteins ---- Actin-1
Source.1517: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1518: DFBPPR5846 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.1519: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.1520: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.1521: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.1522: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1523: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.1524: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1
Source.1525: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.1526: DFBPPR5885 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.1527: DFBPPR5888 ---- Plant proteins ---- 17.0 kDa class II heat shock protein
Source.1528: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.1529: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1530: DFBPPR5903 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.1531: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.1532: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.1533: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2
Source.1534: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3
Source.1535: DFBPPR5927 ---- Plant proteins ---- Aquaporin SIP2-1
Source.1536: DFBPPR5929 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.1537: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1538: DFBPPR5934 ---- Plant proteins ---- Aquaporin NIP2-1
Source.1539: DFBPPR5944 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.1540: DFBPPR5946 ---- Plant proteins ---- Maturase K
Source.1541: DFBPPR5958 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.1542: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.1543: DFBPPR5976 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog
Source.1544: DFBPPR5981 ---- Plant proteins ---- 17.8 kDa class II heat shock protein
Source.1545: DFBPPR5982 ---- Plant proteins ---- Aquaporin TIP5-1
Source.1546: DFBPPR5994 ---- Plant proteins ---- 17.5 kDa class II heat shock protein
Source.1547: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2
Source.1548: DFBPPR5999 ---- Plant proteins ---- Aquaporin NIP1-1
Source.1549: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2
Source.1550: DFBPPR6004 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.1551: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1
Source.1552: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3
Source.1553: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1554: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.1555: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.1556: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3
Source.1557: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.1558: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1
Source.1559: DFBPPR6072 ---- Plant proteins ---- CASP-like protein 5A2
Source.1560: DFBPPR6073 ---- Plant proteins ---- Protein IAL1
Source.1561: DFBPPR6098 ---- Plant proteins ---- CASP-like protein 5A1
Source.1562: DFBPPR6100 ---- Plant proteins ---- CASP-like protein 5B2
Source.1563: DFBPPR6145 ---- Plant proteins ---- Ninja-family protein 6
Source.1564: DFBPPR6146 ---- Plant proteins ---- Uncharacterized protein ycf76
Source.1565: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.1566: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA
Source.1567: DFBPPR6209 ---- Plant proteins ---- Probable S-adenosylmethionine synthase
Source.1568: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic
Source.1569: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1570: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial
Source.1571: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic
Source.1572: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1573: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.1574: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1575: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.1576: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic
Source.1577: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1578: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic
Source.1579: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1580: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.1581: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial
Source.1582: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.1583: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96
Source.1584: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.1585: DFBPPR6271 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 1
Source.1586: DFBPPR6273 ---- Plant proteins ---- Cell division control protein 2 homolog 1
Source.1587: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1588: DFBPPR6276 ---- Plant proteins ---- Outer envelope pore protein 16, chloroplastic
Source.1589: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.1590: DFBPPR6290 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.1591: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.1592: DFBPPR6295 ---- Plant proteins ---- Outer envelope pore protein 37, chloroplastic
Source.1593: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1594: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.1595: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.1596: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1597: DFBPPR6307 ---- Plant proteins ---- Phytochrome-associated serine/threonine-protein phosphatase
Source.1598: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.1599: DFBPPR6310 ---- Plant proteins ---- Catalase
Source.1600: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.1601: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.1602: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.1603: DFBPPR6317 ---- Plant proteins ---- (+)-6a-hydroxymaackiain 3-O-methyltransferase 2
Source.1604: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.1605: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.1606: DFBPPR6326 ---- Plant proteins ---- Albumin-1 F
Source.1607: DFBPPR6329 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic
Source.1608: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.1609: DFBPPR6335 ---- Plant proteins ---- Protein CYCLOPS
Source.1610: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.1611: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.1612: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.1613: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.1614: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.1615: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.1616: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1617: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1618: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1619: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic
Source.1620: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.1621: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.1622: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic
Source.1623: DFBPPR6378 ---- Plant proteins ---- Albumin-1 D
Source.1624: DFBPPR6379 ---- Plant proteins ---- Albumin-1 C
Source.1625: DFBPPR6380 ---- Plant proteins ---- Legumin A
Source.1626: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1627: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.1628: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1629: DFBPPR6386 ---- Plant proteins ---- ATP synthase subunit delta', mitochondrial
Source.1630: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic
Source.1631: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.1632: DFBPPR6389 ---- Plant proteins ---- Auxin-induced protein IAA4
Source.1633: DFBPPR6390 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic
Source.1634: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.1635: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.1636: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.1637: DFBPPR6425 ---- Plant proteins ---- Legumin A2
Source.1638: DFBPPR6432 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.1639: DFBPPR6434 ---- Plant proteins ---- ATP synthase subunit O, mitochondrial
Source.1640: DFBPPR6436 ---- Plant proteins ---- Albumin-1 B
Source.1641: DFBPPR6437 ---- Plant proteins ---- Albumin-1 A
Source.1642: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic
Source.1643: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1644: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase
Source.1645: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.1646: DFBPPR6473 ---- Plant proteins ---- OBERON-like protein
Source.1647: DFBPPR6483 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.1648: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.1649: DFBPPR6489 ---- Plant proteins ---- Albumin-1 E
Source.1650: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein
Source.1651: DFBPPR6491 ---- Plant proteins ---- Early nodulin-5
Source.1652: DFBPPR6495 ---- Plant proteins ---- Leghemoglobin Lb120-34
Source.1653: DFBPPR6496 ---- Plant proteins ---- Leghemoglobin Lb120-1
Source.1654: DFBPPR6497 ---- Plant proteins ---- Leghemoglobin Lb120-8
Source.1655: DFBPPR6498 ---- Plant proteins ---- Leghemoglobin Lb120-29
Source.1656: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.1657: DFBPPR6509 ---- Plant proteins ---- Auxin-induced protein IAA6
Source.1658: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.1659: DFBPPR6526 ---- Plant proteins ---- Albumin-2
Source.1660: DFBPPR6531 ---- Plant proteins ---- 2-dehydro-3-deoxyphosphooctonate aldolase
Source.1661: DFBPPR6540 ---- Plant proteins ---- Non-seed lectin
Source.1662: DFBPPR6550 ---- Plant proteins ---- Actin-3
Source.1663: DFBPPR6551 ---- Plant proteins ---- Actin-2
Source.1664: DFBPPR6552 ---- Plant proteins ---- Actin-1
Source.1665: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1666: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.1667: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.1668: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.1669: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.1670: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.1671: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.1672: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.1673: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic
Source.1674: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.1675: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1676: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.1677: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic
Source.1678: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.1679: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.1680: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1681: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.1682: DFBPPR6674 ---- Plant proteins ---- Oxalate oxidase GF-3.8
Source.1683: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1684: DFBPPR6677 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 2
Source.1685: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10
Source.1686: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.1687: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1688: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein
Source.1689: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.1690: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa
Source.1691: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase
Source.1692: DFBPPR6727 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.1693: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.1694: DFBPPR6733 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.1695: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1696: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase
Source.1697: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.1698: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.1699: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1700: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.1701: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1702: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.1703: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1704: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.1705: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.1706: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.1707: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.1708: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.1709: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.1710: DFBPPR6770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.1711: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1712: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.1713: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.1714: DFBPPR6782 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.1715: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1716: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1717: DFBPPR6796 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.1718: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.1719: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic
Source.1720: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic
Source.1721: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1722: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1723: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1724: DFBPPR6812 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.1725: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1726: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.1727: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1728: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1729: DFBPPR6834 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain clone 512
Source.1730: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.1731: DFBPPR6843 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.1732: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta
Source.1733: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1734: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1735: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1736: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.1737: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1738: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1739: DFBPPR6882 ---- Plant proteins ---- Maturase K
Source.1740: DFBPPR6888 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1741: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1742: DFBPPR6912 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.1743: DFBPPR6923 ---- Plant proteins ---- Avenin-like a1
Source.1744: DFBPPR6961 ---- Plant proteins ---- Avenin-like a2
Source.1745: DFBPPR6964 ---- Plant proteins ---- Avenin-like a3
Source.1746: DFBPPR6971 ---- Plant proteins ---- Avenin-like a7
Source.1747: DFBPPR6983 ---- Plant proteins ---- Avenin-like a4
Source.1748: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.1749: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic
Source.1750: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase
Source.1751: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.1752: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1753: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1754: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic
Source.1755: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII
Source.1756: DFBPPR7049 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.1757: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.1758: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.1759: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1760: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1761: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.1762: DFBPPR7070 ---- Plant proteins ---- Red chlorophyll catabolite reductase
Source.1763: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.1764: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1765: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.1766: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.1767: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1768: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic
Source.1769: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2
Source.1770: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.1771: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.1772: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.1773: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4
Source.1774: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.1775: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.1776: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.1777: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.1778: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1779: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.1780: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1781: DFBPPR7120 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.1782: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1783: DFBPPR7123 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.1784: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1
Source.1785: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2
Source.1786: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial
Source.1787: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A
Source.1788: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3
Source.1789: DFBPPR7133 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.1790: DFBPPR7135 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.1791: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV
Source.1792: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.1793: DFBPPR7142 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.1794: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.1795: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.1796: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.1797: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.1798: DFBPPR7157 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.1799: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.1800: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8
Source.1801: DFBPPR7166 ---- Plant proteins ---- Serine carboxypeptidase II-2
Source.1802: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1803: DFBPPR7170 ---- Plant proteins ---- Maturase K
Source.1804: DFBPPR7171 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.1805: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.1806: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1807: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1808: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.1809: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1810: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1811: DFBPPR7191 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.1812: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.1813: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1814: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.1815: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1816: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.1817: DFBPPR7257 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.1818: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1819: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3
Source.1820: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2
Source.1821: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6
Source.1822: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7
Source.1823: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.1824: DFBPPR7402 ---- Plant proteins ---- Probable pectinesterase/pectinesterase inhibitor
Source.1825: DFBPPR7408 ---- Plant proteins ---- Basic endochitinase CHB4
Source.1826: DFBPPR7410 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.1827: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.1828: DFBPPR7418 ---- Plant proteins ---- Oleosin-B6
Source.1829: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a
Source.1830: DFBPPR7424 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 A, chloroplastic
Source.1831: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.1832: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.1833: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1834: DFBPPR7438 ---- Plant proteins ---- Oleosin-B3
Source.1835: DFBPPR7439 ---- Plant proteins ---- Oleosin-B4
Source.1836: DFBPPR7449 ---- Plant proteins ---- Oleosin-B2
Source.1837: DFBPPR7451 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.1838: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.1839: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.1840: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.1841: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic
Source.1842: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.1843: DFBPPR7479 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 B, chloroplastic
Source.1844: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial
Source.1845: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.1846: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION
Source.1847: DFBPPR7511 ---- Plant proteins ---- Non-symbiotic hemoglobin 2
Source.1848: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1849: DFBPPR7520 ---- Plant proteins ---- 40S ribosomal protein S15a
Source.1850: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A
Source.1851: DFBPPR7522 ---- Plant proteins ---- Proliferating cell nuclear antigen
Source.1852: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1853: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C
Source.1854: DFBPPR7533 ---- Plant proteins ---- Tapetum-specific protein A9
Source.1855: DFBPPR7534 ---- Plant proteins ---- Acyl-CoA-binding protein
Source.1856: DFBPPR7542 ---- Plant proteins ---- 60S ribosomal protein L5, mitochondrial
Source.1857: DFBPPR7597 ---- Milk proteins ---- Alpha-lactalbumin
Source.1858: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.1859: DFBPPR7611 ---- Milk proteins ---- Clusterin
Source.1860: DFBPPR7618 ---- Milk proteins ---- Plasminogen
Source.1861: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.1862: DFBPPR7622 ---- Milk proteins ---- Mucin-1
Source.1863: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4
Source.1864: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.1865: DFBPPR7625 ---- Milk proteins ---- Leucine-rich alpha-2-glycoprotein
Source.1866: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain
Source.1867: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2
Source.1868: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor
Source.1869: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.1870: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.1871: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.1872: DFBPPR7674 ---- Milk proteins ---- Beta-lactoglobulin-2
Source.1873: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.1874: DFBPPR7692 ---- Milk proteins ---- Beta-casein
Source.1875: DFBPPR7700 ---- Milk proteins ---- Beta-casein
Source.1876: DFBPPR7702 ---- Milk proteins ---- Alpha-lactalbumin (Lactose synthase B protein)
Source.1877: DFBPPR7703 ---- Milk proteins ---- Alpha-lactalbumin (Lactose synthase B protein)
Source.1878: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.1879: DFBPPR7718 ---- Milk proteins ---- Beta-casein
Source.1880: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1
Source.1881: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.1882: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.1883: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1884: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1885: DFBPPR7739 ---- Plant proteins ---- Avenin-E
Source.1886: DFBPPR7744 ---- Plant proteins ---- Maturase K
Source.1887: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.1888: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.1889: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101
Source.1890: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.1891: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1892: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1893: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1894: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.1895: DFBPPR8413 ---- Plant proteins ---- Arachin Ahy-3
Source.1896: DFBPPR8419 ---- Plant proteins ---- Arachin 21 kDa protein
Source.1897: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1898: DFBPPR8428 ---- Plant proteins ---- 11S globulin seed storage protein 2
Source.1899: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1900: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.1901: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1902: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.1903: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1904: DFBPPR8468 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1905: DFBPPR8489 ---- Milk proteins ---- Beta-casein
Source.1906: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.1907: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.1908: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4
Source.1909: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.1910: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.1911: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.1912: DFBPPR8508 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.1913: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.1914: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1915: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.1916: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.1917: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.1918: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.1919: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.1920: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.1921: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.1922: DFBPPR15951 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.1923: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.1924: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1925: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.1926: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.1927: DFBPPR15960 ---- Animal proteins ---- Apolipoprotein A-IV
Source.1928: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.1929: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.1930: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1931: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.1932: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1
Source.1933: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8
Source.1934: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.1935: DFBPPR15978 ---- Animal proteins ---- 7,8-dihydro-8-oxoguanine triphosphatase
Source.1936: DFBPPR15982 ---- Animal proteins ---- Triadin
Source.1937: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.1938: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.1939: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.1940: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1
Source.1941: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1942: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.1943: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.1944: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1945: DFBPPR16011 ---- Animal proteins ---- Interferon gamma
Source.1946: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.1947: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1948: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.1949: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.1950: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1951: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.1952: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1953: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN
Source.1954: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.1955: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.1956: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta
Source.1957: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.1958: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1959: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.1960: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.1961: DFBPPR16053 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.1962: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.1963: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase
Source.1964: DFBPPR16058 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.1965: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.1966: DFBPPR16062 ---- Animal proteins ---- Methylosome subunit pICln
Source.1967: DFBPPR16064 ---- Animal proteins ---- Calnexin
Source.1968: DFBPPR16066 ---- Animal proteins ---- Coagulation factor IX
Source.1969: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.1970: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1
Source.1971: DFBPPR16072 ---- Animal proteins ---- Clusterin
Source.1972: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2
Source.1973: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.1974: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.1975: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.1976: DFBPPR16085 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2
Source.1977: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.1978: DFBPPR16089 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.1979: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.1980: DFBPPR16096 ---- Animal proteins ---- Protein CLN8
Source.1981: DFBPPR16098 ---- Animal proteins ---- Fibroblast growth factor 7
Source.1982: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.1983: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1984: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.1985: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.1986: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.1987: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain
Source.1988: DFBPPR16115 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1
Source.1989: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.1990: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.1991: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.1992: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12
Source.1993: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1994: DFBPPR16140 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha
Source.1995: DFBPPR16142 ---- Animal proteins ---- Procathepsin L
Source.1996: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.1997: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.1998: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.1999: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.2000: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.2001: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.2002: DFBPPR16186 ---- Animal proteins ---- Parathyroid hormone
Source.2003: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2004: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.2005: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.2006: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2007: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.2008: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.2009: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.2010: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.2011: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.2012: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.2013: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.2014: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.2015: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.2016: DFBPPR16224 ---- Animal proteins ---- Uromodulin
Source.2017: DFBPPR16225 ---- Animal proteins ---- C-C motif chemokine 24
Source.2018: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.2019: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog
Source.2020: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.2021: DFBPPR16237 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.2022: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.2023: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.2024: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.2025: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.2026: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4
Source.2027: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.2028: DFBPPR16271 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.2029: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.2030: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.2031: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.2032: DFBPPR16306 ---- Animal proteins ---- Ras-related protein Rab-25
Source.2033: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.2034: DFBPPR16322 ---- Animal proteins ---- Interleukin-18
Source.2035: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.2036: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4
Source.2037: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4
Source.2038: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.2039: DFBPPR16341 ---- Animal proteins ---- Calmegin
Source.2040: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.2041: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.2042: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype
Source.2043: DFBPPR16368 ---- Animal proteins ---- Tyrosinase
Source.2044: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.2045: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.2046: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.2047: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.2048: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.2049: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.2050: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.2051: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2
Source.2052: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain
Source.2053: DFBPPR16462 ---- Animal proteins ---- Pantetheinase
Source.2054: DFBPPR16468 ---- Animal proteins ---- Sodium channel subunit beta-2
Source.2055: DFBPPR16475 ---- Animal proteins ---- Transmembrane protein 258
Source.2056: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.2057: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.2058: DFBPPR16478 ---- Animal proteins ---- Chymotrypsinogen 2
Source.2059: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.2060: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor
Source.2061: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.2062: DFBPPR16515 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.2063: DFBPPR16522 ---- Animal proteins ---- Inducible T-cell costimulator
Source.2064: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.2065: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.2066: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.2067: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a
Source.2068: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3
Source.2069: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor
Source.2070: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.2071: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2072: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.2073: DFBPPR16543 ---- Animal proteins ---- ATP synthase protein 8
Source.2074: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein
Source.2075: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.2076: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.2077: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.2078: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.2079: DFBPPR16573 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.2080: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.2081: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2082: DFBPPR16582 ---- Animal proteins ---- Pepsin A
Source.2083: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.2084: DFBPPR16587 ---- Animal proteins ---- B-lymphocyte antigen CD20
Source.2085: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.2086: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4
Source.2087: DFBPPR16595 ---- Animal proteins ---- Annexin A4
Source.2088: DFBPPR16598 ---- Animal proteins ---- Keratin, type I cytoskeletal 9
Source.2089: DFBPPR16600 ---- Animal proteins ---- Ras-related protein Rab-4B
Source.2090: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.2091: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.2092: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1
Source.2093: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.2094: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.2095: DFBPPR16656 ---- Animal proteins ---- 60S ribosomal protein L4
Source.2096: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.2097: DFBPPR16674 ---- Animal proteins ---- Double-headed protease inhibitor, submandibular gland
Source.2098: DFBPPR16679 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.2099: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.2100: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT
Source.2101: DFBPPR16693 ---- Animal proteins ---- Cingulin
Source.2102: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.2103: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.2104: DFBPPR16714 ---- Animal proteins ---- Protein fosB
Source.2105: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.2106: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46
Source.2107: DFBPPR16739 ---- Animal proteins ---- Lengsin
Source.2108: DFBPPR16747 ---- Animal proteins ---- Pleckstrin
Source.2109: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.2110: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.2111: DFBPPR16753 ---- Animal proteins ---- Nicolin-1
Source.2112: DFBPPR16755 ---- Animal proteins ---- Glyoxalase domain-containing protein 5
Source.2113: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.2114: DFBPPR16762 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.2115: DFBPPR16767 ---- Animal proteins ---- Nucleoside diphosphate kinase, mitochondrial
Source.2116: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.2117: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.2118: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase
Source.2119: DFBPPR16809 ---- Animal proteins ---- Rhodopsin
Source.2120: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.2121: DFBPPR16813 ---- Animal proteins ---- Prolactin
Source.2122: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.2123: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2124: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X
Source.2125: DFBPPR16831 ---- Animal proteins ---- Fibrinogen beta chain
Source.2126: DFBPPR16833 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.2127: DFBPPR16837 ---- Animal proteins ---- Interferon gamma
Source.2128: DFBPPR16840 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.2129: DFBPPR16847 ---- Animal proteins ---- Fibrinogen alpha chain
Source.2130: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.2131: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.2132: DFBPPR16852 ---- Animal proteins ---- Cytochrome b
Source.2133: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.2134: DFBPPR16860 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.2135: DFBPPR16861 ---- Animal proteins ---- Adenylate kinase 2, mitochondrial
Source.2136: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX
Source.2137: DFBPPR16873 ---- Animal proteins ---- Cationic trypsin
Source.2138: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor
Source.2139: DFBPPR16876 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.2140: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2141: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.2142: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.2143: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial
Source.2144: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.2145: DFBPPR16893 ---- Animal proteins ---- Annexin A4
Source.2146: DFBPPR16894 ---- Animal proteins ---- Procathepsin L
Source.2147: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII
Source.2148: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.2149: DFBPPR16901 ---- Animal proteins ---- Lens fiber membrane intrinsic protein
Source.2150: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.2151: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.2152: DFBPPR16909 ---- Animal proteins ---- Calreticulin
Source.2153: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.2154: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.2155: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.2156: DFBPPR16935 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13
Source.2157: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.2158: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.2159: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.2160: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic
Source.2161: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53
Source.2162: DFBPPR16950 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.2163: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.2164: DFBPPR16962 ---- Animal proteins ---- Interleukin-18
Source.2165: DFBPPR16967 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta
Source.2166: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.2167: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.2168: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.2169: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3
Source.2170: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.2171: DFBPPR16993 ---- Animal proteins ---- Protein S100-A10
Source.2172: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.2173: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.2174: DFBPPR17000 ---- Animal proteins ---- Vimentin
Source.2175: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.2176: DFBPPR17004 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.2177: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.2178: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.2179: DFBPPR17023 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10
Source.2180: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.2181: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.2182: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.2183: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.2184: DFBPPR17032 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 2
Source.2185: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.2186: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.2187: DFBPPR17037 ---- Animal proteins ---- Annexin A1
Source.2188: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.2189: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.2190: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.2191: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.2192: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.2193: DFBPPR17060 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 1
Source.2194: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.2195: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.2196: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.2197: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.2198: DFBPPR17070 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF168
Source.2199: DFBPPR17076 ---- Animal proteins ---- Ras-related protein Rab-3A
Source.2200: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2201: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.2202: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2
Source.2203: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.2204: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.2205: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.2206: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A
Source.2207: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.2208: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.2209: DFBPPR17108 ---- Animal proteins ---- Coronin-1A
Source.2210: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.2211: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.2212: DFBPPR17118 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1
Source.2213: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.2214: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.2215: DFBPPR17125 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha isoforms short
Source.2216: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit
Source.2217: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.2218: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.2219: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.2220: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.2221: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.2222: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.2223: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.2224: DFBPPR17158 ---- Animal proteins ---- EH domain-containing protein 1
Source.2225: DFBPPR17159 ---- Animal proteins ---- EH domain-containing protein 1
Source.2226: DFBPPR17160 ---- Animal proteins ---- EH domain-containing protein 1
Source.2227: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.2228: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.2229: DFBPPR17168 ---- Animal proteins ---- Angiopoietin-1
Source.2230: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.2231: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.2232: DFBPPR17193 ---- Animal proteins ---- Oxysterols receptor LXR-alpha
Source.2233: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.2234: DFBPPR17204 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.2235: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.2236: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.2237: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.2238: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33
Source.2239: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.2240: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.2241: DFBPPR17267 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 4B
Source.2242: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.2243: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1
Source.2244: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2
Source.2245: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.2246: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2247: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.2248: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D
Source.2249: DFBPPR17297 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.2250: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.2251: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.2252: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.2253: DFBPPR17309 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1
Source.2254: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.2255: DFBPPR17319 ---- Animal proteins ---- Integrin beta-1-binding protein 1
Source.2256: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.2257: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.2258: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.2259: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.2260: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase
Source.2261: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.2262: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.2263: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal
Source.2264: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.2265: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.2266: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.2267: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.2268: DFBPPR17355 ---- Animal proteins ---- Proliferating cell nuclear antigen
Source.2269: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.2270: DFBPPR17362 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.2271: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.2272: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.2273: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.2274: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1
Source.2275: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.2276: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6
Source.2277: DFBPPR17376 ---- Animal proteins ---- Flotillin-1
Source.2278: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.2279: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.2280: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.2281: DFBPPR17382 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 5
Source.2282: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial
Source.2283: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.2284: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.2285: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.2286: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.2287: DFBPPR17409 ---- Animal proteins ---- Geranylgeranyl pyrophosphate synthase
Source.2288: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.2289: DFBPPR17415 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase 1
Source.2290: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5
Source.2291: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.2292: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.2293: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.2294: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.2295: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2296: DFBPPR17452 ---- Animal proteins ---- CD81 antigen
Source.2297: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.2298: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.2299: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial
Source.2300: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.2301: DFBPPR17467 ---- Animal proteins ---- Cytochrome c oxidase subunit 4 isoform 1, mitochondrial
Source.2302: DFBPPR17468 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.2303: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase
Source.2304: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.2305: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.2306: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.2307: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.2308: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.2309: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.2310: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.2311: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.2312: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.2313: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.2314: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1
Source.2315: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.2316: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial
Source.2317: DFBPPR17503 ---- Animal proteins ---- Syntaxin-1A
Source.2318: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.2319: DFBPPR17510 ---- Animal proteins ---- Uroplakin-1b
Source.2320: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.2321: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.2322: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.2323: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.2324: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.2325: DFBPPR17524 ---- Animal proteins ---- DnaJ homolog subfamily A member 1
Source.2326: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.2327: DFBPPR17530 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.2328: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.2329: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.2330: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.2331: DFBPPR17541 ---- Animal proteins ---- Sorting nexin-3
Source.2332: DFBPPR17542 ---- Animal proteins ---- Acetylcholine receptor subunit beta
Source.2333: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.2334: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4
Source.2335: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog
Source.2336: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.2337: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1
Source.2338: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.2339: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.2340: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.2341: DFBPPR17584 ---- Animal proteins ---- Cytochrome c oxidase subunit 7B, mitochondrial
Source.2342: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.2343: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.2344: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.2345: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.2346: DFBPPR17636 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.2347: DFBPPR17648 ---- Animal proteins ---- NAD-capped RNA hydrolase NUDT12
Source.2348: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.2349: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1
Source.2350: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.2351: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.2352: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.2353: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.2354: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L
Source.2355: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.2356: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.2357: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.2358: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1
Source.2359: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.2360: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.2361: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2362: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.2363: DFBPPR17756 ---- Animal proteins ---- Ras-related protein Rab-3B
Source.2364: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.2365: DFBPPR17765 ---- Animal proteins ---- Ras-related protein Rab-27B
Source.2366: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.2367: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.2368: DFBPPR17776 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.2369: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.2370: DFBPPR17782 ---- Animal proteins ---- Ras GTPase-activating protein-binding protein 1
Source.2371: DFBPPR17787 ---- Animal proteins ---- Septin-6
Source.2372: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.2373: DFBPPR17790 ---- Animal proteins ---- Interleukin-15
Source.2374: DFBPPR17792 ---- Animal proteins ---- Glycine N-acyltransferase
Source.2375: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.2376: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.2377: DFBPPR17806 ---- Animal proteins ---- Uroplakin-2
Source.2378: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.2379: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.2380: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.2381: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.2382: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase
Source.2383: DFBPPR17824 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 9
Source.2384: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.2385: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.2386: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.2387: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B
Source.2388: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13
Source.2389: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.2390: DFBPPR17847 ---- Animal proteins ---- Palmitoyltransferase ZDHHC20
Source.2391: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.2392: DFBPPR17861 ---- Animal proteins ---- 3-hydroxyanthranilate 3,4-dioxygenase
Source.2393: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.2394: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.2395: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.2396: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.2397: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.2398: DFBPPR17880 ---- Animal proteins ---- Apolipoprotein A-IV
Source.2399: DFBPPR17883 ---- Animal proteins ---- Sialidase-1
Source.2400: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.2401: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.2402: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.2403: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.2404: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.2405: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.2406: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.2407: DFBPPR17905 ---- Animal proteins ---- DNA endonuclease RBBP8
Source.2408: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.2409: DFBPPR17913 ---- Animal proteins ---- ATP synthase subunit gamma, mitochondrial
Source.2410: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.2411: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A
Source.2412: DFBPPR17918 ---- Animal proteins ---- Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial
Source.2413: DFBPPR17923 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.2414: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.2415: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2
Source.2416: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.2417: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2
Source.2418: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.2419: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.2420: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.2421: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.2422: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.2423: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.2424: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.2425: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.2426: DFBPPR17982 ---- Animal proteins ---- Sorting nexin-10
Source.2427: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial
Source.2428: DFBPPR17987 ---- Animal proteins ---- DCN1-like protein 3
Source.2429: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.2430: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.2431: DFBPPR18001 ---- Animal proteins ---- Syntaxin-1B
Source.2432: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.2433: DFBPPR18015 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.2434: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1
Source.2435: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.2436: DFBPPR18021 ---- Animal proteins ---- Lutropin subunit beta
Source.2437: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.2438: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.2439: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2440: DFBPPR18029 ---- Animal proteins ---- Collagen alpha-3(IV) chain
Source.2441: DFBPPR18031 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 2
Source.2442: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.2443: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3
Source.2444: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.2445: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase
Source.2446: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6
Source.2447: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5
Source.2448: DFBPPR18047 ---- Animal proteins ---- ATP synthase F(0) complex subunit C3, mitochondrial
Source.2449: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.2450: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.2451: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2
Source.2452: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.2453: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.2454: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.2455: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8
Source.2456: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.2457: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.2458: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.2459: DFBPPR18094 ---- Animal proteins ---- Neutrophil cytosol factor 1
Source.2460: DFBPPR18100 ---- Animal proteins ---- Derlin-1
Source.2461: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.2462: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.2463: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.2464: DFBPPR18107 ---- Animal proteins ---- Lymphocyte antigen 96
Source.2465: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2
Source.2466: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38
Source.2467: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.2468: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.2469: DFBPPR18123 ---- Animal proteins ---- Macrophage migration inhibitory factor
Source.2470: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.2471: DFBPPR18136 ---- Animal proteins ---- Septin-8
Source.2472: DFBPPR18137 ---- Animal proteins ---- Septin-8
Source.2473: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.2474: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.2475: DFBPPR18168 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 W
Source.2476: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.2477: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.2478: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.2479: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.2480: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.2481: DFBPPR18197 ---- Animal proteins ---- Bax inhibitor 1
Source.2482: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.2483: DFBPPR18207 ---- Animal proteins ---- Interleukin-7
Source.2484: DFBPPR18233 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3
Source.2485: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.2486: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.2487: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.2488: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.2489: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.2490: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.2491: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.2492: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2
Source.2493: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.2494: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.2495: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.2496: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein
Source.2497: DFBPPR18295 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2
Source.2498: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.2499: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.2500: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.2501: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.2502: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon
Source.2503: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.2504: DFBPPR18332 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.2505: DFBPPR18334 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.2506: DFBPPR18335 ---- Animal proteins ---- Septin-11
Source.2507: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor
Source.2508: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.2509: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1
Source.2510: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.2511: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.2512: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase
Source.2513: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.2514: DFBPPR18361 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.2515: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.2516: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.2517: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial
Source.2518: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.2519: DFBPPR18374 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2
Source.2520: DFBPPR18375 ---- Animal proteins ---- Nucleoporin SEH1
Source.2521: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.2522: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.2523: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.2524: DFBPPR18388 ---- Animal proteins ---- Elongation factor Tu, mitochondrial
Source.2525: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.2526: DFBPPR18402 ---- Animal proteins ---- Uromodulin
Source.2527: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10
Source.2528: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos
Source.2529: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.2530: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor
Source.2531: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.2532: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.2533: DFBPPR18432 ---- Animal proteins ---- Vacuole membrane protein 1
Source.2534: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.2535: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.2536: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.2537: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1
Source.2538: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor
Source.2539: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1
Source.2540: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.2541: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.2542: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component
Source.2543: DFBPPR18480 ---- Animal proteins ---- Casein kinase I isoform gamma-3
Source.2544: DFBPPR18487 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.2545: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.2546: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.2547: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.2548: DFBPPR18506 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.2549: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.2550: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.2551: DFBPPR18514 ---- Animal proteins ---- Ras-related protein Rab-3C
Source.2552: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit
Source.2553: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.2554: DFBPPR18520 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.2555: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1
Source.2556: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.2557: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.2558: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1
Source.2559: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1
Source.2560: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.2561: DFBPPR18564 ---- Animal proteins ---- BRISC and BRCA1-A complex member 1
Source.2562: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4
Source.2563: DFBPPR18567 ---- Animal proteins ---- Dynein heavy chain 12, axonemal
Source.2564: DFBPPR18570 ---- Animal proteins ---- Prolyl 3-hydroxylase OGFOD1
Source.2565: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.2566: DFBPPR18579 ---- Animal proteins ---- ATP synthase protein 8
Source.2567: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.2568: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.2569: DFBPPR18592 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.2570: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.2571: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.2572: DFBPPR18600 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B
Source.2573: DFBPPR18602 ---- Animal proteins ---- Aquaporin-3
Source.2574: DFBPPR18607 ---- Animal proteins ---- MICOS complex subunit MIC26
Source.2575: DFBPPR18621 ---- Animal proteins ---- Cytochrome b561
Source.2576: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4
Source.2577: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.2578: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.2579: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.2580: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1
Source.2581: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1
Source.2582: DFBPPR18653 ---- Animal proteins ---- Palmitoyltransferase ZDHHC21
Source.2583: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.2584: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.2585: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.2586: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4
Source.2587: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor
Source.2588: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.2589: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.2590: DFBPPR18736 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.2591: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.2592: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor
Source.2593: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1
Source.2594: DFBPPR18748 ---- Animal proteins ---- Ras-related protein Rab-4A
Source.2595: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.2596: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.2597: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3
Source.2598: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein
Source.2599: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.2600: DFBPPR18778 ---- Animal proteins ---- Erlin-2
Source.2601: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.2602: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav
Source.2603: DFBPPR18791 ---- Animal proteins ---- Small nuclear ribonucleoprotein Sm D2
Source.2604: DFBPPR18793 ---- Animal proteins ---- BPI fold-containing family A member 1
Source.2605: DFBPPR18795 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C2
Source.2606: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.2607: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.2608: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.2609: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.2610: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.2611: DFBPPR18815 ---- Animal proteins ---- Pantetheinase
Source.2612: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.2613: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.2614: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.2615: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2
Source.2616: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.2617: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.2618: DFBPPR18832 ---- Animal proteins ---- Shiftless antiviral inhibitor of ribosomal frameshifting protein homolog
Source.2619: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.2620: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.2621: DFBPPR18846 ---- Animal proteins ---- Sex-determining region Y protein
Source.2622: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.2623: DFBPPR18853 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor D
Source.2624: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.2625: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase
Source.2626: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2
Source.2627: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.2628: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.2629: DFBPPR18874 ---- Animal proteins ---- Acyl-protein thioesterase 1
Source.2630: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.2631: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.2632: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1
Source.2633: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20
Source.2634: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless
Source.2635: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.2636: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.2637: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.2638: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3
Source.2639: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.2640: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.2641: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.2642: DFBPPR18936 ---- Animal proteins ---- S-methyl-5'-thioadenosine phosphorylase
Source.2643: DFBPPR18937 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2-binding protein
Source.2644: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.2645: DFBPPR18948 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL1
Source.2646: DFBPPR18951 ---- Animal proteins ---- DNA excision repair protein ERCC-8
Source.2647: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2
Source.2648: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.2649: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7
Source.2650: DFBPPR18964 ---- Animal proteins ---- Placental prolactin-related protein 1
Source.2651: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1
Source.2652: DFBPPR18974 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.2653: DFBPPR18975 ---- Animal proteins ---- Ribosome maturation protein SBDS
Source.2654: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3
Source.2655: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.2656: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.2657: DFBPPR18985 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.2658: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.2659: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5
Source.2660: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.2661: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74
Source.2662: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I
Source.2663: DFBPPR19006 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.2664: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1
Source.2665: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5
Source.2666: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1
Source.2667: DFBPPR19027 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E
Source.2668: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.2669: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.2670: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.2671: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.2672: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic
Source.2673: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.2674: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.2675: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.2676: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.2677: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta
Source.2678: DFBPPR19065 ---- Animal proteins ---- Cadherin-6
Source.2679: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.2680: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6
Source.2681: DFBPPR19079 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.2682: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13
Source.2683: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.2684: DFBPPR19107 ---- Animal proteins ---- Lymphocyte transmembrane adapter 1
Source.2685: DFBPPR19109 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.2686: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B
Source.2687: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.2688: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2
Source.2689: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.2690: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.2691: DFBPPR19126 ---- Animal proteins ---- Calpain small subunit 1
Source.2692: DFBPPR19127 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H
Source.2693: DFBPPR19130 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-3 subunit
Source.2694: DFBPPR19137 ---- Animal proteins ---- Serpin H1
Source.2695: DFBPPR19140 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 5
Source.2696: DFBPPR19144 ---- Animal proteins ---- C-X-C motif chemokine 11
Source.2697: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like
Source.2698: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2
Source.2699: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.2700: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2
Source.2701: DFBPPR19172 ---- Animal proteins ---- Persulfide dioxygenase ETHE1, mitochondrial
Source.2702: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.2703: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16
Source.2704: DFBPPR19178 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter SLC6A17
Source.2705: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3
Source.2706: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.2707: DFBPPR19184 ---- Animal proteins ---- Alpha-soluble NSF attachment protein
Source.2708: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.2709: DFBPPR19188 ---- Animal proteins ---- Centromere protein S
Source.2710: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.2711: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2
Source.2712: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.2713: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5
Source.2714: DFBPPR19205 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF169
Source.2715: DFBPPR19209 ---- Animal proteins ---- mRNA export factor
Source.2716: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.2717: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.2718: DFBPPR19225 ---- Animal proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase
Source.2719: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.2720: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase
Source.2721: DFBPPR19247 ---- Animal proteins ---- Calmegin
Source.2722: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.2723: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2
Source.2724: DFBPPR19256 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3-like
Source.2725: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28
Source.2726: DFBPPR19260 ---- Animal proteins ---- rRNA N6-adenosine-methyltransferase ZCCHC4
Source.2727: DFBPPR19261 ---- Animal proteins ---- Transcription factor ETV6
Source.2728: DFBPPR19263 ---- Animal proteins ---- Proteasome subunit beta type-2
Source.2729: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1
Source.2730: DFBPPR19283 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.2731: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.2732: DFBPPR19294 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I
Source.2733: DFBPPR19295 ---- Animal proteins ---- 26S proteasome regulatory subunit 7
Source.2734: DFBPPR19296 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B
Source.2735: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D
Source.2736: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.2737: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.2738: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12
Source.2739: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1
Source.2740: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.2741: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial
Source.2742: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.2743: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1
Source.2744: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2
Source.2745: DFBPPR19329 ---- Animal proteins ---- CD302 antigen
Source.2746: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase
Source.2747: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.2748: DFBPPR19337 ---- Animal proteins ---- CMRF35-like molecule 9
Source.2749: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.2750: DFBPPR19342 ---- Animal proteins ---- Calcium load-activated calcium channel
Source.2751: DFBPPR19346 ---- Animal proteins ---- Cylicin-1
Source.2752: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD
Source.2753: DFBPPR19348 ---- Animal proteins ---- Twinfilin-1
Source.2754: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.2755: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.2756: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.2757: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog
Source.2758: DFBPPR19376 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, testis-specific
Source.2759: DFBPPR19381 ---- Animal proteins ---- BRCA2 and CDKN1A-interacting protein
Source.2760: DFBPPR19382 ---- Animal proteins ---- Arrestin-C
Source.2761: DFBPPR19384 ---- Animal proteins ---- Complement component C9
Source.2762: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2
Source.2763: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.2764: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.2765: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein
Source.2766: DFBPPR19402 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.2767: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.2768: DFBPPR19409 ---- Animal proteins ---- Hyaluronan-binding protein 2
Source.2769: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.2770: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1
Source.2771: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.2772: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.2773: DFBPPR19416 ---- Animal proteins ---- Gamma-glutamyl hydrolase
Source.2774: DFBPPR19422 ---- Animal proteins ---- Syntaxin-19
Source.2775: DFBPPR19430 ---- Animal proteins ---- Aryl-hydrocarbon-interacting protein-like 1
Source.2776: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71
Source.2777: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.2778: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.2779: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.2780: DFBPPR19471 ---- Animal proteins ---- Ribosome biogenesis protein WDR12
Source.2781: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.2782: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.2783: DFBPPR19486 ---- Animal proteins ---- Probable dimethyladenosine transferase
Source.2784: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1
Source.2785: DFBPPR19488 ---- Animal proteins ---- Placental prolactin-related protein 3
Source.2786: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.2787: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.2788: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73
Source.2789: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase
Source.2790: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.2791: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.2792: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2
Source.2793: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.2794: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.2795: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.2796: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3
Source.2797: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.2798: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.2799: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.2800: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9
Source.2801: DFBPPR19559 ---- Animal proteins ---- CCN family member 2
Source.2802: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.2803: DFBPPR19561 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.2804: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.2805: DFBPPR19563 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit K
Source.2806: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.2807: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.2808: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.2809: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.2810: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.2811: DFBPPR19586 ---- Animal proteins ---- Uridine-cytidine kinase 1
Source.2812: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1
Source.2813: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein
Source.2814: DFBPPR19597 ---- Animal proteins ---- Protein HEXIM1
Source.2815: DFBPPR19599 ---- Animal proteins ---- Thrombomodulin
Source.2816: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.2817: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.2818: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5
Source.2819: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.2820: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS
Source.2821: DFBPPR19621 ---- Animal proteins ---- Aspartoacylase
Source.2822: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5
Source.2823: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase
Source.2824: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.2825: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.2826: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator
Source.2827: DFBPPR19663 ---- Animal proteins ---- Synembryn-A
Source.2828: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1
Source.2829: DFBPPR19674 ---- Animal proteins ---- Nuclear transport factor 2
Source.2830: DFBPPR19675 ---- Animal proteins ---- INO80 complex subunit E
Source.2831: DFBPPR19676 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.2832: DFBPPR19687 ---- Animal proteins ---- Cytochrome b ascorbate-dependent protein 3
Source.2833: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase
Source.2834: DFBPPR19694 ---- Animal proteins ---- Palmitoyltransferase ZDHHC4
Source.2835: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.2836: DFBPPR19702 ---- Animal proteins ---- Placental prolactin-related protein 4
Source.2837: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.2838: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10
Source.2839: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.2840: DFBPPR19715 ---- Animal proteins ---- Chorionic somatomammotropin hormone 2
Source.2841: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.2842: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2
Source.2843: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B
Source.2844: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.2845: DFBPPR19737 ---- Animal proteins ---- Proteasome subunit alpha type-5
Source.2846: DFBPPR19744 ---- Animal proteins ---- Placental prolactin-related protein 2
Source.2847: DFBPPR19747 ---- Animal proteins ---- Organic solute transporter subunit beta
Source.2848: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3
Source.2849: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.2850: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13
Source.2851: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.2852: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma
Source.2853: DFBPPR19786 ---- Animal proteins ---- Chorionic somatomammotropin hormone 1
Source.2854: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.2855: DFBPPR19792 ---- Animal proteins ---- Cleavage stimulation factor subunit 2
Source.2856: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4
Source.2857: DFBPPR19796 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.2858: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2
Source.2859: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.2860: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L
Source.2861: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma
Source.2862: DFBPPR19818 ---- Animal proteins ---- Protein YIPF6
Source.2863: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.2864: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.2865: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.2866: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.2867: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3
Source.2868: DFBPPR19834 ---- Animal proteins ---- Harmonin
Source.2869: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.2870: DFBPPR19839 ---- Animal proteins ---- Protein Mdm4
Source.2871: DFBPPR19845 ---- Animal proteins ---- Beta-soluble NSF attachment protein
Source.2872: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C
Source.2873: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.2874: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase
Source.2875: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1
Source.2876: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2
Source.2877: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.2878: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.2879: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.2880: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.2881: DFBPPR19897 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial
Source.2882: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic
Source.2883: DFBPPR19902 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.2884: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial
Source.2885: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.2886: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.2887: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.2888: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1
Source.2889: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2
Source.2890: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7
Source.2891: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B
Source.2892: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial
Source.2893: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2
Source.2894: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.2895: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter
Source.2896: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14
Source.2897: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.2898: DFBPPR19976 ---- Animal proteins ---- Mammalian ependymin-related protein 1
Source.2899: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27
Source.2900: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.2901: DFBPPR19979 ---- Animal proteins ---- Interleukin-1 receptor antagonist protein
Source.2902: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.2903: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1
Source.2904: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase
Source.2905: DFBPPR20002 ---- Animal proteins ---- Regulator of microtubule dynamics protein 2
Source.2906: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3
Source.2907: DFBPPR20012 ---- Animal proteins ---- Zinc transporter ZIP12
Source.2908: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.2909: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7
Source.2910: DFBPPR20022 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.2911: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7
Source.2912: DFBPPR20026 ---- Animal proteins ---- Mitochondrial ribosome-associated GTPase 1
Source.2913: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12
Source.2914: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.2915: DFBPPR20046 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin-2
Source.2916: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.2917: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1
Source.2918: DFBPPR20053 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.2919: DFBPPR20054 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55
Source.2920: DFBPPR20063 ---- Animal proteins ---- Histone H2B subacrosomal variant
Source.2921: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein
Source.2922: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1
Source.2923: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4
Source.2924: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.2925: DFBPPR20081 ---- Animal proteins ---- ADP-ribosylation factor-related protein 1
Source.2926: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.2927: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.2928: DFBPPR20103 ---- Animal proteins ---- Protein MAL2
Source.2929: DFBPPR20104 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D
Source.2930: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.2931: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2
Source.2932: DFBPPR20123 ---- Animal proteins ---- Securin
Source.2933: DFBPPR20124 ---- Animal proteins ---- Serine palmitoyltransferase small subunit B
Source.2934: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.2935: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.2936: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.2937: DFBPPR20144 ---- Animal proteins ---- Destrin
Source.2938: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1
Source.2939: DFBPPR20151 ---- Animal proteins ---- AP-2 complex subunit sigma
Source.2940: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.2941: DFBPPR20153 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.2942: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9
Source.2943: DFBPPR20158 ---- Animal proteins ---- Histone chaperone ASF1A
Source.2944: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2
Source.2945: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1
Source.2946: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.2947: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.2948: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7
Source.2949: DFBPPR20195 ---- Animal proteins ---- GSK3B-interacting protein
Source.2950: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.2951: DFBPPR20201 ---- Animal proteins ---- PDZ and LIM domain protein 7
Source.2952: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial
Source.2953: DFBPPR20204 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.2954: DFBPPR20208 ---- Animal proteins ---- Myeloid leukemia factor 1
Source.2955: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B
Source.2956: DFBPPR20214 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.2957: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.2958: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12
Source.2959: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.2960: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein
Source.2961: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.2962: DFBPPR20252 ---- Animal proteins ---- Myosin regulatory light chain 2, ventricular/cardiac muscle isoform
Source.2963: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A
Source.2964: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1
Source.2965: DFBPPR20265 ---- Animal proteins ---- Histone-lysine N-methyltransferase EZH1
Source.2966: DFBPPR20266 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB7
Source.2967: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.2968: DFBPPR20273 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT14
Source.2969: DFBPPR20278 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 6
Source.2970: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.2971: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.2972: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.2973: DFBPPR20296 ---- Animal proteins ---- Claudin-18
Source.2974: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.2975: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator
Source.2976: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial
Source.2977: DFBPPR20307 ---- Animal proteins ---- Ras-related protein Rab-6B
Source.2978: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.2979: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2
Source.2980: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.2981: DFBPPR20319 ---- Animal proteins ---- Protein pelota homolog
Source.2982: DFBPPR20332 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.2983: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.2984: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.2985: DFBPPR20337 ---- Animal proteins ---- CST complex subunit STN1
Source.2986: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1
Source.2987: DFBPPR20346 ---- Animal proteins ---- Serpin B6
Source.2988: DFBPPR20348 ---- Animal proteins ---- V-type proton ATPase subunit F
Source.2989: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein
Source.2990: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2
Source.2991: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.2992: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.2993: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.2994: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha
Source.2995: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog
Source.2996: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.2997: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.2998: DFBPPR20401 ---- Animal proteins ---- Bystin
Source.2999: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.3000: DFBPPR20408 ---- Animal proteins ---- Phospholipid scramblase 2
Source.3001: DFBPPR20409 ---- Animal proteins ---- DNA damage-regulated autophagy modulator protein 2
Source.3002: DFBPPR20411 ---- Animal proteins ---- Transmembrane protein 106A
Source.3003: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.3004: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.3005: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.3006: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial
Source.3007: DFBPPR20424 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF170
Source.3008: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.3009: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase
Source.3010: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog
Source.3011: DFBPPR20441 ---- Animal proteins ---- 40S ribosomal protein S7
Source.3012: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.3013: DFBPPR20446 ---- Animal proteins ---- 39S ribosomal protein L33, mitochondrial
Source.3014: DFBPPR20447 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 1
Source.3015: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4
Source.3016: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2
Source.3017: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1
Source.3018: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79
Source.3019: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.3020: DFBPPR20482 ---- Animal proteins ---- Tripartite motif-containing protein 54
Source.3021: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase
Source.3022: DFBPPR20489 ---- Animal proteins ---- Translocon-associated protein subunit alpha
Source.3023: DFBPPR20502 ---- Animal proteins ---- COP9 signalosome complex subunit 9
Source.3024: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.3025: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.3026: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29
Source.3027: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1
Source.3028: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42
Source.3029: DFBPPR20519 ---- Animal proteins ---- Spermatogenesis-associated protein 6
Source.3030: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.3031: DFBPPR20529 ---- Animal proteins ---- Transgelin
Source.3032: DFBPPR20530 ---- Animal proteins ---- Protein HEXIM2
Source.3033: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.3034: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.3035: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.3036: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.3037: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4
Source.3038: DFBPPR20555 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.3039: DFBPPR20558 ---- Animal proteins ---- N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase
Source.3040: DFBPPR20561 ---- Animal proteins ---- Protein cornichon homolog 1
Source.3041: DFBPPR20569 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 10
Source.3042: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.3043: DFBPPR20578 ---- Animal proteins ---- Protein rogdi homolog
Source.3044: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi
Source.3045: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.3046: DFBPPR20600 ---- Animal proteins ---- Regulator of G-protein signaling 10
Source.3047: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1
Source.3048: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6
Source.3049: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2
Source.3050: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.3051: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5
Source.3052: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2
Source.3053: DFBPPR20626 ---- Animal proteins ---- Melanocortin receptor 5
Source.3054: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.3055: DFBPPR20639 ---- Animal proteins ---- NmrA-like family domain-containing protein 1
Source.3056: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52
Source.3057: DFBPPR20643 ---- Animal proteins ---- Fibrinogen-like protein 1
Source.3058: DFBPPR20648 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM22 homolog
Source.3059: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa
Source.3060: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein
Source.3061: DFBPPR20656 ---- Animal proteins ---- Protein archease
Source.3062: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.3063: DFBPPR20659 ---- Animal proteins ---- Cystinosin
Source.3064: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain
Source.3065: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.3066: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14
Source.3067: DFBPPR20682 ---- Animal proteins ---- 26S proteasome regulatory subunit 10B
Source.3068: DFBPPR20683 ---- Animal proteins ---- Kinetochore protein Spc25
Source.3069: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.3070: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11
Source.3071: DFBPPR20695 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 28 homolog
Source.3072: DFBPPR20700 ---- Animal proteins ---- General transcription factor IIE subunit 1
Source.3073: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.3074: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.3075: DFBPPR20711 ---- Animal proteins ---- Transcription elongation factor, mitochondrial
Source.3076: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A
Source.3077: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.3078: DFBPPR20724 ---- Animal proteins ---- Exportin-2
Source.3079: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11
Source.3080: DFBPPR20743 ---- Animal proteins ---- Myozenin-1
Source.3081: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1
Source.3082: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33
Source.3083: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7
Source.3084: DFBPPR20756 ---- Animal proteins ---- Myosin regulatory light chain 12B
Source.3085: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9
Source.3086: DFBPPR20759 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform
Source.3087: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2
Source.3088: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein
Source.3089: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.3090: DFBPPR20776 ---- Animal proteins ---- C4b-binding protein beta chain
Source.3091: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15
Source.3092: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.3093: DFBPPR20785 ---- Animal proteins ---- Ribosomal protein 63, mitochondrial
Source.3094: DFBPPR20790 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1
Source.3095: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6
Source.3096: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.3097: DFBPPR20799 ---- Animal proteins ---- F-box/LRR-repeat protein 20
Source.3098: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.3099: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2
Source.3100: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.3101: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.3102: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.3103: DFBPPR20828 ---- Animal proteins ---- Malignant T-cell-amplified sequence 1
Source.3104: DFBPPR20829 ---- Animal proteins ---- Phospholipid phosphatase 6
Source.3105: DFBPPR20832 ---- Animal proteins ---- Metalloproteinase inhibitor 4
Source.3106: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.3107: DFBPPR20841 ---- Animal proteins ---- Translationally-controlled tumor protein
Source.3108: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1
Source.3109: DFBPPR20844 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.3110: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.3111: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial
Source.3112: DFBPPR20859 ---- Animal proteins ---- Trafficking protein particle complex subunit 4
Source.3113: DFBPPR20862 ---- Animal proteins ---- Leucine carboxyl methyltransferase 1
Source.3114: DFBPPR20863 ---- Animal proteins ---- LIM and senescent cell antigen-like-containing domain protein 2
Source.3115: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta
Source.3116: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2
Source.3117: DFBPPR20872 ---- Animal proteins ---- Transmembrane protein 150C
Source.3118: DFBPPR20882 ---- Animal proteins ---- Histone chaperone ASF1B
Source.3119: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237
Source.3120: DFBPPR20885 ---- Animal proteins ---- Zinc transporter ZIP3
Source.3121: DFBPPR20886 ---- Animal proteins ---- Dentin matrix acidic phosphoprotein 1
Source.3122: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.3123: DFBPPR20896 ---- Animal proteins ---- Ribonuclease H2 subunit B
Source.3124: DFBPPR20898 ---- Animal proteins ---- Transaldolase
Source.3125: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1
Source.3126: DFBPPR20902 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 2 homolog
Source.3127: DFBPPR20903 ---- Animal proteins ---- 40S ribosomal protein S3a
Source.3128: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3
Source.3129: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.3130: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor
Source.3131: DFBPPR20908 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27
Source.3132: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668
Source.3133: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.3134: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.3135: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.3136: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14
Source.3137: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A
Source.3138: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial
Source.3139: DFBPPR20936 ---- Animal proteins ---- Transmembrane protein 18
Source.3140: DFBPPR20945 ---- Animal proteins ---- C-type lectin domain family 12 member B
Source.3141: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1
Source.3142: DFBPPR20954 ---- Animal proteins ---- Secretagogin
Source.3143: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.3144: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.3145: DFBPPR20974 ---- Animal proteins ---- Short-chain dehydrogenase/reductase 3
Source.3146: DFBPPR20979 ---- Animal proteins ---- V-type proton ATPase 21 kDa proteolipid subunit
Source.3147: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.3148: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1
Source.3149: DFBPPR20989 ---- Animal proteins ---- Ubiquinone biosynthesis protein COQ9, mitochondrial
Source.3150: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1
Source.3151: DFBPPR20995 ---- Animal proteins ---- Zinc finger protein 181
Source.3152: DFBPPR20996 ---- Animal proteins ---- Tripartite motif-containing protein 44
Source.3153: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1
Source.3154: DFBPPR21003 ---- Animal proteins ---- Protein BCAP
Source.3155: DFBPPR21014 ---- Animal proteins ---- Transmembrane protein 258
Source.3156: DFBPPR21019 ---- Animal proteins ---- Thioredoxin domain-containing protein 9
Source.3157: DFBPPR21036 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.3158: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.3159: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.3160: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.3161: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10
Source.3162: DFBPPR21049 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 9
Source.3163: DFBPPR21060 ---- Animal proteins ---- Signal peptidase complex subunit 1
Source.3164: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.3165: DFBPPR21064 ---- Animal proteins ---- Ribosome production factor 2 homolog
Source.3166: DFBPPR21069 ---- Animal proteins ---- Nuclear transcription factor Y subunit gamma
Source.3167: DFBPPR21072 ---- Animal proteins ---- 39S ribosomal protein L42, mitochondrial
Source.3168: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein
Source.3169: DFBPPR21080 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim22
Source.3170: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.3171: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1
Source.3172: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.3173: DFBPPR21107 ---- Animal proteins ---- Proteasome assembly chaperone 2
Source.3174: DFBPPR21115 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor-like protein
Source.3175: DFBPPR21116 ---- Animal proteins ---- Suppressor of cytokine signaling 5
Source.3176: DFBPPR21117 ---- Animal proteins ---- Spindlin-2
Source.3177: DFBPPR21122 ---- Animal proteins ---- Derlin-3
Source.3178: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.3179: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.3180: DFBPPR21144 ---- Animal proteins ---- Repressor of RNA polymerase III transcription MAF1 homolog
Source.3181: DFBPPR21150 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.3182: DFBPPR21161 ---- Animal proteins ---- Histone H4 transcription factor
Source.3183: DFBPPR21162 ---- Animal proteins ---- Neurogenic differentiation factor 6
Source.3184: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.3185: DFBPPR21175 ---- Animal proteins ---- Adenosine receptor A3
Source.3186: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5
Source.3187: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173
Source.3188: DFBPPR21187 ---- Animal proteins ---- Plasmolipin
Source.3189: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1
Source.3190: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin
Source.3191: DFBPPR21196 ---- Animal proteins ---- Beta-crystallin A4
Source.3192: DFBPPR21197 ---- Animal proteins ---- Spindle and kinetochore-associated protein 2
Source.3193: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog
Source.3194: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase
Source.3195: DFBPPR21201 ---- Animal proteins ---- mRNA turnover protein 4 homolog
Source.3196: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog
Source.3197: DFBPPR21211 ---- Animal proteins ---- TLR adapter interacting with SLC15A4 on the lysosome
Source.3198: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.3199: DFBPPR21225 ---- Animal proteins ---- 28S ribosomal protein S31, mitochondrial
Source.3200: DFBPPR21229 ---- Animal proteins ---- Neurexophilin-2
Source.3201: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase
Source.3202: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4
Source.3203: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal
Source.3204: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5
Source.3205: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.3206: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.3207: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.3208: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1
Source.3209: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2
Source.3210: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.3211: DFBPPR21308 ---- Animal proteins ---- Cysteine-rich protein 1
Source.3212: DFBPPR21311 ---- Animal proteins ---- WD repeat-containing protein 18
Source.3213: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein
Source.3214: DFBPPR21322 ---- Animal proteins ---- Zinc finger protein 227
Source.3215: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4
Source.3216: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.3217: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65
Source.3218: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C
Source.3219: DFBPPR21342 ---- Animal proteins ---- G kinase-anchoring protein 1
Source.3220: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein
Source.3221: DFBPPR21346 ---- Animal proteins ---- Ameloblastin
Source.3222: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.3223: DFBPPR21352 ---- Animal proteins ---- Glutathione peroxidase 7
Source.3224: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.3225: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24
Source.3226: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.3227: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.3228: DFBPPR21372 ---- Animal proteins ---- Zinc finger protein 420
Source.3229: DFBPPR21379 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.3230: DFBPPR21380 ---- Animal proteins ---- AP-4 complex subunit sigma-1
Source.3231: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4
Source.3232: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.3233: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A
Source.3234: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like
Source.3235: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.3236: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B
Source.3237: DFBPPR21441 ---- Animal proteins ---- RING finger protein 207
Source.3238: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8
Source.3239: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4
Source.3240: DFBPPR21446 ---- Animal proteins ---- Spermatid-specific manchette-related protein 1
Source.3241: DFBPPR21452 ---- Animal proteins ---- Spermatogenic leucine zipper protein 1
Source.3242: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.3243: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.3244: DFBPPR21466 ---- Animal proteins ---- Trafficking protein particle complex subunit 2-like protein
Source.3245: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.3246: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3
Source.3247: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.3248: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.3249: DFBPPR21481 ---- Animal proteins ---- EF-hand domain-containing protein D2
Source.3250: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8
Source.3251: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.3252: DFBPPR21501 ---- Animal proteins ---- Peroxisomal biogenesis factor 3
Source.3253: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1
Source.3254: DFBPPR21510 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7
Source.3255: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20
Source.3256: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase
Source.3257: DFBPPR21529 ---- Animal proteins ---- Integrator complex subunit 11
Source.3258: DFBPPR21532 ---- Animal proteins ---- Transmembrane protein 225
Source.3259: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8
Source.3260: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.3261: DFBPPR21549 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit Y
Source.3262: DFBPPR21551 ---- Animal proteins ---- Suppressor of cytokine signaling 4
Source.3263: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.3264: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3
Source.3265: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3
Source.3266: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.3267: DFBPPR21582 ---- Animal proteins ---- MORN repeat-containing protein 4
Source.3268: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.3269: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.3270: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.3271: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.3272: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3
Source.3273: DFBPPR21605 ---- Animal proteins ---- Transmembrane protein 138
Source.3274: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1
Source.3275: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.3276: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.3277: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.3278: DFBPPR21626 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM5 homolog
Source.3279: DFBPPR21644 ---- Animal proteins ---- Mpv17-like protein 2
Source.3280: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8
Source.3281: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.3282: DFBPPR21668 ---- Animal proteins ---- Putative deoxyribonuclease TATDN1
Source.3283: DFBPPR21673 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP4
Source.3284: DFBPPR21674 ---- Animal proteins ---- Leucine-rich repeat-containing protein 3B
Source.3285: DFBPPR21687 ---- Animal proteins ---- Ropporin-1-like protein
Source.3286: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.3287: DFBPPR21701 ---- Animal proteins ---- Prefoldin subunit 1
Source.3288: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.3289: DFBPPR21708 ---- Animal proteins ---- Single-stranded DNA-binding protein, mitochondrial
Source.3290: DFBPPR21713 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2
Source.3291: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.3292: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.3293: DFBPPR21720 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.3294: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.3295: DFBPPR21728 ---- Animal proteins ---- Galectin-9
Source.3296: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.3297: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7
Source.3298: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1
Source.3299: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10
Source.3300: DFBPPR21755 ---- Animal proteins ---- ELMO domain-containing protein 2
Source.3301: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.3302: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1
Source.3303: DFBPPR21762 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 28
Source.3304: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.3305: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.3306: DFBPPR21776 ---- Animal proteins ---- Coiled-coil domain-containing protein 130
Source.3307: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.3308: DFBPPR21779 ---- Animal proteins ---- Serpin B8
Source.3309: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2
Source.3310: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.3311: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B
Source.3312: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.3313: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.3314: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.3315: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.3316: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11
Source.3317: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein
Source.3318: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7
Source.3319: DFBPPR21830 ---- Animal proteins ---- Guanine nucleotide exchange factor for Rab-3A
Source.3320: DFBPPR21841 ---- Animal proteins ---- LIM domain-containing protein 2
Source.3321: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2
Source.3322: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B
Source.3323: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.3324: DFBPPR21873 ---- Animal proteins ---- Vitrin
Source.3325: DFBPPR21875 ---- Animal proteins ---- Coiled-coil domain-containing protein 113
Source.3326: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.3327: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.3328: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.3329: DFBPPR21895 ---- Animal proteins ---- Epithelial membrane protein 3
Source.3330: DFBPPR21903 ---- Animal proteins ---- Inactive serine protease 35
Source.3331: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.3332: DFBPPR21909 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 11
Source.3333: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6
Source.3334: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog
Source.3335: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.3336: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.3337: DFBPPR21942 ---- Animal proteins ---- Neurexophilin-1
Source.3338: DFBPPR21947 ---- Animal proteins ---- rRNA-processing protein UTP23 homolog
Source.3339: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48
Source.3340: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.3341: DFBPPR21966 ---- Animal proteins ---- DNA replication complex GINS protein PSF1
Source.3342: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1
Source.3343: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog
Source.3344: DFBPPR21977 ---- Animal proteins ---- Protein ARV1
Source.3345: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.3346: DFBPPR21993 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.3347: DFBPPR21994 ---- Animal proteins ---- Protein PET100 homolog, mitochondrial
Source.3348: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1
Source.3349: DFBPPR22001 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.3350: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1
Source.3351: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5
Source.3352: DFBPPR22016 ---- Animal proteins ---- Telomere repeats-binding bouquet formation protein 2
Source.3353: DFBPPR22017 ---- Animal proteins ---- 39S ribosomal protein L35, mitochondrial
Source.3354: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2
Source.3355: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.3356: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4
Source.3357: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12
Source.3358: DFBPPR22050 ---- Animal proteins ---- Protein lin-37 homolog
Source.3359: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3
Source.3360: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6
Source.3361: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma
Source.3362: DFBPPR22061 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX16 homolog, mitochondrial
Source.3363: DFBPPR22062 ---- Animal proteins ---- Protein FAM72A
Source.3364: DFBPPR22067 ---- Animal proteins ---- Microfibril-associated glycoprotein 3
Source.3365: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.3366: DFBPPR22076 ---- Animal proteins ---- Tetraspanin-6
Source.3367: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5
Source.3368: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512
Source.3369: DFBPPR22091 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.3370: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.3371: DFBPPR22093 ---- Animal proteins ---- F-box only protein 3
Source.3372: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.3373: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2
Source.3374: DFBPPR22104 ---- Animal proteins ---- Leptin receptor overlapping transcript-like 1
Source.3375: DFBPPR22107 ---- Animal proteins ---- TLD domain-containing protein 2
Source.3376: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6
Source.3377: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.3378: DFBPPR22129 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.3379: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.3380: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1
Source.3381: DFBPPR22148 ---- Animal proteins ---- Hemogen
Source.3382: DFBPPR22153 ---- Animal proteins ---- Leucine-rich repeat-containing protein 3
Source.3383: DFBPPR22160 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.3384: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.3385: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3
Source.3386: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.3387: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5
Source.3388: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.3389: DFBPPR22196 ---- Animal proteins ---- Bladder cancer-associated protein
Source.3390: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.3391: DFBPPR22207 ---- Animal proteins ---- Fas apoptotic inhibitory molecule 1
Source.3392: DFBPPR22209 ---- Animal proteins ---- Transmembrane protein 147
Source.3393: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.3394: DFBPPR22223 ---- Animal proteins ---- Calretinin
Source.3395: DFBPPR22227 ---- Animal proteins ---- Tetraspanin-8
Source.3396: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.3397: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.3398: DFBPPR22242 ---- Animal proteins ---- Neuropeptide S
Source.3399: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3
Source.3400: DFBPPR22257 ---- Animal proteins ---- TLC domain-containing protein 5
Source.3401: DFBPPR22262 ---- Animal proteins ---- Tetraspanin-18
Source.3402: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog
Source.3403: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.3404: DFBPPR22276 ---- Animal proteins ---- Protein MEMO1
Source.3405: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40
Source.3406: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.3407: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.3408: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2
Source.3409: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B
Source.3410: DFBPPR22306 ---- Animal proteins ---- p53 and DNA damage-regulated protein 1
Source.3411: DFBPPR22315 ---- Animal proteins ---- Probable cystatin-15
Source.3412: DFBPPR22320 ---- Animal proteins ---- Transmembrane protein 229B
Source.3413: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.3414: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70
Source.3415: DFBPPR22327 ---- Animal proteins ---- Small integral membrane protein 7
Source.3416: DFBPPR22330 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 39
Source.3417: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.3418: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.3419: DFBPPR22338 ---- Animal proteins ---- Probable cystatin-16
Source.3420: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.3421: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B
Source.3422: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog
Source.3423: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.3424: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6
Source.3425: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.3426: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein
Source.3427: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein
Source.3428: DFBPPR22369 ---- Animal proteins ---- Transmembrane protein 247
Source.3429: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase
Source.3430: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B
Source.3431: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.3432: DFBPPR22393 ---- Animal proteins ---- PDZ domain-containing protein GIPC2
Source.3433: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10
Source.3434: DFBPPR22410 ---- Animal proteins ---- Small acidic protein
Source.3435: DFBPPR22415 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.3436: DFBPPR22416 ---- Animal proteins ---- Gametocyte-specific factor 1-like
Source.3437: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B
Source.3438: DFBPPR22431 ---- Animal proteins ---- BolA-like protein 3
Source.3439: DFBPPR22434 ---- Animal proteins ---- UPF0692 protein C19orf54 homolog
Source.3440: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein
Source.3441: DFBPPR22460 ---- Animal proteins ---- Coiled-coil domain-containing protein 149
Source.3442: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein
Source.3443: DFBPPR22469 ---- Animal proteins ---- Protein FAM136A
Source.3444: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.3445: DFBPPR22474 ---- Animal proteins ---- UPF0691 protein C9orf116 homolog
Source.3446: DFBPPR22480 ---- Animal proteins ---- Coiled-coil domain-containing protein 70
Source.3447: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144
Source.3448: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.3449: DFBPPR22489 ---- Animal proteins ---- Paraneoplastic antigen Ma1 homolog
Source.3450: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.3451: DFBPPR22501 ---- Animal proteins ---- Multiple myeloma tumor-associated protein 2 homolog
Source.3452: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2
Source.3453: DFBPPR22519 ---- Animal proteins ---- Transmembrane protein 248
Source.3454: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1
Source.3455: DFBPPR22528 ---- Animal proteins ---- Transmembrane protein 251
Source.3456: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9
Source.3457: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.3458: DFBPPR22545 ---- Animal proteins ---- Protein FAM214B
Source.3459: DFBPPR22547 ---- Animal proteins ---- Actin-related protein T2
Source.3460: DFBPPR22548 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 1
Source.3461: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1
Source.3462: DFBPPR22561 ---- Animal proteins ---- Pre-rRNA-processing protein TSR2 homolog
Source.3463: DFBPPR22566 ---- Animal proteins ---- Ubiquitin-like protein 4B
Source.3464: DFBPPR22570 ---- Animal proteins ---- Outer dense fiber protein 3-like protein 1
Source.3465: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1
Source.3466: DFBPPR22574 ---- Animal proteins ---- Uncharacterized protein C1orf54 homolog
Source.3467: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.3468: DFBPPR22595 ---- Animal proteins ---- Transmembrane protein 268
Source.3469: DFBPPR22599 ---- Animal proteins ---- Tetratricopeptide repeat protein 9C
Source.3470: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13
Source.3471: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215
Source.3472: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72
Source.3473: DFBPPR22623 ---- Animal proteins ---- Lysine-rich coiled-coil protein 1
Source.3474: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164
Source.3475: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.3476: DFBPPR22652 ---- Animal proteins ---- PX domain-containing protein 1
Source.3477: DFBPPR22667 ---- Animal proteins ---- Uncharacterized protein C17orf78 homolog
Source.3478: DFBPPR22668 ---- Animal proteins ---- Protein FAM243
Source.3479: DFBPPR22679 ---- Animal proteins ---- MORN repeat-containing protein 3
Source.3480: DFBPPR22694 ---- Animal proteins ---- Testis-specific gene 13 protein
Source.3481: DFBPPR22695 ---- Animal proteins ---- MORN repeat-containing protein 5
Source.3482: DFBPPR22697 ---- Animal proteins ---- MORN repeat-containing protein 2
Source.3483: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28
Source.3484: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1
Source.3485: DFBPPR22710 ---- Animal proteins ---- RIIa domain-containing protein 1
Source.3486: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16
Source.3487: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11
Source.3488: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog
Source.3489: DFBPPR22734 ---- Animal proteins ---- Uncharacterized protein C1orf226 homolog
Source.3490: DFBPPR22743 ---- Animal proteins ---- CMT1A duplicated region transcript 4 protein homolog
Source.3491: DFBPPR22746 ---- Animal proteins ---- Uncharacterized protein C1orf146 homolog
Source.3492: DFBPPR22757 ---- Animal proteins ---- Uncharacterized protein CXorf65 homolog
Source.3493: DFBPPR22759 ---- Animal proteins ---- Uncharacterized protein C1orf141 homolog
Source.3494: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6
Source.3495: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.3496: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.3497: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.3498: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.3499: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.3500: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.3501: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.3502: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.3503: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3504: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.3505: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.3506: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.3507: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.3508: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.3509: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.3510: DFBPPR8582 ---- Animal proteins ---- Interferon gamma
Source.3511: DFBPPR8590 ---- Animal proteins ---- Phospholipid hydroperoxide glutathione peroxidase
Source.3512: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.3513: DFBPPR8592 ---- Animal proteins ---- Interleukin-18
Source.3514: DFBPPR8595 ---- Animal proteins ---- Annexin A4
Source.3515: DFBPPR8607 ---- Animal proteins ---- Prolactin
Source.3516: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B
Source.3517: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.3518: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.3519: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3520: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.3521: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.3522: DFBPPR8631 ---- Animal proteins ---- D-amino-acid oxidase
Source.3523: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.3524: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.3525: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor
Source.3526: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.3527: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.3528: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1
Source.3529: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.3530: DFBPPR8651 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.3531: DFBPPR8660 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.3532: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.3533: DFBPPR8663 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.3534: DFBPPR8665 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta
Source.3535: DFBPPR8668 ---- Animal proteins ---- Annexin A1
Source.3536: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1
Source.3537: DFBPPR8673 ---- Animal proteins ---- Calreticulin
Source.3538: DFBPPR8674 ---- Animal proteins ---- Calpain-3
Source.3539: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.3540: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.3541: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.3542: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.3543: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.3544: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.3545: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.3546: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53
Source.3547: DFBPPR8707 ---- Animal proteins ---- Flotillin-1
Source.3548: DFBPPR8708 ---- Animal proteins ---- Macrophage migration inhibitory factor
Source.3549: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.3550: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.3551: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.3552: DFBPPR8721 ---- Animal proteins ---- NF-kappa-B inhibitor alpha
Source.3553: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.3554: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.3555: DFBPPR8730 ---- Animal proteins ---- Phosphoacetylglucosamine mutase
Source.3556: DFBPPR8734 ---- Animal proteins ---- Clusterin
Source.3557: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.3558: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.3559: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.3560: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.3561: DFBPPR8750 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.3562: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3563: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.3564: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I
Source.3565: DFBPPR8763 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit
Source.3566: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.3567: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.3568: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.3569: DFBPPR8792 ---- Animal proteins ---- Plasminogen
Source.3570: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.3571: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase
Source.3572: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.3573: DFBPPR8809 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.3574: DFBPPR8813 ---- Animal proteins ---- Apolipoprotein A-IV
Source.3575: DFBPPR8817 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.3576: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.3577: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.3578: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.3579: DFBPPR8832 ---- Animal proteins ---- Ras-related protein Rab-3A
Source.3580: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5
Source.3581: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1
Source.3582: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.3583: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.3584: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1
Source.3585: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.3586: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.3587: DFBPPR8851 ---- Animal proteins ---- Vimentin
Source.3588: DFBPPR8852 ---- Animal proteins ---- Vimentin
Source.3589: DFBPPR8854 ---- Animal proteins ---- Vimentin
Source.3590: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.3591: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2
Source.3592: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3593: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3594: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.3595: DFBPPR8897 ---- Animal proteins ---- Cytochrome b
Source.3596: DFBPPR8899 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.3597: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1
Source.3598: DFBPPR8906 ---- Animal proteins ---- Sialidase-1
Source.3599: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.3600: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.3601: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.3602: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.3603: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.3604: DFBPPR8966 ---- Animal proteins ---- Calpain small subunit 1
Source.3605: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1
Source.3606: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.3607: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.3608: DFBPPR9015 ---- Animal proteins ---- Serotransferrin
Source.3609: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.3610: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.3611: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2
Source.3612: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.3613: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.3614: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.3615: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.3616: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase
Source.3617: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.3618: DFBPPR9052 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B
Source.3619: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.3620: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.3621: DFBPPR9081 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.3622: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.3623: DFBPPR9095 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor
Source.3624: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.3625: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.3626: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.3627: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.3628: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.3629: DFBPPR9131 ---- Animal proteins ---- Cytochrome P450 2C42
Source.3630: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.3631: DFBPPR9137 ---- Animal proteins ---- Microsomal glutathione S-transferase 1
Source.3632: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor
Source.3633: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.3634: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.3635: DFBPPR9171 ---- Animal proteins ---- Sorbin and SH3 domain-containing protein 2
Source.3636: DFBPPR9172 ---- Animal proteins ---- Protein N-terminal asparagine amidohydrolase
Source.3637: DFBPPR9175 ---- Animal proteins ---- Regulator of G-protein signaling 2
Source.3638: DFBPPR9179 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.3639: DFBPPR9181 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.3640: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.3641: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.3642: DFBPPR9195 ---- Animal proteins ---- Sex-determining region Y protein
Source.3643: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.3644: DFBPPR9198 ---- Animal proteins ---- Fibroblast growth factor 7
Source.3645: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.3646: DFBPPR9204 ---- Animal proteins ---- T-cell surface glycoprotein CD1a
Source.3647: DFBPPR9208 ---- Animal proteins ---- Uteroferrin-associated protein
Source.3648: DFBPPR9216 ---- Animal proteins ---- Netrin-1
Source.3649: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.3650: DFBPPR9234 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 D2
Source.3651: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.3652: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29
Source.3653: DFBPPR9245 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.3654: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.3655: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.3656: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.3657: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.3658: DFBPPR9265 ---- Animal proteins ---- Pantetheinase
Source.3659: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase
Source.3660: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.3661: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3
Source.3662: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.3663: DFBPPR9286 ---- Animal proteins ---- BPI fold-containing family A member 1
Source.3664: DFBPPR9292 ---- Animal proteins ---- Protein S100-A10
Source.3665: DFBPPR9293 ---- Animal proteins ---- Calcium load-activated calcium channel
Source.3666: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4
Source.3667: DFBPPR9298 ---- Animal proteins ---- Melanocortin receptor 4
Source.3668: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.3669: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2
Source.3670: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.3671: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.3672: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.3673: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.3674: DFBPPR9331 ---- Animal proteins ---- Proteasome subunit beta type-8
Source.3675: DFBPPR9337 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.3676: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.3677: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin
Source.3678: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1
Source.3679: DFBPPR9346 ---- Animal proteins ---- Myozenin-1
Source.3680: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.3681: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.3682: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.3683: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.3684: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.3685: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor
Source.3686: DFBPPR9377 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.3687: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1
Source.3688: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D
Source.3689: DFBPPR9392 ---- Animal proteins ---- mRNA export factor
Source.3690: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.3691: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase
Source.3692: DFBPPR9396 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.3693: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.3694: DFBPPR9399 ---- Animal proteins ---- High affinity copper uptake protein 1
Source.3695: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.3696: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3697: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3698: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3699: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.3700: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.3701: DFBPPR9436 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.3702: DFBPPR9437 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.3703: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.3704: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.3705: DFBPPR9461 ---- Animal proteins ---- CCN family member 2
Source.3706: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.3707: DFBPPR9485 ---- Animal proteins ---- Destrin
Source.3708: DFBPPR9487 ---- Animal proteins ---- Troponin C, slow skeletal and cardiac muscles
Source.3709: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa
Source.3710: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.3711: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.3712: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24
Source.3713: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.3714: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a
Source.3715: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25
Source.3716: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase
Source.3717: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.3718: DFBPPR9544 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.3719: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.3720: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2
Source.3721: DFBPPR9554 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.3722: DFBPPR9559 ---- Animal proteins ---- CD302 antigen
Source.3723: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C
Source.3724: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.3725: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3
Source.3726: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.3727: DFBPPR9590 ---- Animal proteins ---- Bax inhibitor 1
Source.3728: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2
Source.3729: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.3730: DFBPPR9614 ---- Animal proteins ---- Myosin regulatory light chain 2, atrial isoform
Source.3731: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.3732: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.3733: DFBPPR9624 ---- Animal proteins ---- Cadherin-3
Source.3734: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3735: DFBPPR9643 ---- Animal proteins ---- Apolipoprotein M
Source.3736: DFBPPR9645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.3737: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial
Source.3738: DFBPPR9658 ---- Animal proteins ---- Melanocortin receptor 5
Source.3739: DFBPPR9660 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2
Source.3740: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.3741: DFBPPR9665 ---- Animal proteins ---- 60S ribosomal protein L21
Source.3742: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.3743: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.3744: DFBPPR9684 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3745: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1
Source.3746: DFBPPR9691 ---- Animal proteins ---- Uroplakin-2
Source.3747: DFBPPR9699 ---- Animal proteins ---- Angiopoietin-1
Source.3748: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.3749: DFBPPR9707 ---- Animal proteins ---- Interleukin-7
Source.3750: DFBPPR9708 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7
Source.3751: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.3752: DFBPPR9712 ---- Animal proteins ---- Signal peptidase complex subunit 1
Source.3753: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.3754: DFBPPR9715 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27
Source.3755: DFBPPR9717 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.3756: DFBPPR9718 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.3757: DFBPPR9725 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.3758: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3759: DFBPPR9750 ---- Animal proteins ---- 60S ribosome subunit biogenesis protein NIP7 homolog
Source.3760: DFBPPR9751 ---- Animal proteins ---- Perilipin-3
Source.3761: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.3762: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.3763: DFBPPR9770 ---- Animal proteins ---- Melatonin receptor type 1A
Source.3764: DFBPPR9789 ---- Animal proteins ---- Calsequestrin-2
Source.3765: DFBPPR9796 ---- Animal proteins ---- Arrestin-C
Source.3766: DFBPPR9813 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.3767: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.3768: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.3769: DFBPPR9829 ---- Animal proteins ---- Translationally-controlled tumor protein
Source.3770: DFBPPR9843 ---- Animal proteins ---- P protein
Source.3771: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.3772: DFBPPR9855 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2
Source.3773: DFBPPR9860 ---- Animal proteins ---- Transcription factor 19
Source.3774: DFBPPR9869 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.3775: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.3776: DFBPPR9880 ---- Animal proteins ---- Trefoil factor 3
Source.3777: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17
Source.3778: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1
Source.3779: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.3780: DFBPPR9906 ---- Animal proteins ---- Tetraspanin-9
Source.3781: DFBPPR9912 ---- Animal proteins ---- Protein PET100 homolog, mitochondrial
Source.3782: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2
Source.3783: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.3784: DFBPPR9943 ---- Animal proteins ---- Transmembrane protein 251
Source.3785: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.3786: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.3787: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.3788: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.3789: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin
Source.3790: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.3791: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.3792: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.3793: DFBPPR9982 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.3794: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput
Source.3795: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.3796: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.3797: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.3798: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1
Source.3799: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.3800: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16
Source.3801: DFBPPR10020 ---- Animal proteins ---- PDZ and LIM domain protein 7
Source.3802: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.3803: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.3804: DFBPPR10030 ---- Animal proteins ---- Calbindin
Source.3805: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.3806: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta
Source.3807: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.3808: DFBPPR10045 ---- Animal proteins ---- Albumin
Source.3809: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.3810: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.3811: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.3812: DFBPPR10064 ---- Animal proteins ---- Pleiotrophin
Source.3813: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.3814: DFBPPR10067 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.3815: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.3816: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase
Source.3817: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1
Source.3818: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3819: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.3820: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.3821: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.3822: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.3823: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2
Source.3824: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.3825: DFBPPR10094 ---- Animal proteins ---- Proliferating cell nuclear antigen
Source.3826: DFBPPR10098 ---- Animal proteins ---- Mucin-6
Source.3827: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3828: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.3829: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2
Source.3830: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.3831: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.3832: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.3833: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.3834: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase
Source.3835: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.3836: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.3837: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.3838: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.3839: DFBPPR10142 ---- Animal proteins ---- Calpain-3
Source.3840: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.3841: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.3842: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.3843: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.3844: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor
Source.3845: DFBPPR10154 ---- Animal proteins ---- Glutathione S-transferase 2
Source.3846: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.3847: DFBPPR10157 ---- Animal proteins ---- CD40 ligand
Source.3848: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1
Source.3849: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.3850: DFBPPR10171 ---- Animal proteins ---- Heterochromatin-associated protein MENT
Source.3851: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.3852: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2
Source.3853: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5
Source.3854: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.3855: DFBPPR10178 ---- Animal proteins ---- Homeobox protein SIX3
Source.3856: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20
Source.3857: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.3858: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.3859: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2
Source.3860: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3
Source.3861: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.3862: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.3863: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.3864: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5
Source.3865: DFBPPR10217 ---- Animal proteins ---- Follistatin
Source.3866: DFBPPR10218 ---- Animal proteins ---- Occludin
Source.3867: DFBPPR10220 ---- Animal proteins ---- Paxillin
Source.3868: DFBPPR10221 ---- Animal proteins ---- Blood vessel epicardial substance
Source.3869: DFBPPR10223 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.3870: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11
Source.3871: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.3872: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3
Source.3873: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.3874: DFBPPR10250 ---- Animal proteins ---- Macrophage migration inhibitory factor
Source.3875: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.3876: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.3877: DFBPPR10261 ---- Animal proteins ---- Cadherin-13
Source.3878: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1
Source.3879: DFBPPR10268 ---- Animal proteins ---- CD166 antigen
Source.3880: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.3881: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2
Source.3882: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.3883: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.3884: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3885: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.3886: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.3887: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.3888: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6
Source.3889: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.3890: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.3891: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2
Source.3892: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.3893: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.3894: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.3895: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.3896: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.3897: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.3898: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.3899: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.3900: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.3901: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1
Source.3902: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7
Source.3903: DFBPPR10327 ---- Animal proteins ---- Proheparin-binding EGF-like growth factor
Source.3904: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.3905: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.3906: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.3907: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.3908: DFBPPR10353 ---- Animal proteins ---- Hemoglobin subunit alpha-A
Source.3909: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.3910: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.3911: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2
Source.3912: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.3913: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.3914: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.3915: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.3916: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR
Source.3917: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.3918: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.3919: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.3920: DFBPPR10385 ---- Animal proteins ---- Centromere protein S
Source.3921: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2
Source.3922: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.3923: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.3924: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.3925: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.3926: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.3927: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.3928: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.3929: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.3930: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.3931: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.3932: DFBPPR10416 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.3933: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5
Source.3934: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin
Source.3935: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.3936: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.3937: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.3938: DFBPPR10427 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle major isoform
Source.3939: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.3940: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.3941: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.3942: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.3943: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2
Source.3944: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.3945: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.3946: DFBPPR10455 ---- Animal proteins ---- Protein S100-A10
Source.3947: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.3948: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4
Source.3949: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3950: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.3951: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.3952: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.3953: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.3954: DFBPPR10484 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.3955: DFBPPR10485 ---- Animal proteins ---- LIM domain-binding protein 1
Source.3956: DFBPPR10487 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2
Source.3957: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.3958: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.3959: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.3960: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.3961: DFBPPR10511 ---- Animal proteins ---- Vitellogenin-3
Source.3962: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.3963: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.3964: DFBPPR10525 ---- Animal proteins ---- Thyroid hormone receptor beta
Source.3965: DFBPPR10527 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1
Source.3966: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.3967: DFBPPR10531 ---- Animal proteins ---- Serpin H1
Source.3968: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase
Source.3969: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.3970: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.3971: DFBPPR10550 ---- Animal proteins ---- Flap endonuclease 1
Source.3972: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.3973: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.3974: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.3975: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.3976: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.3977: DFBPPR10586 ---- Animal proteins ---- Troponin I, fast skeletal muscle
Source.3978: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.3979: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase
Source.3980: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.3981: DFBPPR10598 ---- Animal proteins ---- Histone chaperone ASF1
Source.3982: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.3983: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.3984: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.3985: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.3986: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.3987: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX
Source.3988: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6
Source.3989: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.3990: DFBPPR10620 ---- Animal proteins ---- Centromere protein T
Source.3991: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.3992: DFBPPR10629 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.3993: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.3994: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai
Source.3995: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.3996: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3
Source.3997: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.3998: DFBPPR10644 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.3999: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5
Source.4000: DFBPPR10646 ---- Animal proteins ---- Netrin-1
Source.4001: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.4002: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1
Source.4003: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.4004: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.4005: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3
Source.4006: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.4007: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.4008: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin
Source.4009: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.4010: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.4011: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.4012: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2
Source.4013: DFBPPR10700 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 2
Source.4014: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.4015: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.4016: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.4017: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.4018: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.4019: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1
Source.4020: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.4021: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.4022: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog
Source.4023: DFBPPR10723 ---- Animal proteins ---- Interferon regulatory factor 8
Source.4024: DFBPPR10727 ---- Animal proteins ---- Vimentin
Source.4025: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.4026: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.4027: DFBPPR10733 ---- Animal proteins ---- Ras-related protein Rab-6A
Source.4028: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.4029: DFBPPR10740 ---- Animal proteins ---- Cryptic protein
Source.4030: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.4031: DFBPPR10744 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.4032: DFBPPR10746 ---- Animal proteins ---- P2Y purinoceptor 1
Source.4033: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.4034: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.4035: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.4036: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4
Source.4037: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase
Source.4038: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.4039: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.4040: DFBPPR10770 ---- Animal proteins ---- Mannose-binding protein
Source.4041: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.4042: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.4043: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.4044: DFBPPR10776 ---- Animal proteins ---- GTP cyclohydrolase 1
Source.4045: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5
Source.4046: DFBPPR10780 ---- Animal proteins ---- Caspase-2
Source.4047: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.4048: DFBPPR10794 ---- Animal proteins ---- Zyxin
Source.4049: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.4050: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1
Source.4051: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.4052: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.4053: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.4054: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.4055: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha
Source.4056: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.4057: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.4058: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.4059: DFBPPR10835 ---- Animal proteins ---- Twisted gastrulation protein homolog 1
Source.4060: DFBPPR10836 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.4061: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1
Source.4062: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.4063: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A
Source.4064: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.4065: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.4066: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.4067: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26
Source.4068: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.4069: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.4070: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.4071: DFBPPR10865 ---- Animal proteins ---- Transgelin
Source.4072: DFBPPR10866 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.4073: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase
Source.4074: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11
Source.4075: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.4076: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.4077: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.4078: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain
Source.4079: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.4080: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.4081: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.4082: DFBPPR10900 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.4083: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.4084: DFBPPR10908 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.4085: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12
Source.4086: DFBPPR10911 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.4087: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.4088: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1
Source.4089: DFBPPR10915 ---- Animal proteins ---- Hepatic lectin
Source.4090: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.4091: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.4092: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1
Source.4093: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.4094: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.4095: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.4096: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.4097: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like
Source.4098: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta
Source.4099: DFBPPR10962 ---- Animal proteins ---- Endophilin-A1
Source.4100: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.4101: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.4102: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo
Source.4103: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.4104: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.4105: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.4106: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C
Source.4107: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20
Source.4108: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.4109: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.4110: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4111: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.4112: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.4113: DFBPPR10996 ---- Animal proteins ---- Semaphorin-4D
Source.4114: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1
Source.4115: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein
Source.4116: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.4117: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.4118: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.4119: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.4120: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor
Source.4121: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.4122: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.4123: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.4124: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.4125: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.4126: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.4127: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.4128: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.4129: DFBPPR11052 ---- Animal proteins ---- Protein cornichon homolog 2
Source.4130: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.4131: DFBPPR11055 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.4132: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.4133: DFBPPR11069 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.4134: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1
Source.4135: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.4136: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.4137: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.4138: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.4139: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.4140: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1
Source.4141: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2
Source.4142: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.4143: DFBPPR11103 ---- Animal proteins ---- Ribosome maturation protein SBDS
Source.4144: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.4145: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1
Source.4146: DFBPPR11119 ---- Animal proteins ---- Homeobox protein Nkx-2.5
Source.4147: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.4148: DFBPPR11127 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform
Source.4149: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.4150: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.4151: DFBPPR11145 ---- Animal proteins ---- Chromatin assembly factor 1 subunit B
Source.4152: DFBPPR11152 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.4153: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein
Source.4154: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.4155: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3
Source.4156: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.4157: DFBPPR11165 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF185
Source.4158: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2
Source.4159: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase
Source.4160: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22
Source.4161: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.4162: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.4163: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha
Source.4164: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1
Source.4165: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.4166: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.4167: DFBPPR11215 ---- Animal proteins ---- Zinc finger protein PLAG1
Source.4168: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2
Source.4169: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1
Source.4170: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.4171: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.4172: DFBPPR11226 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.4173: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2
Source.4174: DFBPPR11229 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H
Source.4175: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.4176: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.4177: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.4178: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.4179: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1
Source.4180: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.4181: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.4182: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4
Source.4183: DFBPPR11274 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.4184: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.4185: DFBPPR11281 ---- Animal proteins ---- LIM domain-binding protein 2
Source.4186: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.4187: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1
Source.4188: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.4189: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.4190: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.4191: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.4192: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.4193: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.4194: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein
Source.4195: DFBPPR11307 ---- Animal proteins ---- Thyrotropin subunit beta
Source.4196: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.4197: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog
Source.4198: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2
Source.4199: DFBPPR11320 ---- Animal proteins ---- Nucleoporin NUP42
Source.4200: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8
Source.4201: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog
Source.4202: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1
Source.4203: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.4204: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2
Source.4205: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.4206: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.4207: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.4208: DFBPPR11364 ---- Animal proteins ---- Interleukin-18
Source.4209: DFBPPR11372 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.4210: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.4211: DFBPPR11379 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2
Source.4212: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.4213: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3
Source.4214: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.4215: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.4216: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.4217: DFBPPR11403 ---- Animal proteins ---- Destrin
Source.4218: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner
Source.4219: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1
Source.4220: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.4221: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.4222: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1
Source.4223: DFBPPR11412 ---- Animal proteins ---- Hyaluronan synthase 3
Source.4224: DFBPPR11417 ---- Animal proteins ---- LRP chaperone MESD
Source.4225: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231
Source.4226: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5
Source.4227: DFBPPR11434 ---- Animal proteins ---- Homeobox protein SIX6
Source.4228: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4229: DFBPPR11439 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.4230: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator
Source.4231: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform
Source.4232: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.4233: DFBPPR11447 ---- Animal proteins ---- Translationally-controlled tumor protein homolog
Source.4234: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7
Source.4235: DFBPPR11450 ---- Animal proteins ---- Potassium voltage-gated channel subfamily G member 2
Source.4236: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1
Source.4237: DFBPPR11455 ---- Animal proteins ---- Growth factor receptor-bound protein 2
Source.4238: DFBPPR11457 ---- Animal proteins ---- Homeobox protein DBX2
Source.4239: DFBPPR11467 ---- Animal proteins ---- Synembryn-A
Source.4240: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1
Source.4241: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1
Source.4242: DFBPPR11490 ---- Animal proteins ---- Twinfilin-2
Source.4243: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog
Source.4244: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10
Source.4245: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L
Source.4246: DFBPPR11495 ---- Animal proteins ---- Calretinin
Source.4247: DFBPPR11498 ---- Animal proteins ---- Troponin C, slow skeletal and cardiac muscles
Source.4248: DFBPPR11499 ---- Animal proteins ---- Myosin regulatory light chain 2B, cardiac muscle isoform
Source.4249: DFBPPR11501 ---- Animal proteins ---- TIMELESS-interacting protein
Source.4250: DFBPPR11518 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.4251: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.4252: DFBPPR11524 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF166
Source.4253: DFBPPR11527 ---- Animal proteins ---- Myosin regulatory light chain 2A, cardiac muscle isoform
Source.4254: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.4255: DFBPPR11532 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle minor isoform
Source.4256: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.4257: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein
Source.4258: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.4259: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2
Source.4260: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.4261: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.4262: DFBPPR11556 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.4263: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2
Source.4264: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog
Source.4265: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic
Source.4266: DFBPPR11569 ---- Animal proteins ---- Homeobox protein Hox-D8
Source.4267: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.4268: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein
Source.4269: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.4270: DFBPPR11580 ---- Animal proteins ---- Cilia- and flagella-associated protein 20
Source.4271: DFBPPR11583 ---- Animal proteins ---- Translin
Source.4272: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.4273: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.4274: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.4275: DFBPPR11596 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E
Source.4276: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.4277: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.4278: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.4279: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.4280: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.4281: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.4282: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.4283: DFBPPR11613 ---- Animal proteins ---- Transmembrane protein 258
Source.4284: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.4285: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8
Source.4286: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.4287: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.4288: DFBPPR11634 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.4289: DFBPPR11638 ---- Animal proteins ---- Coatomer subunit epsilon
Source.4290: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.4291: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.4292: DFBPPR11648 ---- Animal proteins ---- Mineralocorticoid receptor
Source.4293: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1
Source.4294: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1
Source.4295: DFBPPR11695 ---- Animal proteins ---- Sodium/bile acid cotransporter 7
Source.4296: DFBPPR11702 ---- Animal proteins ---- DnaJ homolog subfamily C member 27
Source.4297: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.4298: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.4299: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.4300: DFBPPR11717 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.4301: DFBPPR11718 ---- Animal proteins ---- Homeobox protein Hox-C8
Source.4302: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1
Source.4303: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.4304: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi
Source.4305: DFBPPR11734 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.4306: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.4307: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein
Source.4308: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3
Source.4309: DFBPPR11758 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17B
Source.4310: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein
Source.4311: DFBPPR11763 ---- Animal proteins ---- Activated RNA polymerase II transcriptional coactivator p15
Source.4312: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.4313: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.4314: DFBPPR11772 ---- Animal proteins ---- Cbp/p300-interacting transactivator 3
Source.4315: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.4316: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.4317: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.4318: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.4319: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen
Source.4320: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2
Source.4321: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4
Source.4322: DFBPPR11797 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2-binding protein
Source.4323: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.4324: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.4325: DFBPPR11818 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D
Source.4326: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.4327: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.4328: DFBPPR11828 ---- Animal proteins ---- Spindlin-Z
Source.4329: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B
Source.4330: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.4331: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.4332: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7
Source.4333: DFBPPR11844 ---- Animal proteins ---- Integrator complex subunit 11
Source.4334: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17
Source.4335: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9
Source.4336: DFBPPR11856 ---- Animal proteins ---- Spindlin-W
Source.4337: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.4338: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.4339: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.4340: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.4341: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.4342: DFBPPR11885 ---- Animal proteins ---- ELL-associated factor 2
Source.4343: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8
Source.4344: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like
Source.4345: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.4346: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2
Source.4347: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B
Source.4348: DFBPPR11906 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 1
Source.4349: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A
Source.4350: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.4351: DFBPPR11911 ---- Animal proteins ---- NmrA-like family domain-containing protein 1
Source.4352: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13
Source.4353: DFBPPR11914 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.4354: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.4355: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.4356: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.4357: DFBPPR11924 ---- Animal proteins ---- Centromere protein P
Source.4358: DFBPPR11925 ---- Animal proteins ---- GSK3-beta interaction protein
Source.4359: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.4360: DFBPPR11945 ---- Animal proteins ---- Malignant T-cell-amplified sequence 1
Source.4361: DFBPPR11953 ---- Animal proteins ---- Protein NEL
Source.4362: DFBPPR11954 ---- Animal proteins ---- SIN3-HDAC complex-associated factor
Source.4363: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1
Source.4364: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.4365: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.4366: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4
Source.4367: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.4368: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2
Source.4369: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.4370: DFBPPR11975 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.4371: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.4372: DFBPPR11982 ---- Animal proteins ---- Transcription termination factor 3, mitochondrial
Source.4373: DFBPPR11985 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.4374: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.4375: DFBPPR12000 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.4376: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.4377: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.4378: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal
Source.4379: DFBPPR12019 ---- Animal proteins ---- Cobalamin trafficking protein CblD
Source.4380: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.4381: DFBPPR12021 ---- Animal proteins ---- DNA repair protein RAD52 homolog
Source.4382: DFBPPR12025 ---- Animal proteins ---- Transmembrane protein 18
Source.4383: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.4384: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.4385: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.4386: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.4387: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.4388: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24
Source.4389: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.4390: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.4391: DFBPPR12060 ---- Animal proteins ---- Neurobeachin
Source.4392: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.4393: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.4394: DFBPPR12075 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.4395: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.4396: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.4397: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.4398: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2
Source.4399: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.4400: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121
Source.4401: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.4402: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.4403: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.4404: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.4405: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.4406: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.4407: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.4408: DFBPPR12121 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial
Source.4409: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.4410: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19
Source.4411: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.4412: DFBPPR12138 ---- Animal proteins ---- Protein LZIC
Source.4413: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6
Source.4414: DFBPPR12140 ---- Animal proteins ---- Centromere protein N
Source.4415: DFBPPR12141 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.4416: DFBPPR12142 ---- Animal proteins ---- FGFR1 oncogene partner 2 homolog
Source.4417: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23
Source.4418: DFBPPR12146 ---- Animal proteins ---- Transmembrane protein adipocyte-associated 1 homolog
Source.4419: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.4420: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.4421: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.4422: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.4423: DFBPPR12160 ---- Animal proteins ---- Transmembrane protein 229B
Source.4424: DFBPPR12162 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2
Source.4425: DFBPPR12163 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2
Source.4426: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.4427: DFBPPR12181 ---- Animal proteins ---- Small integral membrane protein 15
Source.4428: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.4429: DFBPPR12190 ---- Animal proteins ---- Transmembrane protein 251
Source.4430: DFBPPR12194 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-10
Source.4431: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B
Source.4432: DFBPPR12203 ---- Animal proteins ---- Small acidic protein
Source.4433: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.4434: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.4435: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.4436: DFBPPR12219 ---- Animal proteins ---- PHD finger protein 20-like protein 1
Source.4437: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174
Source.4438: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68
Source.4439: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog
Source.4440: DFBPPR12230 ---- Animal proteins ---- Orofacial cleft 1 candidate gene 1 protein homolog
Source.4441: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.4442: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.4443: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.4444: DFBPPR12246 ---- Animal proteins ---- Uncharacterized protein KIAA1143 homolog
Source.4445: DFBPPR12247 ---- Animal proteins ---- Uncharacterized protein KIAA1671 homolog
Source.4446: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.4447: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.4448: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1
Source.4449: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2
Source.4450: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.4451: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.4452: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.4453: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.4454: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.4455: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.4456: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1
Source.4457: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.4458: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.4459: DFBPPR12287 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.4460: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.4461: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3
Source.4462: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.4463: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.4464: DFBPPR12304 ---- Animal proteins ---- Cellular tumor antigen p53
Source.4465: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.4466: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.4467: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4468: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.4469: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.4470: DFBPPR12315 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.4471: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.4472: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.4473: DFBPPR12319 ---- Animal proteins ---- Calreticulin
Source.4474: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.4475: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5
Source.4476: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor
Source.4477: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.4478: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type
Source.4479: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.4480: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.4481: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.4482: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.4483: DFBPPR12353 ---- Animal proteins ---- Cytochrome P450 2E1
Source.4484: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.4485: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.4486: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.4487: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.4488: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.4489: DFBPPR12366 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 10
Source.4490: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.4491: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.4492: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.4493: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.4494: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.4495: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.4496: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.4497: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.4498: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.4499: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.4500: DFBPPR12389 ---- Animal proteins ---- Clusterin
Source.4501: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.4502: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1
Source.4503: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.4504: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.4505: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.4506: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.4507: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.4508: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.4509: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.4510: DFBPPR12420 ---- Animal proteins ---- Serum paraoxonase/lactonase 3
Source.4511: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.4512: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4513: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.4514: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.4515: DFBPPR12431 ---- Animal proteins ---- Hemoglobin subunit alpha-1/2
Source.4516: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.4517: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.4518: DFBPPR12439 ---- Animal proteins ---- Tissue factor
Source.4519: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.4520: DFBPPR12441 ---- Animal proteins ---- Triadin
Source.4521: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.4522: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.4523: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.4524: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.4525: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.4526: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.4527: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.4528: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.4529: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.4530: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.4531: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.4532: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.4533: DFBPPR12463 ---- Animal proteins ---- Interleukin-15
Source.4534: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.4535: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.4536: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.4537: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.4538: DFBPPR12471 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.4539: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.4540: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.4541: DFBPPR12477 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.4542: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.4543: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.4544: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.4545: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase
Source.4546: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.4547: DFBPPR12497 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.4548: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.4549: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3
Source.4550: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.4551: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic
Source.4552: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.4553: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.4554: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII
Source.4555: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.4556: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.4557: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.4558: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.4559: DFBPPR12535 ---- Animal proteins ---- Troponin I, fast skeletal muscle
Source.4560: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.4561: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.4562: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.4563: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4564: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.4565: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.4566: DFBPPR12567 ---- Animal proteins ---- Calpain small subunit 1
Source.4567: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.4568: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2
Source.4569: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.4570: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.4571: DFBPPR12579 ---- Animal proteins ---- Troponin I, slow skeletal muscle
Source.4572: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.4573: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.4574: DFBPPR12593 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B
Source.4575: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan
Source.4576: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.4577: DFBPPR12602 ---- Animal proteins ---- Osteopontin
Source.4578: DFBPPR12603 ---- Animal proteins ---- Osteopontin
Source.4579: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5
Source.4580: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.4581: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1
Source.4582: DFBPPR12615 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.4583: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.4584: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.4585: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11
Source.4586: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.4587: DFBPPR12627 ---- Animal proteins ---- Morphine 6-dehydrogenase
Source.4588: DFBPPR12636 ---- Animal proteins ---- Complement component C9
Source.4589: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4590: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.4591: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor
Source.4592: DFBPPR12681 ---- Animal proteins ---- Myosin-7
Source.4593: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.4594: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4595: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4596: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.4597: DFBPPR12728 ---- Animal proteins ---- Cytochrome b
Source.4598: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.4599: DFBPPR12733 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 2
Source.4600: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86
Source.4601: DFBPPR12745 ---- Animal proteins ---- Ras-related protein Rab-25
Source.4602: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1
Source.4603: DFBPPR12754 ---- Animal proteins ---- Methylosome subunit pICln
Source.4604: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3
Source.4605: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.4606: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4
Source.4607: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform
Source.4608: DFBPPR12768 ---- Animal proteins ---- Pepsin-3
Source.4609: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.4610: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.4611: DFBPPR12775 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.4612: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.4613: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.4614: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.4615: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.4616: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.4617: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6
Source.4618: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.4619: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter
Source.4620: DFBPPR12817 ---- Animal proteins ---- Cathepsin E
Source.4621: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor
Source.4622: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.4623: DFBPPR12826 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.4624: DFBPPR12829 ---- Animal proteins ---- Glutathione S-transferase Yc
Source.4625: DFBPPR12832 ---- Animal proteins ---- Secretin receptor
Source.4626: DFBPPR12833 ---- Animal proteins ---- Cullin-5
Source.4627: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.4628: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2
Source.4629: DFBPPR12847 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.4630: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.4631: DFBPPR12856 ---- Animal proteins ---- Leupaxin
Source.4632: DFBPPR12869 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.4633: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.4634: DFBPPR12889 ---- Animal proteins ---- Myosin regulatory light chain 2, ventricular/cardiac muscle isoform
Source.4635: DFBPPR12901 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I
Source.4636: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.4637: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.4638: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a
Source.4639: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6
Source.4640: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.4641: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.4642: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.4643: DFBPPR12938 ---- Animal proteins ---- D-amino-acid oxidase
Source.4644: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.4645: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.4646: DFBPPR12945 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.4647: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.4648: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2
Source.4649: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.4650: DFBPPR12963 ---- Animal proteins ---- Adenosine receptor A3
Source.4651: DFBPPR12969 ---- Animal proteins ---- Prolactin
Source.4652: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.4653: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.4654: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.4655: DFBPPR12980 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L
Source.4656: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.4657: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D
Source.4658: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1
Source.4659: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.4660: DFBPPR13004 ---- Animal proteins ---- Protein S100-A10
Source.4661: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4662: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.4663: DFBPPR13007 ---- Animal proteins ---- Potassium voltage-gated channel subfamily E member 2
Source.4664: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4665: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.4666: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein
Source.4667: DFBPPR13019 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B gamma isoform
Source.4668: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2
Source.4669: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.4670: DFBPPR13025 ---- Animal proteins ---- Translationally-controlled tumor protein
Source.4671: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.4672: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.4673: DFBPPR13048 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 1
Source.4674: DFBPPR13061 ---- Animal proteins ---- Single-stranded DNA-binding protein, mitochondrial
Source.4675: DFBPPR13064 ---- Animal proteins ---- Metalloproteinase inhibitor 4
Source.4676: DFBPPR13069 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP alpha-1 chain
Source.4677: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.4678: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1
Source.4679: DFBPPR13081 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.4680: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog
Source.4681: DFBPPR13086 ---- Animal proteins ---- RING finger protein 207
Source.4682: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236
Source.4683: DFBPPR13100 ---- Animal proteins ---- Lengsin
Source.4684: DFBPPR13109 ---- Animal proteins ---- T-cell receptor alpha chain V region RL-5
Source.4685: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.4686: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.4687: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.4688: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.4689: DFBPPR13153 ---- Animal proteins ---- Interleukin-18
Source.4690: DFBPPR13154 ---- Animal proteins ---- Annexin A1
Source.4691: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.4692: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4693: DFBPPR13174 ---- Animal proteins ---- Clusterin
Source.4694: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.4695: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.4696: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11
Source.4697: DFBPPR13196 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.4698: DFBPPR13199 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.4699: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.4700: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.4701: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4702: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23
Source.4703: DFBPPR13209 ---- Animal proteins ---- Parathyroid hormone
Source.4704: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.4705: DFBPPR13215 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.4706: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.4707: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4708: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4709: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4710: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.4711: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.4712: DFBPPR13257 ---- Animal proteins ---- Prolactin
Source.4713: DFBPPR13265 ---- Animal proteins ---- Gasdermin-E
Source.4714: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.4715: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.4716: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.4717: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.4718: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.4719: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain
Source.4720: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein
Source.4721: DFBPPR13296 ---- Animal proteins ---- Complement component C9
Source.4722: DFBPPR13305 ---- Animal proteins ---- Cytochrome b
Source.4723: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.4724: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.4725: DFBPPR13327 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.4726: DFBPPR13330 ---- Animal proteins ---- Uterocalin
Source.4727: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.4728: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.4729: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a
Source.4730: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4731: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.4732: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.4733: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.4734: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein
Source.4735: DFBPPR13385 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.4736: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.4737: DFBPPR13396 ---- Animal proteins ---- Regulator of G-protein signaling 1
Source.4738: DFBPPR13397 ---- Animal proteins ---- Hemoglobin subunit theta-1
Source.4739: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.4740: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.4741: DFBPPR13422 ---- Animal proteins ---- Interferon gamma
Source.4742: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.4743: DFBPPR13434 ---- Animal proteins ---- Aromatase
Source.4744: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2
Source.4745: DFBPPR13436 ---- Animal proteins ---- Transmembrane protein 147
Source.4746: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4747: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4748: DFBPPR13457 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.4749: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4750: DFBPPR13468 ---- Animal proteins ---- Hemoglobin subunit alpha-1
Source.4751: DFBPPR13469 ---- Animal proteins ---- Cytochrome b
Source.4752: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein
Source.4753: DFBPPR13476 ---- Animal proteins ---- Hemoglobin subunit alpha-2
Source.4754: DFBPPR13477 ---- Animal proteins ---- Prolactin
Source.4755: DFBPPR13478 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor
Source.4756: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.4757: DFBPPR13483 ---- Animal proteins ---- Interleukin-18
Source.4758: DFBPPR13493 ---- Animal proteins ---- ATP synthase protein 8
Source.4759: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1
Source.4760: DFBPPR13500 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.4761: DFBPPR13520 ---- Animal proteins ---- 60S ribosomal protein L21
Source.4762: DFBPPR13521 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.4763: DFBPPR13522 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2
Source.4764: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.4765: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4766: DFBPPR13541 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.4767: DFBPPR13545 ---- Animal proteins ---- Prolactin
Source.4768: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1
Source.4769: DFBPPR13555 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1
Source.4770: DFBPPR13557 ---- Animal proteins ---- Interferon gamma
Source.4771: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.4772: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.4773: DFBPPR13562 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.4774: DFBPPR13563 ---- Animal proteins ---- Macrophage migration inhibitory factor
Source.4775: DFBPPR13567 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.4776: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.4777: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.4778: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53
Source.4779: DFBPPR13584 ---- Animal proteins ---- Calpain-3
Source.4780: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4781: DFBPPR13589 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.4782: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4783: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4784: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.4785: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.4786: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.4787: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.4788: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.4789: DFBPPR13628 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.4790: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.4791: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.4792: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.4793: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.4794: DFBPPR13646 ---- Animal proteins ---- Procathepsin L
Source.4795: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4796: DFBPPR13661 ---- Animal proteins ---- Hemoglobin subunit alpha-1/2
Source.4797: DFBPPR13667 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor
Source.4798: DFBPPR13668 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.4799: DFBPPR13671 ---- Animal proteins ---- Interleukin-7
Source.4800: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic
Source.4801: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.4802: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.4803: DFBPPR13686 ---- Animal proteins ---- Vimentin
Source.4804: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1
Source.4805: DFBPPR13701 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.4806: DFBPPR13706 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.4807: DFBPPR13711 ---- Animal proteins ---- Coagulation factor IX
Source.4808: DFBPPR13712 ---- Animal proteins ---- Cytochrome b
Source.4809: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.4810: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.4811: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4812: DFBPPR13735 ---- Animal proteins ---- Thyroid hormone receptor beta
Source.4813: DFBPPR13750 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, cytosolic
Source.4814: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.4815: DFBPPR13755 ---- Animal proteins ---- Aromatase
Source.4816: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21
Source.4817: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.4818: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A
Source.4819: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor
Source.4820: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.4821: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4822: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.4823: DFBPPR13779 ---- Animal proteins ---- Syntaxin-1B
Source.4824: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.4825: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.4826: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.4827: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6
Source.4828: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24
Source.4829: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4
Source.4830: DFBPPR13804 ---- Animal proteins ---- Calcium and integrin-binding family member 2
Source.4831: DFBPPR13823 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.4832: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a
Source.4833: DFBPPR13828 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.4834: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A
Source.4835: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3
Source.4836: DFBPPR13837 ---- Animal proteins ---- ATP synthase protein 8
Source.4837: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein
Source.4838: DFBPPR13846 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.4839: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor
Source.4840: DFBPPR13850 ---- Animal proteins ---- Interleukin-15
Source.4841: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1
Source.4842: DFBPPR13855 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor
Source.4843: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin
Source.4844: DFBPPR13865 ---- Animal proteins ---- C-C chemokine receptor type 9
Source.4845: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor
Source.4846: DFBPPR13873 ---- Animal proteins ---- Mineralocorticoid receptor
Source.4847: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4848: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.4849: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.4850: DFBPPR13890 ---- Animal proteins ---- Fibroblast growth factor 7
Source.4851: DFBPPR13892 ---- Animal proteins ---- Melanocortin receptor 5
Source.4852: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.4853: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.4854: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.4855: DFBPPR13927 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.4856: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.4857: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.4858: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.4859: DFBPPR13953 ---- Animal proteins ---- Tetraspanin-9
Source.4860: DFBPPR13957 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.4861: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.4862: DFBPPR13979 ---- Animal proteins ---- Putative uncharacterized protein Z
Source.4863: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4864: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.4865: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.4866: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.4867: DFBPPR14001 ---- Animal proteins ---- Glycoprotein hormones alpha chain 1
Source.4868: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.4869: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4870: DFBPPR14013 ---- Animal proteins ---- Glycoprotein hormones alpha chain 2
Source.4871: DFBPPR14019 ---- Animal proteins ---- Vimentin
Source.4872: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4873: DFBPPR14026 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.4874: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.4875: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.4876: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4877: DFBPPR14044 ---- Animal proteins ---- Transcription factor jun-B
Source.4878: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.4879: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.4880: DFBPPR14050 ---- Animal proteins ---- Somatoliberin
Source.4881: DFBPPR14060 ---- Animal proteins ---- Gamma-crystallin M2
Source.4882: DFBPPR14061 ---- Animal proteins ---- Neurotrophin-7
Source.4883: DFBPPR14071 ---- Marine protein ---- Somatotropin
Source.4884: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.4885: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.4886: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.4887: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.4888: DFBPPR14089 ---- Marine protein ---- Flap endonuclease 1
Source.4889: DFBPPR14090 ---- Marine protein ---- Trypsin-3
Source.4890: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.4891: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C
Source.4892: DFBPPR14095 ---- Marine protein ---- Enolase-phosphatase E1
Source.4893: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.4894: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran
Source.4895: DFBPPR14106 ---- Marine protein ---- Thyroid hormone receptor alpha
Source.4896: DFBPPR14110 ---- Marine protein ---- BRCA1-A complex subunit Abraxas 1
Source.4897: DFBPPR14117 ---- Marine protein ---- Ferritin, middle subunit
Source.4898: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.4899: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin
Source.4900: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.4901: DFBPPR14129 ---- Marine protein ---- Methylthioribulose-1-phosphate dehydratase
Source.4902: DFBPPR14141 ---- Marine protein ---- Ependymin-2
Source.4903: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I
Source.4904: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1
Source.4905: DFBPPR14144 ---- Marine protein ---- Spindle and kinetochore-associated protein 2
Source.4906: DFBPPR14145 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit H
Source.4907: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein
Source.4908: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.4909: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.4910: DFBPPR14156 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit E
Source.4911: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog
Source.4912: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator
Source.4913: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein
Source.4914: DFBPPR14178 ---- Marine protein ---- Hepcidin-1
Source.4915: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.4916: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog
Source.4917: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein
Source.4918: DFBPPR14198 ---- Marine protein ---- Trafficking protein particle complex subunit 2-like protein
Source.4919: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.4920: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a
Source.4921: DFBPPR14215 ---- Marine protein ---- Protein SMG9
Source.4922: DFBPPR14220 ---- Marine protein ---- Coiled-coil domain-containing protein 58
Source.4923: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1
Source.4924: DFBPPR14228 ---- Marine protein ---- UPF0691 protein C9orf116 homolog
Source.4925: DFBPPR14231 ---- Marine protein ---- Somatotropin
Source.4926: DFBPPR14241 ---- Marine protein ---- Cystatin
Source.4927: DFBPPR14251 ---- Marine protein ---- Isotocin-neurophysin IT 1
Source.4928: DFBPPR14257 ---- Marine protein ---- Somatolactin
Source.4929: DFBPPR14267 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 2, mitochondrial
Source.4930: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial
Source.4931: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.4932: DFBPPR14302 ---- Marine protein ---- ATP synthase subunit b, chloroplastic
Source.4933: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase
Source.4934: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.4935: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.4936: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4937: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH
Source.4938: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.4939: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.4940: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha
Source.4941: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic
Source.4942: DFBPPR14380 ---- Marine protein ---- tRNA(Ile)-lysidine synthase, chloroplastic
Source.4943: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta
Source.4944: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.4945: DFBPPR14384 ---- Marine protein ---- Cytochrome b6-f complex subunit 8
Source.4946: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.4947: DFBPPR14393 ---- Marine protein ---- Ribonuclease E/G-like protein
Source.4948: DFBPPR14400 ---- Marine protein ---- Heme oxygenase
Source.4949: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha
Source.4950: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26
Source.4951: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic
Source.4952: DFBPPR14417 ---- Marine protein ---- Histidine--tRNA ligase, chloroplastic
Source.4953: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.4954: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.4955: DFBPPR14428 ---- Marine protein ---- Photosystem II reaction center protein I
Source.4956: DFBPPR14436 ---- Marine protein ---- 50S ribosomal protein L11, chloroplastic
Source.4957: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.4958: DFBPPR14454 ---- Marine protein ---- Cytochrome c biogenesis protein Ccs1
Source.4959: DFBPPR14485 ---- Marine protein ---- Uncharacterized N-acetyltransferase ycf52
Source.4960: DFBPPR14486 ---- Marine protein ---- Putative transport permease ycf38
Source.4961: DFBPPR14487 ---- Marine protein ---- Chloroplast envelope membrane protein
Source.4962: DFBPPR14489 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.4963: DFBPPR14495 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.4964: DFBPPR14499 ---- Marine protein ---- Photosystem I assembly protein Ycf3
Source.4965: DFBPPR14504 ---- Marine protein ---- Probable ABC transporter permease protein ycf63
Source.4966: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60
Source.4967: DFBPPR14511 ---- Marine protein ---- Uncharacterized protein ycf92
Source.4968: DFBPPR14513 ---- Marine protein ---- Uncharacterized protein ycf19
Source.4969: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.4970: DFBPPR14541 ---- Marine protein ---- Somatotropin-1
Source.4971: DFBPPR14542 ---- Marine protein ---- Somatotropin-2
Source.4972: DFBPPR14549 ---- Marine protein ---- Pro-opiomelanocortin B
Source.4973: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.4974: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2
Source.4975: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.4976: DFBPPR14561 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.4977: DFBPPR14562 ---- Marine protein ---- Ladderlectin
Source.4978: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.4979: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.4980: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1
Source.4981: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.4982: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.4983: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.4984: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.4985: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.4986: DFBPPR14591 ---- Marine protein ---- Vimentin
Source.4987: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II
Source.4988: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4989: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha
Source.4990: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.4991: DFBPPR14620 ---- Marine protein ---- GTP cyclohydrolase 1
Source.4992: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.4993: DFBPPR14634 ---- Marine protein ---- Neuroglobin-2
Source.4994: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein
Source.4995: DFBPPR14645 ---- Marine protein ---- Ependymin-2
Source.4996: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2
Source.4997: DFBPPR14647 ---- Marine protein ---- Retinol-binding protein 4-A
Source.4998: DFBPPR14648 ---- Marine protein ---- Retinol-binding protein 4-B
Source.4999: DFBPPR14650 ---- Marine protein ---- Thyroid hormone receptor alpha
Source.5000: DFBPPR14656 ---- Marine protein ---- Neuroglobin-1
Source.5001: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.5002: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.5003: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A
Source.5004: DFBPPR14671 ---- Marine protein ---- Toll-interacting protein B
Source.5005: DFBPPR14674 ---- Marine protein ---- Glucagon-1
Source.5006: DFBPPR14675 ---- Marine protein ---- Glucagon-2
Source.5007: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor
Source.5008: DFBPPR14679 ---- Marine protein ---- Otolith matrix protein 1
Source.5009: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.5010: DFBPPR14698 ---- Marine protein ---- Cystatin
Source.5011: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.5012: DFBPPR14704 ---- Marine protein ---- Selenoprotein F
Source.5013: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.5014: DFBPPR14711 ---- Marine protein ---- UI
Source.5015: DFBPPR14749 ---- Marine protein ---- Alcohol dehydrogenase 1
Source.5016: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.5017: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.5018: DFBPPR14758 ---- Marine protein ---- Techylectin-5B
Source.5019: DFBPPR14761 ---- Marine protein ---- Intracellular coagulation inhibitor 2
Source.5020: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.5021: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.5022: DFBPPR14775 ---- Marine protein ---- Troponin C
Source.5023: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.5024: DFBPPR14782 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.5025: DFBPPR14784 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.5026: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.5027: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain
Source.5028: DFBPPR14792 ---- Marine protein ---- Crustacean hyperglycemic hormones isoform B
Source.5029: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.5030: DFBPPR14795 ---- Marine protein ---- Guanine nucleotide-binding protein G(s) subunit alpha
Source.5031: DFBPPR14796 ---- Marine protein ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.5032: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.5033: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.5034: DFBPPR14829 ---- Marine protein ---- Crustacean calcium-binding protein 23
Source.5035: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.5036: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.5037: DFBPPR14871 ---- Marine protein ---- Troponin C, skeletal muscle
Source.5038: DFBPPR14873 ---- Marine protein ---- Somatolactin
Source.5039: DFBPPR14877 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 2
Source.5040: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.5041: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.5042: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.5043: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.5044: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.5045: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.5046: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase
Source.5047: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.5048: DFBPPR14900 ---- Microorganism protein ---- Ethanol acetyltransferase 1
Source.5049: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.5050: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.5051: DFBPPR14908 ---- Microorganism protein ---- Flap endonuclease 1
Source.5052: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.5053: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.5054: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP
Source.5055: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase
Source.5056: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific
Source.5057: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific
Source.5058: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.5059: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase
Source.5060: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial
Source.5061: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.5062: DFBPPR14935 ---- Microorganism protein ---- Actin
Source.5063: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1
Source.5064: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.5065: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.5066: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.5067: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2
Source.5068: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1
Source.5069: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.5070: DFBPPR14962 ---- Microorganism protein ---- Diadenosine 5',5'''-P1,P4-tetraphosphate phosphorylase 2
Source.5071: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.5072: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.5073: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.5074: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.5075: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.5076: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.5077: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.5078: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial
Source.5079: DFBPPR15002 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.5080: DFBPPR15004 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 6
Source.5081: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.5082: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1
Source.5083: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b
Source.5084: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1
Source.5085: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein
Source.5086: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.5087: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.5088: DFBPPR15030 ---- Microorganism protein ---- Palmitoyltransferase ERF2
Source.5089: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial
Source.5090: DFBPPR15036 ---- Microorganism protein ---- ATP synthase subunit gamma, mitochondrial
Source.5091: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2
Source.5092: DFBPPR15044 ---- Microorganism protein ---- Alcohol dehydrogenase 4, mitochondrial
Source.5093: DFBPPR15046 ---- Microorganism protein ---- Histone acetyltransferase type B catalytic subunit
Source.5094: DFBPPR15048 ---- Microorganism protein ---- 3-ketodihydrosphingosine reductase TSC10
Source.5095: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9
Source.5096: DFBPPR15058 ---- Microorganism protein ---- DNA repair and recombination protein RAD52
Source.5097: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase
Source.5098: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1
Source.5099: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.5100: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.5101: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial
Source.5102: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1
Source.5103: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.5104: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4
Source.5105: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.5106: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.5107: DFBPPR15079 ---- Microorganism protein ---- Autophagy-related protein 3
Source.5108: DFBPPR15080 ---- Microorganism protein ---- Dimethyladenosine transferase
Source.5109: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.5110: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase
Source.5111: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.5112: DFBPPR15100 ---- Microorganism protein ---- Synaptobrevin homolog YKT6
Source.5113: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.5114: DFBPPR15102 ---- Microorganism protein ---- Signal peptidase complex catalytic subunit SEC11
Source.5115: DFBPPR15106 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.5116: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.5117: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.5118: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28
Source.5119: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial
Source.5120: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear
Source.5121: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.5122: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial
Source.5123: DFBPPR15133 ---- Microorganism protein ---- Iron sulfur cluster assembly protein 1, mitochondrial
Source.5124: DFBPPR15135 ---- Microorganism protein ---- Protein transport protein SEC22
Source.5125: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1
Source.5126: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase
Source.5127: DFBPPR15139 ---- Microorganism protein ---- ATP-dependent RNA helicase eIF4A
Source.5128: DFBPPR15140 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP6
Source.5129: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.5130: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40
Source.5131: DFBPPR15146 ---- Microorganism protein ---- DNA polymerase epsilon subunit D
Source.5132: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.5133: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.5134: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase
Source.5135: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81
Source.5136: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.5137: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.5138: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3
Source.5139: DFBPPR15173 ---- Microorganism protein ---- ATP-dependent DNA helicase CHL1
Source.5140: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.5141: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.5142: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.5143: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8
Source.5144: DFBPPR15199 ---- Microorganism protein ---- mRNA-capping enzyme subunit alpha
Source.5145: DFBPPR15200 ---- Microorganism protein ---- Protein SPT3
Source.5146: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.5147: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.5148: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1
Source.5149: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.5150: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60
Source.5151: DFBPPR15222 ---- Microorganism protein ---- DASH complex subunit ASK1
Source.5152: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial
Source.5153: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase
Source.5154: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4
Source.5155: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4
Source.5156: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.5157: DFBPPR15282 ---- Microorganism protein ---- Peroxisomal biogenesis factor 3
Source.5158: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2
Source.5159: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9
Source.5160: DFBPPR15290 ---- Microorganism protein ---- Peptidyl-prolyl cis-trans isomerase D
Source.5161: DFBPPR15292 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.5162: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.5163: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.5164: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter
Source.5165: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1
Source.5166: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7
Source.5167: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4
Source.5168: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.5169: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.5170: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.5171: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1
Source.5172: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10
Source.5173: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10
Source.5174: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2
Source.5175: DFBPPR15332 ---- Microorganism protein ---- GDP-mannose transporter
Source.5176: DFBPPR15333 ---- Microorganism protein ---- GDP-mannose transporter
Source.5177: DFBPPR15334 ---- Microorganism protein ---- Probable kinetochore protein NUF2
Source.5178: DFBPPR15336 ---- Microorganism protein ---- Microsomal signal peptidase subunit 3
Source.5179: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.5180: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1
Source.5181: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.5182: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.5183: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.5184: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.5185: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial
Source.5186: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5
Source.5187: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.5188: DFBPPR15379 ---- Microorganism protein ---- General transcription and DNA repair factor IIH subunit TFB2
Source.5189: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80
Source.5190: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.5191: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.5192: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.5193: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.5194: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.5195: DFBPPR15393 ---- Microorganism protein ---- Inner membrane assembly complex subunit 17
Source.5196: DFBPPR15404 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM10
Source.5197: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2
Source.5198: DFBPPR15411 ---- Microorganism protein ---- GPI-anchored wall transfer protein 1
Source.5199: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.5200: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase
Source.5201: DFBPPR15428 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC24
Source.5202: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial
Source.5203: DFBPPR15430 ---- Microorganism protein ---- Exportin-T
Source.5204: DFBPPR15432 ---- Microorganism protein ---- Pre-rRNA-processing protein ESF2
Source.5205: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1
Source.5206: DFBPPR15441 ---- Microorganism protein ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.5207: DFBPPR15447 ---- Microorganism protein ---- Genetic interactor of prohibitins 3, mitochondrial
Source.5208: DFBPPR15453 ---- Microorganism protein ---- ATP synthase subunit 5, mitochondrial
Source.5209: DFBPPR15456 ---- Microorganism protein ---- RNA polymerase II holoenzyme cyclin-like subunit
Source.5210: DFBPPR15457 ---- Microorganism protein ---- Ribosome biogenesis protein RLP24
Source.5211: DFBPPR15458 ---- Microorganism protein ---- Mitochondrial glycine transporter
Source.5212: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.5213: DFBPPR15462 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM21
Source.5214: DFBPPR15465 ---- Microorganism protein ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.5215: DFBPPR15469 ---- Microorganism protein ---- SWR1-complex protein 4
Source.5216: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1
Source.5217: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2
Source.5218: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.5219: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.5220: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46
Source.5221: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.5222: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.5223: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1
Source.5224: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6
Source.5225: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.5226: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.5227: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5
Source.5228: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32
Source.5229: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.5230: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.5231: DFBPPR15517 ---- Microorganism protein ---- rRNA biogenesis protein RRP36
Source.5232: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10
Source.5233: DFBPPR15525 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit KXD1
Source.5234: DFBPPR15526 ---- Microorganism protein ---- Telomere replication protein EST3
Source.5235: DFBPPR15533 ---- Microorganism protein ---- Non-histone chromosomal protein 6
Source.5236: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.5237: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.5238: DFBPPR15545 ---- Microorganism protein ---- Ubiquinone biosynthesis protein COQ4, mitochondrial
Source.5239: DFBPPR15548 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 25
Source.5240: DFBPPR15553 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX4
Source.5241: DFBPPR15554 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 22
Source.5242: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.5243: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.5244: DFBPPR15565 ---- Microorganism protein ---- 37S ribosomal protein S10, mitochondrial
Source.5245: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.5246: DFBPPR15567 ---- Microorganism protein ---- Mating-type protein A2
Source.5247: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1
Source.5248: DFBPPR15571 ---- Microorganism protein ---- Mating-type protein ALPHA2
Source.5249: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1
Source.5250: DFBPPR15583 ---- Microorganism protein ---- DNA replication complex GINS protein PSF3
Source.5251: DFBPPR15585 ---- Microorganism protein ---- Putative redox protein FMP46, mitochondrial
Source.5252: DFBPPR15586 ---- Microorganism protein ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.5253: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.5254: DFBPPR15589 ---- Microorganism protein ---- Spindle pole body component KRE28
Source.5255: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1
Source.5256: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.5257: DFBPPR15594 ---- Microorganism protein ---- Pre-mRNA polyadenylation factor FIP1
Source.5258: DFBPPR15598 ---- Microorganism protein ---- 54S ribosomal protein L4, mitochondrial
Source.5259: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1
Source.5260: DFBPPR15605 ---- Microorganism protein ---- Ribosome biogenesis protein NSA2
Source.5261: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2
Source.5262: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.5263: DFBPPR15616 ---- Microorganism protein ---- Chromatin modification-related protein EAF5
Source.5264: DFBPPR15618 ---- Microorganism protein ---- Ribosome assembly protein 3
Source.5265: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.5266: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4
Source.5267: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7
Source.5268: DFBPPR15639 ---- Microorganism protein ---- Nucleolar protein 16
Source.5269: DFBPPR15641 ---- Microorganism protein ---- Ribosomal lysine N-methyltransferase 5
Source.5270: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial
Source.5271: DFBPPR15646 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 36, mitochondrial
Source.5272: DFBPPR15648 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 2
Source.5273: DFBPPR15655 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP18
Source.5274: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11
Source.5275: DFBPPR15658 ---- Microorganism protein ---- Protein DSE1
Source.5276: DFBPPR15661 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 2
Source.5277: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.5278: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.5279: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8
Source.5280: DFBPPR15689 ---- Microorganism protein ---- Ribosomal protein VAR1, mitochondrial
Source.5281: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2
Source.5282: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1
Source.5283: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3
Source.5284: DFBPPR15696 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 1
Source.5285: DFBPPR15700 ---- Microorganism protein ---- Transcription factor NRM1
Source.5286: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.5287: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22
Source.5288: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4
Source.5289: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.5290: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial
Source.5291: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial
Source.5292: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.5293: DFBPPR15725 ---- Microorganism protein ---- Protein DML1
Source.5294: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.5295: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3
Source.5296: DFBPPR15730 ---- Microorganism protein ---- Suppressor of hydroxyurea sensitivity protein 2
Source.5297: DFBPPR15732 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 6, mitochondrial
Source.5298: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2
Source.5299: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1
Source.5300: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.5301: DFBPPR15737 ---- Microorganism protein ---- Required for respiratory growth protein 9, mitochondrial
Source.5302: DFBPPR15739 ---- Microorganism protein ---- Long chronological lifespan protein 2
Source.5303: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21
Source.5304: DFBPPR15744 ---- Microorganism protein ---- Peroxisomal membrane protein PEX21
Source.5305: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8
Source.5306: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86
Source.5307: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6
Source.5308: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5
Source.5309: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.5310: DFBPPR15769 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 11
Source.5311: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111
Source.5312: DFBPPR15773 ---- Microorganism protein ---- 37S ribosomal protein S25, mitochondrial
Source.5313: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1
Source.5314: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3
Source.5315: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3
Source.5316: DFBPPR15784 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 1
Source.5317: DFBPPR15786 ---- Microorganism protein ---- Stationary phase protein 4
Source.5318: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.5319: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.5320: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase
Source.5321: DFBPPR15800 ---- Microorganism protein ---- PTS system lactose-specific EIIA component
Source.5322: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase
Source.5323: DFBPPR15818 ---- Microorganism protein ---- PTS system sorbose-specific EIID component
Source.5324: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.5325: DFBPPR15821 ---- Microorganism protein ---- Inosose dehydratase
Source.5326: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.5327: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.5328: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2
Source.5329: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.5330: DFBPPR15840 ---- Microorganism protein ---- Protein RecA
Source.5331: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase
Source.5332: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3
Source.5333: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase
Source.5334: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.5335: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4
Source.5336: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.5337: DFBPPR15864 ---- Microorganism protein ---- Hydrophobin-3
Source.5338: DFBPPR15868 ---- Microorganism protein ---- Thymidylate synthase
Source.5339: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.5340: DFBPPR15874 ---- Microorganism protein ---- Hydrophobin-2
Source.5341: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.5342: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.5343: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.5344: DFBPPR15882 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.5345: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase
Source.5346: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1
Source.5347: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5348: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.5349: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.5350: DFBPPR0014 ---- Plant protein ---- Isoaspartyl peptidase/L-asparaginase
Source.5351: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.5352: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase
Source.5353: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.5354: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.5355: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.5356: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.5357: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5358: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.5359: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.5360: DFBPPR7765 ---- Plant protein ---- Flap endonuclease 1-A
Source.5361: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.5362: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.5363: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.5364: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.5365: DFBPPR7783 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.5366: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.5367: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.5368: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase
Source.5369: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3
Source.5370: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.5371: DFBPPR7795 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.5372: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.5373: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.5374: DFBPPR7799 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.5375: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.5376: DFBPPR7801 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.5377: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.5378: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.5379: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.5380: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.5381: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.5382: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.5383: DFBPPR7822 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.5384: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.5385: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.5386: DFBPPR7844 ---- Plant protein ---- Actin-1
Source.5387: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.5388: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a
Source.5389: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.5390: DFBPPR7856 ---- Plant protein ---- Maturase K
Source.5391: DFBPPR7870 ---- Plant protein ---- Translation initiation factor IF-1, chloroplastic
Source.5392: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1
Source.5393: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2
Source.5394: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.5395: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.5396: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.5397: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic
Source.5398: DFBPPR7940 ---- Plant protein ---- Leghemoglobin-1
Source.5399: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.5400: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.5401: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1
Source.5402: DFBPPR7959 ---- Plant protein ---- Leghemoglobin 49
Source.5403: DFBPPR7963 ---- Plant protein ---- Leghemoglobin 29
Source.5404: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.5405: DFBPPR7966 ---- Plant protein ---- GTP-binding nuclear protein Ran/TC4
Source.5406: DFBPPR7985 ---- Plant protein ---- Uncharacterized 9.9 kDa protein
Source.5407: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.5408: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.5409: DFBPPR7994 ---- Plant protein ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic
Source.5410: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.5411: DFBPPR8029 ---- Plant protein ---- Vignain
Source.5412: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.5413: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5414: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.5415: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.5416: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.5417: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha
Source.5418: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2
Source.5419: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.5420: DFBPPR8066 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.5421: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.5422: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform
Source.5423: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.5424: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.5425: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.5426: DFBPPR8075 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.5427: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1
Source.5428: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.5429: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.5430: DFBPPR8087 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.5431: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.5432: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.5433: DFBPPR8098 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.5434: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.5435: DFBPPR8113 ---- Plant protein ---- ATP synthase subunit b, chloroplastic
Source.5436: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.5437: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.5438: DFBPPR8122 ---- Plant protein ---- Arcelin-4
Source.5439: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase
Source.5440: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.5441: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase
Source.5442: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase
Source.5443: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5444: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.5445: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1
Source.5446: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.5447: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.5448: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.5449: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase
Source.5450: DFBPPR8235 ---- Plant protein ---- Catalase
Source.5451: DFBPPR8236 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.5452: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.5453: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.5454: DFBPPR8242 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic
Source.5455: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.5456: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.5457: DFBPPR8254 ---- Plant protein ---- Defensin SD2
Source.5458: DFBPPR8255 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 3, chloroplastic
Source.5459: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.5460: DFBPPR8264 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.5461: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.5462: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.5463: DFBPPR8277 ---- Plant protein ---- Profilin
Source.5464: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.5465: DFBPPR8291 ---- Plant protein ---- 2S seed storage protein
Source.5466: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.5467: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.5468: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.5469: DFBPPR8312 ---- Plant protein ---- Translation initiation factor IF-1, chloroplastic
Source.5470: DFBPPR8340 ---- Plant protein ---- 40S ribosomal protein S3a
Link-research
Link 1: DFBPACEI1695----Shark----Shark meat hydrolysates
Link 2: DFBPACEI1890----Amaranth seed proteins----Amaranth glutelins
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 44.7 uM, and its ACE inhibitory pattern was shown by Lineweaver–Burk plots to be a competitive inhibition pattern.

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report

Bitter peptide [1]

Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydrolysis

Enzyme(s)/starter culture

Sardine muscle protein was hydrolyzed with alkaline protease.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
BIOPEP-UWM [D1] 3385, 8827
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Matsufuji H, Matsui T, Seki E, Osajima K, Nakashima M, Osajima Y. Angiotensin I-converting enzyme inhibitory peptides in an alkaline protease hydrolyzate derived from sardine muscle. Biosci Biotechnol Biochem. 1994 Dec;58(12):2244-5.
PMID: 7765718
Other literature(s)

[1] Wu H, He H L, Chen X L, et al. Purification and identification of novel angiotensin-I-converting enzyme inhibitory peptides from shark meat hydrolysate[J]. Process Biochemistry, 2008, 43(4):457-461.
[2] Ap D L R, Montoya A B, Martã­Nez-Cuevas P, et al. Tryptic amaranth glutelin digests induce endothelial nitric oxide production through inhibition of ACE: antihypertensive role of amaranth peptides[J]. Nitric Oxide, 2010, 23(2):106-111.

PubDate 1994
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214