Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI0678(ACE-inhibitory peptide)

DFBP ID	DFBPACEI0678
Peptide sequence	LPG
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Leu-Pro-Gly

Single-letter amino acid

LPG

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	285.34 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

5.73 uM

pIC₅₀

-0.758

GRAVY

0.6000^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Synthesis
Organism/Source	Synthesis peptide
Precursor protein	Synthesis peptide
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2 Source.2: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog Source.3: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3 Source.4: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9 Source.5: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.6: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6 Source.7: DFBPPR0854 ---- Plant proteins ---- Lactoylglutathione lyase Source.8: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46 Source.9: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.10: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q Source.11: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1 Source.12: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8 Source.13: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1 Source.14: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.15: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase Source.16: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.17: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.18: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2 Source.19: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.20: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic Source.21: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.22: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.23: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.24: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase Source.25: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3 Source.26: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.27: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3 Source.28: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1 Source.29: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda Source.30: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.31: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.32: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic Source.33: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2 Source.34: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21 Source.35: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA Source.36: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.37: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP Source.38: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase Source.39: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5 Source.40: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial Source.41: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5 Source.42: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4 Source.43: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic Source.44: DFBPPR1087 ---- Plant proteins ---- Protein TPR1 Source.45: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB Source.46: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1 Source.47: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4 Source.48: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.49: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG Source.50: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A Source.51: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.52: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2 Source.53: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2 Source.54: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2 Source.55: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30 Source.56: DFBPPR1185 ---- Plant proteins ---- PHD finger protein EHD3 Source.57: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.58: DFBPPR1208 ---- Plant proteins ---- RNA polymerase sigma factor sigA Source.59: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2 Source.60: DFBPPR1224 ---- Plant proteins ---- MADS-box transcription factor 50 Source.61: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35 Source.62: DFBPPR1257 ---- Plant proteins ---- Transcription factor MYB2 Source.63: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1 Source.64: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39 Source.65: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B Source.66: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.67: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.68: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.69: DFBPPR1346 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 5 Source.70: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.71: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.72: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L Source.73: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10 Source.74: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.75: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.76: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1 Source.77: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.78: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.79: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23 Source.80: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.81: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4 Source.82: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.83: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.84: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.85: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1 Source.86: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.87: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic Source.88: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1 Source.89: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.90: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5 Source.91: DFBPPR1501 ---- Plant proteins ---- Polygalacturonase inhibitor 1 Source.92: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.93: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d Source.94: DFBPPR1519 ---- Plant proteins ---- Histone H2B.1 Source.95: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1 Source.96: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1 Source.97: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.98: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase Source.99: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3 Source.100: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1 Source.101: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.102: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2 Source.103: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF Source.104: DFBPPR1580 ---- Plant proteins ---- Expansin-A4 Source.105: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.106: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic Source.107: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.108: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic Source.109: DFBPPR1604 ---- Plant proteins ---- Putative bifunctional dihydrofolate reductase-thymidylate synthase Source.110: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.111: DFBPPR1615 ---- Plant proteins ---- Phosphatidylinositol:ceramide inositolphosphotransferase Source.112: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.113: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic Source.114: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic Source.115: DFBPPR1658 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 19 Source.116: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10 Source.117: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.118: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.119: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21 Source.120: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic Source.121: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.122: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.123: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic Source.124: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase Source.125: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1 Source.126: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.127: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase Source.128: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.129: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1 Source.130: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1 Source.131: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2 Source.132: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2 Source.133: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a Source.134: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2 Source.135: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial Source.136: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b Source.137: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11 Source.138: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic Source.139: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.140: DFBPPR1789 ---- Plant proteins ---- NAC domain-containing protein 22 Source.141: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.142: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4 Source.143: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4 Source.144: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3 Source.145: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog Source.146: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase Source.147: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic Source.148: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.149: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type Source.150: DFBPPR1839 ---- Plant proteins ---- Laccase-24 Source.151: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO Source.152: DFBPPR1843 ---- Plant proteins ---- Laccase-13 Source.153: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic Source.154: DFBPPR1851 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1 Source.155: DFBPPR1853 ---- Plant proteins ---- Laccase-4 Source.156: DFBPPR1861 ---- Plant proteins ---- Laccase-25 Source.157: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic Source.158: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.159: DFBPPR1870 ---- Plant proteins ---- Laccase-20 Source.160: DFBPPR1879 ---- Plant proteins ---- Germin-like protein 1-3 Source.161: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11 Source.162: DFBPPR1882 ---- Plant proteins ---- Laccase-12 Source.163: DFBPPR1883 ---- Plant proteins ---- Histone H2B.7 Source.164: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1 Source.165: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.166: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2 Source.167: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.168: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.169: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.170: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2 Source.171: DFBPPR1924 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.172: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1 Source.173: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase Source.174: DFBPPR1931 ---- Plant proteins ---- Thioredoxin X, chloroplastic Source.175: DFBPPR1934 ---- Plant proteins ---- Histone H2B.4 Source.176: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial Source.177: DFBPPR1945 ---- Plant proteins ---- Histone H2B.2 Source.178: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.179: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.180: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.181: DFBPPR1952 ---- Plant proteins ---- CBL-interacting protein kinase 1 Source.182: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.183: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.184: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial Source.185: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.186: DFBPPR1962 ---- Plant proteins ---- Expansin-A2 Source.187: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5 Source.188: DFBPPR1966 ---- Plant proteins ---- Histone H2B.3 Source.189: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.190: DFBPPR1973 ---- Plant proteins ---- Transcription factor MYB30 Source.191: DFBPPR1977 ---- Plant proteins ---- Histone H2B.8 Source.192: DFBPPR1980 ---- Plant proteins ---- Germin-like protein 1-4 Source.193: DFBPPR1982 ---- Plant proteins ---- Histone H2B.6 Source.194: DFBPPR1983 ---- Plant proteins ---- Histone H2B.11 Source.195: DFBPPR1984 ---- Plant proteins ---- Histone H2B.10 Source.196: DFBPPR1986 ---- Plant proteins ---- Histone H2B.5 Source.197: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4 Source.198: DFBPPR1988 ---- Plant proteins ---- Protein FLORAL ORGAN NUMBER2 Source.199: DFBPPR1993 ---- Plant proteins ---- Histone H2B.9 Source.200: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.201: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4 Source.202: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8 Source.203: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.204: DFBPPR2028 ---- Plant proteins ---- Laccase-7 Source.205: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic Source.206: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3 Source.207: DFBPPR2037 ---- Plant proteins ---- Laccase-10 Source.208: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2 Source.209: DFBPPR2040 ---- Plant proteins ---- Laccase-3 Source.210: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial Source.211: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.212: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1 Source.213: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.214: DFBPPR2045 ---- Plant proteins ---- Expansin-A5 Source.215: DFBPPR2047 ---- Plant proteins ---- 17.8 kDa heat shock protein Source.216: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5 Source.217: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.218: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2 Source.219: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11 Source.220: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.221: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.222: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c Source.223: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6 Source.224: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.225: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial Source.226: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.227: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80 Source.228: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic Source.229: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase Source.230: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.231: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6 Source.232: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1 Source.233: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1 Source.234: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1 Source.235: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.236: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.237: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23 Source.238: DFBPPR2154 ---- Plant proteins ---- Germin-like protein 8-2 Source.239: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1 Source.240: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.241: DFBPPR2178 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 2 Source.242: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2 Source.243: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase Source.244: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5 Source.245: DFBPPR2199 ---- Plant proteins ---- 18.0 kDa class II heat shock protein Source.246: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5 Source.247: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9 Source.248: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3 Source.249: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26 Source.250: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB Source.251: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.252: DFBPPR2239 ---- Plant proteins ---- Elongation factor 1-alpha Source.253: DFBPPR2244 ---- Plant proteins ---- Expansin-A6 Source.254: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13 Source.255: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial Source.256: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.257: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase Source.258: DFBPPR2279 ---- Plant proteins ---- Thioredoxin-like protein CITRX, chloroplastic Source.259: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.260: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7 Source.261: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA Source.262: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2 Source.263: DFBPPR2325 ---- Plant proteins ---- Peroxiredoxin-2E-2, chloroplastic Source.264: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1 Source.265: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.266: DFBPPR2342 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic Source.267: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.268: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30 Source.269: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB Source.270: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic Source.271: DFBPPR2374 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2 Source.272: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.273: DFBPPR2389 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-1 Source.274: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6 Source.275: DFBPPR2399 ---- Plant proteins ---- Germin-like protein 5-1 Source.276: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.277: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.278: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2 Source.279: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A Source.280: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.281: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1 Source.282: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS Source.283: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic Source.284: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9 Source.285: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial Source.286: DFBPPR2454 ---- Plant proteins ---- MADS-box transcription factor 56 Source.287: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.288: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase Source.289: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial Source.290: DFBPPR2491 ---- Plant proteins ---- Expansin-A10 Source.291: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic Source.292: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3 Source.293: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900 Source.294: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A Source.295: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5 Source.296: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial Source.297: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22 Source.298: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase Source.299: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3 Source.300: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21 Source.301: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20 Source.302: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta Source.303: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1 Source.304: DFBPPR2538 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B5 Source.305: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial Source.306: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.307: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.308: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.309: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40 Source.310: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.311: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2 Source.312: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b Source.313: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.314: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57 Source.315: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1 Source.316: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3 Source.317: DFBPPR2621 ---- Plant proteins ---- Germin-like protein 4-1 Source.318: DFBPPR2623 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 3 Source.319: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2 Source.320: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.321: DFBPPR2641 ---- Plant proteins ---- 18.8 kDa class V heat shock protein Source.322: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2 Source.323: DFBPPR2651 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL3 Source.324: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2 Source.325: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b Source.326: DFBPPR2659 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.327: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2 Source.328: DFBPPR2667 ---- Plant proteins ---- Germin-like protein 3-1 Source.329: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1 Source.330: DFBPPR2675 ---- Plant proteins ---- Anamorsin homolog 2 Source.331: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1 Source.332: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase Source.333: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.334: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase Source.335: DFBPPR2694 ---- Plant proteins ---- Monothiol glutaredoxin-S7, chloroplastic Source.336: DFBPPR2710 ---- Plant proteins ---- 2-C-methyl-D-erythritol 4-phosphate cytidylyltransferase, chloroplastic Source.337: DFBPPR2712 ---- Plant proteins ---- Expansin-A20 Source.338: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2 Source.339: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1 Source.340: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.341: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal Source.342: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5 Source.343: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8 Source.344: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7 Source.345: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700 Source.346: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9 Source.347: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3 Source.348: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.349: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.350: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.351: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.352: DFBPPR2784 ---- Plant proteins ---- Chitinase 11 Source.353: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein Source.354: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.355: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.356: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.357: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.358: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.359: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1 Source.360: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.361: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.362: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23 Source.363: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.364: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.365: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.366: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.367: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.368: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2 Source.369: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.370: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog Source.371: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2 Source.372: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11 Source.373: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1 Source.374: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13 Source.375: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3 Source.376: DFBPPR2974 ---- Plant proteins ---- Derlin-1 Source.377: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic Source.378: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.379: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19 Source.380: DFBPPR2994 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic Source.381: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4 Source.382: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1 Source.383: DFBPPR3011 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG4 Source.384: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2 Source.385: DFBPPR3028 ---- Plant proteins ---- Expansin-A19 Source.386: DFBPPR3034 ---- Plant proteins ---- Anamorsin homolog 1 Source.387: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1 Source.388: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic Source.389: DFBPPR3044 ---- Plant proteins ---- Thioredoxin-like 4, chloroplastic Source.390: DFBPPR3048 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL10 Source.391: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18 Source.392: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1 Source.393: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6 Source.394: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A Source.395: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.396: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.397: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.398: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.399: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33 Source.400: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.401: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.402: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6 Source.403: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.404: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.405: DFBPPR3133 ---- Plant proteins ---- Double-stranded RNA-binding protein 8 Source.406: DFBPPR3135 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 1 Source.407: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1 Source.408: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11 Source.409: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic Source.410: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11 Source.411: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32 Source.412: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.413: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.414: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10 Source.415: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.416: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic Source.417: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.418: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.419: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.420: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic Source.421: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1 Source.422: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic Source.423: DFBPPR3238 ---- Plant proteins ---- Hydrophobic protein LTI6A Source.424: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B Source.425: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10 Source.426: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6 Source.427: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18 Source.428: DFBPPR3277 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor RA16 Source.429: DFBPPR3283 ---- Plant proteins ---- Auxin-responsive protein IAA21 Source.430: DFBPPR3302 ---- Plant proteins ---- Expansin-A21 Source.431: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2 Source.432: DFBPPR3323 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL7 Source.433: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial Source.434: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2 Source.435: DFBPPR3342 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic Source.436: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38 Source.437: DFBPPR3374 ---- Plant proteins ---- Auxin-responsive protein IAA19 Source.438: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.439: DFBPPR3381 ---- Plant proteins ---- GATA transcription factor 18 Source.440: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14 Source.441: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2 Source.442: DFBPPR3385 ---- Plant proteins ---- Auxin-responsive protein IAA18 Source.443: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17 Source.444: DFBPPR3394 ---- Plant proteins ---- Auxin-responsive protein IAA7 Source.445: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7 Source.446: DFBPPR3400 ---- Plant proteins ---- Auxin-responsive protein IAA12 Source.447: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c Source.448: DFBPPR3404 ---- Plant proteins ---- Auxin-responsive protein IAA3 Source.449: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1 Source.450: DFBPPR3411 ---- Plant proteins ---- Auxin-responsive protein IAA15 Source.451: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.452: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.453: DFBPPR3430 ---- Plant proteins ---- Dehydrin DHN1 Source.454: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2 Source.455: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2 Source.456: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.457: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.458: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6 Source.459: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76 Source.460: DFBPPR3485 ---- Plant proteins ---- Auxin-responsive protein IAA31 Source.461: DFBPPR3494 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS32 Source.462: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic Source.463: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.464: DFBPPR3518 ---- Plant proteins ---- Thioredoxin-like 3-3 Source.465: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1 Source.466: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56 Source.467: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2 Source.468: DFBPPR3530 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL2 Source.469: DFBPPR3542 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 2 Source.470: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5 Source.471: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8 Source.472: DFBPPR3570 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-1 Source.473: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.474: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5 Source.475: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog Source.476: DFBPPR3581 ---- Plant proteins ---- Auxin-responsive protein IAA17 Source.477: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.478: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.479: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase Source.480: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20 Source.481: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K Source.482: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.483: DFBPPR3634 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-2 Source.484: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic Source.485: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2 Source.486: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.487: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29 Source.488: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.489: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F Source.490: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9 Source.491: DFBPPR3681 ---- Plant proteins ---- Transcription factor JAMYB Source.492: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5 Source.493: DFBPPR3695 ---- Plant proteins ---- Auxin-responsive protein IAA23 Source.494: DFBPPR3732 ---- Plant proteins ---- CASP-like protein 5A1 Source.495: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8 Source.496: DFBPPR3745 ---- Plant proteins ---- Protein FERTILITY RESTORER RF2, mitochondrial Source.497: DFBPPR3754 ---- Plant proteins ---- Auxin-responsive protein IAA30 Source.498: DFBPPR3760 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic Source.499: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog Source.500: DFBPPR3763 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.501: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2 Source.502: DFBPPR3782 ---- Plant proteins ---- Auxin-responsive protein IAA16 Source.503: DFBPPR3789 ---- Plant proteins ---- Succinate dehydrogenase subunit 5, mitochondrial Source.504: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.505: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12 Source.506: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C Source.507: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.508: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2 Source.509: DFBPPR3849 ---- Plant proteins ---- Auxin-responsive protein IAA13 Source.510: DFBPPR3860 ---- Plant proteins ---- Probable protein phosphatase 2C 62 Source.511: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13 Source.512: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1 Source.513: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1 Source.514: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13 Source.515: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5 Source.516: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial Source.517: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5 Source.518: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2 Source.519: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.520: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3 Source.521: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2 Source.522: DFBPPR3945 ---- Plant proteins ---- Myb-related protein MYBAS1 Source.523: DFBPPR3962 ---- Plant proteins ---- Myb-related protein MYBAS2 Source.524: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.525: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3 Source.526: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.527: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C Source.528: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5 Source.529: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.530: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic Source.531: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25 Source.532: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B Source.533: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4 Source.534: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.535: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2 Source.536: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400 Source.537: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C Source.538: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22 Source.539: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15 Source.540: DFBPPR4140 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3, chloroplastic Source.541: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2 Source.542: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.543: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.544: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3 Source.545: DFBPPR4168 ---- Plant proteins ---- Protein FERTILITY RESTORER RF2, mitochondrial Source.546: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1 Source.547: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18 Source.548: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3 Source.549: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.550: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4 Source.551: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1 Source.552: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1 Source.553: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4 Source.554: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5 Source.555: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic Source.556: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1 Source.557: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.558: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900 Source.559: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.560: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3 Source.561: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4 Source.562: DFBPPR4292 ---- Plant proteins ---- Double-stranded RNA-binding protein 3 Source.563: DFBPPR4293 ---- Plant proteins ---- Double-stranded RNA-binding protein 7 Source.564: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16 Source.565: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog Source.566: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.567: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5 Source.568: DFBPPR4351 ---- Plant proteins ---- Dehydrin Rab25 Source.569: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2 Source.570: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10 Source.571: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.572: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4 Source.573: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E Source.574: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic Source.575: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4 Source.576: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53 Source.577: DFBPPR4416 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 4 Source.578: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.579: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.580: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4 Source.581: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6 Source.582: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6 Source.583: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.584: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45 Source.585: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.586: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1 Source.587: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.588: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2 Source.589: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.590: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.591: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.592: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1 Source.593: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2 Source.594: DFBPPR4508 ---- Plant proteins ---- Photosystem II stability/assembly factor HCF136, chloroplastic Source.595: DFBPPR4530 ---- Plant proteins ---- Water stress-inducible protein Rab21 Source.596: DFBPPR4532 ---- Plant proteins ---- CASP-like protein 1U2 Source.597: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A Source.598: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.599: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.600: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.601: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12 Source.602: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.603: DFBPPR4561 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 5 Source.604: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.605: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13 Source.606: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65 Source.607: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5 Source.608: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520 Source.609: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4 Source.610: DFBPPR4620 ---- Plant proteins ---- Protein LOL1 Source.611: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700 Source.612: DFBPPR4639 ---- Plant proteins ---- CASP-like protein 4D1 Source.613: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900 Source.614: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7 Source.615: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000 Source.616: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800 Source.617: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B Source.618: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24 Source.619: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3 Source.620: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1 Source.621: DFBPPR4680 ---- Plant proteins ---- Dehydrin Rab16B Source.622: DFBPPR4686 ---- Plant proteins ---- Dehydrin Rab16C Source.623: DFBPPR4687 ---- Plant proteins ---- Dehydrin Rab16D Source.624: DFBPPR4691 ---- Plant proteins ---- Probable protein ABIL3 Source.625: DFBPPR4699 ---- Plant proteins ---- Probable GTP-binding protein OBGC2 Source.626: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32 Source.627: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51 Source.628: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5 Source.629: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.630: DFBPPR4729 ---- Plant proteins ---- Protein PLASTID REDOX INSENSITIVE 2, chloroplastic Source.631: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600 Source.632: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.633: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400 Source.634: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1 Source.635: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11 Source.636: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57 Source.637: DFBPPR4792 ---- Plant proteins ---- B3 domain-containing protein Os03g0212300 Source.638: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900 Source.639: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55 Source.640: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47 Source.641: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20 Source.642: DFBPPR4842 ---- Plant proteins ---- B3 domain-containing protein Os06g0194400 Source.643: DFBPPR4843 ---- Plant proteins ---- Putative ripening-related protein 2 Source.644: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5 Source.645: DFBPPR4850 ---- Plant proteins ---- Putative ripening-related protein 1 Source.646: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64 Source.647: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.648: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3 Source.649: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10 Source.650: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic Source.651: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.652: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2 Source.653: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.654: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A Source.655: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A Source.656: DFBPPR4978 ---- Plant proteins ---- 2-hydroxyisoflavanone dehydratase Source.657: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1 Source.658: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase Source.659: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.660: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase Source.661: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase Source.662: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.663: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.664: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1 Source.665: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase Source.666: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic Source.667: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.668: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2 Source.669: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme Source.670: DFBPPR5091 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.671: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic Source.672: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580 Source.673: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.674: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.675: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1 Source.676: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2 Source.677: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.678: DFBPPR5222 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic Source.679: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase Source.680: DFBPPR5232 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.681: DFBPPR5250 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic Source.682: DFBPPR5271 ---- Plant proteins ---- Auxin-induced protein AUX28 Source.683: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic Source.684: DFBPPR5292 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic Source.685: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.686: DFBPPR5311 ---- Plant proteins ---- Nodulin-20 Source.687: DFBPPR5332 ---- Plant proteins ---- Nodulin-20a Source.688: DFBPPR5364 ---- Plant proteins ---- Auxin-induced protein X10A Source.689: DFBPPR5365 ---- Plant proteins ---- Auxin-induced protein 6B Source.690: DFBPPR5366 ---- Plant proteins ---- Auxin-induced protein 15A Source.691: DFBPPR5367 ---- Plant proteins ---- Auxin-induced protein X15 Source.692: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic Source.693: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.694: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic Source.695: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.696: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.697: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic Source.698: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein Source.699: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.700: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.701: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH] Source.702: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic Source.703: DFBPPR5499 ---- Plant proteins ---- Dehydrin DHN1 Source.704: DFBPPR5500 ---- Plant proteins ---- Trypsin/factor XIIA inhibitor Source.705: DFBPPR5505 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme Source.706: DFBPPR5531 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.707: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.708: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.709: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.710: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.711: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3 Source.712: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.713: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.714: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.715: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.716: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic Source.717: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1 Source.718: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.719: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.720: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.721: DFBPPR5638 ---- Plant proteins ---- Histone H2B.5 Source.722: DFBPPR5639 ---- Plant proteins ---- Histone H2B.1 Source.723: DFBPPR5640 ---- Plant proteins ---- Histone H2B.4 Source.724: DFBPPR5641 ---- Plant proteins ---- Histone H2B.2 Source.725: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1 Source.726: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.727: DFBPPR5656 ---- Plant proteins ---- Histone H2B.3 Source.728: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1 Source.729: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1 Source.730: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.731: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic Source.732: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2 Source.733: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3 Source.734: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.735: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.736: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3 Source.737: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4 Source.738: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.739: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1 Source.740: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2 Source.741: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2 Source.742: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic Source.743: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.744: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele Source.745: DFBPPR5790 ---- Plant proteins ---- Benzoate O-methyltransferase Source.746: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic Source.747: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.748: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.749: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.750: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.751: DFBPPR5822 ---- Plant proteins ---- Elongation factor 1-alpha Source.752: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.753: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.754: DFBPPR5838 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.755: DFBPPR5839 ---- Plant proteins ---- Protein PLASTID REDOX INSENSITIVE 2, chloroplastic Source.756: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.757: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.758: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.759: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.760: DFBPPR5860 ---- Plant proteins ---- Myb-related protein P Source.761: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase Source.762: DFBPPR5865 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial Source.763: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein Source.764: DFBPPR5884 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.765: DFBPPR5892 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic Source.766: DFBPPR5893 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-1, chloroplastic Source.767: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.768: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein Source.769: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.770: DFBPPR5955 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-2, chloroplastic Source.771: DFBPPR5962 ---- Plant proteins ---- Protein RIK Source.772: DFBPPR5974 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic Source.773: DFBPPR5981 ---- Plant proteins ---- 17.8 kDa class II heat shock protein Source.774: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3 Source.775: DFBPPR5991 ---- Plant proteins ---- Myb-related protein Zm38 Source.776: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1 Source.777: DFBPPR5994 ---- Plant proteins ---- 17.5 kDa class II heat shock protein Source.778: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1 Source.779: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.780: DFBPPR6028 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic Source.781: DFBPPR6059 ---- Plant proteins ---- Homeobox protein knotted-1-like 2 Source.782: DFBPPR6060 ---- Plant proteins ---- Homeobox protein knotted-1-like 6 Source.783: DFBPPR6061 ---- Plant proteins ---- Homeobox protein knotted-1-like 1 Source.784: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1 Source.785: DFBPPR6064 ---- Plant proteins ---- Homeobox protein knotted-1-like 7 Source.786: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2 Source.787: DFBPPR6072 ---- Plant proteins ---- CASP-like protein 5A2 Source.788: DFBPPR6075 ---- Plant proteins ---- MFS18 protein Source.789: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.790: DFBPPR6098 ---- Plant proteins ---- CASP-like protein 5A1 Source.791: DFBPPR6099 ---- Plant proteins ---- CASP-like protein 16 Source.792: DFBPPR6138 ---- Plant proteins ---- Anther-specific protein MZm3-3 Source.793: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.794: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.795: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.796: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.797: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.798: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.799: DFBPPR6246 ---- Plant proteins ---- Histone H2B Source.800: DFBPPR6249 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.801: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic Source.802: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic Source.803: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic Source.804: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.805: DFBPPR6277 ---- Plant proteins ---- Leghemoglobin-1 Source.806: DFBPPR6282 ---- Plant proteins ---- Rhicadhesin receptor Source.807: DFBPPR6286 ---- Plant proteins ---- Endochitinase A2 Source.808: DFBPPR6290 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.809: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.810: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.811: DFBPPR6310 ---- Plant proteins ---- Catalase Source.812: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase Source.813: DFBPPR6374 ---- Plant proteins ---- 18.1 kDa class I heat shock protein Source.814: DFBPPR6386 ---- Plant proteins ---- ATP synthase subunit delta', mitochondrial Source.815: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.816: DFBPPR6389 ---- Plant proteins ---- Auxin-induced protein IAA4 Source.817: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A Source.818: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.819: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme Source.820: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B Source.821: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.822: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha Source.823: DFBPPR6469 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.824: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic Source.825: DFBPPR6477 ---- Plant proteins ---- 50S ribosomal protein L15, chloroplastic Source.826: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic Source.827: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2 Source.828: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.829: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2 Source.830: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.831: DFBPPR6534 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic Source.832: DFBPPR6545 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.833: DFBPPR6547 ---- Plant proteins ---- Non-specific lipid-transfer protein 3 Source.834: DFBPPR6548 ---- Plant proteins ---- Dehydrin DHN1 Source.835: DFBPPR6559 ---- Plant proteins ---- Truncated basic helix-loop-helix protein A Source.836: DFBPPR6576 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3 Source.837: DFBPPR6577 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3 Source.838: DFBPPR6620 ---- Plant proteins ---- Dehydrin DHN2 Source.839: DFBPPR6621 ---- Plant proteins ---- Dehydrin DHN3 Source.840: DFBPPR6626 ---- Plant proteins ---- Alpha-amylase inhibitor 0.28 Source.841: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.842: DFBPPR6642 ---- Plant proteins ---- Peroxidase Source.843: DFBPPR6660 ---- Plant proteins ---- Histone H2B.2 Source.844: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.845: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.846: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.847: DFBPPR6681 ---- Plant proteins ---- Histone H2B.4 Source.848: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3 Source.849: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1 Source.850: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic Source.851: DFBPPR6704 ---- Plant proteins ---- Histone H2B.1 Source.852: DFBPPR6706 ---- Plant proteins ---- Adenine phosphoribosyltransferase 1 Source.853: DFBPPR6711 ---- Plant proteins ---- Histone H2B.5 Source.854: DFBPPR6712 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM16 Source.855: DFBPPR6714 ---- Plant proteins ---- Histone H2B.3 Source.856: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3 Source.857: DFBPPR6717 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM3 Source.858: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2 Source.859: DFBPPR6727 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.860: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.861: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53 Source.862: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase Source.863: DFBPPR6749 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic Source.864: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic Source.865: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3 Source.866: DFBPPR6761 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM1 Source.867: DFBPPR6762 ---- Plant proteins ---- Nuclear ribonuclease Z Source.868: DFBPPR6769 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1 Source.869: DFBPPR6773 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2 Source.870: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.871: DFBPPR6776 ---- Plant proteins ---- Alpha-amylase inhibitor WDAI-3 Source.872: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A Source.873: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a Source.874: DFBPPR6793 ---- Plant proteins ---- Chymotrypsin inhibitor WCI Source.875: DFBPPR6794 ---- Plant proteins ---- Elongation factor 1-alpha Source.876: DFBPPR6801 ---- Plant proteins ---- Peroxidase Source.877: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.878: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B Source.879: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B Source.880: DFBPPR6829 ---- Plant proteins ---- Cold-shock protein CS120 Source.881: DFBPPR6832 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial Source.882: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2 Source.883: DFBPPR6843 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.884: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A Source.885: DFBPPR6848 ---- Plant proteins ---- Cold shock protein CS66 Source.886: DFBPPR6866 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic Source.887: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.888: DFBPPR6869 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.889: DFBPPR6874 ---- Plant proteins ---- Dehydrin COR410 Source.890: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.891: DFBPPR6893 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic Source.892: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.893: DFBPPR6921 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic Source.894: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2 Source.895: DFBPPR6962 ---- Plant proteins ---- Dehydrin Rab15 Source.896: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1 Source.897: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3 Source.898: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3 Source.899: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.900: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.901: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase Source.902: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1 Source.903: DFBPPR7031 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMb Source.904: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic Source.905: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.906: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.907: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd Source.908: DFBPPR7053 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMa Source.909: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.910: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.911: DFBPPR7071 ---- Plant proteins ---- Serpin-Z4 Source.912: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase Source.913: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.914: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.915: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.916: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.917: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1 Source.918: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2 Source.919: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial Source.920: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3 Source.921: DFBPPR7135 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.922: DFBPPR7155 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.923: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase Source.924: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3 Source.925: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic Source.926: DFBPPR7178 ---- Plant proteins ---- Elongation factor 1-alpha Source.927: DFBPPR7189 ---- Plant proteins ---- Trypsin inhibitor CMc Source.928: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha Source.929: DFBPPR7191 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.930: DFBPPR7192 ---- Plant proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.931: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.932: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.933: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.934: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase Source.935: DFBPPR7232 ---- Plant proteins ---- 30S ribosomal protein S12, chloroplastic Source.936: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase Source.937: DFBPPR7250 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic Source.938: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic Source.939: DFBPPR7269 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic Source.940: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.941: DFBPPR7286 ---- Plant proteins ---- Myb-related protein Hv1 Source.942: DFBPPR7287 ---- Plant proteins ---- Dehydrin DHN3 Source.943: DFBPPR7288 ---- Plant proteins ---- Dehydrin DHN4 Source.944: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33 Source.945: DFBPPR7295 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic Source.946: DFBPPR7323 ---- Plant proteins ---- Antifungal protein R Source.947: DFBPPR7330 ---- Plant proteins ---- Dehydrin DHN1 Source.948: DFBPPR7331 ---- Plant proteins ---- Dehydrin DHN2 Source.949: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20 Source.950: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic Source.951: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.952: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.953: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412 Source.954: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405 Source.955: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.956: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic Source.957: DFBPPR7481 ---- Plant proteins ---- Ribosomal protein S12, mitochondrial Source.958: DFBPPR7488 ---- Plant proteins ---- Homeobox protein HD1 Source.959: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1 Source.960: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase Source.961: DFBPPR7518 ---- Plant proteins ---- Agamous-like MADS-box protein AGL15 Source.962: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.963: DFBPPR7533 ---- Plant proteins ---- Tapetum-specific protein A9 Source.964: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase Source.965: DFBPPR7610 ---- Milk proteins ---- Immunoglobulin heavy constant alpha 2 Source.966: DFBPPR7611 ---- Milk proteins ---- Clusterin Source.967: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.968: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1 Source.969: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51 Source.970: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2 Source.971: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.972: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1 Source.973: DFBPPR7649 ---- Milk proteins ---- Cadherin-1 Source.974: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.975: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51 Source.976: DFBPPR7666 ---- Milk proteins ---- Whey acidic protein Source.977: DFBPPR7672 ---- Milk proteins ---- Beta-lactoglobulin-1 Source.978: DFBPPR7674 ---- Milk proteins ---- Beta-lactoglobulin-2 Source.979: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.980: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.981: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.982: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5 Source.983: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase Source.984: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta Source.985: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH] Source.986: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal Source.987: DFBPPR8193 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMW33 Source.988: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101 Source.989: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.990: DFBPPR8373 ---- Plant proteins ---- Non-specific lipid-transfer protein Source.991: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.992: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3 Source.993: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2 Source.994: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1 Source.995: DFBPPR8420 ---- Plant proteins ---- Peroxygenase Source.996: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.997: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.998: DFBPPR8438 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.999: DFBPPR8440 ---- Plant proteins ---- Non-specific lipid-transfer protein 4 Source.1000: DFBPPR8441 ---- Plant proteins ---- Non-specific lipid-transfer protein 6 Source.1001: DFBPPR8442 ---- Plant proteins ---- Non-specific lipid-transfer protein 5 Source.1002: DFBPPR8443 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.1003: DFBPPR8444 ---- Plant proteins ---- Non-specific lipid-transfer protein 3 Source.1004: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase Source.1005: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.1006: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1 Source.1007: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3 Source.1008: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2 Source.1009: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.1010: DFBPPR15952 ---- Animal proteins ---- Galectin-3 Source.1011: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.1012: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.1013: DFBPPR15958 ---- Animal proteins ---- Myosin-9 Source.1014: DFBPPR15963 ---- Animal proteins ---- Cadherin-1 Source.1015: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.1016: DFBPPR15974 ---- Animal proteins ---- Androgen receptor Source.1017: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8 Source.1018: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1 Source.1019: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.1020: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1021: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2 Source.1022: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.1023: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.1024: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1025: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36 Source.1026: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV Source.1027: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.1028: DFBPPR16024 ---- Animal proteins ---- Podocalyxin Source.1029: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.1030: DFBPPR16030 ---- Animal proteins ---- E3 ubiquitin-protein ligase Mdm2 Source.1031: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1032: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor Source.1033: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.1034: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.1035: DFBPPR16064 ---- Animal proteins ---- Calnexin Source.1036: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1 Source.1037: DFBPPR16075 ---- Animal proteins ---- Hematopoietic progenitor cell antigen CD34 Source.1038: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein Source.1039: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.1040: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2 Source.1041: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2 Source.1042: DFBPPR16094 ---- Animal proteins ---- Mastin Source.1043: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1 Source.1044: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1045: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2 Source.1046: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain Source.1047: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4 Source.1048: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.1049: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.1050: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR Source.1051: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1052: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase Source.1053: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1 Source.1054: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.1055: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.1056: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1 Source.1057: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2 Source.1058: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1059: DFBPPR16189 ---- Animal proteins ---- Albumin Source.1060: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.1061: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.1062: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1 Source.1063: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.1064: DFBPPR16240 ---- Animal proteins ---- Fibronectin Source.1065: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta Source.1066: DFBPPR16246 ---- Animal proteins ---- Hemoglobin subunit alpha Source.1067: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.1068: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a Source.1069: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1 Source.1070: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4 Source.1071: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha Source.1072: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1 Source.1073: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin Source.1074: DFBPPR16279 ---- Animal proteins ---- Galactokinase Source.1075: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68 Source.1076: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.1077: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21 Source.1078: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.1079: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41 Source.1080: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.1081: DFBPPR16327 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.1082: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.1083: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein Source.1084: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.1085: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.1086: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain Source.1087: DFBPPR16439 ---- Animal proteins ---- Lutropin subunit beta Source.1088: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6 Source.1089: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain Source.1090: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.1091: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin Source.1092: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.1093: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII Source.1094: DFBPPR16503 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase Source.1095: DFBPPR16517 ---- Animal proteins ---- Cholinesterase Source.1096: DFBPPR16520 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C Source.1097: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator Source.1098: DFBPPR16524 ---- Animal proteins ---- Suppressor of cytokine signaling 3 Source.1099: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.1100: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2 Source.1101: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.1102: DFBPPR16558 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC Source.1103: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1104: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3 Source.1105: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2 Source.1106: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.1107: DFBPPR16643 ---- Animal proteins ---- Ribosomal protein L18 Source.1108: DFBPPR16663 ---- Animal proteins ---- Involucrin Source.1109: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.1110: DFBPPR16695 ---- Animal proteins ---- UDP-galactose translocator Source.1111: DFBPPR16704 ---- Animal proteins ---- Retbindin Source.1112: DFBPPR16708 ---- Animal proteins ---- Transmembrane protein 190 Source.1113: DFBPPR16714 ---- Animal proteins ---- Protein fosB Source.1114: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2 Source.1115: DFBPPR16759 ---- Animal proteins ---- Ig mu chain C region Source.1116: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase Source.1117: DFBPPR16789 ---- Animal proteins ---- Feather keratin B-4 Source.1118: DFBPPR16791 ---- Animal proteins ---- Feather keratin Cos2-3 Source.1119: DFBPPR16792 ---- Animal proteins ---- Feather keratin Cos1-1/Cos1-3/Cos2-1 Source.1120: DFBPPR16793 ---- Animal proteins ---- Feather keratin Cos2-2 Source.1121: DFBPPR16794 ---- Animal proteins ---- Feather keratin Cos1-2 Source.1122: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1 Source.1123: DFBPPR16814 ---- Animal proteins ---- Prothrombin Source.1124: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.1125: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1 Source.1126: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.1127: DFBPPR16840 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.1128: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.1129: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial Source.1130: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial Source.1131: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6 Source.1132: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.1133: DFBPPR16862 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 Source.1134: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B Source.1135: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase Source.1136: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor Source.1137: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII Source.1138: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase Source.1139: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV Source.1140: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.1141: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.1142: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1143: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic Source.1144: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A Source.1145: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.1146: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.1147: DFBPPR16974 ---- Animal proteins ---- Natriuretic peptides A Source.1148: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6 Source.1149: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3 Source.1150: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.1151: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1 Source.1152: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.1153: DFBPPR17005 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5 Source.1154: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial Source.1155: DFBPPR17010 ---- Animal proteins ---- Sestrin-2 Source.1156: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial Source.1157: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter Source.1158: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.1159: DFBPPR17036 ---- Animal proteins ---- Parkinson disease protein 7 homolog Source.1160: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.1161: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2 Source.1162: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type Source.1163: DFBPPR17045 ---- Animal proteins ---- Oxysterols receptor LXR-beta Source.1164: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1165: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase Source.1166: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.1167: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.1168: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2 Source.1169: DFBPPR17080 ---- Animal proteins ---- Presenilin-2 Source.1170: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.1171: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1 Source.1172: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.1173: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.1174: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7 Source.1175: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1 Source.1176: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.1177: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain Source.1178: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.1179: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.1180: DFBPPR17193 ---- Animal proteins ---- Oxysterols receptor LXR-alpha Source.1181: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6 Source.1182: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial Source.1183: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.1184: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.1185: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase Source.1186: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1 Source.1187: DFBPPR17272 ---- Animal proteins ---- Dysbindin Source.1188: DFBPPR17279 ---- Animal proteins ---- Stimulator of interferon genes protein Source.1189: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1190: DFBPPR17296 ---- Animal proteins ---- Dynamin-2 Source.1191: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein Source.1192: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1 Source.1193: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2 Source.1194: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7 Source.1195: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase Source.1196: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II Source.1197: DFBPPR17327 ---- Animal proteins ---- Myotubularin Source.1198: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.1199: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112 Source.1200: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal Source.1201: DFBPPR17349 ---- Animal proteins ---- Sialidase-3 Source.1202: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N Source.1203: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.1204: DFBPPR17361 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2 Source.1205: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3 Source.1206: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1 Source.1207: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase Source.1208: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1 Source.1209: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial Source.1210: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36 Source.1211: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD Source.1212: DFBPPR17399 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C Source.1213: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.1214: DFBPPR17409 ---- Animal proteins ---- Geranylgeranyl pyrophosphate synthase Source.1215: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2 Source.1216: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1 Source.1217: DFBPPR17425 ---- Animal proteins ---- Dynamin-1 Source.1218: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit Source.1219: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.1220: DFBPPR17468 ---- Animal proteins ---- Hemoglobin subunit alpha Source.1221: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.1222: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2 Source.1223: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.1224: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase Source.1225: DFBPPR17501 ---- Animal proteins ---- C-C chemokine receptor type 5 Source.1226: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform Source.1227: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.1228: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1 Source.1229: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.1230: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6 Source.1231: DFBPPR17541 ---- Animal proteins ---- Sorting nexin-3 Source.1232: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5 Source.1233: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A Source.1234: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4 Source.1235: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.1236: DFBPPR17580 ---- Animal proteins ---- Insulin-like growth factor-binding protein 5 Source.1237: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1238: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.1239: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1240: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2 Source.1241: DFBPPR17626 ---- Animal proteins ---- Elastin Source.1242: DFBPPR17635 ---- Animal proteins ---- Frataxin, mitochondrial Source.1243: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.1244: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase Source.1245: DFBPPR17713 ---- Animal proteins ---- Urokinase plasminogen activator surface receptor Source.1246: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.1247: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.1248: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.1249: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.1250: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V Source.1251: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3 Source.1252: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase Source.1253: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1 Source.1254: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.1255: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6 Source.1256: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase Source.1257: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase Source.1258: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.1259: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1 Source.1260: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B Source.1261: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.1262: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.1263: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.1264: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.1265: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.1266: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1 Source.1267: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.1268: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.1269: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial Source.1270: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.1271: DFBPPR17918 ---- Animal proteins ---- Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial Source.1272: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1 Source.1273: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter Source.1274: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1 Source.1275: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2 Source.1276: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate Source.1277: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.1278: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1 Source.1279: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.1280: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12 Source.1281: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase Source.1282: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase Source.1283: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase Source.1284: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta Source.1285: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.1286: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10 Source.1287: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase Source.1288: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17 Source.1289: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase Source.1290: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5 Source.1291: DFBPPR18021 ---- Animal proteins ---- Lutropin subunit beta Source.1292: DFBPPR18029 ---- Animal proteins ---- Collagen alpha-3(IV) chain Source.1293: DFBPPR18036 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 6 Source.1294: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.1295: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6 Source.1296: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1 Source.1297: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.1298: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12 Source.1299: DFBPPR18061 ---- Animal proteins ---- Glutathione S-transferase Mu 1 Source.1300: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.1301: DFBPPR18069 ---- Animal proteins ---- Glypican-1 Source.1302: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.1303: DFBPPR18079 ---- Animal proteins ---- DNA polymerase beta Source.1304: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1 Source.1305: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1 Source.1306: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33 Source.1307: DFBPPR18106 ---- Animal proteins ---- Natriuretic peptides B Source.1308: DFBPPR18110 ---- Animal proteins ---- Protein inturned Source.1309: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38 Source.1310: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein Source.1311: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha Source.1312: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7 Source.1313: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1 Source.1314: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44 Source.1315: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1 Source.1316: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII Source.1317: DFBPPR18170 ---- Animal proteins ---- Histone H2B type 1 Source.1318: DFBPPR18191 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-2 Source.1319: DFBPPR18201 ---- Animal proteins ---- Histone H2B type 1-K Source.1320: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter Source.1321: DFBPPR18216 ---- Animal proteins ---- Collectin-12 Source.1322: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8 Source.1323: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40 Source.1324: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.1325: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi Source.1326: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.1327: DFBPPR18252 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.1328: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.1329: DFBPPR18256 ---- Animal proteins ---- Proteasome subunit beta type-10 Source.1330: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.1331: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial Source.1332: DFBPPR18290 ---- Animal proteins ---- Cyclin-dependent kinase 10 Source.1333: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7 Source.1334: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase Source.1335: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.1336: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.1337: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5 Source.1338: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3 Source.1339: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1 Source.1340: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.1341: DFBPPR18403 ---- Animal proteins ---- Complement C1q subcomponent subunit A Source.1342: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10 Source.1343: DFBPPR18406 ---- Animal proteins ---- Angiotensinogen Source.1344: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain Source.1345: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor Source.1346: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6 Source.1347: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1 Source.1348: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor Source.1349: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.1350: DFBPPR18433 ---- Animal proteins ---- Basigin Source.1351: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1 Source.1352: DFBPPR18451 ---- Animal proteins ---- Suppressor of cytokine signaling 3 Source.1353: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22 Source.1354: DFBPPR18466 ---- Animal proteins ---- Retinoic acid receptor responder protein 2 Source.1355: DFBPPR18473 ---- Animal proteins ---- Sharpin Source.1356: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein Source.1357: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1 Source.1358: DFBPPR18485 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.1359: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein Source.1360: DFBPPR18503 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10, mitochondrial Source.1361: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.1362: DFBPPR18510 ---- Animal proteins ---- Myogenic factor 5 Source.1363: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent Source.1364: DFBPPR18516 ---- Animal proteins ---- Galactokinase Source.1365: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B Source.1366: DFBPPR18536 ---- Animal proteins ---- Plastin-1 Source.1367: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.1368: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase Source.1369: DFBPPR18545 ---- Animal proteins ---- Transcriptional adapter 2-alpha Source.1370: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1 Source.1371: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A Source.1372: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3 Source.1373: DFBPPR18568 ---- Animal proteins ---- Cdc42 effector protein 2 Source.1374: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.1375: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.1376: DFBPPR18588 ---- Animal proteins ---- CD166 antigen Source.1377: DFBPPR18603 ---- Animal proteins ---- Sodium channel subunit beta-4 Source.1378: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.1379: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3 Source.1380: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.1381: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.1382: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.1383: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.1384: DFBPPR18686 ---- Animal proteins ---- Intraflagellar transport protein 27 homolog Source.1385: DFBPPR18702 ---- Animal proteins ---- E3 ubiquitin-protein ligase E3D Source.1386: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4 Source.1387: DFBPPR18721 ---- Animal proteins ---- Histone H2B type 1-N Source.1388: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.1389: DFBPPR18726 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF2 Source.1390: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3 Source.1391: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.1392: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9 Source.1393: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4 Source.1394: DFBPPR18793 ---- Animal proteins ---- BPI fold-containing family A member 1 Source.1395: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8 Source.1396: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog Source.1397: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1 Source.1398: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3 Source.1399: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.1400: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.1401: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6 Source.1402: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor Source.1403: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A Source.1404: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.1405: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain Source.1406: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A Source.1407: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.1408: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.1409: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.1410: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6 Source.1411: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic Source.1412: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2 Source.1413: DFBPPR18898 ---- Animal proteins ---- Complexin-3 Source.1414: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase Source.1415: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial Source.1416: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Source.1417: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4 Source.1418: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3 Source.1419: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5 Source.1420: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.1421: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.1422: DFBPPR18925 ---- Animal proteins ---- Neurochondrin Source.1423: DFBPPR18931 ---- Animal proteins ---- Ficolin-2 Source.1424: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B Source.1425: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6 Source.1426: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2 Source.1427: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 Source.1428: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb Source.1429: DFBPPR18983 ---- Animal proteins ---- Endothelial protein C receptor Source.1430: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.1431: DFBPPR19006 ---- Animal proteins ---- Thymidine kinase, cytosolic Source.1432: DFBPPR19016 ---- Animal proteins ---- Arginase-2, mitochondrial Source.1433: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2 Source.1434: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5 Source.1435: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1 Source.1436: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3 Source.1437: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain Source.1438: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9 Source.1439: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2 Source.1440: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.1441: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.1442: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5 Source.1443: DFBPPR19073 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 21 Source.1444: DFBPPR19079 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.1445: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1 Source.1446: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1 Source.1447: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase Source.1448: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.1449: DFBPPR19107 ---- Animal proteins ---- Lymphocyte transmembrane adapter 1 Source.1450: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2 Source.1451: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain Source.1452: DFBPPR19126 ---- Animal proteins ---- Calpain small subunit 1 Source.1453: DFBPPR19128 ---- Animal proteins ---- Spermadhesin-1 Source.1454: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1 Source.1455: DFBPPR19139 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-2 Source.1456: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial Source.1457: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase Source.1458: DFBPPR19162 ---- Animal proteins ---- Macrophage-capping protein Source.1459: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.1460: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3 Source.1461: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14 Source.1462: DFBPPR19172 ---- Animal proteins ---- Persulfide dioxygenase ETHE1, mitochondrial Source.1463: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase Source.1464: DFBPPR19209 ---- Animal proteins ---- mRNA export factor Source.1465: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.1466: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase Source.1467: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A Source.1468: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog Source.1469: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha Source.1470: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1 Source.1471: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128 Source.1472: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.1473: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Source.1474: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase Source.1475: DFBPPR19246 ---- Animal proteins ---- Elongation factor 1-alpha 2 Source.1476: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.1477: DFBPPR19253 ---- Animal proteins ---- Limbin Source.1478: DFBPPR19254 ---- Animal proteins ---- Periaxin Source.1479: DFBPPR19269 ---- Animal proteins ---- HCLS1-associated protein X-1 Source.1480: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2 Source.1481: DFBPPR19277 ---- Animal proteins ---- Prolactin-releasing peptide Source.1482: DFBPPR19299 ---- Animal proteins ---- Annexin A7 Source.1483: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1 Source.1484: DFBPPR19332 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.1485: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase Source.1486: DFBPPR19337 ---- Animal proteins ---- CMRF35-like molecule 9 Source.1487: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.1488: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.1489: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein Source.1490: DFBPPR19435 ---- Animal proteins ---- Interferon alpha-D Source.1491: DFBPPR19442 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit G Source.1492: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase Source.1493: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.1494: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2 Source.1495: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2 Source.1496: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.1497: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase Source.1498: DFBPPR19469 ---- Animal proteins ---- Cholinesterase Source.1499: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.1500: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain Source.1501: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.1502: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.1503: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4 Source.1504: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial Source.1505: DFBPPR19500 ---- Animal proteins ---- Complement C2 Source.1506: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase Source.1507: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2 Source.1508: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A Source.1509: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic Source.1510: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.1511: DFBPPR19538 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial Source.1512: DFBPPR19557 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3 Source.1513: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9 Source.1514: DFBPPR19559 ---- Animal proteins ---- CCN family member 2 Source.1515: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2 Source.1516: DFBPPR19565 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 4 Source.1517: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein Source.1518: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7 Source.1519: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2 Source.1520: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2 Source.1521: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1 Source.1522: DFBPPR19585 ---- Animal proteins ---- Interferon alpha-1 Source.1523: DFBPPR19599 ---- Animal proteins ---- Thrombomodulin Source.1524: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein Source.1525: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.1526: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1 Source.1527: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial Source.1528: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.1529: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2 Source.1530: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3 Source.1531: DFBPPR19678 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 5 Source.1532: DFBPPR19681 ---- Animal proteins ---- Fibroleukin Source.1533: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2 Source.1534: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor Source.1535: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.1536: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10 Source.1537: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205 Source.1538: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.1539: DFBPPR19745 ---- Animal proteins ---- Collectin-46 Source.1540: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3 Source.1541: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase Source.1542: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.1543: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma Source.1544: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A Source.1545: DFBPPR19785 ---- Animal proteins ---- Calcyclin-binding protein Source.1546: DFBPPR19787 ---- Animal proteins ---- 60S ribosomal protein L11 Source.1547: DFBPPR19788 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.1548: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1 Source.1549: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.1550: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog Source.1551: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5 Source.1552: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial Source.1553: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase Source.1554: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3 Source.1555: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.1556: DFBPPR19870 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta Source.1557: DFBPPR19875 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 26A Source.1558: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial Source.1559: DFBPPR19916 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1 Source.1560: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.1561: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial Source.1562: DFBPPR19930 ---- Animal proteins ---- F-box only protein 6 Source.1563: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2 Source.1564: DFBPPR19935 ---- Animal proteins ---- Reticulon-3 Source.1565: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1 Source.1566: DFBPPR19959 ---- Animal proteins ---- Complement C1q subcomponent subunit B Source.1567: DFBPPR19966 ---- Animal proteins ---- 28S ribosomal protein S15, mitochondrial Source.1568: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2 Source.1569: DFBPPR19969 ---- Animal proteins ---- Growth/differentiation factor 10 Source.1570: DFBPPR19973 ---- Animal proteins ---- Plastin-3 Source.1571: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.1572: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20 Source.1573: DFBPPR19993 ---- Animal proteins ---- MRN complex-interacting protein Source.1574: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein Source.1575: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer Source.1576: DFBPPR20007 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETMAR Source.1577: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1 Source.1578: DFBPPR20021 ---- Animal proteins ---- Neugrin Source.1579: DFBPPR20022 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit Source.1580: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.1581: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.1582: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1 Source.1583: DFBPPR20047 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 11B Source.1584: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase Source.1585: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein Source.1586: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.1587: DFBPPR20072 ---- Animal proteins ---- Adenine phosphoribosyltransferase Source.1588: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1 Source.1589: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93 Source.1590: DFBPPR20090 ---- Animal proteins ---- Cytochrome P450 2A Source.1591: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25 Source.1592: DFBPPR20143 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C Source.1593: DFBPPR20154 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 6, mitochondrial Source.1594: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2 Source.1595: DFBPPR20186 ---- Animal proteins ---- Transmembrane protein 98 Source.1596: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.1597: DFBPPR20196 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 4 Source.1598: DFBPPR20210 ---- Animal proteins ---- Exonuclease V Source.1599: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2 Source.1600: DFBPPR20228 ---- Animal proteins ---- Keratin, type II cytoskeletal 7 Source.1601: DFBPPR20248 ---- Animal proteins ---- Ras-related protein Rab-28 Source.1602: DFBPPR20249 ---- Animal proteins ---- Ras-related protein Rab-30 Source.1603: DFBPPR20261 ---- Animal proteins ---- Protein SCO1 homolog, mitochondrial Source.1604: DFBPPR20262 ---- Animal proteins ---- DNA-directed RNA polymerase I subunit RPA12 Source.1605: DFBPPR20263 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 54 Source.1606: DFBPPR20273 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT14 Source.1607: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial Source.1608: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1 Source.1609: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2 Source.1610: DFBPPR20282 ---- Animal proteins ---- SOSS complex subunit B2 Source.1611: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158 Source.1612: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein Source.1613: DFBPPR20297 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4 Source.1614: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator Source.1615: DFBPPR20307 ---- Animal proteins ---- Ras-related protein Rab-6B Source.1616: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel Source.1617: DFBPPR20325 ---- Animal proteins ---- 28S ribosomal protein S12, mitochondrial Source.1618: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27 Source.1619: DFBPPR20336 ---- Animal proteins ---- 39S ribosomal protein L22, mitochondrial Source.1620: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3 Source.1621: DFBPPR20344 ---- Animal proteins ---- Dynactin subunit 2 Source.1622: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein Source.1623: DFBPPR20357 ---- Animal proteins ---- Snurportin-1 Source.1624: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1 Source.1625: DFBPPR20369 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 1 Source.1626: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56 Source.1627: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog Source.1628: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6 Source.1629: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7 Source.1630: DFBPPR20392 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1 Source.1631: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.1632: DFBPPR20399 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC4 Source.1633: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1634: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.1635: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile Source.1636: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2 Source.1637: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.1638: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1 Source.1639: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10 Source.1640: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2 Source.1641: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6 Source.1642: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161 Source.1643: DFBPPR20508 ---- Animal proteins ---- Aurora kinase A and ninein-interacting protein Source.1644: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42 Source.1645: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1 Source.1646: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230 Source.1647: DFBPPR20558 ---- Animal proteins ---- N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase Source.1648: DFBPPR20560 ---- Animal proteins ---- Draxin Source.1649: DFBPPR20567 ---- Animal proteins ---- Prokineticin-2 Source.1650: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4 Source.1651: DFBPPR20578 ---- Animal proteins ---- Protein rogdi homolog Source.1652: DFBPPR20590 ---- Animal proteins ---- POU domain class 2-associating factor 1 Source.1653: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.1654: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13 Source.1655: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10 Source.1656: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2 Source.1657: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.1658: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2 Source.1659: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1 Source.1660: DFBPPR20626 ---- Animal proteins ---- Melanocortin receptor 5 Source.1661: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1 Source.1662: DFBPPR20637 ---- Animal proteins ---- Mitochondrial mRNA pseudouridine synthase RPUSD3 Source.1663: DFBPPR20648 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM22 homolog Source.1664: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C Source.1665: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.1666: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9 Source.1667: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.1668: DFBPPR20702 ---- Animal proteins ---- 5-azacytidine-induced protein 2 Source.1669: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2 Source.1670: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial Source.1671: DFBPPR20723 ---- Animal proteins ---- Histamine N-methyltransferase Source.1672: DFBPPR20724 ---- Animal proteins ---- Exportin-2 Source.1673: DFBPPR20726 ---- Animal proteins ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72 Source.1674: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase Source.1675: DFBPPR20735 ---- Animal proteins ---- Microtubule-associated tumor suppressor 1 homolog Source.1676: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206 Source.1677: DFBPPR20748 ---- Animal proteins ---- Protein ABHD14B Source.1678: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2 Source.1679: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1 Source.1680: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha Source.1681: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2 Source.1682: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1 Source.1683: DFBPPR20823 ---- Animal proteins ---- Ubiquitin-related modifier 1 Source.1684: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog Source.1685: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog Source.1686: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.1687: DFBPPR20854 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.1688: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial Source.1689: DFBPPR20878 ---- Animal proteins ---- Protein SMG9 Source.1690: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein Source.1691: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta Source.1692: DFBPPR20930 ---- Animal proteins ---- Centromere protein U Source.1693: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4 Source.1694: DFBPPR20960 ---- Animal proteins ---- Complexin-1 Source.1695: DFBPPR20963 ---- Animal proteins ---- Protein kintoun Source.1696: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5 Source.1697: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.1698: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like Source.1699: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1 Source.1700: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase Source.1701: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2 Source.1702: DFBPPR21020 ---- Animal proteins ---- 60S ribosomal protein L18 Source.1703: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog Source.1704: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28 Source.1705: DFBPPR21074 ---- Animal proteins ---- Cancer-related nucleoside-triphosphatase homolog Source.1706: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial Source.1707: DFBPPR21087 ---- Animal proteins ---- Claudin-11 Source.1708: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1 Source.1709: DFBPPR21100 ---- Animal proteins ---- Cochlin Source.1710: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.1711: DFBPPR21134 ---- Animal proteins ---- Cell division cycle-associated protein 7 Source.1712: DFBPPR21135 ---- Animal proteins ---- Vesicle transport protein GOT1B Source.1713: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22 Source.1714: DFBPPR21164 ---- Animal proteins ---- Probable cytosolic iron-sulfur protein assembly protein CIAO1 Source.1715: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial Source.1716: DFBPPR21173 ---- Animal proteins ---- Sorting nexin-11 Source.1717: DFBPPR21183 ---- Animal proteins ---- LIM and cysteine-rich domains protein 1 Source.1718: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1 Source.1719: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1 Source.1720: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231 Source.1721: DFBPPR21244 ---- Animal proteins ---- RELT-like protein 1 Source.1722: DFBPPR21258 ---- Animal proteins ---- Insulin-like growth factor-binding protein 6 Source.1723: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1 Source.1724: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase Source.1725: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11 Source.1726: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1 Source.1727: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B Source.1728: DFBPPR21290 ---- Animal proteins ---- Metaxin-1 Source.1729: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1 Source.1730: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115 Source.1731: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial Source.1732: DFBPPR21346 ---- Animal proteins ---- Ameloblastin Source.1733: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter Source.1734: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3 Source.1735: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.1736: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1 Source.1737: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2 Source.1738: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A Source.1739: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1 Source.1740: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2 Source.1741: DFBPPR21421 ---- Animal proteins ---- Protein SMG8 Source.1742: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15 Source.1743: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2 Source.1744: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8 Source.1745: DFBPPR21446 ---- Animal proteins ---- Spermatid-specific manchette-related protein 1 Source.1746: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase Source.1747: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.1748: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein Source.1749: DFBPPR21474 ---- Animal proteins ---- m-AAA protease-interacting protein 1, mitochondrial Source.1750: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.1751: DFBPPR21485 ---- Animal proteins ---- Proline-rich protein 14 Source.1752: DFBPPR21486 ---- Animal proteins ---- Caspase recruitment domain-containing protein 19 Source.1753: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4 Source.1754: DFBPPR21491 ---- Animal proteins ---- CUE domain-containing protein 2 Source.1755: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase Source.1756: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1 Source.1757: DFBPPR21523 ---- Animal proteins ---- tRNA 2'-phosphotransferase 1 Source.1758: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2 Source.1759: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2 Source.1760: DFBPPR21548 ---- Animal proteins ---- Cornifelin Source.1761: DFBPPR21555 ---- Animal proteins ---- Zinc finger and SCAN domain-containing protein 26 Source.1762: DFBPPR21559 ---- Animal proteins ---- C-type lectin domain family 3 member A Source.1763: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3 Source.1764: DFBPPR21565 ---- Animal proteins ---- Insulin-like growth factor-binding protein-like 1 Source.1765: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.1766: DFBPPR21570 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40B Source.1767: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A Source.1768: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase Source.1769: DFBPPR21599 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC Source.1770: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1 Source.1771: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.1772: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3 Source.1773: DFBPPR21623 ---- Animal proteins ---- Notchless protein homolog 1 Source.1774: DFBPPR21624 ---- Animal proteins ---- Docking protein 1 Source.1775: DFBPPR21641 ---- Animal proteins ---- U5 small nuclear ribonucleoprotein 40 kDa protein Source.1776: DFBPPR21648 ---- Animal proteins ---- Keratin, type I cytoskeletal 26 Source.1777: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10 Source.1778: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1 Source.1779: DFBPPR21681 ---- Animal proteins ---- Protein FAM110A Source.1780: DFBPPR21683 ---- Animal proteins ---- Serine protease 23 Source.1781: DFBPPR21697 ---- Animal proteins ---- UDP-galactose translocator Source.1782: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.1783: DFBPPR21711 ---- Animal proteins ---- Hydrolethalus syndrome protein 1 homolog Source.1784: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.1785: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2 Source.1786: DFBPPR21720 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein Source.1787: DFBPPR21722 ---- Animal proteins ---- Protein DDI1 homolog 1 Source.1788: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10 Source.1789: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase Source.1790: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D Source.1791: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.1792: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.1793: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2 Source.1794: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.1795: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.1796: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A Source.1797: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2 Source.1798: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1 Source.1799: DFBPPR21848 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 39 Source.1800: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5 Source.1801: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2 Source.1802: DFBPPR21864 ---- Animal proteins ---- Arpin Source.1803: DFBPPR21868 ---- Animal proteins ---- RAB6-interacting golgin Source.1804: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor Source.1805: DFBPPR21895 ---- Animal proteins ---- Epithelial membrane protein 3 Source.1806: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1 Source.1807: DFBPPR21897 ---- Animal proteins ---- ZW10 interactor Source.1808: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1 Source.1809: DFBPPR21903 ---- Animal proteins ---- Inactive serine protease 35 Source.1810: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein Source.1811: DFBPPR21920 ---- Animal proteins ---- Protein DPCD Source.1812: DFBPPR21923 ---- Animal proteins ---- Endophilin-B2 Source.1813: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11 Source.1814: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2 Source.1815: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1 Source.1816: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor Source.1817: DFBPPR21961 ---- Animal proteins ---- P3 protein Source.1818: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10 Source.1819: DFBPPR21968 ---- Animal proteins ---- F-box only protein 28 Source.1820: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A Source.1821: DFBPPR21984 ---- Animal proteins ---- Leucine-rich repeat-containing protein 10 Source.1822: DFBPPR21992 ---- Animal proteins ---- Intraflagellar transport-associated protein Source.1823: DFBPPR21998 ---- Animal proteins ---- Putative monooxygenase p33MONOX Source.1824: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog Source.1825: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog Source.1826: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4 Source.1827: DFBPPR22018 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.1828: DFBPPR22028 ---- Animal proteins ---- Endonuclease/exonuclease/phosphatase family domain-containing protein 1 Source.1829: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4 Source.1830: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.1831: DFBPPR22037 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2 Source.1832: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2 Source.1833: DFBPPR22048 ---- Animal proteins ---- Regulated endocrine-specific protein 18 Source.1834: DFBPPR22054 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4 Source.1835: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma Source.1836: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1 Source.1837: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1 Source.1838: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5 Source.1839: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9 Source.1840: DFBPPR22082 ---- Animal proteins ---- Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 2 protein Source.1841: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1 Source.1842: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like Source.1843: DFBPPR22097 ---- Animal proteins ---- Ester hydrolase C11orf54 homolog Source.1844: DFBPPR22100 ---- Animal proteins ---- Centromere protein M Source.1845: DFBPPR22116 ---- Animal proteins ---- CB1 cannabinoid receptor-interacting protein 1 Source.1846: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A Source.1847: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2 Source.1848: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1 Source.1849: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48 Source.1850: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2 Source.1851: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41 Source.1852: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein Source.1853: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1 Source.1854: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11 Source.1855: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.1856: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.1857: DFBPPR22191 ---- Animal proteins ---- Heat shock protein beta-3 Source.1858: DFBPPR22193 ---- Animal proteins ---- CapZ-interacting protein Source.1859: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2 Source.1860: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.1861: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2 Source.1862: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1 Source.1863: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1 Source.1864: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.1865: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5 Source.1866: DFBPPR22238 ---- Animal proteins ---- StAR-related lipid transfer protein 5 Source.1867: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3 Source.1868: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog Source.1869: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B Source.1870: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2 Source.1871: DFBPPR22304 ---- Animal proteins ---- Small integral membrane protein 14 Source.1872: DFBPPR22334 ---- Animal proteins ---- Protein HP-25 homolog 1 Source.1873: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2 Source.1874: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2 Source.1875: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1 Source.1876: DFBPPR22345 ---- Animal proteins ---- Small muscular protein Source.1877: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein Source.1878: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1 Source.1879: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1 Source.1880: DFBPPR22386 ---- Animal proteins ---- DPY30 domain-containing protein 2 Source.1881: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10 Source.1882: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog Source.1883: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B Source.1884: DFBPPR22434 ---- Animal proteins ---- UPF0692 protein C19orf54 homolog Source.1885: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein Source.1886: DFBPPR22441 ---- Animal proteins ---- Isochorismatase domain-containing protein 2 Source.1887: DFBPPR22446 ---- Animal proteins ---- Tektin-5 Source.1888: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2 Source.1889: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9 Source.1890: DFBPPR22454 ---- Animal proteins ---- R3H domain-containing protein 4 Source.1891: DFBPPR22457 ---- Animal proteins ---- Cilia- and flagella-associated protein 97 Source.1892: DFBPPR22460 ---- Animal proteins ---- Coiled-coil domain-containing protein 149 Source.1893: DFBPPR22466 ---- Animal proteins ---- Transcription factor BTF3 homolog 4 Source.1894: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1 Source.1895: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3 Source.1896: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144 Source.1897: DFBPPR22493 ---- Animal proteins ---- PC-esterase domain-containing protein 1B Source.1898: DFBPPR22497 ---- Animal proteins ---- Enkurin domain-containing protein 1 Source.1899: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2 Source.1900: DFBPPR22505 ---- Animal proteins ---- Protein HP-20 homolog Source.1901: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101 Source.1902: DFBPPR22536 ---- Animal proteins ---- Suprabasin Source.1903: DFBPPR22545 ---- Animal proteins ---- Protein FAM214B Source.1904: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1 Source.1905: DFBPPR22559 ---- Animal proteins ---- Vimentin-type intermediate filament-associated coiled-coil protein Source.1906: DFBPPR22569 ---- Animal proteins ---- Testis-expressed sequence 37 protein Source.1907: DFBPPR22581 ---- Animal proteins ---- UPF0690 protein C1orf52 homolog Source.1908: DFBPPR22588 ---- Animal proteins ---- Uncharacterized protein C1orf198 homolog Source.1909: DFBPPR22593 ---- Animal proteins ---- UPF0688 protein C1orf174 homolog Source.1910: DFBPPR22595 ---- Animal proteins ---- Transmembrane protein 268 Source.1911: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13 Source.1912: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4 Source.1913: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215 Source.1914: DFBPPR22614 ---- Animal proteins ---- Protein FAM81B Source.1915: DFBPPR22616 ---- Animal proteins ---- Jhy protein homolog Source.1916: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42 Source.1917: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72 Source.1918: DFBPPR22627 ---- Animal proteins ---- Leucine-rich repeat-containing protein 61 Source.1919: DFBPPR22637 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 61 Source.1920: DFBPPR22643 ---- Animal proteins ---- Coiled-coil domain-containing protein 157 Source.1921: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog Source.1922: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32 Source.1923: DFBPPR22667 ---- Animal proteins ---- Uncharacterized protein C17orf78 homolog Source.1924: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein Source.1925: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog Source.1926: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1 Source.1927: DFBPPR22690 ---- Animal proteins ---- Proline-rich protein 19 Source.1928: DFBPPR22699 ---- Animal proteins ---- LYR motif-containing protein 9 Source.1929: DFBPPR22709 ---- Animal proteins ---- PIH1 domain-containing protein 2 Source.1930: DFBPPR22726 ---- Animal proteins ---- Uncharacterized protein C16orf90 homolog Source.1931: DFBPPR22735 ---- Animal proteins ---- NEDD4-binding protein 2-like 1 Source.1932: DFBPPR22742 ---- Animal proteins ---- Uncharacterized protein C12orf71 homolog Source.1933: DFBPPR22751 ---- Animal proteins ---- Uncharacterized protein C8orf74 homolog Source.1934: DFBPPR22755 ---- Animal proteins ---- Uncharacterized protein C11orf86 homolog Source.1935: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial Source.1936: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.1937: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase Source.1938: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.1939: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2 Source.1940: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.1941: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6 Source.1942: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.1943: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.1944: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.1945: DFBPPR8577 ---- Animal proteins ---- Nectin-1 Source.1946: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.1947: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.1948: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial Source.1949: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha Source.1950: DFBPPR8606 ---- Animal proteins ---- Stimulator of interferon genes protein Source.1951: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B Source.1952: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.1953: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein Source.1954: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.1955: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.1956: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.1957: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3 Source.1958: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1959: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4 Source.1960: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.1961: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Source.1962: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.1963: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.1964: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1965: DFBPPR8691 ---- Animal proteins ---- Presenilin-2 Source.1966: DFBPPR8700 ---- Animal proteins ---- Endoglin Source.1967: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C Source.1968: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.1969: DFBPPR8710 ---- Animal proteins ---- Leptin receptor Source.1970: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial Source.1971: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.1972: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.1973: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6 Source.1974: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase Source.1975: DFBPPR8723 ---- Animal proteins ---- Platelet factor 4 Source.1976: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.1977: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.1978: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1 Source.1979: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.1980: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.1981: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.1982: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.1983: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2 Source.1984: DFBPPR8753 ---- Animal proteins ---- Androgen receptor Source.1985: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.1986: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.1987: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.1988: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.1989: DFBPPR8797 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta Source.1990: DFBPPR8811 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial Source.1991: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.1992: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.1993: DFBPPR8859 ---- Animal proteins ---- Interleukin-1 alpha Source.1994: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.1995: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.1996: DFBPPR8879 ---- Animal proteins ---- Glandular kallikrein Source.1997: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial Source.1998: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor Source.1999: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1 Source.2000: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.2001: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.2002: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.2003: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.2004: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.2005: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.2006: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.2007: DFBPPR8966 ---- Animal proteins ---- Calpain small subunit 1 Source.2008: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B Source.2009: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.2010: DFBPPR8972 ---- Animal proteins ---- Lutropin subunit beta Source.2011: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.2012: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.2013: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein Source.2014: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.2015: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.2016: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain Source.2017: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain Source.2018: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain Source.2019: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.2020: DFBPPR9017 ---- Animal proteins ---- Mannose-binding protein C Source.2021: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta Source.2022: DFBPPR9055 ---- Animal proteins ---- Ameloblastin Source.2023: DFBPPR9062 ---- Animal proteins ---- Methylsterol monooxygenase 1 Source.2024: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.2025: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.2026: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta Source.2027: DFBPPR9092 ---- Animal proteins ---- Galanin peptides Source.2028: DFBPPR9109 ---- Animal proteins ---- Natriuretic peptides B Source.2029: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.2030: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.2031: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A Source.2032: DFBPPR9157 ---- Animal proteins ---- POU domain, class 2, transcription factor 2 Source.2033: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein Source.2034: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.2035: DFBPPR9174 ---- Animal proteins ---- Ficolin-1 Source.2036: DFBPPR9178 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 3 Source.2037: DFBPPR9179 ---- Animal proteins ---- Hemoglobin subunit alpha Source.2038: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.2039: DFBPPR9204 ---- Animal proteins ---- T-cell surface glycoprotein CD1a Source.2040: DFBPPR9205 ---- Animal proteins ---- Pulmonary surfactant-associated protein D Source.2041: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4 Source.2042: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII Source.2043: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII Source.2044: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.2045: DFBPPR9226 ---- Animal proteins ---- Protein GPR15L Source.2046: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.2047: DFBPPR9235 ---- Animal proteins ---- Apomucin Source.2048: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 Source.2049: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog Source.2050: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3 Source.2051: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase Source.2052: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent Source.2053: DFBPPR9276 ---- Animal proteins ---- Type I iodothyronine deiodinase Source.2054: DFBPPR9286 ---- Animal proteins ---- BPI fold-containing family A member 1 Source.2055: DFBPPR9298 ---- Animal proteins ---- Melanocortin receptor 4 Source.2056: DFBPPR9306 ---- Animal proteins ---- Complement component C7 Source.2057: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.2058: DFBPPR9323 ---- Animal proteins ---- Lymphotoxin-alpha Source.2059: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2 Source.2060: DFBPPR9348 ---- Animal proteins ---- 60S ribosomal protein L18 Source.2061: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.2062: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1 Source.2063: DFBPPR9391 ---- Animal proteins ---- 60S ribosomal protein L11 Source.2064: DFBPPR9392 ---- Animal proteins ---- mRNA export factor Source.2065: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2 Source.2066: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50 Source.2067: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.2068: DFBPPR9461 ---- Animal proteins ---- CCN family member 2 Source.2069: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1 Source.2070: DFBPPR9501 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.2071: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.2072: DFBPPR9508 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4 Source.2073: DFBPPR9511 ---- Animal proteins ---- Cholinesterase Source.2074: DFBPPR9515 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.2075: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6 Source.2076: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase Source.2077: DFBPPR9554 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit Source.2078: DFBPPR9557 ---- Animal proteins ---- Complement C1q subcomponent subunit A Source.2079: DFBPPR9572 ---- Animal proteins ---- Nuclear transition protein 2 Source.2080: DFBPPR9575 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1 Source.2081: DFBPPR9601 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial Source.2082: DFBPPR9617 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.2083: DFBPPR9624 ---- Animal proteins ---- Cadherin-3 Source.2084: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.2085: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor Source.2086: DFBPPR9653 ---- Animal proteins ---- Carbohydrate-binding protein AQN-1 Source.2087: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial Source.2088: DFBPPR9658 ---- Animal proteins ---- Melanocortin receptor 5 Source.2089: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1 Source.2090: DFBPPR9672 ---- Animal proteins ---- Elongation factor 1-beta Source.2091: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase Source.2092: DFBPPR9685 ---- Animal proteins ---- Interleukin-27 subunit alpha Source.2093: DFBPPR9693 ---- Animal proteins ---- LIM and cysteine-rich domains protein 1 Source.2094: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.2095: DFBPPR9736 ---- Animal proteins ---- Metaxin-1 Source.2096: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.2097: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial Source.2098: DFBPPR9795 ---- Animal proteins ---- Insulin-like growth factor-binding protein 5 Source.2099: DFBPPR9842 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1 Source.2100: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6 Source.2101: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.2102: DFBPPR9867 ---- Animal proteins ---- Phostensin Source.2103: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.2104: DFBPPR9877 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4 Source.2105: DFBPPR9898 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Source.2106: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.2107: DFBPPR9923 ---- Animal proteins ---- Small muscular protein Source.2108: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor Source.2109: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.2110: DFBPPR9964 ---- Animal proteins ---- Histone H2B 1/2/3/4/6 Source.2111: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.2112: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput Source.2113: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.2114: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.2115: DFBPPR9993 ---- Animal proteins ---- Ovalbumin Source.2116: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.2117: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx Source.2118: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2 Source.2119: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.2120: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.2121: DFBPPR10028 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta Source.2122: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.2123: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.2124: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A Source.2125: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta Source.2126: DFBPPR10052 ---- Animal proteins ---- Protein Wnt-11 Source.2127: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2128: DFBPPR10083 ---- Animal proteins ---- Myosin-9 Source.2129: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial Source.2130: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.2131: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2 Source.2132: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.2133: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3 Source.2134: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3 Source.2135: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3 Source.2136: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.2137: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.2138: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.2139: DFBPPR10154 ---- Animal proteins ---- Glutathione S-transferase 2 Source.2140: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog Source.2141: DFBPPR10160 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.2142: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial Source.2143: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos Source.2144: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.2145: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha Source.2146: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.2147: DFBPPR10184 ---- Animal proteins ---- LIM/homeobox protein Lhx1 Source.2148: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia Source.2149: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3 Source.2150: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.2151: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.2152: DFBPPR10202 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.2153: DFBPPR10203 ---- Animal proteins ---- Protein/nucleic acid deglycase DJ-1 Source.2154: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.2155: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2 Source.2156: DFBPPR10223 ---- Animal proteins ---- Retinoic acid receptor alpha Source.2157: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7 Source.2158: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6 Source.2159: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.2160: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5 Source.2161: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3 Source.2162: DFBPPR10264 ---- Animal proteins ---- Fibroblast growth factor 1 Source.2163: DFBPPR10267 ---- Animal proteins ---- Gephyrin Source.2164: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2 Source.2165: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.2166: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs Source.2167: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.2168: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.2169: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2 Source.2170: DFBPPR10306 ---- Animal proteins ---- D-erythrulose reductase Source.2171: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta Source.2172: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.2173: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.2174: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1 Source.2175: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.2176: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.2177: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2 Source.2178: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel Source.2179: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type Source.2180: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.2181: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2 Source.2182: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.2183: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65 Source.2184: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.2185: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf Source.2186: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1 Source.2187: DFBPPR10408 ---- Animal proteins ---- Beta-galactoside-binding lectin Source.2188: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.2189: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.2190: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog Source.2191: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.2192: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2 Source.2193: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial Source.2194: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.2195: DFBPPR10447 ---- Animal proteins ---- Plastin-1 Source.2196: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3 Source.2197: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4 Source.2198: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.2199: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.2200: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1 Source.2201: DFBPPR10469 ---- Animal proteins ---- Histone H2B 5 Source.2202: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.2203: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21 Source.2204: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1 Source.2205: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2 Source.2206: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6 Source.2207: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1 Source.2208: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.2209: DFBPPR10510 ---- Animal proteins ---- Histone H2B 8 Source.2210: DFBPPR10511 ---- Animal proteins ---- Vitellogenin-3 Source.2211: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.2212: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.2213: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1 Source.2214: DFBPPR10541 ---- Animal proteins ---- Glypican-1 Source.2215: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.2216: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1 Source.2217: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.2218: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial Source.2219: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase Source.2220: DFBPPR10586 ---- Animal proteins ---- Troponin I, fast skeletal muscle Source.2221: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.2222: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6 Source.2223: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A Source.2224: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.2225: DFBPPR10605 ---- Animal proteins ---- Elastin Source.2226: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain Source.2227: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM Source.2228: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit Source.2229: DFBPPR10654 ---- Animal proteins ---- Fibronectin Source.2230: DFBPPR10662 ---- Animal proteins ---- CCN family member 3 Source.2231: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase Source.2232: DFBPPR10665 ---- Animal proteins ---- Mitochondrial fission regulator 1 Source.2233: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.2234: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3 Source.2235: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.2236: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb Source.2237: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.2238: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Source.2239: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.2240: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2 Source.2241: DFBPPR10703 ---- Animal proteins ---- Tensin Source.2242: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2 Source.2243: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1 Source.2244: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase Source.2245: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.2246: DFBPPR10733 ---- Animal proteins ---- Ras-related protein Rab-6A Source.2247: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3 Source.2248: DFBPPR10755 ---- Animal proteins ---- Draxin Source.2249: DFBPPR10769 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.2250: DFBPPR10770 ---- Animal proteins ---- Mannose-binding protein Source.2251: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain Source.2252: DFBPPR10788 ---- Animal proteins ---- D-aminoacyl-tRNA deacylase 2 Source.2253: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1 Source.2254: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase Source.2255: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12 Source.2256: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain Source.2257: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.2258: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain Source.2259: DFBPPR10825 ---- Animal proteins ---- Collagen alpha-3(IX) chain Source.2260: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.2261: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3 Source.2262: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.2263: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26 Source.2264: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase Source.2265: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.2266: DFBPPR10878 ---- Animal proteins ---- Zinc finger protein DPF3 Source.2267: DFBPPR10884 ---- Animal proteins ---- Tapasin Source.2268: DFBPPR10891 ---- Animal proteins ---- Hepatocyte nuclear factor 1-alpha Source.2269: DFBPPR10892 ---- Animal proteins ---- Myogenic factor 5 Source.2270: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11 Source.2271: DFBPPR10906 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF152 Source.2272: DFBPPR10917 ---- Animal proteins ---- Ribonuclease UK114 Source.2273: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1 Source.2274: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.2275: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.2276: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2 Source.2277: DFBPPR10952 ---- Animal proteins ---- Protein XRP2 Source.2278: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.2279: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2 Source.2280: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1 Source.2281: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo Source.2282: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2 Source.2283: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.2284: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase Source.2285: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2 Source.2286: DFBPPR10991 ---- Animal proteins ---- Neurogenic differentiation factor 1 Source.2287: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.2288: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.2289: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.2290: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3 Source.2291: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.2292: DFBPPR11012 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6 Source.2293: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.2294: DFBPPR11017 ---- Animal proteins ---- Collectin-12 Source.2295: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.2296: DFBPPR11032 ---- Animal proteins ---- B-cadherin Source.2297: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.2298: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.2299: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6 Source.2300: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5 Source.2301: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein Source.2302: DFBPPR11073 ---- Animal proteins ---- Axin-1 Source.2303: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1 Source.2304: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A Source.2305: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.2306: DFBPPR11118 ---- Animal proteins ---- Filensin Source.2307: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta Source.2308: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit Source.2309: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.2310: DFBPPR11146 ---- Animal proteins ---- Formin Source.2311: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B Source.2312: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2 Source.2313: DFBPPR11176 ---- Animal proteins ---- Zinc finger protein Gfi-1b Source.2314: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase Source.2315: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22 Source.2316: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3 Source.2317: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.2318: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha Source.2319: DFBPPR11213 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13 Source.2320: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.2321: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.2322: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1 Source.2323: DFBPPR11245 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein Source.2324: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2 Source.2325: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.2326: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1 Source.2327: DFBPPR11260 ---- Animal proteins ---- ADP-ribosylation factor-like protein 8A Source.2328: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.2329: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4 Source.2330: DFBPPR11274 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3 Source.2331: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin Source.2332: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1 Source.2333: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein Source.2334: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5 Source.2335: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1 Source.2336: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4 Source.2337: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8 Source.2338: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.2339: DFBPPR11355 ---- Animal proteins ---- Collectin-10 Source.2340: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2 Source.2341: DFBPPR11375 ---- Animal proteins ---- Transcription factor E2F1 Source.2342: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10 Source.2343: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3 Source.2344: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B Source.2345: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.2346: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1 Source.2347: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1 Source.2348: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.2349: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11 Source.2350: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4 Source.2351: DFBPPR11475 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-B Source.2352: DFBPPR11476 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2 Source.2353: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5 Source.2354: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9 Source.2355: DFBPPR11501 ---- Animal proteins ---- TIMELESS-interacting protein Source.2356: DFBPPR11514 ---- Animal proteins ---- Homeobox protein Hox-D11 Source.2357: DFBPPR11521 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1 Source.2358: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1 Source.2359: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A Source.2360: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2 Source.2361: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein Source.2362: DFBPPR11546 ---- Animal proteins ---- Transcriptional adapter 2-alpha Source.2363: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.2364: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase Source.2365: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2 Source.2366: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.2367: DFBPPR11590 ---- Animal proteins ---- Homeobox protein Hox-A2 Source.2368: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230 Source.2369: DFBPPR11597 ---- Animal proteins ---- Trypsin inhibitor ClTI-1 Source.2370: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.2371: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A Source.2372: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2 Source.2373: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3 Source.2374: DFBPPR11635 ---- Animal proteins ---- Cochlin Source.2375: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial Source.2376: DFBPPR11646 ---- Animal proteins ---- Frizzled-9 Source.2377: DFBPPR11647 ---- Animal proteins ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72 Source.2378: DFBPPR11670 ---- Animal proteins ---- Snurportin-1 Source.2379: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1 Source.2380: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog Source.2381: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit Source.2382: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.2383: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.2384: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1 Source.2385: DFBPPR11718 ---- Animal proteins ---- Homeobox protein Hox-C8 Source.2386: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D Source.2387: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta Source.2388: DFBPPR11756 ---- Animal proteins ---- Glutaredoxin-1 Source.2389: DFBPPR11768 ---- Animal proteins ---- Homeobox protein Hox-B1 Source.2390: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.2391: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2 Source.2392: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog Source.2393: DFBPPR11801 ---- Animal proteins ---- Homeobox protein SAX-1 Source.2394: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.2395: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2 Source.2396: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.2397: DFBPPR11874 ---- Animal proteins ---- Serum response factor Source.2398: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.2399: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1 Source.2400: DFBPPR11906 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 1 Source.2401: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.2402: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19 Source.2403: DFBPPR11919 ---- Animal proteins ---- Feather keratin 1 Source.2404: DFBPPR11923 ---- Animal proteins ---- Feather keratin 3 Source.2405: DFBPPR11924 ---- Animal proteins ---- Centromere protein P Source.2406: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2 Source.2407: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A Source.2408: DFBPPR11949 ---- Animal proteins ---- Spindle assembly abnormal protein 6 homolog Source.2409: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.2410: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2 Source.2411: DFBPPR11953 ---- Animal proteins ---- Protein NEL Source.2412: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.2413: DFBPPR11975 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein Source.2414: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4 Source.2415: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1 Source.2416: DFBPPR11997 ---- Animal proteins ---- Oligosaccharyltransferase complex subunit OSTC Source.2417: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a Source.2418: DFBPPR12007 ---- Animal proteins ---- Feather keratin 4 Source.2419: DFBPPR12010 ---- Animal proteins ---- Feather keratin 2 Source.2420: DFBPPR12014 ---- Animal proteins ---- Raftlin Source.2421: DFBPPR12019 ---- Animal proteins ---- Cobalamin trafficking protein CblD Source.2422: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29 Source.2423: DFBPPR12040 ---- Animal proteins ---- Neurochondrin Source.2424: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3 Source.2425: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2 Source.2426: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9 Source.2427: DFBPPR12065 ---- Animal proteins ---- Testin Source.2428: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7 Source.2429: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9 Source.2430: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein Source.2431: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2 Source.2432: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16 Source.2433: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like Source.2434: DFBPPR12096 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 4 Source.2435: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox Source.2436: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2 Source.2437: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10 Source.2438: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A Source.2439: DFBPPR12116 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.2440: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.2441: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19 Source.2442: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.2443: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6 Source.2444: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.2445: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.2446: DFBPPR12162 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2 Source.2447: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45 Source.2448: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog Source.2449: DFBPPR12177 ---- Animal proteins ---- Beta-keratin-related protein Source.2450: DFBPPR12188 ---- Animal proteins ---- Protein limb expression 1 Source.2451: DFBPPR12201 ---- Animal proteins ---- Protein lin-52 homolog Source.2452: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11 Source.2453: DFBPPR12220 ---- Animal proteins ---- Transcription factor BTF3 homolog 4 Source.2454: DFBPPR12225 ---- Animal proteins ---- Coiled-coil domain-containing protein 50 Source.2455: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68 Source.2456: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog Source.2457: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.2458: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.2459: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM Source.2460: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.2461: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2 Source.2462: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2 Source.2463: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.2464: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.2465: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.2466: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.2467: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2468: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.2469: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1 Source.2470: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.2471: DFBPPR12296 ---- Animal proteins ---- Neprilysin Source.2472: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type Source.2473: DFBPPR12315 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit Source.2474: DFBPPR12324 ---- Animal proteins ---- Androgen receptor Source.2475: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14 Source.2476: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.2477: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.2478: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain Source.2479: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein Source.2480: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.2481: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.2482: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform Source.2483: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.2484: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.2485: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1 Source.2486: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.2487: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.2488: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.2489: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.2490: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.2491: DFBPPR12431 ---- Animal proteins ---- Hemoglobin subunit alpha-1/2 Source.2492: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 Source.2493: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.2494: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.2495: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1 Source.2496: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.2497: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6 Source.2498: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type Source.2499: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase Source.2500: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7 Source.2501: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.2502: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.2503: DFBPPR12483 ---- Animal proteins ---- Elongation factor 1-alpha 2 Source.2504: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase Source.2505: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.2506: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase Source.2507: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4 Source.2508: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase Source.2509: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.2510: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.2511: DFBPPR12535 ---- Animal proteins ---- Troponin I, fast skeletal muscle Source.2512: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.2513: DFBPPR12545 ---- Animal proteins ---- Galectin-3 Source.2514: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.2515: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor Source.2516: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2 Source.2517: DFBPPR12567 ---- Animal proteins ---- Calpain small subunit 1 Source.2518: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.2519: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.2520: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11 Source.2521: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5 Source.2522: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.2523: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.2524: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.2525: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.2526: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12 Source.2527: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72 Source.2528: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.2529: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.2530: DFBPPR12708 ---- Animal proteins ---- Pulmonary surfactant-associated protein B Source.2531: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1 Source.2532: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16 Source.2533: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8 Source.2534: DFBPPR12731 ---- Animal proteins ---- Cholinesterase Source.2535: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1 Source.2536: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.2537: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14 Source.2538: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.2539: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.2540: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta Source.2541: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6 Source.2542: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial Source.2543: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15 Source.2544: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10 Source.2545: DFBPPR12805 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic Source.2546: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.2547: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.2548: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B Source.2549: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor Source.2550: DFBPPR12879 ---- Animal proteins ---- Endothelin-2 Source.2551: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1 Source.2552: DFBPPR12921 ---- Animal proteins ---- Cytochrome P450 2C30 Source.2553: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1 Source.2554: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.2555: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.2556: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1 Source.2557: DFBPPR12977 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.2558: DFBPPR12979 ---- Animal proteins ---- Lutropin subunit beta Source.2559: DFBPPR12983 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial Source.2560: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.2561: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D Source.2562: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter Source.2563: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter Source.2564: DFBPPR13053 ---- Animal proteins ---- G-protein coupled bile acid receptor 1 Source.2565: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.2566: DFBPPR13086 ---- Animal proteins ---- RING finger protein 207 Source.2567: DFBPPR13094 ---- Animal proteins ---- Atherin Source.2568: DFBPPR13096 ---- Animal proteins ---- Ig kappa chain V region 12F2 Source.2569: DFBPPR13140 ---- Animal proteins ---- Blastocyst protein 4 Source.2570: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.2571: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.2572: DFBPPR13170 ---- Animal proteins ---- Carbonic anhydrase 1 Source.2573: DFBPPR13188 ---- Animal proteins ---- E3 ubiquitin-protein ligase Mdm2 Source.2574: DFBPPR13199 ---- Animal proteins ---- Hemoglobin subunit alpha Source.2575: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.2576: DFBPPR13226 ---- Animal proteins ---- Lutropin/choriogonadotropin subunit beta Source.2577: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.2578: DFBPPR13233 ---- Animal proteins ---- Fibronectin Source.2579: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3 Source.2580: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2 Source.2581: DFBPPR13250 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3, truncated Source.2582: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.2583: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.2584: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a Source.2585: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.2586: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain Source.2587: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.2588: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1 Source.2589: DFBPPR13315 ---- Animal proteins ---- Ski oncogene Source.2590: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.2591: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.2592: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1 Source.2593: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.2594: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.2595: DFBPPR13468 ---- Animal proteins ---- Hemoglobin subunit alpha-1 Source.2596: DFBPPR13476 ---- Animal proteins ---- Hemoglobin subunit alpha-2 Source.2597: DFBPPR13513 ---- Animal proteins ---- Ubiquitin-related modifier 1 Source.2598: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.2599: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.2600: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein Source.2601: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36 Source.2602: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9 Source.2603: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.2604: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein Source.2605: DFBPPR13592 ---- Animal proteins ---- Natriuretic peptides A Source.2606: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.2607: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.2608: DFBPPR13609 ---- Animal proteins ---- Lutropin subunit beta Source.2609: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.2610: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.2611: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.2612: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6 Source.2613: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.2614: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2 Source.2615: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A Source.2616: DFBPPR13661 ---- Animal proteins ---- Hemoglobin subunit alpha-1/2 Source.2617: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40 Source.2618: DFBPPR13690 ---- Animal proteins ---- Angiotensinogen Source.2619: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III Source.2620: DFBPPR13701 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.2621: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.2622: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d Source.2623: DFBPPR13750 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, cytosolic Source.2624: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2 Source.2625: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin Source.2626: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.2627: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin Source.2628: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor Source.2629: DFBPPR13778 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4 Source.2630: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3 Source.2631: DFBPPR13791 ---- Animal proteins ---- Cholinesterase Source.2632: DFBPPR13794 ---- Animal proteins ---- Inhibin alpha chain Source.2633: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1 Source.2634: DFBPPR13828 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.2635: DFBPPR13836 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.2636: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.2637: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa Source.2638: DFBPPR13873 ---- Animal proteins ---- Mineralocorticoid receptor Source.2639: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.2640: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.2641: DFBPPR13892 ---- Animal proteins ---- Melanocortin receptor 5 Source.2642: DFBPPR13899 ---- Animal proteins ---- Natriuretic peptides B Source.2643: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor Source.2644: DFBPPR13917 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta Source.2645: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.2646: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.2647: DFBPPR14047 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A, mitochondrial Source.2648: DFBPPR14051 ---- Animal proteins ---- Pro-thyrotropin-releasing hormone Source.2649: DFBPPR14055 ---- Animal proteins ---- Insulin-like growth factor I, juvenile form Source.2650: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1 Source.2651: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.2652: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B Source.2653: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C Source.2654: DFBPPR14099 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88 Source.2655: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A Source.2656: DFBPPR14117 ---- Marine protein ---- Ferritin, middle subunit Source.2657: DFBPPR14120 ---- Marine protein ---- Thyrotropin subunit beta Source.2658: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.2659: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein Source.2660: DFBPPR14153 ---- Marine protein ---- Progonadoliberin-3 Source.2661: DFBPPR14166 ---- Marine protein ---- Draxin-A Source.2662: DFBPPR14175 ---- Marine protein ---- Draxin-B Source.2663: DFBPPR14186 ---- Marine protein ---- 60S ribosomal protein L18 Source.2664: DFBPPR14189 ---- Marine protein ---- Protein Flattop Source.2665: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein Source.2666: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein Source.2667: DFBPPR14215 ---- Marine protein ---- Protein SMG9 Source.2668: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1 Source.2669: DFBPPR14240 ---- Marine protein ---- Otolin-1 Source.2670: DFBPPR14248 ---- Marine protein ---- Gonadoliberin-3 Source.2671: DFBPPR14263 ---- Marine protein ---- ATP synthase subunit a Source.2672: DFBPPR14266 ---- Marine protein ---- Gonadotropin subunit beta-1 Source.2673: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase Source.2674: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2675: DFBPPR14344 ---- Marine protein ---- Probable molybdopterin-synthase adenylyltransferase Source.2676: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.2677: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic Source.2678: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha Source.2679: DFBPPR14430 ---- Marine protein ---- 30S ribosomal protein S12, chloroplastic Source.2680: DFBPPR14443 ---- Marine protein ---- 30S ribosomal protein S14, chloroplastic Source.2681: DFBPPR14486 ---- Marine protein ---- Putative transport permease ycf38 Source.2682: DFBPPR14508 ---- Marine protein ---- Uncharacterized tatC-like protein ycf43 Source.2683: DFBPPR14513 ---- Marine protein ---- Uncharacterized protein ycf19 Source.2684: DFBPPR14523 ---- Marine protein ---- Uncharacterized protein ycf56 Source.2685: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1 Source.2686: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3 Source.2687: DFBPPR14548 ---- Marine protein ---- Mineralocorticoid receptor Source.2688: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.2689: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor Source.2690: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.2691: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.2692: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.2693: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain Source.2694: DFBPPR14570 ---- Marine protein ---- Histone H2B Source.2695: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1 Source.2696: DFBPPR14581 ---- Marine protein ---- Interferon alpha/beta receptor 2 Source.2697: DFBPPR14587 ---- Marine protein ---- Thyrotropin subunit beta Source.2698: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible Source.2699: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2 Source.2700: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1 Source.2701: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.2702: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3 Source.2703: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain Source.2704: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88 Source.2705: DFBPPR14660 ---- Marine protein ---- Otolin-1 Source.2706: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II Source.2707: DFBPPR14686 ---- Marine protein ---- Cytochrome c oxidase subunit 6A, mitochondrial Source.2708: DFBPPR14697 ---- Marine protein ---- Progonadoliberin-3 Source.2709: DFBPPR14709 ---- Marine protein ---- Protein lin-52 homolog Source.2710: DFBPPR14716 ---- Marine protein ---- Secreted phosphoprotein 24 Source.2711: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.2712: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme Source.2713: DFBPPR14821 ---- Marine protein ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1 Source.2714: DFBPPR14860 ---- Marine protein ---- Thyrotropin subunit beta Source.2715: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20 Source.2716: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5 Source.2717: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1 Source.2718: DFBPPR14914 ---- Microorganism protein ---- Casein kinase I homolog RAG8 Source.2719: DFBPPR14916 ---- Microorganism protein ---- Putative lipase ATG15 Source.2720: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase Source.2721: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase Source.2722: DFBPPR14932 ---- Microorganism protein ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72 Source.2723: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1 Source.2724: DFBPPR14938 ---- Microorganism protein ---- Inosine triphosphate pyrophosphatase Source.2725: DFBPPR14952 ---- Microorganism protein ---- Histone H2B.1 Source.2726: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1 Source.2727: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27 Source.2728: DFBPPR14967 ---- Microorganism protein ---- Histone H2B.2 Source.2729: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.2730: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial Source.2731: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.2732: DFBPPR15013 ---- Microorganism protein ---- Inorganic pyrophosphatase Source.2733: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase Source.2734: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase Source.2735: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase Source.2736: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase Source.2737: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1 Source.2738: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial Source.2739: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4 Source.2740: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1 Source.2741: DFBPPR15090 ---- Microorganism protein ---- Transketolase Source.2742: DFBPPR15094 ---- Microorganism protein ---- Thioredoxin reductase, mitochondrial Source.2743: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase Source.2744: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10 Source.2745: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase Source.2746: DFBPPR15148 ---- Microorganism protein ---- Riboflavin kinase Source.2747: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.2748: DFBPPR15169 ---- Microorganism protein ---- Protein VTS1 Source.2749: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase Source.2750: DFBPPR15180 ---- Microorganism protein ---- Protein ROT1 Source.2751: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog Source.2752: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal Source.2753: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60 Source.2754: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1 Source.2755: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1 Source.2756: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7 Source.2757: DFBPPR15286 ---- Microorganism protein ---- Deoxyhypusine synthase Source.2758: DFBPPR15294 ---- Microorganism protein ---- Lactose permease Source.2759: DFBPPR15297 ---- Microorganism protein ---- Transcriptional activator HAP2 Source.2760: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1 Source.2761: DFBPPR15307 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 21 Source.2762: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1 Source.2763: DFBPPR15322 ---- Microorganism protein ---- Sorting nexin-3 Source.2764: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog Source.2765: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.2766: DFBPPR15432 ---- Microorganism protein ---- Pre-rRNA-processing protein ESF2 Source.2767: DFBPPR15447 ---- Microorganism protein ---- Genetic interactor of prohibitins 3, mitochondrial Source.2768: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase Source.2769: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1 Source.2770: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3 Source.2771: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2 Source.2772: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46 Source.2773: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1 Source.2774: DFBPPR15505 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC15 Source.2775: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase Source.2776: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6 Source.2777: DFBPPR15591 ---- Microorganism protein ---- Ras modification protein ERF4 Source.2778: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2 Source.2779: DFBPPR15629 ---- Microorganism protein ---- Transcription activator MSS11 Source.2780: DFBPPR15640 ---- Microorganism protein ---- SWI5-dependent HO expression protein 3 Source.2781: DFBPPR15663 ---- Microorganism protein ---- Spindle pole component BBP1 Source.2782: DFBPPR15686 ---- Microorganism protein ---- Polyadenylation factor subunit 2 Source.2783: DFBPPR15693 ---- Microorganism protein ---- Restriction of telomere capping protein 4 Source.2784: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22 Source.2785: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2 Source.2786: DFBPPR15738 ---- Microorganism protein ---- Regulator of rDNA transcription 14 Source.2787: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21 Source.2788: DFBPPR15751 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 41, mitochondrial Source.2789: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10 Source.2790: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.2791: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase Source.2792: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase Source.2793: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase Source.2794: DFBPPR15832 ---- Microorganism protein ---- Uncharacterized protein in fgs 3'region Source.2795: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase Source.2796: DFBPPR15847 ---- Microorganism protein ---- Histone H2B Source.2797: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.2798: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase Source.2799: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase Source.2800: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase Source.2801: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.2802: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic Source.2803: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase Source.2804: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic Source.2805: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase Source.2806: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1 Source.2807: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic Source.2808: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B Source.2809: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic Source.2810: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase Source.2811: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2812: DFBPPR7783 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.2813: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase Source.2814: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial Source.2815: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.2816: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.2817: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.2818: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.2819: DFBPPR7822 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.2820: DFBPPR7837 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic Source.2821: DFBPPR7843 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic Source.2822: DFBPPR7863 ---- Plant protein ---- 50S ribosomal protein L23-B, chloroplastic Source.2823: DFBPPR7865 ---- Plant protein ---- 50S ribosomal protein L23-A, chloroplastic Source.2824: DFBPPR7880 ---- Plant protein ---- 30S ribosomal protein S14, chloroplastic Source.2825: DFBPPR7947 ---- Plant protein ---- Legumin type B Source.2826: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha Source.2827: DFBPPR7964 ---- Plant protein ---- Sucrose synthase Source.2828: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic Source.2829: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase Source.2830: DFBPPR8009 ---- Plant protein ---- CASP-like protein 5B1 Source.2831: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1 Source.2832: DFBPPR8035 ---- Plant protein ---- Endochitinase Source.2833: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.2834: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1 Source.2835: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2 Source.2836: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2837: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B Source.2838: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.2839: DFBPPR8075 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.2840: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta' Source.2841: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2 Source.2842: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.2843: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1 Source.2844: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.2845: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.2846: DFBPPR8115 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic Source.2847: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.2848: DFBPPR8120 ---- Plant protein ---- Protein TIC 214 Source.2849: DFBPPR8126 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic Source.2850: DFBPPR8133 ---- Plant protein ---- 30S ribosomal protein S14, chloroplastic Source.2851: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase Source.2852: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.2853: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase Source.2854: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.2855: DFBPPR8225 ---- Plant protein ---- Non-specific lipid-transfer protein AP10 Source.2856: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2857: DFBPPR8242 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.2858: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3 Source.2859: DFBPPR8258 ---- Plant protein ---- Ribosomal protein S12, mitochondrial Source.2860: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.2861: DFBPPR8264 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic Source.2862: DFBPPR8273 ---- Plant protein ---- Anther-specific protein SF2 Source.2863: DFBPPR8279 ---- Plant protein ---- Oxygen-evolving enhancer protein 1, chloroplastic Source.2864: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.2865: DFBPPR8290 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic Source.2866: DFBPPR8292 ---- Plant protein ---- 30S ribosomal protein S12, chloroplastic Source.2867: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.2868: DFBPPR8310 ---- Plant protein ---- 30S ribosomal protein S14, chloroplastic Source.2869: DFBPPR8312 ---- Plant protein ---- Translation initiation factor IF-1, chloroplastic Source.2870: DFBPPR8318 ---- Plant protein ---- 17.6 kDa class I heat shock protein
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

ACE-inhibitory activity	The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC₅₀ value of 5.73 uM.
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)O

Preparation method

Mode of preparation	Synthesis
Enzyme(s)/starter culture	The peptides were synthesized using the solid phase method with a 430A Peptide Synthesizer (Applied Biosystem Inc., Branchburg, USA).

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

Although the peptide LPG is a synthetic peptide in this study, it is present in many food-source proteins.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Byun HG, Kim SK. Structure and activity of angiotensin I converting enzyme inhibitory peptides derived from Alaskan pollack skin. J Biochem Mol Biol. 2002 Mar 31;35(2):239-43. PMID: 12297036 DOI: 10.5483/bmbrep.2002.35.2.239
Other literature(s)	[1] Byun H G, Kim S K. Purification and characterization of angiotensin I converting enzyme (ACE) inhibitory peptides from Alaska pollack ( Theragra chalcogramma ) skin[J]. Process Biochemistry, 2001, 36(12):1155-1162.
PubDate	2002