| DFBP ID - DFBPACEI1009(ACE-inhibitory peptide) |
| DFBP ID |
DFBPACEI1009 |
| Peptide sequence |
FQPSF |
| Type |
Native peptide |
| Peptide/Function name |
ACE-inhibitory peptide |
|
| Function-activity relationship |
| Main bioactivity |
ACE-inhibitory activity |
| Otheir bioactivity |
N.D |
|
| Calculated physicochemical properties |
| Three-letter amino acid |
Phe-Gln-Pro-Ser-Phe |
| Single-letter amino acid |
FQPSF |
| Peptide length |
5 |
| Peptide mass |
| Experimental mass |
Theoretical mass |
| N.D |
624.69 Da c |
|
| Net charge |
0.00 c |
| Isoelectric point (pI) |
5.97 c |
| IC50 |
12.56 uM |
| pIC50 |
-1.099 |
| GRAVY |
-0.0600 c |
| Hydrophilic residue ratio |
60% c |
| Peptide calculator |
|
|
| Biological/Functional activity & target protein |
| ACE-inhibitory activity |
The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50
value of 12.56 uM. |
| Specific target protein(s) |
Specific Target Protein(s): Angiotensin-converting enzyme |
|
| Taste properties & Structure |
| Bitterness |
| Literature report |
N.D |
| Bitter prediction tools |
Bitter taste prediction |
|
| SMILES |
N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |
|
| Preparation method |
| Mode of preparation |
Enzymatic hydrolysis
|
| Enzyme(s)/starter culture |
Thornback ray (Raja clavata) muscle was hydrolyzed with Bacillus subtilis A26 proteases until a hydrolysis degree of 18.35%. |
|
| Stability & Cytotoxicity |
| Peptide stability |
|
| Peptide cytotoxicity |
|
|
| Additional information |
| Additional information |
N.D |
|
| Database cross-references |
|
|
|
|
|
|
|
|
| Reference(s) |
| Primary literature |
Lassoued, I., Mora, L., Barkia, A., Aristoy, M.C., Nasri, M., Toldrá, F. Angiotensin I-converting enzyme inhibitory peptides FQPSF and LKYPI identified in Bacillus subtilis A26 hydrolysate of thornback ray muscle. International Journal of Food Science & Technology. 2016, 51, 1604-9.
|
| Other literature(s) |
N.D |
| PubDate |
2016 |
|