E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI0644(ACE-inhibitory peptide)
DFBP ID DFBPACEI0644
Peptide sequence YGG
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity Antioxidative activity [D1], Immunomodulatory activity [D2], Multifunctional activity [D3]
Calculated physicochemical properties
Three-letter amino acid Tyr-Gly-Gly
Single-letter amino acid YGG
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 295.30 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.92 c
IC50 > 10000 uM
pIC50 > -4.0
GRAVY -0.7000 c
Hydrophilic residue ratio 66.67% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Grains
Precursor protein Sake
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.2: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.3: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.4: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.5: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.6: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.7: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11
Source.8: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.9: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.10: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.11: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.12: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.13: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1
Source.14: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.15: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.16: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.17: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.18: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.19: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.20: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.21: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.22: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.23: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56
Source.24: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.25: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.26: DFBPPR1065 ---- Plant proteins ---- Protein TIFY 3
Source.27: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1
Source.28: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.29: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.30: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1
Source.31: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG
Source.32: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.33: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP
Source.34: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.35: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.36: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.37: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2
Source.38: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.39: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1
Source.40: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.41: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15
Source.42: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.43: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.44: DFBPPR1294 ---- Plant proteins ---- MADS-box transcription factor 8
Source.45: DFBPPR1297 ---- Plant proteins ---- Peroxygenase
Source.46: DFBPPR1300 ---- Plant proteins ---- Protein G1
Source.47: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.48: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.49: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.50: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic
Source.51: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.52: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.53: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2
Source.54: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.55: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.56: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.57: DFBPPR1427 ---- Plant proteins ---- Probable esterase D14L
Source.58: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.59: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.60: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.61: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c
Source.62: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2
Source.63: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.64: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.65: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.66: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.67: DFBPPR1477 ---- Plant proteins ---- MADS-box transcription factor 16
Source.68: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2
Source.69: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.70: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4
Source.71: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.72: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.73: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.74: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.75: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.76: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148
Source.77: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.78: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9
Source.79: DFBPPR1580 ---- Plant proteins ---- Expansin-A4
Source.80: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4
Source.81: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.82: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11
Source.83: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.84: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.85: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A
Source.86: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.87: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.88: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.89: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.90: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.91: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.92: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.93: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.94: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.95: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.96: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.97: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.98: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.99: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.100: DFBPPR1803 ---- Plant proteins ---- Chitinase 5
Source.101: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1
Source.102: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1
Source.103: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.104: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1
Source.105: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2
Source.106: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.107: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.108: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3
Source.109: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8
Source.110: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.111: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.112: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2
Source.113: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial
Source.114: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.115: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.116: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.117: DFBPPR1962 ---- Plant proteins ---- Expansin-A2
Source.118: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.119: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial
Source.120: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.121: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.122: DFBPPR2045 ---- Plant proteins ---- Expansin-A5
Source.123: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.124: DFBPPR2081 ---- Plant proteins ---- Expansin-A1
Source.125: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1
Source.126: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45
Source.127: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.128: DFBPPR2134 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.129: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.130: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.131: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.132: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2
Source.133: DFBPPR2175 ---- Plant proteins ---- Expansin-A16
Source.134: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11
Source.135: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.136: DFBPPR2220 ---- Plant proteins ---- Expansin-A7
Source.137: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.138: DFBPPR2242 ---- Plant proteins ---- Expansin-A3
Source.139: DFBPPR2243 ---- Plant proteins ---- WRKY transcription factor WRKY76
Source.140: DFBPPR2244 ---- Plant proteins ---- Expansin-A6
Source.141: DFBPPR2245 ---- Plant proteins ---- Expansin-A26
Source.142: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial
Source.143: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.144: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B
Source.145: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.146: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10
Source.147: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.148: DFBPPR2337 ---- Plant proteins ---- Protein TIFY 11b
Source.149: DFBPPR2356 ---- Plant proteins ---- Ubiquitin-like protein-NEDD8-like protein RUB3
Source.150: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.151: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.152: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.153: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.154: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.155: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.156: DFBPPR2448 ---- Plant proteins ---- Expansin-A9
Source.157: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.158: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.159: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900
Source.160: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.161: DFBPPR2516 ---- Plant proteins ---- Expansin-B16
Source.162: DFBPPR2526 ---- Plant proteins ---- Chitinase 10
Source.163: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20
Source.164: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.165: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.166: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.167: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b
Source.168: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.169: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1
Source.170: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase
Source.171: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5
Source.172: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1
Source.173: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3
Source.174: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.175: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.176: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.177: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1
Source.178: DFBPPR2651 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL3
Source.179: DFBPPR2656 ---- Plant proteins ---- Expansin-A15
Source.180: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5
Source.181: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.182: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.183: DFBPPR2676 ---- Plant proteins ---- Expansin-A11
Source.184: DFBPPR2679 ---- Plant proteins ---- Expansin-A22
Source.185: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.186: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase
Source.187: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1
Source.188: DFBPPR2699 ---- Plant proteins ---- Expansin-A8
Source.189: DFBPPR2712 ---- Plant proteins ---- Expansin-A20
Source.190: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77
Source.191: DFBPPR2721 ---- Plant proteins ---- Expansin-A18
Source.192: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20
Source.193: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic
Source.194: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic
Source.195: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5
Source.196: DFBPPR2735 ---- Plant proteins ---- Expansin-A24
Source.197: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8
Source.198: DFBPPR2758 ---- Plant proteins ---- Expansin-B17
Source.199: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9
Source.200: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.201: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.202: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3
Source.203: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.204: DFBPPR2784 ---- Plant proteins ---- Chitinase 11
Source.205: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a
Source.206: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.207: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.208: DFBPPR2793 ---- Plant proteins ---- MADS-box transcription factor 33
Source.209: DFBPPR2796 ---- Plant proteins ---- Protein TIFY 11c
Source.210: DFBPPR2797 ---- Plant proteins ---- Anther-specific protein RTS
Source.211: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.212: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.213: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.214: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.215: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.216: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10
Source.217: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1
Source.218: DFBPPR2831 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 4
Source.219: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.220: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.221: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.222: DFBPPR2873 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL2
Source.223: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.224: DFBPPR2877 ---- Plant proteins ---- Splicing factor U2af small subunit B
Source.225: DFBPPR2880 ---- Plant proteins ---- Nuclear cap-binding protein subunit 2
Source.226: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.227: DFBPPR2900 ---- Plant proteins ---- Expansin-A23
Source.228: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB
Source.229: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.230: DFBPPR2910 ---- Plant proteins ---- Expansin-B5
Source.231: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8
Source.232: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27
Source.233: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.234: DFBPPR2948 ---- Plant proteins ---- Expansin-A25
Source.235: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.236: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.237: DFBPPR2964 ---- Plant proteins ---- Expansin-A14
Source.238: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.239: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.240: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.241: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.242: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.243: DFBPPR3011 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG4
Source.244: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3
Source.245: DFBPPR3015 ---- Plant proteins ---- Expansin-A13
Source.246: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.247: DFBPPR3017 ---- Plant proteins ---- Expansin-A12
Source.248: DFBPPR3027 ---- Plant proteins ---- Expansin-A31
Source.249: DFBPPR3028 ---- Plant proteins ---- Expansin-A19
Source.250: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.251: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1
Source.252: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.253: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24
Source.254: DFBPPR3048 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL10
Source.255: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2
Source.256: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6
Source.257: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16
Source.258: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.259: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.260: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.261: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21
Source.262: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28
Source.263: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.264: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.265: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6
Source.266: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2
Source.267: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3
Source.268: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.269: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4
Source.270: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.271: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5
Source.272: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.273: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27
Source.274: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.275: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.276: DFBPPR3225 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit M, chloroplastic
Source.277: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1
Source.278: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.279: DFBPPR3232 ---- Plant proteins ---- Expansin-A28
Source.280: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.281: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic
Source.282: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.283: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.284: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18
Source.285: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.286: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.287: DFBPPR3286 ---- Plant proteins ---- Expansin-A32
Source.288: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.289: DFBPPR3302 ---- Plant proteins ---- Expansin-A21
Source.290: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.291: DFBPPR3323 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL7
Source.292: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12
Source.293: DFBPPR3330 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 10
Source.294: DFBPPR3333 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 11
Source.295: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2
Source.296: DFBPPR3347 ---- Plant proteins ---- Thiamine pyrophosphokinase 1
Source.297: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.298: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.299: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.300: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.301: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14
Source.302: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2
Source.303: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.304: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.305: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.306: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.307: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.308: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2
Source.309: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.310: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9
Source.311: DFBPPR3415 ---- Plant proteins ---- Expansin-A33
Source.312: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.313: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2
Source.314: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.315: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.316: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.317: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14
Source.318: DFBPPR3476 ---- Plant proteins ---- Glutaredoxin-C3
Source.319: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.320: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.321: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.322: DFBPPR3508 ---- Plant proteins ---- 60S ribosomal protein L5-1
Source.323: DFBPPR3530 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL2
Source.324: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.325: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.326: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.327: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.328: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.329: DFBPPR3603 ---- Plant proteins ---- Protein TIFY 11e
Source.330: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.331: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.332: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.333: DFBPPR3651 ---- Plant proteins ---- 19 kDa globulin
Source.334: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic
Source.335: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.336: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.337: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.338: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.339: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2
Source.340: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11
Source.341: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.342: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.343: DFBPPR3723 ---- Plant proteins ---- Inactive protein FON2 SPARE1
Source.344: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2
Source.345: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3
Source.346: DFBPPR3752 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 7
Source.347: DFBPPR3767 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 8
Source.348: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9
Source.349: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.350: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.351: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.352: DFBPPR3812 ---- Plant proteins ---- Growth-regulating factor 2
Source.353: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.354: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2
Source.355: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.356: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.357: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.358: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.359: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g
Source.360: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.361: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic
Source.362: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.363: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1
Source.364: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic
Source.365: DFBPPR4022 ---- Plant proteins ---- Protein TIFY 11f
Source.366: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.367: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C
Source.368: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.369: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.370: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1
Source.371: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.372: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic
Source.373: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1
Source.374: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.375: DFBPPR4109 ---- Plant proteins ---- 60S ribosomal protein L5-2
Source.376: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49
Source.377: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.378: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.379: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40
Source.380: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.381: DFBPPR4204 ---- Plant proteins ---- CASP-like protein 2B1
Source.382: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.383: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial
Source.384: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.385: DFBPPR4218 ---- Plant proteins ---- Glycine-rich cell wall structural protein 2
Source.386: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.387: DFBPPR4250 ---- Plant proteins ---- Probable carboxylesterase Os04g0669600
Source.388: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP
Source.389: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.390: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.391: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase
Source.392: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.393: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog
Source.394: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.395: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.396: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.397: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.398: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.399: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.400: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.401: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.402: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L
Source.403: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme
Source.404: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.405: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.406: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.407: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.408: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1
Source.409: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3
Source.410: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.411: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D
Source.412: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3
Source.413: DFBPPR4627 ---- Plant proteins ---- 40S ribosomal protein S19
Source.414: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12
Source.415: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1
Source.416: DFBPPR4680 ---- Plant proteins ---- Dehydrin Rab16B
Source.417: DFBPPR4686 ---- Plant proteins ---- Dehydrin Rab16C
Source.418: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B
Source.419: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8
Source.420: DFBPPR4737 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 14
Source.421: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1
Source.422: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31
Source.423: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100
Source.424: DFBPPR4813 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0157700
Source.425: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36
Source.426: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56
Source.427: DFBPPR4842 ---- Plant proteins ---- B3 domain-containing protein Os06g0194400
Source.428: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400
Source.429: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.430: DFBPPR4898 ---- Plant proteins ---- Serine racemase
Source.431: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3
Source.432: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7
Source.433: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.434: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23
Source.435: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.436: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.437: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.438: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.439: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.440: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.441: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.442: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.443: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.444: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.445: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.446: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.447: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.448: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.449: DFBPPR5339 ---- Plant proteins ---- Putative 3,4-dihydroxy-2-butanone kinase
Source.450: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.451: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic
Source.452: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.453: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.454: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5
Source.455: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.456: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.457: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1
Source.458: DFBPPR5526 ---- Plant proteins ---- Oleosin Zm-II
Source.459: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1
Source.460: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.461: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.462: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.463: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic
Source.464: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.465: DFBPPR5702 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.466: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4
Source.467: DFBPPR5766 ---- Plant proteins ---- MADS-box protein ZMM17
Source.468: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1
Source.469: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase
Source.470: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.471: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.472: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.473: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.474: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.475: DFBPPR5927 ---- Plant proteins ---- Aquaporin SIP2-1
Source.476: DFBPPR5931 ---- Plant proteins ---- Glycine-rich RNA-binding, abscisic acid-inducible protein
Source.477: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A
Source.478: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3
Source.479: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B
Source.480: DFBPPR5961 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.481: DFBPPR5966 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.482: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2
Source.483: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6
Source.484: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7
Source.485: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1
Source.486: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1
Source.487: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.488: DFBPPR6108 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 5
Source.489: DFBPPR6135 ---- Plant proteins ---- Defensin-like protein 1
Source.490: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.491: DFBPPR6204 ---- Plant proteins ---- Unknown protein from spot 258 of 2D-PAGE of etiolated coleoptile
Source.492: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.493: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1
Source.494: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.495: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.496: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.497: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.498: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.499: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.500: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.501: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.502: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.503: DFBPPR6337 ---- Plant proteins ---- Histone H2A.1
Source.504: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.505: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.506: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.507: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.508: DFBPPR6389 ---- Plant proteins ---- Auxin-induced protein IAA4
Source.509: DFBPPR6395 ---- Plant proteins ---- Histone H2A.2
Source.510: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.511: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.512: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.513: DFBPPR6486 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 1
Source.514: DFBPPR6548 ---- Plant proteins ---- Dehydrin DHN1
Source.515: DFBPPR6562 ---- Plant proteins ---- Dormancy-associated protein 2
Source.516: DFBPPR6586 ---- Plant proteins ---- 60S ribosomal protein L34
Source.517: DFBPPR6620 ---- Plant proteins ---- Dehydrin DHN2
Source.518: DFBPPR6621 ---- Plant proteins ---- Dehydrin DHN3
Source.519: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.520: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.521: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.522: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.523: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.524: DFBPPR6642 ---- Plant proteins ---- Peroxidase
Source.525: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.526: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.527: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.528: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.529: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase
Source.530: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.531: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1
Source.532: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.533: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1
Source.534: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.535: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.536: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2
Source.537: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.538: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.539: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1
Source.540: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.541: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.542: DFBPPR7063 ---- Plant proteins ---- Glycine-rich RNA-binding protein blt801
Source.543: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.544: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.545: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.546: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.547: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.548: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.549: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4
Source.550: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.551: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial
Source.552: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.553: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.554: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.555: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33
Source.556: DFBPPR7301 ---- Plant proteins ---- Glycine-rich cell wall structural protein
Source.557: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic
Source.558: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.559: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.560: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.561: DFBPPR7417 ---- Plant proteins ---- Cruciferin
Source.562: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.563: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.564: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.565: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.566: DFBPPR7441 ---- Plant proteins ---- Defensin-like protein 4
Source.567: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic
Source.568: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1
Source.569: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic
Source.570: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4
Source.571: DFBPPR7463 ---- Plant proteins ---- Oleosin S2-2
Source.572: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.573: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.574: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.575: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.576: DFBPPR7504 ---- Plant proteins ---- 10 kDa chaperonin
Source.577: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA
Source.578: DFBPPR7527 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.579: DFBPPR7530 ---- Plant proteins ---- Glycine-rich RNA-binding protein 10
Source.580: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.581: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.582: DFBPPR7597 ---- Milk proteins ---- Alpha-lactalbumin
Source.583: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.584: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1
Source.585: DFBPPR7626 ---- Milk proteins ---- Immunoglobulin J chain
Source.586: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.587: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.588: DFBPPR7685 ---- Milk proteins ---- Alpha-lactalbumin
Source.589: DFBPPR7697 ---- Milk proteins ---- Alpha-lactalbumin
Source.590: DFBPPR7711 ---- Milk proteins ---- Alpha-lactalbumin
Source.591: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.592: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.593: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.594: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.595: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.596: DFBPPR8391 ---- Plant proteins ---- Oleosin Ara h 15.0101
Source.597: DFBPPR8399 ---- Plant proteins ---- Oleosin Ara h 11.0101
Source.598: DFBPPR8400 ---- Plant proteins ---- Oleosin Ara h 11.0102
Source.599: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.600: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.601: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic
Source.602: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.603: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.604: DFBPPR8490 ---- Milk proteins ---- Alpha-lactalbumin
Source.605: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.606: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.607: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.608: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.609: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.610: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.611: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV
Source.612: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.613: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor
Source.614: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5
Source.615: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.616: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.617: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.618: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.619: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.620: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase
Source.621: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.622: DFBPPR16198 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.623: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.624: DFBPPR16246 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.625: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4
Source.626: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.627: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.628: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4
Source.629: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4
Source.630: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.631: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11
Source.632: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.633: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.634: DFBPPR16506 ---- Animal proteins ---- Pepsin B
Source.635: DFBPPR16516 ---- Animal proteins ---- Cytospin-A
Source.636: DFBPPR16517 ---- Animal proteins ---- Cholinesterase
Source.637: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.638: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.639: DFBPPR16539 ---- Animal proteins ---- Epididymal sperm-binding protein 1
Source.640: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.641: DFBPPR16598 ---- Animal proteins ---- Keratin, type I cytoskeletal 9
Source.642: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.643: DFBPPR16662 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.644: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.645: DFBPPR16740 ---- Animal proteins ---- 60S ribosomal protein L36a
Source.646: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin
Source.647: DFBPPR16804 ---- Animal proteins ---- Pancreatic trypsin inhibitor
Source.648: DFBPPR16825 ---- Animal proteins ---- Myelin basic protein
Source.649: DFBPPR16834 ---- Animal proteins ---- Seminal plasma protein PDC-109
Source.650: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.651: DFBPPR16864 ---- Animal proteins ---- Protein AMBP
Source.652: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.653: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.654: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial
Source.655: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.656: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV
Source.657: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial
Source.658: DFBPPR16933 ---- Animal proteins ---- Proenkephalin-A
Source.659: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.660: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.661: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.662: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.663: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.664: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.665: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.666: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP
Source.667: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.668: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.669: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.670: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.671: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.672: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.673: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.674: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.675: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase
Source.676: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33
Source.677: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.678: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein
Source.679: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.680: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.681: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1
Source.682: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.683: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.684: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.685: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.686: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.687: DFBPPR17392 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.688: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.689: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.690: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.691: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.692: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.693: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial
Source.694: DFBPPR17549 ---- Animal proteins ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.695: DFBPPR17563 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein A1
Source.696: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.697: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.698: DFBPPR17579 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.699: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.700: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.701: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.702: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.703: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.704: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.705: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.706: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.707: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.708: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.709: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.710: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.711: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.712: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.713: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.714: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase
Source.715: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial
Source.716: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.717: DFBPPR17849 ---- Animal proteins ---- Fibromodulin
Source.718: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.719: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.720: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.721: DFBPPR17883 ---- Animal proteins ---- Sialidase-1
Source.722: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3
Source.723: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.724: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT
Source.725: DFBPPR17934 ---- Animal proteins ---- RNA-binding motif protein, X chromosome
Source.726: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.727: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.728: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.729: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial
Source.730: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase
Source.731: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.732: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.733: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.734: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8
Source.735: DFBPPR18107 ---- Animal proteins ---- Lymphocyte antigen 96
Source.736: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1
Source.737: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.738: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.739: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.740: DFBPPR18162 ---- Animal proteins ---- Renin receptor
Source.741: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.742: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.743: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.744: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.745: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.746: DFBPPR18310 ---- Animal proteins ---- Serine/arginine-rich splicing factor 7
Source.747: DFBPPR18349 ---- Animal proteins ---- Phosphoglycerate mutase 1
Source.748: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B
Source.749: DFBPPR18371 ---- Animal proteins ---- F-actin-capping protein subunit beta
Source.750: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.751: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.752: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22
Source.753: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein
Source.754: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1
Source.755: DFBPPR18570 ---- Animal proteins ---- Prolyl 3-hydroxylase OGFOD1
Source.756: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.757: DFBPPR18586 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoproteins A2/B1
Source.758: DFBPPR18594 ---- Animal proteins ---- Aprataxin and PNK-like factor
Source.759: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.760: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.761: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.762: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.763: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.764: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein
Source.765: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9
Source.766: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.767: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.768: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.769: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase
Source.770: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.771: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1
Source.772: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain
Source.773: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A
Source.774: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.775: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.776: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.777: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.778: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.779: DFBPPR18896 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.780: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20
Source.781: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.782: DFBPPR18910 ---- Animal proteins ---- Aspartyl aminopeptidase
Source.783: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.784: DFBPPR18926 ---- Animal proteins ---- Keratin, type I cytoskeletal 10
Source.785: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.786: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.787: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.788: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.789: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74
Source.790: DFBPPR19007 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1
Source.791: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic
Source.792: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.793: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.794: DFBPPR19065 ---- Animal proteins ---- Cadherin-6
Source.795: DFBPPR19083 ---- Animal proteins ---- UBX domain-containing protein 1
Source.796: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.797: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.798: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8
Source.799: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.800: DFBPPR19192 ---- Animal proteins ---- Neudesin
Source.801: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2
Source.802: DFBPPR19198 ---- Animal proteins ---- Cadherin-3
Source.803: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1
Source.804: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.805: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.806: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.807: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.808: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.809: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.810: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.811: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8
Source.812: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2
Source.813: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F
Source.814: DFBPPR19440 ---- Animal proteins ---- Phosphoglycerate mutase 2
Source.815: DFBPPR19450 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J
Source.816: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20
Source.817: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.818: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.819: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1
Source.820: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.821: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.822: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A
Source.823: DFBPPR19540 ---- Animal proteins ---- Beta-defensin 6
Source.824: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.825: DFBPPR19599 ---- Animal proteins ---- Thrombomodulin
Source.826: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein
Source.827: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5
Source.828: DFBPPR19649 ---- Animal proteins ---- Proteasome subunit alpha type-4
Source.829: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.830: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3
Source.831: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.832: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17
Source.833: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.834: DFBPPR19734 ---- Animal proteins ---- CDC42 small effector protein 2
Source.835: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.836: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.837: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.838: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma
Source.839: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.840: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2
Source.841: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog
Source.842: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.843: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C
Source.844: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.845: DFBPPR19863 ---- Animal proteins ---- Dihydropteridine reductase
Source.846: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.847: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3
Source.848: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B
Source.849: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.850: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.851: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.852: DFBPPR20023 ---- Animal proteins ---- Cysteine and glycine-rich protein 2
Source.853: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.854: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.855: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2
Source.856: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.857: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.858: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.859: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.860: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.861: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator
Source.862: DFBPPR20221 ---- Animal proteins ---- CD99 antigen-like protein 2
Source.863: DFBPPR20243 ---- Animal proteins ---- Tissue factor pathway inhibitor 2
Source.864: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2
Source.865: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.866: DFBPPR20313 ---- Animal proteins ---- 40S ribosomal protein S9
Source.867: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14
Source.868: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1
Source.869: DFBPPR20356 ---- Animal proteins ---- RNA-binding protein 7
Source.870: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.871: DFBPPR20413 ---- Animal proteins ---- 10 kDa heat shock protein, mitochondrial
Source.872: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor
Source.873: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1
Source.874: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C
Source.875: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase
Source.876: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.877: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.878: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.879: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.880: DFBPPR20596 ---- Animal proteins ---- Colostrum trypsin inhibitor
Source.881: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.882: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.883: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.884: DFBPPR20743 ---- Animal proteins ---- Myozenin-1
Source.885: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.886: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.887: DFBPPR20795 ---- Animal proteins ---- Four and a half LIM domains protein 3
Source.888: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.889: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2
Source.890: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.891: DFBPPR20831 ---- Animal proteins ---- Keratin, type II cytoskeletal 59 kDa, component IV
Source.892: DFBPPR20837 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.893: DFBPPR20883 ---- Animal proteins ---- Pre-mRNA-splicing factor 38A
Source.894: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.895: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.896: DFBPPR20947 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.897: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.898: DFBPPR20991 ---- Animal proteins ---- Arfaptin-2
Source.899: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor
Source.900: DFBPPR21067 ---- Animal proteins ---- LIM and SH3 domain protein 1
Source.901: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.902: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4
Source.903: DFBPPR21114 ---- Animal proteins ---- Keratin, type II cytoskeletal 60 kDa, component III
Source.904: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase
Source.905: DFBPPR21223 ---- Animal proteins ---- Serum basic protease inhibitor
Source.906: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231
Source.907: DFBPPR21297 ---- Animal proteins ---- 39S ribosomal protein L30, mitochondrial
Source.908: DFBPPR21394 ---- Animal proteins ---- Elongin-C
Source.909: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.910: DFBPPR21494 ---- Animal proteins ---- Spleen trypsin inhibitor I
Source.911: DFBPPR21500 ---- Animal proteins ---- Docking protein 2
Source.912: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.913: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.914: DFBPPR21651 ---- Animal proteins ---- Dynactin subunit 6
Source.915: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase
Source.916: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.917: DFBPPR21872 ---- Animal proteins ---- 40S ribosomal protein S19
Source.918: DFBPPR21932 ---- Animal proteins ---- Keratin, type II cytoskeletal 68 kDa, component IB
Source.919: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial
Source.920: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.921: DFBPPR22020 ---- Animal proteins ---- Phosphotriesterase-related protein
Source.922: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase
Source.923: DFBPPR22073 ---- Animal proteins ---- C2 calcium-dependent domain-containing protein 4A
Source.924: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.925: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A
Source.926: DFBPPR22127 ---- Animal proteins ---- Tumor protein p53-inducible protein 11
Source.927: DFBPPR22172 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX14
Source.928: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3
Source.929: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34
Source.930: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.931: DFBPPR22308 ---- Animal proteins ---- Mitochondrial pyruvate carrier-like protein
Source.932: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein
Source.933: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.934: DFBPPR22483 ---- Animal proteins ---- 60S ribosomal protein L36a
Source.935: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.936: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1
Source.937: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9
Source.938: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.939: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.940: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164
Source.941: DFBPPR22651 ---- Animal proteins ---- Spermatogenesis-associated protein 2-like protein
Source.942: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.943: DFBPPR22689 ---- Animal proteins ---- Protein FAM166B
Source.944: DFBPPR22716 ---- Animal proteins ---- Overexpressed in colon carcinoma 1 protein homolog
Source.945: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog
Source.946: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.947: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.948: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.949: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.950: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.951: DFBPPR8553 ---- Animal proteins ---- Protein AMBP
Source.952: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.953: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.954: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.955: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.956: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.957: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.958: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.959: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.960: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.961: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.962: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.963: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.964: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.965: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.966: DFBPPR8792 ---- Animal proteins ---- Plasminogen
Source.967: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.968: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3
Source.969: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.970: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide
Source.971: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.972: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.973: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.974: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.975: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.976: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B
Source.977: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.978: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.979: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component
Source.980: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.981: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.982: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.983: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.984: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.985: DFBPPR9178 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 3
Source.986: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.987: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.988: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.989: DFBPPR9263 ---- Animal proteins ---- Serine/arginine-rich splicing factor 2
Source.990: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.991: DFBPPR9307 ---- Animal proteins ---- Epididymal sperm-binding protein 1
Source.992: DFBPPR9319 ---- Animal proteins ---- Myelin basic protein
Source.993: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase
Source.994: DFBPPR9346 ---- Animal proteins ---- Myozenin-1
Source.995: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.996: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2
Source.997: DFBPPR9511 ---- Animal proteins ---- Cholinesterase
Source.998: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.999: DFBPPR9585 ---- Animal proteins ---- Uterine plasmin/trypsin inhibitor
Source.1000: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2
Source.1001: DFBPPR9593 ---- Animal proteins ---- Selenoprotein K
Source.1002: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.1003: DFBPPR9623 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2
Source.1004: DFBPPR9640 ---- Animal proteins ---- Actin-binding Rho-activating protein
Source.1005: DFBPPR9652 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial
Source.1006: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1007: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2
Source.1008: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.1009: DFBPPR9771 ---- Animal proteins ---- 60S ribosomal protein L5
Source.1010: DFBPPR9773 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.1011: DFBPPR9835 ---- Animal proteins ---- 60S ribosomal protein L36a
Source.1012: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.1013: DFBPPR9902 ---- Animal proteins ---- 40S ribosomal protein S19
Source.1014: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase
Source.1015: DFBPPR9966 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.1016: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.1017: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.1018: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.1019: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.1020: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.1021: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1022: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain
Source.1023: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.1024: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11
Source.1025: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1026: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1027: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.1028: DFBPPR10098 ---- Animal proteins ---- Mucin-6
Source.1029: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.1030: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.1031: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.1032: DFBPPR10179 ---- Animal proteins ---- T-box transcription factor TBX20
Source.1033: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.1034: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.1035: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.1036: DFBPPR10191 ---- Animal proteins ---- Src substrate protein p85
Source.1037: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.1038: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.1039: DFBPPR10218 ---- Animal proteins ---- Occludin
Source.1040: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.1041: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.1042: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.1043: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.1044: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.1045: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.1046: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.1047: DFBPPR10345 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.1048: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.1049: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.1050: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.1051: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.1052: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.1053: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.1054: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.1055: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.1056: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.1057: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.1058: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2
Source.1059: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.1060: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.1061: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.1062: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.1063: DFBPPR10605 ---- Animal proteins ---- Elastin
Source.1064: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.1065: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX
Source.1066: DFBPPR10616 ---- Animal proteins ---- Cholecystokinin
Source.1067: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1068: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1069: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5
Source.1070: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.1071: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.1072: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.1073: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.1074: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.1075: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.1076: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.1077: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.1078: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.1079: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.1080: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.1081: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.1082: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1
Source.1083: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.1084: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2
Source.1085: DFBPPR10937 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.1086: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.1087: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20
Source.1088: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.1089: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3
Source.1090: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.1091: DFBPPR11012 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.1092: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.1093: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.1094: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.1095: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.1096: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.1097: DFBPPR11109 ---- Animal proteins ---- Fibrinogen-like protein 1-like protein
Source.1098: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein
Source.1099: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2
Source.1100: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1
Source.1101: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.1102: DFBPPR11219 ---- Animal proteins ---- Cytospin-A
Source.1103: DFBPPR11226 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.1104: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2
Source.1105: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4
Source.1106: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.1107: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.1108: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.1109: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.1110: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15
Source.1111: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.1112: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1113: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.1114: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.1115: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.1116: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.1117: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.1118: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog
Source.1119: DFBPPR11470 ---- Animal proteins ---- Acetylcholine receptor subunit beta
Source.1120: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9
Source.1121: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.1122: DFBPPR11547 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J
Source.1123: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.1124: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43
Source.1125: DFBPPR11665 ---- Animal proteins ---- Shadow of prion protein
Source.1126: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.1127: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13
Source.1128: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.1129: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1
Source.1130: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.1131: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.1132: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.1133: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.1134: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.1135: DFBPPR11772 ---- Animal proteins ---- Cbp/p300-interacting transactivator 3
Source.1136: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.1137: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.1138: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.1139: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.1140: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.1141: DFBPPR11854 ---- Animal proteins ---- Claw keratin
Source.1142: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.1143: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like
Source.1144: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.1145: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1
Source.1146: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4
Source.1147: DFBPPR11986 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2
Source.1148: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal
Source.1149: DFBPPR12038 ---- Animal proteins ---- Scale keratin
Source.1150: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme
Source.1151: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.1152: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox
Source.1153: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.1154: DFBPPR12171 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-3
Source.1155: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.1156: DFBPPR12245 ---- Animal proteins ---- Overexpressed in colon carcinoma 1 protein homolog
Source.1157: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.1158: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.1159: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase
Source.1160: DFBPPR12266 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.1161: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.1162: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.1163: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.1164: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1165: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.1166: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3
Source.1167: DFBPPR12296 ---- Animal proteins ---- Neprilysin
Source.1168: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.1169: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.1170: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.1171: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.1172: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.1173: DFBPPR12339 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.1174: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.1175: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.1176: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.1177: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.1178: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.1179: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.1180: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.1181: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.1182: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.1183: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.1184: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.1185: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1186: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K
Source.1187: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.1188: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT
Source.1189: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT
Source.1190: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.1191: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.1192: DFBPPR12731 ---- Animal proteins ---- Cholinesterase
Source.1193: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1
Source.1194: DFBPPR12747 ---- Animal proteins ---- Myelin basic protein
Source.1195: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3
Source.1196: DFBPPR12770 ---- Animal proteins ---- Filamin-B
Source.1197: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.1198: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.1199: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.1200: DFBPPR12805 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.1201: DFBPPR12837 ---- Animal proteins ---- Tissue factor pathway inhibitor
Source.1202: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain
Source.1203: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.1204: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.1205: DFBPPR13008 ---- Animal proteins ---- Keratin-associated protein 6-1
Source.1206: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1207: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.1208: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1
Source.1209: DFBPPR13106 ---- Animal proteins ---- Ig kappa chain V region BS-1
Source.1210: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.1211: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3
Source.1212: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.1213: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1214: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.1215: DFBPPR13286 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor
Source.1216: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.1217: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.1218: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.1219: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1220: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.1221: DFBPPR13460 ---- Animal proteins ---- RNA-binding protein 3
Source.1222: DFBPPR13478 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor
Source.1223: DFBPPR13503 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.1224: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin
Source.1225: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.1226: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.1227: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.1228: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.1229: DFBPPR13716 ---- Animal proteins ---- Trichohyalin
Source.1230: DFBPPR13791 ---- Animal proteins ---- Cholinesterase
Source.1231: DFBPPR13818 ---- Animal proteins ---- Keratin-associated protein 7-1
Source.1232: DFBPPR13841 ---- Animal proteins ---- Keratin-associated protein 6-1
Source.1233: DFBPPR13855 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor
Source.1234: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1235: DFBPPR13900 ---- Animal proteins ---- Keratin, type I cytoskeletal 15
Source.1236: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1
Source.1237: DFBPPR13984 ---- Animal proteins ---- Pro-opiomelanocortin-2
Source.1238: DFBPPR14020 ---- Animal proteins ---- Parvalbumin alpha
Source.1239: DFBPPR14063 ---- Animal proteins ---- Homeobox protein Hox-B1
Source.1240: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.1241: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.1242: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein
Source.1243: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein
Source.1244: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog
Source.1245: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.1246: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein
Source.1247: DFBPPR14230 ---- Marine protein ---- Pro-opiomelanocortin
Source.1248: DFBPPR14261 ---- Marine protein ---- Beta-endorphin-2
Source.1249: DFBPPR14262 ---- Marine protein ---- Pro-opiomelanocortin
Source.1250: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial
Source.1251: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase
Source.1252: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein
Source.1253: DFBPPR14349 ---- Marine protein ---- Acetylglutamate kinase
Source.1254: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta
Source.1255: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.1256: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator
Source.1257: DFBPPR14500 ---- Marine protein ---- 50S ribosomal protein L27, chloroplastic
Source.1258: DFBPPR14523 ---- Marine protein ---- Uncharacterized protein ycf56
Source.1259: DFBPPR14543 ---- Marine protein ---- Pro-opiomelanocortin A
Source.1260: DFBPPR14549 ---- Marine protein ---- Pro-opiomelanocortin B
Source.1261: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.1262: DFBPPR14633 ---- Marine protein ---- Keratin, type I cytoskeletal 18
Source.1263: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A
Source.1264: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13
Source.1265: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.1266: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.1267: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.1268: DFBPPR14776 ---- Marine protein ---- Proteinase inhibitor
Source.1269: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.1270: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.1271: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain
Source.1272: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.1273: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.1274: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.1275: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.1276: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.1277: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.1278: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.1279: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase
Source.1280: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2
Source.1281: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial
Source.1282: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial
Source.1283: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial
Source.1284: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase
Source.1285: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial
Source.1286: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2
Source.1287: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.1288: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2
Source.1289: DFBPPR15083 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase
Source.1290: DFBPPR15090 ---- Microorganism protein ---- Transketolase
Source.1291: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1
Source.1292: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.1293: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.1294: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial
Source.1295: DFBPPR15135 ---- Microorganism protein ---- Protein transport protein SEC22
Source.1296: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.1297: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.1298: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84
Source.1299: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.1300: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.1301: DFBPPR15207 ---- Microorganism protein ---- Triosephosphate isomerase
Source.1302: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.1303: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial
Source.1304: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4
Source.1305: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase
Source.1306: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter
Source.1307: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7
Source.1308: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.1309: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5
Source.1310: DFBPPR15336 ---- Microorganism protein ---- Microsomal signal peptidase subunit 3
Source.1311: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.1312: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.1313: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.1314: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.1315: DFBPPR15417 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM16
Source.1316: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.1317: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13
Source.1318: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.1319: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.1320: DFBPPR15632 ---- Microorganism protein ---- Ribosome biogenesis protein NSA1
Source.1321: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.1322: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8
Source.1323: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3
Source.1324: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5
Source.1325: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1
Source.1326: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase
Source.1327: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.1328: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.1329: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.1330: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.1331: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.1332: DFBPPR7832 ---- Plant protein ---- Extensin
Source.1333: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1
Source.1334: DFBPPR7910 ---- Plant protein ---- Glycine-rich RNA-binding protein 2
Source.1335: DFBPPR7911 ---- Plant protein ---- Glycine-rich RNA-binding protein 1
Source.1336: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.1337: DFBPPR8003 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.1338: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.1339: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.1340: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.1341: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.1342: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.1343: DFBPPR8121 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.8
Source.1344: DFBPPR8129 ---- Plant protein ---- Serine/threonine-protein phosphatase PP1
Source.1345: DFBPPR8158 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.0
Source.1346: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.1347: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide didn't exhibit Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of > 10000 μM.

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Non-bitter taste prediction
SMILES N[C@@]([H])(Cc1ccc(O)cc1)C(=O)NCC(=O)NCC(=O)O
Preparation method
Mode of preparation

Synthesis

Enzyme(s)/starter culture

Solid-phase peptide synthesis was done with a peptide synthesizer (PEPTICOUPLER 2200; Vega Co., Ltd.).

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
DFBP
[D1] DFBPANOX0611
[D2] DFBPIMMU0087
[D3] DFBPMUFU0142
BIOPEP-UWM [D4] 3741, 7647
APD [D5] -
BioPepDB [D6] -
MBPDB [D7] -
Reference(s)
Primary literature Saito Y, Wanezaki K, Kawato A, Imayasu S. Structure and activity of angiotensin I converting enzyme inhibitory peptides from sake and sake lees. Biosci Biotechnol Biochem. 1994 Oct;58(10):1767-71.
PMID: 7765503
Other literature(s)

[1] Shimizu M. Nutraceutical proteins and peptides in health and disease[J]. ACE Inhibitory Peptides, 2006:269-315.

[2] Kayser H, Meisel H. Stimulation of human peripheral blood lymphocytes by bioactive peptides derived from bovine milk proteins ☆[J]. Febs Letters, 1996, 383(1-2):18-20.

PubDate 1994
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214