E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI1344(ACE-inhibitory peptide)
DFBP ID DFBPACEI1344
Peptide sequence FG
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity Antihypertensive activity [D1], Multifunctional activity [D2]
Calculated physicochemical properties
Three-letter amino acid Phe-Gly
Single-letter amino acid FG
Peptide length 2
Peptide mass
Experimental mass Theoretical mass
223.3 Da 222.24 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50

3700 uM

pIC50 -3.568
GRAVY 1.2000 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Land snail (Helix aspersa)
Precursor protein Hepatopancreas (by-product)
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0379 ---- Plant protein ---- Alpha-gliadin
Source.3: DFBPPR0380 ---- Plant protein ---- Alpha-gliadin
Source.4: DFBPPR0381 ---- Plant protein ---- Alpha-gliadin
Source.5: DFBPPR0382 ---- Plant protein ---- Alpha-gliadin
Source.6: DFBPPR0383 ---- Plant protein ---- Alpha-gliadin
Source.7: DFBPPR0384 ---- Plant protein ---- Alpha-gliadin
Source.8: DFBPPR0385 ---- Plant protein ---- Alpha-gliadin
Source.9: DFBPPR0388 ---- Plant protein ---- Low molecular weight glutenin subunit
Source.10: DFBPPR0389 ---- Plant protein ---- Alpha-gliadin
Source.11: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein
Source.12: DFBPPR0748 ---- Plant proteins ---- Agglutinin
Source.13: DFBPPR0776 ---- Plant proteins ---- 11S globulin
Source.14: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2
Source.15: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.16: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog
Source.17: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1
Source.18: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1
Source.19: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25
Source.20: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.21: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.22: DFBPPR0823 ---- Plant proteins ---- bZIP transcription factor RISBZ3
Source.23: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.24: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8
Source.25: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.26: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.27: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5
Source.28: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.29: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2
Source.30: DFBPPR0833 ---- Plant proteins ---- Allene oxide cyclase, chloroplastic
Source.31: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic
Source.32: DFBPPR0840 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 2
Source.33: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A
Source.34: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1
Source.35: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.36: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.37: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14
Source.38: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.39: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.40: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.41: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.42: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.43: DFBPPR0854 ---- Plant proteins ---- Lactoylglutathione lyase
Source.44: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.45: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.46: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.47: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.48: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.49: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.50: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18
Source.51: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46
Source.52: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.53: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.54: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.55: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q
Source.56: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.57: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.58: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.59: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6
Source.60: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.61: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1
Source.62: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.63: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.64: DFBPPR0879 ---- Plant proteins ---- UDP-arabinopyranose mutase 1
Source.65: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.66: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.67: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.68: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.69: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.70: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8
Source.71: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.72: DFBPPR0899 ---- Plant proteins ---- Cyclin-dependent kinase A-1
Source.73: DFBPPR0901 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 2
Source.74: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.75: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2
Source.76: DFBPPR0904 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK2
Source.77: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase
Source.78: DFBPPR0909 ---- Plant proteins ---- Beta-glucosidase 12
Source.79: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.80: DFBPPR0914 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.81: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.82: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.83: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.84: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.85: DFBPPR0922 ---- Plant proteins ---- Obg-like ATPase 1
Source.86: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.87: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6
Source.88: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1
Source.89: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.90: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.91: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.92: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial
Source.93: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.94: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.95: DFBPPR0936 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK8
Source.96: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.97: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1
Source.98: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.99: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.100: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.101: DFBPPR0944 ---- Plant proteins ---- UDP-arabinopyranose mutase 3
Source.102: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10
Source.103: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.104: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.105: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.106: DFBPPR0949 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK7
Source.107: DFBPPR0950 ---- Plant proteins ---- Flap endonuclease 1-A
Source.108: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.109: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5
Source.110: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.111: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1
Source.112: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1
Source.113: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.114: DFBPPR0959 ---- Plant proteins ---- Probable serine/threonine-protein kinase BSK3
Source.115: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein
Source.116: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.117: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3
Source.118: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog
Source.119: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9
Source.120: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.121: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.122: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3
Source.123: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.124: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.125: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda
Source.126: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7
Source.127: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.128: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic
Source.129: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.130: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1
Source.131: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1
Source.132: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.133: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.134: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic
Source.135: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.136: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70
Source.137: DFBPPR0985 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK6
Source.138: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50
Source.139: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.140: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.141: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21
Source.142: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.143: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185
Source.144: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic
Source.145: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.146: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1
Source.147: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.148: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31
Source.149: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1
Source.150: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.151: DFBPPR1001 ---- Plant proteins ---- GRF-interacting factor 1
Source.152: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.153: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.154: DFBPPR1004 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK9
Source.155: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.156: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.157: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.158: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.159: DFBPPR1009 ---- Plant proteins ---- SPX domain-containing protein 4
Source.160: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.161: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.162: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.163: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.164: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.165: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.166: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.167: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.168: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.169: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.170: DFBPPR1022 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK3
Source.171: DFBPPR1023 ---- Plant proteins ---- Protein disulfide isomerase-like 1-1
Source.172: DFBPPR1024 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK4
Source.173: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A
Source.174: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform
Source.175: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.176: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1
Source.177: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1
Source.178: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.179: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP
Source.180: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic
Source.181: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.182: DFBPPR1040 ---- Plant proteins ---- Calcium/calmodulin-dependent serine/threonine-protein kinase 1
Source.183: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3
Source.184: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.185: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.186: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2
Source.187: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.188: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.189: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5
Source.190: DFBPPR1050 ---- Plant proteins ---- Mitogen-activated protein kinase kinase 1
Source.191: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8
Source.192: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56
Source.193: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.194: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.195: DFBPPR1057 ---- Plant proteins ---- Abscisic acid receptor PYL10
Source.196: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5
Source.197: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.198: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.199: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A
Source.200: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.201: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c
Source.202: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4
Source.203: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1
Source.204: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1
Source.205: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79
Source.206: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.207: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.208: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.209: DFBPPR1075 ---- Plant proteins ---- Cyclin-dependent kinase A-2
Source.210: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24
Source.211: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.212: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.213: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.214: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.215: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24
Source.216: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5
Source.217: DFBPPR1086 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 46
Source.218: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.219: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706
Source.220: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL
Source.221: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1
Source.222: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1
Source.223: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.224: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.225: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic
Source.226: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.227: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.228: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.229: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.230: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.231: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4
Source.232: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.233: DFBPPR1110 ---- Plant proteins ---- Superoxide dismutase [Cu-Zn], chloroplastic
Source.234: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic
Source.235: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.236: DFBPPR1116 ---- Plant proteins ---- Polycomb group protein EMF2B
Source.237: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.238: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.239: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E
Source.240: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4
Source.241: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.242: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic
Source.243: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.244: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic
Source.245: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6
Source.246: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.247: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.248: DFBPPR1129 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.249: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.250: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.251: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B
Source.252: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13
Source.253: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial
Source.254: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.255: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.256: DFBPPR1142 ---- Plant proteins ---- Calreticulin
Source.257: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13
Source.258: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4
Source.259: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.260: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A
Source.261: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.262: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.263: DFBPPR1149 ---- Plant proteins ---- Probable protein phosphatase 2C 6
Source.264: DFBPPR1150 ---- Plant proteins ---- Abscisic stress-ripening protein 5
Source.265: DFBPPR1151 ---- Plant proteins ---- Cytochrome c
Source.266: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.267: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13
Source.268: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.269: DFBPPR1157 ---- Plant proteins ---- MADS-box transcription factor 17
Source.270: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3
Source.271: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.272: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.273: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.274: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.275: DFBPPR1165 ---- Plant proteins ---- Chaperone protein dnaJ A7A, chloroplastic
Source.276: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23
Source.277: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2
Source.278: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30
Source.279: DFBPPR1176 ---- Plant proteins ---- Chitinase 12
Source.280: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.281: DFBPPR1178 ---- Plant proteins ---- Chaperone protein dnaJ A7B, chloroplastic
Source.282: DFBPPR1180 ---- Plant proteins ---- Anthranilate synthase beta subunit 1, chloroplastic
Source.283: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.284: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3
Source.285: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.286: DFBPPR1207 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.287: DFBPPR1208 ---- Plant proteins ---- RNA polymerase sigma factor sigA
Source.288: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.289: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4
Source.290: DFBPPR1215 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A4, chloroplastic
Source.291: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19
Source.292: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.293: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.294: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.295: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial
Source.296: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15
Source.297: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.298: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15
Source.299: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24
Source.300: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.301: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.302: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.303: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.304: DFBPPR1259 ---- Plant proteins ---- Beta-carotene isomerase D27, chloroplastic
Source.305: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.306: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1
Source.307: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.308: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.309: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.310: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.311: DFBPPR1268 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 1, chloroplastic
Source.312: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.313: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.314: DFBPPR1271 ---- Plant proteins ---- CBL-interacting protein kinase 23
Source.315: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.316: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.317: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.318: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase
Source.319: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1
Source.320: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a
Source.321: DFBPPR1281 ---- Plant proteins ---- Arsenate reductase 2.2
Source.322: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.323: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.324: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.325: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.326: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.327: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39
Source.328: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.329: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.330: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.331: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic
Source.332: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1
Source.333: DFBPPR1297 ---- Plant proteins ---- Peroxygenase
Source.334: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.335: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b
Source.336: DFBPPR1300 ---- Plant proteins ---- Protein G1
Source.337: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6
Source.338: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22
Source.339: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.340: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.341: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B
Source.342: DFBPPR1311 ---- Plant proteins ---- Synaptonemal complex protein ZEP1
Source.343: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.344: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.345: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.346: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22
Source.347: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.348: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic
Source.349: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16
Source.350: DFBPPR1323 ---- Plant proteins ---- Transcription factor GHD7
Source.351: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.352: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.353: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.354: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.355: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.356: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1
Source.357: DFBPPR1332 ---- Plant proteins ---- Flap endonuclease 1-B
Source.358: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.359: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.360: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.361: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12
Source.362: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1
Source.363: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.364: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14
Source.365: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1
Source.366: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1
Source.367: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.368: DFBPPR1346 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 5
Source.369: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.370: DFBPPR1349 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.371: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.372: DFBPPR1353 ---- Plant proteins ---- Transcription factor UDT1
Source.373: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.374: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.375: DFBPPR1361 ---- Plant proteins ---- Anthranilate synthase beta subunit 2, chloroplastic
Source.376: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.377: DFBPPR1363 ---- Plant proteins ---- Protein YELLOW LEAF 1, choloroplastic
Source.378: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.379: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.380: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1
Source.381: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.382: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.383: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.384: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.385: DFBPPR1376 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 3
Source.386: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.387: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.388: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.389: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.390: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.391: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase
Source.392: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.393: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.394: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.395: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.396: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.397: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.398: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.399: DFBPPR1393 ---- Plant proteins ---- Serine/threonine-protein kinase Nek6
Source.400: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.401: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29
Source.402: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.403: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5
Source.404: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.405: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B
Source.406: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2
Source.407: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.408: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.409: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.410: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.411: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.412: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.413: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.414: DFBPPR1417 ---- Plant proteins ---- DnaJ protein ERDJ3A
Source.415: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.416: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.417: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.418: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.419: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.420: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156
Source.421: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.422: DFBPPR1427 ---- Plant proteins ---- Probable esterase D14L
Source.423: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.424: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.425: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3
Source.426: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.427: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.428: DFBPPR1435 ---- Plant proteins ---- Photosystem II 22 kDa protein 1, chloroplastic
Source.429: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.430: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3
Source.431: DFBPPR1438 ---- Plant proteins ---- High-affinity nitrate transporter 2.3
Source.432: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1
Source.433: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.434: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.435: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.436: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.437: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.438: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.439: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.440: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.441: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.442: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E
Source.443: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.444: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.445: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c
Source.446: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2
Source.447: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.448: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.449: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.450: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.451: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.452: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.453: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.454: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1
Source.455: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A
Source.456: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.457: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.458: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.459: DFBPPR1477 ---- Plant proteins ---- MADS-box transcription factor 16
Source.460: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.461: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.462: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3
Source.463: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.464: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.465: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.466: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2
Source.467: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.468: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.469: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.470: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.471: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.472: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase
Source.473: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.474: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.475: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.476: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.477: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein
Source.478: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.479: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.480: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5
Source.481: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.482: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.483: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d
Source.484: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.485: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.486: DFBPPR1515 ---- Plant proteins ---- Serine/threonine-protein kinase Nek3
Source.487: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.488: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.489: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3
Source.490: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6
Source.491: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.492: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1
Source.493: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2
Source.494: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.495: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.496: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3
Source.497: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.498: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.499: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.500: DFBPPR1537 ---- Plant proteins ---- Zinc transporter 8
Source.501: DFBPPR1538 ---- Plant proteins ---- Heat stress transcription factor A-2e
Source.502: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.503: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.504: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.505: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.506: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.507: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.508: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148
Source.509: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.510: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2
Source.511: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.512: DFBPPR1554 ---- Plant proteins ---- Signal peptidase complex-like protein DTM1
Source.513: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6
Source.514: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19
Source.515: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80
Source.516: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.517: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3
Source.518: DFBPPR1561 ---- Plant proteins ---- Chitinase 4
Source.519: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.520: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.521: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.522: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.523: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF
Source.524: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2
Source.525: DFBPPR1572 ---- Plant proteins ---- Late embryogenesis abundant protein 17
Source.526: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic
Source.527: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.528: DFBPPR1580 ---- Plant proteins ---- Expansin-A4
Source.529: DFBPPR1581 ---- Plant proteins ---- Peroxiredoxin-2C
Source.530: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4
Source.531: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.532: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.533: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.534: DFBPPR1587 ---- Plant proteins ---- CBL-interacting protein kinase 8
Source.535: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.536: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.537: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.538: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic
Source.539: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11
Source.540: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.541: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.542: DFBPPR1596 ---- Plant proteins ---- Photosystem II 22 kDa protein 2, chloroplastic
Source.543: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.544: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic
Source.545: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.546: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A
Source.547: DFBPPR1604 ---- Plant proteins ---- Putative bifunctional dihydrofolate reductase-thymidylate synthase
Source.548: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.549: DFBPPR1606 ---- Plant proteins ---- 17.4 kDa class I heat shock protein
Source.550: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.551: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.552: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.553: DFBPPR1610 ---- Plant proteins ---- 18.1 kDa class I heat shock protein
Source.554: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2
Source.555: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1
Source.556: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.557: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.558: DFBPPR1615 ---- Plant proteins ---- Phosphatidylinositol:ceramide inositolphosphotransferase
Source.559: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.560: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7
Source.561: DFBPPR1618 ---- Plant proteins ---- Heat stress transcription factor C-1a
Source.562: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.563: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.564: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.565: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.566: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71
Source.567: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.568: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic
Source.569: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.570: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.571: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.572: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic
Source.573: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.574: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.575: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2
Source.576: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.577: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.578: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.579: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic
Source.580: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.581: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial
Source.582: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.583: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.584: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.585: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic
Source.586: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.587: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.588: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.589: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.590: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.591: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A
Source.592: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.593: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.594: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.595: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic
Source.596: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7
Source.597: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3
Source.598: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.599: DFBPPR1681 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.600: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.601: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.602: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.603: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic
Source.604: DFBPPR1688 ---- Plant proteins ---- UMP-CMP kinase 3
Source.605: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.606: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG
Source.607: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic
Source.608: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.609: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.610: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.611: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.612: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2
Source.613: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.614: DFBPPR1701 ---- Plant proteins ---- Protein mago nashi homolog 1
Source.615: DFBPPR1702 ---- Plant proteins ---- Glutelin type-A 2
Source.616: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1
Source.617: DFBPPR1704 ---- Plant proteins ---- RNA-binding protein Y14B
Source.618: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.619: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.620: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a
Source.621: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1
Source.622: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.623: DFBPPR1711 ---- Plant proteins ---- Protein mago nashi homolog 2
Source.624: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.625: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.626: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.627: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.628: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.629: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.630: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.631: DFBPPR1723 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.632: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4
Source.633: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.634: DFBPPR1726 ---- Plant proteins ---- SPX domain-containing protein 1
Source.635: DFBPPR1727 ---- Plant proteins ---- Cyclin-dependent kinase C-3
Source.636: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.637: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.638: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.639: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.640: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2
Source.641: DFBPPR1733 ---- Plant proteins ---- Xylanase inhibitor protein XIP
Source.642: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.643: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic
Source.644: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic
Source.645: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1
Source.646: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic
Source.647: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.648: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.649: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.650: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.651: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.652: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.653: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.654: DFBPPR1748 ---- Plant proteins ---- 17.7 kDa class I heat shock protein
Source.655: DFBPPR1750 ---- Plant proteins ---- Transcription factor IBH1
Source.656: DFBPPR1751 ---- Plant proteins ---- Heat stress transcription factor A-4b
Source.657: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.658: DFBPPR1754 ---- Plant proteins ---- Transcription factor BHLH094
Source.659: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic
Source.660: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.661: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.662: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.663: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.664: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1
Source.665: DFBPPR1763 ---- Plant proteins ---- E3 ubiquitin-protein ligase SRFP1
Source.666: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.667: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2
Source.668: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial
Source.669: DFBPPR1770 ---- Plant proteins ---- Probable tyrosine-protein phosphatase DSP2
Source.670: DFBPPR1771 ---- Plant proteins ---- Replication protein A 32 kDa subunit B
Source.671: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.672: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.673: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.674: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.675: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11
Source.676: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3
Source.677: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.678: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.679: DFBPPR1782 ---- Plant proteins ---- Transcription factor BHLH133
Source.680: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A
Source.681: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.682: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.683: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.684: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.685: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.686: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.687: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.688: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.689: DFBPPR1796 ---- Plant proteins ---- Fibrillin protein 5 homolog
Source.690: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic
Source.691: DFBPPR1798 ---- Plant proteins ---- UMP-CMP kinase 2
Source.692: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1
Source.693: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4
Source.694: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.695: DFBPPR1803 ---- Plant proteins ---- Chitinase 5
Source.696: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase
Source.697: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.698: DFBPPR1806 ---- Plant proteins ---- Laccase-19
Source.699: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2
Source.700: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial
Source.701: DFBPPR1810 ---- Plant proteins ---- Shaggy-related protein kinase GSK4
Source.702: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1
Source.703: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9
Source.704: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5
Source.705: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2
Source.706: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.707: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a
Source.708: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.709: DFBPPR1818 ---- Plant proteins ---- Chitinase 9
Source.710: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B
Source.711: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1
Source.712: DFBPPR1823 ---- Plant proteins ---- Protein YABBY 1
Source.713: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.714: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3
Source.715: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.716: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.717: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.718: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.719: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.720: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3
Source.721: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.722: DFBPPR1836 ---- Plant proteins ---- COP9 signalosome complex subunit 5
Source.723: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.724: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.725: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.726: DFBPPR1841 ---- Plant proteins ---- SPX domain-containing protein 2
Source.727: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO
Source.728: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.729: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.730: DFBPPR1847 ---- Plant proteins ---- Amidase 1
Source.731: DFBPPR1848 ---- Plant proteins ---- Chitinase 7
Source.732: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.733: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1
Source.734: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.735: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.736: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.737: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.738: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.739: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.740: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.741: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.742: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.743: DFBPPR1863 ---- Plant proteins ---- Chitinase 6
Source.744: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.745: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.746: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.747: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.748: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17
Source.749: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.750: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4
Source.751: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.752: DFBPPR1876 ---- Plant proteins ---- Proteasome subunit alpha type-7-B
Source.753: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4
Source.754: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8
Source.755: DFBPPR1879 ---- Plant proteins ---- Germin-like protein 1-3
Source.756: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.757: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.758: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.759: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.760: DFBPPR1890 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 8
Source.761: DFBPPR1891 ---- Plant proteins ---- Transcription factor MYBS2
Source.762: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.763: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.764: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.765: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.766: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.767: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1
Source.768: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.769: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3
Source.770: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.771: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic
Source.772: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8
Source.773: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2
Source.774: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6
Source.775: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.776: DFBPPR1912 ---- Plant proteins ---- Expansin-B3
Source.777: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.778: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.779: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.780: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.781: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.782: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.783: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2
Source.784: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2
Source.785: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.786: DFBPPR1926 ---- Plant proteins ---- Proteasome subunit alpha type-7-A
Source.787: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.788: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2
Source.789: DFBPPR1929 ---- Plant proteins ---- Guanylate kinase 1
Source.790: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.791: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.792: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.793: DFBPPR1939 ---- Plant proteins ---- Signal peptide peptidase-like 2
Source.794: DFBPPR1941 ---- Plant proteins ---- UMP-CMP kinase 4
Source.795: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA
Source.796: DFBPPR1944 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.797: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.798: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.799: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.800: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.801: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.802: DFBPPR1952 ---- Plant proteins ---- CBL-interacting protein kinase 1
Source.803: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17
Source.804: DFBPPR1954 ---- Plant proteins ---- Calcineurin B-like protein 4
Source.805: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.806: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.807: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.808: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.809: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.810: DFBPPR1962 ---- Plant proteins ---- Expansin-A2
Source.811: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.812: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.813: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.814: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.815: DFBPPR1970 ---- Plant proteins ---- UMP-CMP kinase 1
Source.816: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.817: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.818: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.819: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial
Source.820: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.821: DFBPPR1980 ---- Plant proteins ---- Germin-like protein 1-4
Source.822: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A
Source.823: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.824: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.825: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38
Source.826: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2
Source.827: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.828: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B
Source.829: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.830: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4
Source.831: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.832: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b
Source.833: DFBPPR2003 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic
Source.834: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A
Source.835: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.836: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8
Source.837: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.838: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.839: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33
Source.840: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.841: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.842: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.843: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.844: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.845: DFBPPR2019 ---- Plant proteins ---- SPX domain-containing protein 5
Source.846: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1
Source.847: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.848: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.849: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.850: DFBPPR2026 ---- Plant proteins ---- Proteasome subunit alpha type-5
Source.851: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.852: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.853: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.854: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.855: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5
Source.856: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.857: DFBPPR2035 ---- Plant proteins ---- Glutelin type-A 1
Source.858: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.859: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.860: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.861: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial
Source.862: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.863: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1
Source.864: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.865: DFBPPR2045 ---- Plant proteins ---- Expansin-A5
Source.866: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11
Source.867: DFBPPR2048 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ23
Source.868: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.869: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15
Source.870: DFBPPR2051 ---- Plant proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase
Source.871: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.872: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10
Source.873: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.874: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176
Source.875: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.876: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9
Source.877: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3
Source.878: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.879: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.880: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.881: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA
Source.882: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.883: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2
Source.884: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.885: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.886: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.887: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.888: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.889: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C
Source.890: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c
Source.891: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1
Source.892: DFBPPR2081 ---- Plant proteins ---- Expansin-A1
Source.893: DFBPPR2083 ---- Plant proteins ---- Lectin
Source.894: DFBPPR2085 ---- Plant proteins ---- Protein LOL5
Source.895: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.896: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.897: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1
Source.898: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.899: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.900: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.901: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5
Source.902: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.903: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.904: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.905: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein
Source.906: DFBPPR2101 ---- Plant proteins ---- Cupincin
Source.907: DFBPPR2102 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 12
Source.908: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.909: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.910: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.911: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.912: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.913: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4
Source.914: DFBPPR2111 ---- Plant proteins ---- Iron-sulfur cluster assembly protein 1
Source.915: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.916: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.917: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.918: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1
Source.919: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.920: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2
Source.921: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.922: DFBPPR2123 ---- Plant proteins ---- Ninja-family protein MODD
Source.923: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial
Source.924: DFBPPR2125 ---- Plant proteins ---- Protein YABBY 5
Source.925: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2
Source.926: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.927: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C
Source.928: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.929: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.930: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic
Source.931: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.932: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.933: DFBPPR2138 ---- Plant proteins ---- 17.9 kDa class I heat shock protein
Source.934: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.935: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.936: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.937: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.938: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic
Source.939: DFBPPR2146 ---- Plant proteins ---- Expansin-B4
Source.940: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23
Source.941: DFBPPR2148 ---- Plant proteins ---- Auxin-responsive protein SAUR36
Source.942: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.943: DFBPPR2151 ---- Plant proteins ---- Glutelin type-A 3
Source.944: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.945: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.946: DFBPPR2154 ---- Plant proteins ---- Germin-like protein 8-2
Source.947: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.948: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.949: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.950: DFBPPR2159 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.951: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.952: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.953: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.954: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.955: DFBPPR2165 ---- Plant proteins ---- Protein disulfide isomerase-like 1-2
Source.956: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.957: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.958: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2
Source.959: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.960: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.961: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.962: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.963: DFBPPR2175 ---- Plant proteins ---- Expansin-A16
Source.964: DFBPPR2177 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-11
Source.965: DFBPPR2178 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 2
Source.966: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.967: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.968: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1
Source.969: DFBPPR2185 ---- Plant proteins ---- Inositol-pentakisphosphate 2-kinase IPK1
Source.970: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.971: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.972: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.973: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2
Source.974: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.975: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.976: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4
Source.977: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1
Source.978: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.979: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2
Source.980: DFBPPR2199 ---- Plant proteins ---- 18.0 kDa class II heat shock protein
Source.981: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5
Source.982: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.983: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1
Source.984: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.985: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.986: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.987: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16
Source.988: DFBPPR2208 ---- Plant proteins ---- CBL-interacting protein kinase 21
Source.989: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32
Source.990: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.991: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.992: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.993: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.994: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.995: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.996: DFBPPR2220 ---- Plant proteins ---- Expansin-A7
Source.997: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.998: DFBPPR2223 ---- Plant proteins ---- Urease
Source.999: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9
Source.1000: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.1001: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.1002: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1
Source.1003: DFBPPR2230 ---- Plant proteins ---- Proteasome subunit alpha type-2
Source.1004: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.1005: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6
Source.1006: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12
Source.1007: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.1008: DFBPPR2237 ---- Plant proteins ---- Probable glutathione S-transferase GSTU1
Source.1009: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.1010: DFBPPR2239 ---- Plant proteins ---- Elongation factor 1-alpha
Source.1011: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1
Source.1012: DFBPPR2241 ---- Plant proteins ---- Nitrogen regulatory protein P-II homolog
Source.1013: DFBPPR2242 ---- Plant proteins ---- Expansin-A3
Source.1014: DFBPPR2244 ---- Plant proteins ---- Expansin-A6
Source.1015: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9
Source.1016: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.1017: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3
Source.1018: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.1019: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30
Source.1020: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.1021: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13
Source.1022: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.1023: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.1024: DFBPPR2258 ---- Plant proteins ---- Proteasome subunit beta type-3
Source.1025: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.1026: DFBPPR2260 ---- Plant proteins ---- Succinate dehydrogenase subunit 3-1, mitochondrial
Source.1027: DFBPPR2261 ---- Plant proteins ---- Succinate dehydrogenase subunit 3-2, mitochondrial
Source.1028: DFBPPR2262 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 6
Source.1029: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29
Source.1030: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.1031: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.1032: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.1033: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.1034: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.1035: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase
Source.1036: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.1037: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.1038: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.1039: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3
Source.1040: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.1041: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.1042: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.1043: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.1044: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS
Source.1045: DFBPPR2286 ---- Plant proteins ---- Proteasome subunit alpha type-4-1
Source.1046: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3
Source.1047: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B
Source.1048: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.1049: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.1050: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3
Source.1051: DFBPPR2292 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.1052: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3
Source.1053: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.1054: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B
Source.1055: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic
Source.1056: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4
Source.1057: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3
Source.1058: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.1059: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic
Source.1060: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1061: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7
Source.1062: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b
Source.1063: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5
Source.1064: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.1065: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA
Source.1066: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.1067: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.1068: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.1069: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.1070: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2
Source.1071: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic
Source.1072: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2
Source.1073: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.1074: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3
Source.1075: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.1076: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3
Source.1077: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b
Source.1078: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.1079: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4
Source.1080: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.1081: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.1082: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1
Source.1083: DFBPPR2342 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic
Source.1084: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A
Source.1085: DFBPPR2344 ---- Plant proteins ---- Calcineurin B-like protein 8
Source.1086: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.1087: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.1088: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.1089: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.1090: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.1091: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.1092: DFBPPR2358 ---- Plant proteins ---- Germin-like protein 8-11
Source.1093: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.1094: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.1095: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.1096: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.1097: DFBPPR2364 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.1098: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.1099: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.1100: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5
Source.1101: DFBPPR2368 ---- Plant proteins ---- Thioredoxin M1, chloroplastic
Source.1102: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.1103: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.1104: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.1105: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.1106: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6
Source.1107: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.1108: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase
Source.1109: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.1110: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.1111: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.1112: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100
Source.1113: DFBPPR2387 ---- Plant proteins ---- Chitinase 8
Source.1114: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10
Source.1115: DFBPPR2389 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-1
Source.1116: DFBPPR2390 ---- Plant proteins ---- Proteasome subunit alpha type-4-2
Source.1117: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.1118: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.1119: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.1120: DFBPPR2395 ---- Plant proteins ---- Pantoate--beta-alanine ligase
Source.1121: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5
Source.1122: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6
Source.1123: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.1124: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.1125: DFBPPR2405 ---- Plant proteins ---- Transcription factor BHLH089
Source.1126: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6
Source.1127: DFBPPR2408 ---- Plant proteins ---- Cytochrome f
Source.1128: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3
Source.1129: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B
Source.1130: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2
Source.1131: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.1132: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.1133: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.1134: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2
Source.1135: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.1136: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.1137: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1
Source.1138: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33
Source.1139: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic
Source.1140: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.1141: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1
Source.1142: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.1143: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.1144: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.1145: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.1146: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3
Source.1147: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1148: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.1149: DFBPPR2436 ---- Plant proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3
Source.1150: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1
Source.1151: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.1152: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.1153: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain
Source.1154: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1155: DFBPPR2445 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 3
Source.1156: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6
Source.1157: DFBPPR2448 ---- Plant proteins ---- Expansin-A9
Source.1158: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.1159: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic
Source.1160: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic
Source.1161: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.1162: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial
Source.1163: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.1164: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.1165: DFBPPR2457 ---- Plant proteins ---- Proteasome subunit alpha type-4-3
Source.1166: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.1167: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1
Source.1168: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.1169: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25
Source.1170: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.1171: DFBPPR2468 ---- Plant proteins ---- Germin-like protein 8-3
Source.1172: DFBPPR2469 ---- Plant proteins ---- Germin-like protein 8-4
Source.1173: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial
Source.1174: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.1175: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.1176: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.1177: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase
Source.1178: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2
Source.1179: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1180: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14
Source.1181: DFBPPR2480 ---- Plant proteins ---- Germin-like protein 8-7
Source.1182: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1
Source.1183: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2
Source.1184: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1
Source.1185: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.1186: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic
Source.1187: DFBPPR2491 ---- Plant proteins ---- Expansin-A10
Source.1188: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.1189: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic
Source.1190: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.1191: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.1192: DFBPPR2497 ---- Plant proteins ---- Thioredoxin-like protein HCF164, chloroplastic
Source.1193: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20
Source.1194: DFBPPR2501 ---- Plant proteins ---- Germin-like protein 8-10
Source.1195: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900
Source.1196: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.1197: DFBPPR2505 ---- Plant proteins ---- Germin-like protein 8-5
Source.1198: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic
Source.1199: DFBPPR2507 ---- Plant proteins ---- Protein YABBY 4
Source.1200: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic
Source.1201: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.1202: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13
Source.1203: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.1204: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.1205: DFBPPR2516 ---- Plant proteins ---- Expansin-B16
Source.1206: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.1207: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.1208: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.1209: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.1210: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.1211: DFBPPR2526 ---- Plant proteins ---- Chitinase 10
Source.1212: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.1213: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2
Source.1214: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.1215: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20
Source.1216: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4
Source.1217: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta
Source.1218: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c
Source.1219: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.1220: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.1221: DFBPPR2540 ---- Plant proteins ---- 23.2 kDa heat shock protein
Source.1222: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.1223: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.1224: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta
Source.1225: DFBPPR2544 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.1226: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1
Source.1227: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.1228: DFBPPR2547 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 3, chloroplastic
Source.1229: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.1230: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a
Source.1231: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.1232: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.1233: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.1234: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.1235: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.1236: DFBPPR2558 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.1237: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.1238: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic
Source.1239: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4
Source.1240: DFBPPR2562 ---- Plant proteins ---- WUSCHEL-related homeobox 9
Source.1241: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase
Source.1242: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3
Source.1243: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.1244: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4
Source.1245: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.1246: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.1247: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.1248: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200
Source.1249: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b
Source.1250: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial
Source.1251: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.1252: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.1253: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.1254: DFBPPR2586 ---- Plant proteins ---- Probable protein-S-isoprenylcysteine O-methyltransferase
Source.1255: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.1256: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a
Source.1257: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic
Source.1258: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.1259: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1
Source.1260: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.1261: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.1262: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A
Source.1263: DFBPPR2595 ---- Plant proteins ---- Expansin-B7
Source.1264: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9
Source.1265: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase
Source.1266: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5
Source.1267: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.1268: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.1269: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.1270: DFBPPR2605 ---- Plant proteins ---- Clathrin light chain 2
Source.1271: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.1272: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.1273: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E
Source.1274: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.1275: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57
Source.1276: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.1277: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.1278: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3
Source.1279: DFBPPR2618 ---- Plant proteins ---- Putative eukaryotic initiation factor 4A-2
Source.1280: DFBPPR2621 ---- Plant proteins ---- Germin-like protein 4-1
Source.1281: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a
Source.1282: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.1283: DFBPPR2629 ---- Plant proteins ---- Calcineurin B-like protein 1
Source.1284: DFBPPR2630 ---- Plant proteins ---- Probable protein phosphatase 2C 34
Source.1285: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.1286: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.1287: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.1288: DFBPPR2634 ---- Plant proteins ---- 16.0 kDa heat shock protein, peroxisomal
Source.1289: DFBPPR2636 ---- Plant proteins ---- Expansin-B8
Source.1290: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.1291: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.1292: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18
Source.1293: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.1294: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1
Source.1295: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic
Source.1296: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25
Source.1297: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.1298: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8
Source.1299: DFBPPR2650 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 2
Source.1300: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2
Source.1301: DFBPPR2653 ---- Plant proteins ---- Putative germin-like protein 12-4
Source.1302: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.1303: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic
Source.1304: DFBPPR2656 ---- Plant proteins ---- Expansin-A15
Source.1305: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.1306: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b
Source.1307: DFBPPR2659 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.1308: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.1309: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5
Source.1310: DFBPPR2662 ---- Plant proteins ---- Putative germin-like protein 12-3
Source.1311: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8
Source.1312: DFBPPR2665 ---- Plant proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.1313: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2
Source.1314: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.1315: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.1316: DFBPPR2670 ---- Plant proteins ---- Putative germin-like protein 2-2
Source.1317: DFBPPR2671 ---- Plant proteins ---- Proteasome subunit beta type-2
Source.1318: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein
Source.1319: DFBPPR2673 ---- Plant proteins ---- Expansin-B13
Source.1320: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.1321: DFBPPR2676 ---- Plant proteins ---- Expansin-A11
Source.1322: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.1323: DFBPPR2679 ---- Plant proteins ---- Expansin-A22
Source.1324: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1
Source.1325: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.1326: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1
Source.1327: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase
Source.1328: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1
Source.1329: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.1330: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.1331: DFBPPR2689 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.1332: DFBPPR2690 ---- Plant proteins ---- E3 ubiquitin-protein ligase makorin
Source.1333: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.1334: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.1335: DFBPPR2694 ---- Plant proteins ---- Monothiol glutaredoxin-S7, chloroplastic
Source.1336: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27
Source.1337: DFBPPR2698 ---- Plant proteins ---- Proteasome subunit alpha type-6
Source.1338: DFBPPR2699 ---- Plant proteins ---- Expansin-A8
Source.1339: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.1340: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.1341: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.1342: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.1343: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9
Source.1344: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b
Source.1345: DFBPPR2712 ---- Plant proteins ---- Expansin-A20
Source.1346: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.1347: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77
Source.1348: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.1349: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A
Source.1350: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.1351: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.1352: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.1353: DFBPPR2721 ---- Plant proteins ---- Expansin-A18
Source.1354: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20
Source.1355: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B
Source.1356: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic
Source.1357: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit
Source.1358: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic
Source.1359: DFBPPR2728 ---- Plant proteins ---- Autophagy-related protein 8B
Source.1360: DFBPPR2729 ---- Plant proteins ---- Protein BZR1 homolog 2
Source.1361: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.1362: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.1363: DFBPPR2735 ---- Plant proteins ---- Expansin-A24
Source.1364: DFBPPR2737 ---- Plant proteins ---- Putative beta-glucosidase 9
Source.1365: DFBPPR2738 ---- Plant proteins ---- Autophagy-related protein 8C
Source.1366: DFBPPR2740 ---- Plant proteins ---- Autophagy-related protein 8A
Source.1367: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5
Source.1368: DFBPPR2742 ---- Plant proteins ---- Uncharacterized protein Os08g0359500
Source.1369: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1370: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.1371: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7
Source.1372: DFBPPR2748 ---- Plant proteins ---- Secretory carrier-associated membrane protein 6
Source.1373: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.1374: DFBPPR2752 ---- Plant proteins ---- Secretory carrier-associated membrane protein 5
Source.1375: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.1376: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2
Source.1377: DFBPPR2758 ---- Plant proteins ---- Expansin-B17
Source.1378: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.1379: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.1380: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.1381: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.1382: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.1383: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2
Source.1384: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3
Source.1385: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1386: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.1387: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.1388: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.1389: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2
Source.1390: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.1391: DFBPPR2776 ---- Plant proteins ---- Splicing factor U2af small subunit A
Source.1392: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3
Source.1393: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.1394: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2
Source.1395: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2
Source.1396: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.1397: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.1398: DFBPPR2783 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.1399: DFBPPR2784 ---- Plant proteins ---- Chitinase 11
Source.1400: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.1401: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein
Source.1402: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a
Source.1403: DFBPPR2788 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.1404: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1405: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.1406: DFBPPR2791 ---- Plant proteins ---- Calcineurin B-like protein 7
Source.1407: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.1408: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1409: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.1410: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.1411: DFBPPR2800 ---- Plant proteins ---- Germin-like protein 8-12
Source.1412: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.1413: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.1414: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.1415: DFBPPR2805 ---- Plant proteins ---- Serine/threonine-protein kinase Nek2
Source.1416: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.1417: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1418: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.1419: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.1420: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.1421: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.1422: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.1423: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.1424: DFBPPR2818 ---- Plant proteins ---- Replication protein A 14 kDa subunit
Source.1425: DFBPPR2819 ---- Plant proteins ---- Squamosa promoter-binding-like protein 4
Source.1426: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.1427: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1
Source.1428: DFBPPR2823 ---- Plant proteins ---- Germin-like protein 8-9
Source.1429: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3
Source.1430: DFBPPR2827 ---- Plant proteins ---- Germin-like protein 8-8
Source.1431: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.1432: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2
Source.1433: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A
Source.1434: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.1435: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23
Source.1436: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.1437: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B
Source.1438: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.1439: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.1440: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.1441: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.1442: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.1443: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.1444: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.1445: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1446: DFBPPR2850 ---- Plant proteins ---- Germin-like protein 8-6
Source.1447: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.1448: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1449: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.1450: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103
Source.1451: DFBPPR2859 ---- Plant proteins ---- Proton pump-interactor BIP131
Source.1452: DFBPPR2860 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 3
Source.1453: DFBPPR2861 ---- Plant proteins ---- Probable aquaporin TIP1-1
Source.1454: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase
Source.1455: DFBPPR2863 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.1456: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.1457: DFBPPR2866 ---- Plant proteins ---- Phosphomannomutase
Source.1458: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.1459: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2
Source.1460: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.1461: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.1462: DFBPPR2873 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL2
Source.1463: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.1464: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.1465: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.1466: DFBPPR2877 ---- Plant proteins ---- Splicing factor U2af small subunit B
Source.1467: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog
Source.1468: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3
Source.1469: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.1470: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.1471: DFBPPR2883 ---- Plant proteins ---- Expansin-B9
Source.1472: DFBPPR2884 ---- Plant proteins ---- Expansin-B2
Source.1473: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.1474: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32
Source.1475: DFBPPR2888 ---- Plant proteins ---- Expansin-B10
Source.1476: DFBPPR2890 ---- Plant proteins ---- Germin-like protein 3-6
Source.1477: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2
Source.1478: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c
Source.1479: DFBPPR2894 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21A
Source.1480: DFBPPR2895 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21
Source.1481: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.1482: DFBPPR2898 ---- Plant proteins ---- Germin-like protein 12-1
Source.1483: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7
Source.1484: DFBPPR2900 ---- Plant proteins ---- Expansin-A23
Source.1485: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB
Source.1486: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.1487: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2
Source.1488: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.1489: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.1490: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.1491: DFBPPR2910 ---- Plant proteins ---- Expansin-B5
Source.1492: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.1493: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.1494: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.1495: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.1496: DFBPPR2919 ---- Plant proteins ---- Germin-like protein 3-5
Source.1497: DFBPPR2920 ---- Plant proteins ---- Putative germin-like protein 2-3
Source.1498: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.1499: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.1500: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.1501: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.1502: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4
Source.1503: DFBPPR2930 ---- Plant proteins ---- Putative germin-like protein 3-4
Source.1504: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14
Source.1505: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.1506: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.1507: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13
Source.1508: DFBPPR2936 ---- Plant proteins ---- Putative germin-like protein 2-1
Source.1509: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.1510: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A
Source.1511: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5
Source.1512: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1
Source.1513: DFBPPR2942 ---- Plant proteins ---- Germin-like protein 12-2
Source.1514: DFBPPR2943 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 8
Source.1515: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27
Source.1516: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic
Source.1517: DFBPPR2947 ---- Plant proteins ---- Peroxisomal membrane protein 11-5
Source.1518: DFBPPR2948 ---- Plant proteins ---- Expansin-A25
Source.1519: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1
Source.1520: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic
Source.1521: DFBPPR2952 ---- Plant proteins ---- Expansin-A17
Source.1522: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1
Source.1523: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1524: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3
Source.1525: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.1526: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21
Source.1527: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.1528: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.1529: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1
Source.1530: DFBPPR2964 ---- Plant proteins ---- Expansin-A14
Source.1531: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.1532: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7
Source.1533: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.1534: DFBPPR2970 ---- Plant proteins ---- Germin-like protein 1-2
Source.1535: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.1536: DFBPPR2973 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.1537: DFBPPR2974 ---- Plant proteins ---- Derlin-1
Source.1538: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4
Source.1539: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic
Source.1540: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic
Source.1541: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.1542: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1
Source.1543: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.1544: DFBPPR2982 ---- Plant proteins ---- SKP1-like protein 5
Source.1545: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23
Source.1546: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic
Source.1547: DFBPPR2985 ---- Plant proteins ---- Coatomer subunit delta-3
Source.1548: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1
Source.1549: DFBPPR2992 ---- Plant proteins ---- DnaJ protein ERDJ7
Source.1550: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.1551: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.1552: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B
Source.1553: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.1554: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13
Source.1555: DFBPPR3004 ---- Plant proteins ---- Long chain base biosynthesis protein 1a
Source.1556: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like
Source.1557: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.1558: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.1559: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.1560: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2
Source.1561: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2
Source.1562: DFBPPR3015 ---- Plant proteins ---- Expansin-A13
Source.1563: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.1564: DFBPPR3017 ---- Plant proteins ---- Expansin-A12
Source.1565: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.1566: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.1567: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.1568: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.1569: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.1570: DFBPPR3027 ---- Plant proteins ---- Expansin-A31
Source.1571: DFBPPR3028 ---- Plant proteins ---- Expansin-A19
Source.1572: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.1573: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3
Source.1574: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1
Source.1575: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.1576: DFBPPR3035 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL1
Source.1577: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1
Source.1578: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.1579: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.1580: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic
Source.1581: DFBPPR3042 ---- Plant proteins ---- Deoxyuridine 5'-triphosphate nucleotidohydrolase
Source.1582: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24
Source.1583: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase
Source.1584: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B
Source.1585: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.1586: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2
Source.1587: DFBPPR3051 ---- Plant proteins ---- Protein YABBY 3
Source.1588: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.1589: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1
Source.1590: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.1591: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16
Source.1592: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A
Source.1593: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.1594: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.1595: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial
Source.1596: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.1597: DFBPPR3068 ---- Plant proteins ---- Uroporphyrinogen-III synthase, chloroplastic
Source.1598: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.1599: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.1600: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.1601: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.1602: DFBPPR3075 ---- Plant proteins ---- Thiamine pyrophosphokinase 2
Source.1603: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1
Source.1604: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.1605: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.1606: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.1607: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.1608: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7
Source.1609: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.1610: DFBPPR3085 ---- Plant proteins ---- Thiamine pyrophosphokinase 3
Source.1611: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34
Source.1612: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.1613: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase
Source.1614: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.1615: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.1616: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4
Source.1617: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.1618: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic
Source.1619: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.1620: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.1621: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.1622: DFBPPR3102 ---- Plant proteins ---- Expansin-B18
Source.1623: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.1624: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.1625: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21
Source.1626: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.1627: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1
Source.1628: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28
Source.1629: DFBPPR3113 ---- Plant proteins ---- Putative autophagy-related protein 8E
Source.1630: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial
Source.1631: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2
Source.1632: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.1633: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.1634: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.1635: DFBPPR3123 ---- Plant proteins ---- Probable mitochondrial import receptor subunit TOM20
Source.1636: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.1637: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.1638: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.1639: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4
Source.1640: DFBPPR3130 ---- Plant proteins ---- COP9 signalosome complex subunit 6
Source.1641: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1642: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2
Source.1643: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.1644: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5
Source.1645: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.1646: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.1647: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.1648: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.1649: DFBPPR3143 ---- Plant proteins ---- Protein OS-9 homolog
Source.1650: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.1651: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1652: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.1653: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.1654: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.1655: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2
Source.1656: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.1657: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4
Source.1658: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5
Source.1659: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.1660: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.1661: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.1662: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2
Source.1663: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.1664: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.1665: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I
Source.1666: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1
Source.1667: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48
Source.1668: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.1669: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1670: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.1671: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300
Source.1672: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.1673: DFBPPR3191 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial
Source.1674: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1675: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.1676: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.1677: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1
Source.1678: DFBPPR3198 ---- Plant proteins ---- Probable protein phosphatase 2C 59
Source.1679: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.1680: DFBPPR3203 ---- Plant proteins ---- Monothiol glutaredoxin-S10
Source.1681: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.1682: DFBPPR3206 ---- Plant proteins ---- Expansin-B15
Source.1683: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B
Source.1684: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.1685: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic
Source.1686: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2
Source.1687: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.1688: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A
Source.1689: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.1690: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.1691: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.1692: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic
Source.1693: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750
Source.1694: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.1695: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4
Source.1696: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1
Source.1697: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1
Source.1698: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.1699: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3
Source.1700: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.1701: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain
Source.1702: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1
Source.1703: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37
Source.1704: DFBPPR3232 ---- Plant proteins ---- Expansin-A28
Source.1705: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.1706: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26
Source.1707: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.1708: DFBPPR3238 ---- Plant proteins ---- Hydrophobic protein LTI6A
Source.1709: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic
Source.1710: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.1711: DFBPPR3241 ---- Plant proteins ---- Elongation factor 1-delta 2
Source.1712: DFBPPR3242 ---- Plant proteins ---- Peroxisomal membrane protein 11-1
Source.1713: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.1714: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.1715: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.1716: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.1717: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.1718: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.1719: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.1720: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.1721: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70
Source.1722: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.1723: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10
Source.1724: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.1725: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3
Source.1726: DFBPPR3259 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-3 catalytic subunit
Source.1727: DFBPPR3261 ---- Plant proteins ---- Autophagy-related protein 8D
Source.1728: DFBPPR3263 ---- Plant proteins ---- N-carbamoylputrescine amidase
Source.1729: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic
Source.1730: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.1731: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.1732: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.1733: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.1734: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein
Source.1735: DFBPPR3273 ---- Plant proteins ---- Dephospho-CoA kinase
Source.1736: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.1737: DFBPPR3278 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 3
Source.1738: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b
Source.1739: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.1740: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.1741: DFBPPR3284 ---- Plant proteins ---- Probable voltage-gated potassium channel subunit beta
Source.1742: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.1743: DFBPPR3286 ---- Plant proteins ---- Expansin-A32
Source.1744: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.1745: DFBPPR3288 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 2
Source.1746: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500
Source.1747: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1
Source.1748: DFBPPR3293 ---- Plant proteins ---- Protein-ribulosamine 3-kinase, chloroplastic
Source.1749: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.1750: DFBPPR3298 ---- Plant proteins ---- Hydrophobic protein LTI6B
Source.1751: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.1752: DFBPPR3302 ---- Plant proteins ---- Expansin-A21
Source.1753: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.1754: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.1755: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.1756: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.1757: DFBPPR3311 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 2
Source.1758: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1
Source.1759: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1
Source.1760: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.1761: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5
Source.1762: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13
Source.1763: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.1764: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8
Source.1765: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.1766: DFBPPR3321 ---- Plant proteins ---- Glutaredoxin-C8
Source.1767: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.1768: DFBPPR3323 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL7
Source.1769: DFBPPR3324 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2C
Source.1770: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3
Source.1771: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9
Source.1772: DFBPPR3328 ---- Plant proteins ---- Putative expansin-A30
Source.1773: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial
Source.1774: DFBPPR3332 ---- Plant proteins ---- Vacuolar iron transporter homolog 5
Source.1775: DFBPPR3333 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 11
Source.1776: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.1777: DFBPPR3338 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1a
Source.1778: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a
Source.1779: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.1780: DFBPPR3342 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic
Source.1781: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8
Source.1782: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.1783: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.1784: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.1785: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic
Source.1786: DFBPPR3353 ---- Plant proteins ---- Vacuolar iron transporter homolog 2
Source.1787: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.1788: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6
Source.1789: DFBPPR3357 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein B
Source.1790: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4
Source.1791: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.1792: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.1793: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.1794: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.1795: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38
Source.1796: DFBPPR3365 ---- Plant proteins ---- 50S ribosomal protein L5, chloroplastic
Source.1797: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.1798: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.1799: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.1800: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.1801: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1
Source.1802: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28
Source.1803: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.1804: DFBPPR3380 ---- Plant proteins ---- Vacuolar iron transporter homolog 1
Source.1805: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14
Source.1806: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2
Source.1807: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.1808: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2
Source.1809: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.1810: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.1811: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.1812: DFBPPR3390 ---- Plant proteins ---- Probable nucleoredoxin 1-2
Source.1813: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.1814: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.1815: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.1816: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.1817: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.1818: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2
Source.1819: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1
Source.1820: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9
Source.1821: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5
Source.1822: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2
Source.1823: DFBPPR3415 ---- Plant proteins ---- Expansin-A33
Source.1824: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.1825: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.1826: DFBPPR3421 ---- Plant proteins ---- Cyanate hydratase
Source.1827: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10
Source.1828: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.1829: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.1830: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.1831: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1
Source.1832: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.1833: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic
Source.1834: DFBPPR3429 ---- Plant proteins ---- Protein BZR1 homolog 3
Source.1835: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2
Source.1836: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2
Source.1837: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3
Source.1838: DFBPPR3434 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.1839: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49
Source.1840: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F
Source.1841: DFBPPR3437 ---- Plant proteins ---- Putative acetyl-coenzyme A carboxylase carboxyl transferase subunit beta-like protein
Source.1842: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.1843: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1
Source.1844: DFBPPR3444 ---- Plant proteins ---- Vacuolar iron transporter homolog 3
Source.1845: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.1846: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.1847: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.1848: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.1849: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2
Source.1850: DFBPPR3453 ---- Plant proteins ---- Probable protein phosphatase 2C 44
Source.1851: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.1852: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12
Source.1853: DFBPPR3456 ---- Plant proteins ---- Maturase K
Source.1854: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.1855: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.1856: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17
Source.1857: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog
Source.1858: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1
Source.1859: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1
Source.1860: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A
Source.1861: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73
Source.1862: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16
Source.1863: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.1864: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68
Source.1865: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600
Source.1866: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14
Source.1867: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1
Source.1868: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.1869: DFBPPR3481 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 8
Source.1870: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic
Source.1871: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.1872: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.1873: DFBPPR3488 ---- Plant proteins ---- GATA transcription factor 19
Source.1874: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.1875: DFBPPR3492 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 9
Source.1876: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20
Source.1877: DFBPPR3494 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS32
Source.1878: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.1879: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4
Source.1880: DFBPPR3498 ---- Plant proteins ---- Actin-related protein 6
Source.1881: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.1882: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2
Source.1883: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600
Source.1884: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.1885: DFBPPR3506 ---- Plant proteins ---- Growth-regulating factor 12
Source.1886: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2
Source.1887: DFBPPR3508 ---- Plant proteins ---- 60S ribosomal protein L5-1
Source.1888: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.1889: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.1890: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14
Source.1891: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4
Source.1892: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18
Source.1893: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.1894: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6
Source.1895: DFBPPR3521 ---- Plant proteins ---- Photosystem II reaction center W protein, chloroplastic
Source.1896: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56
Source.1897: DFBPPR3523 ---- Plant proteins ---- Ubiquitin-like protein ATG12
Source.1898: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4
Source.1899: DFBPPR3526 ---- Plant proteins ---- Protein XAP5 CIRCADIAN TIMEKEEPER
Source.1900: DFBPPR3527 ---- Plant proteins ---- Elongation factor 1-delta 1
Source.1901: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2
Source.1902: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36
Source.1903: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.1904: DFBPPR3533 ---- Plant proteins ---- Peroxisomal membrane protein 11-4
Source.1905: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial
Source.1906: DFBPPR3535 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.1907: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.1908: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic
Source.1909: DFBPPR3538 ---- Plant proteins ---- Probable protein phosphatase 2C 7
Source.1910: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2
Source.1911: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2
Source.1912: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.1913: DFBPPR3542 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 2
Source.1914: DFBPPR3543 ---- Plant proteins ---- 26.7 kDa heat shock protein, chloroplastic
Source.1915: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.1916: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3
Source.1917: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.1918: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.1919: DFBPPR3551 ---- Plant proteins ---- Salt stress-induced protein
Source.1920: DFBPPR3554 ---- Plant proteins ---- GTP-binding nuclear protein Ran-3
Source.1921: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8
Source.1922: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic
Source.1923: DFBPPR3558 ---- Plant proteins ---- Probable protein phosphatase 2C 45
Source.1924: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.1925: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.1926: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.1927: DFBPPR3569 ---- Plant proteins ---- Probable protein phosphatase 2C 58
Source.1928: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.1929: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.1930: DFBPPR3573 ---- Plant proteins ---- Protein TIFY 5
Source.1931: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.1932: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3
Source.1933: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5
Source.1934: DFBPPR3582 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7c
Source.1935: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.1936: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.1937: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.1938: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3
Source.1939: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.1940: DFBPPR3591 ---- Plant proteins ---- Probable adenylate kinase 7, mitochondrial
Source.1941: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12
Source.1942: DFBPPR3594 ---- Plant proteins ---- Auxin-responsive protein IAA10
Source.1943: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.1944: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2
Source.1945: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.1946: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1
Source.1947: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.1948: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3
Source.1949: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.1950: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.1951: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1
Source.1952: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase
Source.1953: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6
Source.1954: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6
Source.1955: DFBPPR3615 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7b
Source.1956: DFBPPR3617 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog
Source.1957: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.1958: DFBPPR3619 ---- Plant proteins ---- Cyclin-D3-1
Source.1959: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L
Source.1960: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.1961: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6
Source.1962: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K
Source.1963: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1
Source.1964: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1
Source.1965: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.1966: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.1967: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5
Source.1968: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.1969: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.1970: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.1971: DFBPPR3636 ---- Plant proteins ---- Probable aquaporin TIP2-2
Source.1972: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.1973: DFBPPR3640 ---- Plant proteins ---- Dof zinc finger protein 1
Source.1974: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1
Source.1975: DFBPPR3642 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7e
Source.1976: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a
Source.1977: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.1978: DFBPPR3647 ---- Plant proteins ---- Dof zinc finger protein 2
Source.1979: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.1980: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2
Source.1981: DFBPPR3654 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7a
Source.1982: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic
Source.1983: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.1984: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3
Source.1985: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1986: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3
Source.1987: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J
Source.1988: DFBPPR3666 ---- Plant proteins ---- Glutelin type-B 5
Source.1989: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29
Source.1990: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.1991: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.1992: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.1993: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.1994: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F
Source.1995: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.1996: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.1997: DFBPPR3684 ---- Plant proteins ---- Photosystem II reaction center protein I
Source.1998: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.1999: DFBPPR3688 ---- Plant proteins ---- Probable protein phosphatase 2C 67
Source.2000: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.2001: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.2002: DFBPPR3691 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7d
Source.2003: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.2004: DFBPPR3694 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 7
Source.2005: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39
Source.2006: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.2007: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.2008: DFBPPR3700 ---- Plant proteins ---- Protein G1-like3
Source.2009: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.2010: DFBPPR3705 ---- Plant proteins ---- Protein YABBY 2
Source.2011: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2
Source.2012: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11
Source.2013: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.2014: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15
Source.2015: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1
Source.2016: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.2017: DFBPPR3714 ---- Plant proteins ---- GDT1-like protein 4
Source.2018: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3
Source.2019: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.2020: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.2021: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1
Source.2022: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5
Source.2023: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.2024: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.2025: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.2026: DFBPPR3723 ---- Plant proteins ---- Inactive protein FON2 SPARE1
Source.2027: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.2028: DFBPPR3726 ---- Plant proteins ---- Probable aquaporin PIP2-2
Source.2029: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1
Source.2030: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1
Source.2031: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8
Source.2032: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3
Source.2033: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.2034: DFBPPR3740 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0107900
Source.2035: DFBPPR3742 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.2036: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.2037: DFBPPR3745 ---- Plant proteins ---- Protein FERTILITY RESTORER RF2, mitochondrial
Source.2038: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.2039: DFBPPR3752 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 7
Source.2040: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4
Source.2041: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12
Source.2042: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71
Source.2043: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1
Source.2044: DFBPPR3760 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic
Source.2045: DFBPPR3761 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 6
Source.2046: DFBPPR3764 ---- Plant proteins ---- Cytochrome b6-f complex subunit 6
Source.2047: DFBPPR3765 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 1
Source.2048: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1
Source.2049: DFBPPR3767 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 8
Source.2050: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.2051: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51
Source.2052: DFBPPR3772 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 9
Source.2053: DFBPPR3773 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 3
Source.2054: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.2055: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.2056: DFBPPR3776 ---- Plant proteins ---- Cysteine proteinase inhibitor 4
Source.2057: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.2058: DFBPPR3778 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 2
Source.2059: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.2060: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.2061: DFBPPR3781 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 5
Source.2062: DFBPPR3782 ---- Plant proteins ---- Auxin-responsive protein IAA16
Source.2063: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.2064: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D
Source.2065: DFBPPR3787 ---- Plant proteins ---- Probable protein phosphatase 2C 55
Source.2066: DFBPPR3789 ---- Plant proteins ---- Succinate dehydrogenase subunit 5, mitochondrial
Source.2067: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1
Source.2068: DFBPPR3794 ---- Plant proteins ---- UDP-D-apiose/UDP-D-xylose synthase
Source.2069: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77
Source.2070: DFBPPR3799 ---- Plant proteins ---- Probable protein phosphatase 2C 42
Source.2071: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1
Source.2072: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.2073: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E
Source.2074: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.2075: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.2076: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B
Source.2077: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6
Source.2078: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.2079: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.2080: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.2081: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.2082: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.2083: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G
Source.2084: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.2085: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4
Source.2086: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22
Source.2087: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.2088: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.2089: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12
Source.2090: DFBPPR3832 ---- Plant proteins ---- 26.2 kDa heat shock protein, mitochondrial
Source.2091: DFBPPR3833 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-1 catalytic subunit
Source.2092: DFBPPR3834 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS35
Source.2093: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52
Source.2094: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C
Source.2095: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47
Source.2096: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.2097: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7
Source.2098: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2
Source.2099: DFBPPR3842 ---- Plant proteins ---- Probable protein phosphatase 2C 39
Source.2100: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.2101: DFBPPR3844 ---- Plant proteins ---- Probable protein phosphatase 2C 41
Source.2102: DFBPPR3845 ---- Plant proteins ---- Probable protein phosphatase 2C 54
Source.2103: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.2104: DFBPPR3849 ---- Plant proteins ---- Auxin-responsive protein IAA13
Source.2105: DFBPPR3850 ---- Plant proteins ---- Probable protein phosphatase 2C 73
Source.2106: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic
Source.2107: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.2108: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66
Source.2109: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21
Source.2110: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.2111: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29
Source.2112: DFBPPR3860 ---- Plant proteins ---- Probable protein phosphatase 2C 62
Source.2113: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1
Source.2114: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic
Source.2115: DFBPPR3866 ---- Plant proteins ---- Aspartic proteinase Asp1
Source.2116: DFBPPR3867 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 13
Source.2117: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.2118: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.2119: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.2120: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.2121: DFBPPR3876 ---- Plant proteins ---- Bifunctional nuclease 2
Source.2122: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1
Source.2123: DFBPPR3878 ---- Plant proteins ---- Growth-regulating factor 10
Source.2124: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.2125: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1
Source.2126: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.2127: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20
Source.2128: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.2129: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.2130: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.2131: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.2132: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11
Source.2133: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2
Source.2134: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.2135: DFBPPR3898 ---- Plant proteins ---- Squamosa promoter-binding-like protein 11
Source.2136: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.2137: DFBPPR3900 ---- Plant proteins ---- Growth-regulating factor 11
Source.2138: DFBPPR3901 ---- Plant proteins ---- Growth-regulating factor 9
Source.2139: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial
Source.2140: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5
Source.2141: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7
Source.2142: DFBPPR3906 ---- Plant proteins ---- Protein G1-like8
Source.2143: DFBPPR3909 ---- Plant proteins ---- LIM domain-containing protein PLIM2b
Source.2144: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.2145: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.2146: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.2147: DFBPPR3914 ---- Plant proteins ---- Derlin-2
Source.2148: DFBPPR3916 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1b
Source.2149: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b
Source.2150: DFBPPR3922 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-4 catalytic subunit
Source.2151: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.2152: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.2153: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.2154: DFBPPR3927 ---- Plant proteins ---- Basic leucine zipper 2
Source.2155: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.2156: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1
Source.2157: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.2158: DFBPPR3933 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-2 catalytic subunit
Source.2159: DFBPPR3934 ---- Plant proteins ---- Probable calcium-binding protein CML8
Source.2160: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.2161: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14
Source.2162: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3
Source.2163: DFBPPR3941 ---- Plant proteins ---- KIN17-like protein
Source.2164: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.2165: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.2166: DFBPPR3945 ---- Plant proteins ---- Myb-related protein MYBAS1
Source.2167: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.2168: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA
Source.2169: DFBPPR3952 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 1
Source.2170: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16
Source.2171: DFBPPR3954 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-3, chloroplastic
Source.2172: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1
Source.2173: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2
Source.2174: DFBPPR3959 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.2175: DFBPPR3961 ---- Plant proteins ---- Zinc-finger homeodomain protein 8
Source.2176: DFBPPR3962 ---- Plant proteins ---- Myb-related protein MYBAS2
Source.2177: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.2178: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.2179: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic
Source.2180: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.2181: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.2182: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1
Source.2183: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.2184: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2
Source.2185: DFBPPR3979 ---- Plant proteins ---- Probable uridine nucleosidase 1
Source.2186: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.2187: DFBPPR3987 ---- Plant proteins ---- Coatomer subunit epsilon-2
Source.2188: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500
Source.2189: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27
Source.2190: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.2191: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2
Source.2192: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.2193: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.2194: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.2195: DFBPPR3998 ---- Plant proteins ---- Protein G1-like9
Source.2196: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A
Source.2197: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.2198: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2
Source.2199: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6
Source.2200: DFBPPR4005 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.2201: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.2202: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5
Source.2203: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.2204: DFBPPR4012 ---- Plant proteins ---- Protein G1-like5
Source.2205: DFBPPR4014 ---- Plant proteins ---- Probable high-affinity nitrate transporter-activating protein 2.2
Source.2206: DFBPPR4015 ---- Plant proteins ---- GDT1-like protein 3
Source.2207: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic
Source.2208: DFBPPR4017 ---- Plant proteins ---- Protein G1-like4
Source.2209: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.2210: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4
Source.2211: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1
Source.2212: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1
Source.2213: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.2214: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.2215: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.2216: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.2217: DFBPPR4031 ---- Plant proteins ---- Probable protein phosphatase 2C 27
Source.2218: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog
Source.2219: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58
Source.2220: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8
Source.2221: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1
Source.2222: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.2223: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.2224: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.2225: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase
Source.2226: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6
Source.2227: DFBPPR4045 ---- Plant proteins ---- 60S ribosomal protein L11
Source.2228: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta
Source.2229: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.2230: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.2231: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.2232: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.2233: DFBPPR4055 ---- Plant proteins ---- Serpin-ZXB
Source.2234: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11
Source.2235: DFBPPR4060 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic
Source.2236: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.2237: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog
Source.2238: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C
Source.2239: DFBPPR4068 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 6
Source.2240: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.2241: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like
Source.2242: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4
Source.2243: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.2244: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.2245: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3
Source.2246: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.2247: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic
Source.2248: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.2249: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2
Source.2250: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.2251: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.2252: DFBPPR4091 ---- Plant proteins ---- Putative auxin-responsive protein IAA29
Source.2253: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.2254: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.2255: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.2256: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic
Source.2257: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.2258: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.2259: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4
Source.2260: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.2261: DFBPPR4107 ---- Plant proteins ---- Protein PsbN
Source.2262: DFBPPR4109 ---- Plant proteins ---- 60S ribosomal protein L5-2
Source.2263: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.2264: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.2265: DFBPPR4116 ---- Plant proteins ---- 40S ribosomal protein S4
Source.2266: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2
Source.2267: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33
Source.2268: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1
Source.2269: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3
Source.2270: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.2271: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2
Source.2272: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.2273: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75
Source.2274: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5
Source.2275: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.2276: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.2277: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31
Source.2278: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16
Source.2279: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.2280: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.2281: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2
Source.2282: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2
Source.2283: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.2284: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.2285: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1
Source.2286: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.2287: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H
Source.2288: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.2289: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67
Source.2290: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.2291: DFBPPR4159 ---- Plant proteins ---- Protein YABBY 6
Source.2292: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10
Source.2293: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.2294: DFBPPR4164 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 1
Source.2295: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.2296: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.2297: DFBPPR4168 ---- Plant proteins ---- Protein FERTILITY RESTORER RF2, mitochondrial
Source.2298: DFBPPR4169 ---- Plant proteins ---- Succinate dehydrogenase subunit 6, mitochondrial
Source.2299: DFBPPR4170 ---- Plant proteins ---- CMP-sialic acid transporter 3
Source.2300: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4
Source.2301: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.2302: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.2303: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.2304: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.2305: DFBPPR4182 ---- Plant proteins ---- Magnesium transporter MRS2-I
Source.2306: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.2307: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.2308: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH
Source.2309: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2
Source.2310: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.2311: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1
Source.2312: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3
Source.2313: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.2314: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.2315: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.2316: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial
Source.2317: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.2318: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54
Source.2319: DFBPPR4216 ---- Plant proteins ---- Prolamin PPROL 14P
Source.2320: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.2321: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2
Source.2322: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4
Source.2323: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.2324: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.2325: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22
Source.2326: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.2327: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5
Source.2328: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A
Source.2329: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic
Source.2330: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1
Source.2331: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4
Source.2332: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.2333: DFBPPR4233 ---- Plant proteins ---- Putative glutaredoxin-C2
Source.2334: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3
Source.2335: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.2336: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H
Source.2337: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.2338: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.2339: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2
Source.2340: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.2341: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.2342: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4
Source.2343: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic
Source.2344: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1
Source.2345: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1
Source.2346: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1
Source.2347: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.2348: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.2349: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16
Source.2350: DFBPPR4263 ---- Plant proteins ---- Putative protein phosphatase 2C 63
Source.2351: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.2352: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.2353: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1
Source.2354: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3
Source.2355: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1
Source.2356: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6
Source.2357: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.2358: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial
Source.2359: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15
Source.2360: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4
Source.2361: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3
Source.2362: DFBPPR4282 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.2363: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.2364: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.2365: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.2366: DFBPPR4293 ---- Plant proteins ---- Double-stranded RNA-binding protein 7
Source.2367: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.2368: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.2369: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10
Source.2370: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.2371: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17
Source.2372: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1
Source.2373: DFBPPR4311 ---- Plant proteins ---- WUSCHEL-related homeobox 6
Source.2374: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.2375: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1
Source.2376: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.2377: DFBPPR4319 ---- Plant proteins ---- Photosystem I reaction center subunit IX
Source.2378: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1
Source.2379: DFBPPR4324 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.2380: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11
Source.2381: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.2382: DFBPPR4331 ---- Plant proteins ---- 60S ribosomal protein L10-2
Source.2383: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.2384: DFBPPR4333 ---- Plant proteins ---- Putative potassium channel KAT5
Source.2385: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5
Source.2386: DFBPPR4339 ---- Plant proteins ---- Protein LHCP TRANSLOCATION DEFECT
Source.2387: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10
Source.2388: DFBPPR4341 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1J
Source.2389: DFBPPR4342 ---- Plant proteins ---- Nucleolin 1
Source.2390: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2
Source.2391: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.2392: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1
Source.2393: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4
Source.2394: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic
Source.2395: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.2396: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.2397: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.2398: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.2399: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.2400: DFBPPR4370 ---- Plant proteins ---- Glucose and ribitol dehydrogenase homolog
Source.2401: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.2402: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10
Source.2403: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E
Source.2404: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.2405: DFBPPR4379 ---- Plant proteins ---- CASP-like protein 1B1
Source.2406: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.2407: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.2408: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.2409: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2
Source.2410: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5
Source.2411: DFBPPR4387 ---- Plant proteins ---- Dof zinc finger protein 5
Source.2412: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2
Source.2413: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic
Source.2414: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.2415: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2
Source.2416: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.2417: DFBPPR4398 ---- Plant proteins ---- 40S ribosomal protein S16
Source.2418: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5
Source.2419: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2
Source.2420: DFBPPR4403 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.2421: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.2422: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5
Source.2423: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.2424: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.2425: DFBPPR4413 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 4
Source.2426: DFBPPR4415 ---- Plant proteins ---- Putative ataxin-3 homolog
Source.2427: DFBPPR4416 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 4
Source.2428: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.2429: DFBPPR4422 ---- Plant proteins ---- Thioredoxin-like protein CXXS1
Source.2430: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.2431: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.2432: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.2433: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.2434: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.2435: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic
Source.2436: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog
Source.2437: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.2438: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein
Source.2439: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18
Source.2440: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.2441: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1
Source.2442: DFBPPR4439 ---- Plant proteins ---- Copper transporter 5.1
Source.2443: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.2444: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.2445: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.2446: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.2447: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.2448: DFBPPR4448 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS4, chloroplastic
Source.2449: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45
Source.2450: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3
Source.2451: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic
Source.2452: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13
Source.2453: DFBPPR4457 ---- Plant proteins ---- Probable calcium-binding protein CML28
Source.2454: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1
Source.2455: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.2456: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.2457: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2
Source.2458: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1
Source.2459: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.2460: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.2461: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2
Source.2462: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.2463: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.2464: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.2465: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24
Source.2466: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.2467: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.2468: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6
Source.2469: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.2470: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.2471: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.2472: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4
Source.2473: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1
Source.2474: DFBPPR4488 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.2475: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.2476: DFBPPR4490 ---- Plant proteins ---- Succinate dehydrogenase subunit 8A, mitochondrial
Source.2477: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.2478: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.2479: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial
Source.2480: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog
Source.2481: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2
Source.2482: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L
Source.2483: DFBPPR4504 ---- Plant proteins ---- 60S ribosomal protein L10-1
Source.2484: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.2485: DFBPPR4508 ---- Plant proteins ---- Photosystem II stability/assembly factor HCF136, chloroplastic
Source.2486: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic
Source.2487: DFBPPR4511 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 9
Source.2488: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.2489: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6
Source.2490: DFBPPR4516 ---- Plant proteins ---- Lariat debranching enzyme
Source.2491: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3
Source.2492: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.2493: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.2494: DFBPPR4521 ---- Plant proteins ---- Probable aldo-keto reductase 3
Source.2495: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2
Source.2496: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.2497: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.2498: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6
Source.2499: DFBPPR4529 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 1
Source.2500: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.2501: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5
Source.2502: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.2503: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3
Source.2504: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.2505: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.2506: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27
Source.2507: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59
Source.2508: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14
Source.2509: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7
Source.2510: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12
Source.2511: DFBPPR4546 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.2512: DFBPPR4547 ---- Plant proteins ---- Probable calcium-binding protein CML31
Source.2513: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.2514: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.2515: DFBPPR4554 ---- Plant proteins ---- Zinc finger AN1 and C2H2 domain-containing stress-associated protein 16
Source.2516: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.2517: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F
Source.2518: DFBPPR4560 ---- Plant proteins ---- Tubby-like F-box protein 10
Source.2519: DFBPPR4561 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 5
Source.2520: DFBPPR4563 ---- Plant proteins ---- CASP-like protein 4C1
Source.2521: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3
Source.2522: DFBPPR4569 ---- Plant proteins ---- Probable protein ABIL5
Source.2523: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2
Source.2524: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.2525: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32
Source.2526: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.2527: DFBPPR4583 ---- Plant proteins ---- Probable calcium-binding protein CML15
Source.2528: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.2529: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.2530: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.2531: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.2532: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.2533: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.2534: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21
Source.2535: DFBPPR4595 ---- Plant proteins ---- Tubby-like F-box protein 9
Source.2536: DFBPPR4597 ---- Plant proteins ---- Putative calcium-binding protein CML23
Source.2537: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39
Source.2538: DFBPPR4600 ---- Plant proteins ---- Probable U3 small nucleolar RNA-associated protein 11
Source.2539: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.2540: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2
Source.2541: DFBPPR4606 ---- Plant proteins ---- ACT domain-containing protein DS12, chloroplastic
Source.2542: DFBPPR4609 ---- Plant proteins ---- BURP domain-containing protein 16
Source.2543: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.2544: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D
Source.2545: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic
Source.2546: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3
Source.2547: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.2548: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.2549: DFBPPR4618 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 3
Source.2550: DFBPPR4626 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 6
Source.2551: DFBPPR4628 ---- Plant proteins ---- Probable inactive carboxylesterase Os04g0669700
Source.2552: DFBPPR4629 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 7
Source.2553: DFBPPR4630 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 11
Source.2554: DFBPPR4631 ---- Plant proteins ---- B3 domain-containing protein Os03g0620500
Source.2555: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.2556: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700
Source.2557: DFBPPR4634 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 9
Source.2558: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43
Source.2559: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3
Source.2560: DFBPPR4639 ---- Plant proteins ---- CASP-like protein 4D1
Source.2561: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900
Source.2562: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5
Source.2563: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12
Source.2564: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000
Source.2565: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2
Source.2566: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7
Source.2567: DFBPPR4654 ---- Plant proteins ---- Cyclin-P3-1
Source.2568: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.2569: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.2570: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic
Source.2571: DFBPPR4658 ---- Plant proteins ---- 60S ribosomal protein L9
Source.2572: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.2573: DFBPPR4666 ---- Plant proteins ---- Protein IN2-1 homolog A
Source.2574: DFBPPR4667 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 4
Source.2575: DFBPPR4669 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 8
Source.2576: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1
Source.2577: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.2578: DFBPPR4672 ---- Plant proteins ---- Ninja-family protein Os03g0419100
Source.2579: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.2580: DFBPPR4675 ---- Plant proteins ---- Cyclin-P4-1
Source.2581: DFBPPR4676 ---- Plant proteins ---- PP2A regulatory subunit TAP46
Source.2582: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3
Source.2583: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.2584: DFBPPR4682 ---- Plant proteins ---- Protein SPIRAL1-like 1
Source.2585: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.2586: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1
Source.2587: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic
Source.2588: DFBPPR4690 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 44
Source.2589: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B
Source.2590: DFBPPR4702 ---- Plant proteins ---- Uncharacterized protein ycf73
Source.2591: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8
Source.2592: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32
Source.2593: DFBPPR4708 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 5
Source.2594: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.2595: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.2596: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51
Source.2597: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.2598: DFBPPR4713 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 14
Source.2599: DFBPPR4714 ---- Plant proteins ---- B3 domain-containing protein Os06g0107800
Source.2600: DFBPPR4715 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 2
Source.2601: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.2602: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11
Source.2603: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.2604: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8
Source.2605: DFBPPR4722 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 10
Source.2606: DFBPPR4723 ---- Plant proteins ---- Zinc finger A20 domain-containing stress-associated protein 18
Source.2607: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.2608: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19
Source.2609: DFBPPR4726 ---- Plant proteins ---- 40S ribosomal protein S10-2
Source.2610: DFBPPR4728 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 12
Source.2611: DFBPPR4729 ---- Plant proteins ---- Protein PLASTID REDOX INSENSITIVE 2, chloroplastic
Source.2612: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.2613: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.2614: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.2615: DFBPPR4738 ---- Plant proteins ---- Putative yippee-like protein Os10g0369500
Source.2616: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400
Source.2617: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400
Source.2618: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.2619: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9
Source.2620: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.2621: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.2622: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8
Source.2623: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9
Source.2624: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.2625: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2
Source.2626: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400
Source.2627: DFBPPR4755 ---- Plant proteins ---- 40S ribosomal protein S8
Source.2628: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.2629: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21
Source.2630: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57
Source.2631: DFBPPR4767 ---- Plant proteins ---- CRS2-like protein, chloroplastic
Source.2632: DFBPPR4768 ---- Plant proteins ---- Protein SPIRAL1-like 2
Source.2633: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700
Source.2634: DFBPPR4775 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.2635: DFBPPR4776 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 3
Source.2636: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.2637: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31
Source.2638: DFBPPR4781 ---- Plant proteins ---- UPF0496 protein 4
Source.2639: DFBPPR4784 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19
Source.2640: DFBPPR4787 ---- Plant proteins ---- 60S ribosomal protein L7a-1
Source.2641: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.2642: DFBPPR4789 ---- Plant proteins ---- B3 domain-containing protein Os11g0197600
Source.2643: DFBPPR4791 ---- Plant proteins ---- B3 domain-containing protein Os02g0683500
Source.2644: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900
Source.2645: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.2646: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200
Source.2647: DFBPPR4799 ---- Plant proteins ---- B3 domain-containing protein Os03g0622100
Source.2648: DFBPPR4801 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0619850
Source.2649: DFBPPR4802 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 34
Source.2650: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000
Source.2651: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100
Source.2652: DFBPPR4805 ---- Plant proteins ---- B3 domain-containing protein Os02g0764100
Source.2653: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800
Source.2654: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2
Source.2655: DFBPPR4810 ---- Plant proteins ---- Hydrophobic protein OSR8
Source.2656: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55
Source.2657: DFBPPR4812 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 1
Source.2658: DFBPPR4813 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0157700
Source.2659: DFBPPR4815 ---- Plant proteins ---- 40S ribosomal protein S10-1
Source.2660: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20
Source.2661: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b
Source.2662: DFBPPR4821 ---- Plant proteins ---- Protein SPIRAL1-like 4
Source.2663: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.2664: DFBPPR4823 ---- Plant proteins ---- 60S ribosomal protein L7a-2
Source.2665: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a
Source.2666: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1
Source.2667: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6
Source.2668: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000
Source.2669: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36
Source.2670: DFBPPR4832 ---- Plant proteins ---- Protein GOS9
Source.2671: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56
Source.2672: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.2673: DFBPPR4836 ---- Plant proteins ---- Protein SPIRAL1-like 3
Source.2674: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2
Source.2675: DFBPPR4845 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 48
Source.2676: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400
Source.2677: DFBPPR4848 ---- Plant proteins ---- B3 domain-containing protein Os02g0455800
Source.2678: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5
Source.2679: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800
Source.2680: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.2681: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080
Source.2682: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600
Source.2683: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400
Source.2684: DFBPPR4860 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.2685: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37
Source.2686: DFBPPR4863 ---- Plant proteins ---- Protein MOTHER of FT and TFL1 homolog 1
Source.2687: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.2688: DFBPPR4866 ---- Plant proteins ---- Putative B3 domain-containing protein Os02g0455900
Source.2689: DFBPPR4867 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 42
Source.2690: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1
Source.2691: DFBPPR4874 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 1
Source.2692: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64
Source.2693: DFBPPR4876 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 3
Source.2694: DFBPPR4881 ---- Plant proteins ---- Costars family protein
Source.2695: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940
Source.2696: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.2697: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3
Source.2698: DFBPPR4888 ---- Plant proteins ---- bZIP transcription factor RISBZ4
Source.2699: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.2700: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.2701: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12
Source.2702: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic
Source.2703: DFBPPR4897 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK1
Source.2704: DFBPPR4899 ---- Plant proteins ---- Casein kinase 1
Source.2705: DFBPPR4900 ---- Plant proteins ---- Histone-lysine N-methyltransferase CLF
Source.2706: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4
Source.2707: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.2708: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5
Source.2709: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3
Source.2710: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1
Source.2711: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26
Source.2712: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.2713: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.2714: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1
Source.2715: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.2716: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2
Source.2717: DFBPPR4915 ---- Plant proteins ---- Chitinase 2
Source.2718: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic
Source.2719: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1
Source.2720: DFBPPR4920 ---- Plant proteins ---- RNA-binding protein Y14A
Source.2721: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.2722: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic
Source.2723: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25
Source.2724: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8
Source.2725: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1
Source.2726: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.2727: DFBPPR4927 ---- Plant proteins ---- Chaperone protein dnaJ A6
Source.2728: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.2729: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.2730: DFBPPR4930 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.2731: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.2732: DFBPPR4932 ---- Plant proteins ---- Two-component response regulator ORR30
Source.2733: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7
Source.2734: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70
Source.2735: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1
Source.2736: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.2737: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1
Source.2738: DFBPPR4940 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.2739: DFBPPR4941 ---- Plant proteins ---- Chaperone protein dnaJ A8, chloroplastic
Source.2740: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.2741: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.2742: DFBPPR4947 ---- Plant proteins ---- Putative magnesium transporter MRS2-G
Source.2743: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d
Source.2744: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.2745: DFBPPR4964 ---- Plant proteins ---- Soybean toxin 27 kDa chain
Source.2746: DFBPPR4965 ---- Plant proteins ---- Glycinin G1
Source.2747: DFBPPR4966 ---- Plant proteins ---- Glycinin G5
Source.2748: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.2749: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.2750: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.2751: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial
Source.2752: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.2753: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.2754: DFBPPR4973 ---- Plant proteins ---- Glycinin G2
Source.2755: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1
Source.2756: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.2757: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.2758: DFBPPR4980 ---- Plant proteins ---- Lactoylglutathione lyase
Source.2759: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1
Source.2760: DFBPPR4983 ---- Plant proteins ---- Protein SRC2
Source.2761: DFBPPR4986 ---- Plant proteins ---- Uricase-2 isozyme 1
Source.2762: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.2763: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2764: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.2765: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.2766: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.2767: DFBPPR4992 ---- Plant proteins ---- Glycinin G3
Source.2768: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.2769: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase
Source.2770: DFBPPR4996 ---- Plant proteins ---- Peroxisomal adenine nucleotide carrier 1
Source.2771: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial
Source.2772: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.2773: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.2774: DFBPPR5002 ---- Plant proteins ---- 2S albumin
Source.2775: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase
Source.2776: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.2777: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.2778: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.2779: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.2780: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.2781: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.2782: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.2783: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.2784: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.2785: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.2786: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.2787: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin
Source.2788: DFBPPR5021 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.2789: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.2790: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.2791: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.2792: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic
Source.2793: DFBPPR5029 ---- Plant proteins ---- Trypsin inhibitor A
Source.2794: DFBPPR5031 ---- Plant proteins ---- Histone H4
Source.2795: DFBPPR5033 ---- Plant proteins ---- Gamma-glutamyl hydrolase
Source.2796: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.2797: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2
Source.2798: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.2799: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.2800: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.2801: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2
Source.2802: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.2803: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D
Source.2804: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.2805: DFBPPR5043 ---- Plant proteins ---- Flap endonuclease 1
Source.2806: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.2807: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.2808: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.2809: DFBPPR5052 ---- Plant proteins ---- Uricase-2 isozyme 2
Source.2810: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.2811: DFBPPR5054 ---- Plant proteins ---- Leghemoglobin C2
Source.2812: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.2813: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.2814: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.2815: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.2816: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2
Source.2817: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.2818: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.2819: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.2820: DFBPPR5066 ---- Plant proteins ---- Leghemoglobin C3
Source.2821: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic
Source.2822: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2823: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.2824: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.2825: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.2826: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1
Source.2827: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.2828: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.2829: DFBPPR5081 ---- Plant proteins ---- Proteasome subunit alpha type-5
Source.2830: DFBPPR5082 ---- Plant proteins ---- Catalase-4
Source.2831: DFBPPR5084 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.2832: DFBPPR5086 ---- Plant proteins ---- Catalase-3
Source.2833: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.2834: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.2835: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.2836: DFBPPR5092 ---- Plant proteins ---- Glutathione S-transferase 3
Source.2837: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog
Source.2838: DFBPPR5094 ---- Plant proteins ---- Protein PROPEP914
Source.2839: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic
Source.2840: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.2841: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.2842: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.2843: DFBPPR5099 ---- Plant proteins ---- Metalloendoproteinase 1
Source.2844: DFBPPR5100 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase 1
Source.2845: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.2846: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase
Source.2847: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.2848: DFBPPR5105 ---- Plant proteins ---- Probable bifunctional TENA-E protein
Source.2849: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase
Source.2850: DFBPPR5112 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 1, chloroplastic
Source.2851: DFBPPR5113 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 4, chloroplastic
Source.2852: DFBPPR5114 ---- Plant proteins ---- Proteasome subunit alpha type-6
Source.2853: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic
Source.2854: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.2855: DFBPPR5117 ---- Plant proteins ---- P24 oleosin isoform B
Source.2856: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.2857: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.2858: DFBPPR5120 ---- Plant proteins ---- 17.3 kDa class I heat shock protein
Source.2859: DFBPPR5122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.2860: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2861: DFBPPR5126 ---- Plant proteins ---- P24 oleosin isoform A
Source.2862: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.2863: DFBPPR5131 ---- Plant proteins ---- 17.5 kDa class I heat shock protein
Source.2864: DFBPPR5132 ---- Plant proteins ---- 18.5 kDa class I heat shock protein
Source.2865: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6
Source.2866: DFBPPR5137 ---- Plant proteins ---- Cytochrome f
Source.2867: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.2868: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2
Source.2869: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase
Source.2870: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.2871: DFBPPR5143 ---- Plant proteins ---- 17.5 kDa class I heat shock protein
Source.2872: DFBPPR5145 ---- Plant proteins ---- 22.0 kDa class IV heat shock protein
Source.2873: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.2874: DFBPPR5151 ---- Plant proteins ---- Phosphomannomutase
Source.2875: DFBPPR5152 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.2876: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.2877: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.2878: DFBPPR5157 ---- Plant proteins ---- 17.6 kDa class I heat shock protein
Source.2879: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.2880: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.2881: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.2882: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1
Source.2883: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.2884: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein
Source.2885: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2886: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.2887: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.2888: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6
Source.2889: DFBPPR5181 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1
Source.2890: DFBPPR5185 ---- Plant proteins ---- Actin-1
Source.2891: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2892: DFBPPR5191 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.2893: DFBPPR5194 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.2894: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.2895: DFBPPR5196 ---- Plant proteins ---- Arginase
Source.2896: DFBPPR5197 ---- Plant proteins ---- Nodulin-21
Source.2897: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.2898: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2899: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.2900: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.2901: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.2902: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.2903: DFBPPR5205 ---- Plant proteins ---- Urease
Source.2904: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.2905: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.2906: DFBPPR5212 ---- Plant proteins ---- Small ribosomal subunit protein S13, mitochondrial
Source.2907: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.2908: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2909: DFBPPR5216 ---- Plant proteins ---- Cytochrome P450 71A9
Source.2910: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.2911: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.2912: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic
Source.2913: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.2914: DFBPPR5223 ---- Plant proteins ---- Stem 28 kDa glycoprotein
Source.2915: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3
Source.2916: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase
Source.2917: DFBPPR5227 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.2918: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.2919: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.2920: DFBPPR5235 ---- Plant proteins ---- DNA-directed RNA polymerase II subunit RPB7
Source.2921: DFBPPR5237 ---- Plant proteins ---- Trypsin inhibitor B
Source.2922: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.2923: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1
Source.2924: DFBPPR5246 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase, chloroplastic
Source.2925: DFBPPR5251 ---- Plant proteins ---- Cytochrome b6-f complex subunit 6
Source.2926: DFBPPR5252 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.2927: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70
Source.2928: DFBPPR5259 ---- Plant proteins ---- Stem 31 kDa glycoprotein
Source.2929: DFBPPR5260 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.2930: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.2931: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.2932: DFBPPR5264 ---- Plant proteins ---- Casparian strip membrane protein 4
Source.2933: DFBPPR5265 ---- Plant proteins ---- Auxin-induced protein AUX22
Source.2934: DFBPPR5266 ---- Plant proteins ---- Cyanate hydratase
Source.2935: DFBPPR5267 ---- Plant proteins ---- Casparian strip membrane protein 3
Source.2936: DFBPPR5268 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.2937: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.2938: DFBPPR5271 ---- Plant proteins ---- Auxin-induced protein AUX28
Source.2939: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.2940: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9
Source.2941: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.2942: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.2943: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.2944: DFBPPR5284 ---- Plant proteins ---- CASP-like protein 1E2
Source.2945: DFBPPR5285 ---- Plant proteins ---- CASP-like protein 1E1
Source.2946: DFBPPR5286 ---- Plant proteins ---- Photosystem II reaction center protein I
Source.2947: DFBPPR5292 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic
Source.2948: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.2949: DFBPPR5297 ---- Plant proteins ---- Protein PROPEP890
Source.2950: DFBPPR5299 ---- Plant proteins ---- Protein PsbN
Source.2951: DFBPPR5304 ---- Plant proteins ---- Maturase K
Source.2952: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2953: DFBPPR5310 ---- Plant proteins ---- Photosystem I reaction center subunit IX
Source.2954: DFBPPR5311 ---- Plant proteins ---- Nodulin-20
Source.2955: DFBPPR5313 ---- Plant proteins ---- CASP-like protein 1D1
Source.2956: DFBPPR5315 ---- Plant proteins ---- CASP-like protein 1D2
Source.2957: DFBPPR5316 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic
Source.2958: DFBPPR5318 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.2959: DFBPPR5320 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.2960: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.2961: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6
Source.2962: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.2963: DFBPPR5324 ---- Plant proteins ---- CASP-like protein 4D1
Source.2964: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.2965: DFBPPR5329 ---- Plant proteins ---- CASP-like protein 2A2
Source.2966: DFBPPR5332 ---- Plant proteins ---- Nodulin-20a
Source.2967: DFBPPR5340 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.2968: DFBPPR5345 ---- Plant proteins ---- CASP-like protein 2A1
Source.2969: DFBPPR5353 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.2970: DFBPPR5363 ---- Plant proteins ---- Auxin-induced protein 10A5
Source.2971: DFBPPR5364 ---- Plant proteins ---- Auxin-induced protein X10A
Source.2972: DFBPPR5365 ---- Plant proteins ---- Auxin-induced protein 6B
Source.2973: DFBPPR5366 ---- Plant proteins ---- Auxin-induced protein 15A
Source.2974: DFBPPR5367 ---- Plant proteins ---- Auxin-induced protein X15
Source.2975: DFBPPR5369 ---- Plant proteins ---- Early nodulin-36A
Source.2976: DFBPPR5370 ---- Plant proteins ---- Early nodulin-36B
Source.2977: DFBPPR5371 ---- Plant proteins ---- Major Gly 50 kDa allergen
Source.2978: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.2979: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.2980: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.2981: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.2982: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1
Source.2983: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.2984: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.2985: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.2986: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.2987: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.2988: DFBPPR5391 ---- Plant proteins ---- Glutathione S-transferase 4
Source.2989: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.2990: DFBPPR5393 ---- Plant proteins ---- Endochitinase A
Source.2991: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.2992: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.2993: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.2994: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3
Source.2995: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.2996: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.2997: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1
Source.2998: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.2999: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase
Source.3000: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A
Source.3001: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.3002: DFBPPR5412 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1
Source.3003: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4
Source.3004: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.3005: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.3006: DFBPPR5418 ---- Plant proteins ---- Aquaporin PIP1-1
Source.3007: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.3008: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.3009: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.3010: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.3011: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.3012: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.3013: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1
Source.3014: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit
Source.3015: DFBPPR5431 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3B, chloroplastic
Source.3016: DFBPPR5432 ---- Plant proteins ---- Expansin-B1
Source.3017: DFBPPR5434 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.3018: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.3019: DFBPPR5437 ---- Plant proteins ---- Exopolygalacturonase
Source.3020: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2
Source.3021: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1
Source.3022: DFBPPR5442 ---- Plant proteins ---- GRF-interacting factor 1
Source.3023: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog
Source.3024: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.3025: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.3026: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.3027: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.3028: DFBPPR5449 ---- Plant proteins ---- Histone H4
Source.3029: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.3030: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2
Source.3031: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.3032: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.3033: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.3034: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2
Source.3035: DFBPPR5461 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.1, mitochondrial
Source.3036: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial
Source.3037: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.3038: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.3039: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1
Source.3040: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5
Source.3041: DFBPPR5469 ---- Plant proteins ---- Indole-3-glycerol phosphate lyase, chloroplastic
Source.3042: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.3043: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2
Source.3044: DFBPPR5472 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic
Source.3045: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3046: DFBPPR5474 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.3047: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1
Source.3048: DFBPPR5476 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.3049: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.3050: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.3051: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.3052: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.3053: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.3054: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3
Source.3055: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.3056: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic
Source.3057: DFBPPR5487 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase
Source.3058: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.3059: DFBPPR5490 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.3060: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic
Source.3061: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.3062: DFBPPR5494 ---- Plant proteins ---- Peroxidase 70
Source.3063: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.3064: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.3065: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.3066: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.3067: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.3068: DFBPPR5505 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme
Source.3069: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.3070: DFBPPR5508 ---- Plant proteins ---- Expansin-B9
Source.3071: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.3072: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1
Source.3073: DFBPPR5512 ---- Plant proteins ---- Peroxidase 42
Source.3074: DFBPPR5513 ---- Plant proteins ---- Bifunctional TENA2 protein
Source.3075: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase
Source.3076: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.3077: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase
Source.3078: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.3079: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.3080: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.3081: DFBPPR5528 ---- Plant proteins ---- Exopolygalacturonase
Source.3082: DFBPPR5529 ---- Plant proteins ---- Aquaporin TIP1-1
Source.3083: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3084: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.3085: DFBPPR5535 ---- Plant proteins ---- Histone H4.3
Source.3086: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3087: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.3088: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase
Source.3089: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.3090: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3
Source.3091: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1
Source.3092: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic
Source.3093: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.3094: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B
Source.3095: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase
Source.3096: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.3097: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A
Source.3098: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.3099: DFBPPR5555 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial
Source.3100: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic
Source.3101: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10
Source.3102: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic
Source.3103: DFBPPR5559 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.3104: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.3105: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3106: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.3107: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.3108: DFBPPR5568 ---- Plant proteins ---- Microtubule-binding protein TANGLED1
Source.3109: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.3110: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.3111: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.3112: DFBPPR5575 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.3113: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.3114: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3
Source.3115: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.3116: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.3117: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.3118: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.3119: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.3120: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10
Source.3121: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.3122: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1
Source.3123: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1
Source.3124: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.3125: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.3126: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6
Source.3127: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.3128: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic
Source.3129: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.3130: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3
Source.3131: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.3132: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I
Source.3133: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.3134: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.3135: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1
Source.3136: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase
Source.3137: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.3138: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.3139: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1
Source.3140: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.3141: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.3142: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic
Source.3143: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.3144: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9
Source.3145: DFBPPR5627 ---- Plant proteins ---- Expansin-B11
Source.3146: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.3147: DFBPPR5630 ---- Plant proteins ---- LOB domain-containing protein 6
Source.3148: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.3149: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.3150: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.3151: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.3152: DFBPPR5636 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.3, mitochondrial
Source.3153: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.3154: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.3155: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.3156: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.3157: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.3158: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.3159: DFBPPR5650 ---- Plant proteins ---- Enolase 1
Source.3160: DFBPPR5651 ---- Plant proteins ---- Cytochrome c
Source.3161: DFBPPR5652 ---- Plant proteins ---- Expansin-B10
Source.3162: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.3163: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5
Source.3164: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.3165: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.3166: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1
Source.3167: DFBPPR5663 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.3168: DFBPPR5666 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3A, chloroplastic
Source.3169: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3170: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.3171: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.3172: DFBPPR5670 ---- Plant proteins ---- Endochitinase B
Source.3173: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.3174: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.3175: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6
Source.3176: DFBPPR5674 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.4, mitochondrial
Source.3177: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4
Source.3178: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein
Source.3179: DFBPPR5679 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.2, mitochondrial
Source.3180: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3
Source.3181: DFBPPR5681 ---- Plant proteins ---- Single myb histone 4
Source.3182: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2
Source.3183: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.3184: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5
Source.3185: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.3186: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.3187: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3188: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.3189: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.3190: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.3191: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic
Source.3192: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.3193: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.3194: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.3195: DFBPPR5706 ---- Plant proteins ---- Glutelin-2
Source.3196: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.3197: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.3198: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.3199: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3
Source.3200: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.3201: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.3202: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.3203: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.3204: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4
Source.3205: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.3206: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.3207: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.3208: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.3209: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.3210: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.3211: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase
Source.3212: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3
Source.3213: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4
Source.3214: DFBPPR5733 ---- Plant proteins ---- Pyruvate decarboxylase 1
Source.3215: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.3216: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23
Source.3217: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.3218: DFBPPR5741 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.3219: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1
Source.3220: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.3221: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1
Source.3222: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2
Source.3223: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2
Source.3224: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.3225: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.3226: DFBPPR5755 ---- Plant proteins ---- Protein Iojap, chloroplastic
Source.3227: DFBPPR5756 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase, acidic isoform
Source.3228: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.3229: DFBPPR5760 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.3230: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.3231: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.3232: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1
Source.3233: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A
Source.3234: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1
Source.3235: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3236: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2
Source.3237: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.3238: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.3239: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.3240: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.3241: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.3242: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.3243: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.3244: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele
Source.3245: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.3246: DFBPPR5790 ---- Plant proteins ---- Benzoate O-methyltransferase
Source.3247: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic
Source.3248: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase
Source.3249: DFBPPR5795 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.3250: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.3251: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B
Source.3252: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1
Source.3253: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic
Source.3254: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase
Source.3255: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.3256: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.3257: DFBPPR5811 ---- Plant proteins ---- ATP synthase subunit a
Source.3258: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.3259: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.3260: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3261: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.3262: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.3263: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2
Source.3264: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic
Source.3265: DFBPPR5820 ---- Plant proteins ---- Protein EGG APPARATUS-1
Source.3266: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic
Source.3267: DFBPPR5822 ---- Plant proteins ---- Elongation factor 1-alpha
Source.3268: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.3269: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.3270: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.3271: DFBPPR5828 ---- Plant proteins ---- Cytochrome f
Source.3272: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.3273: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.3274: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.3275: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4
Source.3276: DFBPPR5838 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.3277: DFBPPR5839 ---- Plant proteins ---- Protein PLASTID REDOX INSENSITIVE 2, chloroplastic
Source.3278: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19
Source.3279: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.3280: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3
Source.3281: DFBPPR5846 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.3282: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase
Source.3283: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.3284: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.3285: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.3286: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.3287: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3288: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase
Source.3289: DFBPPR5866 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.3290: DFBPPR5867 ---- Plant proteins ---- Eukaryotic translation initiation factor 5
Source.3291: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1
Source.3292: DFBPPR5871 ---- Plant proteins ---- Cell number regulator 2
Source.3293: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.3294: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.3295: DFBPPR5875 ---- Plant proteins ---- Actin-depolymerizing factor 3
Source.3296: DFBPPR5877 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.3297: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1
Source.3298: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.3299: DFBPPR5885 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.3300: DFBPPR5887 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.3301: DFBPPR5888 ---- Plant proteins ---- 17.0 kDa class II heat shock protein
Source.3302: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.3303: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1
Source.3304: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL
Source.3305: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.3306: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.3307: DFBPPR5899 ---- Plant proteins ---- Ras-related protein Rab-2-B
Source.3308: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.3309: DFBPPR5903 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.3310: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.3311: DFBPPR5905 ---- Plant proteins ---- Cyanate hydratase
Source.3312: DFBPPR5906 ---- Plant proteins ---- Ras-related protein Rab-2-A
Source.3313: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.3314: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1
Source.3315: DFBPPR5909 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.3316: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2
Source.3317: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.3318: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4
Source.3319: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1
Source.3320: DFBPPR5920 ---- Plant proteins ---- Cell number regulator 1
Source.3321: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4
Source.3322: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.3323: DFBPPR5928 ---- Plant proteins ---- 16 kDa gamma-zein
Source.3324: DFBPPR5929 ---- Plant proteins ---- Non-symbiotic hemoglobin
Source.3325: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.3326: DFBPPR5931 ---- Plant proteins ---- Glycine-rich RNA-binding, abscisic acid-inducible protein
Source.3327: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.3328: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.3329: DFBPPR5937 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.3330: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic
Source.3331: DFBPPR5941 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic
Source.3332: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3
Source.3333: DFBPPR5946 ---- Plant proteins ---- Maturase K
Source.3334: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2
Source.3335: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1
Source.3336: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1
Source.3337: DFBPPR5950 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3338: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2
Source.3339: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.3340: DFBPPR5964 ---- Plant proteins ---- IN2-2 protein
Source.3341: DFBPPR5966 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.3342: DFBPPR5967 ---- Plant proteins ---- Cytochrome b6-f complex subunit 6
Source.3343: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2
Source.3344: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6
Source.3345: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.3346: DFBPPR5974 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic
Source.3347: DFBPPR5976 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog
Source.3348: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.3349: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2
Source.3350: DFBPPR5981 ---- Plant proteins ---- 17.8 kDa class II heat shock protein
Source.3351: DFBPPR5982 ---- Plant proteins ---- Aquaporin TIP5-1
Source.3352: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1
Source.3353: DFBPPR5984 ---- Plant proteins ---- Aquaporin PIP2-7
Source.3354: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3
Source.3355: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2
Source.3356: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2
Source.3357: DFBPPR5991 ---- Plant proteins ---- Myb-related protein Zm38
Source.3358: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1
Source.3359: DFBPPR5994 ---- Plant proteins ---- 17.5 kDa class II heat shock protein
Source.3360: DFBPPR5997 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.3361: DFBPPR5999 ---- Plant proteins ---- Aquaporin NIP1-1
Source.3362: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2
Source.3363: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2
Source.3364: DFBPPR6003 ---- Plant proteins ---- Aquaporin SIP1-1
Source.3365: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1
Source.3366: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9
Source.3367: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.3368: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.3369: DFBPPR6017 ---- Plant proteins ---- Photosystem II reaction center protein I
Source.3370: DFBPPR6019 ---- Plant proteins ---- Inactive beta selinene synthase
Source.3371: DFBPPR6022 ---- Plant proteins ---- Stress-related protein 1
Source.3372: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.3373: DFBPPR6024 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.3374: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.3375: DFBPPR6028 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic
Source.3376: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.3377: DFBPPR6031 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic
Source.3378: DFBPPR6035 ---- Plant proteins ---- Photosystem I reaction center subunit IX
Source.3379: DFBPPR6039 ---- Plant proteins ---- Protein PsbN
Source.3380: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2
Source.3381: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1
Source.3382: DFBPPR6044 ---- Plant proteins ---- 40S ribosomal protein S4
Source.3383: DFBPPR6047 ---- Plant proteins ---- CASP-like protein 1D1
Source.3384: DFBPPR6049 ---- Plant proteins ---- Probable non-specific lipid-transfer protein 2
Source.3385: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1
Source.3386: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3
Source.3387: DFBPPR6058 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.3388: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.3389: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1
Source.3390: DFBPPR6070 ---- Plant proteins ---- 40S ribosomal protein S8
Source.3391: DFBPPR6073 ---- Plant proteins ---- Protein IAL1
Source.3392: DFBPPR6075 ---- Plant proteins ---- MFS18 protein
Source.3393: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.3394: DFBPPR6077 ---- Plant proteins ---- Pollen-specific protein C13
Source.3395: DFBPPR6083 ---- Plant proteins ---- Cell number regulator 7
Source.3396: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1
Source.3397: DFBPPR6086 ---- Plant proteins ---- Cell number regulator 5
Source.3398: DFBPPR6087 ---- Plant proteins ---- 40S ribosomal protein S14
Source.3399: DFBPPR6089 ---- Plant proteins ---- Cell number regulator 6
Source.3400: DFBPPR6090 ---- Plant proteins ---- 40S ribosomal protein S14
Source.3401: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10
Source.3402: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2
Source.3403: DFBPPR6100 ---- Plant proteins ---- CASP-like protein 5B2
Source.3404: DFBPPR6103 ---- Plant proteins ---- 60S ribosomal protein L10
Source.3405: DFBPPR6106 ---- Plant proteins ---- Cell number regulator 4
Source.3406: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1
Source.3407: DFBPPR6112 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.3408: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.3409: DFBPPR6116 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.3410: DFBPPR6117 ---- Plant proteins ---- Putative uncharacterized protein ycf15
Source.3411: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.3412: DFBPPR6125 ---- Plant proteins ---- Cell number regulator 3
Source.3413: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A
Source.3414: DFBPPR6136 ---- Plant proteins ---- Cell number regulator 11
Source.3415: DFBPPR6143 ---- Plant proteins ---- Uncharacterized protein ycf73
Source.3416: DFBPPR6145 ---- Plant proteins ---- Ninja-family protein 6
Source.3417: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.3418: DFBPPR6153 ---- Plant proteins ---- Ninja-family protein 8
Source.3419: DFBPPR6154 ---- Plant proteins ---- Ninja-family protein 7
Source.3420: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1
Source.3421: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5
Source.3422: DFBPPR6166 ---- Plant proteins ---- Suppressor protein HFN40
Source.3423: DFBPPR6170 ---- Plant proteins ---- Uncharacterized 29 kDa protein in mitochondrial S-1 DNA
Source.3424: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA
Source.3425: DFBPPR6174 ---- Plant proteins ---- Oil body-associated protein 2A
Source.3426: DFBPPR6179 ---- Plant proteins ---- Unknown protein from spot 75 of 2D-PAGE of etiolated coleoptile
Source.3427: DFBPPR6196 ---- Plant proteins ---- Unknown protein from spot 263 of 2D-PAGE of etiolated coleoptile
Source.3428: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial
Source.3429: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2
Source.3430: DFBPPR6209 ---- Plant proteins ---- Probable S-adenosylmethionine synthase
Source.3431: DFBPPR6210 ---- Plant proteins ---- Cysteine synthase
Source.3432: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.3433: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.3434: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic
Source.3435: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic
Source.3436: DFBPPR6218 ---- Plant proteins ---- Translocase of chloroplast 34
Source.3437: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.3438: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.3439: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.3440: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic
Source.3441: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.3442: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.3443: DFBPPR6228 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1
Source.3444: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.3445: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic
Source.3446: DFBPPR6231 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.3447: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.3448: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3449: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.3450: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.3451: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic
Source.3452: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.3453: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1
Source.3454: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.3455: DFBPPR6241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 1 protein
Source.3456: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.3457: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic
Source.3458: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.3459: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.3460: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.3461: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.3462: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.3463: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial
Source.3464: DFBPPR6252 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1
Source.3465: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.3466: DFBPPR6254 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.3467: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96
Source.3468: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic
Source.3469: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.3470: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.3471: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.3472: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.3473: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.3474: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.3475: DFBPPR6273 ---- Plant proteins ---- Cell division control protein 2 homolog 1
Source.3476: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3477: DFBPPR6276 ---- Plant proteins ---- Outer envelope pore protein 16, chloroplastic
Source.3478: DFBPPR6277 ---- Plant proteins ---- Leghemoglobin-1
Source.3479: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic
Source.3480: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.3481: DFBPPR6282 ---- Plant proteins ---- Rhicadhesin receptor
Source.3482: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.3483: DFBPPR6285 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial
Source.3484: DFBPPR6286 ---- Plant proteins ---- Endochitinase A2
Source.3485: DFBPPR6287 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 2 protein
Source.3486: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.3487: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64
Source.3488: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.3489: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic
Source.3490: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic
Source.3491: DFBPPR6295 ---- Plant proteins ---- Outer envelope pore protein 37, chloroplastic
Source.3492: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.3493: DFBPPR6297 ---- Plant proteins ---- Aminomethyltransferase, mitochondrial
Source.3494: DFBPPR6298 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.3495: DFBPPR6300 ---- Plant proteins ---- Strigolactone esterase RMS3
Source.3496: DFBPPR6301 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.3497: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.3498: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3499: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.3500: DFBPPR6307 ---- Plant proteins ---- Phytochrome-associated serine/threonine-protein phosphatase
Source.3501: DFBPPR6308 ---- Plant proteins ---- Histone H4
Source.3502: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.3503: DFBPPR6310 ---- Plant proteins ---- Catalase
Source.3504: DFBPPR6311 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.3505: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.3506: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.3507: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic
Source.3508: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.3509: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.3510: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.3511: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH
Source.3512: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2
Source.3513: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase
Source.3514: DFBPPR6329 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic
Source.3515: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.3516: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.3517: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.3518: DFBPPR6335 ---- Plant proteins ---- Protein CYCLOPS
Source.3519: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.3520: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.3521: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.3522: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3523: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5
Source.3524: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.3525: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic
Source.3526: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic
Source.3527: DFBPPR6345 ---- Plant proteins ---- Aspartate carbamoyltransferase 1, chloroplastic
Source.3528: DFBPPR6346 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.3529: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.3530: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.3531: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.3532: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase
Source.3533: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.3534: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic
Source.3535: DFBPPR6355 ---- Plant proteins ---- Endochitinase
Source.3536: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.3537: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.3538: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.3539: DFBPPR6361 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.3540: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1
Source.3541: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic
Source.3542: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.3543: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.3544: DFBPPR6368 ---- Plant proteins ---- Provicilin
Source.3545: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.3546: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.3547: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.3548: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic
Source.3549: DFBPPR6375 ---- Plant proteins ---- Chlorophyll a-b binding protein 3c, chloroplastic
Source.3550: DFBPPR6380 ---- Plant proteins ---- Legumin A
Source.3551: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.3552: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.3553: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.3554: DFBPPR6391 ---- Plant proteins ---- Cytochrome b6
Source.3555: DFBPPR6392 ---- Plant proteins ---- Cytochrome f
Source.3556: DFBPPR6393 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.3557: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.3558: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3
Source.3559: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3560: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic
Source.3561: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.3562: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase
Source.3563: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.3564: DFBPPR6406 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase
Source.3565: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3566: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.3567: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.3568: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.3569: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.3570: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.3571: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.3572: DFBPPR6418 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.3573: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.3574: DFBPPR6424 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.3575: DFBPPR6425 ---- Plant proteins ---- Legumin A2
Source.3576: DFBPPR6426 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.3577: DFBPPR6428 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase, chloroplastic
Source.3578: DFBPPR6430 ---- Plant proteins ---- Legumin J
Source.3579: DFBPPR6432 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.3580: DFBPPR6434 ---- Plant proteins ---- ATP synthase subunit O, mitochondrial
Source.3581: DFBPPR6440 ---- Plant proteins ---- Cell division control protein 2 homolog 2
Source.3582: DFBPPR6443 ---- Plant proteins ---- Disease resistance response protein 206
Source.3583: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.3584: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.3585: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.3586: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.3587: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.3588: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.3589: DFBPPR6453 ---- Plant proteins ---- Convicilin
Source.3590: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.3591: DFBPPR6455 ---- Plant proteins ---- Legumin K
Source.3592: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase
Source.3593: DFBPPR6459 ---- Plant proteins ---- Legumin B
Source.3594: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.3595: DFBPPR6461 ---- Plant proteins ---- Leghemoglobin Lb5-10
Source.3596: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA
Source.3597: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.3598: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.3599: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase
Source.3600: DFBPPR6469 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.3601: DFBPPR6470 ---- Plant proteins ---- Vicilin
Source.3602: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.3603: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic
Source.3604: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a
Source.3605: DFBPPR6477 ---- Plant proteins ---- 50S ribosomal protein L15, chloroplastic
Source.3606: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.3607: DFBPPR6479 ---- Plant proteins ---- Non-functional protein STAY-GREEN, chloroplastic
Source.3608: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.3609: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.3610: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2
Source.3611: DFBPPR6486 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 1
Source.3612: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.3613: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein
Source.3614: DFBPPR6492 ---- Plant proteins ---- Phospholipid hydroperoxide glutathione peroxidase, chloroplastic
Source.3615: DFBPPR6495 ---- Plant proteins ---- Leghemoglobin Lb120-34
Source.3616: DFBPPR6496 ---- Plant proteins ---- Leghemoglobin Lb120-1
Source.3617: DFBPPR6497 ---- Plant proteins ---- Leghemoglobin Lb120-8
Source.3618: DFBPPR6498 ---- Plant proteins ---- Leghemoglobin Lb120-29
Source.3619: DFBPPR6499 ---- Plant proteins ---- Provicilin
Source.3620: DFBPPR6504 ---- Plant proteins ---- Cysteine proteinase 15A
Source.3621: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.3622: DFBPPR6507 ---- Plant proteins ---- Ribosomal protein S10, mitochondrial
Source.3623: DFBPPR6510 ---- Plant proteins ---- 50S ribosomal protein 6, chloroplastic
Source.3624: DFBPPR6513 ---- Plant proteins ---- Plastoglobulin-1, chloroplastic
Source.3625: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.3626: DFBPPR6516 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3627: DFBPPR6518 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.3628: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.3629: DFBPPR6523 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.3630: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.3631: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.3632: DFBPPR6526 ---- Plant proteins ---- Albumin-2
Source.3633: DFBPPR6528 ---- Plant proteins ---- 30S ribosomal protein S19, chloroplastic
Source.3634: DFBPPR6531 ---- Plant proteins ---- 2-dehydro-3-deoxyphosphooctonate aldolase
Source.3635: DFBPPR6534 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic
Source.3636: DFBPPR6537 ---- Plant proteins ---- Protein PsbN
Source.3637: DFBPPR6539 ---- Plant proteins ---- Defensin-like protein 230
Source.3638: DFBPPR6541 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.3639: DFBPPR6544 ---- Plant proteins ---- Photosystem I reaction center subunit II
Source.3640: DFBPPR6548 ---- Plant proteins ---- Dehydrin DHN1
Source.3641: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3642: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3643: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A
Source.3644: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial
Source.3645: DFBPPR6563 ---- Plant proteins ---- 60S ribosomal protein L9
Source.3646: DFBPPR6566 ---- Plant proteins ---- ABA-responsive protein ABR17
Source.3647: DFBPPR6567 ---- Plant proteins ---- ABA-responsive protein ABR17
Source.3648: DFBPPR6571 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.3649: DFBPPR6614 ---- Plant proteins ---- Early nodulin-75
Source.3650: DFBPPR6617 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.3651: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3652: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.3653: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.3654: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.3655: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.3656: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.3657: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.3658: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.3659: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.3660: DFBPPR6639 ---- Plant proteins ---- Puroindoline-A
Source.3661: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.3662: DFBPPR6642 ---- Plant proteins ---- Peroxidase
Source.3663: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.3664: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.3665: DFBPPR6650 ---- Plant proteins ---- Oxalate oxidase GF-2.8
Source.3666: DFBPPR6651 ---- Plant proteins ---- Obtusifoliol 14-alpha demethylase
Source.3667: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic
Source.3668: DFBPPR6655 ---- Plant proteins ---- Agglutinin isolectin 1
Source.3669: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.3670: DFBPPR6657 ---- Plant proteins ---- Agglutinin isolectin 2
Source.3671: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.3672: DFBPPR6659 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit
Source.3673: DFBPPR6661 ---- Plant proteins ---- Agglutinin isolectin 3
Source.3674: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.3675: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic
Source.3676: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1
Source.3677: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.3678: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic
Source.3679: DFBPPR6667 ---- Plant proteins ---- Cytochrome c
Source.3680: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.3681: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.3682: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.3683: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic
Source.3684: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.3685: DFBPPR6674 ---- Plant proteins ---- Oxalate oxidase GF-3.8
Source.3686: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.3687: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.3688: DFBPPR6677 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 2
Source.3689: DFBPPR6679 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.3690: DFBPPR6685 ---- Plant proteins ---- Rust resistance kinase Lr10
Source.3691: DFBPPR6688 ---- Plant proteins ---- Histone H4 variant TH011
Source.3692: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.3693: DFBPPR6690 ---- Plant proteins ---- Histone H2A.2.2
Source.3694: DFBPPR6691 ---- Plant proteins ---- Histone H2A.2.1
Source.3695: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic
Source.3696: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.3697: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3698: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase
Source.3699: DFBPPR6706 ---- Plant proteins ---- Adenine phosphoribosyltransferase 1
Source.3700: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1
Source.3701: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.3702: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.3703: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase
Source.3704: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.3705: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.3706: DFBPPR6724 ---- Plant proteins ---- Putative ATP synthase protein YMF19
Source.3707: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase
Source.3708: DFBPPR6730 ---- Plant proteins ---- Abscisic acid-inducible protein kinase
Source.3709: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.3710: DFBPPR6733 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.3711: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3712: DFBPPR6735 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.3713: DFBPPR6736 ---- Plant proteins ---- ATP-dependent 6-phosphofructokinase
Source.3714: DFBPPR6738 ---- Plant proteins ---- S-adenosylmethionine synthase
Source.3715: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.3716: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.3717: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.3718: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.3719: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.3720: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.3721: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.3722: DFBPPR6749 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic
Source.3723: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic
Source.3724: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1
Source.3725: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.3726: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase
Source.3727: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial
Source.3728: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial
Source.3729: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.3730: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase
Source.3731: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.3732: DFBPPR6766 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.3733: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1
Source.3734: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3735: DFBPPR6774 ---- Plant proteins ---- Eukaryotic translation initiation factor 4E-1
Source.3736: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3737: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6
Source.3738: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.3739: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.3740: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A
Source.3741: DFBPPR6784 ---- Plant proteins ---- Histone H4 variant TH091
Source.3742: DFBPPR6786 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.3743: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.3744: DFBPPR6792 ---- Plant proteins ---- Cytochrome b6-f complex subunit 6
Source.3745: DFBPPR6794 ---- Plant proteins ---- Elongation factor 1-alpha
Source.3746: DFBPPR6795 ---- Plant proteins ---- Elongation factor 1-beta
Source.3747: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B
Source.3748: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.3749: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B
Source.3750: DFBPPR6801 ---- Plant proteins ---- Peroxidase
Source.3751: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic
Source.3752: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic
Source.3753: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.3754: DFBPPR6805 ---- Plant proteins ---- Cytochrome f
Source.3755: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.3756: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.3757: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.3758: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.3759: DFBPPR6817 ---- Plant proteins ---- Phosphomannomutase
Source.3760: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A
Source.3761: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3762: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.3763: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.3764: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.3765: DFBPPR6830 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.3766: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3767: DFBPPR6834 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain clone 512
Source.3768: DFBPPR6835 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 1, chloroplastic
Source.3769: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2
Source.3770: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3771: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.3772: DFBPPR6843 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.3773: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.3774: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A
Source.3775: DFBPPR6846 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.3776: DFBPPR6847 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.3777: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.3778: DFBPPR6853 ---- Plant proteins ---- Alpha/beta-gliadin MM1
Source.3779: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.3780: DFBPPR6856 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 3, chloroplastic
Source.3781: DFBPPR6857 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 2, chloroplastic
Source.3782: DFBPPR6858 ---- Plant proteins ---- Glutenin, low molecular weight subunit 1D1
Source.3783: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.3784: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.3785: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1
Source.3786: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.3787: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.3788: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.3789: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.3790: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3791: DFBPPR6878 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.3792: DFBPPR6881 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.3793: DFBPPR6882 ---- Plant proteins ---- Maturase K
Source.3794: DFBPPR6888 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3795: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.3796: DFBPPR6893 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic
Source.3797: DFBPPR6896 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.3798: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.3799: DFBPPR6908 ---- Plant proteins ---- Photosystem II reaction center protein I
Source.3800: DFBPPR6915 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.3801: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.3802: DFBPPR6921 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic
Source.3803: DFBPPR6923 ---- Plant proteins ---- Avenin-like a1
Source.3804: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.3805: DFBPPR6928 ---- Plant proteins ---- Avenin-like a5
Source.3806: DFBPPR6929 ---- Plant proteins ---- Protein PsbN
Source.3807: DFBPPR6930 ---- Plant proteins ---- Alpha/beta-gliadin
Source.3808: DFBPPR6934 ---- Plant proteins ---- Alpha/beta-gliadin clone PW1215
Source.3809: DFBPPR6936 ---- Plant proteins ---- Alpha/beta-gliadin A-II
Source.3810: DFBPPR6937 ---- Plant proteins ---- Alpha/beta-gliadin A-IV
Source.3811: DFBPPR6938 ---- Plant proteins ---- Alpha/beta-gliadin clone PW8142
Source.3812: DFBPPR6939 ---- Plant proteins ---- Alpha/beta-gliadin A-V
Source.3813: DFBPPR6940 ---- Plant proteins ---- Alpha/beta-gliadin A-III
Source.3814: DFBPPR6943 ---- Plant proteins ---- Photosystem I reaction center subunit IX
Source.3815: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin
Source.3816: DFBPPR6946 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.3817: DFBPPR6948 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic
Source.3818: DFBPPR6951 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.3819: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.3820: DFBPPR6953 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.3821: DFBPPR6954 ---- Plant proteins ---- Alpha/beta-gliadin clone PTO-A10
Source.3822: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2
Source.3823: DFBPPR6961 ---- Plant proteins ---- Avenin-like a2
Source.3824: DFBPPR6964 ---- Plant proteins ---- Avenin-like a3
Source.3825: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6
Source.3826: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7
Source.3827: DFBPPR6971 ---- Plant proteins ---- Avenin-like a7
Source.3828: DFBPPR6972 ---- Plant proteins ---- Gamma-gliadin B-I
Source.3829: DFBPPR6973 ---- Plant proteins ---- Avenin-like a6
Source.3830: DFBPPR6974 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.3831: DFBPPR6975 ---- Plant proteins ---- Gamma-gliadin
Source.3832: DFBPPR6983 ---- Plant proteins ---- Avenin-like a4
Source.3833: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1
Source.3834: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10
Source.3835: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9
Source.3836: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8
Source.3837: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3
Source.3838: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2
Source.3839: DFBPPR6993 ---- Plant proteins ---- Avenin-like b3
Source.3840: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant
Source.3841: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.3842: DFBPPR7011 ---- Plant proteins ---- Oxalate oxidase 1
Source.3843: DFBPPR7015 ---- Plant proteins ---- Phytepsin
Source.3844: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.3845: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.3846: DFBPPR7019 ---- Plant proteins ---- 2'-deoxymugineic-acid 2'-dioxygenase
Source.3847: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3848: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.3849: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.3850: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1
Source.3851: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2
Source.3852: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic
Source.3853: DFBPPR7028 ---- Plant proteins ---- Agmatine coumaroyltransferase-1
Source.3854: DFBPPR7029 ---- Plant proteins ---- Trypsin inhibitor CMe
Source.3855: DFBPPR7032 ---- Plant proteins ---- Hordoindoline-B2
Source.3856: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.3857: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.3858: DFBPPR7035 ---- Plant proteins ---- Oxalate oxidase 2
Source.3859: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.3860: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7
Source.3861: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.3862: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic
Source.3863: DFBPPR7042 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GII
Source.3864: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.3865: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.3866: DFBPPR7047 ---- Plant proteins ---- Hordoindoline-A
Source.3867: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase
Source.3868: DFBPPR7052 ---- Plant proteins ---- Protein synthesis inhibitor II
Source.3869: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.3870: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3
Source.3871: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump
Source.3872: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3873: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.3874: DFBPPR7063 ---- Plant proteins ---- Glycine-rich RNA-binding protein blt801
Source.3875: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.3876: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.3877: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.3878: DFBPPR7068 ---- Plant proteins ---- Peroxidase 2
Source.3879: DFBPPR7069 ---- Plant proteins ---- Hordoindoline-B1
Source.3880: DFBPPR7070 ---- Plant proteins ---- Red chlorophyll catabolite reductase
Source.3881: DFBPPR7072 ---- Plant proteins ---- Protein synthesis inhibitor I
Source.3882: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase
Source.3883: DFBPPR7077 ---- Plant proteins ---- Bowman-Birk type trypsin inhibitor
Source.3884: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.3885: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3886: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.3887: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.3888: DFBPPR7084 ---- Plant proteins ---- 26 kDa endochitinase 2
Source.3889: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.3890: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.3891: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.3892: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.3893: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.3894: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic
Source.3895: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.3896: DFBPPR7094 ---- Plant proteins ---- S-adenosylmethionine synthase 1
Source.3897: DFBPPR7095 ---- Plant proteins ---- S-adenosylmethionine synthase 2
Source.3898: DFBPPR7096 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.3899: DFBPPR7097 ---- Plant proteins ---- S-adenosylmethionine synthase 4
Source.3900: DFBPPR7098 ---- Plant proteins ---- Acyl carrier protein 2, chloroplastic
Source.3901: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2
Source.3902: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.3903: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.3904: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.3905: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.3906: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.3907: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.3908: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.3909: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6
Source.3910: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.3911: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.3912: DFBPPR7112 ---- Plant proteins ---- 2-Cys peroxiredoxin BAS1, chloroplastic
Source.3913: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.3914: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.3915: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.3916: DFBPPR7120 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.3917: DFBPPR7121 ---- Plant proteins ---- 26 kDa endochitinase 1
Source.3918: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3919: DFBPPR7123 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.3920: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2
Source.3921: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A
Source.3922: DFBPPR7133 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.3923: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV
Source.3924: DFBPPR7137 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.3925: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.3926: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial
Source.3927: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.3928: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX
Source.3929: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.3930: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.3931: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.3932: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3
Source.3933: DFBPPR7155 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.3934: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.3935: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8
Source.3936: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase
Source.3937: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase
Source.3938: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic
Source.3939: DFBPPR7166 ---- Plant proteins ---- Serine carboxypeptidase II-2
Source.3940: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.3941: DFBPPR7170 ---- Plant proteins ---- Maturase K
Source.3942: DFBPPR7173 ---- Plant proteins ---- Photosystem I reaction center subunit II, chloroplastic
Source.3943: DFBPPR7174 ---- Plant proteins ---- Photosystem I reaction center subunit XI, chloroplastic
Source.3944: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV
Source.3945: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.3946: DFBPPR7178 ---- Plant proteins ---- Elongation factor 1-alpha
Source.3947: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.3948: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.3949: DFBPPR7184 ---- Plant proteins ---- Root-specific lectin
Source.3950: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.3951: DFBPPR7186 ---- Plant proteins ---- Photosystem I reaction center subunit III, chloroplastic
Source.3952: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3953: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.3954: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha
Source.3955: DFBPPR7191 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.3956: DFBPPR7192 ---- Plant proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.3957: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog
Source.3958: DFBPPR7194 ---- Plant proteins ---- Cytochrome f
Source.3959: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.3960: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.3961: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.3962: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.3963: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain
Source.3964: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.3965: DFBPPR7206 ---- Plant proteins ---- Photosystem I reaction center subunit V, chloroplastic
Source.3966: DFBPPR7208 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.3967: DFBPPR7209 ---- Plant proteins ---- Photosystem I reaction center subunit psaK, chloroplastic
Source.3968: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.3969: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.3970: DFBPPR7215 ---- Plant proteins ---- Aldose reductase
Source.3971: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.3972: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.3973: DFBPPR7226 ---- Plant proteins ---- Photosystem II reaction center protein I
Source.3974: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.3975: DFBPPR7231 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic
Source.3976: DFBPPR7233 ---- Plant proteins ---- Photosystem I reaction center subunit IX
Source.3977: DFBPPR7240 ---- Plant proteins ---- Agmatine coumaroyltransferase-2
Source.3978: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.3979: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.3980: DFBPPR7244 ---- Plant proteins ---- Cytochrome b6-f complex subunit 5
Source.3981: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase
Source.3982: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.3983: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1
Source.3984: DFBPPR7255 ---- Plant proteins ---- Protein PsbN
Source.3985: DFBPPR7256 ---- Plant proteins ---- Cytochrome b6-f complex subunit 6
Source.3986: DFBPPR7258 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV90, chloroplastic
Source.3987: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic
Source.3988: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic
Source.3989: DFBPPR7265 ---- Plant proteins ---- Gamma-hordein-3
Source.3990: DFBPPR7269 ---- Plant proteins ---- 50S ribosomal protein L23, chloroplastic
Source.3991: DFBPPR7276 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic
Source.3992: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.3993: DFBPPR7280 ---- Plant proteins ---- 30S ribosomal protein 3, chloroplastic
Source.3994: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.3995: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33
Source.3996: DFBPPR7290 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.3997: DFBPPR7295 ---- Plant proteins ---- 30S ribosomal protein S14, chloroplastic
Source.3998: DFBPPR7298 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.3999: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3
Source.4000: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4
Source.4001: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2
Source.4002: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6
Source.4003: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7
Source.4004: DFBPPR7307 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic
Source.4005: DFBPPR7311 ---- Plant proteins ---- B1-hordein
Source.4006: DFBPPR7317 ---- Plant proteins ---- Horcolin
Source.4007: DFBPPR7319 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.4008: DFBPPR7322 ---- Plant proteins ---- Metallothionein-like protein 1
Source.4009: DFBPPR7325 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic
Source.4010: DFBPPR7345 ---- Plant proteins ---- Cold-regulated protein BLT14
Source.4011: DFBPPR7349 ---- Plant proteins ---- Cold-regulated protein 2
Source.4012: DFBPPR7350 ---- Plant proteins ---- Pathogen-related protein
Source.4013: DFBPPR7351 ---- Plant proteins ---- 23 kDa jasmonate-induced protein
Source.4014: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic
Source.4015: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1
Source.4016: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.4017: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.4018: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.4019: DFBPPR7402 ---- Plant proteins ---- Probable pectinesterase/pectinesterase inhibitor
Source.4020: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic
Source.4021: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.4022: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase
Source.4023: DFBPPR7406 ---- Plant proteins ---- Cytochrome c
Source.4024: DFBPPR7408 ---- Plant proteins ---- Basic endochitinase CHB4
Source.4025: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic
Source.4026: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.4027: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.4028: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.4029: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.4030: DFBPPR7415 ---- Plant proteins ---- Co-chaperone protein p23-1
Source.4031: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4
Source.4032: DFBPPR7417 ---- Plant proteins ---- Cruciferin
Source.4033: DFBPPR7418 ---- Plant proteins ---- Oleosin-B6
Source.4034: DFBPPR7419 ---- Plant proteins ---- Cytochrome b
Source.4035: DFBPPR7423 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial
Source.4036: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.4037: DFBPPR7429 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.4038: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic
Source.4039: DFBPPR7433 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase
Source.4040: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.4041: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.4042: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.4043: DFBPPR7441 ---- Plant proteins ---- Defensin-like protein 4
Source.4044: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic
Source.4045: DFBPPR7444 ---- Plant proteins ---- Cruciferin BnC2
Source.4046: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1
Source.4047: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic
Source.4048: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.4049: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.4050: DFBPPR7453 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain F1, chloroplastic
Source.4051: DFBPPR7454 ---- Plant proteins ---- Peptide methionine sulfoxide reductase
Source.4052: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.4053: DFBPPR7456 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.4054: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4
Source.4055: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.4056: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.4057: DFBPPR7461 ---- Plant proteins ---- Shaggy-related protein kinase theta
Source.4058: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.4059: DFBPPR7463 ---- Plant proteins ---- Oleosin S2-2
Source.4060: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.4061: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic
Source.4062: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic
Source.4063: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.4064: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1
Source.4065: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.4066: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.4067: DFBPPR7477 ---- Plant proteins ---- Endochitinase CH25
Source.4068: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III
Source.4069: DFBPPR7485 ---- Plant proteins ---- Oleosin Bn-V
Source.4070: DFBPPR7486 ---- Plant proteins ---- Major oleosin NAP-II
Source.4071: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial
Source.4072: DFBPPR7488 ---- Plant proteins ---- Homeobox protein HD1
Source.4073: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.4074: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2
Source.4075: DFBPPR7494 ---- Plant proteins ---- Putative ATP synthase protein YMF19
Source.4076: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.4077: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.4078: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.4079: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.4080: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.4081: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.4082: DFBPPR7513 ---- Plant proteins ---- Thioredoxin H-type 2
Source.4083: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA
Source.4084: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial
Source.4085: DFBPPR7520 ---- Plant proteins ---- 40S ribosomal protein S15a
Source.4086: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.4087: DFBPPR7527 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1
Source.4088: DFBPPR7528 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.4089: DFBPPR7529 ---- Plant proteins ---- Profilin
Source.4090: DFBPPR7530 ---- Plant proteins ---- Glycine-rich RNA-binding protein 10
Source.4091: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG
Source.4092: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.4093: DFBPPR7536 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.4094: DFBPPR7538 ---- Plant proteins ---- Late embryogenesis abundant protein 76
Source.4095: DFBPPR7594 ---- Milk proteins ---- Lactadherin
Source.4096: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.4097: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin
Source.4098: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.4099: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.4100: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.4101: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.4102: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1
Source.4103: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.4104: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase
Source.4105: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.4106: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b
Source.4107: DFBPPR7618 ---- Milk proteins ---- Plasminogen
Source.4108: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.4109: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.4110: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4
Source.4111: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.4112: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.4113: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.4114: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain
Source.4115: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein
Source.4116: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.4117: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2
Source.4118: DFBPPR7634 ---- Milk proteins ---- CD59 glycoprotein
Source.4119: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.4120: DFBPPR7638 ---- Milk proteins ---- Tissue-type plasminogen activator
Source.4121: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.4122: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1
Source.4123: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.4124: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.4125: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.4126: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.4127: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.4128: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4
Source.4129: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.4130: DFBPPR7657 ---- Milk proteins ---- Chymosin
Source.4131: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.4132: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.4133: DFBPPR7667 ---- Milk proteins ---- Lysozyme C, milk isozyme
Source.4134: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.4135: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.4136: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.4137: DFBPPR7690 ---- Milk proteins ---- Lactadherin
Source.4138: DFBPPR7699 ---- Milk proteins ---- Chymosin
Source.4139: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.4140: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.4141: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein
Source.4142: DFBPPR7719 ---- Milk proteins ---- Beta-defensin 2
Source.4143: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1
Source.4144: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.4145: DFBPPR7722 ---- Plant proteins ---- Peroxygenase 1
Source.4146: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.4147: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2
Source.4148: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.4149: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.4150: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.4151: DFBPPR7729 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.4152: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.4153: DFBPPR7733 ---- Plant proteins ---- 12S seed storage globulin 2
Source.4154: DFBPPR7734 ---- Plant proteins ---- 12S seed storage globulin 1
Source.4155: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.4156: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.4157: DFBPPR7737 ---- Plant proteins ---- Endochitinase
Source.4158: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase
Source.4159: DFBPPR7744 ---- Plant proteins ---- Maturase K
Source.4160: DFBPPR7749 ---- Plant proteins ---- Avenin
Source.4161: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta
Source.4162: DFBPPR8187 ---- Plant proteins ---- Cytochrome c
Source.4163: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.4164: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.4165: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.4166: DFBPPR8193 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMW33
Source.4167: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101
Source.4168: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.4169: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.4170: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.4171: DFBPPR8203 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial
Source.4172: DFBPPR8204 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial
Source.4173: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP
Source.4174: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B
Source.4175: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.4176: DFBPPR8358 ---- Plant proteins ---- Cytochrome c
Source.4177: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1
Source.4178: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2
Source.4179: DFBPPR8370 ---- Plant proteins ---- Maturase K
Source.4180: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.4181: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.4182: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.4183: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.4184: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase
Source.4185: DFBPPR8377 ---- Plant proteins ---- Profilin
Source.4186: DFBPPR8382 ---- Plant proteins ---- Cationic peroxidase 1
Source.4187: DFBPPR8385 ---- Plant proteins ---- Alpha-methyl-mannoside-specific lectin
Source.4188: DFBPPR8387 ---- Plant proteins ---- Cationic peroxidase 2
Source.4189: DFBPPR8390 ---- Plant proteins ---- Galactose-binding lectin
Source.4190: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3
Source.4191: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.4192: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2
Source.4193: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1
Source.4194: DFBPPR8399 ---- Plant proteins ---- Oleosin Ara h 11.0101
Source.4195: DFBPPR8400 ---- Plant proteins ---- Oleosin Ara h 11.0102
Source.4196: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B
Source.4197: DFBPPR8403 ---- Plant proteins ---- Endochitinase 3
Source.4198: DFBPPR8404 ---- Plant proteins ---- Endochitinase 1A
Source.4199: DFBPPR8405 ---- Plant proteins ---- Endochitinase 1B
Source.4200: DFBPPR8407 ---- Plant proteins ---- Endochitinase 2
Source.4201: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17
Source.4202: DFBPPR8411 ---- Plant proteins ---- Oleosin Ara h 10.0101
Source.4203: DFBPPR8412 ---- Plant proteins ---- Oleosin Ara h 10.0102
Source.4204: DFBPPR8413 ---- Plant proteins ---- Arachin Ahy-3
Source.4205: DFBPPR8414 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.4206: DFBPPR8417 ---- Plant proteins ---- Elongation factor G, chloroplastic
Source.4207: DFBPPR8418 ---- Plant proteins ---- Arachin 25 kDa protein
Source.4208: DFBPPR8419 ---- Plant proteins ---- Arachin 21 kDa protein
Source.4209: DFBPPR8420 ---- Plant proteins ---- Peroxygenase
Source.4210: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.4211: DFBPPR8423 ---- Plant proteins ---- Cytochrome c
Source.4212: DFBPPR8424 ---- Plant proteins ---- Oleosin H1
Source.4213: DFBPPR8425 ---- Plant proteins ---- Oleosin L
Source.4214: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.4215: DFBPPR8429 ---- Plant proteins ---- Oleosin H2
Source.4216: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.4217: DFBPPR8431 ---- Plant proteins ---- Antimicrobial protein 2
Source.4218: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.4219: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.4220: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.4221: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.4222: DFBPPR8446 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase
Source.4223: DFBPPR8448 ---- Plant proteins ---- Maturase K
Source.4224: DFBPPR8449 ---- Plant proteins ---- Basic endochitinase C
Source.4225: DFBPPR8450 ---- Plant proteins ---- Basic endochitinase A
Source.4226: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.4227: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.4228: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.4229: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.4230: DFBPPR8458 ---- Plant proteins ---- Catalase
Source.4231: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase
Source.4232: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.4233: DFBPPR8465 ---- Plant proteins ---- Cytochrome b559 subunit alpha
Source.4234: DFBPPR8466 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.4235: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.4236: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.4237: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.4238: DFBPPR8471 ---- Plant proteins ---- Beta-amylase
Source.4239: DFBPPR8473 ---- Plant proteins ---- Photosystem II reaction center protein I
Source.4240: DFBPPR8480 ---- Plant proteins ---- Protein PsbN
Source.4241: DFBPPR8482 ---- Plant proteins ---- 30S ribosomal protein S15, chloroplastic
Source.4242: DFBPPR8486 ---- Milk proteins ---- Lactadherin
Source.4243: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein
Source.4244: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.4245: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.4246: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.4247: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.4248: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4
Source.4249: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.4250: DFBPPR8504 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1
Source.4251: DFBPPR8505 ---- Milk proteins ---- Chymosin
Source.4252: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.4253: DFBPPR8508 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.4254: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.4255: DFBPPR8511 ---- Milk proteins ---- Transcobalamin-2
Source.4256: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.4257: DFBPPR8515 ---- Milk proteins ---- Vitamin D3 receptor
Source.4258: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.4259: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase
Source.4260: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3
Source.4261: DFBPPR8526 ---- Milk proteins ---- Protein FAM13A
Source.4262: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.4263: DFBPPR15935 ---- Animal proteins ---- Catalase
Source.4264: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.4265: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.4266: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.4267: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.4268: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.4269: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.4270: DFBPPR15947 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.4271: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.4272: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.4273: DFBPPR15951 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.4274: DFBPPR15952 ---- Animal proteins ---- Galectin-3
Source.4275: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.4276: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.4277: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.4278: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.4279: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.4280: DFBPPR15960 ---- Animal proteins ---- Apolipoprotein A-IV
Source.4281: DFBPPR15961 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.4282: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.4283: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.4284: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1
Source.4285: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.4286: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4287: DFBPPR15968 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain
Source.4288: DFBPPR15969 ---- Animal proteins ---- Natriuretic peptides A
Source.4289: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.4290: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.4291: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.4292: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.4293: DFBPPR15977 ---- Animal proteins ---- Cytochrome c
Source.4294: DFBPPR15978 ---- Animal proteins ---- 7,8-dihydro-8-oxoguanine triphosphatase
Source.4295: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.4296: DFBPPR15980 ---- Animal proteins ---- Peroxisome proliferator-activated receptor alpha
Source.4297: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.4298: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.4299: DFBPPR15984 ---- Animal proteins ---- Tumor necrosis factor
Source.4300: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.4301: DFBPPR15989 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.4302: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.4303: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.4304: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1
Source.4305: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.4306: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.4307: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.4308: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14
Source.4309: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.4310: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.4311: DFBPPR16015 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.4312: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.4313: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.4314: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.4315: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.4316: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36
Source.4317: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV
Source.4318: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.4319: DFBPPR16025 ---- Animal proteins ---- Transforming protein RhoA
Source.4320: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.4321: DFBPPR16028 ---- Animal proteins ---- Presenilin-1
Source.4322: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.4323: DFBPPR16030 ---- Animal proteins ---- E3 ubiquitin-protein ligase Mdm2
Source.4324: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.4325: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.4326: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.4327: DFBPPR16037 ---- Animal proteins ---- Caveolin-1
Source.4328: DFBPPR16038 ---- Animal proteins ---- Protein amnionless
Source.4329: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.4330: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.4331: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta
Source.4332: DFBPPR16042 ---- Animal proteins ---- Caveolin-2
Source.4333: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.4334: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.4335: DFBPPR16046 ---- Animal proteins ---- C-C motif chemokine 3
Source.4336: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.4337: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.4338: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2
Source.4339: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.4340: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3
Source.4341: DFBPPR16053 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.4342: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4343: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.4344: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase
Source.4345: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.4346: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type
Source.4347: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor
Source.4348: DFBPPR16062 ---- Animal proteins ---- Methylosome subunit pICln
Source.4349: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.4350: DFBPPR16064 ---- Animal proteins ---- Calnexin
Source.4351: DFBPPR16065 ---- Animal proteins ---- Caspase-3
Source.4352: DFBPPR16066 ---- Animal proteins ---- Coagulation factor IX
Source.4353: DFBPPR16067 ---- Animal proteins ---- CD40 ligand
Source.4354: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1
Source.4355: DFBPPR16075 ---- Animal proteins ---- Hematopoietic progenitor cell antigen CD34
Source.4356: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.4357: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.4358: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.4359: DFBPPR16085 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2
Source.4360: DFBPPR16086 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.4361: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.4362: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.4363: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.4364: DFBPPR16093 ---- Animal proteins ---- Menin
Source.4365: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.4366: DFBPPR16096 ---- Animal proteins ---- Protein CLN8
Source.4367: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.4368: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO
Source.4369: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.4370: DFBPPR16102 ---- Animal proteins ---- 40S ribosomal protein S3
Source.4371: DFBPPR16103 ---- Animal proteins ---- Laforin
Source.4372: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.4373: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.4374: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.4375: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.4376: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.4377: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.4378: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.4379: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.4380: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain
Source.4381: DFBPPR16116 ---- Animal proteins ---- Kit ligand
Source.4382: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.4383: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.4384: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.4385: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.4386: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4
Source.4387: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.4388: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer
Source.4389: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.4390: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12
Source.4391: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.4392: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C
Source.4393: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.4394: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.4395: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.4396: DFBPPR16138 ---- Animal proteins ---- Claudin-3
Source.4397: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.4398: DFBPPR16142 ---- Animal proteins ---- Procathepsin L
Source.4399: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3
Source.4400: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.4401: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.4402: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.4403: DFBPPR16152 ---- Animal proteins ---- Growth/differentiation factor 8
Source.4404: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6
Source.4405: DFBPPR16155 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.4406: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.4407: DFBPPR16159 ---- Animal proteins ---- Apolipoprotein C-I
Source.4408: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.4409: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.4410: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.4411: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.4412: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.4413: DFBPPR16172 ---- Animal proteins ---- Translocator protein 2
Source.4414: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.4415: DFBPPR16175 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.4416: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase
Source.4417: DFBPPR16178 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.4418: DFBPPR16181 ---- Animal proteins ---- Inositol polyphosphate-5-phosphatase A
Source.4419: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.4420: DFBPPR16183 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase
Source.4421: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.4422: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.4423: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.4424: DFBPPR16191 ---- Animal proteins ---- Somatotropin
Source.4425: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.4426: DFBPPR16194 ---- Animal proteins ---- Signal peptidase complex subunit 3
Source.4427: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.4428: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4429: DFBPPR16198 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.4430: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.4431: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.4432: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.4433: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.4434: DFBPPR16204 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.4435: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.4436: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.4437: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.4438: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.4439: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.4440: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type
Source.4441: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.4442: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.4443: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.4444: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.4445: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.4446: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.4447: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.4448: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.4449: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.4450: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.4451: DFBPPR16227 ---- Animal proteins ---- Myelin proteolipid protein
Source.4452: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.4453: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog
Source.4454: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.4455: DFBPPR16235 ---- Animal proteins ---- Serum amyloid A protein
Source.4456: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.4457: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.4458: DFBPPR16240 ---- Animal proteins ---- Fibronectin
Source.4459: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.4460: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.4461: DFBPPR16247 ---- Animal proteins ---- Recoverin
Source.4462: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.4463: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.4464: DFBPPR16250 ---- Animal proteins ---- Alpha-crystallin A chain
Source.4465: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15
Source.4466: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.4467: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.4468: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4469: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.4470: DFBPPR16261 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.4471: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.4472: DFBPPR16263 ---- Animal proteins ---- Protein 4.1
Source.4473: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.4474: DFBPPR16267 ---- Animal proteins ---- Ras-related protein Rab-2A
Source.4475: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.4476: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.4477: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.4478: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.4479: DFBPPR16275 ---- Animal proteins ---- Hemoglobin subunit beta
Source.4480: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1
Source.4481: DFBPPR16277 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase
Source.4482: DFBPPR16278 ---- Animal proteins ---- Major prion protein
Source.4483: DFBPPR16279 ---- Animal proteins ---- Galactokinase
Source.4484: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68
Source.4485: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.4486: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.4487: DFBPPR16287 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator
Source.4488: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.4489: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21
Source.4490: DFBPPR16292 ---- Animal proteins ---- Protein unc-119 homolog A
Source.4491: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3
Source.4492: DFBPPR16294 ---- Animal proteins ---- Signal peptidase complex subunit 2
Source.4493: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1
Source.4494: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.4495: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.4496: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor
Source.4497: DFBPPR16299 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.4498: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.4499: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.4500: DFBPPR16303 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.4501: DFBPPR16305 ---- Animal proteins ---- Phosducin
Source.4502: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41
Source.4503: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.4504: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor
Source.4505: DFBPPR16315 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.4506: DFBPPR16316 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.4507: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.4508: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.4509: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.4510: DFBPPR16322 ---- Animal proteins ---- Interleukin-18
Source.4511: DFBPPR16323 ---- Animal proteins ---- Aquaporin-2
Source.4512: DFBPPR16326 ---- Animal proteins ---- Desmin
Source.4513: DFBPPR16327 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.4514: DFBPPR16328 ---- Animal proteins ---- Fibroblast growth factor 8
Source.4515: DFBPPR16329 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.4516: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.4517: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.4518: DFBPPR16336 ---- Animal proteins ---- Colipase
Source.4519: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.4520: DFBPPR16340 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain
Source.4521: DFBPPR16341 ---- Animal proteins ---- Calmegin
Source.4522: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.4523: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.4524: DFBPPR16345 ---- Animal proteins ---- Interleukin-10
Source.4525: DFBPPR16365 ---- Animal proteins ---- Fibroblast growth factor 5
Source.4526: DFBPPR16368 ---- Animal proteins ---- Tyrosinase
Source.4527: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.4528: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.4529: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.4530: DFBPPR16434 ---- Animal proteins ---- Thyrotropin subunit beta
Source.4531: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.4532: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.4533: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.4534: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6
Source.4535: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.4536: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11
Source.4537: DFBPPR16444 ---- Animal proteins ---- Interleukin-33
Source.4538: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2
Source.4539: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain
Source.4540: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.4541: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.4542: DFBPPR16458 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.4543: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.4544: DFBPPR16462 ---- Animal proteins ---- Pantetheinase
Source.4545: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.4546: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4
Source.4547: DFBPPR16474 ---- Animal proteins ---- Pinin
Source.4548: DFBPPR16475 ---- Animal proteins ---- Transmembrane protein 258
Source.4549: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.4550: DFBPPR16478 ---- Animal proteins ---- Chymotrypsinogen 2
Source.4551: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.4552: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2
Source.4553: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.4554: DFBPPR16485 ---- Animal proteins ---- Cathepsin S
Source.4555: DFBPPR16486 ---- Animal proteins ---- Natriuretic peptides B
Source.4556: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.4557: DFBPPR16489 ---- Animal proteins ---- Lymphotoxin-alpha
Source.4558: DFBPPR16490 ---- Animal proteins ---- Translocon-associated protein subunit beta
Source.4559: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1
Source.4560: DFBPPR16492 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.4561: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.4562: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.4563: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.4564: DFBPPR16503 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.4565: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.4566: DFBPPR16506 ---- Animal proteins ---- Pepsin B
Source.4567: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor
Source.4568: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.4569: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.4570: DFBPPR16513 ---- Animal proteins ---- Endothelin-1 receptor
Source.4571: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog
Source.4572: DFBPPR16516 ---- Animal proteins ---- Cytospin-A
Source.4573: DFBPPR16517 ---- Animal proteins ---- Cholinesterase
Source.4574: DFBPPR16518 ---- Animal proteins ---- Keratin, type II cytoskeletal 2 epidermal
Source.4575: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.4576: DFBPPR16522 ---- Animal proteins ---- Inducible T-cell costimulator
Source.4577: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.4578: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.4579: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.4580: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.4581: DFBPPR16531 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3
Source.4582: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.4583: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3
Source.4584: DFBPPR16537 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.4585: DFBPPR16538 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 1B
Source.4586: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.4587: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.4588: DFBPPR16545 ---- Animal proteins ---- Probable G-protein coupled receptor 83
Source.4589: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein
Source.4590: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.4591: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.4592: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.4593: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.4594: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.4595: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.4596: DFBPPR16560 ---- Animal proteins ---- Keratinocyte-associated protein 2
Source.4597: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.4598: DFBPPR16564 ---- Animal proteins ---- Bcl-2-like protein 2
Source.4599: DFBPPR16566 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta
Source.4600: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.4601: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.4602: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.4603: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.4604: DFBPPR16582 ---- Animal proteins ---- Pepsin A
Source.4605: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.4606: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin
Source.4607: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2
Source.4608: DFBPPR16589 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G5c
Source.4609: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.4610: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4
Source.4611: DFBPPR16594 ---- Animal proteins ---- Macoilin
Source.4612: DFBPPR16597 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.4613: DFBPPR16598 ---- Animal proteins ---- Keratin, type I cytoskeletal 9
Source.4614: DFBPPR16599 ---- Animal proteins ---- Receptor-binding cancer antigen expressed on SiSo cells
Source.4615: DFBPPR16600 ---- Animal proteins ---- Ras-related protein Rab-4B
Source.4616: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.4617: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype
Source.4618: DFBPPR16604 ---- Animal proteins ---- Biglycan
Source.4619: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.4620: DFBPPR16610 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.4621: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.4622: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.4623: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1
Source.4624: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.4625: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1
Source.4626: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4627: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.4628: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.4629: DFBPPR16632 ---- Animal proteins ---- Prenylated Rab acceptor protein 1
Source.4630: DFBPPR16638 ---- Animal proteins ---- Synapsin-1
Source.4631: DFBPPR16640 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.4632: DFBPPR16642 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.4633: DFBPPR16643 ---- Animal proteins ---- Ribosomal protein L18
Source.4634: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.4635: DFBPPR16650 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.4636: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.4637: DFBPPR16653 ---- Animal proteins ---- Clusterin-like protein 1
Source.4638: DFBPPR16656 ---- Animal proteins ---- 60S ribosomal protein L4
Source.4639: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5
Source.4640: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b
Source.4641: DFBPPR16666 ---- Animal proteins ---- Pro-adrenomedullin
Source.4642: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22
Source.4643: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8
Source.4644: DFBPPR16671 ---- Animal proteins ---- Forkhead box protein I3
Source.4645: DFBPPR16675 ---- Animal proteins ---- V-type proton ATPase subunit e 1
Source.4646: DFBPPR16676 ---- Animal proteins ---- Olfactory receptor-like protein OLF2
Source.4647: DFBPPR16679 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.4648: DFBPPR16683 ---- Animal proteins ---- Oocyte-expressed protein
Source.4649: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.4650: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.4651: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT
Source.4652: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4
Source.4653: DFBPPR16693 ---- Animal proteins ---- Cingulin
Source.4654: DFBPPR16695 ---- Animal proteins ---- UDP-galactose translocator
Source.4655: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.4656: DFBPPR16701 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog
Source.4657: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.4658: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47
Source.4659: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252
Source.4660: DFBPPR16714 ---- Animal proteins ---- Protein fosB
Source.4661: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.4662: DFBPPR16721 ---- Animal proteins ---- Testin
Source.4663: DFBPPR16722 ---- Animal proteins ---- Ig heavy chain V region MOO
Source.4664: DFBPPR16724 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2
Source.4665: DFBPPR16725 ---- Animal proteins ---- Fibrinogen gamma chain
Source.4666: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2
Source.4667: DFBPPR16733 ---- Animal proteins ---- 40S ribosomal protein S17
Source.4668: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46
Source.4669: DFBPPR16739 ---- Animal proteins ---- Lengsin
Source.4670: DFBPPR16745 ---- Animal proteins ---- Ig kappa chain V region GOM
Source.4671: DFBPPR16747 ---- Animal proteins ---- Pleckstrin
Source.4672: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.4673: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.4674: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10
Source.4675: DFBPPR16755 ---- Animal proteins ---- Glyoxalase domain-containing protein 5
Source.4676: DFBPPR16759 ---- Animal proteins ---- Ig mu chain C region
Source.4677: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.4678: DFBPPR16762 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.4679: DFBPPR16763 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.4680: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.4681: DFBPPR16765 ---- Animal proteins ---- Annexin A1 isoform p37
Source.4682: DFBPPR16768 ---- Animal proteins ---- Cytochrome c
Source.4683: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor
Source.4684: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase
Source.4685: DFBPPR16774 ---- Animal proteins ---- Annexin A1 isoform p35
Source.4686: DFBPPR16775 ---- Animal proteins ---- Pinopsin
Source.4687: DFBPPR16779 ---- Animal proteins ---- Hemoglobin subunit beta
Source.4688: DFBPPR16780 ---- Animal proteins ---- Growth/differentiation factor 8
Source.4689: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.4690: DFBPPR16788 ---- Animal proteins ---- Alpha-crystallin A chain
Source.4691: DFBPPR16790 ---- Animal proteins ---- Alpha-crystallin B chain
Source.4692: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.4693: DFBPPR16796 ---- Animal proteins ---- Major prion protein
Source.4694: DFBPPR16797 ---- Animal proteins ---- Albumin
Source.4695: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.4696: DFBPPR16799 ---- Animal proteins ---- Somatotropin
Source.4697: DFBPPR16800 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn]
Source.4698: DFBPPR16801 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.4699: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin
Source.4700: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.4701: DFBPPR16809 ---- Animal proteins ---- Rhodopsin
Source.4702: DFBPPR16810 ---- Animal proteins ---- Cathepsin B
Source.4703: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.4704: DFBPPR16813 ---- Animal proteins ---- Prolactin
Source.4705: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.4706: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1
Source.4707: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4708: DFBPPR16818 ---- Animal proteins ---- ATPase inhibitor, mitochondrial
Source.4709: DFBPPR16819 ---- Animal proteins ---- Hemoglobin subunit beta
Source.4710: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.4711: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.4712: DFBPPR16825 ---- Animal proteins ---- Myelin basic protein
Source.4713: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X
Source.4714: DFBPPR16829 ---- Animal proteins ---- Fibroblast growth factor 1
Source.4715: DFBPPR16831 ---- Animal proteins ---- Fibrinogen beta chain
Source.4716: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.4717: DFBPPR16833 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.4718: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.4719: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein
Source.4720: DFBPPR16841 ---- Animal proteins ---- Peroxiredoxin-6
Source.4721: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.4722: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.4723: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.4724: DFBPPR16847 ---- Animal proteins ---- Fibrinogen alpha chain
Source.4725: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.4726: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.4727: DFBPPR16852 ---- Animal proteins ---- Cytochrome b
Source.4728: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6
Source.4729: DFBPPR16856 ---- Animal proteins ---- Tumor necrosis factor
Source.4730: DFBPPR16860 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.4731: DFBPPR16863 ---- Animal proteins ---- Biglycan
Source.4732: DFBPPR16865 ---- Animal proteins ---- Apolipoprotein E
Source.4733: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B
Source.4734: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.4735: DFBPPR16870 ---- Animal proteins ---- Coagulation factor IX
Source.4736: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.4737: DFBPPR16872 ---- Animal proteins ---- Oxytocin-neurophysin 1
Source.4738: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor
Source.4739: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.4740: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1
Source.4741: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.4742: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.4743: DFBPPR16887 ---- Animal proteins ---- Pleiotrophin
Source.4744: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial
Source.4745: DFBPPR16890 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase F, mitochondrial
Source.4746: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4747: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.4748: DFBPPR16894 ---- Animal proteins ---- Procathepsin L
Source.4749: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII
Source.4750: DFBPPR16896 ---- Animal proteins ---- Alpha-crystallin A chain
Source.4751: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1
Source.4752: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.4753: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.4754: DFBPPR16901 ---- Animal proteins ---- Lens fiber membrane intrinsic protein
Source.4755: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.4756: DFBPPR16907 ---- Animal proteins ---- Acyl carrier protein, mitochondrial
Source.4757: DFBPPR16909 ---- Animal proteins ---- Calreticulin
Source.4758: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.4759: DFBPPR16913 ---- Animal proteins ---- Alpha-crystallin B chain
Source.4760: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV
Source.4761: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.4762: DFBPPR16919 ---- Animal proteins ---- VIP peptides
Source.4763: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.4764: DFBPPR16922 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.4765: DFBPPR16923 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.4766: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial
Source.4767: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.4768: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.4769: DFBPPR16927 ---- Animal proteins ---- Caveolin-1
Source.4770: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.4771: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.4772: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.4773: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.4774: DFBPPR16935 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13
Source.4775: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.4776: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.4777: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.4778: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.4779: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.4780: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic
Source.4781: DFBPPR16945 ---- Animal proteins ---- Transforming protein RhoA
Source.4782: DFBPPR16946 ---- Animal proteins ---- Recoverin
Source.4783: DFBPPR16948 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.4784: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.4785: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.4786: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin
Source.4787: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.4788: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4789: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.4790: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.4791: DFBPPR16962 ---- Animal proteins ---- Interleukin-18
Source.4792: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.4793: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.4794: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.4795: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.4796: DFBPPR16967 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta
Source.4797: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.4798: DFBPPR16969 ---- Animal proteins ---- Adenosine deaminase
Source.4799: DFBPPR16970 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.4800: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.4801: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.4802: DFBPPR16974 ---- Animal proteins ---- Natriuretic peptides A
Source.4803: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6
Source.4804: DFBPPR16976 ---- Animal proteins ---- Growth/differentiation factor 8
Source.4805: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.4806: DFBPPR16979 ---- Animal proteins ---- Aquaporin-1
Source.4807: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.4808: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.4809: DFBPPR16988 ---- Animal proteins ---- Protachykinin-1
Source.4810: DFBPPR16989 ---- Animal proteins ---- Cytochrome c
Source.4811: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2
Source.4812: DFBPPR16996 ---- Animal proteins ---- Retinol dehydrogenase 5
Source.4813: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.4814: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.4815: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1
Source.4816: DFBPPR17000 ---- Animal proteins ---- Vimentin
Source.4817: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.4818: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.4819: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.4820: DFBPPR17004 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.4821: DFBPPR17005 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.4822: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP
Source.4823: DFBPPR17010 ---- Animal proteins ---- Sestrin-2
Source.4824: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2
Source.4825: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1
Source.4826: DFBPPR17013 ---- Animal proteins ---- Presenilin-1
Source.4827: DFBPPR17014 ---- Animal proteins ---- Microtubule-associated proteins 1A/1B light chain 3B
Source.4828: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.4829: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.4830: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.4831: DFBPPR17022 ---- Animal proteins ---- Serine--tRNA ligase, mitochondrial
Source.4832: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.4833: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.4834: DFBPPR17027 ---- Animal proteins ---- D(1A) dopamine receptor
Source.4835: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.4836: DFBPPR17029 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.4837: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.4838: DFBPPR17031 ---- Animal proteins ---- Aurora kinase A
Source.4839: DFBPPR17032 ---- Animal proteins ---- Gamma-aminobutyric acid receptor-associated protein-like 2
Source.4840: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.4841: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.4842: DFBPPR17036 ---- Animal proteins ---- Parkinson disease protein 7 homolog
Source.4843: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.4844: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.4845: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.4846: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.4847: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D
Source.4848: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.4849: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.4850: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.4851: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.4852: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform
Source.4853: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.4854: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5
Source.4855: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.4856: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.4857: DFBPPR17067 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A
Source.4858: DFBPPR17068 ---- Animal proteins ---- Mitogen-activated protein kinase 1
Source.4859: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.4860: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.4861: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.4862: DFBPPR17073 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.4863: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.4864: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.4865: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.4866: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase
Source.4867: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.4868: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.4869: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.4870: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.4871: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.4872: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1
Source.4873: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.4874: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.4875: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1
Source.4876: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1
Source.4877: DFBPPR17101 ---- Animal proteins ---- Annexin A5
Source.4878: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.4879: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.4880: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.4881: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.4882: DFBPPR17108 ---- Animal proteins ---- Coronin-1A
Source.4883: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.4884: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2
Source.4885: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.4886: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.4887: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.4888: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.4889: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.4890: DFBPPR17121 ---- Animal proteins ---- 3-hydroxyacyl-CoA dehydrogenase type-2
Source.4891: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.4892: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.4893: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.4894: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit
Source.4895: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.4896: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1
Source.4897: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.4898: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4899: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein
Source.4900: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.4901: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1
Source.4902: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta
Source.4903: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.4904: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2
Source.4905: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.4906: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.4907: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.4908: DFBPPR17158 ---- Animal proteins ---- EH domain-containing protein 1
Source.4909: DFBPPR17159 ---- Animal proteins ---- EH domain-containing protein 1
Source.4910: DFBPPR17160 ---- Animal proteins ---- EH domain-containing protein 1
Source.4911: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor
Source.4912: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.4913: DFBPPR17164 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.4914: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.4915: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.4916: DFBPPR17168 ---- Animal proteins ---- Angiopoietin-1
Source.4917: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.4918: DFBPPR17172 ---- Animal proteins ---- Cartilage oligomeric matrix protein
Source.4919: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.4920: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.4921: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.4922: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.4923: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.4924: DFBPPR17192 ---- Animal proteins ---- Kit ligand
Source.4925: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.4926: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.4927: DFBPPR17196 ---- Animal proteins ---- Histone H4
Source.4928: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial
Source.4929: DFBPPR17198 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial
Source.4930: DFBPPR17204 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.4931: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.4932: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.4933: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase
Source.4934: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.4935: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.4936: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35
Source.4937: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.4938: DFBPPR17261 ---- Animal proteins ---- NAD-dependent protein lipoamidase sirtuin-4, mitochondrial
Source.4939: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.4940: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.4941: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.4942: DFBPPR17267 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 4B
Source.4943: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.4944: DFBPPR17270 ---- Animal proteins ---- Nucleophosmin
Source.4945: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3
Source.4946: DFBPPR17274 ---- Animal proteins ---- U8 snoRNA-decapping enzyme
Source.4947: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.4948: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7
Source.4949: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.4950: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1
Source.4951: DFBPPR17286 ---- Animal proteins ---- Septin-2
Source.4952: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.4953: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.4954: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2
Source.4955: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D
Source.4956: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2
Source.4957: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B
Source.4958: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.4959: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.4960: DFBPPR17296 ---- Animal proteins ---- Dynamin-2
Source.4961: DFBPPR17297 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.4962: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.4963: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.4964: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1
Source.4965: DFBPPR17304 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.4966: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial
Source.4967: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.4968: DFBPPR17309 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1
Source.4969: DFBPPR17310 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.4970: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.4971: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.4972: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3
Source.4973: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.4974: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase
Source.4975: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.4976: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II
Source.4977: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.4978: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.4979: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.4980: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.4981: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase
Source.4982: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1
Source.4983: DFBPPR17334 ---- Animal proteins ---- Prohibitin
Source.4984: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.4985: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.4986: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.4987: DFBPPR17339 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.4988: DFBPPR17340 ---- Animal proteins ---- Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating
Source.4989: DFBPPR17341 ---- Animal proteins ---- Radixin
Source.4990: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.4991: DFBPPR17345 ---- Animal proteins ---- Palmitoyl-protein thioesterase 1
Source.4992: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.4993: DFBPPR17349 ---- Animal proteins ---- Sialidase-3
Source.4994: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.4995: DFBPPR17352 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 2
Source.4996: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.4997: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.4998: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.4999: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.5000: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.5001: DFBPPR17362 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.5002: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin
Source.5003: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.5004: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.5005: DFBPPR17367 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.5006: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1
Source.5007: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.5008: DFBPPR17371 ---- Animal proteins ---- Autophagy protein 5
Source.5009: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.5010: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.5011: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.5012: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.5013: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.5014: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.5015: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.5016: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.5017: DFBPPR17382 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 5
Source.5018: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1
Source.5019: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial
Source.5020: DFBPPR17386 ---- Animal proteins ---- Epithelial membrane protein 2
Source.5021: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.5022: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.5023: DFBPPR17392 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.5024: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.5025: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD
Source.5026: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3
Source.5027: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.5028: DFBPPR17399 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.5029: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1
Source.5030: DFBPPR17401 ---- Animal proteins ---- Moesin
Source.5031: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.5032: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1
Source.5033: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.5034: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.5035: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.5036: DFBPPR17409 ---- Animal proteins ---- Geranylgeranyl pyrophosphate synthase
Source.5037: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.5038: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.5039: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.5040: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5
Source.5041: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.5042: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.5043: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.5044: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial
Source.5045: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1
Source.5046: DFBPPR17423 ---- Animal proteins ---- Furin
Source.5047: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5
Source.5048: DFBPPR17425 ---- Animal proteins ---- Dynamin-1
Source.5049: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.5050: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.5051: DFBPPR17428 ---- Animal proteins ---- DNA damage-inducible transcript 3 protein
Source.5052: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.5053: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.5054: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.5055: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5
Source.5056: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.5057: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.5058: DFBPPR17437 ---- Animal proteins ---- DNA excision repair protein ERCC-1
Source.5059: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.5060: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.5061: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.5062: DFBPPR17441 ---- Animal proteins ---- DnaJ homolog subfamily C member 5
Source.5063: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.5064: DFBPPR17443 ---- Animal proteins ---- Beclin-1
Source.5065: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.5066: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.5067: DFBPPR17449 ---- Animal proteins ---- C-C motif chemokine 3
Source.5068: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.5069: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.5070: DFBPPR17454 ---- Animal proteins ---- Peripherin-2
Source.5071: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.5072: DFBPPR17457 ---- Animal proteins ---- 15-hydroxyprostaglandin dehydrogenase [NAD(+)]
Source.5073: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial
Source.5074: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3
Source.5075: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.5076: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.5077: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1
Source.5078: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.5079: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.5080: DFBPPR17466 ---- Animal proteins ---- N-alpha-acetyltransferase 50
Source.5081: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.5082: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase
Source.5083: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.5084: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.5085: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.5086: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.5087: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit
Source.5088: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.5089: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1
Source.5090: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.5091: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase
Source.5092: DFBPPR17485 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain
Source.5093: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.5094: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.5095: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.5096: DFBPPR17490 ---- Animal proteins ---- TIR domain-containing adapter molecule 2
Source.5097: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1
Source.5098: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.5099: DFBPPR17494 ---- Animal proteins ---- C-C motif chemokine 8
Source.5100: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C
Source.5101: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.5102: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha
Source.5103: DFBPPR17499 ---- Animal proteins ---- Allograft inflammatory factor 1
Source.5104: DFBPPR17501 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.5105: DFBPPR17503 ---- Animal proteins ---- Syntaxin-1A
Source.5106: DFBPPR17506 ---- Animal proteins ---- Vasopressin-neurophysin 2-copeptin
Source.5107: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.5108: DFBPPR17510 ---- Animal proteins ---- Uroplakin-1b
Source.5109: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.5110: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.5111: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.5112: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase
Source.5113: DFBPPR17516 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.5114: DFBPPR17518 ---- Animal proteins ---- ADP-ribosylation factor 1
Source.5115: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase
Source.5116: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.5117: DFBPPR17521 ---- Animal proteins ---- Transforming growth factor beta-1-induced transcript 1 protein
Source.5118: DFBPPR17522 ---- Animal proteins ---- Homer protein homolog 1
Source.5119: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.5120: DFBPPR17524 ---- Animal proteins ---- DnaJ homolog subfamily A member 1
Source.5121: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3
Source.5122: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.5123: DFBPPR17530 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.5124: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.5125: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase
Source.5126: DFBPPR17538 ---- Animal proteins ---- Septin-7
Source.5127: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.5128: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.5129: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial
Source.5130: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1
Source.5131: DFBPPR17547 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 5
Source.5132: DFBPPR17549 ---- Animal proteins ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.5133: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4
Source.5134: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.5135: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4
Source.5136: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.5137: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog
Source.5138: DFBPPR17555 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial
Source.5139: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.5140: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1
Source.5141: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1
Source.5142: DFBPPR17561 ---- Animal proteins ---- Aquaporin-4
Source.5143: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.5144: DFBPPR17563 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein A1
Source.5145: DFBPPR17566 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial
Source.5146: DFBPPR17568 ---- Animal proteins ---- Interferon tau-2
Source.5147: DFBPPR17570 ---- Animal proteins ---- Clathrin light chain B
Source.5148: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.5149: DFBPPR17574 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.5150: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.5151: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.5152: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.5153: DFBPPR17579 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.5154: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1
Source.5155: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1
Source.5156: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial
Source.5157: DFBPPR17589 ---- Animal proteins ---- Aquaporin-2
Source.5158: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1
Source.5159: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.5160: DFBPPR17592 ---- Animal proteins ---- Claudin-3
Source.5161: DFBPPR17593 ---- Animal proteins ---- Claudin-3
Source.5162: DFBPPR17595 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.5163: DFBPPR17596 ---- Animal proteins ---- [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial
Source.5164: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.5165: DFBPPR17599 ---- Animal proteins ---- Tissue factor
Source.5166: DFBPPR17600 ---- Animal proteins ---- Tissue factor
Source.5167: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.5168: DFBPPR17603 ---- Animal proteins ---- Flavin reductase (NADPH)
Source.5169: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.5170: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.5171: DFBPPR17610 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A2, mitochondrial
Source.5172: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.5173: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.5174: DFBPPR17618 ---- Animal proteins ---- Synaptophysin
Source.5175: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A
Source.5176: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A
Source.5177: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.5178: DFBPPR17629 ---- Animal proteins ---- Thiamine-triphosphatase
Source.5179: DFBPPR17630 ---- Animal proteins ---- Thiamine-triphosphatase
Source.5180: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.5181: DFBPPR17635 ---- Animal proteins ---- Frataxin, mitochondrial
Source.5182: DFBPPR17637 ---- Animal proteins ---- Cytochrome c oxidase subunit 7C, mitochondrial
Source.5183: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.5184: DFBPPR17647 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 1
Source.5185: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.5186: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.5187: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2
Source.5188: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2
Source.5189: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.5190: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.5191: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.5192: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16
Source.5193: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2
Source.5194: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.5195: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.5196: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L
Source.5197: DFBPPR17692 ---- Animal proteins ---- Adenylate kinase 4, mitochondrial
Source.5198: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.5199: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.5200: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.5201: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B
Source.5202: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.5203: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.5204: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.5205: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1
Source.5206: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.5207: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.5208: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.5209: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2
Source.5210: DFBPPR17748 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.5211: DFBPPR17749 ---- Animal proteins ---- CD9 antigen
Source.5212: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.5213: DFBPPR17757 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.5214: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.5215: DFBPPR17763 ---- Animal proteins ---- Dynein light chain 1, cytoplasmic
Source.5216: DFBPPR17764 ---- Animal proteins ---- L-selectin
Source.5217: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.5218: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5
Source.5219: DFBPPR17768 ---- Animal proteins ---- Microtubule-associated proteins 1A/1B light chain 3A
Source.5220: DFBPPR17771 ---- Animal proteins ---- Thyrotropin subunit beta
Source.5221: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.5222: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.5223: DFBPPR17774 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.5224: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3
Source.5225: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.5226: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.5227: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.5228: DFBPPR17782 ---- Animal proteins ---- Ras GTPase-activating protein-binding protein 1
Source.5229: DFBPPR17783 ---- Animal proteins ---- 40S ribosomal protein S3
Source.5230: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.5231: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3
Source.5232: DFBPPR17787 ---- Animal proteins ---- Septin-6
Source.5233: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.5234: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.5235: DFBPPR17792 ---- Animal proteins ---- Glycine N-acyltransferase
Source.5236: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.5237: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.5238: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.5239: DFBPPR17800 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13
Source.5240: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.5241: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.5242: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.5243: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1
Source.5244: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.5245: DFBPPR17812 ---- Animal proteins ---- Dynein light chain Tctex-type 1
Source.5246: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.5247: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.5248: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.5249: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.5250: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase
Source.5251: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.5252: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.5253: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial
Source.5254: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.5255: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.5256: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B
Source.5257: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.5258: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1
Source.5259: DFBPPR17834 ---- Animal proteins ---- Apolipoprotein D
Source.5260: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.5261: DFBPPR17836 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 6
Source.5262: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.5263: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B
Source.5264: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.5265: DFBPPR17846 ---- Animal proteins ---- (Lyso)-N-acylphosphatidylethanolamine lipase
Source.5266: DFBPPR17847 ---- Animal proteins ---- Palmitoyltransferase ZDHHC20
Source.5267: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3
Source.5268: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.5269: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.5270: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.5271: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase
Source.5272: DFBPPR17855 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.5273: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.5274: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.5275: DFBPPR17861 ---- Animal proteins ---- 3-hydroxyanthranilate 3,4-dioxygenase
Source.5276: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.5277: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.5278: DFBPPR17867 ---- Animal proteins ---- Guanylate kinase
Source.5279: DFBPPR17868 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit gamma
Source.5280: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.5281: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.5282: DFBPPR17874 ---- Animal proteins ---- Endonuclease 8-like 2
Source.5283: DFBPPR17877 ---- Animal proteins ---- Syntaxin-7
Source.5284: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.5285: DFBPPR17879 ---- Animal proteins ---- Menin
Source.5286: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1
Source.5287: DFBPPR17885 ---- Animal proteins ---- Serine protease inhibitor Kazal-type 6
Source.5288: DFBPPR17886 ---- Animal proteins ---- Sperm protamine P1
Source.5289: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.5290: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.5291: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.5292: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.5293: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.5294: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.5295: DFBPPR17894 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 9
Source.5296: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.5297: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.5298: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.5299: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.5300: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.5301: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB
Source.5302: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.5303: DFBPPR17905 ---- Animal proteins ---- DNA endonuclease RBBP8
Source.5304: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.5305: DFBPPR17908 ---- Animal proteins ---- Membrane cofactor protein
Source.5306: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.5307: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.5308: DFBPPR17913 ---- Animal proteins ---- ATP synthase subunit gamma, mitochondrial
Source.5309: DFBPPR17914 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.5310: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A
Source.5311: DFBPPR17916 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF126
Source.5312: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.5313: DFBPPR17919 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.5314: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1
Source.5315: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.5316: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.5317: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.5318: DFBPPR17928 ---- Animal proteins ---- CD40 ligand
Source.5319: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2
Source.5320: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.5321: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.5322: DFBPPR17934 ---- Animal proteins ---- RNA-binding motif protein, X chromosome
Source.5323: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.5324: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.5325: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.5326: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2
Source.5327: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.5328: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.5329: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.5330: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.5331: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.5332: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1
Source.5333: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.5334: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.5335: DFBPPR17953 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.5336: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.5337: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.5338: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.5339: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial
Source.5340: DFBPPR17966 ---- Animal proteins ---- Clathrin light chain A
Source.5341: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase
Source.5342: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase
Source.5343: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial
Source.5344: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.5345: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.5346: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.5347: DFBPPR17976 ---- Animal proteins ---- Apoptosis regulator Bcl-2
Source.5348: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.5349: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin
Source.5350: DFBPPR17982 ---- Animal proteins ---- Sorting nexin-10
Source.5351: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.5352: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.5353: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor
Source.5354: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial
Source.5355: DFBPPR17987 ---- Animal proteins ---- DCN1-like protein 3
Source.5356: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN
Source.5357: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein
Source.5358: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.5359: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.5360: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.5361: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase
Source.5362: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.5363: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.5364: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.5365: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.5366: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase
Source.5367: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.5368: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.5369: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.5370: DFBPPR18008 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF144B
Source.5371: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.5372: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon
Source.5373: DFBPPR18011 ---- Animal proteins ---- Afamin
Source.5374: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.5375: DFBPPR18015 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.5376: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2
Source.5377: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1
Source.5378: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase
Source.5379: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.5380: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.5381: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.5382: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.5383: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta
Source.5384: DFBPPR18031 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 2
Source.5385: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.5386: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.5387: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3
Source.5388: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.5389: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6
Source.5390: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5
Source.5391: DFBPPR18047 ---- Animal proteins ---- ATP synthase F(0) complex subunit C3, mitochondrial
Source.5392: DFBPPR18049 ---- Animal proteins ---- Transcription factor Dp-1
Source.5393: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.5394: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.5395: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.5396: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2
Source.5397: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.5398: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.5399: DFBPPR18068 ---- Animal proteins ---- Annexin A11
Source.5400: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.5401: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein
Source.5402: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.5403: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial
Source.5404: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.5405: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.5406: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.5407: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1
Source.5408: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.5409: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.5410: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor
Source.5411: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta
Source.5412: DFBPPR18091 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.5413: DFBPPR18092 ---- Animal proteins ---- Carbonyl reductase family member 4
Source.5414: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.5415: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1
Source.5416: DFBPPR18097 ---- Animal proteins ---- Deoxycytidine kinase
Source.5417: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33
Source.5418: DFBPPR18100 ---- Animal proteins ---- Derlin-1
Source.5419: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.5420: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.5421: DFBPPR18106 ---- Animal proteins ---- Natriuretic peptides B
Source.5422: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1
Source.5423: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29
Source.5424: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.5425: DFBPPR18111 ---- Animal proteins ---- Transcriptional adapter 3
Source.5426: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2
Source.5427: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38
Source.5428: DFBPPR18114 ---- Animal proteins ---- Charged multivesicular body protein 4a
Source.5429: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1
Source.5430: DFBPPR18118 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 8
Source.5431: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.5432: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.5433: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.5434: DFBPPR18123 ---- Animal proteins ---- Macrophage migration inhibitory factor
Source.5435: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3
Source.5436: DFBPPR18125 ---- Animal proteins ---- Serine/threonine-protein kinase VRK1
Source.5437: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog
Source.5438: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.5439: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.5440: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha
Source.5441: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.5442: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1
Source.5443: DFBPPR18136 ---- Animal proteins ---- Septin-8
Source.5444: DFBPPR18137 ---- Animal proteins ---- Septin-8
Source.5445: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1
Source.5446: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1
Source.5447: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.5448: DFBPPR18150 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 1
Source.5449: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain
Source.5450: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.5451: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein
Source.5452: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.5453: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1
Source.5454: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.5455: DFBPPR18162 ---- Animal proteins ---- Renin receptor
Source.5456: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.5457: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.5458: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.5459: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1
Source.5460: DFBPPR18173 ---- Animal proteins ---- Cytokine receptor common subunit gamma
Source.5461: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.5462: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.5463: DFBPPR18188 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.5464: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.5465: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25
Source.5466: DFBPPR18191 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-2
Source.5467: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.5468: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.5469: DFBPPR18197 ---- Animal proteins ---- Bax inhibitor 1
Source.5470: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5
Source.5471: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.5472: DFBPPR18207 ---- Animal proteins ---- Interleukin-7
Source.5473: DFBPPR18208 ---- Animal proteins ---- THO complex subunit 4
Source.5474: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.5475: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.5476: DFBPPR18211 ---- Animal proteins ---- Phosducin
Source.5477: DFBPPR18213 ---- Animal proteins ---- Transformer-2 protein homolog beta
Source.5478: DFBPPR18216 ---- Animal proteins ---- Collectin-12
Source.5479: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.5480: DFBPPR18218 ---- Animal proteins ---- Dual specificity protein phosphatase 6
Source.5481: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.5482: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.5483: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40
Source.5484: DFBPPR18224 ---- Animal proteins ---- Integral membrane protein 2B
Source.5485: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.5486: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4
Source.5487: DFBPPR18227 ---- Animal proteins ---- Desmin
Source.5488: DFBPPR18228 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.5489: DFBPPR18230 ---- Animal proteins ---- Multivesicular body subunit 12A
Source.5490: DFBPPR18232 ---- Animal proteins ---- Ragulator complex protein LAMTOR1
Source.5491: DFBPPR18233 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 3
Source.5492: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.5493: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.5494: DFBPPR18237 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.5495: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1
Source.5496: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3
Source.5497: DFBPPR18242 ---- Animal proteins ---- Heparanase
Source.5498: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi
Source.5499: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.5500: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.5501: DFBPPR18252 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.5502: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7
Source.5503: DFBPPR18254 ---- Animal proteins ---- C-type lectin domain family 6 member A
Source.5504: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.5505: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.5506: DFBPPR18262 ---- Animal proteins ---- Claudin-1
Source.5507: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.5508: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2
Source.5509: DFBPPR18268 ---- Animal proteins ---- Myoglobin
Source.5510: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI
Source.5511: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1
Source.5512: DFBPPR18275 ---- Animal proteins ---- Enoyl-CoA hydratase, mitochondrial
Source.5513: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.5514: DFBPPR18277 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.5515: DFBPPR18278 ---- Animal proteins ---- ATP synthase F(0) complex subunit B1, mitochondrial
Source.5516: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.5517: DFBPPR18285 ---- Animal proteins ---- ADP-ribose glycohydrolase OARD1
Source.5518: DFBPPR18286 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.5519: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56
Source.5520: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.5521: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.5522: DFBPPR18290 ---- Animal proteins ---- Cyclin-dependent kinase 10
Source.5523: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.5524: DFBPPR18292 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 11
Source.5525: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C
Source.5526: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein
Source.5527: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.5528: DFBPPR18297 ---- Animal proteins ---- Casein kinase I isoform beta
Source.5529: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase
Source.5530: DFBPPR18299 ---- Animal proteins ---- Synapsin-1
Source.5531: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.5532: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.5533: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.5534: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.5535: DFBPPR18307 ---- Animal proteins ---- Claudin-4
Source.5536: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain
Source.5537: DFBPPR18312 ---- Animal proteins ---- Interleukin-10
Source.5538: DFBPPR18313 ---- Animal proteins ---- Septin-12
Source.5539: DFBPPR18315 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.5540: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.5541: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.5542: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.5543: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.5544: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.5545: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase
Source.5546: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.5547: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.5548: DFBPPR18332 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.5549: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a
Source.5550: DFBPPR18334 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.5551: DFBPPR18335 ---- Animal proteins ---- Septin-11
Source.5552: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor
Source.5553: DFBPPR18339 ---- Animal proteins ---- SPARC
Source.5554: DFBPPR18340 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2
Source.5555: DFBPPR18343 ---- Animal proteins ---- Inositol polyphosphate 1-phosphatase
Source.5556: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.5557: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2
Source.5558: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.5559: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.5560: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.5561: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1
Source.5562: DFBPPR18353 ---- Animal proteins ---- Lactosylceramide alpha-2,3-sialyltransferase
Source.5563: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.5564: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase
Source.5565: DFBPPR18358 ---- Animal proteins ---- Lymphatic vessel endothelial hyaluronic acid receptor 1
Source.5566: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.5567: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3
Source.5568: DFBPPR18361 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.5569: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.5570: DFBPPR18364 ---- Animal proteins ---- Inhibitor of growth protein 4
Source.5571: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.5572: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2
Source.5573: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial
Source.5574: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.5575: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.5576: DFBPPR18371 ---- Animal proteins ---- F-actin-capping protein subunit beta
Source.5577: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.5578: DFBPPR18373 ---- Animal proteins ---- Cellular retinoic acid-binding protein 1
Source.5579: DFBPPR18375 ---- Animal proteins ---- Nucleoporin SEH1
Source.5580: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5
Source.5581: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.5582: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.5583: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.5584: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.5585: DFBPPR18388 ---- Animal proteins ---- Elongation factor Tu, mitochondrial
Source.5586: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.5587: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.5588: DFBPPR18391 ---- Animal proteins ---- Exosome complex component RRP43
Source.5589: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.5590: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.5591: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase
Source.5592: DFBPPR18397 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4
Source.5593: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6
Source.5594: DFBPPR18403 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.5595: DFBPPR18407 ---- Animal proteins ---- DNA damage-inducible transcript 4 protein
Source.5596: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor
Source.5597: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.5598: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.5599: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.5600: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.5601: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.5602: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.5603: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.5604: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.5605: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16
Source.5606: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin
Source.5607: DFBPPR18432 ---- Animal proteins ---- Vacuole membrane protein 1
Source.5608: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1
Source.5609: DFBPPR18437 ---- Animal proteins ---- Diamine acetyltransferase 1
Source.5610: DFBPPR18438 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.5611: DFBPPR18439 ---- Animal proteins ---- Retinol dehydrogenase 12
Source.5612: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.5613: DFBPPR18441 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial
Source.5614: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.5615: DFBPPR18443 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase
Source.5616: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.5617: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.5618: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.5619: DFBPPR18448 ---- Animal proteins ---- Septin-1
Source.5620: DFBPPR18449 ---- Animal proteins ---- Prepronociceptin
Source.5621: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.5622: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22
Source.5623: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.5624: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4
Source.5625: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.5626: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.5627: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.5628: DFBPPR18462 ---- Animal proteins ---- Serotonin N-acetyltransferase
Source.5629: DFBPPR18464 ---- Animal proteins ---- Regucalcin
Source.5630: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor
Source.5631: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial
Source.5632: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.5633: DFBPPR18471 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF113A
Source.5634: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1
Source.5635: DFBPPR18473 ---- Animal proteins ---- Sharpin
Source.5636: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.5637: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.5638: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1
Source.5639: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein
Source.5640: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.5641: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component
Source.5642: DFBPPR18480 ---- Animal proteins ---- Casein kinase I isoform gamma-3
Source.5643: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein
Source.5644: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1
Source.5645: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2
Source.5646: DFBPPR18484 ---- Animal proteins ---- Charged multivesicular body protein 3
Source.5647: DFBPPR18487 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.5648: DFBPPR18488 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.5649: DFBPPR18490 ---- Animal proteins ---- N-terminal Xaa-Pro-Lys N-methyltransferase 1
Source.5650: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein
Source.5651: DFBPPR18492 ---- Animal proteins ---- ADP-ribosylation factor-like protein 1
Source.5652: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.5653: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.5654: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase
Source.5655: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1
Source.5656: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.5657: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8
Source.5658: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.5659: DFBPPR18509 ---- Animal proteins ---- Hemoglobin fetal subunit beta
Source.5660: DFBPPR18510 ---- Animal proteins ---- Myogenic factor 5
Source.5661: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent
Source.5662: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.5663: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit
Source.5664: DFBPPR18516 ---- Animal proteins ---- Galactokinase
Source.5665: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.5666: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1
Source.5667: DFBPPR18524 ---- Animal proteins ---- Beta-defensin 5
Source.5668: DFBPPR18526 ---- Animal proteins ---- Beta-defensin 4
Source.5669: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.5670: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.5671: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin
Source.5672: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain
Source.5673: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain
Source.5674: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.5675: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.5676: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1
Source.5677: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.5678: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1
Source.5679: DFBPPR18543 ---- Animal proteins ---- Proproteinase E
Source.5680: DFBPPR18545 ---- Animal proteins ---- Transcriptional adapter 2-alpha
Source.5681: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu
Source.5682: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial
Source.5683: DFBPPR18549 ---- Animal proteins ---- Serum amyloid A protein
Source.5684: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.5685: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.5686: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.5687: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1
Source.5688: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.5689: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.5690: DFBPPR18558 ---- Animal proteins ---- Troponin T, cardiac muscle
Source.5691: DFBPPR18562 ---- Animal proteins ---- Neuronal calcium sensor 1
Source.5692: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4
Source.5693: DFBPPR18568 ---- Animal proteins ---- Cdc42 effector protein 2
Source.5694: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5
Source.5695: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.5696: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.5697: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.5698: DFBPPR18586 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoproteins A2/B1
Source.5699: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.5700: DFBPPR18589 ---- Animal proteins ---- Interleukin-13
Source.5701: DFBPPR18593 ---- Animal proteins ---- Pigment epithelium-derived factor
Source.5702: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.5703: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.5704: DFBPPR18600 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B
Source.5705: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2
Source.5706: DFBPPR18602 ---- Animal proteins ---- Aquaporin-3
Source.5707: DFBPPR18603 ---- Animal proteins ---- Sodium channel subunit beta-4
Source.5708: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.5709: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1
Source.5710: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.5711: DFBPPR18609 ---- Animal proteins ---- ERO1-like protein alpha
Source.5712: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.5713: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.5714: DFBPPR18612 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2
Source.5715: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial
Source.5716: DFBPPR18614 ---- Animal proteins ---- Beta-enolase
Source.5717: DFBPPR18616 ---- Animal proteins ---- Organic solute transporter subunit alpha
Source.5718: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta
Source.5719: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.5720: DFBPPR18621 ---- Animal proteins ---- Cytochrome b561
Source.5721: DFBPPR18626 ---- Animal proteins ---- Thymidylate synthase
Source.5722: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.5723: DFBPPR18630 ---- Animal proteins ---- Phosphoserine phosphatase
Source.5724: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.5725: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14
Source.5726: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.5727: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.5728: DFBPPR18641 ---- Animal proteins ---- Cadherin-5
Source.5729: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.5730: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1
Source.5731: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2
Source.5732: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1
Source.5733: DFBPPR18651 ---- Animal proteins ---- Allergen Bos d 2
Source.5734: DFBPPR18653 ---- Animal proteins ---- Palmitoyltransferase ZDHHC21
Source.5735: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.5736: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial
Source.5737: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.5738: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.5739: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase
Source.5740: DFBPPR18703 ---- Animal proteins ---- Thialysine N-epsilon-acetyltransferase
Source.5741: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.5742: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.5743: DFBPPR18707 ---- Animal proteins ---- Hepatoma-derived growth factor
Source.5744: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3
Source.5745: DFBPPR18710 ---- Animal proteins ---- Pyridoxine-5'-phosphate oxidase
Source.5746: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.5747: DFBPPR18713 ---- Animal proteins ---- Arginase-1
Source.5748: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4
Source.5749: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.5750: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor
Source.5751: DFBPPR18718 ---- Animal proteins ---- Chondroadherin
Source.5752: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.5753: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2
Source.5754: DFBPPR18724 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.5755: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor
Source.5756: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.5757: DFBPPR18732 ---- Animal proteins ---- RNA-binding protein 8A
Source.5758: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.5759: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.5760: DFBPPR18736 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.5761: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.5762: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7
Source.5763: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.5764: DFBPPR18746 ---- Animal proteins ---- Anamorsin
Source.5765: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1
Source.5766: DFBPPR18748 ---- Animal proteins ---- Ras-related protein Rab-4A
Source.5767: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.5768: DFBPPR18752 ---- Animal proteins ---- Serine/arginine-rich splicing factor 3
Source.5769: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.5770: DFBPPR18759 ---- Animal proteins ---- Neuronal-specific septin-3
Source.5771: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1
Source.5772: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.5773: DFBPPR18763 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.5774: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3
Source.5775: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50
Source.5776: DFBPPR18766 ---- Animal proteins ---- Negative elongation factor E
Source.5777: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.5778: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.5779: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9
Source.5780: DFBPPR18774 ---- Animal proteins ---- Testis-specific serine/threonine-protein kinase 1
Source.5781: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.5782: DFBPPR18778 ---- Animal proteins ---- Erlin-2
Source.5783: DFBPPR18779 ---- Animal proteins ---- Mucin-15
Source.5784: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.5785: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.5786: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.5787: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.5788: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav
Source.5789: DFBPPR18792 ---- Animal proteins ---- Integral membrane protein 2C
Source.5790: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba
Source.5791: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A
Source.5792: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.5793: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8
Source.5794: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.5795: DFBPPR18805 ---- Animal proteins ---- Nascent polypeptide-associated complex subunit alpha
Source.5796: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.5797: DFBPPR18807 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.5798: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.5799: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5
Source.5800: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.5801: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.5802: DFBPPR18815 ---- Animal proteins ---- Pantetheinase
Source.5803: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.5804: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.5805: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.5806: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2
Source.5807: DFBPPR18821 ---- Animal proteins ---- Diphosphomevalonate decarboxylase
Source.5808: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.5809: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6
Source.5810: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type
Source.5811: DFBPPR18832 ---- Animal proteins ---- Shiftless antiviral inhibitor of ribosomal frameshifting protein homolog
Source.5812: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1
Source.5813: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.5814: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.5815: DFBPPR18836 ---- Animal proteins ---- Calcitonin gene-related peptide type 1 receptor
Source.5816: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.5817: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma
Source.5818: DFBPPR18839 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 12
Source.5819: DFBPPR18841 ---- Animal proteins ---- PHD finger protein 6
Source.5820: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.5821: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.5822: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.5823: DFBPPR18849 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF3
Source.5824: DFBPPR18853 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor D
Source.5825: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin
Source.5826: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.5827: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.5828: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2
Source.5829: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase
Source.5830: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7
Source.5831: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain
Source.5832: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.5833: DFBPPR18869 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit beta
Source.5834: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.5835: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.5836: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.5837: DFBPPR18873 ---- Animal proteins ---- Proteasome subunit beta type-3
Source.5838: DFBPPR18874 ---- Animal proteins ---- Acyl-protein thioesterase 1
Source.5839: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.5840: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.5841: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.5842: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1
Source.5843: DFBPPR18884 ---- Animal proteins ---- Beta-defensin 3
Source.5844: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6
Source.5845: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.5846: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.5847: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase
Source.5848: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.5849: DFBPPR18904 ---- Animal proteins ---- Protein KASH5
Source.5850: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.5851: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless
Source.5852: DFBPPR18909 ---- Animal proteins ---- Enolase-phosphatase E1
Source.5853: DFBPPR18910 ---- Animal proteins ---- Aspartyl aminopeptidase
Source.5854: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.5855: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED
Source.5856: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.5857: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.5858: DFBPPR18917 ---- Animal proteins ---- CUGBP Elav-like family member 3
Source.5859: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.5860: DFBPPR18919 ---- Animal proteins ---- Dual specificity protein phosphatase 18
Source.5861: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b
Source.5862: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.5863: DFBPPR18926 ---- Animal proteins ---- Keratin, type I cytoskeletal 10
Source.5864: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.5865: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.5866: DFBPPR18931 ---- Animal proteins ---- Ficolin-2
Source.5867: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta
Source.5868: DFBPPR18936 ---- Animal proteins ---- S-methyl-5'-thioadenosine phosphorylase
Source.5869: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.5870: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13
Source.5871: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.5872: DFBPPR18942 ---- Animal proteins ---- Four and a half LIM domains protein 2
Source.5873: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2
Source.5874: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.5875: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.5876: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.5877: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3
Source.5878: DFBPPR18952 ---- Animal proteins ---- Serotransferrin
Source.5879: DFBPPR18955 ---- Animal proteins ---- Lymphotoxin-alpha
Source.5880: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase
Source.5881: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.5882: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A
Source.5883: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7
Source.5884: DFBPPR18966 ---- Animal proteins ---- Lupus La protein homolog
Source.5885: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1
Source.5886: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.5887: DFBPPR18975 ---- Animal proteins ---- Ribosome maturation protein SBDS
Source.5888: DFBPPR18976 ---- Animal proteins ---- Tumor suppressor candidate 3
Source.5889: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.5890: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.5891: DFBPPR18986 ---- Animal proteins ---- Granzyme A
Source.5892: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase
Source.5893: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.5894: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5
Source.5895: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6
Source.5896: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.5897: DFBPPR18998 ---- Animal proteins ---- E3 ubiquitin-protein ligase ZNRF1
Source.5898: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74
Source.5899: DFBPPR19000 ---- Animal proteins ---- Centrosomal protein of 57 kDa
Source.5900: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I
Source.5901: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter
Source.5902: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746
Source.5903: DFBPPR19006 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.5904: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1
Source.5905: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D
Source.5906: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2
Source.5907: DFBPPR19016 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.5908: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5
Source.5909: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.5910: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase
Source.5911: DFBPPR19023 ---- Animal proteins ---- Cellular nucleic acid-binding protein
Source.5912: DFBPPR19024 ---- Animal proteins ---- UDP-glucose 4-epimerase
Source.5913: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1
Source.5914: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3
Source.5915: DFBPPR19029 ---- Animal proteins ---- Homeobox protein Hox-B4
Source.5916: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D
Source.5917: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3
Source.5918: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.5919: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.5920: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.5921: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.5922: DFBPPR19039 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11A
Source.5923: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.5924: DFBPPR19042 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 2
Source.5925: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic
Source.5926: DFBPPR19045 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta
Source.5927: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.5928: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2
Source.5929: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.5930: DFBPPR19056 ---- Animal proteins ---- Gastrin
Source.5931: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.5932: DFBPPR19058 ---- Animal proteins ---- Phosphatidylserine decarboxylase proenzyme, mitochondrial
Source.5933: DFBPPR19059 ---- Animal proteins ---- Lysozyme C, non-stomach isozyme
Source.5934: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.5935: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta
Source.5936: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.5937: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.5938: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1
Source.5939: DFBPPR19069 ---- Animal proteins ---- Small glutamine-rich tetratricopeptide repeat-containing protein alpha
Source.5940: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5
Source.5941: DFBPPR19071 ---- Animal proteins ---- Collectrin
Source.5942: DFBPPR19080 ---- Animal proteins ---- Beta-defensin 11
Source.5943: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3
Source.5944: DFBPPR19082 ---- Animal proteins ---- Protein SCO2 homolog, mitochondrial
Source.5945: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.5946: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.5947: DFBPPR19091 ---- Animal proteins ---- Ribonuclease H2 subunit A
Source.5948: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13
Source.5949: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1
Source.5950: DFBPPR19095 ---- Animal proteins ---- Mitochondrial peptide methionine sulfoxide reductase
Source.5951: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1
Source.5952: DFBPPR19098 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 9
Source.5953: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.5954: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.5955: DFBPPR19109 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.5956: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B
Source.5957: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.5958: DFBPPR19112 ---- Animal proteins ---- Ubiquitin-like-conjugating enzyme ATG3
Source.5959: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2
Source.5960: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.5961: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.5962: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.5963: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.5964: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein
Source.5965: DFBPPR19126 ---- Animal proteins ---- Calpain small subunit 1
Source.5966: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1
Source.5967: DFBPPR19130 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-3 subunit
Source.5968: DFBPPR19132 ---- Animal proteins ---- DNA oxidative demethylase ALKBH2
Source.5969: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5
Source.5970: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.5971: DFBPPR19145 ---- Animal proteins ---- Pepsin A
Source.5972: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.5973: DFBPPR19150 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase H
Source.5974: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial
Source.5975: DFBPPR19153 ---- Animal proteins ---- Copine-6
Source.5976: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2
Source.5977: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase
Source.5978: DFBPPR19157 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator
Source.5979: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.5980: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14
Source.5981: DFBPPR19170 ---- Animal proteins ---- Isoaspartyl peptidase/L-asparaginase
Source.5982: DFBPPR19172 ---- Animal proteins ---- Persulfide dioxygenase ETHE1, mitochondrial
Source.5983: DFBPPR19181 ---- Animal proteins ---- Solute carrier family 25 member 33
Source.5984: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase
Source.5985: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.5986: DFBPPR19184 ---- Animal proteins ---- Alpha-soluble NSF attachment protein
Source.5987: DFBPPR19186 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.5988: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.5989: DFBPPR19188 ---- Animal proteins ---- Centromere protein S
Source.5990: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4
Source.5991: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma
Source.5992: DFBPPR19191 ---- Animal proteins ---- Protein unc-119 homolog A
Source.5993: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.5994: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2
Source.5995: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.5996: DFBPPR19197 ---- Animal proteins ---- Protein LSM14 homolog A
Source.5997: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5
Source.5998: DFBPPR19200 ---- Animal proteins ---- Beta-defensin 12
Source.5999: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial
Source.6000: DFBPPR19202 ---- Animal proteins ---- Zinc finger protein 639
Source.6001: DFBPPR19203 ---- Animal proteins ---- Mitochondrial inner membrane protease subunit 2
Source.6002: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7
Source.6003: DFBPPR19206 ---- Animal proteins ---- Protein chibby homolog 1
Source.6004: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7
Source.6005: DFBPPR19209 ---- Animal proteins ---- mRNA export factor
Source.6006: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2
Source.6007: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase
Source.6008: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.6009: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.6010: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.6011: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.6012: DFBPPR19224 ---- Animal proteins ---- Fetuin-B
Source.6013: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1
Source.6014: DFBPPR19229 ---- Animal proteins ---- Interferon alpha-F
Source.6015: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase
Source.6016: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A
Source.6017: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial
Source.6018: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.6019: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.6020: DFBPPR19242 ---- Animal proteins ---- Tryptophan 2,3-dioxygenase
Source.6021: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase
Source.6022: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.6023: DFBPPR19247 ---- Animal proteins ---- Calmegin
Source.6024: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.6025: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.6026: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.6027: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.6028: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.6029: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2
Source.6030: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3
Source.6031: DFBPPR19258 ---- Animal proteins ---- Cytochrome P450 3A28
Source.6032: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.6033: DFBPPR19260 ---- Animal proteins ---- rRNA N6-adenosine-methyltransferase ZCCHC4
Source.6034: DFBPPR19264 ---- Animal proteins ---- Claudin-16
Source.6035: DFBPPR19266 ---- Animal proteins ---- Ubiquitin/ISG15-conjugating enzyme E2 L6
Source.6036: DFBPPR19269 ---- Animal proteins ---- HCLS1-associated protein X-1
Source.6037: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2
Source.6038: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.6039: DFBPPR19277 ---- Animal proteins ---- Prolactin-releasing peptide
Source.6040: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33
Source.6041: DFBPPR19284 ---- Animal proteins ---- Protein lifeguard 2
Source.6042: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.6043: DFBPPR19286 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.6044: DFBPPR19287 ---- Animal proteins ---- Rab-like protein 3
Source.6045: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.6046: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1
Source.6047: DFBPPR19291 ---- Animal proteins ---- Multicilin
Source.6048: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.6049: DFBPPR19294 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I
Source.6050: DFBPPR19295 ---- Animal proteins ---- 26S proteasome regulatory subunit 7
Source.6051: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D
Source.6052: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.6053: DFBPPR19301 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF220
Source.6054: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12
Source.6055: DFBPPR19303 ---- Animal proteins ---- Microsomal glutathione S-transferase 1
Source.6056: DFBPPR19304 ---- Animal proteins ---- Retinal cone rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit gamma
Source.6057: DFBPPR19305 ---- Animal proteins ---- Beta-crystallin B3
Source.6058: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.6059: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8
Source.6060: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1
Source.6061: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1
Source.6062: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.6063: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3
Source.6064: DFBPPR19312 ---- Animal proteins ---- Copine-1
Source.6065: DFBPPR19313 ---- Animal proteins ---- Vitamin K epoxide reductase complex subunit 1
Source.6066: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.6067: DFBPPR19317 ---- Animal proteins ---- AP-1 complex subunit sigma-1A
Source.6068: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial
Source.6069: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.6070: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2
Source.6071: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.6072: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1
Source.6073: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2
Source.6074: DFBPPR19328 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 12
Source.6075: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85
Source.6076: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.6077: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase
Source.6078: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1
Source.6079: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.6080: DFBPPR19339 ---- Animal proteins ---- Peroxiredoxin-4
Source.6081: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.6082: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.6083: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.6084: DFBPPR19348 ---- Animal proteins ---- Twinfilin-1
Source.6085: DFBPPR19349 ---- Animal proteins ---- Zinc transporter 3
Source.6086: DFBPPR19350 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.6087: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.6088: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.6089: DFBPPR19361 ---- Animal proteins ---- Retinol dehydrogenase 14
Source.6090: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1
Source.6091: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.6092: DFBPPR19368 ---- Animal proteins ---- Prion-like protein doppel
Source.6093: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog
Source.6094: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.6095: DFBPPR19371 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 1
Source.6096: DFBPPR19372 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.6097: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.6098: DFBPPR19374 ---- Animal proteins ---- Protein FAM92A
Source.6099: DFBPPR19375 ---- Animal proteins ---- ATPase family AAA domain-containing protein 1
Source.6100: DFBPPR19376 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, testis-specific
Source.6101: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.6102: DFBPPR19380 ---- Animal proteins ---- Proteasome subunit alpha type-3
Source.6103: DFBPPR19381 ---- Animal proteins ---- BRCA2 and CDKN1A-interacting protein
Source.6104: DFBPPR19384 ---- Animal proteins ---- Complement component C9
Source.6105: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2
Source.6106: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.6107: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein
Source.6108: DFBPPR19401 ---- Animal proteins ---- Small integral membrane protein 20
Source.6109: DFBPPR19402 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.6110: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.6111: DFBPPR19404 ---- Animal proteins ---- Microfibril-associated glycoprotein 4
Source.6112: DFBPPR19406 ---- Animal proteins ---- [3-methyl-2-oxobutanoate dehydrogenase [lipoamide]] kinase, mitochondrial
Source.6113: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein
Source.6114: DFBPPR19409 ---- Animal proteins ---- Hyaluronan-binding protein 2
Source.6115: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F
Source.6116: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.6117: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1
Source.6118: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.6119: DFBPPR19416 ---- Animal proteins ---- Gamma-glutamyl hydrolase
Source.6120: DFBPPR19418 ---- Animal proteins ---- Pterin-4-alpha-carbinolamine dehydratase
Source.6121: DFBPPR19419 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.6122: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1
Source.6123: DFBPPR19422 ---- Animal proteins ---- Syntaxin-19
Source.6124: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.6125: DFBPPR19425 ---- Animal proteins ---- Microfibrillar-associated protein 5
Source.6126: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF
Source.6127: DFBPPR19428 ---- Animal proteins ---- CAAX prenyl protease 2
Source.6128: DFBPPR19431 ---- Animal proteins ---- Aminoacyl tRNA synthase complex-interacting multifunctional protein 2
Source.6129: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71
Source.6130: DFBPPR19442 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit G
Source.6131: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.6132: DFBPPR19445 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.6133: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.6134: DFBPPR19450 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J
Source.6135: DFBPPR19451 ---- Animal proteins ---- Proline/serine-rich coiled-coil protein 1
Source.6136: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.6137: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.6138: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.6139: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.6140: DFBPPR19460 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase NIMA-interacting 4
Source.6141: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.6142: DFBPPR19463 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide VF
Source.6143: DFBPPR19465 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.6144: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.6145: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137
Source.6146: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.6147: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.6148: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.6149: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.6150: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.6151: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.6152: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.6153: DFBPPR19482 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.6154: DFBPPR19485 ---- Animal proteins ---- Fibroblast growth factor 5
Source.6155: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1
Source.6156: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.6157: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.6158: DFBPPR19496 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.6159: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73
Source.6160: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.6161: DFBPPR19501 ---- Animal proteins ---- CD320 antigen
Source.6162: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72
Source.6163: DFBPPR19507 ---- Animal proteins ---- Glutathione synthetase
Source.6164: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase
Source.6165: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.6166: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.6167: DFBPPR19514 ---- Animal proteins ---- tRNA (cytosine(38)-C(5))-methyltransferase
Source.6168: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.6169: DFBPPR19516 ---- Animal proteins ---- Protein phosphatase 1L
Source.6170: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.6171: DFBPPR19521 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 12
Source.6172: DFBPPR19525 ---- Animal proteins ---- Tomoregulin-2
Source.6173: DFBPPR19526 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase E
Source.6174: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.6175: DFBPPR19529 ---- Animal proteins ---- Cbp/p300-interacting transactivator 1
Source.6176: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.6177: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase
Source.6178: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.6179: DFBPPR19538 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial
Source.6180: DFBPPR19540 ---- Animal proteins ---- Beta-defensin 6
Source.6181: DFBPPR19542 ---- Animal proteins ---- Phosphomannomutase 2
Source.6182: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.6183: DFBPPR19544 ---- Animal proteins ---- Marginal zone B- and B1-cell-specific protein
Source.6184: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase
Source.6185: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3
Source.6186: DFBPPR19548 ---- Animal proteins ---- Reticulophagy regulator 1
Source.6187: DFBPPR19549 ---- Animal proteins ---- Mitochondrial RNA pseudouridine synthase RPUSD4
Source.6188: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.6189: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2
Source.6190: DFBPPR19554 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.6191: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9
Source.6192: DFBPPR19559 ---- Animal proteins ---- CCN family member 2
Source.6193: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.6194: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.6195: DFBPPR19565 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 4
Source.6196: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.6197: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.6198: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.6199: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.6200: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.6201: DFBPPR19575 ---- Animal proteins ---- Acylphosphatase-2
Source.6202: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20
Source.6203: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.6204: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial
Source.6205: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.6206: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2
Source.6207: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.6208: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1
Source.6209: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C
Source.6210: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2
Source.6211: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1
Source.6212: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.6213: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin
Source.6214: DFBPPR19597 ---- Animal proteins ---- Protein HEXIM1
Source.6215: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4
Source.6216: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.6217: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.6218: DFBPPR19607 ---- Animal proteins ---- Obg-like ATPase 1
Source.6219: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.6220: DFBPPR19610 ---- Animal proteins ---- RING finger protein 11
Source.6221: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase
Source.6222: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.6223: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5
Source.6224: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.6225: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS
Source.6226: DFBPPR19618 ---- Animal proteins ---- TCF3 fusion partner homolog
Source.6227: DFBPPR19621 ---- Animal proteins ---- Aspartoacylase
Source.6228: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1
Source.6229: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5
Source.6230: DFBPPR19629 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide FF
Source.6231: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.6232: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase
Source.6233: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.6234: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.6235: DFBPPR19645 ---- Animal proteins ---- Barrier-to-autointegration factor
Source.6236: DFBPPR19646 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit beta, mitochondrial
Source.6237: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4
Source.6238: DFBPPR19648 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit
Source.6239: DFBPPR19649 ---- Animal proteins ---- Proteasome subunit alpha type-4
Source.6240: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.6241: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase
Source.6242: DFBPPR19656 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.6243: DFBPPR19657 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.6244: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.6245: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.6246: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator
Source.6247: DFBPPR19668 ---- Animal proteins ---- Calicin
Source.6248: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.6249: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.6250: DFBPPR19674 ---- Animal proteins ---- Nuclear transport factor 2
Source.6251: DFBPPR19676 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.6252: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3
Source.6253: DFBPPR19678 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 5
Source.6254: DFBPPR19680 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.6255: DFBPPR19681 ---- Animal proteins ---- Fibroleukin
Source.6256: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2
Source.6257: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor
Source.6258: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.6259: DFBPPR19687 ---- Animal proteins ---- Cytochrome b ascorbate-dependent protein 3
Source.6260: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.6261: DFBPPR19689 ---- Animal proteins ---- Ecto-ADP-ribosyltransferase 5
Source.6262: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.6263: DFBPPR19694 ---- Animal proteins ---- Palmitoyltransferase ZDHHC4
Source.6264: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.6265: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1
Source.6266: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3
Source.6267: DFBPPR19702 ---- Animal proteins ---- Placental prolactin-related protein 4
Source.6268: DFBPPR19703 ---- Animal proteins ---- Claudin-10
Source.6269: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.6270: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.6271: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.6272: DFBPPR19711 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 2
Source.6273: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205
Source.6274: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17
Source.6275: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4
Source.6276: DFBPPR19722 ---- Animal proteins ---- Cdc42 effector protein 1
Source.6277: DFBPPR19723 ---- Animal proteins ---- Spindle and kinetochore-associated protein 3
Source.6278: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B
Source.6279: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.6280: DFBPPR19732 ---- Animal proteins ---- Proteasome subunit alpha type-2
Source.6281: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.6282: DFBPPR19737 ---- Animal proteins ---- Proteasome subunit alpha type-5
Source.6283: DFBPPR19738 ---- Animal proteins ---- Translocator protein
Source.6284: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1
Source.6285: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase
Source.6286: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.6287: DFBPPR19752 ---- Animal proteins ---- Chromatin target of PRMT1 protein
Source.6288: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2
Source.6289: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase
Source.6290: DFBPPR19758 ---- Animal proteins ---- MICOS complex subunit MIC25
Source.6291: DFBPPR19760 ---- Animal proteins ---- Protein phosphatase 1K, mitochondrial
Source.6292: DFBPPR19761 ---- Animal proteins ---- N-chimaerin
Source.6293: DFBPPR19763 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.6294: DFBPPR19764 ---- Animal proteins ---- Bcl-2-like protein 2
Source.6295: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1
Source.6296: DFBPPR19769 ---- Animal proteins ---- Septin-14
Source.6297: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13
Source.6298: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.6299: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.6300: DFBPPR19777 ---- Animal proteins ---- Translin
Source.6301: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.6302: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma
Source.6303: DFBPPR19781 ---- Animal proteins ---- Secretory carrier-associated membrane protein 5
Source.6304: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A
Source.6305: DFBPPR19786 ---- Animal proteins ---- Chorionic somatomammotropin hormone 1
Source.6306: DFBPPR19787 ---- Animal proteins ---- 60S ribosomal protein L11
Source.6307: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.6308: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4
Source.6309: DFBPPR19791 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif protein 1
Source.6310: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4
Source.6311: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3
Source.6312: DFBPPR19803 ---- Animal proteins ---- Zinc phosphodiesterase ELAC protein 1
Source.6313: DFBPPR19807 ---- Animal proteins ---- Spermine synthase
Source.6314: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2
Source.6315: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.6316: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L
Source.6317: DFBPPR19812 ---- Animal proteins ---- Probable inactive serine protease 37
Source.6318: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma
Source.6319: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2
Source.6320: DFBPPR19815 ---- Animal proteins ---- V-type proton ATPase subunit E 1
Source.6321: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.6322: DFBPPR19818 ---- Animal proteins ---- Protein YIPF6
Source.6323: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.6324: DFBPPR19820 ---- Animal proteins ---- Septin-10
Source.6325: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.6326: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.6327: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.6328: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial
Source.6329: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.6330: DFBPPR19828 ---- Animal proteins ---- Transmembrane protein 14C
Source.6331: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.6332: DFBPPR19830 ---- Animal proteins ---- Sesquipedalian-2
Source.6333: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3
Source.6334: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.6335: DFBPPR19834 ---- Animal proteins ---- Harmonin
Source.6336: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2
Source.6337: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.6338: DFBPPR19837 ---- Animal proteins ---- Ribonuclease P protein subunit p30
Source.6339: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.6340: DFBPPR19839 ---- Animal proteins ---- Protein Mdm4
Source.6341: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial
Source.6342: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial
Source.6343: DFBPPR19844 ---- Animal proteins ---- Prosalusin
Source.6344: DFBPPR19845 ---- Animal proteins ---- Beta-soluble NSF attachment protein
Source.6345: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial
Source.6346: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.6347: DFBPPR19851 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.6348: DFBPPR19852 ---- Animal proteins ---- Transmembrane and immunoglobulin domain-containing protein 1
Source.6349: DFBPPR19855 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.6350: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1
Source.6351: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2
Source.6352: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2
Source.6353: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.6354: DFBPPR19864 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B
Source.6355: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.6356: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.6357: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.6358: DFBPPR19869 ---- Animal proteins ---- Beta-defensin 13
Source.6359: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.6360: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.6361: DFBPPR19874 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor B
Source.6362: DFBPPR19875 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 26A
Source.6363: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.6364: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14
Source.6365: DFBPPR19880 ---- Animal proteins ---- TATA box-binding protein-like 1
Source.6366: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.6367: DFBPPR19882 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.6368: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.6369: DFBPPR19884 ---- Animal proteins ---- Activator of basal transcription 1
Source.6370: DFBPPR19885 ---- Animal proteins ---- Cytochrome c 2
Source.6371: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta
Source.6372: DFBPPR19894 ---- Animal proteins ---- Reactive oxygen species modulator 1
Source.6373: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60
Source.6374: DFBPPR19897 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial
Source.6375: DFBPPR19898 ---- Animal proteins ---- Essential MCU regulator, mitochondrial
Source.6376: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6
Source.6377: DFBPPR19900 ---- Animal proteins ---- C-type natriuretic peptide
Source.6378: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic
Source.6379: DFBPPR19902 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.6380: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27
Source.6381: DFBPPR19905 ---- Animal proteins ---- Complement component C6
Source.6382: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.6383: DFBPPR19911 ---- Animal proteins ---- Guided entry of tail-anchored proteins factor 1
Source.6384: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial
Source.6385: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.6386: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.6387: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.6388: DFBPPR19920 ---- Animal proteins ---- Proteasome subunit alpha type-7
Source.6389: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.6390: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.6391: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.6392: DFBPPR19928 ---- Animal proteins ---- Interferon beta-1
Source.6393: DFBPPR19929 ---- Animal proteins ---- Ermin
Source.6394: DFBPPR19935 ---- Animal proteins ---- Reticulon-3
Source.6395: DFBPPR19937 ---- Animal proteins ---- Prostamide/prostaglandin F synthase
Source.6396: DFBPPR19938 ---- Animal proteins ---- Serine/threonine-protein phosphatase CPPED1
Source.6397: DFBPPR19940 ---- Animal proteins ---- Keratin, type II cytoskeletal 78
Source.6398: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7
Source.6399: DFBPPR19942 ---- Animal proteins ---- AP-1 complex subunit sigma-2
Source.6400: DFBPPR19945 ---- Animal proteins ---- Protein maelstrom homolog
Source.6401: DFBPPR19948 ---- Animal proteins ---- Tensin-4
Source.6402: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial
Source.6403: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2
Source.6404: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1
Source.6405: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.6406: DFBPPR19955 ---- Animal proteins ---- Hemoglobin subunit epsilon-2
Source.6407: DFBPPR19958 ---- Animal proteins ---- 60S ribosomal protein L10
Source.6408: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter
Source.6409: DFBPPR19962 ---- Animal proteins ---- Troponin T, slow skeletal muscle
Source.6410: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14
Source.6411: DFBPPR19964 ---- Animal proteins ---- MKI67 FHA domain-interacting nucleolar phosphoprotein
Source.6412: DFBPPR19968 ---- Animal proteins ---- Hemoglobin subunit epsilon-4
Source.6413: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z
Source.6414: DFBPPR19974 ---- Animal proteins ---- Prolactin-releasing peptide receptor
Source.6415: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.6416: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.6417: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.6418: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1
Source.6419: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.6420: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7
Source.6421: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2
Source.6422: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein
Source.6423: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.6424: DFBPPR19990 ---- Animal proteins ---- Synaptonemal complex protein 3
Source.6425: DFBPPR19994 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.6426: DFBPPR19996 ---- Animal proteins ---- Interleukin-3
Source.6427: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1
Source.6428: DFBPPR20000 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7C
Source.6429: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase
Source.6430: DFBPPR20002 ---- Animal proteins ---- Regulator of microtubule dynamics protein 2
Source.6431: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.6432: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit
Source.6433: DFBPPR20012 ---- Animal proteins ---- Zinc transporter ZIP12
Source.6434: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.6435: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.6436: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7
Source.6437: DFBPPR20017 ---- Animal proteins ---- Lysoplasmalogenase
Source.6438: DFBPPR20020 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.6439: DFBPPR20022 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.6440: DFBPPR20023 ---- Animal proteins ---- Cysteine and glycine-rich protein 2
Source.6441: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.6442: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7
Source.6443: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12
Source.6444: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.6445: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.6446: DFBPPR20030 ---- Animal proteins ---- Calumenin
Source.6447: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4
Source.6448: DFBPPR20032 ---- Animal proteins ---- Annexin A9
Source.6449: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.6450: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta
Source.6451: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.6452: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase
Source.6453: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1
Source.6454: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1
Source.6455: DFBPPR20044 ---- Animal proteins ---- Secernin-1
Source.6456: DFBPPR20047 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 11B
Source.6457: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.6458: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase
Source.6459: DFBPPR20053 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.6460: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.6461: DFBPPR20060 ---- Animal proteins ---- Fibulin-5
Source.6462: DFBPPR20063 ---- Animal proteins ---- Histone H2B subacrosomal variant
Source.6463: DFBPPR20065 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3
Source.6464: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein
Source.6465: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.6466: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4
Source.6467: DFBPPR20072 ---- Animal proteins ---- Adenine phosphoribosyltransferase
Source.6468: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase
Source.6469: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.6470: DFBPPR20078 ---- Animal proteins ---- Ragulator complex protein LAMTOR2
Source.6471: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.6472: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47
Source.6473: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.6474: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.6475: DFBPPR20091 ---- Animal proteins ---- Carboxypeptidase O
Source.6476: DFBPPR20092 ---- Animal proteins ---- Peptidyl-tRNA hydrolase 2, mitochondrial
Source.6477: DFBPPR20093 ---- Animal proteins ---- Natural cytotoxicity triggering receptor 1
Source.6478: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.6479: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6
Source.6480: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1
Source.6481: DFBPPR20098 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B
Source.6482: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.6483: DFBPPR20102 ---- Animal proteins ---- Cylicin-2
Source.6484: DFBPPR20103 ---- Animal proteins ---- Protein MAL2
Source.6485: DFBPPR20105 ---- Animal proteins ---- Poly(U)-specific endoribonuclease
Source.6486: DFBPPR20107 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial
Source.6487: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.6488: DFBPPR20112 ---- Animal proteins ---- Proteasome assembly chaperone 1
Source.6489: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2
Source.6490: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.6491: DFBPPR20126 ---- Animal proteins ---- 39S ribosomal protein L44, mitochondrial
Source.6492: DFBPPR20128 ---- Animal proteins ---- PHD finger protein 23
Source.6493: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase
Source.6494: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.6495: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.6496: DFBPPR20139 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm4
Source.6497: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.6498: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1
Source.6499: DFBPPR20148 ---- Animal proteins ---- Integrin-linked kinase-associated serine/threonine phosphatase 2C
Source.6500: DFBPPR20149 ---- Animal proteins ---- Flotillin-2
Source.6501: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a
Source.6502: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.6503: DFBPPR20154 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 6, mitochondrial
Source.6504: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9
Source.6505: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.6506: DFBPPR20161 ---- Animal proteins ---- Calponin-2
Source.6507: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog
Source.6508: DFBPPR20167 ---- Animal proteins ---- Protein BANP
Source.6509: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1
Source.6510: DFBPPR20170 ---- Animal proteins ---- EEF1A lysine methyltransferase 4
Source.6511: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1
Source.6512: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.6513: DFBPPR20176 ---- Animal proteins ---- Wiskott-Aldrich syndrome protein family member 2
Source.6514: DFBPPR20178 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.6515: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.6516: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.6517: DFBPPR20182 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.6518: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7
Source.6519: DFBPPR20189 ---- Animal proteins ---- Protein disulfide isomerase CRELD2
Source.6520: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.6521: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.6522: DFBPPR20195 ---- Animal proteins ---- GSK3B-interacting protein
Source.6523: DFBPPR20197 ---- Animal proteins ---- Ribonuclease P protein subunit p20
Source.6524: DFBPPR20199 ---- Animal proteins ---- Claudin-7
Source.6525: DFBPPR20201 ---- Animal proteins ---- PDZ and LIM domain protein 7
Source.6526: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial
Source.6527: DFBPPR20203 ---- Animal proteins ---- Calcitonin
Source.6528: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial
Source.6529: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.6530: DFBPPR20208 ---- Animal proteins ---- Myeloid leukemia factor 1
Source.6531: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B
Source.6532: DFBPPR20213 ---- Animal proteins ---- Coiled-coil domain-containing protein 115
Source.6533: DFBPPR20214 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.6534: DFBPPR20215 ---- Animal proteins ---- Caspase-3
Source.6535: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12
Source.6536: DFBPPR20223 ---- Animal proteins ---- Protein cereblon
Source.6537: DFBPPR20224 ---- Animal proteins ---- Sclerostin
Source.6538: DFBPPR20226 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.6539: DFBPPR20227 ---- Animal proteins ---- 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline decarboxylase
Source.6540: DFBPPR20228 ---- Animal proteins ---- Keratin, type II cytoskeletal 7
Source.6541: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase
Source.6542: DFBPPR20231 ---- Animal proteins ---- Dynein light chain 2, cytoplasmic
Source.6543: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2
Source.6544: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase
Source.6545: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3
Source.6546: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1
Source.6547: DFBPPR20240 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.6548: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.6549: DFBPPR20245 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial
Source.6550: DFBPPR20247 ---- Animal proteins ---- Claudin-15
Source.6551: DFBPPR20248 ---- Animal proteins ---- Ras-related protein Rab-28
Source.6552: DFBPPR20252 ---- Animal proteins ---- Myosin regulatory light chain 2, ventricular/cardiac muscle isoform
Source.6553: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A
Source.6554: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2
Source.6555: DFBPPR20256 ---- Animal proteins ---- Leukocyte surface antigen CD53
Source.6556: DFBPPR20257 ---- Animal proteins ---- Targeting protein for Xklp2
Source.6557: DFBPPR20258 ---- Animal proteins ---- Ribosome biogenesis regulatory protein homolog
Source.6558: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1
Source.6559: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79
Source.6560: DFBPPR20261 ---- Animal proteins ---- Protein SCO1 homolog, mitochondrial
Source.6561: DFBPPR20263 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 54
Source.6562: DFBPPR20266 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB7
Source.6563: DFBPPR20269 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor
Source.6564: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.6565: DFBPPR20271 ---- Animal proteins ---- EEF1A lysine methyltransferase 3
Source.6566: DFBPPR20273 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT14
Source.6567: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.6568: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1
Source.6569: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.6570: DFBPPR20278 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 6
Source.6571: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.6572: DFBPPR20282 ---- Animal proteins ---- SOSS complex subunit B2
Source.6573: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.6574: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.6575: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.6576: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN
Source.6577: DFBPPR20296 ---- Animal proteins ---- Claudin-18
Source.6578: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.6579: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator
Source.6580: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3
Source.6581: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial
Source.6582: DFBPPR20305 ---- Animal proteins ---- Nostrin
Source.6583: DFBPPR20307 ---- Animal proteins ---- Ras-related protein Rab-6B
Source.6584: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.6585: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2
Source.6586: DFBPPR20314 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC3
Source.6587: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial
Source.6588: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2
Source.6589: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.6590: DFBPPR20328 ---- Animal proteins ---- 40S ribosomal protein S23
Source.6591: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.6592: DFBPPR20332 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.6593: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14
Source.6594: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.6595: DFBPPR20336 ---- Animal proteins ---- 39S ribosomal protein L22, mitochondrial
Source.6596: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.6597: DFBPPR20340 ---- Animal proteins ---- Peripherin
Source.6598: DFBPPR20341 ---- Animal proteins ---- Peptide YY
Source.6599: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1
Source.6600: DFBPPR20344 ---- Animal proteins ---- Dynactin subunit 2
Source.6601: DFBPPR20345 ---- Animal proteins ---- DnaJ homolog subfamily B member 14
Source.6602: DFBPPR20346 ---- Animal proteins ---- Serpin B6
Source.6603: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.6604: DFBPPR20350 ---- Animal proteins ---- Pinin
Source.6605: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2
Source.6606: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.6607: DFBPPR20353 ---- Animal proteins ---- Protein mago nashi homolog 2
Source.6608: DFBPPR20354 ---- Animal proteins ---- Single-strand selective monofunctional uracil DNA glycosylase
Source.6609: DFBPPR20356 ---- Animal proteins ---- RNA-binding protein 7
Source.6610: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.6611: DFBPPR20364 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3
Source.6612: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein
Source.6613: DFBPPR20371 ---- Animal proteins ---- Vesicle-associated membrane protein 4
Source.6614: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56
Source.6615: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.6616: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.6617: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha
Source.6618: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog
Source.6619: DFBPPR20383 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 7, mitochondrial
Source.6620: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6
Source.6621: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.6622: DFBPPR20386 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59
Source.6623: DFBPPR20388 ---- Animal proteins ---- SOSS complex subunit C
Source.6624: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.6625: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.6626: DFBPPR20395 ---- Animal proteins ---- GDP-fucose transporter 1
Source.6627: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.6628: DFBPPR20402 ---- Animal proteins ---- tRNA-specific adenosine deaminase 2
Source.6629: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.6630: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.6631: DFBPPR20408 ---- Animal proteins ---- Phospholipid scramblase 2
Source.6632: DFBPPR20409 ---- Animal proteins ---- DNA damage-regulated autophagy modulator protein 2
Source.6633: DFBPPR20411 ---- Animal proteins ---- Transmembrane protein 106A
Source.6634: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.6635: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.6636: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor
Source.6637: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.6638: DFBPPR20422 ---- Animal proteins ---- WD repeat-containing protein 61
Source.6639: DFBPPR20424 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF170
Source.6640: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.6641: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein
Source.6642: DFBPPR20428 ---- Animal proteins ---- Rab effector Noc2
Source.6643: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase
Source.6644: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog
Source.6645: DFBPPR20431 ---- Animal proteins ---- Cell division cycle protein 27 homolog
Source.6646: DFBPPR20432 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 4
Source.6647: DFBPPR20435 ---- Animal proteins ---- Leucine-rich glioma-inactivated protein 1
Source.6648: DFBPPR20436 ---- Animal proteins ---- Beta-defensin 2
Source.6649: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5
Source.6650: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.6651: DFBPPR20440 ---- Animal proteins ---- 28S ribosomal protein S25, mitochondrial
Source.6652: DFBPPR20444 ---- Animal proteins ---- Ribonuclease P/MRP protein subunit POP5
Source.6653: DFBPPR20447 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 1
Source.6654: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4
Source.6655: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.6656: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3
Source.6657: DFBPPR20453 ---- Animal proteins ---- Cysteine dioxygenase type 1
Source.6658: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2
Source.6659: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8
Source.6660: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.6661: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1
Source.6662: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1
Source.6663: DFBPPR20463 ---- Animal proteins ---- Transmembrane protein 79
Source.6664: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C
Source.6665: DFBPPR20466 ---- Animal proteins ---- Ribonuclease P protein subunit p38
Source.6666: DFBPPR20468 ---- Animal proteins ---- 28S ribosomal protein S28, mitochondrial
Source.6667: DFBPPR20470 ---- Animal proteins ---- Orexigenic neuropeptide QRFP
Source.6668: DFBPPR20471 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.6669: DFBPPR20473 ---- Animal proteins ---- Evolutionarily conserved signaling intermediate in Toll pathway, mitochondrial
Source.6670: DFBPPR20474 ---- Animal proteins ---- Cysteine and glycine-rich protein 1
Source.6671: DFBPPR20476 ---- Animal proteins ---- Translocon-associated protein subunit beta
Source.6672: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.6673: DFBPPR20478 ---- Animal proteins ---- Macoilin
Source.6674: DFBPPR20480 ---- Animal proteins ---- Protein S100-A14
Source.6675: DFBPPR20481 ---- Animal proteins ---- Ropporin-1
Source.6676: DFBPPR20482 ---- Animal proteins ---- Tripartite motif-containing protein 54
Source.6677: DFBPPR20483 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 1
Source.6678: DFBPPR20485 ---- Animal proteins ---- Beta-crystallin A2
Source.6679: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase
Source.6680: DFBPPR20489 ---- Animal proteins ---- Translocon-associated protein subunit alpha
Source.6681: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.6682: DFBPPR20491 ---- Animal proteins ---- Beta-sarcoglycan
Source.6683: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.6684: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.6685: DFBPPR20494 ---- Animal proteins ---- Protein mago nashi homolog
Source.6686: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2
Source.6687: DFBPPR20501 ---- Animal proteins ---- 28S ribosomal protein S2, mitochondrial
Source.6688: DFBPPR20506 ---- Animal proteins ---- Akirin-2
Source.6689: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.6690: DFBPPR20509 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase II inhibitor 1
Source.6691: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.6692: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29
Source.6693: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial
Source.6694: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42
Source.6695: DFBPPR20519 ---- Animal proteins ---- Spermatogenesis-associated protein 6
Source.6696: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.6697: DFBPPR20524 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A
Source.6698: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.6699: DFBPPR20528 ---- Animal proteins ---- Thiamin pyrophosphokinase 1
Source.6700: DFBPPR20531 ---- Animal proteins ---- Myozenin-2
Source.6701: DFBPPR20532 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.6702: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.6703: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.6704: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.6705: DFBPPR20538 ---- Animal proteins ---- Signal peptidase complex subunit 3
Source.6706: DFBPPR20540 ---- Animal proteins ---- Structure-specific endonuclease subunit SLX1
Source.6707: DFBPPR20541 ---- Animal proteins ---- Lambda-crystallin homolog
Source.6708: DFBPPR20542 ---- Animal proteins ---- ADP-ribosylation factor 2
Source.6709: DFBPPR20544 ---- Animal proteins ---- 28S ribosomal protein S34, mitochondrial
Source.6710: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.6711: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.6712: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.6713: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4
Source.6714: DFBPPR20556 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.6715: DFBPPR20557 ---- Animal proteins ---- Asporin
Source.6716: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial
Source.6717: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.6718: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1
Source.6719: DFBPPR20567 ---- Animal proteins ---- Prokineticin-2
Source.6720: DFBPPR20568 ---- Animal proteins ---- Phenazine biosynthesis-like domain-containing protein
Source.6721: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.6722: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.6723: DFBPPR20574 ---- Animal proteins ---- Transmembrane protein 201
Source.6724: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.6725: DFBPPR20577 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor-interacting protein
Source.6726: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3
Source.6727: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.6728: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein
Source.6729: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.6730: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi
Source.6731: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16
Source.6732: DFBPPR20595 ---- Animal proteins ---- LHFPL tetraspan subfamily member 4 protein
Source.6733: DFBPPR20598 ---- Animal proteins ---- Oncostatin-M
Source.6734: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.6735: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1
Source.6736: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6
Source.6737: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2
Source.6738: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.6739: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.6740: DFBPPR20607 ---- Animal proteins ---- Spliceosome-associated protein CWC27 homolog
Source.6741: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.6742: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10
Source.6743: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.6744: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2
Source.6745: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.6746: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase
Source.6747: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.6748: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.6749: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2
Source.6750: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1
Source.6751: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5
Source.6752: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2
Source.6753: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.6754: DFBPPR20627 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.6755: DFBPPR20628 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase C
Source.6756: DFBPPR20633 ---- Animal proteins ---- Transmembrane protein 47
Source.6757: DFBPPR20634 ---- Animal proteins ---- GDNF family receptor alpha-2
Source.6758: DFBPPR20637 ---- Animal proteins ---- Mitochondrial mRNA pseudouridine synthase RPUSD3
Source.6759: DFBPPR20639 ---- Animal proteins ---- NmrA-like family domain-containing protein 1
Source.6760: DFBPPR20642 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX52
Source.6761: DFBPPR20643 ---- Animal proteins ---- Fibrinogen-like protein 1
Source.6762: DFBPPR20647 ---- Animal proteins ---- Annexin A8
Source.6763: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91
Source.6764: DFBPPR20652 ---- Animal proteins ---- HAUS augmin-like complex subunit 1
Source.6765: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.6766: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein
Source.6767: DFBPPR20656 ---- Animal proteins ---- Protein archease
Source.6768: DFBPPR20657 ---- Animal proteins ---- Anaphase-promoting complex subunit CDC26
Source.6769: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.6770: DFBPPR20659 ---- Animal proteins ---- Cystinosin
Source.6771: DFBPPR20660 ---- Animal proteins ---- ADP-ribosylation factor 3
Source.6772: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.6773: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain
Source.6774: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein
Source.6775: DFBPPR20669 ---- Animal proteins ---- D site-binding protein
Source.6776: DFBPPR20671 ---- Animal proteins ---- 39S ribosomal protein L27, mitochondrial
Source.6777: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.6778: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease
Source.6779: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14
Source.6780: DFBPPR20679 ---- Animal proteins ---- Ragulator complex protein LAMTOR4
Source.6781: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.6782: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.6783: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.6784: DFBPPR20687 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX19
Source.6785: DFBPPR20690 ---- Animal proteins ---- Neurotrimin
Source.6786: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11
Source.6787: DFBPPR20692 ---- Animal proteins ---- ELMO domain-containing protein 3
Source.6788: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12
Source.6789: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11
Source.6790: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial
Source.6791: DFBPPR20702 ---- Animal proteins ---- 5-azacytidine-induced protein 2
Source.6792: DFBPPR20705 ---- Animal proteins ---- Anaphase-promoting complex subunit 10
Source.6793: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1
Source.6794: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.6795: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.6796: DFBPPR20711 ---- Animal proteins ---- Transcription elongation factor, mitochondrial
Source.6797: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.6798: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2
Source.6799: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3
Source.6800: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase
Source.6801: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1
Source.6802: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21
Source.6803: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial
Source.6804: DFBPPR20724 ---- Animal proteins ---- Exportin-2
Source.6805: DFBPPR20725 ---- Animal proteins ---- RBPJ-interacting and tubulin-associated protein 1
Source.6806: DFBPPR20726 ---- Animal proteins ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.6807: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.6808: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2
Source.6809: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11
Source.6810: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.6811: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial
Source.6812: DFBPPR20739 ---- Animal proteins ---- Acrosin inhibitor 1
Source.6813: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5
Source.6814: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1
Source.6815: DFBPPR20747 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7B
Source.6816: DFBPPR20749 ---- Animal proteins ---- SUMO-activating enzyme subunit 1
Source.6817: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog
Source.6818: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33
Source.6819: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.6820: DFBPPR20756 ---- Animal proteins ---- Myosin regulatory light chain 12B
Source.6821: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45
Source.6822: DFBPPR20759 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform
Source.6823: DFBPPR20760 ---- Animal proteins ---- Beta-defensin C7
Source.6824: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2
Source.6825: DFBPPR20762 ---- Animal proteins ---- Mucosal pentraxin
Source.6826: DFBPPR20763 ---- Animal proteins ---- Dual specificity protein phosphatase 14
Source.6827: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein
Source.6828: DFBPPR20766 ---- Animal proteins ---- Torsin-2A
Source.6829: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.6830: DFBPPR20775 ---- Animal proteins ---- Colipase
Source.6831: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2
Source.6832: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.6833: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial
Source.6834: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.6835: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.6836: DFBPPR20790 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1
Source.6837: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial
Source.6838: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6
Source.6839: DFBPPR20795 ---- Animal proteins ---- Four and a half LIM domains protein 3
Source.6840: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.6841: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.6842: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171
Source.6843: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.6844: DFBPPR20806 ---- Animal proteins ---- Transcriptional adapter 1
Source.6845: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2
Source.6846: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.6847: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148
Source.6848: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216
Source.6849: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2
Source.6850: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14
Source.6851: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.6852: DFBPPR20817 ---- Animal proteins ---- 60S ribosomal protein L3
Source.6853: DFBPPR20819 ---- Animal proteins ---- GATOR complex protein NPRL2
Source.6854: DFBPPR20821 ---- Animal proteins ---- Prefoldin subunit 4
Source.6855: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase
Source.6856: DFBPPR20823 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.6857: DFBPPR20824 ---- Animal proteins ---- CD151 antigen
Source.6858: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.6859: DFBPPR20829 ---- Animal proteins ---- Phospholipid phosphatase 6
Source.6860: DFBPPR20831 ---- Animal proteins ---- Keratin, type II cytoskeletal 59 kDa, component IV
Source.6861: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12
Source.6862: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24
Source.6863: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.6864: DFBPPR20837 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.6865: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2
Source.6866: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3
Source.6867: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1
Source.6868: DFBPPR20843 ---- Animal proteins ---- ARL14 effector protein
Source.6869: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9
Source.6870: DFBPPR20846 ---- Animal proteins ---- Thiopurine S-methyltransferase
Source.6871: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.6872: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.6873: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.6874: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.6875: DFBPPR20853 ---- Animal proteins ---- Hemopexin
Source.6876: DFBPPR20854 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.6877: DFBPPR20855 ---- Animal proteins ---- Diphthine methyl ester synthase
Source.6878: DFBPPR20857 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.6879: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial
Source.6880: DFBPPR20859 ---- Animal proteins ---- Trafficking protein particle complex subunit 4
Source.6881: DFBPPR20861 ---- Animal proteins ---- Zinc finger protein 135
Source.6882: DFBPPR20862 ---- Animal proteins ---- Leucine carboxyl methyltransferase 1
Source.6883: DFBPPR20863 ---- Animal proteins ---- LIM and senescent cell antigen-like-containing domain protein 2
Source.6884: DFBPPR20864 ---- Animal proteins ---- Polycomb group RING finger protein 5
Source.6885: DFBPPR20867 ---- Animal proteins ---- Protein BUD31 homolog
Source.6886: DFBPPR20868 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.6887: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2
Source.6888: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1
Source.6889: DFBPPR20872 ---- Animal proteins ---- Transmembrane protein 150C
Source.6890: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1
Source.6891: DFBPPR20877 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD5
Source.6892: DFBPPR20879 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.6893: DFBPPR20883 ---- Animal proteins ---- Pre-mRNA-splicing factor 38A
Source.6894: DFBPPR20885 ---- Animal proteins ---- Zinc transporter ZIP3
Source.6895: DFBPPR20886 ---- Animal proteins ---- Dentin matrix acidic phosphoprotein 1
Source.6896: DFBPPR20887 ---- Animal proteins ---- UAP56-interacting factor
Source.6897: DFBPPR20889 ---- Animal proteins ---- Myelin protein zero-like protein 3
Source.6898: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.6899: DFBPPR20892 ---- Animal proteins ---- Lysosomal thioesterase PPT2
Source.6900: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein
Source.6901: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.6902: DFBPPR20896 ---- Animal proteins ---- Ribonuclease H2 subunit B
Source.6903: DFBPPR20898 ---- Animal proteins ---- Transaldolase
Source.6904: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1
Source.6905: DFBPPR20902 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 2 homolog
Source.6906: DFBPPR20905 ---- Animal proteins ---- THO complex subunit 3
Source.6907: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.6908: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor
Source.6909: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.6910: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.6911: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3
Source.6912: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.6913: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.6914: DFBPPR20924 ---- Animal proteins ---- Cyclin-dependent kinase 2-associated protein 2
Source.6915: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta
Source.6916: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8
Source.6917: DFBPPR20927 ---- Animal proteins ---- ADP-ribosylation factor 4
Source.6918: DFBPPR20928 ---- Animal proteins ---- Nuclear envelope integral membrane protein 1
Source.6919: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14
Source.6920: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial
Source.6921: DFBPPR20940 ---- Animal proteins ---- Prenylated Rab acceptor protein 1
Source.6922: DFBPPR20941 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC1
Source.6923: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.6924: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1
Source.6925: DFBPPR20948 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 9
Source.6926: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2
Source.6927: DFBPPR20950 ---- Animal proteins ---- WAP four-disulfide core domain protein 18
Source.6928: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1
Source.6929: DFBPPR20957 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial
Source.6930: DFBPPR20958 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial
Source.6931: DFBPPR20959 ---- Animal proteins ---- Janus kinase and microtubule-interacting protein 1
Source.6932: DFBPPR20961 ---- Animal proteins ---- Tetraspanin-17
Source.6933: DFBPPR20962 ---- Animal proteins ---- Protein unc-50 homolog
Source.6934: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.6935: DFBPPR20966 ---- Animal proteins ---- Ubiquitin-like protein ATG12
Source.6936: DFBPPR20967 ---- Animal proteins ---- Phosducin-like protein
Source.6937: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.6938: DFBPPR20970 ---- Animal proteins ---- ETS homologous factor
Source.6939: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1
Source.6940: DFBPPR20972 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP11
Source.6941: DFBPPR20979 ---- Animal proteins ---- V-type proton ATPase 21 kDa proteolipid subunit
Source.6942: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5
Source.6943: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.6944: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.6945: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7
Source.6946: DFBPPR20989 ---- Animal proteins ---- Ubiquinone biosynthesis protein COQ9, mitochondrial
Source.6947: DFBPPR20991 ---- Animal proteins ---- Arfaptin-2
Source.6948: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1
Source.6949: DFBPPR20995 ---- Animal proteins ---- Zinc finger protein 181
Source.6950: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821
Source.6951: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1
Source.6952: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha
Source.6953: DFBPPR21003 ---- Animal proteins ---- Protein BCAP
Source.6954: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.6955: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1
Source.6956: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase
Source.6957: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor
Source.6958: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.6959: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.6960: DFBPPR21014 ---- Animal proteins ---- Transmembrane protein 258
Source.6961: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.6962: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17
Source.6963: DFBPPR21019 ---- Animal proteins ---- Thioredoxin domain-containing protein 9
Source.6964: DFBPPR21020 ---- Animal proteins ---- 60S ribosomal protein L18
Source.6965: DFBPPR21021 ---- Animal proteins ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.6966: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein
Source.6967: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.6968: DFBPPR21030 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit C
Source.6969: DFBPPR21032 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase II inhibitor 2
Source.6970: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial
Source.6971: DFBPPR21036 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.6972: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.6973: DFBPPR21039 ---- Animal proteins ---- V-type proton ATPase subunit e 2
Source.6974: DFBPPR21043 ---- Animal proteins ---- Modulator of macroautophagy TMEM150B
Source.6975: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.6976: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10
Source.6977: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48
Source.6978: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.6979: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28
Source.6980: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.6981: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.6982: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.6983: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.6984: DFBPPR21060 ---- Animal proteins ---- Signal peptidase complex subunit 1
Source.6985: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.6986: DFBPPR21063 ---- Animal proteins ---- Zinc finger protein 691
Source.6987: DFBPPR21064 ---- Animal proteins ---- Ribosome production factor 2 homolog
Source.6988: DFBPPR21068 ---- Animal proteins ---- 40S ribosomal protein S5
Source.6989: DFBPPR21069 ---- Animal proteins ---- Nuclear transcription factor Y subunit gamma
Source.6990: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.6991: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.6992: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein
Source.6993: DFBPPR21080 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim22
Source.6994: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7
Source.6995: DFBPPR21083 ---- Animal proteins ---- TRAF-interacting protein with FHA domain-containing protein A
Source.6996: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.6997: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial
Source.6998: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6
Source.6999: DFBPPR21087 ---- Animal proteins ---- Claudin-11
Source.7000: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.7001: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1
Source.7002: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148
Source.7003: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4
Source.7004: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor
Source.7005: DFBPPR21100 ---- Animal proteins ---- Cochlin
Source.7006: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.7007: DFBPPR21102 ---- Animal proteins ---- Gamma-glutamylcyclotransferase
Source.7008: DFBPPR21104 ---- Animal proteins ---- Keratinocyte-associated protein 2
Source.7009: DFBPPR21105 ---- Animal proteins ---- Calcipressin-3
Source.7010: DFBPPR21106 ---- Animal proteins ---- 40S ribosomal protein S10
Source.7011: DFBPPR21107 ---- Animal proteins ---- Proteasome assembly chaperone 2
Source.7012: DFBPPR21108 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.7013: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.7014: DFBPPR21110 ---- Animal proteins ---- Pro-adrenomedullin
Source.7015: DFBPPR21114 ---- Animal proteins ---- Keratin, type II cytoskeletal 60 kDa, component III
Source.7016: DFBPPR21115 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor-like protein
Source.7017: DFBPPR21116 ---- Animal proteins ---- Suppressor of cytokine signaling 5
Source.7018: DFBPPR21122 ---- Animal proteins ---- Derlin-3
Source.7019: DFBPPR21124 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.7020: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial
Source.7021: DFBPPR21127 ---- Animal proteins ---- 60S acidic ribosomal protein P1
Source.7022: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.7023: DFBPPR21132 ---- Animal proteins ---- Regulator of G-protein signaling 7-binding protein
Source.7024: DFBPPR21134 ---- Animal proteins ---- Cell division cycle-associated protein 7
Source.7025: DFBPPR21135 ---- Animal proteins ---- Vesicle transport protein GOT1B
Source.7026: DFBPPR21136 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.7027: DFBPPR21137 ---- Animal proteins ---- Thioredoxin domain-containing protein 12
Source.7028: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2
Source.7029: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.7030: DFBPPR21144 ---- Animal proteins ---- Repressor of RNA polymerase III transcription MAF1 homolog
Source.7031: DFBPPR21146 ---- Animal proteins ---- Arylamine N-acetyltransferase 1
Source.7032: DFBPPR21147 ---- Animal proteins ---- Transmembrane protein 88
Source.7033: DFBPPR21156 ---- Animal proteins ---- Transmembrane gamma-carboxyglutamic acid protein 1
Source.7034: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.7035: DFBPPR21159 ---- Animal proteins ---- Origin recognition complex subunit 4
Source.7036: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.7037: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial
Source.7038: DFBPPR21172 ---- Animal proteins ---- G-protein coupled receptor 52
Source.7039: DFBPPR21173 ---- Animal proteins ---- Sorting nexin-11
Source.7040: DFBPPR21175 ---- Animal proteins ---- Adenosine receptor A3
Source.7041: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase
Source.7042: DFBPPR21177 ---- Animal proteins ---- Ran guanine nucleotide release factor
Source.7043: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5
Source.7044: DFBPPR21179 ---- Animal proteins ---- Eukaryotic translation initiation factor 4H
Source.7045: DFBPPR21181 ---- Animal proteins ---- Calpastatin
Source.7046: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173
Source.7047: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2
Source.7048: DFBPPR21188 ---- Animal proteins ---- High mobility group protein B4
Source.7049: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal
Source.7050: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.7051: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1
Source.7052: DFBPPR21193 ---- Animal proteins ---- Protein Wnt-16
Source.7053: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase
Source.7054: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2
Source.7055: DFBPPR21201 ---- Animal proteins ---- mRNA turnover protein 4 homolog
Source.7056: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1
Source.7057: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog
Source.7058: DFBPPR21210 ---- Animal proteins ---- T-cell receptor-associated transmembrane adapter 1
Source.7059: DFBPPR21212 ---- Animal proteins ---- Tropomodulin-4
Source.7060: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog
Source.7061: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9
Source.7062: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1
Source.7063: DFBPPR21219 ---- Animal proteins ---- Zinc finger CCHC-type and RNA-binding motif-containing protein 1
Source.7064: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1
Source.7065: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2
Source.7066: DFBPPR21225 ---- Animal proteins ---- 28S ribosomal protein S31, mitochondrial
Source.7067: DFBPPR21226 ---- Animal proteins ---- GPN-loop GTPase 2
Source.7068: DFBPPR21227 ---- Animal proteins ---- FUN14 domain-containing protein 1
Source.7069: DFBPPR21229 ---- Animal proteins ---- Neurexophilin-2
Source.7070: DFBPPR21230 ---- Animal proteins ---- Dynein light chain 4, axonemal
Source.7071: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase
Source.7072: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4
Source.7073: DFBPPR21241 ---- Animal proteins ---- Cytochrome b-245 chaperone 1
Source.7074: DFBPPR21242 ---- Animal proteins ---- Tachykinin-3
Source.7075: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.7076: DFBPPR21244 ---- Animal proteins ---- RELT-like protein 1
Source.7077: DFBPPR21251 ---- Animal proteins ---- B9 domain-containing protein 2
Source.7078: DFBPPR21253 ---- Animal proteins ---- Sorting nexin-8
Source.7079: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.7080: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2
Source.7081: DFBPPR21259 ---- Animal proteins ---- Elongation factor 1-delta
Source.7082: DFBPPR21268 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40 homolog
Source.7083: DFBPPR21269 ---- Animal proteins ---- TOX high mobility group box family member 4
Source.7084: DFBPPR21270 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim21
Source.7085: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase
Source.7086: DFBPPR21272 ---- Animal proteins ---- Testin
Source.7087: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.7088: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11
Source.7089: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.7090: DFBPPR21278 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 2
Source.7091: DFBPPR21279 ---- Animal proteins ---- 40S ribosomal protein S29
Source.7092: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen
Source.7093: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.7094: DFBPPR21288 ---- Animal proteins ---- Polycomb group RING finger protein 1
Source.7095: DFBPPR21290 ---- Animal proteins ---- Metaxin-1
Source.7096: DFBPPR21293 ---- Animal proteins ---- IST1 homolog
Source.7097: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.7098: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b
Source.7099: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial
Source.7100: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4
Source.7101: DFBPPR21308 ---- Animal proteins ---- Cysteine-rich protein 1
Source.7102: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1
Source.7103: DFBPPR21311 ---- Animal proteins ---- WD repeat-containing protein 18
Source.7104: DFBPPR21313 ---- Animal proteins ---- Zinc finger protein 184
Source.7105: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein
Source.7106: DFBPPR21321 ---- Animal proteins ---- Zinc finger matrin-type protein 3
Source.7107: DFBPPR21322 ---- Animal proteins ---- Zinc finger protein 227
Source.7108: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115
Source.7109: DFBPPR21325 ---- Animal proteins ---- Translocon-associated protein subunit gamma
Source.7110: DFBPPR21327 ---- Animal proteins ---- Zinc finger protein 34
Source.7111: DFBPPR21328 ---- Animal proteins ---- Outer dense fiber protein 3
Source.7112: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.7113: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65
Source.7114: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein
Source.7115: DFBPPR21346 ---- Animal proteins ---- Ameloblastin
Source.7116: DFBPPR21347 ---- Animal proteins ---- Zinc finger protein 397
Source.7117: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.7118: DFBPPR21352 ---- Animal proteins ---- Glutathione peroxidase 7
Source.7119: DFBPPR21353 ---- Animal proteins ---- Zinc finger protein OZF
Source.7120: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.7121: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3
Source.7122: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1
Source.7123: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.7124: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18
Source.7125: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.7126: DFBPPR21369 ---- Animal proteins ---- Protein MIS12 homolog
Source.7127: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.7128: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.7129: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D
Source.7130: DFBPPR21377 ---- Animal proteins ---- Hemoglobin subunit mu
Source.7131: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4
Source.7132: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2
Source.7133: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2
Source.7134: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B
Source.7135: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4
Source.7136: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.7137: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.7138: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.7139: DFBPPR21400 ---- Animal proteins ---- Replication initiator 1
Source.7140: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein
Source.7141: DFBPPR21405 ---- Animal proteins ---- 60S ribosomal protein L37
Source.7142: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.7143: DFBPPR21407 ---- Animal proteins ---- Ribosome biogenesis protein BRX1 homolog
Source.7144: DFBPPR21410 ---- Animal proteins ---- Trans-2,3-enoyl-CoA reductase-like
Source.7145: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.7146: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.7147: DFBPPR21415 ---- Animal proteins ---- Leucine-rich repeat-containing protein 39
Source.7148: DFBPPR21418 ---- Animal proteins ---- Angiopoietin-related protein 1
Source.7149: DFBPPR21420 ---- Animal proteins ---- Gem-associated protein 7
Source.7150: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.7151: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B
Source.7152: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84
Source.7153: DFBPPR21426 ---- Animal proteins ---- ORM1-like protein 3
Source.7154: DFBPPR21427 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 2
Source.7155: DFBPPR21433 ---- Animal proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.7156: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.7157: DFBPPR21435 ---- Animal proteins ---- ETS-related transcription factor Elf-5
Source.7158: DFBPPR21436 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1A
Source.7159: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8
Source.7160: DFBPPR21444 ---- Animal proteins ---- DAZ-associated protein 2
Source.7161: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4
Source.7162: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.7163: DFBPPR21451 ---- Animal proteins ---- Nurim
Source.7164: DFBPPR21457 ---- Animal proteins ---- Zinc finger protein 330
Source.7165: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.7166: DFBPPR21460 ---- Animal proteins ---- SREBP regulating gene protein
Source.7167: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.7168: DFBPPR21462 ---- Animal proteins ---- Vesicle transport protein GOT1A
Source.7169: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.7170: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.7171: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3
Source.7172: DFBPPR21469 ---- Animal proteins ---- Probable glutathione peroxidase 8
Source.7173: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.7174: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.7175: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.7176: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1
Source.7177: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein
Source.7178: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.7179: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.7180: DFBPPR21489 ---- Animal proteins ---- Pre-mRNA-splicing factor 18
Source.7181: DFBPPR21490 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.7182: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.7183: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like
Source.7184: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47
Source.7185: DFBPPR21498 ---- Animal proteins ---- Alanyl-tRNA editing protein Aarsd1
Source.7186: DFBPPR21500 ---- Animal proteins ---- Docking protein 2
Source.7187: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.7188: DFBPPR21504 ---- Animal proteins ---- Ribonuclease P protein subunit p40
Source.7189: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1
Source.7190: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3
Source.7191: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.7192: DFBPPR21509 ---- Animal proteins ---- Myoneurin
Source.7193: DFBPPR21510 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7
Source.7194: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1
Source.7195: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20
Source.7196: DFBPPR21520 ---- Animal proteins ---- LYR motif-containing protein 4
Source.7197: DFBPPR21521 ---- Animal proteins ---- Active regulator of SIRT1
Source.7198: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1
Source.7199: DFBPPR21523 ---- Animal proteins ---- tRNA 2'-phosphotransferase 1
Source.7200: DFBPPR21524 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 receptor
Source.7201: DFBPPR21526 ---- Animal proteins ---- Interferon alpha-inducible protein 27-like protein 2
Source.7202: DFBPPR21528 ---- Animal proteins ---- Vasculin
Source.7203: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2
Source.7204: DFBPPR21531 ---- Animal proteins ---- 60S ribosomal protein L13
Source.7205: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19
Source.7206: DFBPPR21535 ---- Animal proteins ---- Gastrotropin
Source.7207: DFBPPR21540 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.7208: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A
Source.7209: DFBPPR21544 ---- Animal proteins ---- General transcription factor IIE subunit 2
Source.7210: DFBPPR21545 ---- Animal proteins ---- Musculoskeletal embryonic nuclear protein 1
Source.7211: DFBPPR21548 ---- Animal proteins ---- Cornifelin
Source.7212: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22
Source.7213: DFBPPR21552 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 3
Source.7214: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.7215: DFBPPR21557 ---- Animal proteins ---- WD repeat-containing protein 55
Source.7216: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39
Source.7217: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3
Source.7218: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.7219: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3
Source.7220: DFBPPR21570 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40B
Source.7221: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2
Source.7222: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.7223: DFBPPR21582 ---- Animal proteins ---- MORN repeat-containing protein 4
Source.7224: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.7225: DFBPPR21584 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.7226: DFBPPR21586 ---- Animal proteins ---- Cyclin-C
Source.7227: DFBPPR21590 ---- Animal proteins ---- Rhombotin-1
Source.7228: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4
Source.7229: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.7230: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3
Source.7231: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1
Source.7232: DFBPPR21604 ---- Animal proteins ---- Zinc finger protein 345
Source.7233: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork
Source.7234: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1
Source.7235: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.7236: DFBPPR21618 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.7237: DFBPPR21619 ---- Animal proteins ---- CBY1-interacting BAR domain-containing protein 2
Source.7238: DFBPPR21622 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.7239: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.7240: DFBPPR21625 ---- Animal proteins ---- 40S ribosomal protein S24
Source.7241: DFBPPR21630 ---- Animal proteins ---- Maspardin
Source.7242: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14
Source.7243: DFBPPR21633 ---- Animal proteins ---- DNA fragmentation factor subunit beta
Source.7244: DFBPPR21637 ---- Animal proteins ---- 60S acidic ribosomal protein P2
Source.7245: DFBPPR21638 ---- Animal proteins ---- 28S ribosomal protein S10, mitochondrial
Source.7246: DFBPPR21639 ---- Animal proteins ---- Elongator complex protein 4
Source.7247: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44
Source.7248: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6
Source.7249: DFBPPR21645 ---- Animal proteins ---- Proteasome activator complex subunit 1
Source.7250: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1
Source.7251: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein
Source.7252: DFBPPR21650 ---- Animal proteins ---- Synaptonemal complex central element protein 1
Source.7253: DFBPPR21652 ---- Animal proteins ---- Protein Flattop
Source.7254: DFBPPR21653 ---- Animal proteins ---- Cytochrome P450 20A1
Source.7255: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11
Source.7256: DFBPPR21661 ---- Animal proteins ---- Arginine/serine-rich coiled-coil protein 2
Source.7257: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.7258: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.7259: DFBPPR21670 ---- Animal proteins ---- V-type proton ATPase subunit E 2
Source.7260: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10
Source.7261: DFBPPR21673 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP4
Source.7262: DFBPPR21674 ---- Animal proteins ---- Leucine-rich repeat-containing protein 3B
Source.7263: DFBPPR21675 ---- Animal proteins ---- Short palate, lung and nasal epithelium carcinoma-associated protein 2B
Source.7264: DFBPPR21678 ---- Animal proteins ---- Transmembrane protein 35A
Source.7265: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1
Source.7266: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.7267: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like
Source.7268: DFBPPR21687 ---- Animal proteins ---- Ropporin-1-like protein
Source.7269: DFBPPR21691 ---- Animal proteins ---- Protein LRATD1
Source.7270: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1
Source.7271: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.7272: DFBPPR21697 ---- Animal proteins ---- UDP-galactose translocator
Source.7273: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.7274: DFBPPR21702 ---- Animal proteins ---- Rhombotin-2
Source.7275: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.7276: DFBPPR21707 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim23
Source.7277: DFBPPR21709 ---- Animal proteins ---- PEST proteolytic signal-containing nuclear protein
Source.7278: DFBPPR21712 ---- Animal proteins ---- Serpin E3
Source.7279: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.7280: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.7281: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.7282: DFBPPR21717 ---- Animal proteins ---- Transmembrane protein 134
Source.7283: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2
Source.7284: DFBPPR21719 ---- Animal proteins ---- Protein reprimo
Source.7285: DFBPPR21720 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.7286: DFBPPR21722 ---- Animal proteins ---- Protein DDI1 homolog 1
Source.7287: DFBPPR21723 ---- Animal proteins ---- OCIA domain-containing protein 1
Source.7288: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.7289: DFBPPR21727 ---- Animal proteins ---- 39S ribosomal protein L1, mitochondrial
Source.7290: DFBPPR21728 ---- Animal proteins ---- Galectin-9
Source.7291: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2
Source.7292: DFBPPR21732 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1
Source.7293: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.7294: DFBPPR21738 ---- Animal proteins ---- Bcl-2-related protein A1
Source.7295: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15
Source.7296: DFBPPR21741 ---- Animal proteins ---- Meiotic nuclear division protein 1 homolog
Source.7297: DFBPPR21743 ---- Animal proteins ---- Short palate, lung and nasal epithelium carcinoma-associated protein 2A
Source.7298: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.7299: DFBPPR21751 ---- Animal proteins ---- Oocyte-expressed protein homolog
Source.7300: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10
Source.7301: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1
Source.7302: DFBPPR21754 ---- Animal proteins ---- BLOC-1-related complex subunit 6
Source.7303: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase
Source.7304: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1
Source.7305: DFBPPR21763 ---- Animal proteins ---- Protein GOLM2
Source.7306: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25
Source.7307: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12
Source.7308: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.7309: DFBPPR21768 ---- Animal proteins ---- Tektin-4
Source.7310: DFBPPR21769 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 21
Source.7311: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4
Source.7312: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.7313: DFBPPR21773 ---- Animal proteins ---- Isoamyl acetate-hydrolyzing esterase 1 homolog
Source.7314: DFBPPR21775 ---- Animal proteins ---- Protein FAM193B
Source.7315: DFBPPR21779 ---- Animal proteins ---- Serpin B8
Source.7316: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1
Source.7317: DFBPPR21783 ---- Animal proteins ---- Radial spoke head protein 9 homolog
Source.7318: DFBPPR21787 ---- Animal proteins ---- PRA1 family protein 2
Source.7319: DFBPPR21789 ---- Animal proteins ---- Protein kish-B
Source.7320: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.7321: DFBPPR21793 ---- Animal proteins ---- Dynein light chain Tctex-type protein 2B
Source.7322: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.7323: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like
Source.7324: DFBPPR21799 ---- Animal proteins ---- Major vault protein
Source.7325: DFBPPR21800 ---- Animal proteins ---- Carbonic anhydrase-related protein 10
Source.7326: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B
Source.7327: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.7328: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.7329: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.7330: DFBPPR21806 ---- Animal proteins ---- Keratin, type II cuticular Hb1
Source.7331: DFBPPR21807 ---- Animal proteins ---- Lysine-rich nucleolar protein 1
Source.7332: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.7333: DFBPPR21815 ---- Animal proteins ---- ORM1-like protein 2
Source.7334: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2
Source.7335: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11
Source.7336: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2
Source.7337: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein
Source.7338: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7
Source.7339: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526
Source.7340: DFBPPR21829 ---- Animal proteins ---- Mitochondrial 2-oxodicarboxylate carrier
Source.7341: DFBPPR21833 ---- Animal proteins ---- Keratin, type II cuticular Hb3
Source.7342: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1
Source.7343: DFBPPR21836 ---- Animal proteins ---- Potassium channel regulatory protein
Source.7344: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750
Source.7345: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.7346: DFBPPR21841 ---- Animal proteins ---- LIM domain-containing protein 2
Source.7347: DFBPPR21842 ---- Animal proteins ---- Transmembrane protein 14A
Source.7348: DFBPPR21844 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1
Source.7349: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.7350: DFBPPR21850 ---- Animal proteins ---- GATA zinc finger domain-containing protein 1
Source.7351: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5
Source.7352: DFBPPR21853 ---- Animal proteins ---- F-box/LRR-repeat protein 14
Source.7353: DFBPPR21858 ---- Animal proteins ---- Chromatin complexes subunit BAP18
Source.7354: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B
Source.7355: DFBPPR21861 ---- Animal proteins ---- Succinate dehydrogenase assembly factor 3, mitochondrial
Source.7356: DFBPPR21863 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 3
Source.7357: DFBPPR21865 ---- Animal proteins ---- Transcription factor EC
Source.7358: DFBPPR21867 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 5
Source.7359: DFBPPR21868 ---- Animal proteins ---- RAB6-interacting golgin
Source.7360: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.7361: DFBPPR21871 ---- Animal proteins ---- Serpin B10
Source.7362: DFBPPR21873 ---- Animal proteins ---- Vitrin
Source.7363: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein
Source.7364: DFBPPR21883 ---- Animal proteins ---- 39S ribosomal protein L47, mitochondrial
Source.7365: DFBPPR21884 ---- Animal proteins ---- Calcium-binding protein 39
Source.7366: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.7367: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2
Source.7368: DFBPPR21887 ---- Animal proteins ---- Cyclin-G1
Source.7369: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor
Source.7370: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6
Source.7371: DFBPPR21891 ---- Animal proteins ---- 39S ribosomal protein L54, mitochondrial
Source.7372: DFBPPR21894 ---- Animal proteins ---- COMM domain-containing protein 5
Source.7373: DFBPPR21895 ---- Animal proteins ---- Epithelial membrane protein 3
Source.7374: DFBPPR21902 ---- Animal proteins ---- Centromere protein N
Source.7375: DFBPPR21903 ---- Animal proteins ---- Inactive serine protease 35
Source.7376: DFBPPR21904 ---- Animal proteins ---- Protein TBATA
Source.7377: DFBPPR21905 ---- Animal proteins ---- Tubulin polymerization-promoting protein family member 2
Source.7378: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.7379: DFBPPR21908 ---- Animal proteins ---- Solute carrier family 66 member 2
Source.7380: DFBPPR21909 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 11
Source.7381: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog
Source.7382: DFBPPR21911 ---- Animal proteins ---- ORM1-like protein 1
Source.7383: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2
Source.7384: DFBPPR21914 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 13
Source.7385: DFBPPR21915 ---- Animal proteins ---- Tetraspanin-13
Source.7386: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6
Source.7387: DFBPPR21919 ---- Animal proteins ---- Ras-like protein family member 12
Source.7388: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.7389: DFBPPR21922 ---- Animal proteins ---- Sideroflexin-4
Source.7390: DFBPPR21923 ---- Animal proteins ---- Endophilin-B2
Source.7391: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog
Source.7392: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.7393: DFBPPR21932 ---- Animal proteins ---- Keratin, type II cytoskeletal 68 kDa, component IB
Source.7394: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2
Source.7395: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.7396: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.7397: DFBPPR21941 ---- Animal proteins ---- MOB kinase activator 3A
Source.7398: DFBPPR21942 ---- Animal proteins ---- Neurexophilin-1
Source.7399: DFBPPR21945 ---- Animal proteins ---- Dermokine
Source.7400: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414
Source.7401: DFBPPR21947 ---- Animal proteins ---- rRNA-processing protein UTP23 homolog
Source.7402: DFBPPR21948 ---- Animal proteins ---- Selenoprotein F
Source.7403: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48
Source.7404: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11
Source.7405: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6
Source.7406: DFBPPR21953 ---- Animal proteins ---- Clusterin-like protein 1
Source.7407: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.7408: DFBPPR21956 ---- Animal proteins ---- DNA replication complex GINS protein PSF3
Source.7409: DFBPPR21957 ---- Animal proteins ---- LIM domain transcription factor LMO4
Source.7410: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.7411: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog
Source.7412: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1
Source.7413: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1
Source.7414: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.7415: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog
Source.7416: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1
Source.7417: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1
Source.7418: DFBPPR21991 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC7-like
Source.7419: DFBPPR21992 ---- Animal proteins ---- Intraflagellar transport-associated protein
Source.7420: DFBPPR21993 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.7421: DFBPPR21995 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 2
Source.7422: DFBPPR21996 ---- Animal proteins ---- Shieldin complex subunit 1
Source.7423: DFBPPR21998 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.7424: DFBPPR22000 ---- Animal proteins ---- Protein LDOC1
Source.7425: DFBPPR22001 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.7426: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog
Source.7427: DFBPPR22005 ---- Animal proteins ---- Transmembrane protein 81
Source.7428: DFBPPR22006 ---- Animal proteins ---- EKC/KEOPS complex subunit GON7
Source.7429: DFBPPR22007 ---- Animal proteins ---- Protein C8orf37 homolog
Source.7430: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.7431: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1
Source.7432: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4
Source.7433: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3
Source.7434: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5
Source.7435: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2
Source.7436: DFBPPR22020 ---- Animal proteins ---- Phosphotriesterase-related protein
Source.7437: DFBPPR22022 ---- Animal proteins ---- SRA stem-loop-interacting RNA-binding protein, mitochondrial
Source.7438: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.7439: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2
Source.7440: DFBPPR22028 ---- Animal proteins ---- Endonuclease/exonuclease/phosphatase family domain-containing protein 1
Source.7441: DFBPPR22029 ---- Animal proteins ---- COMM domain-containing protein 7
Source.7442: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4
Source.7443: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.7444: DFBPPR22037 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2
Source.7445: DFBPPR22038 ---- Animal proteins ---- Kelch domain-containing protein 3
Source.7446: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12
Source.7447: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C
Source.7448: DFBPPR22043 ---- Animal proteins ---- Leukocyte antigen CD37
Source.7449: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2
Source.7450: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.7451: DFBPPR22054 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.7452: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3
Source.7453: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6
Source.7454: DFBPPR22059 ---- Animal proteins ---- Immediate early response 3-interacting protein 1
Source.7455: DFBPPR22060 ---- Animal proteins ---- Transmembrane protein 126A
Source.7456: DFBPPR22061 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX16 homolog, mitochondrial
Source.7457: DFBPPR22065 ---- Animal proteins ---- 60S ribosomal protein L10-like
Source.7458: DFBPPR22066 ---- Animal proteins ---- Pyridoxal phosphate homeostasis protein
Source.7459: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.7460: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.7461: DFBPPR22072 ---- Animal proteins ---- Brain protein I3
Source.7462: DFBPPR22076 ---- Animal proteins ---- Tetraspanin-6
Source.7463: DFBPPR22077 ---- Animal proteins ---- 39S ribosomal protein L21, mitochondrial
Source.7464: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5
Source.7465: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9
Source.7466: DFBPPR22081 ---- Animal proteins ---- DnaJ homolog subfamily C member 5B
Source.7467: DFBPPR22083 ---- Animal proteins ---- 40S ribosomal protein S15a
Source.7468: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7
Source.7469: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1
Source.7470: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.7471: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.7472: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41
Source.7473: DFBPPR22097 ---- Animal proteins ---- Ester hydrolase C11orf54 homolog
Source.7474: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2
Source.7475: DFBPPR22099 ---- Animal proteins ---- Beta-centractin
Source.7476: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.7477: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2
Source.7478: DFBPPR22104 ---- Animal proteins ---- Leptin receptor overlapping transcript-like 1
Source.7479: DFBPPR22105 ---- Animal proteins ---- Centromere protein L
Source.7480: DFBPPR22107 ---- Animal proteins ---- TLD domain-containing protein 2
Source.7481: DFBPPR22108 ---- Animal proteins ---- SH3 domain-containing YSC84-like protein 1
Source.7482: DFBPPR22111 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.7483: DFBPPR22116 ---- Animal proteins ---- CB1 cannabinoid receptor-interacting protein 1
Source.7484: DFBPPR22120 ---- Animal proteins ---- Outer dense fiber protein 4
Source.7485: DFBPPR22121 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.7486: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog
Source.7487: DFBPPR22125 ---- Animal proteins ---- 40S ribosomal protein S16
Source.7488: DFBPPR22126 ---- Animal proteins ---- Zinc finger protein 572
Source.7489: DFBPPR22129 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.7490: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2
Source.7491: DFBPPR22132 ---- Animal proteins ---- 60S ribosomal protein L18a
Source.7492: DFBPPR22134 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8
Source.7493: DFBPPR22136 ---- Animal proteins ---- RUN domain-containing protein 3B
Source.7494: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1
Source.7495: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48
Source.7496: DFBPPR22141 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 1
Source.7497: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1
Source.7498: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B
Source.7499: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.7500: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein
Source.7501: DFBPPR22153 ---- Animal proteins ---- Leucine-rich repeat-containing protein 3
Source.7502: DFBPPR22156 ---- Animal proteins ---- Cell division cycle protein 123 homolog
Source.7503: DFBPPR22159 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 24
Source.7504: DFBPPR22161 ---- Animal proteins ---- 39S ribosomal protein L53, mitochondrial
Source.7505: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.7506: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2
Source.7507: DFBPPR22165 ---- Animal proteins ---- Coiled-coil domain-containing protein 106
Source.7508: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.7509: DFBPPR22168 ---- Animal proteins ---- Transmembrane protein 182
Source.7510: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3
Source.7511: DFBPPR22177 ---- Animal proteins ---- Protein C9orf135 homolog
Source.7512: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.7513: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.7514: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.7515: DFBPPR22183 ---- Animal proteins ---- Retrotransposon Gag-like protein 8
Source.7516: DFBPPR22186 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 2
Source.7517: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.7518: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5
Source.7519: DFBPPR22192 ---- Animal proteins ---- Receptor expression-enhancing protein 5
Source.7520: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.7521: DFBPPR22197 ---- Animal proteins ---- Nuclear receptor 2C2-associated protein
Source.7522: DFBPPR22198 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2
Source.7523: DFBPPR22204 ---- Animal proteins ---- Ubiquitin-like protein 3
Source.7524: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.7525: DFBPPR22209 ---- Animal proteins ---- Transmembrane protein 147
Source.7526: DFBPPR22210 ---- Animal proteins ---- Peroxisomal membrane protein 4
Source.7527: DFBPPR22213 ---- Animal proteins ---- Protein TEX261
Source.7528: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.7529: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.7530: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein
Source.7531: DFBPPR22218 ---- Animal proteins ---- Galectin-4
Source.7532: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1
Source.7533: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.7534: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.7535: DFBPPR22227 ---- Animal proteins ---- Tetraspanin-8
Source.7536: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.7537: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.7538: DFBPPR22231 ---- Animal proteins ---- DnaJ homolog subfamily C member 12
Source.7539: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5
Source.7540: DFBPPR22235 ---- Animal proteins ---- Cilia- and flagella-associated protein 300
Source.7541: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.7542: DFBPPR22238 ---- Animal proteins ---- StAR-related lipid transfer protein 5
Source.7543: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.7544: DFBPPR22244 ---- Animal proteins ---- THAP domain-containing protein 3
Source.7545: DFBPPR22246 ---- Animal proteins ---- Pancreatic progenitor cell differentiation and proliferation factor
Source.7546: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3
Source.7547: DFBPPR22250 ---- Animal proteins ---- Tetratricopeptide repeat protein 23-like
Source.7548: DFBPPR22254 ---- Animal proteins ---- BLOC-1-related complex subunit 7
Source.7549: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.7550: DFBPPR22256 ---- Animal proteins ---- Proteolipid protein 2
Source.7551: DFBPPR22257 ---- Animal proteins ---- TLC domain-containing protein 5
Source.7552: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.7553: DFBPPR22260 ---- Animal proteins ---- GTPase IMAP family member GIMD1
Source.7554: DFBPPR22262 ---- Animal proteins ---- Tetraspanin-18
Source.7555: DFBPPR22263 ---- Animal proteins ---- Protein C1orf43 homolog
Source.7556: DFBPPR22270 ---- Animal proteins ---- COX assembly mitochondrial protein 2 homolog
Source.7557: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.7558: DFBPPR22272 ---- Animal proteins ---- 40S ribosomal protein S30
Source.7559: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial
Source.7560: DFBPPR22276 ---- Animal proteins ---- Protein MEMO1
Source.7561: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B
Source.7562: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40
Source.7563: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3
Source.7564: DFBPPR22280 ---- Animal proteins ---- 60S ribosomal protein L27a
Source.7565: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.7566: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.7567: DFBPPR22285 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1-interacting protein 2
Source.7568: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B
Source.7569: DFBPPR22289 ---- Animal proteins ---- Heme-binding protein 1
Source.7570: DFBPPR22290 ---- Animal proteins ---- Cell death activator CIDE-B
Source.7571: DFBPPR22292 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial
Source.7572: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.7573: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2
Source.7574: DFBPPR22298 ---- Animal proteins ---- 40S ribosomal protein S17
Source.7575: DFBPPR22299 ---- Animal proteins ---- Tetraspanin-31
Source.7576: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B
Source.7577: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A
Source.7578: DFBPPR22306 ---- Animal proteins ---- p53 and DNA damage-regulated protein 1
Source.7579: DFBPPR22311 ---- Animal proteins ---- Calcium-binding and spermatid-specific protein 1
Source.7580: DFBPPR22313 ---- Animal proteins ---- Nucleolar protein 16
Source.7581: DFBPPR22314 ---- Animal proteins ---- TM2 domain-containing protein 2
Source.7582: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like
Source.7583: DFBPPR22321 ---- Animal proteins ---- Solute carrier family 25 member 35
Source.7584: DFBPPR22324 ---- Animal proteins ---- Arginine and glutamate-rich protein 1
Source.7585: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.7586: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70
Source.7587: DFBPPR22327 ---- Animal proteins ---- Small integral membrane protein 7
Source.7588: DFBPPR22330 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 39
Source.7589: DFBPPR22332 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 3
Source.7590: DFBPPR22334 ---- Animal proteins ---- Protein HP-25 homolog 1
Source.7591: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.7592: DFBPPR22337 ---- Animal proteins ---- Uncharacterized protein CLBA1
Source.7593: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.7594: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.7595: DFBPPR22342 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog
Source.7596: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B
Source.7597: DFBPPR22346 ---- Animal proteins ---- FUN14 domain-containing protein 2
Source.7598: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog
Source.7599: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80
Source.7600: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.7601: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein
Source.7602: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180
Source.7603: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.7604: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.7605: DFBPPR22360 ---- Animal proteins ---- Mitochondrial fission regulator 1-like
Source.7606: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23
Source.7607: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4
Source.7608: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase
Source.7609: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92
Source.7610: DFBPPR22373 ---- Animal proteins ---- 60S ribosomal protein L3-like
Source.7611: DFBPPR22374 ---- Animal proteins ---- Cysteine-rich protein 2
Source.7612: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1
Source.7613: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.7614: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B
Source.7615: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A
Source.7616: DFBPPR22386 ---- Animal proteins ---- DPY30 domain-containing protein 2
Source.7617: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.7618: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10
Source.7619: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.7620: DFBPPR22398 ---- Animal proteins ---- Protein NDRG3
Source.7621: DFBPPR22400 ---- Animal proteins ---- Stromal cell-derived factor 2-like protein 1
Source.7622: DFBPPR22401 ---- Animal proteins ---- Zinc finger protein 474
Source.7623: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog
Source.7624: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1
Source.7625: DFBPPR22409 ---- Animal proteins ---- DnaJ homolog subfamily B member 5
Source.7626: DFBPPR22420 ---- Animal proteins ---- Small integral membrane protein 19
Source.7627: DFBPPR22422 ---- Animal proteins ---- UPF0428 protein CXorf56 homolog
Source.7628: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B
Source.7629: DFBPPR22424 ---- Animal proteins ---- Transmembrane protein 243
Source.7630: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186
Source.7631: DFBPPR22434 ---- Animal proteins ---- UPF0692 protein C19orf54 homolog
Source.7632: DFBPPR22435 ---- Animal proteins ---- CDAN1-interacting nuclease 1
Source.7633: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3
Source.7634: DFBPPR22443 ---- Animal proteins ---- Stromal cell-derived factor 2
Source.7635: DFBPPR22444 ---- Animal proteins ---- Tetraspanin-11
Source.7636: DFBPPR22445 ---- Animal proteins ---- Tetratricopeptide repeat protein 1
Source.7637: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9
Source.7638: DFBPPR22452 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 37
Source.7639: DFBPPR22455 ---- Animal proteins ---- Phosducin-like protein 2
Source.7640: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2
Source.7641: DFBPPR22460 ---- Animal proteins ---- Coiled-coil domain-containing protein 149
Source.7642: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2
Source.7643: DFBPPR22464 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 13
Source.7644: DFBPPR22465 ---- Animal proteins ---- OCIA domain-containing protein 2
Source.7645: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein
Source.7646: DFBPPR22470 ---- Animal proteins ---- Coiled-coil domain-containing protein 137
Source.7647: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.7648: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.7649: DFBPPR22478 ---- Animal proteins ---- Trichohyalin-like protein 1
Source.7650: DFBPPR22481 ---- Animal proteins ---- Uncharacterized protein FAM241A
Source.7651: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144
Source.7652: DFBPPR22486 ---- Animal proteins ---- Transmembrane protein 223
Source.7653: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.7654: DFBPPR22489 ---- Animal proteins ---- Paraneoplastic antigen Ma1 homolog
Source.7655: DFBPPR22490 ---- Animal proteins ---- Costars family protein ABRACL
Source.7656: DFBPPR22492 ---- Animal proteins ---- SAYSvFN domain-containing protein 1
Source.7657: DFBPPR22493 ---- Animal proteins ---- PC-esterase domain-containing protein 1B
Source.7658: DFBPPR22494 ---- Animal proteins ---- Protein FAM53C
Source.7659: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.7660: DFBPPR22496 ---- Animal proteins ---- Dysbindin domain-containing protein 1
Source.7661: DFBPPR22501 ---- Animal proteins ---- Multiple myeloma tumor-associated protein 2 homolog
Source.7662: DFBPPR22502 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 46
Source.7663: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2
Source.7664: DFBPPR22506 ---- Animal proteins ---- Transport and Golgi organization protein 2 homolog
Source.7665: DFBPPR22507 ---- Animal proteins ---- Secernin-3
Source.7666: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101
Source.7667: DFBPPR22510 ---- Animal proteins ---- GPALPP motifs-containing protein 1
Source.7668: DFBPPR22514 ---- Animal proteins ---- Transmembrane protein 205
Source.7669: DFBPPR22515 ---- Animal proteins ---- Small integral membrane protein 8
Source.7670: DFBPPR22516 ---- Animal proteins ---- Transmembrane protein 141
Source.7671: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15
Source.7672: DFBPPR22519 ---- Animal proteins ---- Transmembrane protein 248
Source.7673: DFBPPR22520 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 2
Source.7674: DFBPPR22522 ---- Animal proteins ---- Coiled-coil domain-containing protein 126
Source.7675: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54
Source.7676: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8
Source.7677: DFBPPR22536 ---- Animal proteins ---- Suprabasin
Source.7678: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.7679: DFBPPR22539 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 18
Source.7680: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B
Source.7681: DFBPPR22547 ---- Animal proteins ---- Actin-related protein T2
Source.7682: DFBPPR22548 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 1
Source.7683: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1
Source.7684: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2
Source.7685: DFBPPR22556 ---- Animal proteins ---- Protein maestro
Source.7686: DFBPPR22557 ---- Animal proteins ---- Ataxin-7-like protein 1
Source.7687: DFBPPR22559 ---- Animal proteins ---- Vimentin-type intermediate filament-associated coiled-coil protein
Source.7688: DFBPPR22560 ---- Animal proteins ---- Mesenteric estrogen-dependent adipogenesis protein
Source.7689: DFBPPR22561 ---- Animal proteins ---- Pre-rRNA-processing protein TSR2 homolog
Source.7690: DFBPPR22565 ---- Animal proteins ---- Probable RNA-binding protein 18
Source.7691: DFBPPR22566 ---- Animal proteins ---- Ubiquitin-like protein 4B
Source.7692: DFBPPR22570 ---- Animal proteins ---- Outer dense fiber protein 3-like protein 1
Source.7693: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1
Source.7694: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.7695: DFBPPR22574 ---- Animal proteins ---- Uncharacterized protein C1orf54 homolog
Source.7696: DFBPPR22583 ---- Animal proteins ---- UPF0184 protein C9orf16 homolog
Source.7697: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.7698: DFBPPR22588 ---- Animal proteins ---- Uncharacterized protein C1orf198 homolog
Source.7699: DFBPPR22589 ---- Animal proteins ---- Transmembrane protein 171
Source.7700: DFBPPR22590 ---- Animal proteins ---- Transmembrane protein 267
Source.7701: DFBPPR22593 ---- Animal proteins ---- UPF0688 protein C1orf174 homolog
Source.7702: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19
Source.7703: DFBPPR22595 ---- Animal proteins ---- Transmembrane protein 268
Source.7704: DFBPPR22598 ---- Animal proteins ---- UPF0488 protein C8orf33 homolog
Source.7705: DFBPPR22599 ---- Animal proteins ---- Tetratricopeptide repeat protein 9C
Source.7706: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13
Source.7707: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.7708: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B
Source.7709: DFBPPR22605 ---- Animal proteins ---- Transmembrane protein 254
Source.7710: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128
Source.7711: DFBPPR22608 ---- Animal proteins ---- Tetratricopeptide repeat protein 36
Source.7712: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215
Source.7713: DFBPPR22615 ---- Animal proteins ---- Coiled-coil domain-containing protein 54
Source.7714: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42
Source.7715: DFBPPR22622 ---- Animal proteins ---- Coiled-coil domain-containing glutamate-rich protein 1
Source.7716: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164
Source.7717: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B
Source.7718: DFBPPR22634 ---- Animal proteins ---- Testis-expressed protein 30
Source.7719: DFBPPR22637 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 61
Source.7720: DFBPPR22641 ---- Animal proteins ---- LIM domain only protein 3
Source.7721: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.7722: DFBPPR22655 ---- Animal proteins ---- Coiled-coil domain-containing protein 190
Source.7723: DFBPPR22663 ---- Animal proteins ---- Erythrodihydroneopterin triphosphate synthetase
Source.7724: DFBPPR22665 ---- Animal proteins ---- UPF0686 protein C11orf1 homolog
Source.7725: DFBPPR22668 ---- Animal proteins ---- Protein FAM243
Source.7726: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog
Source.7727: DFBPPR22679 ---- Animal proteins ---- MORN repeat-containing protein 3
Source.7728: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32
Source.7729: DFBPPR22684 ---- Animal proteins ---- Protein FAM204A
Source.7730: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C
Source.7731: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1
Source.7732: DFBPPR22689 ---- Animal proteins ---- Protein FAM166B
Source.7733: DFBPPR22692 ---- Animal proteins ---- Protein FAM229B
Source.7734: DFBPPR22697 ---- Animal proteins ---- MORN repeat-containing protein 2
Source.7735: DFBPPR22698 ---- Animal proteins ---- Protein FAM228A
Source.7736: DFBPPR22702 ---- Animal proteins ---- Coiled-coil domain-containing protein 83
Source.7737: DFBPPR22706 ---- Animal proteins ---- Uncharacterized protein C3orf38 homolog
Source.7738: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1
Source.7739: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16
Source.7740: DFBPPR22713 ---- Animal proteins ---- UPF0728 protein C10orf53 homolog
Source.7741: DFBPPR22714 ---- Animal proteins ---- Protein FAM71E1
Source.7742: DFBPPR22715 ---- Animal proteins ---- Spermatogenesis-associated protein 45
Source.7743: DFBPPR22717 ---- Animal proteins ---- FANCD2 opposite strand protein
Source.7744: DFBPPR22720 ---- Animal proteins ---- UPF0739 protein C1orf74 homolog
Source.7745: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog
Source.7746: DFBPPR22727 ---- Animal proteins ---- Uncharacterized protein C6orf163 homolog
Source.7747: DFBPPR22733 ---- Animal proteins ---- Armadillo-like helical domain containing protein 1
Source.7748: DFBPPR22735 ---- Animal proteins ---- NEDD4-binding protein 2-like 1
Source.7749: DFBPPR22737 ---- Animal proteins ---- UPF0705 protein C11orf49 homolog
Source.7750: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog
Source.7751: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.7752: DFBPPR22758 ---- Animal proteins ---- Uncharacterized protein C14orf28 homolog
Source.7753: DFBPPR22763 ---- Animal proteins ---- Uncharacterized protein C19orf71 homolog
Source.7754: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6
Source.7755: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.7756: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.7757: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.7758: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.7759: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.7760: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.7761: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.7762: DFBPPR8538 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.7763: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase
Source.7764: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.7765: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.7766: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.7767: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.7768: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.7769: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.7770: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.7771: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein
Source.7772: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.7773: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.7774: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6
Source.7775: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial
Source.7776: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.7777: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.7778: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.7779: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.7780: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.7781: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.7782: DFBPPR8570 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.7783: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.7784: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.7785: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.7786: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1
Source.7787: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.7788: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.7789: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.7790: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1
Source.7791: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.7792: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10
Source.7793: DFBPPR8585 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.7794: DFBPPR8586 ---- Animal proteins ---- Aurora kinase B
Source.7795: DFBPPR8590 ---- Animal proteins ---- Phospholipid hydroperoxide glutathione peroxidase
Source.7796: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.7797: DFBPPR8592 ---- Animal proteins ---- Interleukin-18
Source.7798: DFBPPR8593 ---- Animal proteins ---- Caveolin-1
Source.7799: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.7800: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.7801: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.7802: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha
Source.7803: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.7804: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1
Source.7805: DFBPPR8604 ---- Animal proteins ---- Alpha-synuclein
Source.7806: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.7807: DFBPPR8612 ---- Animal proteins ---- Peroxiredoxin-6
Source.7808: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.7809: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.7810: DFBPPR8616 ---- Animal proteins ---- Pleiotrophin
Source.7811: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.7812: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.7813: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.7814: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.7815: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.7816: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1
Source.7817: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.7818: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.7819: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.7820: DFBPPR8631 ---- Animal proteins ---- D-amino-acid oxidase
Source.7821: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.7822: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.7823: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor
Source.7824: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.7825: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.7826: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.7827: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1
Source.7828: DFBPPR8642 ---- Animal proteins ---- Major prion protein
Source.7829: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.7830: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.7831: DFBPPR8646 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.7832: DFBPPR8647 ---- Animal proteins ---- Beclin-1
Source.7833: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.7834: DFBPPR8649 ---- Animal proteins ---- Acrosin
Source.7835: DFBPPR8650 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.7836: DFBPPR8651 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.7837: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2
Source.7838: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.7839: DFBPPR8660 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.7840: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.7841: DFBPPR8663 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.7842: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.7843: DFBPPR8665 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta
Source.7844: DFBPPR8670 ---- Animal proteins ---- Aurora kinase A
Source.7845: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.7846: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1
Source.7847: DFBPPR8673 ---- Animal proteins ---- Calreticulin
Source.7848: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.7849: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.7850: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1
Source.7851: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.7852: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.7853: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.7854: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.7855: DFBPPR8683 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn]
Source.7856: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.7857: DFBPPR8687 ---- Animal proteins ---- Tumor necrosis factor
Source.7858: DFBPPR8689 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.7859: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.7860: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.7861: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6
Source.7862: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1
Source.7863: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.7864: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.7865: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.7866: DFBPPR8699 ---- Animal proteins ---- ADP-ribosylation factor 6
Source.7867: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.7868: DFBPPR8701 ---- Animal proteins ---- Myocyte-specific enhancer factor 2C
Source.7869: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.7870: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.7871: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.7872: DFBPPR8708 ---- Animal proteins ---- Macrophage migration inhibitory factor
Source.7873: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.7874: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.7875: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.7876: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.7877: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2
Source.7878: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.7879: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.7880: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C
Source.7881: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.7882: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.7883: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.7884: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1
Source.7885: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.7886: DFBPPR8731 ---- Animal proteins ---- Natriuretic peptides A
Source.7887: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.7888: DFBPPR8734 ---- Animal proteins ---- Clusterin
Source.7889: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.7890: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.7891: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.7892: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.7893: DFBPPR8744 ---- Animal proteins ---- Fibroblast growth factor 9
Source.7894: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.7895: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.7896: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.7897: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.7898: DFBPPR8750 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.7899: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.7900: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.7901: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.7902: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.7903: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I
Source.7904: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.7905: DFBPPR8760 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A
Source.7906: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.7907: DFBPPR8763 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit
Source.7908: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.7909: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.7910: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.7911: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase
Source.7912: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.7913: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.7914: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.7915: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.7916: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.7917: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.7918: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.7919: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.7920: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain
Source.7921: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.7922: DFBPPR8785 ---- Animal proteins ---- 40S ribosomal protein S3
Source.7923: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.7924: DFBPPR8787 ---- Animal proteins ---- Cathepsin D
Source.7925: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain
Source.7926: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.7927: DFBPPR8792 ---- Animal proteins ---- Plasminogen
Source.7928: DFBPPR8793 ---- Animal proteins ---- Histone H4
Source.7929: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.7930: DFBPPR8795 ---- Animal proteins ---- Pro-adrenomedullin
Source.7931: DFBPPR8797 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.7932: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.7933: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase
Source.7934: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.7935: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.7936: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.7937: DFBPPR8809 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.7938: DFBPPR8811 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.7939: DFBPPR8817 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.7940: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.7941: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.7942: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.7943: DFBPPR8827 ---- Animal proteins ---- Guanylate kinase
Source.7944: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase
Source.7945: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.7946: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5
Source.7947: DFBPPR8836 ---- Animal proteins ---- Myogenin
Source.7948: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.7949: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4
Source.7950: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.7951: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1
Source.7952: DFBPPR8843 ---- Animal proteins ---- Pepsin A
Source.7953: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.7954: DFBPPR8851 ---- Animal proteins ---- Vimentin
Source.7955: DFBPPR8852 ---- Animal proteins ---- Vimentin
Source.7956: DFBPPR8854 ---- Animal proteins ---- Vimentin
Source.7957: DFBPPR8855 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.7958: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.7959: DFBPPR8857 ---- Animal proteins ---- Allograft inflammatory factor 1
Source.7960: DFBPPR8861 ---- Animal proteins ---- Colipase
Source.7961: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide
Source.7962: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.7963: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2
Source.7964: DFBPPR8869 ---- Animal proteins ---- Muscarinic acetylcholine receptor M1
Source.7965: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.7966: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase
Source.7967: DFBPPR8875 ---- Animal proteins ---- C-type lectin domain family 5 member A
Source.7968: DFBPPR8876 ---- Animal proteins ---- C-type lectin domain family 5 member A
Source.7969: DFBPPR8877 ---- Animal proteins ---- C-type lectin domain family 5 member A
Source.7970: DFBPPR8879 ---- Animal proteins ---- Glandular kallikrein
Source.7971: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.7972: DFBPPR8886 ---- Animal proteins ---- Endothelin receptor type B
Source.7973: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.7974: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.7975: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor
Source.7976: DFBPPR8897 ---- Animal proteins ---- Cytochrome b
Source.7977: DFBPPR8898 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.7978: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1
Source.7979: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.7980: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.7981: DFBPPR8909 ---- Animal proteins ---- Chymotrypsin-like elastase family member 2A
Source.7982: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.7983: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.7984: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.7985: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.7986: DFBPPR8922 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.7987: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.7988: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.7989: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.7990: DFBPPR8932 ---- Animal proteins ---- ATPase inhibitor, mitochondrial
Source.7991: DFBPPR8933 ---- Animal proteins ---- ATPase inhibitor, mitochondrial
Source.7992: DFBPPR8939 ---- Animal proteins ---- Kit ligand
Source.7993: DFBPPR8940 ---- Animal proteins ---- Hemoglobin subunit beta
Source.7994: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.7995: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.7996: DFBPPR8951 ---- Animal proteins ---- ERO1-like protein alpha
Source.7997: DFBPPR8952 ---- Animal proteins ---- ERO1-like protein alpha
Source.7998: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.7999: DFBPPR8966 ---- Animal proteins ---- Calpain small subunit 1
Source.8000: DFBPPR8968 ---- Animal proteins ---- Vasopressin-neurophysin 2-copeptin
Source.8001: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.8002: DFBPPR8973 ---- Animal proteins ---- Caspase-3
Source.8003: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.8004: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.8005: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.8006: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1
Source.8007: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.8008: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.8009: DFBPPR8991 ---- Animal proteins ---- Cholecystokinin
Source.8010: DFBPPR8992 ---- Animal proteins ---- Hyaluronidase-3
Source.8011: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.8012: DFBPPR9009 ---- Animal proteins ---- Prostamide/prostaglandin F synthase
Source.8013: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.8014: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.8015: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.8016: DFBPPR9015 ---- Animal proteins ---- Serotransferrin
Source.8017: DFBPPR9016 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial
Source.8018: DFBPPR9018 ---- Animal proteins ---- Transthyretin
Source.8019: DFBPPR9019 ---- Animal proteins ---- Inositol monophosphatase 1
Source.8020: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.8021: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.8022: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.8023: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2
Source.8024: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.8025: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.8026: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.8027: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.8028: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.8029: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.8030: DFBPPR9038 ---- Animal proteins ---- C-type natriuretic peptide
Source.8031: DFBPPR9039 ---- Animal proteins ---- Desmin
Source.8032: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.8033: DFBPPR9042 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.8034: DFBPPR9044 ---- Animal proteins ---- Albumin
Source.8035: DFBPPR9046 ---- Animal proteins ---- Interferon regulatory factor 3
Source.8036: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80
Source.8037: DFBPPR9048 ---- Animal proteins ---- Neuroendocrine protein 7B2
Source.8038: DFBPPR9049 ---- Animal proteins ---- Integral membrane protein 2B
Source.8039: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.8040: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A
Source.8041: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.8042: DFBPPR9059 ---- Animal proteins ---- Alpha-crystallin A chain
Source.8043: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf
Source.8044: DFBPPR9062 ---- Animal proteins ---- Methylsterol monooxygenase 1
Source.8045: DFBPPR9063 ---- Animal proteins ---- Oxytocin-neurophysin 1
Source.8046: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.8047: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.8048: DFBPPR9069 ---- Animal proteins ---- E-selectin
Source.8049: DFBPPR9070 ---- Animal proteins ---- Angiopoietin-related protein 4
Source.8050: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.8051: DFBPPR9072 ---- Animal proteins ---- CD9 antigen
Source.8052: DFBPPR9073 ---- Animal proteins ---- Vitronectin
Source.8053: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.8054: DFBPPR9082 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.8055: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.8056: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.8057: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta
Source.8058: DFBPPR9089 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.8059: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.8060: DFBPPR9094 ---- Animal proteins ---- Aquaporin-5
Source.8061: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.8062: DFBPPR9100 ---- Animal proteins ---- Ras-related protein Rab-32
Source.8063: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.8064: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.8065: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.8066: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.8067: DFBPPR9109 ---- Animal proteins ---- Natriuretic peptides B
Source.8068: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial
Source.8069: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.8070: DFBPPR9113 ---- Animal proteins ---- Prophenin and tritrpticin precursor
Source.8071: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.8072: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.8073: DFBPPR9116 ---- Animal proteins ---- Cathepsin B
Source.8074: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.8075: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase
Source.8076: DFBPPR9121 ---- Animal proteins ---- Endoplasmin
Source.8077: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.8078: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.8079: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.8080: DFBPPR9128 ---- Animal proteins ---- Interleukin-13
Source.8081: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.8082: DFBPPR9134 ---- Animal proteins ---- Ras-related protein Rab-14
Source.8083: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A
Source.8084: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.8085: DFBPPR9137 ---- Animal proteins ---- Microsomal glutathione S-transferase 1
Source.8086: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.8087: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1
Source.8088: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1
Source.8089: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor
Source.8090: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.8091: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.8092: DFBPPR9149 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.8093: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.8094: DFBPPR9156 ---- Animal proteins ---- Diamine acetyltransferase 1
Source.8095: DFBPPR9160 ---- Animal proteins ---- Acylphosphatase-1
Source.8096: DFBPPR9161 ---- Animal proteins ---- Potassium voltage-gated channel subfamily E member 1
Source.8097: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.8098: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.8099: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.8100: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.8101: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein
Source.8102: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.8103: DFBPPR9174 ---- Animal proteins ---- Ficolin-1
Source.8104: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.8105: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6
Source.8106: DFBPPR9181 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.8107: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.8108: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1
Source.8109: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.8110: DFBPPR9185 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.8111: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.8112: DFBPPR9190 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.8113: DFBPPR9194 ---- Animal proteins ---- Arginase-1
Source.8114: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.8115: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.8116: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.8117: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.8118: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.8119: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10
Source.8120: DFBPPR9207 ---- Animal proteins ---- Beta-enolase
Source.8121: DFBPPR9209 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.8122: DFBPPR9210 ---- Animal proteins ---- 40S ribosomal protein S23
Source.8123: DFBPPR9211 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.8124: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1
Source.8125: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.8126: DFBPPR9215 ---- Animal proteins ---- Phosphomevalonate kinase
Source.8127: DFBPPR9216 ---- Animal proteins ---- Netrin-1
Source.8128: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.8129: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.8130: DFBPPR9221 ---- Animal proteins ---- Catalase
Source.8131: DFBPPR9222 ---- Animal proteins ---- Glutathione peroxidase 1
Source.8132: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.8133: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.8134: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.8135: DFBPPR9228 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.8136: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10
Source.8137: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.8138: DFBPPR9233 ---- Animal proteins ---- Integral membrane protein 2C
Source.8139: DFBPPR9235 ---- Animal proteins ---- Apomucin
Source.8140: DFBPPR9236 ---- Animal proteins ---- Radixin
Source.8141: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.8142: DFBPPR9239 ---- Animal proteins ---- Prophenin-2
Source.8143: DFBPPR9240 ---- Animal proteins ---- Thyrotropin subunit beta
Source.8144: DFBPPR9241 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.8145: DFBPPR9243 ---- Animal proteins ---- Cytochrome P450 3A29
Source.8146: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.8147: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.8148: DFBPPR9251 ---- Animal proteins ---- Methionine-R-sulfoxide reductase B1
Source.8149: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.8150: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor
Source.8151: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.8152: DFBPPR9258 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.8153: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.8154: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.8155: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase
Source.8156: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.8157: DFBPPR9265 ---- Animal proteins ---- Pantetheinase
Source.8158: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase
Source.8159: DFBPPR9269 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.8160: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.8161: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase
Source.8162: DFBPPR9275 ---- Animal proteins ---- Hemoglobin subunit epsilon
Source.8163: DFBPPR9276 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.8164: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3
Source.8165: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.8166: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.8167: DFBPPR9294 ---- Animal proteins ---- 60S ribosomal protein L10
Source.8168: DFBPPR9295 ---- Animal proteins ---- Ribonuclease T2
Source.8169: DFBPPR9296 ---- Animal proteins ---- Transcobalamin-1
Source.8170: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4
Source.8171: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.8172: DFBPPR9300 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.8173: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase
Source.8174: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2
Source.8175: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.8176: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.8177: DFBPPR9307 ---- Animal proteins ---- Epididymal sperm-binding protein 1
Source.8178: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.8179: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.8180: DFBPPR9314 ---- Animal proteins ---- Regucalcin
Source.8181: DFBPPR9316 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.8182: DFBPPR9319 ---- Animal proteins ---- Myelin basic protein
Source.8183: DFBPPR9320 ---- Animal proteins ---- Aromatase 1
Source.8184: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.8185: DFBPPR9323 ---- Animal proteins ---- Lymphotoxin-alpha
Source.8186: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.8187: DFBPPR9327 ---- Animal proteins ---- Multicilin
Source.8188: DFBPPR9329 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2
Source.8189: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor
Source.8190: DFBPPR9334 ---- Animal proteins ---- Seminal plasma acrosin inhibitor A1
Source.8191: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase
Source.8192: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase
Source.8193: DFBPPR9338 ---- Animal proteins ---- SPARC
Source.8194: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.8195: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.8196: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.8197: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1
Source.8198: DFBPPR9348 ---- Animal proteins ---- 60S ribosomal protein L18
Source.8199: DFBPPR9349 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.8200: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.8201: DFBPPR9354 ---- Animal proteins ---- D(1A) dopamine receptor
Source.8202: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.8203: DFBPPR9359 ---- Animal proteins ---- Thialysine N-epsilon-acetyltransferase
Source.8204: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein
Source.8205: DFBPPR9363 ---- Animal proteins ---- Moesin
Source.8206: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.8207: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.8208: DFBPPR9369 ---- Animal proteins ---- Nuclear receptor subfamily 6 group A member 1
Source.8209: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.8210: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.8211: DFBPPR9374 ---- Animal proteins ---- Casein kinase II subunit beta
Source.8212: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.8213: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor
Source.8214: DFBPPR9377 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.8215: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.8216: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1
Source.8217: DFBPPR9381 ---- Animal proteins ---- Alpha-crystallin B chain
Source.8218: DFBPPR9385 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.8219: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D
Source.8220: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4
Source.8221: DFBPPR9391 ---- Animal proteins ---- 60S ribosomal protein L11
Source.8222: DFBPPR9392 ---- Animal proteins ---- mRNA export factor
Source.8223: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.8224: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase
Source.8225: DFBPPR9395 ---- Animal proteins ---- Calponin-2
Source.8226: DFBPPR9396 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.8227: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.8228: DFBPPR9399 ---- Animal proteins ---- High affinity copper uptake protein 1
Source.8229: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.8230: DFBPPR9404 ---- Animal proteins ---- Tryptase
Source.8231: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.8232: DFBPPR9408 ---- Animal proteins ---- CD70 antigen
Source.8233: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.8234: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.8235: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.8236: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2
Source.8237: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase
Source.8238: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.8239: DFBPPR9420 ---- Animal proteins ---- B1 bradykinin receptor
Source.8240: DFBPPR9422 ---- Animal proteins ---- C-C motif chemokine 25
Source.8241: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.8242: DFBPPR9425 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.8243: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.8244: DFBPPR9433 ---- Animal proteins ---- Autophagy protein 5
Source.8245: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.8246: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.8247: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.8248: DFBPPR9448 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.8249: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.8250: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.8251: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.8252: DFBPPR9456 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.8253: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase
Source.8254: DFBPPR9461 ---- Animal proteins ---- CCN family member 2
Source.8255: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.8256: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.8257: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1
Source.8258: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type
Source.8259: DFBPPR9484 ---- Animal proteins ---- Macoilin
Source.8260: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.8261: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14
Source.8262: DFBPPR9497 ---- Animal proteins ---- Myoglobin
Source.8263: DFBPPR9500 ---- Animal proteins ---- 40S ribosomal protein S29
Source.8264: DFBPPR9502 ---- Animal proteins ---- Endothelin-1 receptor
Source.8265: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1
Source.8266: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2
Source.8267: DFBPPR9505 ---- Animal proteins ---- Cytochrome c oxidase subunit 7C, mitochondrial
Source.8268: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.8269: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa
Source.8270: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.8271: DFBPPR9511 ---- Animal proteins ---- Cholinesterase
Source.8272: DFBPPR9512 ---- Animal proteins ---- Acylphosphatase-2
Source.8273: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3
Source.8274: DFBPPR9517 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.8275: DFBPPR9521 ---- Animal proteins ---- Endothelin-3
Source.8276: DFBPPR9525 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.8277: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase
Source.8278: DFBPPR9531 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.8279: DFBPPR9538 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.8280: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase
Source.8281: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic
Source.8282: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha
Source.8283: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.8284: DFBPPR9551 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.8285: DFBPPR9554 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.8286: DFBPPR9561 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.8287: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.8288: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1
Source.8289: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.8290: DFBPPR9567 ---- Animal proteins ---- Aquaporin-3
Source.8291: DFBPPR9569 ---- Animal proteins ---- Myelin proteolipid protein
Source.8292: DFBPPR9570 ---- Animal proteins ---- Gastrokine-1
Source.8293: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.8294: DFBPPR9575 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.8295: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase
Source.8296: DFBPPR9578 ---- Animal proteins ---- Biglycan
Source.8297: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.8298: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.8299: DFBPPR9589 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein A
Source.8300: DFBPPR9590 ---- Animal proteins ---- Bax inhibitor 1
Source.8301: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.8302: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin
Source.8303: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.8304: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.8305: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.8306: DFBPPR9607 ---- Animal proteins ---- F-actin-capping protein subunit beta
Source.8307: DFBPPR9609 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.8308: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.8309: DFBPPR9614 ---- Animal proteins ---- Myosin regulatory light chain 2, atrial isoform
Source.8310: DFBPPR9615 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit
Source.8311: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.8312: DFBPPR9622 ---- Animal proteins ---- Calcitonin
Source.8313: DFBPPR9623 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2
Source.8314: DFBPPR9624 ---- Animal proteins ---- Cadherin-3
Source.8315: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.8316: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.8317: DFBPPR9635 ---- Animal proteins ---- Cytochrome b561
Source.8318: DFBPPR9638 ---- Animal proteins ---- Troponin T, slow skeletal muscle
Source.8319: DFBPPR9640 ---- Animal proteins ---- Actin-binding Rho-activating protein
Source.8320: DFBPPR9644 ---- Animal proteins ---- Lambda-crystallin homolog
Source.8321: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.8322: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1
Source.8323: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial
Source.8324: DFBPPR9659 ---- Animal proteins ---- Placenta-expressed transcript 1 protein
Source.8325: DFBPPR9660 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2
Source.8326: DFBPPR9661 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial
Source.8327: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.8328: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.8329: DFBPPR9668 ---- Animal proteins ---- Reactive oxygen species modulator 1
Source.8330: DFBPPR9670 ---- Animal proteins ---- NF-kappa-B inhibitor-like protein 1
Source.8331: DFBPPR9672 ---- Animal proteins ---- Elongation factor 1-beta
Source.8332: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2
Source.8333: DFBPPR9678 ---- Animal proteins ---- Neuropeptide W
Source.8334: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.8335: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase
Source.8336: DFBPPR9689 ---- Animal proteins ---- G-protein coupled receptor 4
Source.8337: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein
Source.8338: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.8339: DFBPPR9699 ---- Animal proteins ---- Angiopoietin-1
Source.8340: DFBPPR9700 ---- Animal proteins ---- Galectin-1
Source.8341: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.8342: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.8343: DFBPPR9704 ---- Animal proteins ---- Hemoglobin subunit theta
Source.8344: DFBPPR9707 ---- Animal proteins ---- Interleukin-7
Source.8345: DFBPPR9708 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7
Source.8346: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.8347: DFBPPR9710 ---- Animal proteins ---- Gastricsin
Source.8348: DFBPPR9712 ---- Animal proteins ---- Signal peptidase complex subunit 1
Source.8349: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.8350: DFBPPR9717 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.8351: DFBPPR9719 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.8352: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.8353: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.8354: DFBPPR9736 ---- Animal proteins ---- Metaxin-1
Source.8355: DFBPPR9737 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 7
Source.8356: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2
Source.8357: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.8358: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.8359: DFBPPR9750 ---- Animal proteins ---- 60S ribosome subunit biogenesis protein NIP7 homolog
Source.8360: DFBPPR9752 ---- Animal proteins ---- GPN-loop GTPase 2
Source.8361: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.8362: DFBPPR9760 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.8363: DFBPPR9762 ---- Animal proteins ---- Prenylated Rab acceptor protein 1
Source.8364: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform
Source.8365: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.8366: DFBPPR9771 ---- Animal proteins ---- 60S ribosomal protein L5
Source.8367: DFBPPR9776 ---- Animal proteins ---- Zinc finger protein PLAGL1
Source.8368: DFBPPR9784 ---- Animal proteins ---- Translocator protein
Source.8369: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.8370: DFBPPR9791 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.8371: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2
Source.8372: DFBPPR9803 ---- Animal proteins ---- 60S ribosomal protein L3
Source.8373: DFBPPR9807 ---- Animal proteins ---- Galectin-4
Source.8374: DFBPPR9810 ---- Animal proteins ---- 40S ribosomal protein S16
Source.8375: DFBPPR9813 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.8376: DFBPPR9814 ---- Animal proteins ---- Testin
Source.8377: DFBPPR9816 ---- Animal proteins ---- Metaxin-2
Source.8378: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.8379: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1
Source.8380: DFBPPR9828 ---- Animal proteins ---- Dynein light chain 4, axonemal
Source.8381: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.8382: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.8383: DFBPPR9834 ---- Animal proteins ---- Interferon-related developmental regulator 1
Source.8384: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3
Source.8385: DFBPPR9839 ---- Animal proteins ---- Nurim
Source.8386: DFBPPR9841 ---- Animal proteins ---- Interleukin-10
Source.8387: DFBPPR9843 ---- Animal proteins ---- P protein
Source.8388: DFBPPR9846 ---- Animal proteins ---- Nociceptin
Source.8389: DFBPPR9848 ---- Animal proteins ---- Nicotinamide N-methyltransferase
Source.8390: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.8391: DFBPPR9856 ---- Animal proteins ---- 60S acidic ribosomal protein P1
Source.8392: DFBPPR9860 ---- Animal proteins ---- Transcription factor 19
Source.8393: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.8394: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.8395: DFBPPR9868 ---- Animal proteins ---- Integrin beta-1-binding protein 2
Source.8396: DFBPPR9869 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.8397: DFBPPR9870 ---- Animal proteins ---- 40S ribosomal protein S17
Source.8398: DFBPPR9872 ---- Animal proteins ---- Transmembrane protein 14A
Source.8399: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.8400: DFBPPR9874 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1
Source.8401: DFBPPR9877 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.8402: DFBPPR9878 ---- Animal proteins ---- Selenoprotein F
Source.8403: DFBPPR9890 ---- Animal proteins ---- 60S acidic ribosomal protein P2
Source.8404: DFBPPR9896 ---- Animal proteins ---- Pepsin B
Source.8405: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.8406: DFBPPR9901 ---- Animal proteins ---- 40S ribosomal protein S14
Source.8407: DFBPPR9903 ---- Animal proteins ---- Cyclin-G1
Source.8408: DFBPPR9904 ---- Animal proteins ---- EKC/KEOPS complex subunit GON7
Source.8409: DFBPPR9905 ---- Animal proteins ---- DnaJ homolog subfamily C member 5B
Source.8410: DFBPPR9909 ---- Animal proteins ---- Tetraspanin-31
Source.8411: DFBPPR9916 ---- Animal proteins ---- Proteasome activator complex subunit 1
Source.8412: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.8413: DFBPPR9925 ---- Animal proteins ---- Corneodesmosin
Source.8414: DFBPPR9927 ---- Animal proteins ---- Protein BTG3
Source.8415: DFBPPR9928 ---- Animal proteins ---- Galectin-2
Source.8416: DFBPPR9934 ---- Animal proteins ---- Heme-binding protein 1
Source.8417: DFBPPR9935 ---- Animal proteins ---- 40S ribosomal protein S30
Source.8418: DFBPPR9938 ---- Animal proteins ---- FUN14 domain-containing protein 2
Source.8419: DFBPPR9941 ---- Animal proteins ---- 60S ribosomal protein L7-like 1
Source.8420: DFBPPR9944 ---- Animal proteins ---- 60S ribosomal protein L27a
Source.8421: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3
Source.8422: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.8423: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.8424: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.8425: DFBPPR9957 ---- Animal proteins ---- Ovoinhibitor
Source.8426: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase
Source.8427: DFBPPR9961 ---- Animal proteins ---- Somatotropin
Source.8428: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.8429: DFBPPR9965 ---- Animal proteins ---- Lysozyme C
Source.8430: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.8431: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor
Source.8432: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin
Source.8433: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.8434: DFBPPR9975 ---- Animal proteins ---- Interleukin-10
Source.8435: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.8436: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.8437: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.8438: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.8439: DFBPPR9982 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.8440: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.8441: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.8442: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.8443: DFBPPR9993 ---- Animal proteins ---- Ovalbumin
Source.8444: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.8445: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.8446: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.8447: DFBPPR9999 ---- Animal proteins ---- Apoptosis regulator Bcl-2
Source.8448: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain
Source.8449: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type
Source.8450: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.8451: DFBPPR10005 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn]
Source.8452: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1
Source.8453: DFBPPR10007 ---- Animal proteins ---- Protein Wnt-1
Source.8454: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b
Source.8455: DFBPPR10009 ---- Animal proteins ---- Transthyretin
Source.8456: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.8457: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16
Source.8458: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src
Source.8459: DFBPPR10014 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF13
Source.8460: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.8461: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx
Source.8462: DFBPPR10020 ---- Animal proteins ---- PDZ and LIM domain protein 7
Source.8463: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.8464: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.8465: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B
Source.8466: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.8467: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.8468: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.8469: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A
Source.8470: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.8471: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta
Source.8472: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.8473: DFBPPR10044 ---- Animal proteins ---- Histone H4
Source.8474: DFBPPR10045 ---- Animal proteins ---- Albumin
Source.8475: DFBPPR10046 ---- Animal proteins ---- Gallinacin-2
Source.8476: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.8477: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.8478: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.8479: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.8480: DFBPPR10055 ---- Animal proteins ---- Protein Wnt-3a
Source.8481: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1
Source.8482: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4
Source.8483: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase
Source.8484: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.8485: DFBPPR10064 ---- Animal proteins ---- Pleiotrophin
Source.8486: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC
Source.8487: DFBPPR10066 ---- Animal proteins ---- Peroxiredoxin-6
Source.8488: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.8489: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.8490: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase
Source.8491: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1
Source.8492: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.8493: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.8494: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.8495: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor
Source.8496: DFBPPR10082 ---- Animal proteins ---- Pinopsin
Source.8497: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.8498: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.8499: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.8500: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2
Source.8501: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.8502: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.8503: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.8504: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.8505: DFBPPR10098 ---- Animal proteins ---- Mucin-6
Source.8506: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1
Source.8507: DFBPPR10100 ---- Animal proteins ---- STIP1 homology and U box-containing protein 1
Source.8508: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.8509: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.8510: DFBPPR10105 ---- Animal proteins ---- ADP-ribosylation factor 6
Source.8511: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.8512: DFBPPR10107 ---- Animal proteins ---- Ovomucoid
Source.8513: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7
Source.8514: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase
Source.8515: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2
Source.8516: DFBPPR10113 ---- Animal proteins ---- Cysteine and glycine-rich protein 1
Source.8517: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.8518: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.8519: DFBPPR10118 ---- Animal proteins ---- GATA-binding factor 3
Source.8520: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.8521: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.8522: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3
Source.8523: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.8524: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.8525: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase
Source.8526: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.8527: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1
Source.8528: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.8529: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.8530: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase
Source.8531: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.8532: DFBPPR10137 ---- Animal proteins ---- Growth/differentiation factor 8
Source.8533: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor
Source.8534: DFBPPR10139 ---- Animal proteins ---- Cytochrome b
Source.8535: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.8536: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.8537: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.8538: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.8539: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.8540: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.8541: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.8542: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.8543: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor
Source.8544: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.8545: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.8546: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5
Source.8547: DFBPPR10157 ---- Animal proteins ---- CD40 ligand
Source.8548: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog
Source.8549: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1
Source.8550: DFBPPR10160 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.8551: DFBPPR10163 ---- Animal proteins ---- Annexin A6
Source.8552: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8
Source.8553: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.8554: DFBPPR10170 ---- Animal proteins ---- Drebrin
Source.8555: DFBPPR10171 ---- Animal proteins ---- Heterochromatin-associated protein MENT
Source.8556: DFBPPR10172 ---- Animal proteins ---- Basic helix-loop-helix transcription factor scleraxis
Source.8557: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.8558: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2
Source.8559: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.8560: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5
Source.8561: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.8562: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.8563: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.8564: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1
Source.8565: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.8566: DFBPPR10184 ---- Animal proteins ---- LIM/homeobox protein Lhx1
Source.8567: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.8568: DFBPPR10187 ---- Animal proteins ---- Myogenin
Source.8569: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.8570: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2
Source.8571: DFBPPR10191 ---- Animal proteins ---- Src substrate protein p85
Source.8572: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.8573: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk
Source.8574: DFBPPR10195 ---- Animal proteins ---- SUMO-conjugating enzyme UBC9
Source.8575: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.8576: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.8577: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.8578: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.8579: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.8580: DFBPPR10203 ---- Animal proteins ---- Protein/nucleic acid deglycase DJ-1
Source.8581: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.8582: DFBPPR10205 ---- Animal proteins ---- Noelin
Source.8583: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.8584: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.8585: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.8586: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.8587: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.8588: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1
Source.8589: DFBPPR10215 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.8590: DFBPPR10219 ---- Animal proteins ---- Presenilin-1
Source.8591: DFBPPR10220 ---- Animal proteins ---- Paxillin
Source.8592: DFBPPR10222 ---- Animal proteins ---- Podocalyxin
Source.8593: DFBPPR10223 ---- Animal proteins ---- Retinoic acid receptor alpha
Source.8594: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.8595: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1
Source.8596: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11
Source.8597: DFBPPR10228 ---- Animal proteins ---- Presenilin-2
Source.8598: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.8599: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.8600: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.8601: DFBPPR10235 ---- Animal proteins ---- Fibroblast growth factor 8
Source.8602: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.8603: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1
Source.8604: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2
Source.8605: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.8606: DFBPPR10240 ---- Animal proteins ---- Cerberus
Source.8607: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.8608: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase
Source.8609: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4
Source.8610: DFBPPR10246 ---- Animal proteins ---- Heat shock protein beta-1
Source.8611: DFBPPR10247 ---- Animal proteins ---- Actin filament-associated protein 1
Source.8612: DFBPPR10248 ---- Animal proteins ---- Mitotic spindle assembly checkpoint protein MAD2B
Source.8613: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1
Source.8614: DFBPPR10250 ---- Animal proteins ---- Macrophage migration inhibitory factor
Source.8615: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.8616: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1
Source.8617: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.8618: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6
Source.8619: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.8620: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.8621: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.8622: DFBPPR10260 ---- Animal proteins ---- F-actin-capping protein subunit beta isoforms 1 and 2
Source.8623: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1
Source.8624: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.8625: DFBPPR10264 ---- Animal proteins ---- Fibroblast growth factor 1
Source.8626: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.8627: DFBPPR10267 ---- Animal proteins ---- Gephyrin
Source.8628: DFBPPR10268 ---- Animal proteins ---- CD166 antigen
Source.8629: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1
Source.8630: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.8631: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2
Source.8632: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.8633: DFBPPR10274 ---- Animal proteins ---- CCN family member 1
Source.8634: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.8635: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.8636: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.8637: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.8638: DFBPPR10280 ---- Animal proteins ---- Cytochrome c
Source.8639: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.8640: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.8641: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.8642: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6
Source.8643: DFBPPR10286 ---- Animal proteins ---- Avidin
Source.8644: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.8645: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.8646: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.8647: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2
Source.8648: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.8649: DFBPPR10296 ---- Animal proteins ---- Mucin-5B
Source.8650: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.8651: DFBPPR10298 ---- Animal proteins ---- Caldesmon
Source.8652: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.8653: DFBPPR10302 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1
Source.8654: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.8655: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.8656: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.8657: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1
Source.8658: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.8659: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.8660: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.8661: DFBPPR10311 ---- Animal proteins ---- Homeobox protein engrailed-2
Source.8662: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.8663: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.8664: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.8665: DFBPPR10317 ---- Animal proteins ---- Nucleophosmin
Source.8666: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1
Source.8667: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.8668: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7
Source.8669: DFBPPR10325 ---- Animal proteins ---- Alpha-crystallin B chain
Source.8670: DFBPPR10326 ---- Animal proteins ---- Alpha-crystallin A chain
Source.8671: DFBPPR10327 ---- Animal proteins ---- Proheparin-binding EGF-like growth factor
Source.8672: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.8673: DFBPPR10333 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.8674: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.8675: DFBPPR10336 ---- Animal proteins ---- Rho-related GTP-binding protein RhoC
Source.8676: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.8677: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.8678: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.8679: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1
Source.8680: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.8681: DFBPPR10349 ---- Animal proteins ---- Leiomodin-2
Source.8682: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.8683: DFBPPR10352 ---- Animal proteins ---- Hemoglobin subunit beta
Source.8684: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.8685: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.8686: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2
Source.8687: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase
Source.8688: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.8689: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.8690: DFBPPR10361 ---- Animal proteins ---- Protein HIRA
Source.8691: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.8692: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.8693: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR
Source.8694: DFBPPR10366 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.8695: DFBPPR10367 ---- Animal proteins ---- RNA-binding protein 24
Source.8696: DFBPPR10368 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.8697: DFBPPR10369 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.8698: DFBPPR10376 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.8699: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.8700: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.8701: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1
Source.8702: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.8703: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2
Source.8704: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.8705: DFBPPR10391 ---- Animal proteins ---- Annexin A5
Source.8706: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65
Source.8707: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.8708: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.8709: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.8710: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.8711: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.8712: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.8713: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.8714: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.8715: DFBPPR10405 ---- Animal proteins ---- Ras-related protein Rab-8A
Source.8716: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.8717: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.8718: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.8719: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.8720: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.8721: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.8722: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.8723: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5
Source.8724: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin
Source.8725: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.8726: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin
Source.8727: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.8728: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.8729: DFBPPR10424 ---- Animal proteins ---- Charged multivesicular body protein 4b
Source.8730: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.8731: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10
Source.8732: DFBPPR10427 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle major isoform
Source.8733: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.8734: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.8735: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.8736: DFBPPR10433 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.8737: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.8738: DFBPPR10436 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.8739: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16
Source.8740: DFBPPR10441 ---- Animal proteins ---- Laminin subunit beta-1
Source.8741: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.8742: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2
Source.8743: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.8744: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c
Source.8745: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.8746: DFBPPR10449 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.8747: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.8748: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.8749: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.8750: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.8751: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.8752: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.8753: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.8754: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.8755: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.8756: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.8757: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.8758: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1
Source.8759: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.8760: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.8761: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.8762: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.8763: DFBPPR10477 ---- Animal proteins ---- Aprataxin
Source.8764: DFBPPR10480 ---- Animal proteins ---- Cathepsin D
Source.8765: DFBPPR10481 ---- Animal proteins ---- Syndecan-3
Source.8766: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.8767: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.8768: DFBPPR10484 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe
Source.8769: DFBPPR10485 ---- Animal proteins ---- LIM domain-binding protein 1
Source.8770: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2
Source.8771: DFBPPR10487 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2
Source.8772: DFBPPR10490 ---- Animal proteins ---- Tudor-interacting repair regulator protein
Source.8773: DFBPPR10491 ---- Animal proteins ---- Neuronal calcium sensor 1
Source.8774: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.8775: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.8776: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.8777: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.8778: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon
Source.8779: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.8780: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.8781: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.8782: DFBPPR10508 ---- Animal proteins ---- Septin-2
Source.8783: DFBPPR10511 ---- Animal proteins ---- Vitellogenin-3
Source.8784: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.8785: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.8786: DFBPPR10515 ---- Animal proteins ---- Cathelicidin-2
Source.8787: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.8788: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.8789: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2
Source.8790: DFBPPR10521 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.8791: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.8792: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.8793: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase
Source.8794: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2
Source.8795: DFBPPR10527 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1
Source.8796: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.8797: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.8798: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.8799: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.8800: DFBPPR10535 ---- Animal proteins ---- Protein SPT2 homolog
Source.8801: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.8802: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.8803: DFBPPR10541 ---- Animal proteins ---- Glypican-1
Source.8804: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor
Source.8805: DFBPPR10544 ---- Animal proteins ---- Thioredoxin
Source.8806: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.8807: DFBPPR10550 ---- Animal proteins ---- Flap endonuclease 1
Source.8808: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.8809: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.8810: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.8811: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.8812: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2
Source.8813: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.8814: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.8815: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.8816: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2
Source.8817: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.8818: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.8819: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.8820: DFBPPR10567 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial
Source.8821: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase
Source.8822: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.8823: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b
Source.8824: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.8825: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.8826: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase
Source.8827: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.8828: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.8829: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.8830: DFBPPR10584 ---- Animal proteins ---- Nuclear distribution protein nudE homolog 1
Source.8831: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.8832: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.8833: DFBPPR10591 ---- Animal proteins ---- Beta,beta-carotene 15,15'-dioxygenase
Source.8834: DFBPPR10592 ---- Animal proteins ---- Ras-related protein Rab-14
Source.8835: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6
Source.8836: DFBPPR10594 ---- Animal proteins ---- Aromatase
Source.8837: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit
Source.8838: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.8839: DFBPPR10597 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase B
Source.8840: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain
Source.8841: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.8842: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.8843: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.8844: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.8845: DFBPPR10605 ---- Animal proteins ---- Elastin
Source.8846: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.8847: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.8848: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D
Source.8849: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.8850: DFBPPR10611 ---- Animal proteins ---- Inhibitor of growth protein 4
Source.8851: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.8852: DFBPPR10613 ---- Animal proteins ---- Diamine acetyltransferase 1
Source.8853: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.8854: DFBPPR10616 ---- Animal proteins ---- Cholecystokinin
Source.8855: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6
Source.8856: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.8857: DFBPPR10619 ---- Animal proteins ---- Adenosine receptor A2b
Source.8858: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1
Source.8859: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin
Source.8860: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.8861: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.8862: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.8863: DFBPPR10629 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.8864: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.8865: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai
Source.8866: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase
Source.8867: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.8868: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.8869: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3
Source.8870: DFBPPR10640 ---- Animal proteins ---- Caveolin-1
Source.8871: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.8872: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.8873: DFBPPR10644 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.8874: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5
Source.8875: DFBPPR10646 ---- Animal proteins ---- Netrin-1
Source.8876: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.8877: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.8878: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1
Source.8879: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.8880: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.8881: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.8882: DFBPPR10655 ---- Animal proteins ---- DBH-like monooxygenase protein 1
Source.8883: DFBPPR10656 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.8884: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.8885: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial
Source.8886: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.8887: DFBPPR10660 ---- Animal proteins ---- Tsukushin
Source.8888: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.8889: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase
Source.8890: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.8891: DFBPPR10665 ---- Animal proteins ---- Mitochondrial fission regulator 1
Source.8892: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.8893: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.8894: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.8895: DFBPPR10672 ---- Animal proteins ---- Nibrin
Source.8896: DFBPPR10674 ---- Animal proteins ---- Myelin basic protein
Source.8897: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin
Source.8898: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.8899: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.8900: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.8901: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.8902: DFBPPR10683 ---- Animal proteins ---- Histone H4 type VIII
Source.8903: DFBPPR10684 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.8904: DFBPPR10685 ---- Animal proteins ---- Cellular retinoic acid-binding protein 1
Source.8905: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.8906: DFBPPR10691 ---- Animal proteins ---- Beclin-1
Source.8907: DFBPPR10692 ---- Animal proteins ---- Protein Wnt-9a
Source.8908: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.8909: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.8910: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.8911: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.8912: DFBPPR10700 ---- Animal proteins ---- BTB/POZ domain-containing adapter for CUL3-mediated RhoA degradation protein 2
Source.8913: DFBPPR10701 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.8914: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.8915: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2
Source.8916: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.8917: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.8918: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.8919: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.8920: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.8921: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.8922: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.8923: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase
Source.8924: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9
Source.8925: DFBPPR10715 ---- Animal proteins ---- Lumican
Source.8926: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.8927: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1
Source.8928: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.8929: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog
Source.8930: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.8931: DFBPPR10723 ---- Animal proteins ---- Interferon regulatory factor 8
Source.8932: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2
Source.8933: DFBPPR10727 ---- Animal proteins ---- Vimentin
Source.8934: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.8935: DFBPPR10731 ---- Animal proteins ---- Protein cereblon
Source.8936: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.8937: DFBPPR10733 ---- Animal proteins ---- Ras-related protein Rab-6A
Source.8938: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.8939: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1
Source.8940: DFBPPR10739 ---- Animal proteins ---- Transcription factor SOX-14
Source.8941: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.8942: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.8943: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.8944: DFBPPR10746 ---- Animal proteins ---- P2Y purinoceptor 1
Source.8945: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.8946: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.8947: DFBPPR10749 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.8948: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.8949: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.8950: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4
Source.8951: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.8952: DFBPPR10757 ---- Animal proteins ---- Hemoglobin subunit epsilon
Source.8953: DFBPPR10759 ---- Animal proteins ---- Phosphoethanolamine/phosphocholine phosphatase
Source.8954: DFBPPR10760 ---- Animal proteins ---- Fatty acid-binding protein, liver
Source.8955: DFBPPR10762 ---- Animal proteins ---- Cadherin-6
Source.8956: DFBPPR10764 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX6
Source.8957: DFBPPR10765 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.8958: DFBPPR10766 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 5
Source.8959: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.8960: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.8961: DFBPPR10769 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.8962: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.8963: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.8964: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.8965: DFBPPR10778 ---- Animal proteins ---- Avidin-related protein 2
Source.8966: DFBPPR10779 ---- Animal proteins ---- Natriuretic peptides A
Source.8967: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain
Source.8968: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.8969: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe
Source.8970: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase
Source.8971: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.8972: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.8973: DFBPPR10796 ---- Animal proteins ---- Protrudin
Source.8974: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12
Source.8975: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.8976: DFBPPR10799 ---- Animal proteins ---- Adenylosuccinate lyase
Source.8977: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1
Source.8978: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.8979: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.8980: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.8981: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.8982: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.8983: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.8984: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.8985: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.8986: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.8987: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.8988: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.8989: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain
Source.8990: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.8991: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha
Source.8992: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.8993: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.8994: DFBPPR10825 ---- Animal proteins ---- Collagen alpha-3(IX) chain
Source.8995: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1
Source.8996: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.8997: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.8998: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa
Source.8999: DFBPPR10836 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.9000: DFBPPR10838 ---- Animal proteins ---- Protein lin-28 homolog A
Source.9001: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.9002: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5
Source.9003: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1
Source.9004: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.9005: DFBPPR10849 ---- Animal proteins ---- Fatty acid-binding protein, brain
Source.9006: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.9007: DFBPPR10851 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.9008: DFBPPR10852 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.9009: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.9010: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.9011: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26
Source.9012: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.9013: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.9014: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.9015: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.9016: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase
Source.9017: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11
Source.9018: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.9019: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2
Source.9020: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.9021: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.9022: DFBPPR10875 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.9023: DFBPPR10878 ---- Animal proteins ---- Zinc finger protein DPF3
Source.9024: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain
Source.9025: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.9026: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.9027: DFBPPR10885 ---- Animal proteins ---- Pepsin A
Source.9028: DFBPPR10887 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.9029: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.9030: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1
Source.9031: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.9032: DFBPPR10892 ---- Animal proteins ---- Myogenic factor 5
Source.9033: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.9034: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.9035: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.9036: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.9037: DFBPPR10900 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.9038: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.9039: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2
Source.9040: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12
Source.9041: DFBPPR10911 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.9042: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.9043: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.9044: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.9045: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.9046: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1
Source.9047: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3
Source.9048: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B
Source.9049: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.9050: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.9051: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48
Source.9052: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1
Source.9053: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.9054: DFBPPR10938 ---- Animal proteins ---- Serine/threonine-protein kinase mos
Source.9055: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.9056: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.9057: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2
Source.9058: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.9059: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.9060: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.9061: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.9062: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2
Source.9063: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y
Source.9064: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor
Source.9065: DFBPPR10952 ---- Animal proteins ---- Protein XRP2
Source.9066: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta
Source.9067: DFBPPR10957 ---- Animal proteins ---- Hemoglobin subunit rho
Source.9068: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta
Source.9069: DFBPPR10962 ---- Animal proteins ---- Endophilin-A1
Source.9070: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.9071: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.9072: DFBPPR10965 ---- Animal proteins ---- Nuclear factor 1 X-type
Source.9073: DFBPPR10966 ---- Animal proteins ---- Nuclear cap-binding protein subunit 2
Source.9074: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2
Source.9075: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1
Source.9076: DFBPPR10970 ---- Animal proteins ---- Prohibitin
Source.9077: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo
Source.9078: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.9079: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1
Source.9080: DFBPPR10976 ---- Animal proteins ---- Lamin-B2
Source.9081: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.9082: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.9083: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.9084: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.9085: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8
Source.9086: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase
Source.9087: DFBPPR10987 ---- Animal proteins ---- Charged multivesicular body protein 6
Source.9088: DFBPPR10988 ---- Animal proteins ---- Midkine
Source.9089: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.9090: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.9091: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.9092: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.9093: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.9094: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.9095: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1
Source.9096: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3
Source.9097: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.9098: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit
Source.9099: DFBPPR11008 ---- Animal proteins ---- Homeobox protein NANOG
Source.9100: DFBPPR11011 ---- Animal proteins ---- Epigen
Source.9101: DFBPPR11012 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.9102: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.9103: DFBPPR11015 ---- Animal proteins ---- Myeloid protein 1
Source.9104: DFBPPR11017 ---- Animal proteins ---- Collectin-12
Source.9105: DFBPPR11020 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 2
Source.9106: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.9107: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor
Source.9108: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.9109: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu
Source.9110: DFBPPR11029 ---- Animal proteins ---- Myelin proteolipid protein
Source.9111: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.9112: DFBPPR11035 ---- Animal proteins ---- Protein Dr1
Source.9113: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1
Source.9114: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.9115: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.9116: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.9117: DFBPPR11042 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.9118: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.9119: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha
Source.9120: DFBPPR11047 ---- Animal proteins ---- Nucleolin
Source.9121: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.9122: DFBPPR11051 ---- Animal proteins ---- Signal peptidase complex subunit 3
Source.9123: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.9124: DFBPPR11055 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.9125: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13
Source.9126: DFBPPR11057 ---- Animal proteins ---- Calcitonin gene-related peptide
Source.9127: DFBPPR11060 ---- Animal proteins ---- Netrin-3
Source.9128: DFBPPR11062 ---- Animal proteins ---- Regucalcin
Source.9129: DFBPPR11066 ---- Animal proteins ---- Protein sprouty homolog 2
Source.9130: DFBPPR11067 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.9131: DFBPPR11069 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.9132: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1
Source.9133: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1
Source.9134: DFBPPR11076 ---- Animal proteins ---- Myoglobin
Source.9135: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.9136: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.9137: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.9138: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.9139: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.9140: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.9141: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.9142: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.9143: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2
Source.9144: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.9145: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.9146: DFBPPR11094 ---- Animal proteins ---- Transcription factor MafA
Source.9147: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.9148: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A
Source.9149: DFBPPR11103 ---- Animal proteins ---- Ribosome maturation protein SBDS
Source.9150: DFBPPR11104 ---- Animal proteins ---- Importin subunit alpha-5
Source.9151: DFBPPR11109 ---- Animal proteins ---- Fibrinogen-like protein 1-like protein
Source.9152: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.9153: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.9154: DFBPPR11115 ---- Animal proteins ---- Eyes absent homolog 1
Source.9155: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D
Source.9156: DFBPPR11119 ---- Animal proteins ---- Homeobox protein Nkx-2.5
Source.9157: DFBPPR11121 ---- Animal proteins ---- Lysosomal amino acid transporter 1 homolog
Source.9158: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.9159: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta
Source.9160: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.9161: DFBPPR11126 ---- Animal proteins ---- Parvalbumin, thymic
Source.9162: DFBPPR11127 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform
Source.9163: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1
Source.9164: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.9165: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.9166: DFBPPR11141 ---- Animal proteins ---- Serine/threonine-protein kinase ULK3
Source.9167: DFBPPR11142 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.9168: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.9169: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain
Source.9170: DFBPPR11145 ---- Animal proteins ---- Chromatin assembly factor 1 subunit B
Source.9171: DFBPPR11146 ---- Animal proteins ---- Formin
Source.9172: DFBPPR11148 ---- Animal proteins ---- Pro-thyrotropin-releasing hormone
Source.9173: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.9174: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog
Source.9175: DFBPPR11151 ---- Animal proteins ---- SPARC
Source.9176: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.9177: DFBPPR11156 ---- Animal proteins ---- Pterin-4-alpha-carbinolamine dehydratase
Source.9178: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.9179: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3
Source.9180: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.9181: DFBPPR11162 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.9182: DFBPPR11165 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF185
Source.9183: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta
Source.9184: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.9185: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.9186: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta
Source.9187: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.9188: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2
Source.9189: DFBPPR11176 ---- Animal proteins ---- Zinc finger protein Gfi-1b
Source.9190: DFBPPR11177 ---- Animal proteins ---- Gallinacin-11
Source.9191: DFBPPR11184 ---- Animal proteins ---- Small RNA 2'-O-methyltransferase
Source.9192: DFBPPR11187 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.9193: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22
Source.9194: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.9195: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.9196: DFBPPR11193 ---- Animal proteins ---- Gallinacin-8
Source.9197: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.9198: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.9199: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.9200: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1
Source.9201: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.9202: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha
Source.9203: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.9204: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.9205: DFBPPR11211 ---- Animal proteins ---- Acylphosphatase-2
Source.9206: DFBPPR11212 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.9207: DFBPPR11213 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.9208: DFBPPR11215 ---- Animal proteins ---- Zinc finger protein PLAG1
Source.9209: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2
Source.9210: DFBPPR11219 ---- Animal proteins ---- Cytospin-A
Source.9211: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.9212: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.9213: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2
Source.9214: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.9215: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic
Source.9216: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2
Source.9217: DFBPPR11229 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H
Source.9218: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.9219: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.9220: DFBPPR11233 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.9221: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase
Source.9222: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.9223: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.9224: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.9225: DFBPPR11244 ---- Animal proteins ---- Frizzled-6
Source.9226: DFBPPR11245 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.9227: DFBPPR11247 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 3
Source.9228: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.9229: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED
Source.9230: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.9231: DFBPPR11254 ---- Animal proteins ---- Intracellular hyaluronan-binding protein 4
Source.9232: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1
Source.9233: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.9234: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6
Source.9235: DFBPPR11263 ---- Animal proteins ---- Obg-like ATPase 1
Source.9236: DFBPPR11265 ---- Animal proteins ---- Integral membrane protein 2B
Source.9237: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.9238: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4
Source.9239: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3
Source.9240: DFBPPR11274 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.9241: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.9242: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5
Source.9243: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.9244: DFBPPR11281 ---- Animal proteins ---- LIM domain-binding protein 2
Source.9245: DFBPPR11284 ---- Animal proteins ---- Methylsterol monooxygenase 1
Source.9246: DFBPPR11285 ---- Animal proteins ---- Matrix Gla protein
Source.9247: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.9248: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein
Source.9249: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.9250: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.9251: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4
Source.9252: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.9253: DFBPPR11294 ---- Animal proteins ---- Frizzled-8
Source.9254: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.9255: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.9256: DFBPPR11299 ---- Animal proteins ---- Casein kinase II subunit beta
Source.9257: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.9258: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.9259: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein
Source.9260: DFBPPR11305 ---- Animal proteins ---- Cysteine and glycine-rich protein 2
Source.9261: DFBPPR11307 ---- Animal proteins ---- Thyrotropin subunit beta
Source.9262: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6
Source.9263: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.9264: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog
Source.9265: DFBPPR11314 ---- Animal proteins ---- Multivesicular body subunit 12A
Source.9266: DFBPPR11315 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 3
Source.9267: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2
Source.9268: DFBPPR11320 ---- Animal proteins ---- Nucleoporin NUP42
Source.9269: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17
Source.9270: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.9271: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8
Source.9272: DFBPPR11327 ---- Animal proteins ---- Integrin alpha-1
Source.9273: DFBPPR11330 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.9274: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog
Source.9275: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3
Source.9276: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2
Source.9277: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.9278: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.9279: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.9280: DFBPPR11344 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.9281: DFBPPR11350 ---- Animal proteins ---- Homeobox protein Hox-D13
Source.9282: DFBPPR11352 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.9283: DFBPPR11355 ---- Animal proteins ---- Collectin-10
Source.9284: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4
Source.9285: DFBPPR11358 ---- Animal proteins ---- Lysozyme g
Source.9286: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.9287: DFBPPR11362 ---- Animal proteins ---- Beta-crystallin B2
Source.9288: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.9289: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.9290: DFBPPR11366 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.9291: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2
Source.9292: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1
Source.9293: DFBPPR11373 ---- Animal proteins ---- Decorin
Source.9294: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.9295: DFBPPR11375 ---- Animal proteins ---- Transcription factor E2F1
Source.9296: DFBPPR11379 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2
Source.9297: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.9298: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1
Source.9299: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.9300: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.9301: DFBPPR11386 ---- Animal proteins ---- Interferon regulatory factor 3
Source.9302: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.9303: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.9304: DFBPPR11393 ---- Animal proteins ---- Avidin-related protein 4/5
Source.9305: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B
Source.9306: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A
Source.9307: DFBPPR11398 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.9308: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.9309: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.9310: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.9311: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner
Source.9312: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.9313: DFBPPR11407 ---- Animal proteins ---- RAD52 motif-containing protein 1
Source.9314: DFBPPR11412 ---- Animal proteins ---- Hyaluronan synthase 3
Source.9315: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.9316: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.9317: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231
Source.9318: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.9319: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.9320: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1
Source.9321: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.9322: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1
Source.9323: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5
Source.9324: DFBPPR11433 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.9325: DFBPPR11435 ---- Animal proteins ---- Eyes absent homolog 3
Source.9326: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.9327: DFBPPR11439 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.9328: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator
Source.9329: DFBPPR11444 ---- Animal proteins ---- Troponin T, cardiac muscle isoforms
Source.9330: DFBPPR11448 ---- Animal proteins ---- Pterin-4-alpha-carbinolamine dehydratase 2
Source.9331: DFBPPR11450 ---- Animal proteins ---- Potassium voltage-gated channel subfamily G member 2
Source.9332: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1
Source.9333: DFBPPR11453 ---- Animal proteins ---- Charged multivesicular body protein 2a
Source.9334: DFBPPR11454 ---- Animal proteins ---- Calcium release-activated calcium channel protein 1
Source.9335: DFBPPR11455 ---- Animal proteins ---- Growth factor receptor-bound protein 2
Source.9336: DFBPPR11456 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-2
Source.9337: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin
Source.9338: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46
Source.9339: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.9340: DFBPPR11465 ---- Animal proteins ---- Serine/threonine-protein kinase 40
Source.9341: DFBPPR11466 ---- Animal proteins ---- GDNF family receptor alpha-2
Source.9342: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11
Source.9343: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.9344: DFBPPR11476 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.9345: DFBPPR11480 ---- Animal proteins ---- Cytochrome P450 1A2
Source.9346: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein
Source.9347: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.9348: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1
Source.9349: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase
Source.9350: DFBPPR11488 ---- Animal proteins ---- Ras-related protein Rab-2A
Source.9351: DFBPPR11490 ---- Animal proteins ---- Twinfilin-2
Source.9352: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog
Source.9353: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10
Source.9354: DFBPPR11493 ---- Animal proteins ---- Interferon regulatory factor 1
Source.9355: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7
Source.9356: DFBPPR11499 ---- Animal proteins ---- Myosin regulatory light chain 2B, cardiac muscle isoform
Source.9357: DFBPPR11500 ---- Animal proteins ---- Ovalbumin-related protein X
Source.9358: DFBPPR11502 ---- Animal proteins ---- Transcription factor GATA-4
Source.9359: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2
Source.9360: DFBPPR11504 ---- Animal proteins ---- TATA box-binding protein-like 1
Source.9361: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.9362: DFBPPR11506 ---- Animal proteins ---- Homeobox protein BarH-like 1b
Source.9363: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog
Source.9364: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.9365: DFBPPR11512 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.9366: DFBPPR11513 ---- Animal proteins ---- Corepressor interacting with RBPJ 1
Source.9367: DFBPPR11516 ---- Animal proteins ---- Gastrin/cholecystokinin-like peptide
Source.9368: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.9369: DFBPPR11520 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2
Source.9370: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.9371: DFBPPR11527 ---- Animal proteins ---- Myosin regulatory light chain 2A, cardiac muscle isoform
Source.9372: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.9373: DFBPPR11531 ---- Animal proteins ---- Protein AATF
Source.9374: DFBPPR11532 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle minor isoform
Source.9375: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.9376: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD
Source.9377: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.9378: DFBPPR11541 ---- Animal proteins ---- Tetraspanin-12
Source.9379: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein
Source.9380: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2
Source.9381: DFBPPR11546 ---- Animal proteins ---- Transcriptional adapter 2-alpha
Source.9382: DFBPPR11547 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J
Source.9383: DFBPPR11548 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1
Source.9384: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.9385: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.9386: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.9387: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.9388: DFBPPR11556 ---- Animal proteins ---- Leptin receptor gene-related protein
Source.9389: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2
Source.9390: DFBPPR11565 ---- Animal proteins ---- Eyes absent homolog 4
Source.9391: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic
Source.9392: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.9393: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein
Source.9394: DFBPPR11577 ---- Animal proteins ---- Vasotocin-neurophysin VT
Source.9395: DFBPPR11579 ---- Animal proteins ---- Actin-related protein 6
Source.9396: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.9397: DFBPPR11583 ---- Animal proteins ---- Translin
Source.9398: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.9399: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.9400: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.9401: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.9402: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.9403: DFBPPR11598 ---- Animal proteins ---- Cellular nucleic acid-binding protein
Source.9404: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.9405: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.9406: DFBPPR11606 ---- Animal proteins ---- 60S ribosomal protein L13
Source.9407: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.9408: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.9409: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.9410: DFBPPR11613 ---- Animal proteins ---- Transmembrane protein 258
Source.9411: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.9412: DFBPPR11618 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.9413: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3
Source.9414: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.9415: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59
Source.9416: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2
Source.9417: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.9418: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1
Source.9419: DFBPPR11635 ---- Animal proteins ---- Cochlin
Source.9420: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.9421: DFBPPR11637 ---- Animal proteins ---- 2-oxoglutarate and iron-dependent oxygenase JMJD4
Source.9422: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.9423: DFBPPR11641 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.9424: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.9425: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4
Source.9426: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.9427: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.9428: DFBPPR11646 ---- Animal proteins ---- Frizzled-9
Source.9429: DFBPPR11647 ---- Animal proteins ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.9430: DFBPPR11649 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.9431: DFBPPR11651 ---- Animal proteins ---- Vitelline membrane outer layer protein 1
Source.9432: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.9433: DFBPPR11655 ---- Animal proteins ---- 60S ribosomal protein L10
Source.9434: DFBPPR11656 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.9435: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43
Source.9436: DFBPPR11664 ---- Animal proteins ---- Swi5-dependent recombination DNA repair protein 1 homolog
Source.9437: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2
Source.9438: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.9439: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.9440: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1
Source.9441: DFBPPR11672 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 3
Source.9442: DFBPPR11674 ---- Animal proteins ---- Protein MRP-126
Source.9443: DFBPPR11675 ---- Animal proteins ---- Endophilin-B1
Source.9444: DFBPPR11677 ---- Animal proteins ---- SOSS complex subunit C
Source.9445: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13
Source.9446: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.9447: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.9448: DFBPPR11687 ---- Animal proteins ---- Antithrombin-III
Source.9449: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1
Source.9450: DFBPPR11695 ---- Animal proteins ---- Sodium/bile acid cotransporter 7
Source.9451: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit
Source.9452: DFBPPR11698 ---- Animal proteins ---- NADH-cytochrome b5 reductase 2
Source.9453: DFBPPR11700 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.9454: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.9455: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.9456: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.9457: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.9458: DFBPPR11710 ---- Animal proteins ---- WAP four-disulfide core domain protein 1
Source.9459: DFBPPR11712 ---- Animal proteins ---- 60S acidic ribosomal protein P1
Source.9460: DFBPPR11716 ---- Animal proteins ---- Substance P
Source.9461: DFBPPR11717 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.9462: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D
Source.9463: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A
Source.9464: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor
Source.9465: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1
Source.9466: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta
Source.9467: DFBPPR11730 ---- Animal proteins ---- Proteasome subunit alpha type-7
Source.9468: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.9469: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi
Source.9470: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3
Source.9471: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.9472: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.9473: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.9474: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.9475: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3
Source.9476: DFBPPR11757 ---- Animal proteins ---- RNA-binding protein 38
Source.9477: DFBPPR11759 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.9478: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein
Source.9479: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6
Source.9480: DFBPPR11762 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.9481: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.9482: DFBPPR11766 ---- Animal proteins ---- C-type natriuretic peptide
Source.9483: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1
Source.9484: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.9485: DFBPPR11774 ---- Animal proteins ---- Musculoskeletal embryonic nuclear protein 1
Source.9486: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.9487: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4
Source.9488: DFBPPR11777 ---- Animal proteins ---- Homeobox protein Hox-B3
Source.9489: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.9490: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.9491: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen
Source.9492: DFBPPR11785 ---- Animal proteins ---- ADP-ribosylation factor 5
Source.9493: DFBPPR11786 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2
Source.9494: DFBPPR11791 ---- Animal proteins ---- Protein shisa-5
Source.9495: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.9496: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4
Source.9497: DFBPPR11797 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2-binding protein
Source.9498: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3
Source.9499: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5
Source.9500: DFBPPR11805 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.9501: DFBPPR11806 ---- Animal proteins ---- Homeobox protein Hox-B6
Source.9502: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.9503: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.9504: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.9505: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.9506: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.9507: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.9508: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog
Source.9509: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.9510: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1
Source.9511: DFBPPR11826 ---- Animal proteins ---- Protein mago nashi homolog
Source.9512: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.9513: DFBPPR11828 ---- Animal proteins ---- Spindlin-Z
Source.9514: DFBPPR11831 ---- Animal proteins ---- Protein lin-28 homolog B
Source.9515: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7
Source.9516: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein
Source.9517: DFBPPR11837 ---- Animal proteins ---- Protein FAM210A
Source.9518: DFBPPR11838 ---- Animal proteins ---- Enhancer of mRNA-decapping protein 3
Source.9519: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9
Source.9520: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase
Source.9521: DFBPPR11854 ---- Animal proteins ---- Claw keratin
Source.9522: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.9523: DFBPPR11856 ---- Animal proteins ---- Spindlin-W
Source.9524: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.9525: DFBPPR11858 ---- Animal proteins ---- WD repeat-containing protein 82
Source.9526: DFBPPR11859 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59
Source.9527: DFBPPR11863 ---- Animal proteins ---- Purpurin
Source.9528: DFBPPR11864 ---- Animal proteins ---- Radixin
Source.9529: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog
Source.9530: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.9531: DFBPPR11871 ---- Animal proteins ---- RAD51-associated protein 1
Source.9532: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.9533: DFBPPR11875 ---- Animal proteins ---- WD repeat-containing protein 61
Source.9534: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.9535: DFBPPR11879 ---- Animal proteins ---- Nicalin
Source.9536: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.9537: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.9538: DFBPPR11886 ---- Animal proteins ---- Olfactory receptor-like protein COR9
Source.9539: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.9540: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8
Source.9541: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.9542: DFBPPR11892 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein D-like
Source.9543: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.9544: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.9545: DFBPPR11900 ---- Animal proteins ---- Calcipressin-3
Source.9546: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8
Source.9547: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2
Source.9548: DFBPPR11903 ---- Animal proteins ---- SREBP regulating gene protein
Source.9549: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9
Source.9550: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A
Source.9551: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.9552: DFBPPR11911 ---- Animal proteins ---- NmrA-like family domain-containing protein 1
Source.9553: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13
Source.9554: DFBPPR11913 ---- Animal proteins ---- Bcl-2-related ovarian killer protein
Source.9555: DFBPPR11914 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.9556: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.9557: DFBPPR11919 ---- Animal proteins ---- Feather keratin 1
Source.9558: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.9559: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.9560: DFBPPR11923 ---- Animal proteins ---- Feather keratin 3
Source.9561: DFBPPR11924 ---- Animal proteins ---- Centromere protein P
Source.9562: DFBPPR11925 ---- Animal proteins ---- GSK3-beta interaction protein
Source.9563: DFBPPR11928 ---- Animal proteins ---- Cyclin-C
Source.9564: DFBPPR11930 ---- Animal proteins ---- UAP56-interacting factor
Source.9565: DFBPPR11931 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 20
Source.9566: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.9567: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7
Source.9568: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.9569: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.9570: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.9571: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.9572: DFBPPR11952 ---- Animal proteins ---- Avidin-related protein 1
Source.9573: DFBPPR11953 ---- Animal proteins ---- Protein NEL
Source.9574: DFBPPR11954 ---- Animal proteins ---- SIN3-HDAC complex-associated factor
Source.9575: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2
Source.9576: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.9577: DFBPPR11958 ---- Animal proteins ---- Homeobox protein engrailed-1
Source.9578: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.9579: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein
Source.9580: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.9581: DFBPPR11966 ---- Animal proteins ---- Protein CREG1
Source.9582: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4
Source.9583: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.9584: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.9585: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2
Source.9586: DFBPPR11971 ---- Animal proteins ---- Protein YIPF4
Source.9587: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1
Source.9588: DFBPPR11973 ---- Animal proteins ---- Avidin-related protein 3
Source.9589: DFBPPR11975 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.9590: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.9591: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.9592: DFBPPR11982 ---- Animal proteins ---- Transcription termination factor 3, mitochondrial
Source.9593: DFBPPR11983 ---- Animal proteins ---- Tumor protein D53 homolog
Source.9594: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4
Source.9595: DFBPPR11985 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.9596: DFBPPR11986 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2
Source.9597: DFBPPR11987 ---- Animal proteins ---- NEDD4-binding protein 3 homolog
Source.9598: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.9599: DFBPPR11994 ---- Animal proteins ---- Surfeit locus protein 1
Source.9600: DFBPPR12001 ---- Animal proteins ---- Pleckstrin homology domain-containing family F member 2
Source.9601: DFBPPR12002 ---- Animal proteins ---- Avidin-related protein 6
Source.9602: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.9603: DFBPPR12006 ---- Animal proteins ---- Avidin-related protein 7
Source.9604: DFBPPR12007 ---- Animal proteins ---- Feather keratin 4
Source.9605: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal
Source.9606: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein
Source.9607: DFBPPR12010 ---- Animal proteins ---- Feather keratin 2
Source.9608: DFBPPR12012 ---- Animal proteins ---- Galectin-related protein
Source.9609: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.9610: DFBPPR12016 ---- Animal proteins ---- ORM1-like protein 2
Source.9611: DFBPPR12017 ---- Animal proteins ---- Zinc finger protein CKR1
Source.9612: DFBPPR12019 ---- Animal proteins ---- Cobalamin trafficking protein CblD
Source.9613: DFBPPR12021 ---- Animal proteins ---- DNA repair protein RAD52 homolog
Source.9614: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2
Source.9615: DFBPPR12027 ---- Animal proteins ---- Centromere protein L
Source.9616: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.9617: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.9618: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.9619: DFBPPR12038 ---- Animal proteins ---- Scale keratin
Source.9620: DFBPPR12039 ---- Animal proteins ---- Protein GOLM2
Source.9621: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.9622: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.9623: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.9624: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.9625: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.9626: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.9627: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.9628: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.9629: DFBPPR12061 ---- Animal proteins ---- Otoraplin
Source.9630: DFBPPR12062 ---- Animal proteins ---- Endophilin-B2
Source.9631: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9
Source.9632: DFBPPR12065 ---- Animal proteins ---- Testin
Source.9633: DFBPPR12066 ---- Animal proteins ---- Protein-L-isoaspartate O-methyltransferase domain-containing protein 1
Source.9634: DFBPPR12067 ---- Animal proteins ---- Transcription factor EC
Source.9635: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.9636: DFBPPR12072 ---- Animal proteins ---- 40S ribosomal protein S17
Source.9637: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9
Source.9638: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.9639: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129
Source.9640: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.9641: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.9642: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2
Source.9643: DFBPPR12083 ---- Animal proteins ---- Homeobox protein Hox-A5
Source.9644: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.9645: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme
Source.9646: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.9647: DFBPPR12091 ---- Animal proteins ---- Neurofibromin
Source.9648: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.9649: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.9650: DFBPPR12099 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.9651: DFBPPR12103 ---- Animal proteins ---- FUN14 domain-containing protein 1
Source.9652: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.9653: DFBPPR12105 ---- Animal proteins ---- Pleckstrin homology domain-containing family J member 1
Source.9654: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.9655: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.9656: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1
Source.9657: DFBPPR12115 ---- Animal proteins ---- Active regulator of SIRT1
Source.9658: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1
Source.9659: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.9660: DFBPPR12121 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial
Source.9661: DFBPPR12125 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8
Source.9662: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.9663: DFBPPR12129 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial
Source.9664: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19
Source.9665: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.9666: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.9667: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.9668: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6
Source.9669: DFBPPR12140 ---- Animal proteins ---- Centromere protein N
Source.9670: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23
Source.9671: DFBPPR12145 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1-like
Source.9672: DFBPPR12146 ---- Animal proteins ---- Transmembrane protein adipocyte-associated 1 homolog
Source.9673: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.9674: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3
Source.9675: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.9676: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1
Source.9677: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.9678: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.9679: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A
Source.9680: DFBPPR12154 ---- Animal proteins ---- 60S ribosomal protein L7a
Source.9681: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.9682: DFBPPR12156 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.9683: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.9684: DFBPPR12162 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2
Source.9685: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog
Source.9686: DFBPPR12171 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-3
Source.9687: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog
Source.9688: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1
Source.9689: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.9690: DFBPPR12177 ---- Animal proteins ---- Beta-keratin-related protein
Source.9691: DFBPPR12180 ---- Animal proteins ---- Arylamine N-acetyltransferase, liver isozyme
Source.9692: DFBPPR12188 ---- Animal proteins ---- Protein limb expression 1
Source.9693: DFBPPR12189 ---- Animal proteins ---- Arginine and glutamate-rich protein 1
Source.9694: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.9695: DFBPPR12194 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-10
Source.9696: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B
Source.9697: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40
Source.9698: DFBPPR12205 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.9699: DFBPPR12206 ---- Animal proteins ---- CDAN1-interacting nuclease 1
Source.9700: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180
Source.9701: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.9702: DFBPPR12215 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog
Source.9703: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.9704: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174
Source.9705: DFBPPR12222 ---- Animal proteins ---- Coiled-coil domain-containing protein 43
Source.9706: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein
Source.9707: DFBPPR12226 ---- Animal proteins ---- Protein DGCR6
Source.9708: DFBPPR12230 ---- Animal proteins ---- Orofacial cleft 1 candidate gene 1 protein homolog
Source.9709: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10
Source.9710: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.9711: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.9712: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.9713: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like
Source.9714: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.9715: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.9716: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.9717: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1
Source.9718: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.9719: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2
Source.9720: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.9721: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1
Source.9722: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.9723: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2
Source.9724: DFBPPR12259 ---- Animal proteins ---- Lambda-crystallin
Source.9725: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase
Source.9726: DFBPPR12261 ---- Animal proteins ---- Tumor necrosis factor
Source.9727: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.9728: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.9729: DFBPPR12266 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit
Source.9730: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.9731: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1
Source.9732: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.9733: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.9734: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.9735: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.9736: DFBPPR12278 ---- Animal proteins ---- Major prion protein
Source.9737: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.9738: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1
Source.9739: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.9740: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1
Source.9741: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.9742: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.9743: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.9744: DFBPPR12287 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.9745: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.9746: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit
Source.9747: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.9748: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1
Source.9749: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.9750: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.9751: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3
Source.9752: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.9753: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.9754: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.9755: DFBPPR12303 ---- Animal proteins ---- Histidine-rich glycoprotein
Source.9756: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.9757: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.9758: DFBPPR12307 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn]
Source.9759: DFBPPR12309 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase A
Source.9760: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.9761: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.9762: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.9763: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.9764: DFBPPR12314 ---- Animal proteins ---- Annexin A1
Source.9765: DFBPPR12315 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.9766: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.9767: DFBPPR12319 ---- Animal proteins ---- Calreticulin
Source.9768: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.9769: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.9770: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5
Source.9771: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.9772: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.9773: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type
Source.9774: DFBPPR12329 ---- Animal proteins ---- Natriuretic peptides A
Source.9775: DFBPPR12330 ---- Animal proteins ---- Alpha-crystallin B chain
Source.9776: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1
Source.9777: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.9778: DFBPPR12333 ---- Animal proteins ---- Angiogenin
Source.9779: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.9780: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.9781: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.9782: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.9783: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.9784: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2
Source.9785: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase
Source.9786: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.9787: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.9788: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.9789: DFBPPR12350 ---- Animal proteins ---- Troponin T, cardiac muscle
Source.9790: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain
Source.9791: DFBPPR12353 ---- Animal proteins ---- Cytochrome P450 2E1
Source.9792: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.9793: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.9794: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.9795: DFBPPR12358 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 1
Source.9796: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.9797: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.9798: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.9799: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.9800: DFBPPR12364 ---- Animal proteins ---- Protein Wnt-5a
Source.9801: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.9802: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2
Source.9803: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.9804: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.9805: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform
Source.9806: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1
Source.9807: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.9808: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.9809: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.9810: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.9811: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.9812: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.9813: DFBPPR12379 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.9814: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.9815: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.9816: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1
Source.9817: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma
Source.9818: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.9819: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1
Source.9820: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.9821: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.9822: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.9823: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.9824: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.9825: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1
Source.9826: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.9827: DFBPPR12397 ---- Animal proteins ---- Caveolin-1
Source.9828: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase
Source.9829: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.9830: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1
Source.9831: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.9832: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4
Source.9833: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.9834: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.9835: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.9836: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.9837: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.9838: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.9839: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.9840: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.9841: DFBPPR12418 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.9842: DFBPPR12420 ---- Animal proteins ---- Serum paraoxonase/lactonase 3
Source.9843: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.9844: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.9845: DFBPPR12425 ---- Animal proteins ---- Beta-enolase
Source.9846: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A
Source.9847: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.9848: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.9849: DFBPPR12429 ---- Animal proteins ---- Apolipoprotein A-I
Source.9850: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.9851: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.9852: DFBPPR12433 ---- Animal proteins ---- Carbonic anhydrase 2
Source.9853: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.9854: DFBPPR12435 ---- Animal proteins ---- Cytochrome c
Source.9855: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.9856: DFBPPR12439 ---- Animal proteins ---- Tissue factor
Source.9857: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.9858: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.9859: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.9860: DFBPPR12445 ---- Animal proteins ---- Hemoglobin subunit beta-1/2
Source.9861: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.9862: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.9863: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.9864: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.9865: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.9866: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.9867: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.9868: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.9869: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.9870: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.9871: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.9872: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.9873: DFBPPR12461 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1
Source.9874: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.9875: DFBPPR12463 ---- Animal proteins ---- Interleukin-15
Source.9876: DFBPPR12464 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.9877: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.9878: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.9879: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.9880: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.9881: DFBPPR12471 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.9882: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype
Source.9883: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.9884: DFBPPR12475 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.9885: DFBPPR12476 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.9886: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.9887: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.9888: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.9889: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.9890: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.9891: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.9892: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase
Source.9893: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.9894: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.9895: DFBPPR12495 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma
Source.9896: DFBPPR12496 ---- Animal proteins ---- Protachykinin-1
Source.9897: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.9898: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.9899: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.9900: DFBPPR12505 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 3
Source.9901: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.9902: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.9903: DFBPPR12511 ---- Animal proteins ---- Serine/threonine-protein kinase 17A
Source.9904: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.9905: DFBPPR12516 ---- Animal proteins ---- Indolethylamine N-methyltransferase
Source.9906: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.9907: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.9908: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.9909: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.9910: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.9911: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.9912: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.9913: DFBPPR12534 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.9914: DFBPPR12536 ---- Animal proteins ---- Albumin
Source.9915: DFBPPR12538 ---- Animal proteins ---- Troponin T, fast skeletal muscle
Source.9916: DFBPPR12539 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1
Source.9917: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.9918: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.9919: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.9920: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2
Source.9921: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.9922: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.9923: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.9924: DFBPPR12551 ---- Animal proteins ---- C-reactive protein
Source.9925: DFBPPR12552 ---- Animal proteins ---- Acylphosphatase-2
Source.9926: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.9927: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.9928: DFBPPR12557 ---- Animal proteins ---- Acrosin
Source.9929: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type
Source.9930: DFBPPR12560 ---- Animal proteins ---- Calumenin
Source.9931: DFBPPR12561 ---- Animal proteins ---- Dynein light chain 1, cytoplasmic
Source.9932: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.9933: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1
Source.9934: DFBPPR12564 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.9935: DFBPPR12567 ---- Animal proteins ---- Calpain small subunit 1
Source.9936: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.9937: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.9938: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2
Source.9939: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.9940: DFBPPR12573 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.9941: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.9942: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K
Source.9943: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.9944: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.9945: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.9946: DFBPPR12588 ---- Animal proteins ---- Phosphoserine aminotransferase
Source.9947: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.9948: DFBPPR12591 ---- Animal proteins ---- Annexin A11
Source.9949: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.9950: DFBPPR12593 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B
Source.9951: DFBPPR12594 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.9952: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20
Source.9953: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.9954: DFBPPR12607 ---- Animal proteins ---- Basigin
Source.9955: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.9956: DFBPPR12610 ---- Animal proteins ---- Cyclin-dependent kinase 14
Source.9957: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1
Source.9958: DFBPPR12613 ---- Animal proteins ---- Glutathione peroxidase 1
Source.9959: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.9960: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.9961: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11
Source.9962: DFBPPR12621 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.9963: DFBPPR12622 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.9964: DFBPPR12623 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP1B
Source.9965: DFBPPR12624 ---- Animal proteins ---- Heparin cofactor 2
Source.9966: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.9967: DFBPPR12626 ---- Animal proteins ---- E-selectin
Source.9968: DFBPPR12627 ---- Animal proteins ---- Morphine 6-dehydrogenase
Source.9969: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12
Source.9970: DFBPPR12629 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.9971: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.9972: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.9973: DFBPPR12636 ---- Animal proteins ---- Complement component C9
Source.9974: DFBPPR12641 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.9975: DFBPPR12642 ---- Animal proteins ---- Haptoglobin
Source.9976: DFBPPR12643 ---- Animal proteins ---- Haptoglobin
Source.9977: DFBPPR12649 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.9978: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.9979: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5
Source.9980: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.9981: DFBPPR12657 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.9982: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.9983: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.9984: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5
Source.9985: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.9986: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.9987: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.9988: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.9989: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor
Source.9990: DFBPPR12681 ---- Animal proteins ---- Myosin-7
Source.9991: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4
Source.9992: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.9993: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.9994: DFBPPR12709 ---- Animal proteins ---- Somatotropin
Source.9995: DFBPPR12710 ---- Animal proteins ---- Endoplasmin
Source.9996: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic
Source.9997: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1
Source.9998: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.9999: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16
Source.10000: DFBPPR12722 ---- Animal proteins ---- Myelin proteolipid protein
Source.10001: DFBPPR12724 ---- Animal proteins ---- Integrin beta-8
Source.10002: DFBPPR12726 ---- Animal proteins ---- Pulmonary surfactant-associated protein C
Source.10003: DFBPPR12728 ---- Animal proteins ---- Cytochrome b
Source.10004: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.10005: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.10006: DFBPPR12731 ---- Animal proteins ---- Cholinesterase
Source.10007: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1
Source.10008: DFBPPR12733 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 2
Source.10009: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.10010: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.10011: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1
Source.10012: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.10013: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14
Source.10014: DFBPPR12742 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.10015: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1
Source.10016: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain
Source.10017: DFBPPR12747 ---- Animal proteins ---- Myelin basic protein
Source.10018: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1
Source.10019: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.10020: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.10021: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain
Source.10022: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta
Source.10023: DFBPPR12754 ---- Animal proteins ---- Methylosome subunit pICln
Source.10024: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3
Source.10025: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.10026: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4
Source.10027: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.10028: DFBPPR12760 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3
Source.10029: DFBPPR12761 ---- Animal proteins ---- Trichohyalin
Source.10030: DFBPPR12762 ---- Animal proteins ---- SPARC
Source.10031: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3
Source.10032: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6
Source.10033: DFBPPR12767 ---- Animal proteins ---- Follitropin subunit beta
Source.10034: DFBPPR12768 ---- Animal proteins ---- Pepsin-3
Source.10035: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.10036: DFBPPR12772 ---- Animal proteins ---- Colipase
Source.10037: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.10038: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.10039: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.10040: DFBPPR12779 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain
Source.10041: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.10042: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.10043: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.10044: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.10045: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.10046: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.10047: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15
Source.10048: DFBPPR12797 ---- Animal proteins ---- Potassium voltage-gated channel subfamily E member 1
Source.10049: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.10050: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor
Source.10051: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6
Source.10052: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.10053: DFBPPR12805 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.10054: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.10055: DFBPPR12811 ---- Animal proteins ---- Heme oxygenase 2
Source.10056: DFBPPR12812 ---- Animal proteins ---- Hemoglobin subunit gamma
Source.10057: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter
Source.10058: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.10059: DFBPPR12817 ---- Animal proteins ---- Cathepsin E
Source.10060: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor
Source.10061: DFBPPR12819 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.10062: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B
Source.10063: DFBPPR12821 ---- Animal proteins ---- Gastricsin
Source.10064: DFBPPR12823 ---- Animal proteins ---- Pepsin F
Source.10065: DFBPPR12824 ---- Animal proteins ---- Alpha-crystallin A chain
Source.10066: DFBPPR12826 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.10067: DFBPPR12831 ---- Animal proteins ---- Serine--pyruvate aminotransferase
Source.10068: DFBPPR12832 ---- Animal proteins ---- Secretin receptor
Source.10069: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor
Source.10070: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.10071: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.10072: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.10073: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.10074: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2
Source.10075: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.10076: DFBPPR12843 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 1
Source.10077: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain
Source.10078: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.10079: DFBPPR12854 ---- Animal proteins ---- D(1A) dopamine receptor
Source.10080: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.10081: DFBPPR12856 ---- Animal proteins ---- Leupaxin
Source.10082: DFBPPR12857 ---- Animal proteins ---- Arginase-1
Source.10083: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.10084: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11
Source.10085: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.10086: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein
Source.10087: DFBPPR12863 ---- Animal proteins ---- Casein kinase II subunit beta
Source.10088: DFBPPR12864 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.10089: DFBPPR12865 ---- Animal proteins ---- Sperm surface protein Sp17
Source.10090: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.10091: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin
Source.10092: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.10093: DFBPPR12877 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.10094: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.10095: DFBPPR12882 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.10096: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.10097: DFBPPR12884 ---- Animal proteins ---- Extracellular superoxide dismutase [Cu-Zn]
Source.10098: DFBPPR12888 ---- Animal proteins ---- Myoglobin
Source.10099: DFBPPR12889 ---- Animal proteins ---- Myosin regulatory light chain 2, ventricular/cardiac muscle isoform
Source.10100: DFBPPR12892 ---- Animal proteins ---- Translocon-associated protein subunit alpha
Source.10101: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D
Source.10102: DFBPPR12897 ---- Animal proteins ---- Fibronectin
Source.10103: DFBPPR12898 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.10104: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.10105: DFBPPR12901 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I
Source.10106: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.10107: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.10108: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.10109: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.10110: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.10111: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6
Source.10112: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.10113: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.10114: DFBPPR12914 ---- Animal proteins ---- Lipase member H
Source.10115: DFBPPR12916 ---- Animal proteins ---- Hemoglobin subunit epsilon
Source.10116: DFBPPR12920 ---- Animal proteins ---- Arylamine N-acetyltransferase 2
Source.10117: DFBPPR12921 ---- Animal proteins ---- Cytochrome P450 2C30
Source.10118: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.10119: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2
Source.10120: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1
Source.10121: DFBPPR12936 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.10122: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.10123: DFBPPR12938 ---- Animal proteins ---- D-amino-acid oxidase
Source.10124: DFBPPR12939 ---- Animal proteins ---- Gastrotropin
Source.10125: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.10126: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.10127: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.10128: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.10129: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein
Source.10130: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2
Source.10131: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.10132: DFBPPR12957 ---- Animal proteins ---- Arylamine N-acetyltransferase 1
Source.10133: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.10134: DFBPPR12959 ---- Animal proteins ---- Keratin, type I cytoskeletal 12
Source.10135: DFBPPR12960 ---- Animal proteins ---- Synaptophysin-like protein 2
Source.10136: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3
Source.10137: DFBPPR12962 ---- Animal proteins ---- Coronin-1B
Source.10138: DFBPPR12963 ---- Animal proteins ---- Adenosine receptor A3
Source.10139: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.10140: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.10141: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.10142: DFBPPR12975 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.10143: DFBPPR12981 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-4
Source.10144: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.10145: DFBPPR12989 ---- Animal proteins ---- Eukaryotic translation initiation factor 1A
Source.10146: DFBPPR12993 ---- Animal proteins ---- Tumor protein D52
Source.10147: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1
Source.10148: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.10149: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.10150: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.10151: DFBPPR13008 ---- Animal proteins ---- Keratin-associated protein 6-1
Source.10152: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.10153: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.10154: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2
Source.10155: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein
Source.10156: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2
Source.10157: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.10158: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.10159: DFBPPR13029 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 5
Source.10160: DFBPPR13030 ---- Animal proteins ---- T-cell surface glycoprotein CD1b
Source.10161: DFBPPR13031 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial
Source.10162: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.10163: DFBPPR13039 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit beta-5
Source.10164: DFBPPR13044 ---- Animal proteins ---- Neuromedin-U-25
Source.10165: DFBPPR13047 ---- Animal proteins ---- Elongation factor 1-delta
Source.10166: DFBPPR13048 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 1
Source.10167: DFBPPR13053 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.10168: DFBPPR13058 ---- Animal proteins ---- Anion exchange transporter
Source.10169: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2
Source.10170: DFBPPR13062 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.10171: DFBPPR13068 ---- Animal proteins ---- Biglycan
Source.10172: DFBPPR13069 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP alpha-1 chain
Source.10173: DFBPPR13070 ---- Animal proteins ---- Beta-crystallin A2
Source.10174: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.10175: DFBPPR13074 ---- Animal proteins ---- Islet amyloid polypeptide
Source.10176: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.10177: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1
Source.10178: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog
Source.10179: DFBPPR13088 ---- Animal proteins ---- Tachykinin-4
Source.10180: DFBPPR13090 ---- Animal proteins ---- Annexin A8
Source.10181: DFBPPR13092 ---- Animal proteins ---- Testin
Source.10182: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236
Source.10183: DFBPPR13094 ---- Animal proteins ---- Atherin
Source.10184: DFBPPR13096 ---- Animal proteins ---- Ig kappa chain V region 12F2
Source.10185: DFBPPR13100 ---- Animal proteins ---- Lengsin
Source.10186: DFBPPR13101 ---- Animal proteins ---- Apolipoprotein C-I
Source.10187: DFBPPR13103 ---- Animal proteins ---- T-cell receptor beta chain C region
Source.10188: DFBPPR13104 ---- Animal proteins ---- Ig kappa chain V region 2717
Source.10189: DFBPPR13105 ---- Animal proteins ---- Ig kappa chain V region BS-5
Source.10190: DFBPPR13106 ---- Animal proteins ---- Ig kappa chain V region BS-1
Source.10191: DFBPPR13108 ---- Animal proteins ---- Proteolipid protein 2
Source.10192: DFBPPR13110 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2
Source.10193: DFBPPR13118 ---- Animal proteins ---- Ig kappa-B5 chain V region 2699
Source.10194: DFBPPR13124 ---- Animal proteins ---- Ig kappa chain V region K-25
Source.10195: DFBPPR13125 ---- Animal proteins ---- Ig kappa chain V region 3547
Source.10196: DFBPPR13126 ---- Animal proteins ---- Ig kappa chain V region 3368
Source.10197: DFBPPR13128 ---- Animal proteins ---- Ig kappa chain V region 4135
Source.10198: DFBPPR13129 ---- Animal proteins ---- Ig kappa chain V region 3374
Source.10199: DFBPPR13130 ---- Animal proteins ---- Ig kappa chain V region AH80-5
Source.10200: DFBPPR13131 ---- Animal proteins ---- Ig kappa chain V region K29-213
Source.10201: DFBPPR13132 ---- Animal proteins ---- Ig kappa chain V region 3315
Source.10202: DFBPPR13133 ---- Animal proteins ---- Ig kappa chain V region K16-167
Source.10203: DFBPPR13134 ---- Animal proteins ---- Ig kappa chain V region 120
Source.10204: DFBPPR13136 ---- Animal proteins ---- Ig kappa chain V region XP-1
Source.10205: DFBPPR13141 ---- Animal proteins ---- Cytochrome c
Source.10206: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.10207: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.10208: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.10209: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.10210: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1
Source.10211: DFBPPR13152 ---- Animal proteins ---- Interleukin-4
Source.10212: DFBPPR13153 ---- Animal proteins ---- Interleukin-18
Source.10213: DFBPPR13154 ---- Animal proteins ---- Annexin A1
Source.10214: DFBPPR13159 ---- Animal proteins ---- Tumor necrosis factor
Source.10215: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.10216: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.10217: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor
Source.10218: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.10219: DFBPPR13167 ---- Animal proteins ---- Natriuretic peptides A
Source.10220: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.10221: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2
Source.10222: DFBPPR13173 ---- Animal proteins ---- Caveolin-1
Source.10223: DFBPPR13176 ---- Animal proteins ---- Aromatase
Source.10224: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.10225: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain
Source.10226: DFBPPR13186 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn]
Source.10227: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.10228: DFBPPR13188 ---- Animal proteins ---- E3 ubiquitin-protein ligase Mdm2
Source.10229: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.10230: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.10231: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.10232: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain
Source.10233: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.10234: DFBPPR13195 ---- Animal proteins ---- Albumin
Source.10235: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.10236: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.10237: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.10238: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23
Source.10239: DFBPPR13211 ---- Animal proteins ---- Colipase B
Source.10240: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2
Source.10241: DFBPPR13215 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6
Source.10242: DFBPPR13216 ---- Animal proteins ---- Colipase A
Source.10243: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.10244: DFBPPR13218 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.10245: DFBPPR13219 ---- Animal proteins ---- Kit ligand
Source.10246: DFBPPR13220 ---- Animal proteins ---- Latherin
Source.10247: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.10248: DFBPPR13222 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.10249: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.10250: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.10251: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.10252: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.10253: DFBPPR13233 ---- Animal proteins ---- Fibronectin
Source.10254: DFBPPR13234 ---- Animal proteins ---- Alpha-crystallin A chain
Source.10255: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein
Source.10256: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2
Source.10257: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.10258: DFBPPR13242 ---- Animal proteins ---- E-selectin
Source.10259: DFBPPR13244 ---- Animal proteins ---- Endothelin receptor type B
Source.10260: DFBPPR13245 ---- Animal proteins ---- Somatotropin
Source.10261: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.10262: DFBPPR13247 ---- Animal proteins ---- Hemoglobin subunit beta
Source.10263: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.10264: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.10265: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.10266: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.10267: DFBPPR13262 ---- Animal proteins ---- Gastrin
Source.10268: DFBPPR13263 ---- Animal proteins ---- Serotransferrin
Source.10269: DFBPPR13265 ---- Animal proteins ---- Gasdermin-E
Source.10270: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.10271: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.10272: DFBPPR13273 ---- Animal proteins ---- Growth/differentiation factor 8
Source.10273: DFBPPR13274 ---- Animal proteins ---- Aquaporin-2
Source.10274: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.10275: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.10276: DFBPPR13280 ---- Animal proteins ---- Oxytocin-neurophysin 1
Source.10277: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.10278: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.10279: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.10280: DFBPPR13290 ---- Animal proteins ---- Myelin basic protein
Source.10281: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.10282: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.10283: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein
Source.10284: DFBPPR13296 ---- Animal proteins ---- Complement component C9
Source.10285: DFBPPR13297 ---- Animal proteins ---- Plasminogen
Source.10286: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1
Source.10287: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.10288: DFBPPR13305 ---- Animal proteins ---- Cytochrome b
Source.10289: DFBPPR13309 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.10290: DFBPPR13310 ---- Animal proteins ---- Thyrotropin subunit beta
Source.10291: DFBPPR13312 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.10292: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.10293: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.10294: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.10295: DFBPPR13320 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.10296: DFBPPR13323 ---- Animal proteins ---- Myoglobin
Source.10297: DFBPPR13324 ---- Animal proteins ---- Acylphosphatase-2
Source.10298: DFBPPR13325 ---- Animal proteins ---- Serum amyloid A protein
Source.10299: DFBPPR13326 ---- Animal proteins ---- Interferon alpha-1
Source.10300: DFBPPR13328 ---- Animal proteins ---- Interferon alpha-2
Source.10301: DFBPPR13329 ---- Animal proteins ---- Follitropin subunit beta
Source.10302: DFBPPR13332 ---- Animal proteins ---- Interferon alpha-3
Source.10303: DFBPPR13333 ---- Animal proteins ---- Interferon alpha-4
Source.10304: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.10305: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha
Source.10306: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter
Source.10307: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.10308: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.10309: DFBPPR13347 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.10310: DFBPPR13351 ---- Animal proteins ---- Substance P
Source.10311: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.10312: DFBPPR13357 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.10313: DFBPPR13358 ---- Animal proteins ---- Erythropoietin
Source.10314: DFBPPR13362 ---- Animal proteins ---- Biglycan
Source.10315: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.10316: DFBPPR13367 ---- Animal proteins ---- Neutrophil elastase 2B
Source.10317: DFBPPR13371 ---- Animal proteins ---- Calcitonin gene-related peptide 2
Source.10318: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.10319: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein
Source.10320: DFBPPR13378 ---- Animal proteins ---- Neutrophil elastase 2A
Source.10321: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.10322: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.10323: DFBPPR13389 ---- Animal proteins ---- Phosducin
Source.10324: DFBPPR13396 ---- Animal proteins ---- Regulator of G-protein signaling 1
Source.10325: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.10326: DFBPPR13402 ---- Animal proteins ---- Neurophysin 2
Source.10327: DFBPPR13405 ---- Animal proteins ---- 60S acidic ribosomal protein P2
Source.10328: DFBPPR13409 ---- Animal proteins ---- Testin
Source.10329: DFBPPR13416 ---- Animal proteins ---- Antimicrobial peptide eNAP-2
Source.10330: DFBPPR13421 ---- Animal proteins ---- Tumor necrosis factor
Source.10331: DFBPPR13423 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.10332: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.10333: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.10334: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.10335: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2
Source.10336: DFBPPR13433 ---- Animal proteins ---- Major prion protein
Source.10337: DFBPPR13434 ---- Animal proteins ---- Aromatase
Source.10338: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2
Source.10339: DFBPPR13436 ---- Animal proteins ---- Transmembrane protein 147
Source.10340: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.10341: DFBPPR13438 ---- Animal proteins ---- Growth/differentiation factor 8
Source.10342: DFBPPR13439 ---- Animal proteins ---- Hemoglobin subunit beta-A
Source.10343: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.10344: DFBPPR13443 ---- Animal proteins ---- Kit ligand
Source.10345: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.10346: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.10347: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.10348: DFBPPR13453 ---- Animal proteins ---- Hemoglobin subunit beta-C
Source.10349: DFBPPR13459 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn]
Source.10350: DFBPPR13460 ---- Animal proteins ---- RNA-binding protein 3
Source.10351: DFBPPR13461 ---- Animal proteins ---- Sperm protamine P1
Source.10352: DFBPPR13464 ---- Animal proteins ---- Interferon tau
Source.10353: DFBPPR13465 ---- Animal proteins ---- Hemoglobin fetal subunit beta
Source.10354: DFBPPR13469 ---- Animal proteins ---- Cytochrome b
Source.10355: DFBPPR13470 ---- Animal proteins ---- Hemoglobin subunit epsilon-2
Source.10356: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein
Source.10357: DFBPPR13474 ---- Animal proteins ---- Hemoglobin subunit epsilon-1
Source.10358: DFBPPR13475 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.10359: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3
Source.10360: DFBPPR13481 ---- Animal proteins ---- Somatotropin
Source.10361: DFBPPR13483 ---- Animal proteins ---- Interleukin-18
Source.10362: DFBPPR13486 ---- Animal proteins ---- Beta-defensin 1
Source.10363: DFBPPR13490 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.10364: DFBPPR13503 ---- Animal proteins ---- Keratin, type I cytoskeletal 27
Source.10365: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.10366: DFBPPR13511 ---- Animal proteins ---- Myoglobin
Source.10367: DFBPPR13513 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.10368: DFBPPR13522 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2
Source.10369: DFBPPR13523 ---- Animal proteins ---- Keratin-associated protein 15-1
Source.10370: DFBPPR13530 ---- Animal proteins ---- Major prion protein
Source.10371: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin
Source.10372: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.10373: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.10374: DFBPPR13534 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.10375: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.10376: DFBPPR13540 ---- Animal proteins ---- Somatotropin
Source.10377: DFBPPR13544 ---- Animal proteins ---- U8 snoRNA-decapping enzyme
Source.10378: DFBPPR13545 ---- Animal proteins ---- Prolactin
Source.10379: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.10380: DFBPPR13549 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.10381: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1
Source.10382: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.10383: DFBPPR13554 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn]
Source.10384: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.10385: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.10386: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1
Source.10387: DFBPPR13562 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha
Source.10388: DFBPPR13563 ---- Animal proteins ---- Macrophage migration inhibitory factor
Source.10389: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.10390: DFBPPR13567 ---- Animal proteins ---- Cyclin-dependent kinase 4
Source.10391: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1
Source.10392: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36
Source.10393: DFBPPR13573 ---- Animal proteins ---- Tumor necrosis factor
Source.10394: DFBPPR13574 ---- Animal proteins ---- Serotonin N-acetyltransferase
Source.10395: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2
Source.10396: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.10397: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.10398: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.10399: DFBPPR13584 ---- Animal proteins ---- Calpain-3
Source.10400: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.10401: DFBPPR13586 ---- Animal proteins ---- Fibroblast growth factor 1
Source.10402: DFBPPR13587 ---- Animal proteins ---- Aquaporin-1
Source.10403: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.10404: DFBPPR13589 ---- Animal proteins ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.10405: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.10406: DFBPPR13592 ---- Animal proteins ---- Natriuretic peptides A
Source.10407: DFBPPR13593 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.10408: DFBPPR13594 ---- Animal proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating
Source.10409: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.10410: DFBPPR13601 ---- Animal proteins ---- Cathepsin B
Source.10411: DFBPPR13602 ---- Animal proteins ---- Acrosin
Source.10412: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.10413: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2
Source.10414: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.10415: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.10416: DFBPPR13611 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.10417: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.10418: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.10419: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.10420: DFBPPR13618 ---- Animal proteins ---- Hemoglobin subunit beta
Source.10421: DFBPPR13619 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial
Source.10422: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.10423: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.10424: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.10425: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.10426: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.10427: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.10428: DFBPPR13633 ---- Animal proteins ---- Interferon tau-2
Source.10429: DFBPPR13636 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.10430: DFBPPR13637 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial
Source.10431: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.10432: DFBPPR13640 ---- Animal proteins ---- Growth/differentiation factor 8
Source.10433: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6
Source.10434: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.10435: DFBPPR13645 ---- Animal proteins ---- Interferon tau-6
Source.10436: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.10437: DFBPPR13652 ---- Animal proteins ---- Interleukin-3
Source.10438: DFBPPR13653 ---- Animal proteins ---- Interferon tau-11
Source.10439: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.10440: DFBPPR13658 ---- Animal proteins ---- Alpha-crystallin A chain
Source.10441: DFBPPR13659 ---- Animal proteins ---- Oxytocin-neurophysin 1
Source.10442: DFBPPR13662 ---- Animal proteins ---- Aquaporin-2
Source.10443: DFBPPR13664 ---- Animal proteins ---- Interleukin-10
Source.10444: DFBPPR13665 ---- Animal proteins ---- Kit ligand
Source.10445: DFBPPR13666 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.10446: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2
Source.10447: DFBPPR13670 ---- Animal proteins ---- Vasopressin-neurophysin 2-copeptin
Source.10448: DFBPPR13671 ---- Animal proteins ---- Interleukin-7
Source.10449: DFBPPR13675 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.10450: DFBPPR13678 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.10451: DFBPPR13679 ---- Animal proteins ---- Interferon tau-3
Source.10452: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.10453: DFBPPR13681 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1
Source.10454: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.10455: DFBPPR13685 ---- Animal proteins ---- T-cell surface glycoprotein CD3 zeta chain
Source.10456: DFBPPR13686 ---- Animal proteins ---- Vimentin
Source.10457: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1
Source.10458: DFBPPR13689 ---- Animal proteins ---- Caveolin-1
Source.10459: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.10460: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III
Source.10461: DFBPPR13694 ---- Animal proteins ---- Interferon tau-1
Source.10462: DFBPPR13695 ---- Animal proteins ---- Hemoglobin subunit beta-C
Source.10463: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.10464: DFBPPR13697 ---- Animal proteins ---- Carbonic anhydrase 1
Source.10465: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.10466: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.10467: DFBPPR13708 ---- Animal proteins ---- Renin
Source.10468: DFBPPR13711 ---- Animal proteins ---- Coagulation factor IX
Source.10469: DFBPPR13712 ---- Animal proteins ---- Cytochrome b
Source.10470: DFBPPR13713 ---- Animal proteins ---- Plasminogen
Source.10471: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.10472: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.10473: DFBPPR13716 ---- Animal proteins ---- Trichohyalin
Source.10474: DFBPPR13717 ---- Animal proteins ---- C-type natriuretic peptide
Source.10475: DFBPPR13720 ---- Animal proteins ---- Interferon tau-10
Source.10476: DFBPPR13723 ---- Animal proteins ---- Cytochrome c
Source.10477: DFBPPR13724 ---- Animal proteins ---- Sperm protamine P1
Source.10478: DFBPPR13726 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.10479: DFBPPR13727 ---- Animal proteins ---- Prolactin-releasing peptide
Source.10480: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.10481: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.10482: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.10483: DFBPPR13733 ---- Animal proteins ---- Keratin-associated protein 8-1
Source.10484: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.10485: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.10486: DFBPPR13740 ---- Animal proteins ---- Lysozyme C, kidney isozyme
Source.10487: DFBPPR13742 ---- Animal proteins ---- Interferon tau-5
Source.10488: DFBPPR13743 ---- Animal proteins ---- Interferon tau-9
Source.10489: DFBPPR13744 ---- Animal proteins ---- Interferon tau-8
Source.10490: DFBPPR13745 ---- Animal proteins ---- Interferon tau-7
Source.10491: DFBPPR13748 ---- Animal proteins ---- Interferon tau-4
Source.10492: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.10493: DFBPPR13750 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, cytosolic
Source.10494: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.10495: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.10496: DFBPPR13755 ---- Animal proteins ---- Aromatase
Source.10497: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21
Source.10498: DFBPPR13759 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.10499: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.10500: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A
Source.10501: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.10502: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor
Source.10503: DFBPPR13776 ---- Animal proteins ---- Keratin, type II microfibrillar, component 7C
Source.10504: DFBPPR13777 ---- Animal proteins ---- Centromere protein C
Source.10505: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.10506: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.10507: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.10508: DFBPPR13787 ---- Animal proteins ---- Alpha-crystallin B chain
Source.10509: DFBPPR13788 ---- Animal proteins ---- Albumin
Source.10510: DFBPPR13791 ---- Animal proteins ---- Cholinesterase
Source.10511: DFBPPR13792 ---- Animal proteins ---- Antileukoproteinase
Source.10512: DFBPPR13796 ---- Animal proteins ---- Prion-like protein doppel
Source.10513: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor
Source.10514: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6
Source.10515: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24
Source.10516: DFBPPR13800 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.10517: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4
Source.10518: DFBPPR13806 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein
Source.10519: DFBPPR13812 ---- Animal proteins ---- Myoglobin
Source.10520: DFBPPR13814 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide VF
Source.10521: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1
Source.10522: DFBPPR13818 ---- Animal proteins ---- Keratin-associated protein 7-1
Source.10523: DFBPPR13819 ---- Animal proteins ---- Aquaporin-5
Source.10524: DFBPPR13821 ---- Animal proteins ---- Calcitonin
Source.10525: DFBPPR13824 ---- Animal proteins ---- Adrenodoxin
Source.10526: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a
Source.10527: DFBPPR13826 ---- Animal proteins ---- Translocator protein
Source.10528: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3
Source.10529: DFBPPR13834 ---- Animal proteins ---- Biglycan
Source.10530: DFBPPR13840 ---- Animal proteins ---- Cytochrome b561
Source.10531: DFBPPR13841 ---- Animal proteins ---- Keratin-associated protein 6-1
Source.10532: DFBPPR13843 ---- Animal proteins ---- 60S ribosomal protein L10
Source.10533: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein
Source.10534: DFBPPR13845 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.10535: DFBPPR13853 ---- Animal proteins ---- Keratin, type II microfibrillar, component 5
Source.10536: DFBPPR13854 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.10537: DFBPPR13856 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor
Source.10538: DFBPPR13859 ---- Animal proteins ---- Hemoglobin fetal subunit beta
Source.10539: DFBPPR13861 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.10540: DFBPPR13866 ---- Animal proteins ---- Type-2 angiotensin II receptor
Source.10541: DFBPPR13867 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B
Source.10542: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.10543: DFBPPR13871 ---- Animal proteins ---- Parathyroid hormone-related protein
Source.10544: DFBPPR13873 ---- Animal proteins ---- Mineralocorticoid receptor
Source.10545: DFBPPR13875 ---- Animal proteins ---- Gastrin
Source.10546: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.10547: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.10548: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.10549: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.10550: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.10551: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.10552: DFBPPR13895 ---- Animal proteins ---- Elastin
Source.10553: DFBPPR13899 ---- Animal proteins ---- Natriuretic peptides B
Source.10554: DFBPPR13900 ---- Animal proteins ---- Keratin, type I cytoskeletal 15
Source.10555: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter
Source.10556: DFBPPR13910 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.10557: DFBPPR13913 ---- Animal proteins ---- Bombesin receptor subtype-3
Source.10558: DFBPPR13916 ---- Animal proteins ---- Neuropeptide Y receptor type 1
Source.10559: DFBPPR13918 ---- Animal proteins ---- Testin
Source.10560: DFBPPR13920 ---- Animal proteins ---- Troponin T, cardiac muscle
Source.10561: DFBPPR13923 ---- Animal proteins ---- CCAAT/enhancer-binding protein epsilon
Source.10562: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.10563: DFBPPR13927 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.10564: DFBPPR13933 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.10565: DFBPPR13935 ---- Animal proteins ---- Major centromere autoantigen B
Source.10566: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.10567: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.10568: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.10569: DFBPPR13955 ---- Animal proteins ---- Beta-defensin 2
Source.10570: DFBPPR13956 ---- Animal proteins ---- Proteolipid protein 2
Source.10571: DFBPPR13961 ---- Animal proteins ---- Elongation factor 1-delta
Source.10572: DFBPPR13979 ---- Animal proteins ---- Putative uncharacterized protein Z
Source.10573: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B
Source.10574: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A
Source.10575: DFBPPR13986 ---- Animal proteins ---- Cytochrome c iso-1/iso-2
Source.10576: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.10577: DFBPPR13989 ---- Animal proteins ---- Hemoglobin subunit beta-A/B
Source.10578: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.10579: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.10580: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.10581: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.10582: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B
Source.10583: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A
Source.10584: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.10585: DFBPPR14001 ---- Animal proteins ---- Glycoprotein hormones alpha chain 1
Source.10586: DFBPPR14002 ---- Animal proteins ---- Cytochrome b
Source.10587: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.10588: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.10589: DFBPPR14005 ---- Animal proteins ---- Fish-egg lectin
Source.10590: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase
Source.10591: DFBPPR14013 ---- Animal proteins ---- Glycoprotein hormones alpha chain 2
Source.10592: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.10593: DFBPPR14017 ---- Animal proteins ---- Ependymin
Source.10594: DFBPPR14019 ---- Animal proteins ---- Vimentin
Source.10595: DFBPPR14029 ---- Animal proteins ---- Gamma-crystallin M1
Source.10596: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.10597: DFBPPR14044 ---- Animal proteins ---- Transcription factor jun-B
Source.10598: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.10599: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.10600: DFBPPR14056 ---- Animal proteins ---- Gamma-crystallin M3
Source.10601: DFBPPR14057 ---- Animal proteins ---- Granulin-2
Source.10602: DFBPPR14058 ---- Animal proteins ---- Granulin-3
Source.10603: DFBPPR14060 ---- Animal proteins ---- Gamma-crystallin M2
Source.10604: DFBPPR14062 ---- Animal proteins ---- Alpha-1-antitrypsin homolog
Source.10605: DFBPPR14065 ---- Animal proteins ---- Lysozyme g
Source.10606: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.10607: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.10608: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.10609: DFBPPR14081 ---- Marine protein ---- Beta-enolase
Source.10610: DFBPPR14085 ---- Marine protein ---- Hemoglobin subunit beta
Source.10611: DFBPPR14089 ---- Marine protein ---- Flap endonuclease 1
Source.10612: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.10613: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C
Source.10614: DFBPPR14095 ---- Marine protein ---- Enolase-phosphatase E1
Source.10615: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1
Source.10616: DFBPPR14100 ---- Marine protein ---- Cytochrome b
Source.10617: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.10618: DFBPPR14102 ---- Marine protein ---- Anamorsin-B
Source.10619: DFBPPR14104 ---- Marine protein ---- Anamorsin-A
Source.10620: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran
Source.10621: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.10622: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin
Source.10623: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.10624: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.10625: DFBPPR14127 ---- Marine protein ---- RNA-binding protein 8A
Source.10626: DFBPPR14130 ---- Marine protein ---- Ubiquitin carboxyl-terminal hydrolase 12
Source.10627: DFBPPR14132 ---- Marine protein ---- Calumenin-A
Source.10628: DFBPPR14133 ---- Marine protein ---- Calumenin-B
Source.10629: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.10630: DFBPPR14139 ---- Marine protein ---- Thrombin
Source.10631: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein
Source.10632: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.10633: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.10634: DFBPPR14161 ---- Marine protein ---- GTPase Era, mitochondrial
Source.10635: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog
Source.10636: DFBPPR14164 ---- Marine protein ---- Ragulator complex protein LAMTOR2
Source.10637: DFBPPR14165 ---- Marine protein ---- Protein mago nashi homolog
Source.10638: DFBPPR14166 ---- Marine protein ---- Draxin-A
Source.10639: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.10640: DFBPPR14170 ---- Marine protein ---- SOSS complex subunit C
Source.10641: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator
Source.10642: DFBPPR14175 ---- Marine protein ---- Draxin-B
Source.10643: DFBPPR14180 ---- Marine protein ---- Prostamide/prostaglandin F synthase
Source.10644: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.10645: DFBPPR14187 ---- Marine protein ---- Secreted phosphoprotein 24
Source.10646: DFBPPR14188 ---- Marine protein ---- DNA repair protein SWI5 homolog
Source.10647: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.10648: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog
Source.10649: DFBPPR14197 ---- Marine protein ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.10650: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.10651: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein
Source.10652: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein
Source.10653: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.10654: DFBPPR14213 ---- Marine protein ---- Electron transfer flavoprotein regulatory factor 1
Source.10655: DFBPPR14217 ---- Marine protein ---- Tumor necrosis factor alpha-induced protein 8-like protein 2
Source.10656: DFBPPR14218 ---- Marine protein ---- 60S ribosomal protein L18a
Source.10657: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1
Source.10658: DFBPPR14224 ---- Marine protein ---- Costars family protein ABRACL
Source.10659: DFBPPR14229 ---- Marine protein ---- UPF0739 protein C1orf74 homolog
Source.10660: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain
Source.10661: DFBPPR14242 ---- Marine protein ---- Cytochrome b
Source.10662: DFBPPR14250 ---- Marine protein ---- Vasotocin-neurophysin VT 2
Source.10663: DFBPPR14251 ---- Marine protein ---- Isotocin-neurophysin IT 1
Source.10664: DFBPPR14253 ---- Marine protein ---- Vasotocin-neurophysin VT 1
Source.10665: DFBPPR14254 ---- Marine protein ---- Isotocin-neurophysin IT 2
Source.10666: DFBPPR14255 ---- Marine protein ---- L-rhamnose-binding lectin CSL3
Source.10667: DFBPPR14256 ---- Marine protein ---- L-rhamnose-binding lectin CSL1
Source.10668: DFBPPR14263 ---- Marine protein ---- ATP synthase subunit a
Source.10669: DFBPPR14267 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 2, mitochondrial
Source.10670: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial
Source.10671: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1
Source.10672: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.10673: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.10674: DFBPPR14292 ---- Marine protein ---- Phosphomannomutase
Source.10675: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.10676: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE
Source.10677: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.10678: DFBPPR14303 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG
Source.10679: DFBPPR14304 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.10680: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.10681: DFBPPR14308 ---- Marine protein ---- ATP synthase subunit delta, chloroplastic
Source.10682: DFBPPR14311 ---- Marine protein ---- ATP synthase epsilon chain, chloroplastic
Source.10683: DFBPPR14312 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.10684: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase
Source.10685: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1
Source.10686: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.10687: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.10688: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.10689: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.10690: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain
Source.10691: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.10692: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.10693: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH
Source.10694: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B
Source.10695: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N
Source.10696: DFBPPR14350 ---- Marine protein ---- 3-oxoacyl-[acyl-carrier-protein] synthase 3
Source.10697: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.10698: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI
Source.10699: DFBPPR14353 ---- Marine protein ---- Cytochrome c6
Source.10700: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha
Source.10701: DFBPPR14358 ---- Marine protein ---- Thiazole synthase
Source.10702: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'
Source.10703: DFBPPR14361 ---- Marine protein ---- Acetolactate synthase small subunit
Source.10704: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.10705: DFBPPR14363 ---- Marine protein ---- Putative peroxiredoxin ycf42
Source.10706: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE
Source.10707: DFBPPR14367 ---- Marine protein ---- Cytochrome f
Source.10708: DFBPPR14371 ---- Marine protein ---- DNA-directed RNA polymerase subunit alpha
Source.10709: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.10710: DFBPPR14373 ---- Marine protein ---- Cytochrome b6
Source.10711: DFBPPR14374 ---- Marine protein ---- Cytochrome b559 subunit alpha
Source.10712: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.10713: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.10714: DFBPPR14385 ---- Marine protein ---- ATP synthase subunit b, chloroplastic
Source.10715: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.10716: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.10717: DFBPPR14391 ---- Marine protein ---- Cytochrome b6-f complex subunit 5
Source.10718: DFBPPR14393 ---- Marine protein ---- Ribonuclease E/G-like protein
Source.10719: DFBPPR14396 ---- Marine protein ---- Tryptophan synthase alpha chain
Source.10720: DFBPPR14401 ---- Marine protein ---- 50S ribosomal protein L4, chloroplastic
Source.10721: DFBPPR14403 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG
Source.10722: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha
Source.10723: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.10724: DFBPPR14408 ---- Marine protein ---- Cytochrome b6-f complex subunit 6
Source.10725: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26
Source.10726: DFBPPR14417 ---- Marine protein ---- Histidine--tRNA ligase, chloroplastic
Source.10727: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.10728: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.10729: DFBPPR14424 ---- Marine protein ---- Nitrogen regulatory protein P-II
Source.10730: DFBPPR14428 ---- Marine protein ---- Photosystem II reaction center protein I
Source.10731: DFBPPR14433 ---- Marine protein ---- 50S ribosomal protein L14, chloroplastic
Source.10732: DFBPPR14438 ---- Marine protein ---- 50S ribosomal protein L1, chloroplastic
Source.10733: DFBPPR14443 ---- Marine protein ---- 30S ribosomal protein S14, chloroplastic
Source.10734: DFBPPR14447 ---- Marine protein ---- Protein translocase subunit SecY
Source.10735: DFBPPR14451 ---- Marine protein ---- Protein PsbN
Source.10736: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.10737: DFBPPR14454 ---- Marine protein ---- Cytochrome c biogenesis protein Ccs1
Source.10738: DFBPPR14460 ---- Marine protein ---- Probable 30S ribosomal protein 3, chloroplastic
Source.10739: DFBPPR14462 ---- Marine protein ---- Chromophore lyase CpcS/CpeS homolog
Source.10740: DFBPPR14465 ---- Marine protein ---- 50S ribosomal protein L16, chloroplastic
Source.10741: DFBPPR14468 ---- Marine protein ---- 50S ribosomal protein L9, chloroplastic
Source.10742: DFBPPR14470 ---- Marine protein ---- Photosystem I reaction center subunit PsaK
Source.10743: DFBPPR14474 ---- Marine protein ---- Probable ATP-dependent transporter ycf16
Source.10744: DFBPPR14486 ---- Marine protein ---- Putative transport permease ycf38
Source.10745: DFBPPR14487 ---- Marine protein ---- Chloroplast envelope membrane protein
Source.10746: DFBPPR14490 ---- Marine protein ---- Putative HTH-type transcriptional regulator ycf28
Source.10747: DFBPPR14491 ---- Marine protein ---- Photosystem I reaction center subunit II
Source.10748: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46
Source.10749: DFBPPR14495 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.10750: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.10751: DFBPPR14508 ---- Marine protein ---- Uncharacterized tatC-like protein ycf43
Source.10752: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60
Source.10753: DFBPPR14513 ---- Marine protein ---- Uncharacterized protein ycf19
Source.10754: DFBPPR14516 ---- Marine protein ---- Uncharacterized protein ycf53
Source.10755: DFBPPR14525 ---- Marine protein ---- Uncharacterized protein ycf55
Source.10756: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.10757: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2
Source.10758: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.10759: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1
Source.10760: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3
Source.10761: DFBPPR14546 ---- Marine protein ---- Stanniocalcin
Source.10762: DFBPPR14549 ---- Marine protein ---- Pro-opiomelanocortin B
Source.10763: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.10764: DFBPPR14551 ---- Marine protein ---- Histone H4
Source.10765: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor
Source.10766: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2
Source.10767: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.10768: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.10769: DFBPPR14561 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.10770: DFBPPR14562 ---- Marine protein ---- Ladderlectin
Source.10771: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.10772: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.10773: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1
Source.10774: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.10775: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain
Source.10776: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.10777: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.10778: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27
Source.10779: DFBPPR14574 ---- Marine protein ---- Hemoglobin subunit beta-4
Source.10780: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53
Source.10781: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.10782: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.10783: DFBPPR14582 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.10784: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.10785: DFBPPR14585 ---- Marine protein ---- Hemoglobin subunit alpha-4
Source.10786: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible
Source.10787: DFBPPR14589 ---- Marine protein ---- Hemoglobin subunit beta-1
Source.10788: DFBPPR14590 ---- Marine protein ---- Cytochrome b
Source.10789: DFBPPR14591 ---- Marine protein ---- Vimentin
Source.10790: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.10791: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2
Source.10792: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2
Source.10793: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.10794: DFBPPR14602 ---- Marine protein ---- Proteasome subunit beta type-3
Source.10795: DFBPPR14604 ---- Marine protein ---- Anamorsin
Source.10796: DFBPPR14612 ---- Marine protein ---- Complement component C9
Source.10797: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha
Source.10798: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1
Source.10799: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.10800: DFBPPR14620 ---- Marine protein ---- GTP cyclohydrolase 1
Source.10801: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.10802: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase
Source.10803: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.10804: DFBPPR14628 ---- Marine protein ---- C-type natriuretic peptide 1
Source.10805: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1
Source.10806: DFBPPR14635 ---- Marine protein ---- Myelin proteolipid protein
Source.10807: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3
Source.10808: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain
Source.10809: DFBPPR14647 ---- Marine protein ---- Retinol-binding protein 4-A
Source.10810: DFBPPR14648 ---- Marine protein ---- Retinol-binding protein 4-B
Source.10811: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.10812: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.10813: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.10814: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I
Source.10815: DFBPPR14674 ---- Marine protein ---- Glucagon-1
Source.10816: DFBPPR14675 ---- Marine protein ---- Glucagon-2
Source.10817: DFBPPR14679 ---- Marine protein ---- Otolith matrix protein 1
Source.10818: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.10819: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.10820: DFBPPR14695 ---- Marine protein ---- C-type natriuretic peptide 2
Source.10821: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.10822: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13
Source.10823: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.10824: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.10825: DFBPPR14710 ---- Marine protein ---- Substance P
Source.10826: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.10827: DFBPPR14716 ---- Marine protein ---- Secreted phosphoprotein 24
Source.10828: DFBPPR14729 ---- Marine protein ---- Protein LEG1 homolog
Source.10829: DFBPPR14735 ---- Marine protein ---- Salmocidin-1
Source.10830: DFBPPR14739 ---- Marine protein ---- Interleukin-1 receptor-associated kinase 1-binding protein 1 homolog
Source.10831: DFBPPR14746 ---- Marine protein ---- Parvalbumin beta 1
Source.10832: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.10833: DFBPPR14749 ---- Marine protein ---- Alcohol dehydrogenase 1
Source.10834: DFBPPR14750 ---- Marine protein ---- Parvalbumin beta
Source.10835: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme
Source.10836: DFBPPR14753 ---- Marine protein ---- Clotting factor B
Source.10837: DFBPPR14755 ---- Marine protein ---- Techylectin-5A
Source.10838: DFBPPR14756 ---- Marine protein ---- Clotting factor G beta subunit
Source.10839: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.10840: DFBPPR14758 ---- Marine protein ---- Techylectin-5B
Source.10841: DFBPPR14761 ---- Marine protein ---- Intracellular coagulation inhibitor 2
Source.10842: DFBPPR14762 ---- Marine protein ---- Coagulogen
Source.10843: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.10844: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3
Source.10845: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.10846: DFBPPR14768 ---- Marine protein ---- Tachylectin-2
Source.10847: DFBPPR14770 ---- Marine protein ---- Lectin L6
Source.10848: DFBPPR14772 ---- Marine protein ---- Tachystatin-B1
Source.10849: DFBPPR14773 ---- Marine protein ---- Tachystatin-B2
Source.10850: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.10851: DFBPPR14782 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.10852: DFBPPR14783 ---- Marine protein ---- Enolase
Source.10853: DFBPPR14784 ---- Marine protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.10854: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.10855: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain
Source.10856: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain
Source.10857: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain
Source.10858: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.10859: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.10860: DFBPPR14795 ---- Marine protein ---- Guanine nucleotide-binding protein G(s) subunit alpha
Source.10861: DFBPPR14799 ---- Marine protein ---- Arginine kinase
Source.10862: DFBPPR14800 ---- Marine protein ---- Crustacyanin-A1 subunit
Source.10863: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.10864: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase
Source.10865: DFBPPR14804 ---- Marine protein ---- Crustacyanin-C1 subunit
Source.10866: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.10867: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.10868: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.10869: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.10870: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.10871: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1
Source.10872: DFBPPR14814 ---- Marine protein ---- Superoxide dismutase [Mn], mitochondrial
Source.10873: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.10874: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3
Source.10875: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2
Source.10876: DFBPPR14829 ---- Marine protein ---- Crustacean calcium-binding protein 23
Source.10877: DFBPPR14853 ---- Marine protein ---- Sarcoplasmic calcium-binding protein 1
Source.10878: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.10879: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.10880: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.10881: DFBPPR14861 ---- Marine protein ---- Cytochrome b
Source.10882: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233
Source.10883: DFBPPR14864 ---- Marine protein ---- Hemoglobin anodic subunit beta
Source.10884: DFBPPR14865 ---- Marine protein ---- Hemoglobin cathodic subunit beta
Source.10885: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase
Source.10886: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.10887: DFBPPR14871 ---- Marine protein ---- Troponin C, skeletal muscle
Source.10888: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1
Source.10889: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.10890: DFBPPR14880 ---- Microorganism protein ---- Spindle assembly checkpoint kinase
Source.10891: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.10892: DFBPPR14884 ---- Microorganism protein ---- Negative regulator of the PHO system
Source.10893: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1
Source.10894: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.10895: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1
Source.10896: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.10897: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.10898: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific
Source.10899: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.10900: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.10901: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.10902: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase
Source.10903: DFBPPR14898 ---- Microorganism protein ---- Transcription factor IIIB 70 kDa subunit
Source.10904: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.10905: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.10906: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.10907: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.10908: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.10909: DFBPPR14906 ---- Microorganism protein ---- Autophagy-related protein 8
Source.10910: DFBPPR14909 ---- Microorganism protein ---- ATPase GET3
Source.10911: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.10912: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.10913: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.10914: DFBPPR14914 ---- Microorganism protein ---- Casein kinase I homolog RAG8
Source.10915: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein
Source.10916: DFBPPR14916 ---- Microorganism protein ---- Putative lipase ATG15
Source.10917: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase
Source.10918: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1
Source.10919: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific
Source.10920: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific
Source.10921: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.10922: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.10923: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase
Source.10924: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18
Source.10925: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase
Source.10926: DFBPPR14932 ---- Microorganism protein ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72
Source.10927: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.10928: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial
Source.10929: DFBPPR14936 ---- Microorganism protein ---- Inner kinetochore subunit MCM21
Source.10930: DFBPPR14938 ---- Microorganism protein ---- Inosine triphosphate pyrophosphatase
Source.10931: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1
Source.10932: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.10933: DFBPPR14941 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP5
Source.10934: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4
Source.10935: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.10936: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.10937: DFBPPR14949 ---- Microorganism protein ---- EKC/KEOPS complex subunit BUD32
Source.10938: DFBPPR14951 ---- Microorganism protein ---- Octanoyltransferase, mitochondrial
Source.10939: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.10940: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase
Source.10941: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.10942: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1
Source.10943: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1
Source.10944: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1
Source.10945: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.10946: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27
Source.10947: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1
Source.10948: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.10949: DFBPPR14968 ---- Microorganism protein ---- Small COPII coat GTPase SAR1
Source.10950: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2
Source.10951: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.10952: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.10953: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit
Source.10954: DFBPPR14977 ---- Microorganism protein ---- Superoxide dismutase [Cu-Zn]
Source.10955: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase
Source.10956: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like
Source.10957: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.10958: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3
Source.10959: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.10960: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.10961: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.10962: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial
Source.10963: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial
Source.10964: DFBPPR14989 ---- Microorganism protein ---- cAMP-dependent protein kinase regulatory subunit
Source.10965: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.10966: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.10967: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial
Source.10968: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase
Source.10969: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.10970: DFBPPR14998 ---- Microorganism protein ---- Galactokinase
Source.10971: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial
Source.10972: DFBPPR15002 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.10973: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16
Source.10974: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.10975: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase
Source.10976: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b
Source.10977: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase
Source.10978: DFBPPR15014 ---- Microorganism protein ---- AP-1-like transcription factor YAP1
Source.10979: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase
Source.10980: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.10981: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial
Source.10982: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase
Source.10983: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein
Source.10984: DFBPPR15025 ---- Microorganism protein ---- Inner kinetochore subunit OKP1
Source.10985: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.10986: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.10987: DFBPPR15030 ---- Microorganism protein ---- Palmitoyltransferase ERF2
Source.10988: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.10989: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase
Source.10990: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.10991: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial
Source.10992: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.10993: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.10994: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase
Source.10995: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2
Source.10996: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.10997: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase
Source.10998: DFBPPR15046 ---- Microorganism protein ---- Histone acetyltransferase type B catalytic subunit
Source.10999: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1
Source.11000: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1
Source.11001: DFBPPR15051 ---- Microorganism protein ---- Autophagy-related protein 21
Source.11002: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9
Source.11003: DFBPPR15055 ---- Microorganism protein ---- DNA damage-inducible protein 1
Source.11004: DFBPPR15057 ---- Microorganism protein ---- Protein transport protein SEC13
Source.11005: DFBPPR15058 ---- Microorganism protein ---- DNA repair and recombination protein RAD52
Source.11006: DFBPPR15060 ---- Microorganism protein ---- Transaldolase
Source.11007: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase
Source.11008: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.11009: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.11010: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.11011: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial
Source.11012: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1
Source.11013: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1
Source.11014: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.11015: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4
Source.11016: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.11017: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.11018: DFBPPR15082 ---- Microorganism protein ---- Cytochrome c
Source.11019: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase
Source.11020: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.11021: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13
Source.11022: DFBPPR15090 ---- Microorganism protein ---- Transketolase
Source.11023: DFBPPR15091 ---- Microorganism protein ---- Lipoyl synthase, mitochondrial
Source.11024: DFBPPR15092 ---- Microorganism protein ---- Alcohol dehydrogenase 3, mitochondrial
Source.11025: DFBPPR15094 ---- Microorganism protein ---- Thioredoxin reductase, mitochondrial
Source.11026: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.11027: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1
Source.11028: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase
Source.11029: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.11030: DFBPPR15100 ---- Microorganism protein ---- Synaptobrevin homolog YKT6
Source.11031: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.11032: DFBPPR15102 ---- Microorganism protein ---- Signal peptidase complex catalytic subunit SEC11
Source.11033: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.11034: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.11035: DFBPPR15111 ---- Microorganism protein ---- mRNA cap guanine-N7 methyltransferase
Source.11036: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28
Source.11037: DFBPPR15113 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 1
Source.11038: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.11039: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase
Source.11040: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10
Source.11041: DFBPPR15118 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC2
Source.11042: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1
Source.11043: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial
Source.11044: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.11045: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1
Source.11046: DFBPPR15125 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit G
Source.11047: DFBPPR15126 ---- Microorganism protein ---- Adenine phosphoribosyltransferase
Source.11048: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear
Source.11049: DFBPPR15128 ---- Microorganism protein ---- Deoxyuridine 5'-triphosphate nucleotidohydrolase
Source.11050: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.11051: DFBPPR15133 ---- Microorganism protein ---- Iron sulfur cluster assembly protein 1, mitochondrial
Source.11052: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.11053: DFBPPR15138 ---- Microorganism protein ---- GDP-Man:Man(3)GlcNAc(2)-PP-Dol alpha-1,2-mannosyltransferase
Source.11054: DFBPPR15139 ---- Microorganism protein ---- ATP-dependent RNA helicase eIF4A
Source.11055: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4
Source.11056: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase
Source.11057: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.11058: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4
Source.11059: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.11060: DFBPPR15148 ---- Microorganism protein ---- Riboflavin kinase
Source.11061: DFBPPR15149 ---- Microorganism protein ---- Dynein light chain 1, cytoplasmic
Source.11062: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.11063: DFBPPR15151 ---- Microorganism protein ---- 2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-phosphate reductase
Source.11064: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.11065: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase
Source.11066: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase
Source.11067: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81
Source.11068: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.11069: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.11070: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3
Source.11071: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2
Source.11072: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain
Source.11073: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.11074: DFBPPR15169 ---- Microorganism protein ---- Protein VTS1
Source.11075: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.11076: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.11077: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3
Source.11078: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.11079: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84
Source.11080: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.11081: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.11082: DFBPPR15182 ---- Microorganism protein ---- Mitochondrial transcription factor 1
Source.11083: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.11084: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase
Source.11085: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3
Source.11086: DFBPPR15191 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit I
Source.11087: DFBPPR15192 ---- Microorganism protein ---- D-aminoacyl-tRNA deacylase
Source.11088: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9
Source.11089: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3
Source.11090: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.11091: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8
Source.11092: DFBPPR15197 ---- Microorganism protein ---- ATP-dependent RNA helicase FAL1
Source.11093: DFBPPR15198 ---- Microorganism protein ---- tRNA:m(4)X modification enzyme TRM13
Source.11094: DFBPPR15203 ---- Microorganism protein ---- Ubiquitin-like protein ATG12
Source.11095: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.11096: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.11097: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal
Source.11098: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.11099: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1
Source.11100: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.11101: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1
Source.11102: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60
Source.11103: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1
Source.11104: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial
Source.11105: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial
Source.11106: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase
Source.11107: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2
Source.11108: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4
Source.11109: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.11110: DFBPPR15234 ---- Microorganism protein ---- V-type proton ATPase 16 kDa proteolipid subunit 2
Source.11111: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5
Source.11112: DFBPPR15236 ---- Microorganism protein ---- Protein PBN1
Source.11113: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.11114: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3
Source.11115: DFBPPR15242 ---- Microorganism protein ---- Golgi to ER traffic protein 2
Source.11116: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial
Source.11117: DFBPPR15246 ---- Microorganism protein ---- ATP synthase subunit a
Source.11118: DFBPPR15247 ---- Microorganism protein ---- Vacuolar-sorting protein SNF7
Source.11119: DFBPPR15250 ---- Microorganism protein ---- DNA replication regulator SLD2
Source.11120: DFBPPR15253 ---- Microorganism protein ---- Orotate phosphoribosyltransferase
Source.11121: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase
Source.11122: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.11123: DFBPPR15256 ---- Microorganism protein ---- SEC14 cytosolic factor
Source.11124: DFBPPR15258 ---- Microorganism protein ---- Invertase
Source.11125: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.11126: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.11127: DFBPPR15261 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit alpha
Source.11128: DFBPPR15263 ---- Microorganism protein ---- Transcriptional regulator PUL4
Source.11129: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.11130: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.11131: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7
Source.11132: DFBPPR15275 ---- Microorganism protein ---- Exocyst complex protein EXO70
Source.11133: DFBPPR15277 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 20
Source.11134: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.11135: DFBPPR15280 ---- Microorganism protein ---- Protein transport protein BOS1
Source.11136: DFBPPR15282 ---- Microorganism protein ---- Peroxisomal biogenesis factor 3
Source.11137: DFBPPR15283 ---- Microorganism protein ---- Diphthine methyl ester synthase
Source.11138: DFBPPR15285 ---- Microorganism protein ---- Superoxide dismutase 1 copper chaperone
Source.11139: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2
Source.11140: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9
Source.11141: DFBPPR15290 ---- Microorganism protein ---- Peptidyl-prolyl cis-trans isomerase D
Source.11142: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.11143: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.11144: DFBPPR15295 ---- Microorganism protein ---- Galactose/lactose metabolism regulatory protein GAL80
Source.11145: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter
Source.11146: DFBPPR15299 ---- Microorganism protein ---- Histone chaperone RTT106
Source.11147: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1
Source.11148: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7
Source.11149: DFBPPR15308 ---- Microorganism protein ---- UDP-N-acetylglucosamine transporter YEA4
Source.11150: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21
Source.11151: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.11152: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone
Source.11153: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.11154: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1
Source.11155: DFBPPR15315 ---- Microorganism protein ---- Porphobilinogen deaminase
Source.11156: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.11157: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.11158: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial
Source.11159: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1
Source.11160: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2
Source.11161: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3
Source.11162: DFBPPR15331 ---- Microorganism protein ---- Protein YOP1
Source.11163: DFBPPR15332 ---- Microorganism protein ---- GDP-mannose transporter
Source.11164: DFBPPR15333 ---- Microorganism protein ---- GDP-mannose transporter
Source.11165: DFBPPR15334 ---- Microorganism protein ---- Probable kinetochore protein NUF2
Source.11166: DFBPPR15336 ---- Microorganism protein ---- Microsomal signal peptidase subunit 3
Source.11167: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.11168: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.11169: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1
Source.11170: DFBPPR15353 ---- Microorganism protein ---- Pre-mRNA-splicing factor ISY1
Source.11171: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.11172: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.11173: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.11174: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.11175: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.11176: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.11177: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1
Source.11178: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial
Source.11179: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase
Source.11180: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5
Source.11181: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.11182: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1
Source.11183: DFBPPR15379 ---- Microorganism protein ---- General transcription and DNA repair factor IIH subunit TFB2
Source.11184: DFBPPR15383 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 17
Source.11185: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.11186: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.11187: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.11188: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.11189: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.11190: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.11191: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2
Source.11192: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1
Source.11193: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41
Source.11194: DFBPPR15403 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM13
Source.11195: DFBPPR15404 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM10
Source.11196: DFBPPR15406 ---- Microorganism protein ---- Leucine carboxyl methyltransferase 1
Source.11197: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2
Source.11198: DFBPPR15411 ---- Microorganism protein ---- GPI-anchored wall transfer protein 1
Source.11199: DFBPPR15412 ---- Microorganism protein ---- DNA repair protein RAD59
Source.11200: DFBPPR15415 ---- Microorganism protein ---- Transcription initiation factor TFIID subunit 4
Source.11201: DFBPPR15416 ---- Microorganism protein ---- Protein SOP4
Source.11202: DFBPPR15417 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM16
Source.11203: DFBPPR15421 ---- Microorganism protein ---- Cytochrome c lysine N-methyltransferase 1
Source.11204: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.11205: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase
Source.11206: DFBPPR15426 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit TRM82
Source.11207: DFBPPR15427 ---- Microorganism protein ---- RNA exonuclease 4
Source.11208: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial
Source.11209: DFBPPR15430 ---- Microorganism protein ---- Exportin-T
Source.11210: DFBPPR15432 ---- Microorganism protein ---- Pre-rRNA-processing protein ESF2
Source.11211: DFBPPR15435 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit GAR1
Source.11212: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase
Source.11213: DFBPPR15444 ---- Microorganism protein ---- Monopolar spindle protein 2
Source.11214: DFBPPR15445 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM22
Source.11215: DFBPPR15447 ---- Microorganism protein ---- Genetic interactor of prohibitins 3, mitochondrial
Source.11216: DFBPPR15449 ---- Microorganism protein ---- Increased recombination centers protein 22
Source.11217: DFBPPR15451 ---- Microorganism protein ---- GrpE protein homolog, mitochondrial
Source.11218: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase
Source.11219: DFBPPR15453 ---- Microorganism protein ---- ATP synthase subunit 5, mitochondrial
Source.11220: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.11221: DFBPPR15458 ---- Microorganism protein ---- Mitochondrial glycine transporter
Source.11222: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.11223: DFBPPR15460 ---- Microorganism protein ---- Protein BTN1
Source.11224: DFBPPR15461 ---- Microorganism protein ---- EKC/KEOPS complex subunit CGI121
Source.11225: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.11226: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1
Source.11227: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3
Source.11228: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1
Source.11229: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2
Source.11230: DFBPPR15474 ---- Microorganism protein ---- GPN-loop GTPase 3
Source.11231: DFBPPR15476 ---- Microorganism protein ---- Mitochondrial inner membrane i-AAA protease complex subunit MGR1
Source.11232: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.11233: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.11234: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44
Source.11235: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.11236: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.11237: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.11238: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6
Source.11239: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.11240: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62
Source.11241: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.11242: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.11243: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5
Source.11244: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1
Source.11245: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32
Source.11246: DFBPPR15503 ---- Microorganism protein ---- Glycosylphosphatidylinositol anchor biosynthesis protein 11
Source.11247: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.11248: DFBPPR15505 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC15
Source.11249: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1
Source.11250: DFBPPR15511 ---- Microorganism protein ---- 1-(5-phosphoribosyl)-5-[(5-phosphoribosylamino)methylideneamino] imidazole-4-carboxamide isomerase
Source.11251: DFBPPR15513 ---- Microorganism protein ---- Killer toxin subunit gamma
Source.11252: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1
Source.11253: DFBPPR15515 ---- Microorganism protein ---- Tethering factor for nuclear proteasome STS1
Source.11254: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14
Source.11255: DFBPPR15517 ---- Microorganism protein ---- rRNA biogenesis protein RRP36
Source.11256: DFBPPR15519 ---- Microorganism protein ---- Mitochondrial genome maintenance protein MGM101
Source.11257: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10
Source.11258: DFBPPR15533 ---- Microorganism protein ---- Non-histone chromosomal protein 6
Source.11259: DFBPPR15535 ---- Microorganism protein ---- 60S ribosomal protein L44
Source.11260: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23
Source.11261: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase
Source.11262: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.11263: DFBPPR15543 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 7
Source.11264: DFBPPR15544 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 6
Source.11265: DFBPPR15545 ---- Microorganism protein ---- Ubiquinone biosynthesis protein COQ4, mitochondrial
Source.11266: DFBPPR15548 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 25
Source.11267: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.11268: DFBPPR15552 ---- Microorganism protein ---- Autophagy-related protein 14
Source.11269: DFBPPR15554 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 22
Source.11270: DFBPPR15556 ---- Microorganism protein ---- Presequence translocated-associated motor subunit PAM17, mitochondrial
Source.11271: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.11272: DFBPPR15559 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC26
Source.11273: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.11274: DFBPPR15563 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 1
Source.11275: DFBPPR15564 ---- Microorganism protein ---- Protein ZIP2
Source.11276: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.11277: DFBPPR15569 ---- Microorganism protein ---- Phosphatidylglycerol/phosphatidylinositol transfer protein
Source.11278: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1
Source.11279: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1
Source.11280: DFBPPR15574 ---- Microorganism protein ---- Protein PXR1
Source.11281: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1
Source.11282: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.11283: DFBPPR15585 ---- Microorganism protein ---- Putative redox protein FMP46, mitochondrial
Source.11284: DFBPPR15586 ---- Microorganism protein ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.11285: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.11286: DFBPPR15594 ---- Microorganism protein ---- Pre-mRNA polyadenylation factor FIP1
Source.11287: DFBPPR15595 ---- Microorganism protein ---- MICOS complex subunit MIC27
Source.11288: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2
Source.11289: DFBPPR15608 ---- Microorganism protein ---- Pre-mRNA-splicing factor SPP2
Source.11290: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13
Source.11291: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2
Source.11292: DFBPPR15614 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX16, mitochondrial
Source.11293: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1
Source.11294: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.11295: DFBPPR15621 ---- Microorganism protein ---- Spore membrane assembly protein 2
Source.11296: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.11297: DFBPPR15626 ---- Microorganism protein ---- Nucleolar protein 12
Source.11298: DFBPPR15629 ---- Microorganism protein ---- Transcription activator MSS11
Source.11299: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7
Source.11300: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.11301: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4
Source.11302: DFBPPR15634 ---- Microorganism protein ---- Hsp70 nucleotide exchange factor FES1
Source.11303: DFBPPR15636 ---- Microorganism protein ---- ATP synthase subunit d, mitochondrial
Source.11304: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial
Source.11305: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2
Source.11306: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3
Source.11307: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.11308: DFBPPR15655 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP18
Source.11309: DFBPPR15658 ---- Microorganism protein ---- Protein DSE1
Source.11310: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit
Source.11311: DFBPPR15661 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 2
Source.11312: DFBPPR15664 ---- Microorganism protein ---- Spindle pole body component SPC42
Source.11313: DFBPPR15669 ---- Microorganism protein ---- Serine palmitoyltransferase-regulating protein TSC3
Source.11314: DFBPPR15670 ---- Microorganism protein ---- Imidazoleglycerol-phosphate dehydratase
Source.11315: DFBPPR15676 ---- Microorganism protein ---- Antagonist of mitotic exit network protein 1
Source.11316: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.11317: DFBPPR15679 ---- Microorganism protein ---- 40S ribosomal protein S6
Source.11318: DFBPPR15680 ---- Microorganism protein ---- Protein SYM1
Source.11319: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21
Source.11320: DFBPPR15682 ---- Microorganism protein ---- Protein YIM1
Source.11321: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4
Source.11322: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8
Source.11323: DFBPPR15686 ---- Microorganism protein ---- Polyadenylation factor subunit 2
Source.11324: DFBPPR15687 ---- Microorganism protein ---- 40S ribosomal protein S14
Source.11325: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2
Source.11326: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3
Source.11327: DFBPPR15692 ---- Microorganism protein ---- Defect at low temperature protein 1
Source.11328: DFBPPR15693 ---- Microorganism protein ---- Restriction of telomere capping protein 4
Source.11329: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3
Source.11330: DFBPPR15696 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 1
Source.11331: DFBPPR15697 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 2
Source.11332: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.11333: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.11334: DFBPPR15702 ---- Microorganism protein ---- Protein FYV4, mitochondrial
Source.11335: DFBPPR15704 ---- Microorganism protein ---- Oxidation resistance protein 1
Source.11336: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22
Source.11337: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23
Source.11338: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4
Source.11339: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.11340: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial
Source.11341: DFBPPR15714 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 39, mitochondrial
Source.11342: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial
Source.11343: DFBPPR15716 ---- Microorganism protein ---- 40S ribosomal protein S22
Source.11344: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial
Source.11345: DFBPPR15718 ---- Microorganism protein ---- RF4 protein
Source.11346: DFBPPR15720 ---- Microorganism protein ---- Protein BFR2
Source.11347: DFBPPR15722 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 18, mitochondrial
Source.11348: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.11349: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.11350: DFBPPR15732 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 6, mitochondrial
Source.11351: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2
Source.11352: DFBPPR15734 ---- Microorganism protein ---- 40S ribosomal protein S29
Source.11353: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1
Source.11354: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.11355: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1
Source.11356: DFBPPR15744 ---- Microorganism protein ---- Peroxisomal membrane protein PEX21
Source.11357: DFBPPR15748 ---- Microorganism protein ---- Vacuolar membrane protein KLLA0F03465g
Source.11358: DFBPPR15749 ---- Microorganism protein ---- Regulator of rDNA transcription protein 5
Source.11359: DFBPPR15751 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 41, mitochondrial
Source.11360: DFBPPR15752 ---- Microorganism protein ---- Protein HRI1
Source.11361: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog
Source.11362: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86
Source.11363: DFBPPR15760 ---- Microorganism protein ---- 40S ribosomal protein S16
Source.11364: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1
Source.11365: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6
Source.11366: DFBPPR15765 ---- Microorganism protein ---- Protein FMP52, mitochondrial
Source.11367: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5
Source.11368: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.11369: DFBPPR15769 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 11
Source.11370: DFBPPR15771 ---- Microorganism protein ---- Required for respiratory growth protein 1, mitochondrial
Source.11371: DFBPPR15773 ---- Microorganism protein ---- 37S ribosomal protein S25, mitochondrial
Source.11372: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1
Source.11373: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3
Source.11374: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9
Source.11375: DFBPPR15789 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 4
Source.11376: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.11377: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.11378: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32
Source.11379: DFBPPR15798 ---- Microorganism protein ---- HPr kinase/phosphorylase
Source.11380: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.11381: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.11382: DFBPPR15803 ---- Microorganism protein ---- Galactokinase
Source.11383: DFBPPR15804 ---- Microorganism protein ---- Thymidylate synthase
Source.11384: DFBPPR15805 ---- Microorganism protein ---- Serine O-acetyltransferase
Source.11385: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase
Source.11386: DFBPPR15807 ---- Microorganism protein ---- PTS system sorbose-specific EIIB component
Source.11387: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.11388: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.11389: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.11390: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta
Source.11391: DFBPPR15813 ---- Microorganism protein ---- Anthranilate phosphoribosyltransferase
Source.11392: DFBPPR15814 ---- Microorganism protein ---- Amidophosphoribosyltransferase
Source.11393: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase
Source.11394: DFBPPR15816 ---- Microorganism protein ---- Tyrosine recombinase XerD
Source.11395: DFBPPR15818 ---- Microorganism protein ---- PTS system sorbose-specific EIID component
Source.11396: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.11397: DFBPPR15823 ---- Microorganism protein ---- Tryptophan synthase alpha chain
Source.11398: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase
Source.11399: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase
Source.11400: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT
Source.11401: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase
Source.11402: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.11403: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.11404: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase
Source.11405: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.11406: DFBPPR15840 ---- Microorganism protein ---- Protein RecA
Source.11407: DFBPPR15841 ---- Microorganism protein ---- Agaricus bisporus lectin
Source.11408: DFBPPR15842 ---- Microorganism protein ---- Pyranose dehydrogenase
Source.11409: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase
Source.11410: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3
Source.11411: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase
Source.11412: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.11413: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.11414: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.11415: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase
Source.11416: DFBPPR15859 ---- Microorganism protein ---- Histone H4
Source.11417: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase
Source.11418: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.11419: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase
Source.11420: DFBPPR15867 ---- Microorganism protein ---- Superoxide dismutase [Mn], mitochondrial
Source.11421: DFBPPR15868 ---- Microorganism protein ---- Thymidylate synthase
Source.11422: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.11423: DFBPPR15871 ---- Microorganism protein ---- Aldehyde dehydrogenase
Source.11424: DFBPPR15872 ---- Microorganism protein ---- Glutamine synthetase
Source.11425: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.11426: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.11427: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.11428: DFBPPR15882 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.11429: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.11430: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase
Source.11431: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1
Source.11432: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1
Source.11433: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase
Source.11434: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2
Source.11435: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1
Source.11436: DFBPPR0005 ---- Plant protein ---- Farnesyl pyrophosphate synthase 2
Source.11437: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.11438: DFBPPR0008 ---- Plant protein ---- Gamma conglutin 2
Source.11439: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.11440: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.11441: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.11442: DFBPPR0015 ---- Plant protein ---- Isoflavone reductase homolog
Source.11443: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase
Source.11444: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.11445: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic
Source.11446: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.11447: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.11448: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.11449: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.11450: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.11451: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.11452: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.11453: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.11454: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.11455: DFBPPR7765 ---- Plant protein ---- Flap endonuclease 1-A
Source.11456: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.11457: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.11458: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.11459: DFBPPR7769 ---- Plant protein ---- Flap endonuclease 1-B
Source.11460: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic
Source.11461: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase
Source.11462: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.11463: DFBPPR7774 ---- Plant protein ---- Obtusifoliol 14-alpha demethylase
Source.11464: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.11465: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.11466: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.11467: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial
Source.11468: DFBPPR7781 ---- Plant protein ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase
Source.11469: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.11470: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.11471: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3
Source.11472: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic
Source.11473: DFBPPR7789 ---- Plant protein ---- Thiamine thiazole synthase 2, chloroplastic
Source.11474: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase
Source.11475: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.11476: DFBPPR7794 ---- Plant protein ---- Cytochrome b6
Source.11477: DFBPPR7795 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.11478: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.11479: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.11480: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.11481: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.11482: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.11483: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial
Source.11484: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.11485: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.11486: DFBPPR7810 ---- Plant protein ---- Cytochrome f
Source.11487: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.11488: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.11489: DFBPPR7816 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha
Source.11490: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.11491: DFBPPR7819 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial
Source.11492: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.11493: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.11494: DFBPPR7822 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.11495: DFBPPR7824 ---- Plant protein ---- Cytochrome b559 subunit alpha
Source.11496: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.11497: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.11498: DFBPPR7829 ---- Plant protein ---- Cyanate hydratase
Source.11499: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.11500: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a
Source.11501: DFBPPR7836 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic
Source.11502: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.11503: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.11504: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.11505: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.11506: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.11507: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.11508: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2
Source.11509: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.11510: DFBPPR7849 ---- Plant protein ---- Cytochrome b6-f complex subunit 5
Source.11511: DFBPPR7850 ---- Plant protein ---- ATP synthase subunit b, chloroplastic
Source.11512: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.11513: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a
Source.11514: DFBPPR7854 ---- Plant protein ---- Cytochrome b6-f complex subunit 6
Source.11515: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.11516: DFBPPR7856 ---- Plant protein ---- Maturase K
Source.11517: DFBPPR7860 ---- Plant protein ---- CASP-like protein 1C1
Source.11518: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.11519: DFBPPR7863 ---- Plant protein ---- 50S ribosomal protein L23-B, chloroplastic
Source.11520: DFBPPR7865 ---- Plant protein ---- 50S ribosomal protein L23-A, chloroplastic
Source.11521: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1
Source.11522: DFBPPR7871 ---- Plant protein ---- Casparian strip membrane protein 3
Source.11523: DFBPPR7876 ---- Plant protein ---- Photosystem II reaction center protein I
Source.11524: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.11525: DFBPPR7880 ---- Plant protein ---- 30S ribosomal protein S14, chloroplastic
Source.11526: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1
Source.11527: DFBPPR7886 ---- Plant protein ---- Protein PsbN
Source.11528: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1
Source.11529: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1
Source.11530: DFBPPR7891 ---- Plant protein ---- CASP-like protein 1B1
Source.11531: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1
Source.11532: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1
Source.11533: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1
Source.11534: DFBPPR7896 ---- Plant protein ---- Photosystem I reaction center subunit IX
Source.11535: DFBPPR7898 ---- Plant protein ---- 50S ribosomal protein L16, chloroplastic
Source.11536: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1
Source.11537: DFBPPR7909 ---- Plant protein ---- CASP-like protein 2D1
Source.11538: DFBPPR7910 ---- Plant protein ---- Glycine-rich RNA-binding protein 2
Source.11539: DFBPPR7911 ---- Plant protein ---- Glycine-rich RNA-binding protein 1
Source.11540: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2
Source.11541: DFBPPR7915 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.11542: DFBPPR7918 ---- Plant protein ---- CASP-like protein 1U1
Source.11543: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.11544: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.11545: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.11546: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.11547: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.11548: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.11549: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.11550: DFBPPR7936 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase, chloroplastic
Source.11551: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.11552: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic
Source.11553: DFBPPR7940 ---- Plant protein ---- Leghemoglobin-1
Source.11554: DFBPPR7941 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial
Source.11555: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.11556: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1
Source.11557: DFBPPR7947 ---- Plant protein ---- Legumin type B
Source.11558: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.11559: DFBPPR7949 ---- Plant protein ---- Cytochrome f
Source.11560: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP
Source.11561: DFBPPR7951 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.11562: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1
Source.11563: DFBPPR7956 ---- Plant protein ---- Legumin type B
Source.11564: DFBPPR7957 ---- Plant protein ---- Legumin type B
Source.11565: DFBPPR7958 ---- Plant protein ---- Legumin type B
Source.11566: DFBPPR7959 ---- Plant protein ---- Leghemoglobin 49
Source.11567: DFBPPR7960 ---- Plant protein ---- Vicilin
Source.11568: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.11569: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1
Source.11570: DFBPPR7966 ---- Plant protein ---- GTP-binding nuclear protein Ran/TC4
Source.11571: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92
Source.11572: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87
Source.11573: DFBPPR7974 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.11574: DFBPPR7975 ---- Plant protein ---- Protein Ycf2
Source.11575: DFBPPR7980 ---- Plant protein ---- Metallothionein-like protein 1A
Source.11576: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1
Source.11577: DFBPPR7983 ---- Plant protein ---- 14-3-3-like protein B
Source.11578: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.11579: DFBPPR7989 ---- Plant protein ---- Cytochrome c
Source.11580: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.11581: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1
Source.11582: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.11583: DFBPPR7994 ---- Plant protein ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic
Source.11584: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B
Source.11585: DFBPPR7996 ---- Plant protein ---- Cytochrome b559 subunit alpha
Source.11586: DFBPPR8003 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.11587: DFBPPR8006 ---- Plant protein ---- Protein PsbN
Source.11588: DFBPPR8007 ---- Plant protein ---- Maturase K
Source.11589: DFBPPR8013 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.11590: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.11591: DFBPPR8028 ---- Plant protein ---- Polygalacturonase inhibitor 2
Source.11592: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.11593: DFBPPR8033 ---- Plant protein ---- Uricase-2
Source.11594: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.11595: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.11596: DFBPPR8036 ---- Plant protein ---- Pectinesterase 3
Source.11597: DFBPPR8037 ---- Plant protein ---- Arcelin-1
Source.11598: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.11599: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.11600: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.11601: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.11602: DFBPPR8045 ---- Plant protein ---- Polygalacturonase inhibitor 1
Source.11603: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.11604: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.11605: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.11606: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.11607: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.11608: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.11609: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.11610: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha
Source.11611: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.11612: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.11613: DFBPPR8060 ---- Plant protein ---- Phenylalanine ammonia-lyase class 2
Source.11614: DFBPPR8062 ---- Plant protein ---- Polygalacturonase inhibitor 3
Source.11615: DFBPPR8063 ---- Plant protein ---- Leghemoglobin A
Source.11616: DFBPPR8064 ---- Plant protein ---- Endochitinase PR4
Source.11617: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.11618: DFBPPR8066 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.11619: DFBPPR8067 ---- Plant protein ---- Phenylalanine ammonia-lyase class 3
Source.11620: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.11621: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.11622: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform
Source.11623: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.11624: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.11625: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.11626: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.11627: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme
Source.11628: DFBPPR8081 ---- Plant protein ---- Glutamine synthetase N-1
Source.11629: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.11630: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase
Source.11631: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.11632: DFBPPR8088 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.11633: DFBPPR8091 ---- Plant protein ---- Cytochrome f
Source.11634: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.11635: DFBPPR8094 ---- Plant protein ---- Glutamine synthetase PR-1
Source.11636: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.11637: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.11638: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.11639: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.11640: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.11641: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.11642: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.11643: DFBPPR8110 ---- Plant protein ---- Leghemoglobin
Source.11644: DFBPPR8111 ---- Plant protein ---- Cytochrome b6-f complex subunit 5
Source.11645: DFBPPR8113 ---- Plant protein ---- ATP synthase subunit b, chloroplastic
Source.11646: DFBPPR8114 ---- Plant protein ---- Arcelin-2
Source.11647: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.11648: DFBPPR8117 ---- Plant protein ---- Cytochrome b6-f complex subunit 6
Source.11649: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.11650: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.11651: DFBPPR8122 ---- Plant protein ---- Arcelin-4
Source.11652: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1
Source.11653: DFBPPR8125 ---- Plant protein ---- Eukaryotic translation initiation factor 5
Source.11654: DFBPPR8129 ---- Plant protein ---- Serine/threonine-protein phosphatase PP1
Source.11655: DFBPPR8132 ---- Plant protein ---- Photosystem II reaction center protein I
Source.11656: DFBPPR8133 ---- Plant protein ---- 30S ribosomal protein S14, chloroplastic
Source.11657: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase
Source.11658: DFBPPR8141 ---- Plant protein ---- Photosystem I reaction center subunit IX
Source.11659: DFBPPR8142 ---- Plant protein ---- Protein PsbN
Source.11660: DFBPPR8144 ---- Plant protein ---- Maturase K
Source.11661: DFBPPR8149 ---- Plant protein ---- 50S ribosomal protein L16, chloroplastic
Source.11662: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.11663: DFBPPR8158 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.0
Source.11664: DFBPPR8159 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.11665: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial
Source.11666: DFBPPR8162 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.11667: DFBPPR8184 ---- Plant protein ---- 43 kDa cell wall protein
Source.11668: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.11669: DFBPPR8214 ---- Plant protein ---- Cytochrome c
Source.11670: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase
Source.11671: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.11672: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase
Source.11673: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase
Source.11674: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase
Source.11675: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.11676: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.11677: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.11678: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.11679: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.11680: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase
Source.11681: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.11682: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.11683: DFBPPR8232 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial
Source.11684: DFBPPR8234 ---- Plant protein ---- Anther-specific protein SF18
Source.11685: DFBPPR8236 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit I, chloroplastic
Source.11686: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.11687: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.11688: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase
Source.11689: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.11690: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.11691: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.11692: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.11693: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.11694: DFBPPR8252 ---- Plant protein ---- NADH-ubiquinone oxidoreductase chain 3
Source.11695: DFBPPR8256 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme
Source.11696: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.11697: DFBPPR8259 ---- Plant protein ---- Cytochrome f
Source.11698: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.11699: DFBPPR8266 ---- Plant protein ---- Putative ATP synthase protein YMF19
Source.11700: DFBPPR8267 ---- Plant protein ---- Cytochrome b559 subunit alpha
Source.11701: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.11702: DFBPPR8271 ---- Plant protein ---- Cytochrome b6
Source.11703: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.11704: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.11705: DFBPPR8279 ---- Plant protein ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.11706: DFBPPR8280 ---- Plant protein ---- Putative serine/threonine-protein kinase
Source.11707: DFBPPR8286 ---- Plant protein ---- Oleosin
Source.11708: DFBPPR8287 ---- Plant protein ---- Seed fatty acyl-ester hydrolase
Source.11709: DFBPPR8288 ---- Plant protein ---- Cytochrome b6-f complex subunit 5
Source.11710: DFBPPR8289 ---- Plant protein ---- ATP synthase subunit b, chloroplastic
Source.11711: DFBPPR8291 ---- Plant protein ---- 2S seed storage protein
Source.11712: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.11713: DFBPPR8294 ---- Plant protein ---- Cytochrome b6-f complex subunit 6
Source.11714: DFBPPR8295 ---- Plant protein ---- Probable phospholipid hydroperoxide glutathione peroxidase
Source.11715: DFBPPR8299 ---- Plant protein ---- 50S ribosomal protein L23, chloroplastic
Source.11716: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.11717: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5
Source.11718: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.11719: DFBPPR8305 ---- Plant protein ---- Photosystem II reaction center protein I
Source.11720: DFBPPR8306 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic
Source.11721: DFBPPR8310 ---- Plant protein ---- 30S ribosomal protein S14, chloroplastic
Source.11722: DFBPPR8314 ---- Plant protein ---- Maturase K
Source.11723: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.11724: DFBPPR8319 ---- Plant protein ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.11725: DFBPPR8321 ---- Plant protein ---- Protein PsbN
Source.11726: DFBPPR8326 ---- Plant protein ---- Photosystem I reaction center subunit IX
Source.11727: DFBPPR8327 ---- Plant protein ---- 50S ribosomal protein L16, chloroplastic
Source.11728: DFBPPR8331 ---- Plant protein ---- Auxin-responsive protein SAUR50
Source.11729: DFBPPR8332 ---- Plant protein ---- Glutathione peroxidase 1
Source.11730: DFBPPR8341 ---- Plant protein ---- Cysteine proteinase inhibitor A
Source.11731: DFBPPR8343 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.11732: DFBPPR8346 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Source.11733: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide exhibited very low Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of  3700 μM. 


Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools No prediction can be made about the peptide bitterness. prediction
SMILES N[C@@]([H])(Cc1ccccc1)C(=O)NCC(=O)O
Preparation method
Mode of preparation

Enzymatic hydrolysis

Enzyme(s)/starter culture

Land snail by-product (hepatopancreas) was hydrolyzed with Alcalase.

Stability & Cytotoxicity
Peptide stability
Literature report:

Land snail by-product hydrolysate was not affected by human in vitro gastrointestinal digestion.

EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report:

Land snail by-product hydrolysate enhanced the Caco-2 intestinal cell metabolic activity and did not induce any toxicity in Wistar rats.

Prediction: ToxinPred
Additional information
Additional information

Land snail by-product hydrolysate represents a new candidate as an ingredient for the design of functional foods against hypertension.

Database cross-references
DFBP
[D1] DFBPANHY0067
[D2] DFBPMUFU0331
BIOPEP-UWM [D3] 7605
APD [D4] -
BioPepDB [D5] -
MBPDB [D6] -
Reference(s)
Primary literature Drevet P. Preuves de l’effet antihypertenseur d’un hydrolysat de coproduit d’escargot terrestre (Helix aspersa) – Identification des peptides impliqués [Evidence of antihypertensive effect of a land snail (Helix aspersa) by-product hydrolysate - Identification of involved peptides]. Ann Cardiol Angeiol (Paris). 2017 Jun;66(3):140-148. French.
PMID: 28576282
Other literature(s)

[1] Cheung, H.S., et al., Binding of peptide substrates and inhibitors of angiotensin-converting enzyme. Importance of the COOH-terminal dipeptide sequence. J Biol Chem, 1980. 255(2): p. 401-7.

PubDate 2017
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214