Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI1107(ACE-inhibitory peptide)

DFBP ID	DFBPACEI1107
Peptide sequence	MAP
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	Antihypertensive activity ^[D1], Multifunctional activity ^[D2]

Calculated physicochemical properties

Three-letter amino acid

Met-Ala-Pro

Single-letter amino acid

MAP

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	317.40 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

0.8 μM

pIC₅₀

0.097

GRAVY

0.7000^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Danish skim-milk cheese (Enzyme modified cheese)
Precursor protein	β-Casein
Residue position	f(102-104)
Precursor protein(s) search	Source.1: DFBPPR0379 ---- Plant protein ---- Alpha-gliadin Source.2: DFBPPR0381 ---- Plant protein ---- Alpha-gliadin Source.3: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein Source.4: DFBPPR0776 ---- Plant proteins ---- 11S globulin Source.5: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4 Source.6: DFBPPR0840 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 2 Source.7: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.8: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.9: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.10: DFBPPR0894 ---- Plant proteins ---- Serotonin N-acetyltransferase 1, chloroplastic Source.11: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.12: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.13: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1 Source.14: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda Source.15: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21 Source.16: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA Source.17: DFBPPR1001 ---- Plant proteins ---- GRF-interacting factor 1 Source.18: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75 Source.19: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A Source.20: DFBPPR1028 ---- Plant proteins ---- Defensin-like protein CAL1 Source.21: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1 Source.22: DFBPPR1050 ---- Plant proteins ---- Mitogen-activated protein kinase kinase 1 Source.23: DFBPPR1062 ---- Plant proteins ---- Transcription factor LAX PANICLE 1 Source.24: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1 Source.25: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24 Source.26: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2 Source.27: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.28: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13 Source.29: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6 Source.30: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2 Source.31: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.32: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20 Source.33: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3 Source.34: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic Source.35: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic Source.36: DFBPPR1308 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 4 Source.37: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B Source.38: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8 Source.39: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2 Source.40: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22 Source.41: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16 Source.42: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.43: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.44: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1 Source.45: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic Source.46: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.47: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29 Source.48: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.49: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3 Source.50: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4 Source.51: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.52: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase Source.53: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3 Source.54: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4 Source.55: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2 Source.56: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81 Source.57: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.58: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic Source.59: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9 Source.60: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase Source.61: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.62: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein Source.63: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4 Source.64: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.65: DFBPPR1519 ---- Plant proteins ---- Histone H2B.1 Source.66: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1 Source.67: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3 Source.68: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15 Source.69: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.70: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic Source.71: DFBPPR1581 ---- Plant proteins ---- Peroxiredoxin-2C Source.72: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2 Source.73: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.74: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2 Source.75: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase Source.76: DFBPPR1620 ---- Plant proteins ---- MADS-box transcription factor 29 Source.77: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4 Source.78: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic Source.79: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1 Source.80: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1 Source.81: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase Source.82: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.83: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.84: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2 Source.85: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.86: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4 Source.87: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3 Source.88: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic Source.89: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase Source.90: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.91: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1 Source.92: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1 Source.93: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3 Source.94: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5 Source.95: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.96: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog Source.97: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.98: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4 Source.99: DFBPPR1883 ---- Plant proteins ---- Histone H2B.7 Source.100: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2 Source.101: DFBPPR1924 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.102: DFBPPR1934 ---- Plant proteins ---- Histone H2B.4 Source.103: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA Source.104: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase Source.105: DFBPPR1945 ---- Plant proteins ---- Histone H2B.2 Source.106: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.107: DFBPPR1966 ---- Plant proteins ---- Histone H2B.3 Source.108: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.109: DFBPPR1977 ---- Plant proteins ---- Histone H2B.8 Source.110: DFBPPR1982 ---- Plant proteins ---- Histone H2B.6 Source.111: DFBPPR1983 ---- Plant proteins ---- Histone H2B.11 Source.112: DFBPPR1984 ---- Plant proteins ---- Histone H2B.10 Source.113: DFBPPR1986 ---- Plant proteins ---- Histone H2B.5 Source.114: DFBPPR1993 ---- Plant proteins ---- Histone H2B.9 Source.115: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28 Source.116: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.117: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6 Source.118: DFBPPR2033 ---- Plant proteins ---- Laccase-2 Source.119: DFBPPR2063 ---- Plant proteins ---- Non-specific lipid-transfer protein C6 Source.120: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c Source.121: DFBPPR2134 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor Source.122: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7 Source.123: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2 Source.124: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic Source.125: DFBPPR2214 ---- Plant proteins ---- Cyclase-like protein 4 Source.126: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1 Source.127: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5 Source.128: DFBPPR2244 ---- Plant proteins ---- Expansin-A6 Source.129: DFBPPR2245 ---- Plant proteins ---- Expansin-A26 Source.130: DFBPPR2252 ---- Plant proteins ---- MADS-box transcription factor 21 Source.131: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3 Source.132: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic Source.133: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2 Source.134: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein Source.135: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.136: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6 Source.137: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8 Source.138: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4 Source.139: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c Source.140: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic Source.141: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4 Source.142: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9 Source.143: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1 Source.144: DFBPPR2491 ---- Plant proteins ---- Expansin-A10 Source.145: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial Source.146: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21 Source.147: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta Source.148: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.149: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5 Source.150: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1 Source.151: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1 Source.152: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5 Source.153: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3 Source.154: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2 Source.155: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic Source.156: DFBPPR2667 ---- Plant proteins ---- Germin-like protein 3-1 Source.157: DFBPPR2679 ---- Plant proteins ---- Expansin-A22 Source.158: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1 Source.159: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2 Source.160: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9 Source.161: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.162: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B Source.163: DFBPPR2729 ---- Plant proteins ---- Protein BZR1 homolog 2 Source.164: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.165: DFBPPR2735 ---- Plant proteins ---- Expansin-A24 Source.166: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5 Source.167: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1 Source.168: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2 Source.169: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3 Source.170: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.171: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21 Source.172: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.173: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A Source.174: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.175: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4 Source.176: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B Source.177: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B Source.178: DFBPPR2900 ---- Plant proteins ---- Expansin-A23 Source.179: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3 Source.180: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.181: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A Source.182: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5 Source.183: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1 Source.184: DFBPPR2952 ---- Plant proteins ---- Expansin-A17 Source.185: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21 Source.186: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3 Source.187: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23 Source.188: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1 Source.189: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2 Source.190: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3 Source.191: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b Source.192: DFBPPR3048 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL10 Source.193: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1 Source.194: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10 Source.195: DFBPPR3085 ---- Plant proteins ---- Thiamine pyrophosphokinase 3 Source.196: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1 Source.197: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28 Source.198: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2 Source.199: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic Source.200: DFBPPR3135 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 1 Source.201: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B Source.202: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic Source.203: DFBPPR3167 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.204: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.205: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3 Source.206: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1 Source.207: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2 Source.208: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A Source.209: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.210: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6 Source.211: DFBPPR3283 ---- Plant proteins ---- Auxin-responsive protein IAA21 Source.212: DFBPPR3302 ---- Plant proteins ---- Expansin-A21 Source.213: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2 Source.214: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10 Source.215: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9 Source.216: DFBPPR3357 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein B Source.217: DFBPPR3374 ---- Plant proteins ---- Auxin-responsive protein IAA19 Source.218: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.219: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4 Source.220: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c Source.221: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.222: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11 Source.223: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.224: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3 Source.225: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.226: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27 Source.227: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic Source.228: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14 Source.229: DFBPPR3535 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.230: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.231: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3 Source.232: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.233: DFBPPR3605 ---- Plant proteins ---- Thioredoxin F, chloroplastic Source.234: DFBPPR3619 ---- Plant proteins ---- Cyclin-D3-1 Source.235: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.236: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6 Source.237: DFBPPR3647 ---- Plant proteins ---- Dof zinc finger protein 2 Source.238: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5 Source.239: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8 Source.240: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.241: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2 Source.242: DFBPPR3703 ---- Plant proteins ---- Zinc-finger homeodomain protein 1 Source.243: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5 Source.244: DFBPPR3728 ---- Plant proteins ---- 10 kDa prolamin Source.245: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1 Source.246: DFBPPR3773 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 3 Source.247: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.248: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2 Source.249: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.250: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1 Source.251: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2 Source.252: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.253: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3 Source.254: DFBPPR3979 ---- Plant proteins ---- Probable uridine nucleosidase 1 Source.255: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7 Source.256: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12 Source.257: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1 Source.258: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3 Source.259: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase Source.260: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog Source.261: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5 Source.262: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic Source.263: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2 Source.264: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.265: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1 Source.266: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16 Source.267: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH Source.268: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27 Source.269: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8 Source.270: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6 Source.271: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8 Source.272: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10 Source.273: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12 Source.274: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4 Source.275: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2 Source.276: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5 Source.277: DFBPPR4387 ---- Plant proteins ---- Dof zinc finger protein 5 Source.278: DFBPPR4400 ---- Plant proteins ---- Putative calmodulin-like protein 6 Source.279: DFBPPR4403 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.280: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32 Source.281: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.282: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4 Source.283: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15 Source.284: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2 Source.285: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9 Source.286: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic Source.287: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45 Source.288: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3 Source.289: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6 Source.290: DFBPPR4482 ---- Plant proteins ---- Probable calcium-binding protein CML30 Source.291: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.292: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.293: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14 Source.294: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.295: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1 Source.296: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2 Source.297: DFBPPR4722 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 10 Source.298: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic Source.299: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21 Source.300: DFBPPR4766 ---- Plant proteins ---- 14-3-3-like protein GF14-G Source.301: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31 Source.302: DFBPPR4787 ---- Plant proteins ---- 60S ribosomal protein L7a-1 Source.303: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600 Source.304: DFBPPR4789 ---- Plant proteins ---- B3 domain-containing protein Os11g0197600 Source.305: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47 Source.306: DFBPPR4823 ---- Plant proteins ---- 60S ribosomal protein L7a-2 Source.307: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3 Source.308: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2 Source.309: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7 Source.310: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1 Source.311: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase Source.312: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2 Source.313: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.314: DFBPPR5091 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.315: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7 Source.316: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1 Source.317: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5 Source.318: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2 Source.319: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3 Source.320: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.321: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.322: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic Source.323: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1 Source.324: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1 Source.325: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase Source.326: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6 Source.327: DFBPPR5442 ---- Plant proteins ---- GRF-interacting factor 1 Source.328: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2 Source.329: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic Source.330: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.331: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase Source.332: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3 Source.333: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.334: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.335: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic Source.336: DFBPPR5531 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.337: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.338: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.339: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic Source.340: DFBPPR5601 ---- Plant proteins ---- Protein HIRA Source.341: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.342: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase Source.343: DFBPPR5638 ---- Plant proteins ---- Histone H2B.5 Source.344: DFBPPR5639 ---- Plant proteins ---- Histone H2B.1 Source.345: DFBPPR5640 ---- Plant proteins ---- Histone H2B.4 Source.346: DFBPPR5641 ---- Plant proteins ---- Histone H2B.2 Source.347: DFBPPR5656 ---- Plant proteins ---- Histone H2B.3 Source.348: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2 Source.349: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.350: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.351: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform Source.352: DFBPPR5766 ---- Plant proteins ---- MADS-box protein ZMM17 Source.353: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.354: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.355: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.356: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.357: DFBPPR5823 ---- Plant proteins ---- Regulatory protein opaque-2 Source.358: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.359: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.360: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic Source.361: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1 Source.362: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2 Source.363: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase Source.364: DFBPPR5973 ---- Plant proteins ---- Cortical cell-delineating protein Source.365: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2 Source.366: DFBPPR6116 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.367: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein Source.368: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.369: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.370: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial Source.371: DFBPPR6249 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.372: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase Source.373: DFBPPR6290 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.374: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.375: DFBPPR6335 ---- Plant proteins ---- Protein CYCLOPS Source.376: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6 Source.377: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B Source.378: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2 Source.379: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A Source.380: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3 Source.381: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4 Source.382: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5 Source.383: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1 Source.384: DFBPPR6510 ---- Plant proteins ---- 50S ribosomal protein 6, chloroplastic Source.385: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A Source.386: DFBPPR6617 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.387: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1 Source.388: DFBPPR6681 ---- Plant proteins ---- Histone H2B.4 Source.389: DFBPPR6704 ---- Plant proteins ---- Histone H2B.1 Source.390: DFBPPR6711 ---- Plant proteins ---- Histone H2B.5 Source.391: DFBPPR6713 ---- Plant proteins ---- Histone H2B.6 Source.392: DFBPPR6714 ---- Plant proteins ---- Histone H2B.3 Source.393: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.394: DFBPPR6727 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.395: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic Source.396: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase Source.397: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A Source.398: DFBPPR6783 ---- Plant proteins ---- Thioredoxin H-type Source.399: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.400: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic Source.401: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic Source.402: DFBPPR6835 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 1, chloroplastic Source.403: DFBPPR6856 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 3, chloroplastic Source.404: DFBPPR6857 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 2, chloroplastic Source.405: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.406: DFBPPR6884 ---- Plant proteins ---- Endogenous alpha-amylase/subtilisin inhibitor Source.407: DFBPPR6974 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.408: DFBPPR6996 ---- Plant proteins ---- 60S ribosomal protein L30 Source.409: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.410: DFBPPR7043 ---- Plant proteins ---- Beta-amylase Source.411: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase Source.412: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor Source.413: DFBPPR7135 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.414: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9 Source.415: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.416: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2 Source.417: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.418: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1 Source.419: DFBPPR7251 ---- Plant proteins ---- Leaf-specific thionin DB4 Source.420: DFBPPR7264 ---- Plant proteins ---- Leaf-specific thionin BTH6 Source.421: DFBPPR7325 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.422: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1 Source.423: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1 Source.424: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin Source.425: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1 Source.426: DFBPPR7630 ---- Milk proteins ---- Folate receptor alpha Source.427: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.428: DFBPPR7718 ---- Milk proteins ---- Beta-casein Source.429: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2 Source.430: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1 Source.431: DFBPPR8481 ---- Plant proteins ---- Granule-bound starch synthase 1 Source.432: DFBPPR8489 ---- Milk proteins ---- Beta-casein Source.433: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1 Source.434: DFBPPR15965 ---- Animal proteins ---- Dystroglycan Source.435: DFBPPR15992 ---- Animal proteins ---- Phospholemman Source.436: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.437: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.438: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.439: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type Source.440: DFBPPR16065 ---- Animal proteins ---- Caspase-3 Source.441: DFBPPR16089 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.442: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor Source.443: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2 Source.444: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6 Source.445: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.446: DFBPPR16170 ---- Animal proteins ---- Inversin Source.447: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase Source.448: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.449: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11 Source.450: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11 Source.451: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel Source.452: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein Source.453: DFBPPR16354 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.454: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.455: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII Source.456: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein Source.457: DFBPPR16655 ---- Animal proteins ---- Somatostatin Source.458: DFBPPR16739 ---- Animal proteins ---- Lengsin Source.459: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.460: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial Source.461: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial Source.462: DFBPPR16861 ---- Animal proteins ---- Adenylate kinase 2, mitochondrial Source.463: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.464: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial Source.465: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A Source.466: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase Source.467: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.468: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1 Source.469: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.470: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.471: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.472: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.473: DFBPPR17090 ---- Animal proteins ---- Phakinin Source.474: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1 Source.475: DFBPPR17102 ---- Animal proteins ---- Dystroglycan Source.476: DFBPPR17103 ---- Animal proteins ---- Dystroglycan Source.477: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.478: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain Source.479: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.480: DFBPPR17193 ---- Animal proteins ---- Oxysterols receptor LXR-alpha Source.481: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.482: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial Source.483: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1 Source.484: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1 Source.485: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1 Source.486: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase Source.487: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1 Source.488: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.489: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1 Source.490: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5 Source.491: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit Source.492: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.493: DFBPPR17484 ---- Animal proteins ---- Histone H1.8 Source.494: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1 Source.495: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4 Source.496: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase Source.497: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein Source.498: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B Source.499: DFBPPR17743 ---- Animal proteins ---- Myelin protein P0 Source.500: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.501: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3 Source.502: DFBPPR17776 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.503: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase Source.504: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor Source.505: DFBPPR17836 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 6 Source.506: DFBPPR17847 ---- Animal proteins ---- Palmitoyltransferase ZDHHC20 Source.507: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.508: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13 Source.509: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1 Source.510: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.511: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3 Source.512: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA Source.513: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2 Source.514: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate Source.515: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1 Source.516: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase Source.517: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial Source.518: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7 Source.519: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.520: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.521: DFBPPR18029 ---- Animal proteins ---- Collagen alpha-3(IV) chain Source.522: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.523: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1 Source.524: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.525: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.526: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4 Source.527: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog Source.528: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7 Source.529: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25 Source.530: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.531: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.532: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4 Source.533: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.534: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.535: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1 Source.536: DFBPPR18241 ---- Animal proteins ---- Seminal plasma protein BSP-30 kDa Source.537: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI Source.538: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10 Source.539: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7 Source.540: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2 Source.541: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon Source.542: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5 Source.543: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.544: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5 Source.545: DFBPPR18406 ---- Animal proteins ---- Angiotensinogen Source.546: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B Source.547: DFBPPR18473 ---- Animal proteins ---- Sharpin Source.548: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1 Source.549: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2 Source.550: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.551: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1 Source.552: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.553: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta Source.554: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.555: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial Source.556: DFBPPR18778 ---- Animal proteins ---- Erlin-2 Source.557: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8 Source.558: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2 Source.559: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.560: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2 Source.561: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.562: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A Source.563: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.564: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless Source.565: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.566: DFBPPR18964 ---- Animal proteins ---- Placental prolactin-related protein 1 Source.567: DFBPPR18993 ---- Animal proteins ---- Dynein regulatory complex protein 1 Source.568: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5 Source.569: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1 Source.570: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase Source.571: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4 Source.572: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma Source.573: DFBPPR19222 ---- Animal proteins ---- Interferon alpha-H Source.574: DFBPPR19229 ---- Animal proteins ---- Interferon alpha-F Source.575: DFBPPR19230 ---- Animal proteins ---- Interferon alpha-G Source.576: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.577: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.578: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33 Source.579: DFBPPR19288 ---- Animal proteins ---- Interferon alpha-C Source.580: DFBPPR19301 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF220 Source.581: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1 Source.582: DFBPPR19322 ---- Animal proteins ---- Interferon alpha-A Source.583: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.584: DFBPPR19372 ---- Animal proteins ---- Epithelial cell adhesion molecule Source.585: DFBPPR19431 ---- Animal proteins ---- Aminoacyl tRNA synthase complex-interacting multifunctional protein 2 Source.586: DFBPPR19434 ---- Animal proteins ---- Interferon alpha-B Source.587: DFBPPR19435 ---- Animal proteins ---- Interferon alpha-D Source.588: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.589: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.590: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7 Source.591: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1 Source.592: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11 Source.593: DFBPPR19505 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein N Source.594: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A Source.595: DFBPPR19546 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 1, mitochondrial Source.596: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1 Source.597: DFBPPR19585 ---- Animal proteins ---- Interferon alpha-1 Source.598: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.599: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2 Source.600: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator Source.601: DFBPPR19702 ---- Animal proteins ---- Placental prolactin-related protein 4 Source.602: DFBPPR19715 ---- Animal proteins ---- Chorionic somatomammotropin hormone 2 Source.603: DFBPPR19738 ---- Animal proteins ---- Translocator protein Source.604: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3 Source.605: DFBPPR19765 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.606: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma Source.607: DFBPPR19783 ---- Animal proteins ---- Syndecan-1 Source.608: DFBPPR19786 ---- Animal proteins ---- Chorionic somatomammotropin hormone 1 Source.609: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.610: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L Source.611: DFBPPR19873 ---- Animal proteins ---- Syntaxin-8 Source.612: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6 Source.613: DFBPPR19904 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 30 Source.614: DFBPPR19948 ---- Animal proteins ---- Tensin-4 Source.615: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5 Source.616: DFBPPR19993 ---- Animal proteins ---- MRN complex-interacting protein Source.617: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.618: DFBPPR20034 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C1, mitochondrial Source.619: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2 Source.620: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein Source.621: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.622: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1 Source.623: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial Source.624: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator Source.625: DFBPPR20217 ---- Animal proteins ---- Cytochrome c oxidase assembly factor 8 Source.626: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12 Source.627: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase Source.628: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2 Source.629: DFBPPR20274 ---- Animal proteins ---- Phospholipase A1 member A Source.630: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4 Source.631: DFBPPR20323 ---- Animal proteins ---- Myosin light chain 3 Source.632: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2 Source.633: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10 Source.634: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein Source.635: DFBPPR20483 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 1 Source.636: DFBPPR20498 ---- Animal proteins ---- Protein sprouty homolog 4 Source.637: DFBPPR20508 ---- Animal proteins ---- Aurora kinase A and ninein-interacting protein Source.638: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1 Source.639: DFBPPR20563 ---- Animal proteins ---- ADP-ribosylation factor-like protein 4D Source.640: DFBPPR20576 ---- Animal proteins ---- 60S ribosomal protein L23a Source.641: DFBPPR20581 ---- Animal proteins ---- Membrane magnesium transporter 1 Source.642: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog Source.643: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.644: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease Source.645: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2 Source.646: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A Source.647: DFBPPR20714 ---- Animal proteins ---- Phosphomevalonate kinase Source.648: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1 Source.649: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1 Source.650: DFBPPR20749 ---- Animal proteins ---- SUMO-activating enzyme subunit 1 Source.651: DFBPPR20759 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform Source.652: DFBPPR20763 ---- Animal proteins ---- Dual specificity protein phosphatase 14 Source.653: DFBPPR20790 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1 Source.654: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216 Source.655: DFBPPR20818 ---- Animal proteins ---- Protein-lysine N-methyltransferase EEF2KMT Source.656: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1 Source.657: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1 Source.658: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3 Source.659: DFBPPR20913 ---- Animal proteins ---- Somatostatin Source.660: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase Source.661: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.662: DFBPPR20954 ---- Animal proteins ---- Secretagogin Source.663: DFBPPR20973 ---- Animal proteins ---- Growth-regulated protein homolog gamma Source.664: DFBPPR21005 ---- Animal proteins ---- Growth-regulated protein homolog beta Source.665: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A Source.666: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2 Source.667: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B Source.668: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574 Source.669: DFBPPR21076 ---- Animal proteins ---- Ferredoxin-2, mitochondrial Source.670: DFBPPR21077 ---- Animal proteins ---- Growth-regulated protein homolog alpha Source.671: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein Source.672: DFBPPR21244 ---- Animal proteins ---- RELT-like protein 1 Source.673: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1 Source.674: DFBPPR21325 ---- Animal proteins ---- Translocon-associated protein subunit gamma Source.675: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15 Source.676: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter Source.677: DFBPPR21358 ---- Animal proteins ---- Myosin light chain 1/3, skeletal muscle isoform Source.678: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B Source.679: DFBPPR21395 ---- Animal proteins ---- Elongation factor Ts, mitochondrial Source.680: DFBPPR21396 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM6 homolog Source.681: DFBPPR21416 ---- Animal proteins ---- 39S ribosomal protein L32, mitochondrial Source.682: DFBPPR21451 ---- Animal proteins ---- Nurim Source.683: DFBPPR21491 ---- Animal proteins ---- CUE domain-containing protein 2 Source.684: DFBPPR21512 ---- Animal proteins ---- Membrane protein FAM174B Source.685: DFBPPR21531 ---- Animal proteins ---- 60S ribosomal protein L13 Source.686: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3 Source.687: DFBPPR21585 ---- Animal proteins ---- Ras-related protein Rab-19 Source.688: DFBPPR21586 ---- Animal proteins ---- Cyclin-C Source.689: DFBPPR21605 ---- Animal proteins ---- Transmembrane protein 138 Source.690: DFBPPR21699 ---- Animal proteins ---- Transmembrane protein 208 Source.691: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog Source.692: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1 Source.693: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5 Source.694: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein Source.695: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2 Source.696: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2 Source.697: DFBPPR21926 ---- Animal proteins ---- N-acetyltransferase 14 Source.698: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2 Source.699: DFBPPR21971 ---- Animal proteins ---- Chemokine-like protein TAFA-5 Source.700: DFBPPR21981 ---- Animal proteins ---- Polyamine-modulated factor 1 Source.701: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6 Source.702: DFBPPR22192 ---- Animal proteins ---- Receptor expression-enhancing protein 5 Source.703: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1 Source.704: DFBPPR22245 ---- Animal proteins ---- Thyroid transcription factor 1-associated protein 26 Source.705: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.706: DFBPPR22367 ---- Animal proteins ---- 60S ribosomal protein L22-like 1 Source.707: DFBPPR22369 ---- Animal proteins ---- Transmembrane protein 247 Source.708: DFBPPR22376 ---- Animal proteins ---- 60S ribosomal protein L31 Source.709: DFBPPR22501 ---- Animal proteins ---- Multiple myeloma tumor-associated protein 2 homolog Source.710: DFBPPR22555 ---- Animal proteins ---- Bcl-2-like protein 15 Source.711: DFBPPR22587 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog Source.712: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13 Source.713: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18 Source.714: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.715: DFBPPR22699 ---- Animal proteins ---- LYR motif-containing protein 9 Source.716: DFBPPR22701 ---- Animal proteins ---- Fibronectin type III domain-containing protein 8 Source.717: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.718: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 Source.719: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.720: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.721: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.722: DFBPPR8639 ---- Animal proteins ---- Mannose-binding protein A Source.723: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1 Source.724: DFBPPR8674 ---- Animal proteins ---- Calpain-3 Source.725: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1 Source.726: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.727: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.728: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor Source.729: DFBPPR8744 ---- Animal proteins ---- Fibroblast growth factor 9 Source.730: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I Source.731: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.732: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14 Source.733: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.734: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.735: DFBPPR8772 ---- Animal proteins ---- Dystroglycan Source.736: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.737: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.738: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.739: DFBPPR8859 ---- Animal proteins ---- Interleukin-1 alpha Source.740: DFBPPR8880 ---- Animal proteins ---- Apolipoprotein A-I Source.741: DFBPPR8883 ---- Animal proteins ---- Apolipoprotein A-I Source.742: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.743: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.744: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.745: DFBPPR9022 ---- Animal proteins ---- Prothrombin Source.746: DFBPPR9073 ---- Animal proteins ---- Vitronectin Source.747: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1 Source.748: DFBPPR9108 ---- Animal proteins ---- Somatostatin Source.749: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.750: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.751: DFBPPR9159 ---- Animal proteins ---- Hematopoietic cell signal transducer Source.752: DFBPPR9215 ---- Animal proteins ---- Phosphomevalonate kinase Source.753: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII Source.754: DFBPPR9241 ---- Animal proteins ---- Epithelial cell adhesion molecule Source.755: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2 Source.756: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1 Source.757: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.758: DFBPPR9515 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.759: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.760: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.761: DFBPPR9641 ---- Animal proteins ---- 60S ribosomal protein L22 Source.762: DFBPPR9753 ---- Animal proteins ---- Syntaxin-binding protein 2 Source.763: DFBPPR9770 ---- Animal proteins ---- Melatonin receptor type 1A Source.764: DFBPPR9779 ---- Animal proteins ---- Beta-2-microglobulin Source.765: DFBPPR9784 ---- Animal proteins ---- Translocator protein Source.766: DFBPPR9838 ---- Animal proteins ---- Transcription factor PU.1 Source.767: DFBPPR9839 ---- Animal proteins ---- Nurim Source.768: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1 Source.769: DFBPPR9881 ---- Animal proteins ---- 60S ribosomal protein L31 Source.770: DFBPPR9948 ---- Animal proteins ---- Vertnin Source.771: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3 Source.772: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase Source.773: DFBPPR9961 ---- Animal proteins ---- Somatotropin Source.774: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.775: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B Source.776: DFBPPR10033 ---- Animal proteins ---- Apolipoprotein A-I Source.777: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase Source.778: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A Source.779: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.780: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1 Source.781: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.782: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog Source.783: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7 Source.784: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.785: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3 Source.786: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.787: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1 Source.788: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.789: DFBPPR10139 ---- Animal proteins ---- Cytochrome b Source.790: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.791: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial Source.792: DFBPPR10163 ---- Animal proteins ---- Annexin A6 Source.793: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha Source.794: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2 Source.795: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1 Source.796: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1 Source.797: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2 Source.798: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3 Source.799: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2 Source.800: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1 Source.801: DFBPPR10270 ---- Animal proteins ---- Agrin Source.802: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.803: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1 Source.804: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase Source.805: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1 Source.806: DFBPPR10361 ---- Animal proteins ---- Protein HIRA Source.807: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.808: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.809: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.810: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5 Source.811: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.812: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.813: DFBPPR10480 ---- Animal proteins ---- Cathepsin D Source.814: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.815: DFBPPR10516 ---- Animal proteins ---- Adseverin Source.816: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2 Source.817: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2 Source.818: DFBPPR10552 ---- Animal proteins ---- Transcription factor AP-1 Source.819: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.820: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2 Source.821: DFBPPR10563 ---- Animal proteins ---- Optineurin Source.822: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.823: DFBPPR10620 ---- Animal proteins ---- Centromere protein T Source.824: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai Source.825: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.826: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.827: DFBPPR10718 ---- Animal proteins ---- Myosin light chain 1, skeletal muscle isoform Source.828: DFBPPR10794 ---- Animal proteins ---- Zyxin Source.829: DFBPPR10805 ---- Animal proteins ---- Interferon type A1/A2 Source.830: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5 Source.831: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha Source.832: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein Source.833: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.834: DFBPPR10860 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.835: DFBPPR10866 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.836: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2 Source.837: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7 Source.838: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.839: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.840: DFBPPR10955 ---- Animal proteins ---- DNA damage-binding protein 2 Source.841: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3 Source.842: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4 Source.843: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2 Source.844: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.845: DFBPPR11047 ---- Animal proteins ---- Nucleolin Source.846: DFBPPR11073 ---- Animal proteins ---- Axin-1 Source.847: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2 Source.848: DFBPPR11102 ---- Animal proteins ---- Interferon type A3 Source.849: DFBPPR11127 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform Source.850: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.851: DFBPPR11141 ---- Animal proteins ---- Serine/threonine-protein kinase ULK3 Source.852: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B Source.853: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase Source.854: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog Source.855: DFBPPR11263 ---- Animal proteins ---- Obg-like ATPase 1 Source.856: DFBPPR11346 ---- Animal proteins ---- Diencephalon/mesencephalon homeobox protein 1 Source.857: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10 Source.858: DFBPPR11373 ---- Animal proteins ---- Decorin Source.859: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.860: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48 Source.861: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.862: DFBPPR11452 ---- Animal proteins ---- Paired mesoderm homeobox protein 2 Source.863: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4 Source.864: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5 Source.865: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog Source.866: DFBPPR11499 ---- Animal proteins ---- Myosin regulatory light chain 2B, cardiac muscle isoform Source.867: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2 Source.868: DFBPPR11527 ---- Animal proteins ---- Myosin regulatory light chain 2A, cardiac muscle isoform Source.869: DFBPPR11531 ---- Animal proteins ---- Protein AATF Source.870: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.871: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1 Source.872: DFBPPR11606 ---- Animal proteins ---- 60S ribosomal protein L13 Source.873: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.874: DFBPPR11649 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.875: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase Source.876: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1 Source.877: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D Source.878: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A Source.879: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial Source.880: DFBPPR11822 ---- Animal proteins ---- Inversin Source.881: DFBPPR11829 ---- Animal proteins ---- Melatonin receptor type 1B Source.882: DFBPPR11840 ---- Animal proteins ---- RELT-like protein 1 Source.883: DFBPPR11851 ---- Animal proteins ---- Borealin Source.884: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1 Source.885: DFBPPR11885 ---- Animal proteins ---- ELL-associated factor 2 Source.886: DFBPPR11928 ---- Animal proteins ---- Cyclin-C Source.887: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1 Source.888: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.889: DFBPPR12021 ---- Animal proteins ---- DNA repair protein RAD52 homolog Source.890: DFBPPR12030 ---- Animal proteins ---- Transmembrane protein 208 Source.891: DFBPPR12050 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1 Source.892: DFBPPR12067 ---- Animal proteins ---- Transcription factor EC Source.893: DFBPPR12075 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial Source.894: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A Source.895: DFBPPR12131 ---- Animal proteins ---- Exportin-4 Source.896: DFBPPR12163 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2 Source.897: DFBPPR12209 ---- Animal proteins ---- 60S ribosomal protein L22 Source.898: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.899: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.900: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.901: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase Source.902: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.903: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.904: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.905: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.906: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF Source.907: DFBPPR12320 ---- Animal proteins ---- Dystroglycan Source.908: DFBPPR12336 ---- Animal proteins ---- Apolipoprotein D Source.909: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2 Source.910: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.911: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein Source.912: DFBPPR12408 ---- Animal proteins ---- Vitronectin Source.913: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase Source.914: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N Source.915: DFBPPR12439 ---- Animal proteins ---- Tissue factor Source.916: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2 Source.917: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14 Source.918: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.919: DFBPPR12512 ---- Animal proteins ---- Carbonic anhydrase 4 Source.920: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII Source.921: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor Source.922: DFBPPR12583 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.923: DFBPPR12615 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.924: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11 Source.925: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.926: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.927: DFBPPR12733 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 2 Source.928: DFBPPR12770 ---- Animal proteins ---- Filamin-B Source.929: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.930: DFBPPR13048 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 1 Source.931: DFBPPR13060 ---- Animal proteins ---- Growth-regulated protein homolog Source.932: DFBPPR13100 ---- Animal proteins ---- Lengsin Source.933: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.934: DFBPPR13196 ---- Animal proteins ---- Metalloproteinase inhibitor 1 Source.935: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.936: DFBPPR13316 ---- Animal proteins ---- Myelin protein P0 Source.937: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.938: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.939: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.940: DFBPPR13500 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.941: DFBPPR13550 ---- Animal proteins ---- Corticotropin-releasing factor-binding protein Source.942: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.943: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor Source.944: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.945: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.946: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A Source.947: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.948: DFBPPR13690 ---- Animal proteins ---- Angiotensinogen Source.949: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.950: DFBPPR13826 ---- Animal proteins ---- Translocator protein Source.951: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A Source.952: DFBPPR13846 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.953: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein Source.954: DFBPPR13896 ---- Animal proteins ---- Somatostatin Source.955: DFBPPR13897 ---- Animal proteins ---- Inactive ribonuclease-like protein 10 Source.956: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.957: DFBPPR14026 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.958: DFBPPR14115 ---- Marine protein ---- Adenylate kinase 2, mitochondrial Source.959: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5 Source.960: DFBPPR14240 ---- Marine protein ---- Otolin-1 Source.961: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.962: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic Source.963: DFBPPR14488 ---- Marine protein ---- Putative cytochrome c-type biogenesis protein DbsD-like Source.964: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator Source.965: DFBPPR14751 ---- Marine protein ---- Insulin Source.966: DFBPPR14814 ---- Marine protein ---- Superoxide dismutase [Mn], mitochondrial Source.967: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20 Source.968: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1 Source.969: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80 Source.970: DFBPPR14967 ---- Microorganism protein ---- Histone H2B.2 Source.971: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.972: DFBPPR14989 ---- Microorganism protein ---- cAMP-dependent protein kinase regulatory subunit Source.973: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase Source.974: DFBPPR15053 ---- Microorganism protein ---- 60S ribosomal subunit assembly/export protein LOC1 Source.975: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear Source.976: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A Source.977: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10 Source.978: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial Source.979: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1 Source.980: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor Source.981: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3 Source.982: DFBPPR15534 ---- Microorganism protein ---- 60S ribosomal protein L30 Source.983: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1 Source.984: DFBPPR15667 ---- Microorganism protein ---- 60S ribosomal protein L25 Source.985: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1 Source.986: DFBPPR15731 ---- Microorganism protein ---- Protein SOM1, mitochondrial Source.987: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5 Source.988: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase Source.989: DFBPPR15840 ---- Microorganism protein ---- Protein RecA Source.990: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase Source.991: DFBPPR15847 ---- Microorganism protein ---- Histone H2B Source.992: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase Source.993: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1 Source.994: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase Source.995: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase Source.996: DFBPPR7783 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.997: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.998: DFBPPR7826 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-2 Source.999: DFBPPR7827 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-1 Source.1000: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6 Source.1001: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7 Source.1002: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1 Source.1003: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4 Source.1004: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3 Source.1005: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5 Source.1006: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2 Source.1007: DFBPPR7915 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.1008: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase Source.1009: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase Source.1010: DFBPPR8075 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.1011: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17 Source.1012: DFBPPR8228 ---- Plant protein ---- Albumin-8 Source.1013: DFBPPR8242 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit K, chloroplastic Source.1014: DFBPPR8290 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic Source.1015: DFBPPR8346 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

ACE-inhibitory activity	The peptide exhibited very strong Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC₅₀ value of 0.8 μM.
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	The enzyme modified cheese was prepared by a combination of Protease N, Umamizyme, and Flavourzyme 500L.

Stability & Cytotoxicity

Peptide stability

Literature report:	Inhibition activity of Met-Ala-Pro against ACE was examined by the pre-incubation method. The IC₅₀ value and HPLC chromatogram of Met-Ala-Pro were not affected by pre-incubation with ACE. Therefore, Met-Ala-Pro was regarded as the true inhibitor type for ACE.
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The purified peptide MAP is a possible candidate for application as a dietary supplement or as a component of a functional food product.

Database cross-references

DFBP

[D1]	DFBPANHY0576
[D2]	DFBPMUFU0441

[D3]

[D4]

[D5]

[D6]

Reference(s)

Primary literature	Tonouchi H, Suzuki M, Uchida M, Oda M. Antihypertensive effect of an angiotensin converting enzyme inhibitory peptide from enzyme modified cheese. J Dairy Res. 2008 Aug;75(3):284-90. PMID: 18620614 DOI: 10.1017/S0022029908003452
Other literature(s)	N.D
PubDate	2008