| DFBP ID - DFBPACEI1323(ACE-inhibitory peptide) |
| DFBP ID |
DFBPACEI1323 |
| Peptide sequence |
SKTY |
| Type |
Native peptide |
| Peptide/Function name |
ACE-inhibitory peptide |
|
| Function-activity relationship |
| Main bioactivity |
ACE-inhibitory activity |
| Otheir bioactivity |
N.D |
|
| Calculated physicochemical properties |
| Three-letter amino acid |
Ser-Lys-Thr-Tyr |
| Single-letter amino acid |
SKTY |
| Peptide length |
4 |
| Peptide mass |
| Experimental mass |
Theoretical mass |
| 498.4 Da |
497.54 Da c |
|
| Net charge |
0.00 c |
| Isoelectric point (pI) |
9.70 c |
| IC50 |
20.63 uM |
| pIC50 |
-1.314 |
| GRAVY |
-1.6750 c |
| Hydrophilic residue ratio |
0% c |
| Peptide calculator |
|
|
| Biological/Functional activity & target protein |
| ACE-inhibitory activity |
The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50
value of 20.63 μM. |
| Specific target protein(s) |
Specific Target Protein(s): Angiotensin-converting enzyme |
|
| Taste properties & Structure |
| Bitterness |
| Literature report |
N.D |
| Bitter prediction tools |
Non-bitter taste prediction |
|
| SMILES |
N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O |
|
| Preparation method |
| Mode of preparation |
Enzymatic hydrolysis
|
| Enzyme(s)/starter culture |
Laminaria japonica protein was hydrolyzed with combined enzymes (alcalase, trypsin and papain). |
|
| Stability & Cytotoxicity |
| Peptide stability |
|
| Peptide cytotoxicity |
|
|
| Additional information |
| Additional information |
(1) Laminaria japonica proteins would be a good source of hypotensive peptides. (2) A simple and efficient RP-HPLC method was developed for simultaneous analysis of eight small anti-hypertensive peptides with tyrosine at the C-terminal.
|
|
| Database cross-references |
|
|
|
|
|
|
|
|
| Reference(s) |
| Primary literature |
Chen, J.-C., Wang, J., Zheng, B.-D., Pang, J., Chen, L.-J., Lin, H.-t., et al. Simultaneous Determination of 8 Small Antihypertensive Peptides with Tyrosine at the C-Terminal inLaminaria japonicaHydrolysates by RP-HPLC Method. Journal of Food Processing and Preservation. 2016, 40, 492-501.
|
| Other literature(s) |
N.D |
| PubDate |
2016 |
|