E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI1185(ACE-inhibitory peptide)
DFBP ID DFBPACEI1185
Peptide sequence LVE
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity Antihypertensive activity [D1], Multifunctional activity [D2]
Calculated physicochemical properties
Three-letter amino acid Leu-Val-Glu
Single-letter amino acid LVE
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 359.42 Da c
Net charge 0.00 c
Isoelectric point (pI) 3.34 c
IC50

14.2 uM

pIC50 -1.152
GRAVY 1.5000 c
Hydrophilic residue ratio 66.67% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal, Marine
Organism/Source Short-necked clam (Tapes philippinarum)
Precursor protein Short-necked clam powder hydrolysates
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.2: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.3: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.4: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.5: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5
Source.6: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.7: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71
Source.8: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.9: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.10: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18
Source.11: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.12: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.13: DFBPPR0892 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 1
Source.14: DFBPPR0900 ---- Plant proteins ---- GTPase activating protein 1
Source.15: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.16: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2
Source.17: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase
Source.18: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.19: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.20: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a
Source.21: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.22: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.23: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial
Source.24: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.25: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1
Source.26: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.27: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.28: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.29: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A
Source.30: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5
Source.31: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC
Source.32: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.33: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3
Source.34: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.35: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic
Source.36: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1
Source.37: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.38: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185
Source.39: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.40: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.41: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31
Source.42: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1
Source.43: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.44: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75
Source.45: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.46: DFBPPR1017 ---- Plant proteins ---- Glucosamine 6-phosphate N-acetyltransferase 1
Source.47: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.48: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.49: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.50: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1
Source.51: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1
Source.52: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3
Source.53: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.54: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.55: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.56: DFBPPR1050 ---- Plant proteins ---- Mitogen-activated protein kinase kinase 1
Source.57: DFBPPR1051 ---- Plant proteins ---- MADS-box transcription factor 14
Source.58: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62
Source.59: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A
Source.60: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.61: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c
Source.62: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.63: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.64: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.65: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.66: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.67: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.68: DFBPPR1097 ---- Plant proteins ---- Thioredoxin M5, chloroplastic
Source.69: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.70: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.71: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.72: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.73: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG
Source.74: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic
Source.75: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.76: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.77: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13
Source.78: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.79: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6
Source.80: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13
Source.81: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.82: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.83: DFBPPR1167 ---- Plant proteins ---- Phototropin-2
Source.84: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.85: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic
Source.86: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2
Source.87: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic
Source.88: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.89: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.90: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.91: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19
Source.92: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.93: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b
Source.94: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28
Source.95: DFBPPR1257 ---- Plant proteins ---- Transcription factor MYB2
Source.96: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic
Source.97: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic
Source.98: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.99: DFBPPR1272 ---- Plant proteins ---- MADS-box transcription factor 15
Source.100: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.101: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.102: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.103: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b
Source.104: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6
Source.105: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16
Source.106: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.107: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.108: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.109: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.110: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.111: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1
Source.112: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.113: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.114: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1
Source.115: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.116: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.117: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.118: DFBPPR1356 ---- Plant proteins ---- Non-symbiotic hemoglobin 1
Source.119: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.120: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.121: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.122: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.123: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.124: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.125: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.126: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B
Source.127: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.128: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.129: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.130: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.131: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.132: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.133: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.134: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3
Source.135: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3
Source.136: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.137: DFBPPR1446 ---- Plant proteins ---- Nucleoside diphosphate kinase 1
Source.138: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.139: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.140: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.141: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.142: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.143: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2
Source.144: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.145: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.146: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.147: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.148: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.149: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.150: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.151: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.152: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.153: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.154: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.155: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.156: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.157: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.158: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2
Source.159: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.160: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.161: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic
Source.162: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2
Source.163: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.164: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic
Source.165: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic
Source.166: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.167: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1
Source.168: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.169: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.170: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic
Source.171: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.172: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.173: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.174: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic
Source.175: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.176: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.177: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1
Source.178: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal
Source.179: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.180: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.181: DFBPPR1682 ---- Plant proteins ---- Phytosulfokines 3
Source.182: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.183: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic
Source.184: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1
Source.185: DFBPPR1704 ---- Plant proteins ---- RNA-binding protein Y14B
Source.186: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.187: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.188: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.189: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.190: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.191: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.192: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.193: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.194: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.195: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.196: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.197: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1
Source.198: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.199: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A
Source.200: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.201: DFBPPR1796 ---- Plant proteins ---- Fibrillin protein 5 homolog
Source.202: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.203: DFBPPR1810 ---- Plant proteins ---- Shaggy-related protein kinase GSK4
Source.204: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.205: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.206: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1
Source.207: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.208: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.209: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.210: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.211: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.212: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.213: DFBPPR1870 ---- Plant proteins ---- Laccase-20
Source.214: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.215: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.216: DFBPPR1893 ---- Plant proteins ---- Probable glucosamine 6-phosphate N-acetyltransferase 2
Source.217: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.218: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.219: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.220: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.221: DFBPPR1912 ---- Plant proteins ---- Expansin-B3
Source.222: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.223: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.224: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.225: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.226: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.227: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.228: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.229: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.230: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.231: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.232: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.233: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.234: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.235: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12
Source.236: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38
Source.237: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.238: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B
Source.239: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b
Source.240: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.241: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.242: DFBPPR2026 ---- Plant proteins ---- Proteasome subunit alpha type-5
Source.243: DFBPPR2029 ---- Plant proteins ---- Protein disulfide isomerase-like 2-1
Source.244: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.245: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5
Source.246: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.247: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.248: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.249: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176
Source.250: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3
Source.251: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.252: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA
Source.253: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.254: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.255: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.256: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.257: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.258: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.259: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.260: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1
Source.261: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.262: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.263: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.264: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein
Source.265: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.266: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2
Source.267: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.268: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.269: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.270: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.271: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.272: DFBPPR2146 ---- Plant proteins ---- Expansin-B4
Source.273: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.274: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.275: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.276: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.277: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.278: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.279: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.280: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2
Source.281: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1
Source.282: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1
Source.283: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.284: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.285: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.286: DFBPPR2214 ---- Plant proteins ---- Cyclase-like protein 4
Source.287: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.288: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.289: DFBPPR2243 ---- Plant proteins ---- WRKY transcription factor WRKY76
Source.290: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.291: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.292: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.293: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.294: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.295: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.296: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.297: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.298: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS
Source.299: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3
Source.300: DFBPPR2303 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-10
Source.301: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.302: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.303: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.304: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.305: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.306: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.307: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.308: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.309: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.310: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.311: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.312: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.313: DFBPPR2368 ---- Plant proteins ---- Thioredoxin M1, chloroplastic
Source.314: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.315: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.316: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1
Source.317: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100
Source.318: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10
Source.319: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.320: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5
Source.321: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6
Source.322: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22
Source.323: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.324: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B
Source.325: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.326: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.327: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.328: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1
Source.329: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.330: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.331: DFBPPR2433 ---- Plant proteins ---- SAP-like protein BP-73
Source.332: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.333: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6
Source.334: DFBPPR2470 ---- Plant proteins ---- Protein disulfide isomerase-like 2-2
Source.335: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.336: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.337: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2
Source.338: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.339: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.340: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic
Source.341: DFBPPR2516 ---- Plant proteins ---- Expansin-B16
Source.342: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.343: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.344: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.345: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1
Source.346: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.347: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.348: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic
Source.349: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.350: DFBPPR2595 ---- Plant proteins ---- Expansin-B7
Source.351: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.352: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24
Source.353: DFBPPR2636 ---- Plant proteins ---- Expansin-B8
Source.354: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.355: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.356: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18
Source.357: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.358: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.359: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.360: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.361: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9
Source.362: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.363: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.364: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit
Source.365: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5
Source.366: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.367: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8
Source.368: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.369: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700
Source.370: DFBPPR2758 ---- Plant proteins ---- Expansin-B17
Source.371: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.372: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.373: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3
Source.374: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.375: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.376: DFBPPR2793 ---- Plant proteins ---- MADS-box transcription factor 33
Source.377: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.378: DFBPPR2795 ---- Plant proteins ---- Protein THYLAKOID FORMATION1, chloroplastic
Source.379: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.380: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.381: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.382: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.383: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.384: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.385: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.386: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.387: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.388: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.389: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.390: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.391: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9
Source.392: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.393: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.394: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.395: DFBPPR2884 ---- Plant proteins ---- Expansin-B2
Source.396: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32
Source.397: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.398: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.399: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.400: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.401: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.402: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14
Source.403: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.404: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.405: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40
Source.406: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.407: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.408: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.409: DFBPPR2988 ---- Plant proteins ---- Non-symbiotic hemoglobin 2
Source.410: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog
Source.411: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.412: DFBPPR3011 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG4
Source.413: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2
Source.414: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit
Source.415: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.416: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1
Source.417: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1
Source.418: DFBPPR3063 ---- Plant proteins ---- Profilin-A
Source.419: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial
Source.420: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.421: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.422: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.423: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.424: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.425: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.426: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.427: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1
Source.428: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial
Source.429: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2
Source.430: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit
Source.431: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.432: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.433: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.434: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4
Source.435: DFBPPR3130 ---- Plant proteins ---- COP9 signalosome complex subunit 6
Source.436: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.437: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.438: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2
Source.439: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.440: DFBPPR3158 ---- Plant proteins ---- Probable adenylate kinase 1, chloroplastic
Source.441: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.442: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.443: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.444: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.445: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48
Source.446: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.447: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10
Source.448: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300
Source.449: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3
Source.450: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1
Source.451: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A
Source.452: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic
Source.453: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750
Source.454: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.455: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.456: DFBPPR3242 ---- Plant proteins ---- Peroxisomal membrane protein 11-1
Source.457: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.458: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.459: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.460: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial
Source.461: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.462: DFBPPR3288 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 2
Source.463: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500
Source.464: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.465: DFBPPR3308 ---- Plant proteins ---- Auxin-responsive protein IAA26
Source.466: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2
Source.467: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1
Source.468: DFBPPR3316 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 7
Source.469: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.470: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.471: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.472: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.473: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.474: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.475: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.476: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic
Source.477: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.478: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.479: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.480: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.481: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.482: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.483: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.484: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic
Source.485: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3
Source.486: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.487: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.488: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.489: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.490: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.491: DFBPPR3453 ---- Plant proteins ---- Probable protein phosphatase 2C 44
Source.492: DFBPPR3456 ---- Plant proteins ---- Maturase K
Source.493: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.494: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.495: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73
Source.496: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600
Source.497: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2
Source.498: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.499: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.500: DFBPPR3498 ---- Plant proteins ---- Actin-related protein 6
Source.501: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600
Source.502: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.503: DFBPPR3508 ---- Plant proteins ---- 60S ribosomal protein L5-1
Source.504: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.505: DFBPPR3542 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 2
Source.506: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.507: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.508: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B
Source.509: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.510: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.511: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.512: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.513: DFBPPR3593 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 1
Source.514: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3
Source.515: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.516: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.517: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.518: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1
Source.519: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a
Source.520: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3
Source.521: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.522: DFBPPR3652 ---- Plant proteins ---- Nucleosome assembly protein 1;3
Source.523: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.524: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J
Source.525: DFBPPR3665 ---- Plant proteins ---- Calcineurin B-like protein 10
Source.526: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.527: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29
Source.528: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic
Source.529: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.530: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.531: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.532: DFBPPR3680 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.533: DFBPPR3687 ---- Plant proteins ---- Two-component response regulator ORR41
Source.534: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.535: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6
Source.536: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.537: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11
Source.538: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.539: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.540: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.541: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1
Source.542: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1
Source.543: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.544: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.545: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8
Source.546: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900
Source.547: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.548: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.549: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.550: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.551: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.552: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.553: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.554: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B
Source.555: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.556: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.557: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.558: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4
Source.559: DFBPPR3833 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-1 catalytic subunit
Source.560: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.561: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.562: DFBPPR3850 ---- Plant proteins ---- Probable protein phosphatase 2C 73
Source.563: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.564: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.565: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.566: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.567: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.568: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1
Source.569: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.570: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11
Source.571: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4
Source.572: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.573: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6
Source.574: DFBPPR3922 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-4 catalytic subunit
Source.575: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2
Source.576: DFBPPR3933 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-2 catalytic subunit
Source.577: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.578: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.579: DFBPPR3958 ---- Plant proteins ---- Probable U6 snRNA-associated Sm-like protein LSm4
Source.580: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.581: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3
Source.582: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.583: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.584: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4
Source.585: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A
Source.586: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.587: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9
Source.588: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2
Source.589: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4
Source.590: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.591: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.592: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog
Source.593: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1
Source.594: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog
Source.595: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.596: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.597: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic
Source.598: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2
Source.599: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8
Source.600: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.601: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.602: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1
Source.603: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3
Source.604: DFBPPR4109 ---- Plant proteins ---- 60S ribosomal protein L5-2
Source.605: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2
Source.606: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2
Source.607: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1
Source.608: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49
Source.609: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.610: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.611: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.612: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.613: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.614: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.615: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2
Source.616: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.617: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.618: DFBPPR4213 ---- Plant proteins ---- Mitochondrial import inner membrane translocase subunit Tim9
Source.619: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic
Source.620: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1
Source.621: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.622: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.623: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic
Source.624: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.625: DFBPPR4263 ---- Plant proteins ---- Putative protein phosphatase 2C 63
Source.626: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.627: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3
Source.628: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.629: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial
Source.630: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.631: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.632: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3
Source.633: DFBPPR4294 ---- Plant proteins ---- Nucleosome assembly protein 1-like 4
Source.634: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5
Source.635: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.636: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.637: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.638: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.639: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.640: DFBPPR4364 ---- Plant proteins ---- Two-component response regulator ORR42
Source.641: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.642: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.643: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.644: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.645: DFBPPR4372 ---- Plant proteins ---- NAP1-related protein 2
Source.646: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.647: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9
Source.648: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.649: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8
Source.650: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.651: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.652: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.653: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4
Source.654: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic
Source.655: DFBPPR4521 ---- Plant proteins ---- Probable aldo-keto reductase 3
Source.656: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2
Source.657: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.658: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.659: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14
Source.660: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog
Source.661: DFBPPR4554 ---- Plant proteins ---- Zinc finger AN1 and C2H2 domain-containing stress-associated protein 16
Source.662: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.663: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H
Source.664: DFBPPR4560 ---- Plant proteins ---- Tubby-like F-box protein 10
Source.665: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.666: DFBPPR4584 ---- Plant proteins ---- Probable calcium-binding protein CML29
Source.667: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.668: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.669: DFBPPR4605 ---- Plant proteins ---- Protein LOL4
Source.670: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3
Source.671: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1
Source.672: DFBPPR4646 ---- Plant proteins ---- 40S ribosomal protein S13-1
Source.673: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.674: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1
Source.675: DFBPPR4702 ---- Plant proteins ---- Uncharacterized protein ycf73
Source.676: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51
Source.677: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.678: DFBPPR4730 ---- Plant proteins ---- 40S ribosomal protein S13-2
Source.679: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.680: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400
Source.681: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57
Source.682: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4
Source.683: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900
Source.684: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20
Source.685: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b
Source.686: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a
Source.687: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36
Source.688: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2
Source.689: DFBPPR4864 ---- Plant proteins ---- Putative B3 domain-containing protein Os11g0625400
Source.690: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.691: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1
Source.692: DFBPPR4871 ---- Plant proteins ---- Putative B3 domain-containing protein Os11g0242900
Source.693: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64
Source.694: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic
Source.695: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.696: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.697: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.698: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.699: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.700: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1
Source.701: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.702: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.703: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.704: DFBPPR4984 ---- Plant proteins ---- Histone acetyltransferase TAP1
Source.705: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.706: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.707: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.708: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.709: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.710: DFBPPR5021 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.711: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.712: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2
Source.713: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.714: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.715: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.716: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.717: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.718: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.719: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.720: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.721: DFBPPR5081 ---- Plant proteins ---- Proteasome subunit alpha type-5
Source.722: DFBPPR5082 ---- Plant proteins ---- Catalase-4
Source.723: DFBPPR5086 ---- Plant proteins ---- Catalase-3
Source.724: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.725: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.726: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.727: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog
Source.728: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.729: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.730: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7
Source.731: DFBPPR5127 ---- Plant proteins ---- Pathogenesis-related protein 10
Source.732: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.733: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2
Source.734: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.735: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.736: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.737: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.738: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.739: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6
Source.740: DFBPPR5188 ---- Plant proteins ---- Omega-3 fatty acid desaturase, endoplasmic reticulum
Source.741: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.742: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.743: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.744: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.745: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.746: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.747: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.748: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase
Source.749: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.750: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.751: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70
Source.752: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.753: DFBPPR5304 ---- Plant proteins ---- Maturase K
Source.754: DFBPPR5319 ---- Plant proteins ---- Nodulin-22
Source.755: DFBPPR5336 ---- Plant proteins ---- Nodulin-26B
Source.756: DFBPPR5338 ---- Plant proteins ---- 40S ribosomal protein S13
Source.757: DFBPPR5352 ---- Plant proteins ---- Nodulin-27
Source.758: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.759: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.760: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.761: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.762: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase
Source.763: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A
Source.764: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.765: DFBPPR5417 ---- Plant proteins ---- Profilin-3
Source.766: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit
Source.767: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6
Source.768: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.769: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.770: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic
Source.771: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.772: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.773: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.774: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.775: DFBPPR5532 ---- Plant proteins ---- Farnesyl pyrophosphate synthase
Source.776: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1
Source.777: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase
Source.778: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.779: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1
Source.780: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.781: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10
Source.782: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.783: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.784: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.785: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3
Source.786: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.787: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.788: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.789: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10
Source.790: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.791: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.792: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6
Source.793: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic
Source.794: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.795: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1
Source.796: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.797: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.798: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic
Source.799: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.800: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.801: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.802: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.803: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.804: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.805: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.806: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.807: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.808: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.809: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic
Source.810: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.811: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.812: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.813: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.814: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.815: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.816: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.817: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic
Source.818: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1
Source.819: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.820: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2
Source.821: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1
Source.822: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.823: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.824: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.825: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.826: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.827: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.828: DFBPPR5790 ---- Plant proteins ---- Benzoate O-methyltransferase
Source.829: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B
Source.830: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase
Source.831: DFBPPR5811 ---- Plant proteins ---- ATP synthase subunit a
Source.832: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.833: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2
Source.834: DFBPPR5846 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.835: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase
Source.836: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.837: DFBPPR5853 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.838: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.839: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.840: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.841: DFBPPR5864 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.842: DFBPPR5878 ---- Plant proteins ---- Ocs element-binding factor 1
Source.843: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.844: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.845: DFBPPR5898 ---- Plant proteins ---- ATP synthase protein MI25
Source.846: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.847: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.848: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.849: DFBPPR5964 ---- Plant proteins ---- IN2-2 protein
Source.850: DFBPPR5975 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.851: DFBPPR5986 ---- Plant proteins ---- Beta-amylase
Source.852: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.853: DFBPPR6019 ---- Plant proteins ---- Inactive beta selinene synthase
Source.854: DFBPPR6061 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.855: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1
Source.856: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.857: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.858: DFBPPR6133 ---- Plant proteins ---- 40S ribosomal protein S13
Source.859: DFBPPR6143 ---- Plant proteins ---- Uncharacterized protein ycf73
Source.860: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA
Source.861: DFBPPR6185 ---- Plant proteins ---- Unknown protein from spot 415 of 2D-PAGE of etiolated coleoptile
Source.862: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic
Source.863: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.864: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.865: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.866: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.867: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.868: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.869: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.870: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64
Source.871: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.872: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.873: DFBPPR6310 ---- Plant proteins ---- Catalase
Source.874: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.875: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.876: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.877: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5
Source.878: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.879: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic
Source.880: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic
Source.881: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.882: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.883: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.884: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.885: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.886: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.887: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.888: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.889: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.890: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic
Source.891: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.892: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.893: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.894: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic
Source.895: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.896: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic
Source.897: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.898: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.899: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.900: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.901: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.902: DFBPPR6453 ---- Plant proteins ---- Convicilin
Source.903: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.904: DFBPPR6458 ---- Plant proteins ---- Convicilin
Source.905: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.906: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.907: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.908: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.909: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.910: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A
Source.911: DFBPPR6585 ---- Plant proteins ---- 40S ribosomal protein S13
Source.912: DFBPPR6586 ---- Plant proteins ---- 60S ribosomal protein L34
Source.913: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase
Source.914: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1
Source.915: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.916: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase
Source.917: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.918: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.919: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.920: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic
Source.921: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1
Source.922: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase
Source.923: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.924: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.925: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.926: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.927: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.928: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.929: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.930: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.931: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic
Source.932: DFBPPR6762 ---- Plant proteins ---- Nuclear ribonuclease Z
Source.933: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6
Source.934: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.935: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a
Source.936: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.937: DFBPPR6812 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.938: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.939: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.940: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.941: DFBPPR6835 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 1, chloroplastic
Source.942: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.943: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A
Source.944: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta
Source.945: DFBPPR6856 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 3, chloroplastic
Source.946: DFBPPR6857 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 2, chloroplastic
Source.947: DFBPPR6881 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.948: DFBPPR6902 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.949: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant
Source.950: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.951: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.952: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.953: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic
Source.954: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.955: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase
Source.956: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.957: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.958: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.959: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.960: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6
Source.961: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.962: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial
Source.963: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.964: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.965: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.966: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3
Source.967: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9
Source.968: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.969: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.970: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.971: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.972: DFBPPR7207 ---- Plant proteins ---- Profilin-1
Source.973: DFBPPR7266 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.974: DFBPPR7277 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor-2B
Source.975: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3
Source.976: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2
Source.977: DFBPPR7311 ---- Plant proteins ---- B1-hordein
Source.978: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein
Source.979: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.980: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.981: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.982: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.983: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.984: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a
Source.985: DFBPPR7424 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 A, chloroplastic
Source.986: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.987: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic
Source.988: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic
Source.989: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4
Source.990: DFBPPR7458 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase
Source.991: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.992: DFBPPR7461 ---- Plant proteins ---- Shaggy-related protein kinase theta
Source.993: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.994: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum
Source.995: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.996: DFBPPR7488 ---- Plant proteins ---- Homeobox protein HD1
Source.997: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.998: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.999: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.1000: DFBPPR7528 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.1001: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.1002: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.1003: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1
Source.1004: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.1005: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2
Source.1006: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.1007: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.1008: DFBPPR7637 ---- Milk proteins ---- Perilipin-2
Source.1009: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1
Source.1010: DFBPPR7659 ---- Milk proteins ---- Glycosylation-dependent cell adhesion molecule 1
Source.1011: DFBPPR7691 ---- Milk proteins ---- Albumin
Source.1012: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.1013: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.1014: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.1015: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1016: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.1017: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase
Source.1018: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.1019: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.1020: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101
Source.1021: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.1022: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2
Source.1023: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B
Source.1024: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1025: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.1026: DFBPPR8448 ---- Plant proteins ---- Maturase K
Source.1027: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4
Source.1028: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.1029: DFBPPR8511 ---- Milk proteins ---- Transcobalamin-2
Source.1030: DFBPPR8515 ---- Milk proteins ---- Vitamin D3 receptor
Source.1031: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.1032: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1
Source.1033: DFBPPR15936 ---- Animal proteins ---- Apolipoprotein E
Source.1034: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.1035: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.1036: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.1037: DFBPPR15952 ---- Animal proteins ---- Galectin-3
Source.1038: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.1039: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.1040: DFBPPR15968 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain
Source.1041: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.1042: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.1043: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2
Source.1044: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1045: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.1046: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1047: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1048: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1049: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV
Source.1050: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.1051: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.1052: DFBPPR16028 ---- Animal proteins ---- Presenilin-1
Source.1053: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1054: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.1055: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.1056: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.1057: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta
Source.1058: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.1059: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.1060: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type
Source.1061: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.1062: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2
Source.1063: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.1064: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.1065: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO
Source.1066: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.1067: DFBPPR16115 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1
Source.1068: DFBPPR16116 ---- Animal proteins ---- Kit ligand
Source.1069: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.1070: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.1071: DFBPPR16148 ---- Animal proteins ---- Haptoglobin
Source.1072: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.1073: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.1074: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.1075: DFBPPR16186 ---- Animal proteins ---- Parathyroid hormone
Source.1076: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1077: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.1078: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.1079: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1
Source.1080: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1081: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.1082: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.1083: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.1084: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.1085: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.1086: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2
Source.1087: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1088: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta
Source.1089: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.1090: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.1091: DFBPPR16279 ---- Animal proteins ---- Galactokinase
Source.1092: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68
Source.1093: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.1094: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1095: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21
Source.1096: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.1097: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.1098: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41
Source.1099: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.1100: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.1101: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.1102: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.1103: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.1104: DFBPPR16435 ---- Animal proteins ---- S-arrestin
Source.1105: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1106: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11
Source.1107: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.1108: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.1109: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1110: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.1111: DFBPPR16515 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.1112: DFBPPR16518 ---- Animal proteins ---- Keratin, type II cytoskeletal 2 epidermal
Source.1113: DFBPPR16526 ---- Animal proteins ---- Insulin
Source.1114: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.1115: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.1116: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.1117: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.1118: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.1119: DFBPPR16604 ---- Animal proteins ---- Biglycan
Source.1120: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1121: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1
Source.1122: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.1123: DFBPPR16633 ---- Animal proteins ---- DnaJ homolog subfamily C member 1
Source.1124: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1125: DFBPPR16654 ---- Animal proteins ---- Serine protease inhibitor Kazal-type 1
Source.1126: DFBPPR16683 ---- Animal proteins ---- Oocyte-expressed protein
Source.1127: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.1128: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.1129: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.1130: DFBPPR16722 ---- Animal proteins ---- Ig heavy chain V region MOO
Source.1131: DFBPPR16723 ---- Animal proteins ---- Ig heavy chain V region GOM
Source.1132: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase
Source.1133: DFBPPR16773 ---- Animal proteins ---- Hemoglobin subunit alpha-A
Source.1134: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.1135: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.1136: DFBPPR16797 ---- Animal proteins ---- Albumin
Source.1137: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.1138: DFBPPR16827 ---- Animal proteins ---- S-arrestin
Source.1139: DFBPPR16835 ---- Animal proteins ---- Insulin
Source.1140: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.1141: DFBPPR16847 ---- Animal proteins ---- Fibrinogen alpha chain
Source.1142: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.1143: DFBPPR16852 ---- Animal proteins ---- Cytochrome b
Source.1144: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.1145: DFBPPR16861 ---- Animal proteins ---- Adenylate kinase 2, mitochondrial
Source.1146: DFBPPR16863 ---- Animal proteins ---- Biglycan
Source.1147: DFBPPR16865 ---- Animal proteins ---- Apolipoprotein E
Source.1148: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.1149: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor
Source.1150: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.1151: DFBPPR16905 ---- Animal proteins ---- Fatty acid-binding protein 5
Source.1152: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV
Source.1153: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial
Source.1154: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.1155: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1156: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.1157: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.1158: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.1159: DFBPPR16947 ---- Animal proteins ---- Polyadenylate-binding protein 2
Source.1160: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.1161: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.1162: DFBPPR16972 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-2
Source.1163: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.1164: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.1165: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.1166: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.1167: DFBPPR17005 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.1168: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2
Source.1169: DFBPPR17013 ---- Animal proteins ---- Presenilin-1
Source.1170: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.1171: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.1172: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.1173: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.1174: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1175: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.1176: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1177: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.1178: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.1179: DFBPPR17083 ---- Animal proteins ---- Cyclin-dependent kinase 5 activator 1
Source.1180: DFBPPR17090 ---- Animal proteins ---- Phakinin
Source.1181: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2
Source.1182: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.1183: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A
Source.1184: DFBPPR17107 ---- Animal proteins ---- High affinity immunoglobulin epsilon receptor subunit gamma
Source.1185: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.1186: DFBPPR17118 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1
Source.1187: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.1188: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1189: DFBPPR17132 ---- Animal proteins ---- Apolipoprotein A-II
Source.1190: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein
Source.1191: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1
Source.1192: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.1193: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.1194: DFBPPR17192 ---- Animal proteins ---- Kit ligand
Source.1195: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.1196: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.1197: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35
Source.1198: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.1199: DFBPPR17268 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.1200: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.1201: DFBPPR17276 ---- Animal proteins ---- Synaptosomal-associated protein 25
Source.1202: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1
Source.1203: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.1204: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1205: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1206: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.1207: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3
Source.1208: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.1209: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.1210: DFBPPR17335 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, liver type
Source.1211: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1212: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.1213: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.1214: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.1215: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.1216: DFBPPR17361 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2
Source.1217: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.1218: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1
Source.1219: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.1220: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial
Source.1221: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.1222: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.1223: DFBPPR17432 ---- Animal proteins ---- Ephrin-A1
Source.1224: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.1225: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.1226: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1
Source.1227: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.1228: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1229: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.1230: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial
Source.1231: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.1232: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.1233: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2
Source.1234: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.1235: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.1236: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase
Source.1237: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.1238: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.1239: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C
Source.1240: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.1241: DFBPPR17503 ---- Animal proteins ---- Syntaxin-1A
Source.1242: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.1243: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1244: DFBPPR17524 ---- Animal proteins ---- DnaJ homolog subfamily A member 1
Source.1245: DFBPPR17534 ---- Animal proteins ---- RISC-loading complex subunit TARBP2
Source.1246: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.1247: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.1248: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.1249: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1
Source.1250: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.1251: DFBPPR17561 ---- Animal proteins ---- Aquaporin-4
Source.1252: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.1253: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta
Source.1254: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1
Source.1255: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.1256: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.1257: DFBPPR17614 ---- Animal proteins ---- E3 ubiquitin-protein ligase ARIH1
Source.1258: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.1259: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.1260: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1
Source.1261: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.1262: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.1263: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B
Source.1264: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.1265: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.1266: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.1267: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.1268: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.1269: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.1270: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.1271: DFBPPR17795 ---- Animal proteins ---- Acyl-coenzyme A thioesterase THEM4
Source.1272: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.1273: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.1274: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6
Source.1275: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.1276: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.1277: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.1278: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase
Source.1279: DFBPPR17824 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 9
Source.1280: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.1281: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.1282: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3
Source.1283: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.1284: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.1285: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.1286: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.1287: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.1288: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.1289: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.1290: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.1291: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1292: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.1293: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB
Source.1294: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.1295: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.1296: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.1297: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1298: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT
Source.1299: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.1300: DFBPPR17940 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM38
Source.1301: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.1302: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.1303: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.1304: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.1305: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.1306: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.1307: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.1308: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor
Source.1309: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.1310: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase
Source.1311: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.1312: DFBPPR18001 ---- Animal proteins ---- Syntaxin-1B
Source.1313: DFBPPR18008 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF144B
Source.1314: DFBPPR18028 ---- Animal proteins ---- Atlastin-1
Source.1315: DFBPPR18034 ---- Animal proteins ---- E3 SUMO-protein ligase NSE2
Source.1316: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1317: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.1318: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8
Source.1319: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.1320: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1
Source.1321: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33
Source.1322: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.1323: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1
Source.1324: DFBPPR18111 ---- Animal proteins ---- Transcriptional adapter 3
Source.1325: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38
Source.1326: DFBPPR18116 ---- Animal proteins ---- Carbonic anhydrase 4
Source.1327: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.1328: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.1329: DFBPPR18150 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 1
Source.1330: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.1331: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25
Source.1332: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5
Source.1333: DFBPPR18203 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-7
Source.1334: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.1335: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4
Source.1336: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi
Source.1337: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7
Source.1338: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.1339: DFBPPR18256 ---- Animal proteins ---- Proteasome subunit beta type-10
Source.1340: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.1341: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6
Source.1342: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2
Source.1343: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.1344: DFBPPR18281 ---- Animal proteins ---- CD63 antigen
Source.1345: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1346: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.1347: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.1348: DFBPPR18311 ---- Animal proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.1349: DFBPPR18315 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.1350: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.1351: DFBPPR18325 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.1352: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase
Source.1353: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.1354: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a
Source.1355: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor
Source.1356: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1
Source.1357: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.1358: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B
Source.1359: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.1360: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.1361: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.1362: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.1363: DFBPPR18371 ---- Animal proteins ---- F-actin-capping protein subunit beta
Source.1364: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5
Source.1365: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.1366: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.1367: DFBPPR18388 ---- Animal proteins ---- Elongation factor Tu, mitochondrial
Source.1368: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.1369: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.1370: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor
Source.1371: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.1372: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.1373: DFBPPR18434 ---- Animal proteins ---- Interferon beta-3
Source.1374: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.1375: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.1376: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.1377: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component
Source.1378: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1
Source.1379: DFBPPR18492 ---- Animal proteins ---- ADP-ribosylation factor-like protein 1
Source.1380: DFBPPR18502 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.1381: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8
Source.1382: DFBPPR18516 ---- Animal proteins ---- Galactokinase
Source.1383: DFBPPR18518 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP1
Source.1384: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.1385: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.1386: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.1387: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.1388: DFBPPR18540 ---- Animal proteins ---- Fibroblast growth factor-binding protein 1
Source.1389: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial
Source.1390: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.1391: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.1392: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.1393: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit
Source.1394: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2
Source.1395: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.1396: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.1397: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1
Source.1398: DFBPPR18616 ---- Animal proteins ---- Organic solute transporter subunit alpha
Source.1399: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.1400: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.1401: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1
Source.1402: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.1403: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor
Source.1404: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.1405: DFBPPR18728 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 5
Source.1406: DFBPPR18732 ---- Animal proteins ---- RNA-binding protein 8A
Source.1407: DFBPPR18734 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF114
Source.1408: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.1409: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7
Source.1410: DFBPPR18746 ---- Animal proteins ---- Anamorsin
Source.1411: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.1412: DFBPPR18763 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.1413: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.1414: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.1415: DFBPPR18782 ---- Animal proteins ---- Parathyroid hormone
Source.1416: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.1417: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.1418: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav
Source.1419: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8
Source.1420: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.1421: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.1422: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.1423: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.1424: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1
Source.1425: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma
Source.1426: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.1427: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1428: DFBPPR18849 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF3
Source.1429: DFBPPR18853 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor D
Source.1430: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.1431: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.1432: DFBPPR18868 ---- Animal proteins ---- Haptoglobin
Source.1433: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.1434: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.1435: DFBPPR18881 ---- Animal proteins ---- Proteasome subunit beta type-4
Source.1436: DFBPPR18898 ---- Animal proteins ---- Complexin-3
Source.1437: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.1438: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.1439: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11
Source.1440: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.1441: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.1442: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.1443: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B
Source.1444: DFBPPR18937 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2-binding protein
Source.1445: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.1446: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.1447: DFBPPR18952 ---- Animal proteins ---- Serotransferrin
Source.1448: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.1449: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.1450: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase
Source.1451: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb
Source.1452: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.1453: DFBPPR18984 ---- Animal proteins ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.1454: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase
Source.1455: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6
Source.1456: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.1457: DFBPPR18994 ---- Animal proteins ---- Breast cancer anti-estrogen resistance protein 3 homolog
Source.1458: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74
Source.1459: DFBPPR19010 ---- Animal proteins ---- Peroxisomal biogenesis factor 19
Source.1460: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2
Source.1461: DFBPPR19016 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.1462: DFBPPR19022 ---- Animal proteins ---- Spermatogenesis-defective protein 39 homolog
Source.1463: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.1464: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.1465: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.1466: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11
Source.1467: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.1468: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.1469: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.1470: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.1471: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.1472: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1
Source.1473: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.1474: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.1475: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.1476: DFBPPR19124 ---- Animal proteins ---- Neuroguidin
Source.1477: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1
Source.1478: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like
Source.1479: DFBPPR19165 ---- Animal proteins ---- Tropomyosin beta chain
Source.1480: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.1481: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3
Source.1482: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase
Source.1483: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1484: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2
Source.1485: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.1486: DFBPPR19198 ---- Animal proteins ---- Cadherin-3
Source.1487: DFBPPR19212 ---- Animal proteins ---- Nucleosome assembly protein 1-like 1
Source.1488: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.1489: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.1490: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.1491: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog
Source.1492: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1
Source.1493: DFBPPR19242 ---- Animal proteins ---- Tryptophan 2,3-dioxygenase
Source.1494: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase
Source.1495: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.1496: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B
Source.1497: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.1498: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.1499: DFBPPR19256 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3-like
Source.1500: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.1501: DFBPPR19260 ---- Animal proteins ---- rRNA N6-adenosine-methyltransferase ZCCHC4
Source.1502: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.1503: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D
Source.1504: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.1505: DFBPPR19313 ---- Animal proteins ---- Vitamin K epoxide reductase complex subunit 1
Source.1506: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.1507: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2
Source.1508: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1509: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.1510: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog
Source.1511: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.1512: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129
Source.1513: DFBPPR19391 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein A
Source.1514: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.1515: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.1516: DFBPPR19422 ---- Animal proteins ---- Syntaxin-19
Source.1517: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.1518: DFBPPR19429 ---- Animal proteins ---- Protein Spindly
Source.1519: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.1520: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.1521: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.1522: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.1523: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.1524: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.1525: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1
Source.1526: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.1527: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.1528: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.1529: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.1530: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain
Source.1531: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.1532: DFBPPR19484 ---- Animal proteins ---- Protein lin-7 homolog B
Source.1533: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1
Source.1534: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.1535: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.1536: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.1537: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.1538: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.1539: DFBPPR19520 ---- Animal proteins ---- Ferritin light chain
Source.1540: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1
Source.1541: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A
Source.1542: DFBPPR19530 ---- Animal proteins ---- Tuftelin
Source.1543: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase
Source.1544: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3
Source.1545: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase
Source.1546: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2
Source.1547: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20
Source.1548: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.1549: DFBPPR19592 ---- Animal proteins ---- Ras-related protein Rab-18
Source.1550: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.1551: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.1552: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS
Source.1553: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1
Source.1554: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5
Source.1555: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta
Source.1556: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.1557: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.1558: DFBPPR19659 ---- Animal proteins ---- 39S ribosomal protein L9, mitochondrial
Source.1559: DFBPPR19667 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 2
Source.1560: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.1561: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.1562: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1
Source.1563: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.1564: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.1565: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.1566: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1
Source.1567: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase
Source.1568: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1
Source.1569: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.1570: DFBPPR19776 ---- Animal proteins ---- Tropomyosin alpha-3 chain
Source.1571: DFBPPR19780 ---- Animal proteins ---- Molybdopterin synthase catalytic subunit
Source.1572: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.1573: DFBPPR19801 ---- Animal proteins ---- Outer dense fiber protein 2
Source.1574: DFBPPR19804 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 2
Source.1575: DFBPPR19807 ---- Animal proteins ---- Spermine synthase
Source.1576: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2
Source.1577: DFBPPR19830 ---- Animal proteins ---- Sesquipedalian-2
Source.1578: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.1579: DFBPPR19837 ---- Animal proteins ---- Ribonuclease P protein subunit p30
Source.1580: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.1581: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C
Source.1582: DFBPPR19863 ---- Animal proteins ---- Dihydropteridine reductase
Source.1583: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.1584: DFBPPR19870 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.1585: DFBPPR19873 ---- Animal proteins ---- Syntaxin-8
Source.1586: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.1587: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27
Source.1588: DFBPPR19912 ---- Animal proteins ---- GrpE protein homolog 1, mitochondrial
Source.1589: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.1590: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.1591: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2
Source.1592: DFBPPR19935 ---- Animal proteins ---- Reticulon-3
Source.1593: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40
Source.1594: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial
Source.1595: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter
Source.1596: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2
Source.1597: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.1598: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein
Source.1599: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3
Source.1600: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16
Source.1601: DFBPPR20012 ---- Animal proteins ---- Zinc transporter ZIP12
Source.1602: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.1603: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7
Source.1604: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.1605: DFBPPR20061 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8
Source.1606: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26
Source.1607: DFBPPR20072 ---- Animal proteins ---- Adenine phosphoribosyltransferase
Source.1608: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.1609: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B
Source.1610: DFBPPR20092 ---- Animal proteins ---- Peptidyl-tRNA hydrolase 2, mitochondrial
Source.1611: DFBPPR20139 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm4
Source.1612: DFBPPR20148 ---- Animal proteins ---- Integrin-linked kinase-associated serine/threonine phosphatase 2C
Source.1613: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1
Source.1614: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.1615: DFBPPR20188 ---- Animal proteins ---- Protein S100-A16
Source.1616: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.1617: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial
Source.1618: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B
Source.1619: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1
Source.1620: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.1621: DFBPPR20233 ---- Animal proteins ---- Beta-catenin-like protein 1
Source.1622: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.1623: DFBPPR20245 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial
Source.1624: DFBPPR20254 ---- Animal proteins ---- Leukemia inhibitory factor
Source.1625: DFBPPR20257 ---- Animal proteins ---- Targeting protein for Xklp2
Source.1626: DFBPPR20274 ---- Animal proteins ---- Phospholipase A1 member A
Source.1627: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.1628: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.1629: DFBPPR20288 ---- Animal proteins ---- Golgi phosphoprotein 3-like
Source.1630: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.1631: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.1632: DFBPPR20305 ---- Animal proteins ---- Nostrin
Source.1633: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.1634: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.1635: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.1636: DFBPPR20336 ---- Animal proteins ---- 39S ribosomal protein L22, mitochondrial
Source.1637: DFBPPR20337 ---- Animal proteins ---- CST complex subunit STN1
Source.1638: DFBPPR20350 ---- Animal proteins ---- Pinin
Source.1639: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.1640: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.1641: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4
Source.1642: DFBPPR20393 ---- Animal proteins ---- Putative nuclease HARBI1
Source.1643: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.1644: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4
Source.1645: DFBPPR20413 ---- Animal proteins ---- 10 kDa heat shock protein, mitochondrial
Source.1646: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein
Source.1647: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.1648: DFBPPR20428 ---- Animal proteins ---- Rab effector Noc2
Source.1649: DFBPPR20435 ---- Animal proteins ---- Leucine-rich glioma-inactivated protein 1
Source.1650: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.1651: DFBPPR20442 ---- Animal proteins ---- DNA replication complex GINS protein SLD5
Source.1652: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.1653: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2
Source.1654: DFBPPR20482 ---- Animal proteins ---- Tripartite motif-containing protein 54
Source.1655: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.1656: DFBPPR20497 ---- Animal proteins ---- Serine/Arginine-related protein 53
Source.1657: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29
Source.1658: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.1659: DFBPPR20529 ---- Animal proteins ---- Transgelin
Source.1660: DFBPPR20541 ---- Animal proteins ---- Lambda-crystallin homolog
Source.1661: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.1662: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.1663: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3
Source.1664: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.1665: DFBPPR20556 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.1666: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta
Source.1667: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.1668: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.1669: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2
Source.1670: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase
Source.1671: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.1672: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.1673: DFBPPR20645 ---- Animal proteins ---- Eukaryotic translation initiation factor 1
Source.1674: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial
Source.1675: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.1676: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.1677: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease
Source.1678: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14
Source.1679: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10
Source.1680: DFBPPR20690 ---- Animal proteins ---- Neurotrimin
Source.1681: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog
Source.1682: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial
Source.1683: DFBPPR20702 ---- Animal proteins ---- 5-azacytidine-induced protein 2
Source.1684: DFBPPR20705 ---- Animal proteins ---- Anaphase-promoting complex subunit 10
Source.1685: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.1686: DFBPPR20708 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 beta
Source.1687: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.1688: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21
Source.1689: DFBPPR20733 ---- Animal proteins ---- Integrator complex subunit 12
Source.1690: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.1691: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5
Source.1692: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.1693: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.1694: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial
Source.1695: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.1696: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.1697: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.1698: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.1699: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12
Source.1700: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24
Source.1701: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.1702: DFBPPR20844 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.1703: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.1704: DFBPPR20861 ---- Animal proteins ---- Zinc finger protein 135
Source.1705: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta
Source.1706: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1
Source.1707: DFBPPR20883 ---- Animal proteins ---- Pre-mRNA-splicing factor 38A
Source.1708: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1709: DFBPPR20898 ---- Animal proteins ---- Transaldolase
Source.1710: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1
Source.1711: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.1712: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.1713: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1
Source.1714: DFBPPR20947 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.1715: DFBPPR20957 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial
Source.1716: DFBPPR20958 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial
Source.1717: DFBPPR20959 ---- Animal proteins ---- Janus kinase and microtubule-interacting protein 1
Source.1718: DFBPPR20972 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP11
Source.1719: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1720: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.1721: DFBPPR20993 ---- Animal proteins ---- 39S ribosomal protein L12, mitochondrial
Source.1722: DFBPPR20996 ---- Animal proteins ---- Tripartite motif-containing protein 44
Source.1723: DFBPPR20997 ---- Animal proteins ---- Prefoldin subunit 2
Source.1724: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.1725: DFBPPR21013 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit D
Source.1726: DFBPPR21019 ---- Animal proteins ---- Thioredoxin domain-containing protein 9
Source.1727: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.1728: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.1729: DFBPPR21053 ---- Animal proteins ---- V-type proton ATPase subunit D
Source.1730: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C
Source.1731: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.1732: DFBPPR21074 ---- Animal proteins ---- Cancer-related nucleoside-triphosphatase homolog
Source.1733: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.1734: DFBPPR21080 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim22
Source.1735: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7
Source.1736: DFBPPR21083 ---- Animal proteins ---- TRAF-interacting protein with FHA domain-containing protein A
Source.1737: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.1738: DFBPPR21107 ---- Animal proteins ---- Proteasome assembly chaperone 2
Source.1739: DFBPPR21108 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.1740: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.1741: DFBPPR21146 ---- Animal proteins ---- Arylamine N-acetyltransferase 1
Source.1742: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel
Source.1743: DFBPPR21165 ---- Animal proteins ---- Protein canopy homolog 3
Source.1744: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A
Source.1745: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.1746: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1
Source.1747: DFBPPR21205 ---- Animal proteins ---- ATP synthase mitochondrial F1 complex assembly factor 2
Source.1748: DFBPPR21211 ---- Animal proteins ---- TLR adapter interacting with SLC15A4 on the lysosome
Source.1749: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1
Source.1750: DFBPPR21245 ---- Animal proteins ---- Cilia- and flagella-associated protein 36
Source.1751: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5
Source.1752: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B
Source.1753: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6
Source.1754: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.1755: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2
Source.1756: DFBPPR21291 ---- Animal proteins ---- 39S ribosomal protein L18, mitochondrial
Source.1757: DFBPPR21293 ---- Animal proteins ---- IST1 homolog
Source.1758: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.1759: DFBPPR21301 ---- Animal proteins ---- Lymphocyte antigen 6D
Source.1760: DFBPPR21303 ---- Animal proteins ---- Palmdelphin
Source.1761: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein
Source.1762: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4
Source.1763: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34
Source.1764: DFBPPR21332 ---- Animal proteins ---- ER membrane protein complex subunit 4
Source.1765: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.1766: DFBPPR21348 ---- Animal proteins ---- Transmembrane protein 204
Source.1767: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.1768: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18
Source.1769: DFBPPR21373 ---- Animal proteins ---- Zinc finger protein 2
Source.1770: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2
Source.1771: DFBPPR21395 ---- Animal proteins ---- Elongation factor Ts, mitochondrial
Source.1772: DFBPPR21397 ---- Animal proteins ---- Leucine zipper transcription factor-like protein 1
Source.1773: DFBPPR21402 ---- Animal proteins ---- Pyridoxal phosphate phosphatase PHOSPHO2
Source.1774: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.1775: DFBPPR21407 ---- Animal proteins ---- Ribosome biogenesis protein BRX1 homolog
Source.1776: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.1777: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.1778: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B
Source.1779: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.1780: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2
Source.1781: DFBPPR21439 ---- Animal proteins ---- Mapk-regulated corepressor-interacting protein 1
Source.1782: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2
Source.1783: DFBPPR21450 ---- Animal proteins ---- Nuclear ubiquitous casein and cyclin-dependent kinase substrate 1
Source.1784: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.1785: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.1786: DFBPPR21489 ---- Animal proteins ---- Pre-mRNA-splicing factor 18
Source.1787: DFBPPR21491 ---- Animal proteins ---- CUE domain-containing protein 2
Source.1788: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.1789: DFBPPR21501 ---- Animal proteins ---- Peroxisomal biogenesis factor 3
Source.1790: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3
Source.1791: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1
Source.1792: DFBPPR21535 ---- Animal proteins ---- Gastrotropin
Source.1793: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8
Source.1794: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.1795: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1
Source.1796: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.1797: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.1798: DFBPPR21589 ---- Animal proteins ---- Dynein regulatory complex protein 10
Source.1799: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2
Source.1800: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.1801: DFBPPR21601 ---- Animal proteins ---- Haloacid dehalogenase-like hydrolase domain-containing protein 2
Source.1802: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.1803: DFBPPR21622 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.1804: DFBPPR21650 ---- Animal proteins ---- Synaptonemal complex central element protein 1
Source.1805: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial
Source.1806: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8
Source.1807: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.1808: DFBPPR21667 ---- Animal proteins ---- Four and a half LIM domains protein 5
Source.1809: DFBPPR21670 ---- Animal proteins ---- V-type proton ATPase subunit E 2
Source.1810: DFBPPR21689 ---- Animal proteins ---- ADP-ribosylation factor-like protein 11
Source.1811: DFBPPR21693 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 18
Source.1812: DFBPPR21710 ---- Animal proteins ---- Differentially expressed in FDCP 8 homolog
Source.1813: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.1814: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7
Source.1815: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.1816: DFBPPR21751 ---- Animal proteins ---- Oocyte-expressed protein homolog
Source.1817: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.1818: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.1819: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.1820: DFBPPR21818 ---- Animal proteins ---- Zinc finger protein 410
Source.1821: DFBPPR21829 ---- Animal proteins ---- Mitochondrial 2-oxodicarboxylate carrier
Source.1822: DFBPPR21836 ---- Animal proteins ---- Potassium channel regulatory protein
Source.1823: DFBPPR21847 ---- Animal proteins ---- Protein Mpv17
Source.1824: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5
Source.1825: DFBPPR21867 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 5
Source.1826: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein
Source.1827: DFBPPR21875 ---- Animal proteins ---- Coiled-coil domain-containing protein 113
Source.1828: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2
Source.1829: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1
Source.1830: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.1831: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.1832: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein
Source.1833: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11
Source.1834: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.1835: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.1836: DFBPPR21977 ---- Animal proteins ---- Protein ARV1
Source.1837: DFBPPR21995 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 2
Source.1838: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.1839: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1
Source.1840: DFBPPR22011 ---- Animal proteins ---- 40S ribosomal protein S12
Source.1841: DFBPPR22020 ---- Animal proteins ---- Phosphotriesterase-related protein
Source.1842: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein
Source.1843: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.1844: DFBPPR22024 ---- Animal proteins ---- Motile sperm domain-containing protein 1
Source.1845: DFBPPR22031 ---- Animal proteins ---- KxDL motif-containing protein 1
Source.1846: DFBPPR22037 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2
Source.1847: DFBPPR22056 ---- Animal proteins ---- dTDP-D-glucose 4,6-dehydratase
Source.1848: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma
Source.1849: DFBPPR22066 ---- Animal proteins ---- Pyridoxal phosphate homeostasis protein
Source.1850: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.1851: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.1852: DFBPPR22076 ---- Animal proteins ---- Tetraspanin-6
Source.1853: DFBPPR22126 ---- Animal proteins ---- Zinc finger protein 572
Source.1854: DFBPPR22130 ---- Animal proteins ---- 60S ribosomal protein L9
Source.1855: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48
Source.1856: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.1857: DFBPPR22155 ---- Animal proteins ---- IQ domain-containing protein F1
Source.1858: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1
Source.1859: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.1860: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial
Source.1861: DFBPPR22198 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2
Source.1862: DFBPPR22218 ---- Animal proteins ---- Galectin-4
Source.1863: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1
Source.1864: DFBPPR22224 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 3
Source.1865: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5
Source.1866: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300
Source.1867: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.1868: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.1869: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3
Source.1870: DFBPPR22256 ---- Animal proteins ---- Proteolipid protein 2
Source.1871: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.1872: DFBPPR22306 ---- Animal proteins ---- p53 and DNA damage-regulated protein 1
Source.1873: DFBPPR22307 ---- Animal proteins ---- MORF4 family-associated protein 1
Source.1874: DFBPPR22319 ---- Animal proteins ---- Regulator of G-protein signaling 5
Source.1875: DFBPPR22320 ---- Animal proteins ---- Transmembrane protein 229B
Source.1876: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.1877: DFBPPR22334 ---- Animal proteins ---- Protein HP-25 homolog 1
Source.1878: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.1879: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.1880: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63
Source.1881: DFBPPR22349 ---- Animal proteins ---- PHD finger protein 11
Source.1882: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.1883: DFBPPR22364 ---- Animal proteins ---- Transcription elongation factor A N-terminal and central domain-containing protein 2
Source.1884: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1
Source.1885: DFBPPR22378 ---- Animal proteins ---- Coiled-coil domain-containing protein 86
Source.1886: DFBPPR22393 ---- Animal proteins ---- PDZ domain-containing protein GIPC2
Source.1887: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10
Source.1888: DFBPPR22398 ---- Animal proteins ---- Protein NDRG3
Source.1889: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9
Source.1890: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B
Source.1891: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein
Source.1892: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein
Source.1893: DFBPPR22444 ---- Animal proteins ---- Tetraspanin-11
Source.1894: DFBPPR22448 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 5B
Source.1895: DFBPPR22466 ---- Animal proteins ---- Transcription factor BTF3 homolog 4
Source.1896: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.1897: DFBPPR22478 ---- Animal proteins ---- Trichohyalin-like protein 1
Source.1898: DFBPPR22490 ---- Animal proteins ---- Costars family protein ABRACL
Source.1899: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15
Source.1900: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169
Source.1901: DFBPPR22532 ---- Animal proteins ---- Cilia- and flagella-associated protein 299
Source.1902: DFBPPR22548 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 1
Source.1903: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1
Source.1904: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A
Source.1905: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4
Source.1906: DFBPPR22614 ---- Animal proteins ---- Protein FAM81B
Source.1907: DFBPPR22622 ---- Animal proteins ---- Coiled-coil domain-containing glutamate-rich protein 1
Source.1908: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1
Source.1909: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175
Source.1910: DFBPPR22643 ---- Animal proteins ---- Coiled-coil domain-containing protein 157
Source.1911: DFBPPR22646 ---- Animal proteins ---- Coiled-coil domain-containing protein 184
Source.1912: DFBPPR22651 ---- Animal proteins ---- Spermatogenesis-associated protein 2-like protein
Source.1913: DFBPPR22657 ---- Animal proteins ---- Protein FAM110D
Source.1914: DFBPPR22673 ---- Animal proteins ---- Uncharacterized protein C7orf61 homolog
Source.1915: DFBPPR22682 ---- Animal proteins ---- Protein FAM216A
Source.1916: DFBPPR22705 ---- Animal proteins ---- Leucine-rich repeat-containing protein 28
Source.1917: DFBPPR22715 ---- Animal proteins ---- Spermatogenesis-associated protein 45
Source.1918: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11
Source.1919: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.1920: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1921: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.1922: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.1923: DFBPPR8546 ---- Animal proteins ---- Insulin
Source.1924: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.1925: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.1926: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial
Source.1927: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1928: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.1929: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.1930: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.1931: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.1932: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.1933: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1
Source.1934: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.1935: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.1936: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.1937: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.1938: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1939: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.1940: DFBPPR8685 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.1941: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1
Source.1942: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.1943: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.1944: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.1945: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.1946: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.1947: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C
Source.1948: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1949: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.1950: DFBPPR8736 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1
Source.1951: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.1952: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.1953: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.1954: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.1955: DFBPPR8799 ---- Animal proteins ---- Parathyroid hormone
Source.1956: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.1957: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.1958: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.1959: DFBPPR8822 ---- Animal proteins ---- Apolipoprotein E
Source.1960: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.1961: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5
Source.1962: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.1963: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.1964: DFBPPR8860 ---- Animal proteins ---- Nucleoside diphosphate kinase B
Source.1965: DFBPPR8866 ---- Animal proteins ---- High affinity immunoglobulin epsilon receptor subunit gamma
Source.1966: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.1967: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.1968: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.1969: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.1970: DFBPPR8897 ---- Animal proteins ---- Cytochrome b
Source.1971: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.1972: DFBPPR8939 ---- Animal proteins ---- Kit ligand
Source.1973: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.1974: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.1975: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B
Source.1976: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.1977: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.1978: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.1979: DFBPPR9015 ---- Animal proteins ---- Serotransferrin
Source.1980: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.1981: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.1982: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.1983: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.1984: DFBPPR9033 ---- Animal proteins ---- Interleukin-2
Source.1985: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.1986: DFBPPR9042 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.1987: DFBPPR9044 ---- Animal proteins ---- Albumin
Source.1988: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3
Source.1989: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.1990: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.1991: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor
Source.1992: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.1993: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta
Source.1994: DFBPPR9098 ---- Animal proteins ---- Gastrotropin
Source.1995: DFBPPR9100 ---- Animal proteins ---- Ras-related protein Rab-32
Source.1996: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.1997: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.1998: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1999: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.2000: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase
Source.2001: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.2002: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.2003: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A
Source.2004: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.2005: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor
Source.2006: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.2007: DFBPPR9154 ---- Animal proteins ---- Interleukin-6
Source.2008: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.2009: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.2010: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.2011: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.2012: DFBPPR9172 ---- Animal proteins ---- Protein N-terminal asparagine amidohydrolase
Source.2013: DFBPPR9173 ---- Animal proteins ---- Neurotrophin-3
Source.2014: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10
Source.2015: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.2016: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.2017: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.2018: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.2019: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.2020: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.2021: DFBPPR9280 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.2022: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.2023: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.2024: DFBPPR9296 ---- Animal proteins ---- Transcobalamin-1
Source.2025: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.2026: DFBPPR9325 ---- Animal proteins ---- Ephrin-A1
Source.2027: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.2028: DFBPPR9327 ---- Animal proteins ---- Multicilin
Source.2029: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2030: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.2031: DFBPPR9352 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.2032: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.2033: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2034: DFBPPR9384 ---- Animal proteins ---- Interferon epsilon
Source.2035: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D
Source.2036: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.2037: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2038: DFBPPR9425 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.2039: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.2040: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.2041: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.2042: DFBPPR9501 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.2043: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.2044: DFBPPR9530 ---- Animal proteins ---- Rho-related GTP-binding protein RhoE
Source.2045: DFBPPR9538 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.2046: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.2047: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.2048: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.2049: DFBPPR9607 ---- Animal proteins ---- F-actin-capping protein subunit beta
Source.2050: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2051: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.2052: DFBPPR9644 ---- Animal proteins ---- Lambda-crystallin homolog
Source.2053: DFBPPR9671 ---- Animal proteins ---- S-arrestin
Source.2054: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.2055: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain
Source.2056: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.2057: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.2058: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain
Source.2059: DFBPPR9751 ---- Animal proteins ---- Perilipin-3
Source.2060: DFBPPR9768 ---- Animal proteins ---- Protein canopy homolog 3
Source.2061: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8
Source.2062: DFBPPR9789 ---- Animal proteins ---- Calsequestrin-2
Source.2063: DFBPPR9791 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.2064: DFBPPR9801 ---- Animal proteins ---- Tropomyosin alpha-3 chain
Source.2065: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.2066: DFBPPR9858 ---- Animal proteins ---- Transaldolase
Source.2067: DFBPPR9895 ---- Animal proteins ---- 40S ribosomal protein S12
Source.2068: DFBPPR9899 ---- Animal proteins ---- D-xylulose reductase
Source.2069: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2
Source.2070: DFBPPR9926 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.2071: DFBPPR9932 ---- Animal proteins ---- Regulator of G-protein signaling 5
Source.2072: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.2073: DFBPPR9963 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.2074: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2075: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin
Source.2076: DFBPPR9984 ---- Animal proteins ---- Circadian locomoter output cycles protein kaput
Source.2077: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.2078: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2079: DFBPPR10003 ---- Animal proteins ---- Progonadoliberin-1
Source.2080: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.2081: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.2082: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.2083: DFBPPR10045 ---- Animal proteins ---- Albumin
Source.2084: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.2085: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.2086: DFBPPR10053 ---- Animal proteins ---- Synaptosomal-associated protein 25
Source.2087: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11
Source.2088: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.2089: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.2090: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2091: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2
Source.2092: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.2093: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2
Source.2094: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3
Source.2095: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.2096: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.2097: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1
Source.2098: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.2099: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.2100: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor
Source.2101: DFBPPR10139 ---- Animal proteins ---- Cytochrome b
Source.2102: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5
Source.2103: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.2104: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.2105: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor
Source.2106: DFBPPR10163 ---- Animal proteins ---- Annexin A6
Source.2107: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.2108: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.2109: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.2110: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1
Source.2111: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.2112: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.2113: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.2114: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.2115: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.2116: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.2117: DFBPPR10219 ---- Animal proteins ---- Presenilin-1
Source.2118: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.2119: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.2120: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.2121: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.2122: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.2123: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.2124: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.2125: DFBPPR10260 ---- Animal proteins ---- F-actin-capping protein subunit beta isoforms 1 and 2
Source.2126: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1
Source.2127: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.2128: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2129: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.2130: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.2131: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.2132: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.2133: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.2134: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.2135: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.2136: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.2137: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1
Source.2138: DFBPPR10320 ---- Animal proteins ---- Insulin
Source.2139: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.2140: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1
Source.2141: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.2142: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.2143: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.2144: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.2145: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.2146: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.2147: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.2148: DFBPPR10391 ---- Animal proteins ---- Annexin A5
Source.2149: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.2150: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.2151: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.2152: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.2153: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.2154: DFBPPR10412 ---- Animal proteins ---- Dysbindin
Source.2155: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.2156: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.2157: DFBPPR10416 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.2158: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin
Source.2159: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.2160: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.2161: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16
Source.2162: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.2163: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2
Source.2164: DFBPPR10447 ---- Animal proteins ---- Plastin-1
Source.2165: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.2166: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.2167: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.2168: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.2169: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.2170: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.2171: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2
Source.2172: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.2173: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.2174: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.2175: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.2176: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.2177: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase
Source.2178: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.2179: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.2180: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase
Source.2181: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.2182: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.2183: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6
Source.2184: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit
Source.2185: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.2186: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.2187: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.2188: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.2189: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.2190: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.2191: DFBPPR10620 ---- Animal proteins ---- Centromere protein T
Source.2192: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.2193: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.2194: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.2195: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.2196: DFBPPR10637 ---- Animal proteins ---- CTD small phosphatase-like protein
Source.2197: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.2198: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.2199: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.2200: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.2201: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.2202: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.2203: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.2204: DFBPPR10670 ---- Animal proteins ---- Interferon lambda-3
Source.2205: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.2206: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.2207: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.2208: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.2209: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.2210: DFBPPR10701 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.2211: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.2212: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.2213: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase
Source.2214: DFBPPR10715 ---- Animal proteins ---- Lumican
Source.2215: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.2216: DFBPPR10728 ---- Animal proteins ---- Myelomonocytic growth factor
Source.2217: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1
Source.2218: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2219: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.2220: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.2221: DFBPPR10788 ---- Animal proteins ---- D-aminoacyl-tRNA deacylase 2
Source.2222: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1
Source.2223: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1
Source.2224: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.2225: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.2226: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2227: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.2228: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.2229: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2230: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1
Source.2231: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.2232: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.2233: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.2234: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1
Source.2235: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.2236: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.2237: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.2238: DFBPPR10865 ---- Animal proteins ---- Transgelin
Source.2239: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.2240: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.2241: DFBPPR10891 ---- Animal proteins ---- Hepatocyte nuclear factor 1-alpha
Source.2242: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.2243: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.2244: DFBPPR10914 ---- Animal proteins ---- Protein APCDD1
Source.2245: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.2246: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.2247: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.2248: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.2249: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.2250: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.2251: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.2252: DFBPPR10976 ---- Animal proteins ---- Lamin-B2
Source.2253: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.2254: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.2255: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.2256: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.2257: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.2258: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.2259: DFBPPR11000 ---- Animal proteins ---- Tropomyosin beta chain
Source.2260: DFBPPR11007 ---- Animal proteins ---- Anamorsin
Source.2261: DFBPPR11009 ---- Animal proteins ---- Cathelicidin-B1
Source.2262: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.2263: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.2264: DFBPPR11027 ---- Animal proteins ---- Ras-related protein Rab-18
Source.2265: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.2266: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.2267: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.2268: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.2269: DFBPPR11042 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.2270: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2
Source.2271: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.2272: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.2273: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.2274: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.2275: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin
Source.2276: DFBPPR11104 ---- Animal proteins ---- Importin subunit alpha-5
Source.2277: DFBPPR11110 ---- Animal proteins ---- Lamin-B1
Source.2278: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.2279: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.2280: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.2281: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.2282: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.2283: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.2284: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.2285: DFBPPR11199 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.2286: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.2287: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha
Source.2288: DFBPPR11206 ---- Animal proteins ---- Voltage-gated hydrogen channel 1
Source.2289: DFBPPR11213 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.2290: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2
Source.2291: DFBPPR11256 ---- Animal proteins ---- Neuroblastoma suppressor of tumorigenicity 1
Source.2292: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.2293: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B
Source.2294: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.2295: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin
Source.2296: DFBPPR11283 ---- Animal proteins ---- Centromere protein U
Source.2297: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.2298: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.2299: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.2300: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.2301: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2
Source.2302: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.2303: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2
Source.2304: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.2305: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog
Source.2306: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2
Source.2307: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.2308: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47
Source.2309: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2
Source.2310: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1
Source.2311: DFBPPR11376 ---- Animal proteins ---- Lamin-A
Source.2312: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.2313: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B
Source.2314: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A
Source.2315: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.2316: DFBPPR11415 ---- Animal proteins ---- Elongation factor Tu, mitochondrial
Source.2317: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.2318: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.2319: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1
Source.2320: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.2321: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1
Source.2322: DFBPPR11473 ---- Animal proteins ---- G2/M phase-specific E3 ubiquitin-protein ligase
Source.2323: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog
Source.2324: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.2325: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A
Source.2326: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.2327: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2
Source.2328: DFBPPR11557 ---- Animal proteins ---- Regulator of G-protein signaling 17
Source.2329: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.2330: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.2331: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.2332: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.2333: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.2334: DFBPPR11600 ---- Animal proteins ---- Hyccin
Source.2335: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2336: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8
Source.2337: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2
Source.2338: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5
Source.2339: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.2340: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.2341: DFBPPR11634 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.2342: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.2343: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.2344: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.2345: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43
Source.2346: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.2347: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.2348: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.2349: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.2350: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor
Source.2351: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.2352: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.2353: DFBPPR11762 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.2354: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.2355: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1
Source.2356: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B
Source.2357: DFBPPR11777 ---- Animal proteins ---- Homeobox protein Hox-B3
Source.2358: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.2359: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3
Source.2360: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5
Source.2361: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.2362: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.2363: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.2364: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.2365: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.2366: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7
Source.2367: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3
Source.2368: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.2369: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.2370: DFBPPR11865 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8
Source.2371: DFBPPR11868 ---- Animal proteins ---- Apoptosis inhibitor 5
Source.2372: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.2373: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.2374: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.2375: DFBPPR11895 ---- Animal proteins ---- 40S ribosomal protein S12
Source.2376: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.2377: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.2378: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19
Source.2379: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.2380: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2
Source.2381: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A
Source.2382: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.2383: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.2384: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.2385: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4
Source.2386: DFBPPR11987 ---- Animal proteins ---- NEDD4-binding protein 3 homolog
Source.2387: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.2388: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal
Source.2389: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.2390: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.2391: DFBPPR12042 ---- Animal proteins ---- Mapk-regulated corepressor-interacting protein 1
Source.2392: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.2393: DFBPPR12060 ---- Animal proteins ---- Neurobeachin
Source.2394: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.2395: DFBPPR12077 ---- Animal proteins ---- Eukaryotic translation initiation factor 1
Source.2396: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129
Source.2397: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121
Source.2398: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.2399: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.2400: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.2401: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.2402: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2
Source.2403: DFBPPR12129 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial
Source.2404: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.2405: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.2406: DFBPPR12142 ---- Animal proteins ---- FGFR1 oncogene partner 2 homolog
Source.2407: DFBPPR12145 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1-like
Source.2408: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.2409: DFBPPR12154 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.2410: DFBPPR12162 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2
Source.2411: DFBPPR12171 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-3
Source.2412: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog
Source.2413: DFBPPR12194 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-10
Source.2414: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180
Source.2415: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein
Source.2416: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2
Source.2417: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.2418: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.2419: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.2420: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1
Source.2421: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.2422: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1
Source.2423: DFBPPR12259 ---- Animal proteins ---- Lambda-crystallin
Source.2424: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.2425: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.2426: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.2427: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2428: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.2429: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1
Source.2430: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.2431: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.2432: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.2433: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.2434: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.2435: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.2436: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.2437: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.2438: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1
Source.2439: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E
Source.2440: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.2441: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2442: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.2443: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.2444: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.2445: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.2446: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1
Source.2447: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.2448: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.2449: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.2450: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2451: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.2452: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma
Source.2453: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.2454: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1
Source.2455: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.2456: DFBPPR12401 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.2457: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4
Source.2458: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.2459: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.2460: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.2461: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.2462: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2
Source.2463: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2464: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.2465: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.2466: DFBPPR12471 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.2467: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.2468: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.2469: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.2470: DFBPPR12512 ---- Animal proteins ---- Carbonic anhydrase 4
Source.2471: DFBPPR12523 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.2472: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.2473: DFBPPR12536 ---- Animal proteins ---- Albumin
Source.2474: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.2475: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.2476: DFBPPR12545 ---- Animal proteins ---- Galectin-3
Source.2477: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2
Source.2478: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.2479: DFBPPR12557 ---- Animal proteins ---- Acrosin
Source.2480: DFBPPR12575 ---- Animal proteins ---- CD63 antigen
Source.2481: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.2482: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.2483: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1
Source.2484: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.2485: DFBPPR12594 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.2486: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT
Source.2487: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT
Source.2488: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1
Source.2489: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11
Source.2490: DFBPPR12624 ---- Animal proteins ---- Heparin cofactor 2
Source.2491: DFBPPR12642 ---- Animal proteins ---- Haptoglobin
Source.2492: DFBPPR12643 ---- Animal proteins ---- Haptoglobin
Source.2493: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5
Source.2494: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2495: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.2496: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.2497: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5
Source.2498: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase
Source.2499: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4
Source.2500: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2501: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.2502: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.2503: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16
Source.2504: DFBPPR12723 ---- Animal proteins ---- Glutathione S-transferase alpha I
Source.2505: DFBPPR12728 ---- Animal proteins ---- Cytochrome b
Source.2506: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.2507: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1
Source.2508: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14
Source.2509: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1
Source.2510: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.2511: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3
Source.2512: DFBPPR12770 ---- Animal proteins ---- Filamin-B
Source.2513: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.2514: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.2515: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.2516: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.2517: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.2518: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.2519: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.2520: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15
Source.2521: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.2522: DFBPPR12829 ---- Animal proteins ---- Glutathione S-transferase Yc
Source.2523: DFBPPR12831 ---- Animal proteins ---- Serine--pyruvate aminotransferase
Source.2524: DFBPPR12832 ---- Animal proteins ---- Secretin receptor
Source.2525: DFBPPR12833 ---- Animal proteins ---- Cullin-5
Source.2526: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.2527: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.2528: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain
Source.2529: DFBPPR12853 ---- Animal proteins ---- Insulin
Source.2530: DFBPPR12868 ---- Animal proteins ---- Synaptosomal-associated protein 25
Source.2531: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.2532: DFBPPR12871 ---- Animal proteins ---- Tropomyosin beta chain
Source.2533: DFBPPR12920 ---- Animal proteins ---- Arylamine N-acetyltransferase 2
Source.2534: DFBPPR12925 ---- Animal proteins ---- Methylmalonic aciduria type A homolog, mitochondrial
Source.2535: DFBPPR12935 ---- Animal proteins ---- Histone H1.3
Source.2536: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.2537: DFBPPR12939 ---- Animal proteins ---- Gastrotropin
Source.2538: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.2539: DFBPPR12950 ---- Animal proteins ---- Vitamin D-binding protein
Source.2540: DFBPPR12957 ---- Animal proteins ---- Arylamine N-acetyltransferase 1
Source.2541: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.2542: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.2543: DFBPPR13001 ---- Animal proteins ---- Annexin A6
Source.2544: DFBPPR13017 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.2545: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.2546: DFBPPR13026 ---- Animal proteins ---- Homeobox expressed in ES cells 1
Source.2547: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.2548: DFBPPR13030 ---- Animal proteins ---- T-cell surface glycoprotein CD1b
Source.2549: DFBPPR13056 ---- Animal proteins ---- V-type proton ATPase subunit D
Source.2550: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.2551: DFBPPR13097 ---- Animal proteins ---- Lumican
Source.2552: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2
Source.2553: DFBPPR13110 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2
Source.2554: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2555: DFBPPR13149 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.2556: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1
Source.2557: DFBPPR13153 ---- Animal proteins ---- Interleukin-18
Source.2558: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2559: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2
Source.2560: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.2561: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.2562: DFBPPR13195 ---- Animal proteins ---- Albumin
Source.2563: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.2564: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.2565: DFBPPR13215 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.2566: DFBPPR13219 ---- Animal proteins ---- Kit ligand
Source.2567: DFBPPR13263 ---- Animal proteins ---- Serotransferrin
Source.2568: DFBPPR13267 ---- Animal proteins ---- Interferon beta
Source.2569: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.2570: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.2571: DFBPPR13305 ---- Animal proteins ---- Cytochrome b
Source.2572: DFBPPR13306 ---- Animal proteins ---- Tropomyosin alpha-4 chain
Source.2573: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.2574: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.2575: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.2576: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.2577: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.2578: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.2579: DFBPPR13362 ---- Animal proteins ---- Biglycan
Source.2580: DFBPPR13383 ---- Animal proteins ---- Insulin
Source.2581: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.2582: DFBPPR13394 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.2583: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.2584: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.2585: DFBPPR13443 ---- Animal proteins ---- Kit ligand
Source.2586: DFBPPR13469 ---- Animal proteins ---- Cytochrome b
Source.2587: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.2588: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.2589: DFBPPR13514 ---- Animal proteins ---- Insulin
Source.2590: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2591: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.2592: DFBPPR13538 ---- Animal proteins ---- Apolipoprotein E
Source.2593: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2594: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36
Source.2595: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.2596: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.2597: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2598: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.2599: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2600: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.2601: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.2602: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.2603: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6
Source.2604: DFBPPR13665 ---- Animal proteins ---- Kit ligand
Source.2605: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2606: DFBPPR13712 ---- Animal proteins ---- Cytochrome b
Source.2607: DFBPPR13722 ---- Animal proteins ---- Insulin
Source.2608: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.2609: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.2610: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.2611: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.2612: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.2613: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2614: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.2615: DFBPPR13779 ---- Animal proteins ---- Syntaxin-1B
Source.2616: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.2617: DFBPPR13788 ---- Animal proteins ---- Albumin
Source.2618: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1
Source.2619: DFBPPR13822 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.2620: DFBPPR13834 ---- Animal proteins ---- Biglycan
Source.2621: DFBPPR13845 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.2622: DFBPPR13853 ---- Animal proteins ---- Keratin, type II microfibrillar, component 5
Source.2623: DFBPPR13854 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.2624: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa
Source.2625: DFBPPR13873 ---- Animal proteins ---- Mineralocorticoid receptor
Source.2626: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.2627: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.2628: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.2629: DFBPPR13917 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.2630: DFBPPR13926 ---- Animal proteins ---- Ferritin light chain
Source.2631: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.2632: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.2633: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.2634: DFBPPR13956 ---- Animal proteins ---- Proteolipid protein 2
Source.2635: DFBPPR13958 ---- Animal proteins ---- Homeobox protein Hox-D3
Source.2636: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.2637: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.2638: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.2639: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.2640: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.2641: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.2642: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha
Source.2643: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C
Source.2644: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.2645: DFBPPR14110 ---- Marine protein ---- BRCA1-A complex subunit Abraxas 1
Source.2646: DFBPPR14123 ---- Marine protein ---- Albumin 1
Source.2647: DFBPPR14124 ---- Marine protein ---- Albumin 2
Source.2648: DFBPPR14127 ---- Marine protein ---- RNA-binding protein 8A
Source.2649: DFBPPR14133 ---- Marine protein ---- Calumenin-B
Source.2650: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.2651: DFBPPR14191 ---- Marine protein ---- THAP domain-containing protein 1
Source.2652: DFBPPR14193 ---- Marine protein ---- ER membrane protein complex subunit 4
Source.2653: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog
Source.2654: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein
Source.2655: DFBPPR14217 ---- Marine protein ---- Tumor necrosis factor alpha-induced protein 8-like protein 2
Source.2656: DFBPPR14298 ---- Marine protein ---- Acetolactate synthase small subunit
Source.2657: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.2658: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.2659: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.2660: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'
Source.2661: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic
Source.2662: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE
Source.2663: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.2664: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.2665: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.2666: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.2667: DFBPPR14393 ---- Marine protein ---- Ribonuclease E/G-like protein
Source.2668: DFBPPR14397 ---- Marine protein ---- 30S ribosomal protein S4, chloroplastic
Source.2669: DFBPPR14398 ---- Marine protein ---- 30S ribosomal protein S7, chloroplastic
Source.2670: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic
Source.2671: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK
Source.2672: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.2673: DFBPPR14457 ---- Marine protein ---- Probable transcriptional regulator ycf29
Source.2674: DFBPPR14458 ---- Marine protein ---- 50S ribosomal protein L12, chloroplastic
Source.2675: DFBPPR14489 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.2676: DFBPPR14504 ---- Marine protein ---- Probable ABC transporter permease protein ycf63
Source.2677: DFBPPR14530 ---- Marine protein ---- Uncharacterized protein ycf34
Source.2678: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.2679: DFBPPR14548 ---- Marine protein ---- Mineralocorticoid receptor
Source.2680: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.2681: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.2682: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.2683: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible
Source.2684: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.2685: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2
Source.2686: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha
Source.2687: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1
Source.2688: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.2689: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase
Source.2690: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein
Source.2691: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3
Source.2692: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme
Source.2693: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.2694: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.2695: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.2696: DFBPPR14775 ---- Marine protein ---- Troponin C
Source.2697: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.2698: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.2699: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2700: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.2701: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.2702: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1
Source.2703: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.2704: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.2705: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.2706: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.2707: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.2708: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.2709: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.2710: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase
Source.2711: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial
Source.2712: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase
Source.2713: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.2714: DFBPPR14931 ---- Microorganism protein ---- E3 ubiquitin-protein ligase BRE1
Source.2715: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.2716: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.2717: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4
Source.2718: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1
Source.2719: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.2720: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.2721: DFBPPR14949 ---- Microorganism protein ---- EKC/KEOPS complex subunit BUD32
Source.2722: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.2723: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase
Source.2724: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.2725: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase
Source.2726: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.2727: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.2728: DFBPPR14998 ---- Microorganism protein ---- Galactokinase
Source.2729: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial
Source.2730: DFBPPR15002 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.2731: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16
Source.2732: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.2733: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase
Source.2734: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.2735: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase
Source.2736: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.2737: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.2738: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase
Source.2739: DFBPPR15046 ---- Microorganism protein ---- Histone acetyltransferase type B catalytic subunit
Source.2740: DFBPPR15051 ---- Microorganism protein ---- Autophagy-related protein 21
Source.2741: DFBPPR15060 ---- Microorganism protein ---- Transaldolase
Source.2742: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase
Source.2743: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.2744: DFBPPR15073 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 12
Source.2745: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase
Source.2746: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13
Source.2747: DFBPPR15091 ---- Microorganism protein ---- Lipoyl synthase, mitochondrial
Source.2748: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.2749: DFBPPR15105 ---- Microorganism protein ---- Arginase
Source.2750: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.2751: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1
Source.2752: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.2753: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial
Source.2754: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.2755: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase
Source.2756: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4
Source.2757: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.2758: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4
Source.2759: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.2760: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase
Source.2761: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81
Source.2762: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2
Source.2763: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain
Source.2764: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.2765: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.2766: DFBPPR15176 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NBP35
Source.2767: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.2768: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial
Source.2769: DFBPPR15182 ---- Microorganism protein ---- Mitochondrial transcription factor 1
Source.2770: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9
Source.2771: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3
Source.2772: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8
Source.2773: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.2774: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.2775: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal
Source.2776: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3
Source.2777: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17
Source.2778: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.2779: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase
Source.2780: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.2781: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60
Source.2782: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial
Source.2783: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial
Source.2784: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.2785: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.2786: DFBPPR15256 ---- Microorganism protein ---- SEC14 cytosolic factor
Source.2787: DFBPPR15262 ---- Microorganism protein ---- Inner kinetochore subunit NKP1
Source.2788: DFBPPR15268 ---- Microorganism protein ---- Diphthamide biosynthesis protein 3
Source.2789: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.2790: DFBPPR15283 ---- Microorganism protein ---- Diphthine methyl ester synthase
Source.2791: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.2792: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.2793: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18
Source.2794: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.2795: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.2796: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.2797: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.2798: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1
Source.2799: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.2800: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1
Source.2801: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.2802: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase
Source.2803: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1
Source.2804: DFBPPR15399 ---- Microorganism protein ---- 40S ribosomal protein S21
Source.2805: DFBPPR15405 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM9
Source.2806: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2
Source.2807: DFBPPR15419 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 34
Source.2808: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.2809: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase
Source.2810: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.2811: DFBPPR15443 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 10
Source.2812: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.2813: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.2814: DFBPPR15455 ---- Microorganism protein ---- Putative tyrosine-protein phosphatase OCA1
Source.2815: DFBPPR15457 ---- Microorganism protein ---- Ribosome biogenesis protein RLP24
Source.2816: DFBPPR15465 ---- Microorganism protein ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.2817: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.2818: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46
Source.2819: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.2820: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1
Source.2821: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.2822: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.2823: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.2824: DFBPPR15508 ---- Microorganism protein ---- RNA polymerase II transcription factor B subunit 3
Source.2825: DFBPPR15511 ---- Microorganism protein ---- 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase
Source.2826: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.2827: DFBPPR15513 ---- Microorganism protein ---- Killer toxin subunit gamma
Source.2828: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1
Source.2829: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10
Source.2830: DFBPPR15532 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit beta
Source.2831: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23
Source.2832: DFBPPR15544 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 6
Source.2833: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.2834: DFBPPR15553 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX4
Source.2835: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.2836: DFBPPR15564 ---- Microorganism protein ---- Protein ZIP2
Source.2837: DFBPPR15565 ---- Microorganism protein ---- 37S ribosomal protein S10, mitochondrial
Source.2838: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta
Source.2839: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.2840: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2
Source.2841: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.2842: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1
Source.2843: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7
Source.2844: DFBPPR15651 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 34, mitochondrial
Source.2845: DFBPPR15656 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC25
Source.2846: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11
Source.2847: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial
Source.2848: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.2849: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.2850: DFBPPR15711 ---- Microorganism protein ---- SWR1-complex protein 7
Source.2851: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.2852: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial
Source.2853: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.2854: DFBPPR15720 ---- Microorganism protein ---- Protein BFR2
Source.2855: DFBPPR15739 ---- Microorganism protein ---- Long chronological lifespan protein 2
Source.2856: DFBPPR15751 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 41, mitochondrial
Source.2857: DFBPPR15752 ---- Microorganism protein ---- Protein HRI1
Source.2858: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86
Source.2859: DFBPPR15773 ---- Microorganism protein ---- 37S ribosomal protein S25, mitochondrial
Source.2860: DFBPPR15784 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 1
Source.2861: DFBPPR15785 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 7
Source.2862: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.2863: DFBPPR15800 ---- Microorganism protein ---- PTS system lactose-specific EIIA component
Source.2864: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase
Source.2865: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase
Source.2866: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase
Source.2867: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.2868: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase
Source.2869: DFBPPR0005 ---- Plant protein ---- Farnesyl pyrophosphate synthase 2
Source.2870: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.2871: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.2872: DFBPPR0015 ---- Plant protein ---- Isoflavone reductase homolog
Source.2873: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase
Source.2874: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.2875: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.2876: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.2877: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic
Source.2878: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase
Source.2879: DFBPPR7773 ---- Plant protein ---- Lipoyl synthase, chloroplastic
Source.2880: DFBPPR7781 ---- Plant protein ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.2881: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.2882: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3
Source.2883: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.2884: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.2885: DFBPPR7794 ---- Plant protein ---- Cytochrome b6
Source.2886: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2
Source.2887: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.2888: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.2889: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.2890: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.2891: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.2892: DFBPPR7864 ---- Plant protein ---- ATP synthase epsilon chain, chloroplastic
Source.2893: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1
Source.2894: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.2895: DFBPPR7943 ---- Plant protein ---- ATP synthase subunit a
Source.2896: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.2897: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1
Source.2898: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.2899: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.2900: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.2901: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.2902: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.2903: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.2904: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.2905: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.2906: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.2907: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.2908: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.2909: DFBPPR8125 ---- Plant protein ---- Eukaryotic translation initiation factor 5
Source.2910: DFBPPR8144 ---- Plant protein ---- Maturase K
Source.2911: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.2912: DFBPPR8157 ---- Plant protein ---- 30S ribosomal protein S15, chloroplastic
Source.2913: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.2914: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase
Source.2915: DFBPPR8235 ---- Plant protein ---- Catalase
Source.2916: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase
Source.2917: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.2918: DFBPPR8247 ---- Plant protein ---- Nucleoside diphosphate kinase
Source.2919: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.2920: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.2921: DFBPPR8271 ---- Plant protein ---- Cytochrome b6
Source.2922: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.2923: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2924: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.2925: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3
Source.2926: DFBPPR8319 ---- Plant protein ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.2927: DFBPPR8323 ---- Plant protein ---- Cytochrome P450
Source.2928: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Source.2929: DFBPPR8356 ---- Plant protein ---- Unknown protein 1
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 14.2 uM.

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydrolysis

Enzyme(s)/starter culture

Hydrolysis with pepsin (Porcine tomach mucosa; Wako Pure Chemicals, Osaka, Japan).

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

The purified peptide LVE is a possible candidate for application as a dietary supplement or as a component of a functional food product.

Database cross-references
DFBP
[D1] DFBPANHY0850
[D2] DFBPMUFU0241
BIOPEP-UWM [D3] 7746
APD [D4] -
BioPepDB [D5] -
MBPDB [D6] -
Reference(s)
Primary literature Suetsuna, K. Identification of antihypertensive peptides from peptic digest of the short-necked clam Tapes philippinarum and the pearl oyster Pinctada fucata martensii. Fisheries Science. 2002, 68, 233-5.
Other literature(s) N.D
PubDate 2002
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214