Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI0633(ACE-inhibitory peptide)

DFBP ID	DFBPACEI0633
Peptide sequence	AIP
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Ala-Ile-Pro

Single-letter amino acid

AIP

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	299.36 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

350 μM

pIC₅₀

-2.544

GRAVY

1.5667^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Human
Organism/Source	Human milk protein
Precursor protein	κ-Casein
Residue position	f(95-97)
Precursor protein(s) search	Source.1: DFBPPR0435 ---- Plant protein ---- 22kDa storage protein Source.2: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1 Source.3: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25 Source.4: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.5: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2 Source.6: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.7: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1 Source.8: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.9: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.10: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q Source.11: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.12: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1 Source.13: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.14: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.15: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11 Source.16: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5 Source.17: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6 Source.18: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.19: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.20: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.21: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5 Source.22: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1 Source.23: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.24: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21 Source.25: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda Source.26: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.27: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2 Source.28: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10 Source.29: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA Source.30: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic Source.31: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.32: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4 Source.33: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1 Source.34: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic Source.35: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9 Source.36: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7 Source.37: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.38: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24 Source.39: DFBPPR1094 ---- Plant proteins ---- MADS-box transcription factor 13 Source.40: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2 Source.41: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2 Source.42: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1 Source.43: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.44: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic Source.45: DFBPPR1158 ---- Plant proteins ---- Cysteine and histidine-rich domain-containing protein RAR1 Source.46: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A Source.47: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2 Source.48: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30 Source.49: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.50: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.51: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.52: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM Source.53: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic Source.54: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.55: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.56: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.57: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase Source.58: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.59: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39 Source.60: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.61: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3 Source.62: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.63: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic Source.64: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1 Source.65: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.66: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.67: DFBPPR1348 ---- Plant proteins ---- Cytochrome b Source.68: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.69: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B Source.70: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1 Source.71: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.72: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2 Source.73: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4 Source.74: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3 Source.75: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.76: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4 Source.77: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.78: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E Source.79: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9 Source.80: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1 Source.81: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic Source.82: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.83: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1 Source.84: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5 Source.85: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein Source.86: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4 Source.87: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6 Source.88: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1 Source.89: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2 Source.90: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33 Source.91: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6 Source.92: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic Source.93: DFBPPR1609 ---- Plant proteins ---- Expansin-B1 Source.94: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2 Source.95: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1 Source.96: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.97: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10 Source.98: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2 Source.99: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a Source.100: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1 Source.101: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2 Source.102: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11 Source.103: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11 Source.104: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1 Source.105: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.106: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1 Source.107: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2 Source.108: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.109: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3 Source.110: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.111: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.112: DFBPPR1847 ---- Plant proteins ---- Amidase 1 Source.113: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic Source.114: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B Source.115: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D Source.116: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b Source.117: DFBPPR1861 ---- Plant proteins ---- Laccase-25 Source.118: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17 Source.119: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2 Source.120: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic Source.121: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial Source.122: DFBPPR1939 ---- Plant proteins ---- Signal peptide peptidase-like 2 Source.123: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.124: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.125: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.126: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12 Source.127: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial Source.128: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38 Source.129: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.130: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6 Source.131: DFBPPR2013 ---- Plant proteins ---- Laccase-6 Source.132: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9 Source.133: DFBPPR2037 ---- Plant proteins ---- Laccase-10 Source.134: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.135: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.136: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.137: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.138: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5 Source.139: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1 Source.140: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1 Source.141: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.142: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3 Source.143: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase Source.144: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1 Source.145: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2 Source.146: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.147: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4 Source.148: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1 Source.149: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1 Source.150: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.151: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.152: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1 Source.153: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.154: DFBPPR2270 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-3 Source.155: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.156: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS Source.157: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3 Source.158: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic Source.159: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7 Source.160: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1 Source.161: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2 Source.162: DFBPPR2353 ---- Plant proteins ---- Expansin-B12 Source.163: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.164: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.165: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5 Source.166: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic Source.167: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6 Source.168: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.169: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.170: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5 Source.171: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.172: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c Source.173: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic Source.174: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25 Source.175: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2 Source.176: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.177: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4 Source.178: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase Source.179: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.180: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3 Source.181: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2 Source.182: DFBPPR2673 ---- Plant proteins ---- Expansin-B13 Source.183: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18 Source.184: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic Source.185: DFBPPR2729 ---- Plant proteins ---- Protein BZR1 homolog 2 Source.186: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3 Source.187: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2 Source.188: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.189: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3 Source.190: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.191: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.192: DFBPPR2783 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.193: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein Source.194: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.195: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3 Source.196: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2 Source.197: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2 Source.198: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4 Source.199: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.200: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B Source.201: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.202: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.203: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4 Source.204: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.205: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2 Source.206: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1 Source.207: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32 Source.208: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3 Source.209: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1 Source.210: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1 Source.211: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.212: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4 Source.213: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1 Source.214: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1 Source.215: DFBPPR2974 ---- Plant proteins ---- Derlin-1 Source.216: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1 Source.217: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B Source.218: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3 Source.219: DFBPPR3042 ---- Plant proteins ---- Deoxyuridine 5'-triphosphate nucleotidohydrolase Source.220: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9 Source.221: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.222: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.223: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.224: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.225: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2 Source.226: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13 Source.227: DFBPPR3085 ---- Plant proteins ---- Thiamine pyrophosphokinase 3 Source.228: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.229: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.230: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2 Source.231: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit Source.232: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.233: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.234: DFBPPR3133 ---- Plant proteins ---- Double-stranded RNA-binding protein 8 Source.235: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.236: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6 Source.237: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial Source.238: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5 Source.239: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700 Source.240: DFBPPR3191 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial Source.241: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog Source.242: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic Source.243: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750 Source.244: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2 Source.245: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3 Source.246: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37 Source.247: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400 Source.248: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B Source.249: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500 Source.250: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2 Source.251: DFBPPR3311 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 2 Source.252: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12 Source.253: DFBPPR3338 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1a Source.254: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8 Source.255: DFBPPR3385 ---- Plant proteins ---- Auxin-responsive protein IAA18 Source.256: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2 Source.257: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2 Source.258: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5 Source.259: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.260: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2 Source.261: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.262: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5 Source.263: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic Source.264: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.265: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1 Source.266: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A Source.267: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600 Source.268: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4 Source.269: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5 Source.270: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3 Source.271: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B Source.272: DFBPPR3494 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS32 Source.273: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9 Source.274: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600 Source.275: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9 Source.276: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2 Source.277: DFBPPR3531 ---- Plant proteins ---- Zinc transporter 10 Source.278: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3 Source.279: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.280: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12 Source.281: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6 Source.282: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6 Source.283: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3 Source.284: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5 Source.285: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14 Source.286: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11 Source.287: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.288: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G Source.289: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1 Source.290: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9 Source.291: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C Source.292: DFBPPR3810 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.293: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66 Source.294: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57 Source.295: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26 Source.296: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13 Source.297: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.298: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4 Source.299: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1 Source.300: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog Source.301: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16 Source.302: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.303: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25 Source.304: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2 Source.305: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic Source.306: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8 Source.307: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9 Source.308: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69 Source.309: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.310: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2 Source.311: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic Source.312: DFBPPR4098 ---- Plant proteins ---- ESCRT-related protein CHMP1 Source.313: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2 Source.314: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49 Source.315: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15 Source.316: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6 Source.317: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3 Source.318: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40 Source.319: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7 Source.320: DFBPPR4189 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.321: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH Source.322: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22 Source.323: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3 Source.324: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10 Source.325: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1 Source.326: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600 Source.327: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.328: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11 Source.329: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.330: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1 Source.331: DFBPPR4292 ---- Plant proteins ---- Double-stranded RNA-binding protein 3 Source.332: DFBPPR4293 ---- Plant proteins ---- Double-stranded RNA-binding protein 7 Source.333: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.334: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A Source.335: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B Source.336: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog Source.337: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.338: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15 Source.339: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.340: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.341: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4 Source.342: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.343: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3 Source.344: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2 Source.345: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15 Source.346: DFBPPR4646 ---- Plant proteins ---- 40S ribosomal protein S13-1 Source.347: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7 Source.348: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800 Source.349: DFBPPR4700 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 6 Source.350: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32 Source.351: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.352: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11 Source.353: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8 Source.354: DFBPPR4757 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 13 Source.355: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200 Source.356: DFBPPR4820 ---- Plant proteins ---- B3 domain-containing protein Os10g0323000 Source.357: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400 Source.358: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic Source.359: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8 Source.360: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic Source.361: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1 Source.362: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.363: DFBPPR4995 ---- Plant proteins ---- Glycinin G4 Source.364: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.365: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1 Source.366: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2 Source.367: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2 Source.368: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.369: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.370: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic Source.371: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.372: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1 Source.373: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1 Source.374: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial Source.375: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic Source.376: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.377: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1 Source.378: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.379: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.380: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6 Source.381: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2 Source.382: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.383: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.384: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70 Source.385: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2 Source.386: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4 Source.387: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic Source.388: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2 Source.389: DFBPPR5307 ---- Plant proteins ---- 4-coumarate--CoA ligase 1 Source.390: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1 Source.391: DFBPPR5319 ---- Plant proteins ---- Nodulin-22 Source.392: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10 Source.393: DFBPPR5352 ---- Plant proteins ---- Nodulin-27 Source.394: DFBPPR5355 ---- Plant proteins ---- Early nodulin-93 Source.395: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1 Source.396: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.397: DFBPPR5418 ---- Plant proteins ---- Aquaporin PIP1-1 Source.398: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic Source.399: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6 Source.400: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8 Source.401: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2 Source.402: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.403: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.404: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2 Source.405: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic Source.406: DFBPPR5469 ---- Plant proteins ---- Indole-3-glycerol phosphate lyase, chloroplastic Source.407: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3 Source.408: DFBPPR5500 ---- Plant proteins ---- Trypsin/factor XIIA inhibitor Source.409: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1 Source.410: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.411: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.412: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.413: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6 Source.414: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.415: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.416: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic Source.417: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.418: DFBPPR5669 ---- Plant proteins ---- Cytochrome b Source.419: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6 Source.420: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4 Source.421: DFBPPR5678 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic Source.422: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.423: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1 Source.424: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.425: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.426: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3 Source.427: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.428: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform Source.429: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase Source.430: DFBPPR5782 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic Source.431: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1 Source.432: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6 Source.433: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4 Source.434: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2 Source.435: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.436: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1 Source.437: DFBPPR5890 ---- Plant proteins ---- Nuclear transcription factor Y subunit B Source.438: DFBPPR5898 ---- Plant proteins ---- ATP synthase protein MI25 Source.439: DFBPPR5899 ---- Plant proteins ---- Ras-related protein Rab-2-B Source.440: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1 Source.441: DFBPPR5920 ---- Plant proteins ---- Cell number regulator 1 Source.442: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2 Source.443: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1 Source.444: DFBPPR5980 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.445: DFBPPR6008 ---- Plant proteins ---- Zein-beta Source.446: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.447: DFBPPR6149 ---- Plant proteins ---- 60S ribosomal protein L17 Source.448: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase Source.449: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase Source.450: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.451: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial Source.452: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase Source.453: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.454: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.455: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8 Source.456: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.457: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.458: DFBPPR6309 ---- Plant proteins ---- Cytochrome b Source.459: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing] Source.460: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic Source.461: DFBPPR6368 ---- Plant proteins ---- Provicilin Source.462: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.463: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.464: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.465: DFBPPR6391 ---- Plant proteins ---- Cytochrome b6 Source.466: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic Source.467: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.468: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.469: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.470: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.471: DFBPPR6430 ---- Plant proteins ---- Legumin J Source.472: DFBPPR6443 ---- Plant proteins ---- Disease resistance response protein 206 Source.473: DFBPPR6470 ---- Plant proteins ---- Vicilin Source.474: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a Source.475: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.476: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.477: DFBPPR6576 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3 Source.478: DFBPPR6577 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3 Source.479: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.480: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.481: DFBPPR6668 ---- Plant proteins ---- Cytochrome b Source.482: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.483: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1 Source.484: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.485: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic Source.486: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.487: DFBPPR6706 ---- Plant proteins ---- Adenine phosphoribosyltransferase 1 Source.488: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3 Source.489: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2 Source.490: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.491: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.492: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic Source.493: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic Source.494: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6 Source.495: DFBPPR6821 ---- Plant proteins ---- bZIP transcription factor 1-B Source.496: DFBPPR6825 ---- Plant proteins ---- bZIP transcription factor 1-D Source.497: DFBPPR6827 ---- Plant proteins ---- bZIP transcription factor 1-A Source.498: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.499: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.500: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.501: DFBPPR6898 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.502: DFBPPR6932 ---- Plant proteins ---- ATP synthase protein MI25 Source.503: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.504: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1 Source.505: DFBPPR7029 ---- Plant proteins ---- Trypsin inhibitor CMe Source.506: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2 Source.507: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.508: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6 Source.509: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.510: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase Source.511: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase Source.512: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase Source.513: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2 Source.514: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1 Source.515: DFBPPR7313 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.516: DFBPPR7332 ---- Plant proteins ---- 60S ribosomal protein L17-1 Source.517: DFBPPR7346 ---- Plant proteins ---- 60S ribosomal protein L17-2 Source.518: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.519: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.520: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.521: DFBPPR7422 ---- Plant proteins ---- Napin-1A Source.522: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.523: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.524: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.525: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.526: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum Source.527: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2 Source.528: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.529: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA Source.530: DFBPPR7606 ---- Milk proteins ---- Osteopontin Source.531: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein Source.532: DFBPPR7608 ---- Milk proteins ---- Kappa-casein Source.533: DFBPPR7621 ---- Milk proteins ---- Mucin-4 Source.534: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain Source.535: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.536: DFBPPR7663 ---- Milk proteins ---- Kappa-casein Source.537: DFBPPR7673 ---- Milk proteins ---- Kappa-casein Source.538: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein Source.539: DFBPPR7686 ---- Milk proteins ---- Kappa-casein Source.540: DFBPPR7689 ---- Milk proteins ---- Alpha-S2-casein Source.541: DFBPPR7695 ---- Milk proteins ---- Kappa-casein Source.542: DFBPPR7701 ---- Milk proteins ---- Alpha-S2-casein Source.543: DFBPPR7715 ---- Milk proteins ---- Kappa-casein Source.544: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2 Source.545: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.546: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.547: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase Source.548: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4 Source.549: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta Source.550: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.551: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal Source.552: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1 Source.553: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3 Source.554: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2 Source.555: DFBPPR8368 ---- Plant proteins ---- 13S globulin basic chain Source.556: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.557: DFBPPR8428 ---- Plant proteins ---- 11S globulin seed storage protein 2 Source.558: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic Source.559: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase Source.560: DFBPPR8484 ---- Milk proteins ---- Transforming growth factor beta-2 proprotein Source.561: DFBPPR8492 ---- Milk proteins ---- Kappa-casein Source.562: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.563: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.564: DFBPPR15939 ---- Animal proteins ---- Rhodopsin Source.565: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.566: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.567: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.568: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1 Source.569: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1 Source.570: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2 Source.571: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.572: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3 Source.573: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor Source.574: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2 Source.575: DFBPPR16095 ---- Animal proteins ---- Myosin-7 Source.576: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO Source.577: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer Source.578: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3 Source.579: DFBPPR16190 ---- Animal proteins ---- Aprataxin Source.580: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.581: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.582: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2 Source.583: DFBPPR16224 ---- Animal proteins ---- Uromodulin Source.584: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.585: DFBPPR16240 ---- Animal proteins ---- Fibronectin Source.586: DFBPPR16250 ---- Animal proteins ---- Alpha-crystallin A chain Source.587: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a Source.588: DFBPPR16302 ---- Animal proteins ---- Myosin-2 Source.589: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel Source.590: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.591: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.592: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.593: DFBPPR16418 ---- Animal proteins ---- Myosin-1 Source.594: DFBPPR16437 ---- Animal proteins ---- Myosin-4 Source.595: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.596: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII Source.597: DFBPPR16513 ---- Animal proteins ---- Endothelin-1 receptor Source.598: DFBPPR16516 ---- Animal proteins ---- Cytospin-A Source.599: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.600: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a Source.601: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.602: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.603: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b Source.604: DFBPPR16681 ---- Animal proteins ---- Olfactory receptor-like protein OLF3 Source.605: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.606: DFBPPR16698 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-3 Source.607: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.608: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.609: DFBPPR16797 ---- Animal proteins ---- Albumin Source.610: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.611: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.612: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.613: DFBPPR16852 ---- Animal proteins ---- Cytochrome b Source.614: DFBPPR16858 ---- Animal proteins ---- Thioredoxin-dependent peroxide reductase, mitochondrial Source.615: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX Source.616: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2 Source.617: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial Source.618: DFBPPR16896 ---- Animal proteins ---- Alpha-crystallin A chain Source.619: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.620: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.621: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.622: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.623: DFBPPR16984 ---- Animal proteins ---- Caveolin-2 Source.624: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.625: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.626: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter Source.627: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.628: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2 Source.629: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D Source.630: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.631: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2 Source.632: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.633: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.634: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial Source.635: DFBPPR17204 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2 Source.636: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.637: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.638: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1 Source.639: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.640: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2 Source.641: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3 Source.642: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.643: DFBPPR17379 ---- Animal proteins ---- Dematin Source.644: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme Source.645: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12 Source.646: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1 Source.647: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial Source.648: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4 Source.649: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.650: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.651: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1 Source.652: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.653: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1 Source.654: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase Source.655: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.656: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.657: DFBPPR17619 ---- Animal proteins ---- Vesicle-associated membrane protein 8 Source.658: DFBPPR17620 ---- Animal proteins ---- Vesicle-associated membrane protein 8 Source.659: DFBPPR17626 ---- Animal proteins ---- Elastin Source.660: DFBPPR17679 ---- Animal proteins ---- Platelet-derived growth factor subunit A Source.661: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase Source.662: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.663: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1 Source.664: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.665: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.666: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2 Source.667: DFBPPR17807 ---- Animal proteins ---- Opticin Source.668: DFBPPR17815 ---- Animal proteins ---- 40S ribosomal protein SA Source.669: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.670: DFBPPR17859 ---- Animal proteins ---- Beta-nerve growth factor Source.671: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.672: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.673: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial Source.674: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.675: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8 Source.676: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.677: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.678: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate Source.679: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein Source.680: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12 Source.681: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.682: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.683: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3 Source.684: DFBPPR18029 ---- Animal proteins ---- Collagen alpha-3(IV) chain Source.685: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.686: DFBPPR18055 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF8 Source.687: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2 Source.688: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor Source.689: DFBPPR18088 ---- Animal proteins ---- Aprataxin Source.690: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1 Source.691: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.692: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2 Source.693: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38 Source.694: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4 Source.695: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.696: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain Source.697: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.698: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.699: DFBPPR18218 ---- Animal proteins ---- Dual specificity protein phosphatase 6 Source.700: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.701: DFBPPR18245 ---- Animal proteins ---- ATP synthase subunit a Source.702: DFBPPR18247 ---- Animal proteins ---- Interferon regulatory factor 1 Source.703: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2 Source.704: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3 Source.705: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C Source.706: DFBPPR18341 ---- Animal proteins ---- BRISC complex subunit Abraxas 2 Source.707: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1 Source.708: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase Source.709: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.710: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.711: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5 Source.712: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.713: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1 Source.714: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.715: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.716: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B Source.717: DFBPPR18475 ---- Animal proteins ---- Myosin-2 Source.718: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein Source.719: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3 Source.720: DFBPPR18545 ---- Animal proteins ---- Transcriptional adapter 2-alpha Source.721: DFBPPR18592 ---- Animal proteins ---- Alpha-1-antiproteinase Source.722: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3 Source.723: DFBPPR18612 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2 Source.724: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A Source.725: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.726: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1 Source.727: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9 Source.728: DFBPPR18772 ---- Animal proteins ---- Myosin-7 Source.729: DFBPPR18799 ---- Animal proteins ---- Myosin-1 Source.730: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8 Source.731: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1 Source.732: DFBPPR18847 ---- Animal proteins ---- Heme oxygenase 1 Source.733: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase Source.734: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6 Source.735: DFBPPR18910 ---- Animal proteins ---- Aspartyl aminopeptidase Source.736: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3 Source.737: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3 Source.738: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b Source.739: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase Source.740: DFBPPR18986 ---- Animal proteins ---- Granzyme A Source.741: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1 Source.742: DFBPPR19139 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-2 Source.743: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like Source.744: DFBPPR19174 ---- Animal proteins ---- Neuroendocrine secretory protein 55 Source.745: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase Source.746: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.747: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1 Source.748: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.749: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.750: DFBPPR19264 ---- Animal proteins ---- Claudin-16 Source.751: DFBPPR19278 ---- Animal proteins ---- R-spondin-3 Source.752: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Source.753: DFBPPR19286 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.754: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1 Source.755: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47 Source.756: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1 Source.757: DFBPPR19329 ---- Animal proteins ---- CD302 antigen Source.758: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1 Source.759: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.760: DFBPPR19371 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 1 Source.761: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.762: DFBPPR19405 ---- Animal proteins ---- Endothelial differentiation-related factor 1 Source.763: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2 Source.764: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.765: DFBPPR19489 ---- Animal proteins ---- Keratocan Source.766: DFBPPR19516 ---- Animal proteins ---- Protein phosphatase 1L Source.767: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.768: DFBPPR19544 ---- Animal proteins ---- Marginal zone B- and B1-cell-specific protein Source.769: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.770: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1 Source.771: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein Source.772: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS Source.773: DFBPPR19640 ---- Animal proteins ---- Prolargin Source.774: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase Source.775: DFBPPR19701 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.776: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10 Source.777: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3 Source.778: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3 Source.779: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2 Source.780: DFBPPR19815 ---- Animal proteins ---- V-type proton ATPase subunit E 1 Source.781: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase Source.782: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2 Source.783: DFBPPR19839 ---- Animal proteins ---- Protein Mdm4 Source.784: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29 Source.785: DFBPPR19855 ---- Animal proteins ---- AP-3 complex subunit mu-1 Source.786: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase Source.787: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7 Source.788: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog Source.789: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B Source.790: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase Source.791: DFBPPR20002 ---- Animal proteins ---- Regulator of microtubule dynamics protein 2 Source.792: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1 Source.793: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4 Source.794: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1 Source.795: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2 Source.796: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1 Source.797: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.798: DFBPPR20199 ---- Animal proteins ---- Claudin-7 Source.799: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2 Source.800: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3 Source.801: DFBPPR20286 ---- Animal proteins ---- Nuclear transcription factor Y subunit beta Source.802: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.803: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.804: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56 Source.805: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog Source.806: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.807: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1 Source.808: DFBPPR20393 ---- Animal proteins ---- Putative nuclease HARBI1 Source.809: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor Source.810: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2 Source.811: DFBPPR20484 ---- Animal proteins ---- MEF2-activating motif and SAP domain-containing transcriptional regulator Source.812: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36 Source.813: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1 Source.814: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2 Source.815: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.816: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1 Source.817: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52 Source.818: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2 Source.819: DFBPPR20721 ---- Animal proteins ---- Myomesin-1 Source.820: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206 Source.821: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5 Source.822: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1 Source.823: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33 Source.824: DFBPPR20829 ---- Animal proteins ---- Phospholipid phosphatase 6 Source.825: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24 Source.826: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3 Source.827: DFBPPR20938 ---- Animal proteins ---- Serine protease HTR4 Source.828: DFBPPR20960 ---- Animal proteins ---- Complexin-1 Source.829: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3 Source.830: DFBPPR20974 ---- Animal proteins ---- Short-chain dehydrogenase/reductase 3 Source.831: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like Source.832: DFBPPR21141 ---- Animal proteins ---- Biotinidase Source.833: DFBPPR21146 ---- Animal proteins ---- Arylamine N-acetyltransferase 1 Source.834: DFBPPR21169 ---- Animal proteins ---- GA-binding protein subunit beta-2 Source.835: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1 Source.836: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5 Source.837: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.838: DFBPPR21325 ---- Animal proteins ---- Translocon-associated protein subunit gamma Source.839: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65 Source.840: DFBPPR21401 ---- Animal proteins ---- THAP domain-containing protein 5 Source.841: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1 Source.842: DFBPPR21503 ---- Animal proteins ---- Sideroflexin-3 Source.843: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20 Source.844: DFBPPR21524 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 receptor Source.845: DFBPPR21525 ---- Animal proteins ---- AN1-type zinc finger protein 6 Source.846: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3 Source.847: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6 Source.848: DFBPPR21670 ---- Animal proteins ---- V-type proton ATPase subunit E 2 Source.849: DFBPPR21677 ---- Animal proteins ---- Dolichol phosphate-mannose biosynthesis regulatory protein Source.850: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1 Source.851: DFBPPR21721 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor C2 Source.852: DFBPPR21744 ---- Animal proteins ---- Anaphase-promoting complex subunit 13 Source.853: DFBPPR21754 ---- Animal proteins ---- BLOC-1-related complex subunit 6 Source.854: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.855: DFBPPR21776 ---- Animal proteins ---- Coiled-coil domain-containing protein 130 Source.856: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.857: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14 Source.858: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter Source.859: DFBPPR21956 ---- Animal proteins ---- DNA replication complex GINS protein PSF3 Source.860: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.861: DFBPPR21961 ---- Animal proteins ---- P3 protein Source.862: DFBPPR22005 ---- Animal proteins ---- Transmembrane protein 81 Source.863: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5 Source.864: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2 Source.865: DFBPPR22060 ---- Animal proteins ---- Transmembrane protein 126A Source.866: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1 Source.867: DFBPPR22093 ---- Animal proteins ---- F-box only protein 3 Source.868: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B Source.869: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5 Source.870: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8 Source.871: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B Source.872: DFBPPR22246 ---- Animal proteins ---- Pancreatic progenitor cell differentiation and proliferation factor Source.873: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1 Source.874: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3 Source.875: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B Source.876: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A Source.877: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog Source.878: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1 Source.879: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3 Source.880: DFBPPR22461 ---- Animal proteins ---- Ashwin Source.881: DFBPPR22470 ---- Animal proteins ---- Coiled-coil domain-containing protein 137 Source.882: DFBPPR22489 ---- Animal proteins ---- Paraneoplastic antigen Ma1 homolog Source.883: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68 Source.884: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183 Source.885: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.886: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A Source.887: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13 Source.888: DFBPPR22614 ---- Animal proteins ---- Protein FAM81B Source.889: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72 Source.890: DFBPPR22633 ---- Animal proteins ---- Transmembrane protein 270 Source.891: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog Source.892: DFBPPR22747 ---- Animal proteins ---- Uncharacterized protein C1orf100 homolog Source.893: DFBPPR22754 ---- Animal proteins ---- Uncharacterized protein C1orf158 homolog Source.894: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.895: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6 Source.896: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.897: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.898: DFBPPR8643 ---- Animal proteins ---- Phospholipase A2, major isoenzyme Source.899: DFBPPR8669 ---- Animal proteins ---- Heme oxygenase 1 Source.900: DFBPPR8688 ---- Animal proteins ---- Vinculin Source.901: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor Source.902: DFBPPR8753 ---- Animal proteins ---- Androgen receptor Source.903: DFBPPR8758 ---- Animal proteins ---- Caveolin-2 Source.904: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.905: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.906: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.907: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.908: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.909: DFBPPR8816 ---- Animal proteins ---- 40S ribosomal protein SA Source.910: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.911: DFBPPR8831 ---- Animal proteins ---- Interferon regulatory factor 1 Source.912: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase Source.913: DFBPPR8870 ---- Animal proteins ---- Ribonuclease K3 Source.914: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2 Source.915: DFBPPR8897 ---- Animal proteins ---- Cytochrome b Source.916: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.917: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.918: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.919: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.920: DFBPPR8988 ---- Animal proteins ---- Erythropoietin Source.921: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.922: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.923: DFBPPR9034 ---- Animal proteins ---- Carbohydrate-binding protein AWN Source.924: DFBPPR9044 ---- Animal proteins ---- Albumin Source.925: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A Source.926: DFBPPR9054 ---- Animal proteins ---- Secretin Source.927: DFBPPR9059 ---- Animal proteins ---- Alpha-crystallin A chain Source.928: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A Source.929: DFBPPR9144 ---- Animal proteins ---- Major seminal plasma glycoprotein PSP-II Source.930: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase Source.931: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.932: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein Source.933: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10 Source.934: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.935: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.936: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII Source.937: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.938: DFBPPR9249 ---- Animal proteins ---- 5-hydroxytryptamine receptor 4 Source.939: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase Source.940: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.941: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.942: DFBPPR9288 ---- Animal proteins ---- Beta-microseminoprotein Source.943: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.944: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4 Source.945: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin Source.946: DFBPPR9368 ---- Animal proteins ---- Myosin-11 Source.947: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.948: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.949: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.950: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.951: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2 Source.952: DFBPPR9422 ---- Animal proteins ---- C-C motif chemokine 25 Source.953: DFBPPR9462 ---- Animal proteins ---- Cytochrome c oxidase copper chaperone Source.954: DFBPPR9502 ---- Animal proteins ---- Endothelin-1 receptor Source.955: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase Source.956: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a Source.957: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1 Source.958: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase Source.959: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.960: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.961: DFBPPR9553 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3 Source.962: DFBPPR9559 ---- Animal proteins ---- CD302 antigen Source.963: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog Source.964: DFBPPR9575 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1 Source.965: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin Source.966: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1 Source.967: DFBPPR9607 ---- Animal proteins ---- F-actin-capping protein subunit beta Source.968: DFBPPR9653 ---- Animal proteins ---- Carbohydrate-binding protein AQN-1 Source.969: DFBPPR9683 ---- Animal proteins ---- Calpastatin Source.970: DFBPPR9695 ---- Animal proteins ---- Seminal plasma sperm motility inhibitor Source.971: DFBPPR9717 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.972: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.973: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.974: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.975: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8 Source.976: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.977: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6 Source.978: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.979: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey Source.980: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.981: DFBPPR9988 ---- Animal proteins ---- Vinculin Source.982: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL Source.983: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1 Source.984: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein Source.985: DFBPPR10011 ---- Animal proteins ---- Myosin-11 Source.986: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.987: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor Source.988: DFBPPR10083 ---- Animal proteins ---- Myosin-9 Source.989: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.990: DFBPPR10098 ---- Animal proteins ---- Mucin-6 Source.991: DFBPPR10101 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12 Source.992: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog Source.993: DFBPPR10129 ---- Animal proteins ---- Gremlin-1 Source.994: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.995: DFBPPR10139 ---- Animal proteins ---- Cytochrome b Source.996: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.997: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8 Source.998: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.999: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein Source.1000: DFBPPR10195 ---- Animal proteins ---- SUMO-conjugating enzyme UBC9 Source.1001: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.1002: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4 Source.1003: DFBPPR10259 ---- Animal proteins ---- Frizzled-4 Source.1004: DFBPPR10260 ---- Animal proteins ---- F-actin-capping protein subunit beta isoforms 1 and 2 Source.1005: DFBPPR10270 ---- Animal proteins ---- Agrin Source.1006: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1007: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2 Source.1008: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial Source.1009: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.1010: DFBPPR10335 ---- Animal proteins ---- RNA-binding protein with multiple splicing 2 Source.1011: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.1012: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.1013: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.1014: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.1015: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.1016: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.1017: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.1018: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.1019: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.1020: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1 Source.1021: DFBPPR10477 ---- Animal proteins ---- Aprataxin Source.1022: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein Source.1023: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.1024: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.1025: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2 Source.1026: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2 Source.1027: DFBPPR10541 ---- Animal proteins ---- Glypican-1 Source.1028: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.1029: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.1030: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.1031: DFBPPR10577 ---- Animal proteins ---- Frizzled-10 Source.1032: DFBPPR10581 ---- Animal proteins ---- Ephrin-A5 Source.1033: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.1034: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8 Source.1035: DFBPPR10605 ---- Animal proteins ---- Elastin Source.1036: DFBPPR10619 ---- Animal proteins ---- Adenosine receptor A2b Source.1037: DFBPPR10624 ---- Animal proteins ---- 40S ribosomal protein SA Source.1038: DFBPPR10654 ---- Animal proteins ---- Fibronectin Source.1039: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8 Source.1040: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3 Source.1041: DFBPPR10672 ---- Animal proteins ---- Nibrin Source.1042: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.1043: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.1044: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.1045: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.1046: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A Source.1047: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1048: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.1049: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase Source.1050: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11 Source.1051: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.1052: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.1053: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1 Source.1054: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149 Source.1055: DFBPPR10906 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF152 Source.1056: DFBPPR10918 ---- Animal proteins ---- Frizzled-2 Source.1057: DFBPPR10927 ---- Animal proteins ---- Frizzled-7 Source.1058: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1 Source.1059: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2 Source.1060: DFBPPR11012 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6 Source.1061: DFBPPR11018 ---- Animal proteins ---- Transcriptional coactivator YAP1 Source.1062: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6 Source.1063: DFBPPR11079 ---- Animal proteins ---- Frizzled-1 Source.1064: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase Source.1065: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.1066: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1 Source.1067: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1 Source.1068: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2 Source.1069: DFBPPR11107 ---- Animal proteins ---- Zinc finger protein GLI1 Source.1070: DFBPPR11134 ---- Animal proteins ---- Keratocan Source.1071: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.1072: DFBPPR11146 ---- Animal proteins ---- Formin Source.1073: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.1074: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein Source.1075: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1 Source.1076: DFBPPR11164 ---- Animal proteins ---- Nuclear transcription factor Y subunit beta Source.1077: DFBPPR11186 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.1078: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.1079: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.1080: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1 Source.1081: DFBPPR11243 ---- Animal proteins ---- Epiphycan Source.1082: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog Source.1083: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.1084: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.1085: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1 Source.1086: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein Source.1087: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.1088: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.1089: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Source.1090: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3 Source.1091: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2 Source.1092: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1 Source.1093: DFBPPR11456 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-2 Source.1094: DFBPPR11526 ---- Animal proteins ---- Fibromodulin Source.1095: DFBPPR11546 ---- Animal proteins ---- Transcriptional adapter 2-alpha Source.1096: DFBPPR11558 ---- Animal proteins ---- Nuclear migration protein nudC Source.1097: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.1098: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3 Source.1099: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622 Source.1100: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230 Source.1101: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein Source.1102: DFBPPR11604 ---- Animal proteins ---- Centromere protein I Source.1103: DFBPPR11615 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.1104: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3 Source.1105: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog Source.1106: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.1107: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.1108: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.1109: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1 Source.1110: DFBPPR11786 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2 Source.1111: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.1112: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9 Source.1113: DFBPPR11852 ---- Animal proteins ---- Endothelial differentiation-related factor 1 homolog Source.1114: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.1115: DFBPPR11869 ---- Animal proteins ---- BH3-interacting domain death agonist Source.1116: DFBPPR11885 ---- Animal proteins ---- ELL-associated factor 2 Source.1117: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8 Source.1118: DFBPPR11905 ---- Animal proteins ---- Transmembrane protein 41B Source.1119: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.1120: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.1121: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2 Source.1122: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.1123: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1 Source.1124: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130 Source.1125: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7 Source.1126: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9 Source.1127: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14 Source.1128: DFBPPR12131 ---- Animal proteins ---- Exportin-4 Source.1129: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.1130: DFBPPR12160 ---- Animal proteins ---- Transmembrane protein 229B Source.1131: DFBPPR12175 ---- Animal proteins ---- Ashwin Source.1132: DFBPPR12180 ---- Animal proteins ---- Arylamine N-acetyltransferase, liver isozyme Source.1133: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3 Source.1134: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40 Source.1135: DFBPPR12206 ---- Animal proteins ---- CDAN1-interacting nuclease 1 Source.1136: DFBPPR12230 ---- Animal proteins ---- Orofacial cleft 1 candidate gene 1 protein homolog Source.1137: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.1138: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.1139: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.1140: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.1141: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.1142: DFBPPR12299 ---- Animal proteins ---- Myocilin Source.1143: DFBPPR12300 ---- Animal proteins ---- Platelet-derived growth factor subunit A Source.1144: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.1145: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor Source.1146: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.1147: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.1148: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.1149: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.1150: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial Source.1151: DFBPPR12385 ---- Animal proteins ---- Myosin-11 Source.1152: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase Source.1153: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.1154: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1155: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.1156: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2 Source.1157: DFBPPR12441 ---- Animal proteins ---- Triadin Source.1158: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1159: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1 Source.1160: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1 Source.1161: DFBPPR12484 ---- Animal proteins ---- Myosin-4 Source.1162: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.1163: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.1164: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1 Source.1165: DFBPPR12602 ---- Animal proteins ---- Osteopontin Source.1166: DFBPPR12603 ---- Animal proteins ---- Osteopontin Source.1167: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S Source.1168: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.1169: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.1170: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.1171: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.1172: DFBPPR12632 ---- Animal proteins ---- Caveolin-2 Source.1173: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.1174: DFBPPR12681 ---- Animal proteins ---- Myosin-7 Source.1175: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.1176: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform Source.1177: DFBPPR12728 ---- Animal proteins ---- Cytochrome b Source.1178: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.1179: DFBPPR12770 ---- Animal proteins ---- Filamin-B Source.1180: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1181: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.1182: DFBPPR12824 ---- Animal proteins ---- Alpha-crystallin A chain Source.1183: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.1184: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1 Source.1185: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.1186: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a Source.1187: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2 Source.1188: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1 Source.1189: DFBPPR12913 ---- Animal proteins ---- 15 kDa protein A Source.1190: DFBPPR12922 ---- Animal proteins ---- 15 kDa protein B Source.1191: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1 Source.1192: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.1193: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1 Source.1194: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein Source.1195: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2 Source.1196: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.1197: DFBPPR12982 ---- Animal proteins ---- Histone H2A.V Source.1198: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1199: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein Source.1200: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein Source.1201: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2 Source.1202: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2 Source.1203: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4 Source.1204: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.1205: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.1206: DFBPPR13197 ---- Animal proteins ---- Caveolin-2 Source.1207: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.1208: DFBPPR13226 ---- Animal proteins ---- Lutropin/choriogonadotropin subunit beta Source.1209: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.1210: DFBPPR13234 ---- Animal proteins ---- Alpha-crystallin A chain Source.1211: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.1212: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.1213: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a Source.1214: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.1215: DFBPPR13291 ---- Animal proteins ---- Myosin-7 Source.1216: DFBPPR13305 ---- Animal proteins ---- Cytochrome b Source.1217: DFBPPR13314 ---- Animal proteins ---- Myosin-1 Source.1218: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.1219: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1220: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.1221: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a Source.1222: DFBPPR13350 ---- Animal proteins ---- Carbohydrate-binding protein AWN Source.1223: DFBPPR13355 ---- Animal proteins ---- Nuclear transcription factor Y subunit beta Source.1224: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2 Source.1225: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase Source.1226: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.1227: DFBPPR13469 ---- Animal proteins ---- Cytochrome b Source.1228: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1229: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a Source.1230: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.1231: DFBPPR13583 ---- Animal proteins ---- Caveolin-2 Source.1232: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.1233: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.1234: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.1235: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1236: DFBPPR13627 ---- Animal proteins ---- Erythropoietin Source.1237: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.1238: DFBPPR13658 ---- Animal proteins ---- Alpha-crystallin A chain Source.1239: DFBPPR13660 ---- Animal proteins ---- 40S ribosomal protein SA Source.1240: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.1241: DFBPPR13706 ---- Animal proteins ---- Alpha-1-antiproteinase Source.1242: DFBPPR13711 ---- Animal proteins ---- Coagulation factor IX Source.1243: DFBPPR13712 ---- Animal proteins ---- Cytochrome b Source.1244: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.1245: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.1246: DFBPPR13764 ---- Animal proteins ---- Mast cell protease 1A Source.1247: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor Source.1248: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.1249: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.1250: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor Source.1251: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.1252: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a Source.1253: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin Source.1254: DFBPPR13885 ---- Animal proteins ---- Mast cell protease 3 Source.1255: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1 Source.1256: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1257: DFBPPR13912 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.1258: DFBPPR13959 ---- Animal proteins ---- Calpastatin Source.1259: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.1260: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.1261: DFBPPR14091 ---- Marine protein ---- 40S ribosomal protein SA Source.1262: DFBPPR14197 ---- Marine protein ---- Ubiquitin-fold modifier-conjugating enzyme 1 Source.1263: DFBPPR14247 ---- Marine protein ---- Pro-MCH 2 Source.1264: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase Source.1265: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1266: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH Source.1267: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.1268: DFBPPR14375 ---- Marine protein ---- Cytochrome b559 subunit beta Source.1269: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta Source.1270: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic Source.1271: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA Source.1272: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39 Source.1273: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60 Source.1274: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.1275: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.1276: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein Source.1277: DFBPPR14684 ---- Marine protein ---- Pro-MCH 2 Source.1278: DFBPPR14685 ---- Marine protein ---- Pro-MCH 1 Source.1279: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit Source.1280: DFBPPR14763 ---- Marine protein ---- Tachyplesin-1 Source.1281: DFBPPR14766 ---- Marine protein ---- Tachyplesin-2 Source.1282: DFBPPR14821 ---- Marine protein ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1 Source.1283: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta Source.1284: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20 Source.1285: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta Source.1286: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.1287: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.1288: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.1289: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27 Source.1290: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.1291: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1 Source.1292: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit Source.1293: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.1294: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1 Source.1295: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase Source.1296: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b Source.1297: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase Source.1298: DFBPPR15044 ---- Microorganism protein ---- Alcohol dehydrogenase 4, mitochondrial Source.1299: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1 Source.1300: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2 Source.1301: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial Source.1302: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase Source.1303: DFBPPR15090 ---- Microorganism protein ---- Transketolase Source.1304: DFBPPR15125 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit G Source.1305: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2 Source.1306: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase Source.1307: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4 Source.1308: DFBPPR15167 ---- Microorganism protein ---- Methylthioribulose-1-phosphate dehydratase Source.1309: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3 Source.1310: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial Source.1311: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9 Source.1312: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8 Source.1313: DFBPPR15203 ---- Microorganism protein ---- Ubiquitin-like protein ATG12 Source.1314: DFBPPR15204 ---- Microorganism protein ---- FK506-binding protein 1 Source.1315: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1 Source.1316: DFBPPR15216 ---- Microorganism protein ---- Golgi to ER traffic protein 1 Source.1317: DFBPPR15220 ---- Microorganism protein ---- Spindle assembly checkpoint component MAD1 Source.1318: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase Source.1319: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5 Source.1320: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1 Source.1321: DFBPPR15297 ---- Microorganism protein ---- Transcriptional activator HAP2 Source.1322: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1 Source.1323: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1 Source.1324: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1 Source.1325: DFBPPR15331 ---- Microorganism protein ---- Protein YOP1 Source.1326: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31 Source.1327: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B Source.1328: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial Source.1329: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.1330: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1 Source.1331: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14 Source.1332: DFBPPR15399 ---- Microorganism protein ---- 40S ribosomal protein S21 Source.1333: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1 Source.1334: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase Source.1335: DFBPPR15448 ---- Microorganism protein ---- 40S ribosomal protein S0 Source.1336: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2 Source.1337: DFBPPR15494 ---- Microorganism protein ---- Protein STU1 Source.1338: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1 Source.1339: DFBPPR15525 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit KXD1 Source.1340: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20 Source.1341: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.1342: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1 Source.1343: DFBPPR15589 ---- Microorganism protein ---- Spindle pole body component KRE28 Source.1344: DFBPPR15597 ---- Microorganism protein ---- DNA damage-binding protein CMR1 Source.1345: DFBPPR15663 ---- Microorganism protein ---- Spindle pole component BBP1 Source.1346: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3 Source.1347: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1 Source.1348: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21 Source.1349: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5 Source.1350: DFBPPR15756 ---- Microorganism protein ---- Inheritance of peroxisomes protein 1 Source.1351: DFBPPR15787 ---- Microorganism protein ---- Required for respiratory growth protein 7, mitochondrial Source.1352: DFBPPR15805 ---- Microorganism protein ---- Serine O-acetyltransferase Source.1353: DFBPPR15829 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase Source.1354: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1 Source.1355: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2 Source.1356: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase Source.1357: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2 Source.1358: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1 Source.1359: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2 Source.1360: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1 Source.1361: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase Source.1362: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase Source.1363: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3 Source.1364: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase Source.1365: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1 Source.1366: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1367: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.1368: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase Source.1369: DFBPPR7794 ---- Plant protein ---- Cytochrome b6 Source.1370: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1371: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2 Source.1372: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2 Source.1373: DFBPPR7819 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial Source.1374: DFBPPR7861 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic Source.1375: DFBPPR7868 ---- Plant protein ---- Alpha-amylase inhibitor 4 Source.1376: DFBPPR7935 ---- Plant protein ---- Cytochrome b Source.1377: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1 Source.1378: DFBPPR7947 ---- Plant protein ---- Legumin type B Source.1379: DFBPPR7951 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme Source.1380: DFBPPR8028 ---- Plant protein ---- Polygalacturonase inhibitor 2 Source.1381: DFBPPR8045 ---- Plant protein ---- Polygalacturonase inhibitor 1 Source.1382: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1383: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2 Source.1384: DFBPPR8062 ---- Plant protein ---- Polygalacturonase inhibitor 3 Source.1385: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1386: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.1387: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.1388: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1 Source.1389: DFBPPR8120 ---- Plant protein ---- Protein TIC 214 Source.1390: DFBPPR8181 ---- Plant protein ---- 33 kDa cell wall protein Source.1391: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic Source.1392: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1393: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase Source.1394: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3 Source.1395: DFBPPR8271 ---- Plant protein ---- Cytochrome b6 Source.1396: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1397: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3 Source.1398: DFBPPR8328 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic Source.1399: DFBPPR8335 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Link-research Inductive analysis	Link 1: DFBPACEI1903----Amaranth seed proteins----Amaranth glutelins

Biological/Functional activity & target protein

ACE-inhibitory activity	The peptide exhibited moderate Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC₅₀ value of 350 μM.
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O

Preparation method

Mode of preparation	Synthesis
Enzyme(s)/starter culture	The peptide was synthesized by the stepwise solid-phase method, using Fmoc amino acids and mild acid labile side chain protection.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

N.D

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Kohmura, M., Nio, N., Ariyoshi, Y. Inhibition of Angiotensin-Converting Enzyme by Synthetic Peptide Fragments of Human κ-Casein. Agricultural and Biological Chemistry. 2014, 54, 835-6. DOI: 10.1080/00021369.1990.10870018
Other literature(s)	[1] Ap D L R, Montoya A B, Martã-Nez-Cuevas P, et al. Tryptic amaranth glutelin digests induce endothelial nitric oxide production through inhibition of ACE: antihypertensive role of amaranth peptides[J]. Nitric Oxide, 2010, 23(2):106-111.
PubDate	2014