E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI1405(ACE-inhibitory peptide)
DFBP ID DFBPACEI1405
Peptide sequence DFY
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Asp-Phe-Tyr
Single-letter amino acid DFY
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
443.46 Da 443.45 Da c
Net charge 0.00 c
Isoelectric point (pI)

3.80

IC50 44.35 ± 3.93 μM
pIC50 -1.647
GRAVY -0.6667 c
Hydrophilic residue ratio 33.33% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal
Organism/Source Bovine meat proteins
Precursor protein Collagen alpha-2(I) chain
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0894 ---- Plant proteins ---- Serotonin N-acetyltransferase 1, chloroplastic
Source.2: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.3: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.4: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.5: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic
Source.6: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1
Source.7: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.8: DFBPPR1009 ---- Plant proteins ---- SPX domain-containing protein 4
Source.9: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.10: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.11: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.12: DFBPPR1101 ---- Plant proteins ---- Histidine-containing phosphotransfer protein 2
Source.13: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.14: DFBPPR1165 ---- Plant proteins ---- Chaperone protein dnaJ A7A, chloroplastic
Source.15: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.16: DFBPPR1178 ---- Plant proteins ---- Chaperone protein dnaJ A7B, chloroplastic
Source.17: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial
Source.18: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.19: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.20: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.21: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.22: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1
Source.23: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2
Source.24: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.25: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.26: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2
Source.27: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.28: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.29: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.30: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.31: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.32: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.33: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.34: DFBPPR1789 ---- Plant proteins ---- NAC domain-containing protein 22
Source.35: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.36: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.37: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.38: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.39: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.40: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.41: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.42: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2
Source.43: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.44: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.45: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.46: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.47: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.48: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.49: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5
Source.50: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.51: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23
Source.52: DFBPPR2233 ---- Plant proteins ---- Thioredoxin Y, chloroplastic
Source.53: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30
Source.54: DFBPPR2279 ---- Plant proteins ---- Thioredoxin-like protein CITRX, chloroplastic
Source.55: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2
Source.56: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.57: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.58: DFBPPR2399 ---- Plant proteins ---- Germin-like protein 5-1
Source.59: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial
Source.60: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.61: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.62: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.63: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.64: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a
Source.65: DFBPPR2659 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.66: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.67: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.68: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b
Source.69: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.70: DFBPPR2776 ---- Plant proteins ---- Splicing factor U2af small subunit A
Source.71: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.72: DFBPPR2863 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.73: DFBPPR2877 ---- Plant proteins ---- Splicing factor U2af small subunit B
Source.74: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d
Source.75: DFBPPR2915 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 2
Source.76: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13
Source.77: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3
Source.78: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.79: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.80: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.81: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28
Source.82: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4
Source.83: DFBPPR3130 ---- Plant proteins ---- COP9 signalosome complex subunit 6
Source.84: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.85: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.86: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.87: DFBPPR3198 ---- Plant proteins ---- Probable protein phosphatase 2C 59
Source.88: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4
Source.89: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic
Source.90: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10
Source.91: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.92: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3
Source.93: DFBPPR3349 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.94: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68
Source.95: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.96: DFBPPR3421 ---- Plant proteins ---- Cyanate hydratase
Source.97: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.98: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.99: DFBPPR3538 ---- Plant proteins ---- Probable protein phosphatase 2C 7
Source.100: DFBPPR3558 ---- Plant proteins ---- Probable protein phosphatase 2C 45
Source.101: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.102: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B''
Source.103: DFBPPR3765 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 1
Source.104: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52
Source.105: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic
Source.106: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.107: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.108: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2
Source.109: DFBPPR4045 ---- Plant proteins ---- 60S ribosomal protein L11
Source.110: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.111: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.112: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.113: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.114: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.115: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.116: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1
Source.117: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5
Source.118: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.119: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.120: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.121: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.122: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.123: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.124: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein
Source.125: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.126: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.127: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.128: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.129: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.130: DFBPPR4574 ---- Plant proteins ---- Cyclin-C1-1
Source.131: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3
Source.132: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.133: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.134: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.135: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.136: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.137: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8
Source.138: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.139: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.140: DFBPPR4941 ---- Plant proteins ---- Chaperone protein dnaJ A8, chloroplastic
Source.141: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d
Source.142: DFBPPR4966 ---- Plant proteins ---- Glycinin G5
Source.143: DFBPPR4980 ---- Plant proteins ---- Lactoylglutathione lyase
Source.144: DFBPPR4995 ---- Plant proteins ---- Glycinin G4
Source.145: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.146: DFBPPR5097 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.147: DFBPPR5135 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-2
Source.148: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.149: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.150: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.151: DFBPPR5242 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-1
Source.152: DFBPPR5255 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-B
Source.153: DFBPPR5266 ---- Plant proteins ---- Cyanate hydratase
Source.154: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.155: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.156: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.157: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.158: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.159: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase
Source.160: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A
Source.161: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.162: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.163: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.164: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase
Source.165: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.166: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.167: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B
Source.168: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase
Source.169: DFBPPR5838 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.170: DFBPPR5905 ---- Plant proteins ---- Cyanate hydratase
Source.171: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1
Source.172: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic
Source.173: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.174: DFBPPR6320 ---- Plant proteins ---- Phenylalanine ammonia-lyase 1
Source.175: DFBPPR6324 ---- Plant proteins ---- Phenylalanine ammonia-lyase 2
Source.176: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.177: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.178: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.179: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.180: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.181: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.182: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.183: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.184: DFBPPR6511 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.185: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.186: DFBPPR6659 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit
Source.187: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.188: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B
Source.189: DFBPPR6843 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.190: DFBPPR6984 ---- Plant proteins ---- Thaumatin-like protein PWIR2
Source.191: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2
Source.192: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.193: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.194: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1
Source.195: DFBPPR7191 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.196: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.197: DFBPPR7339 ---- Plant proteins ---- Pathogenesis-related protein 1C
Source.198: DFBPPR7341 ---- Plant proteins ---- Pathogenesis-related protein 1A/1B
Source.199: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase
Source.200: DFBPPR7619 ---- Milk proteins ---- Prolactin-inducible protein
Source.201: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein
Source.202: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor
Source.203: DFBPPR7705 ---- Milk proteins ---- Late lactation protein A, LLP-A
Source.204: DFBPPR7746 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 2
Source.205: DFBPPR7747 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 1
Source.206: DFBPPR7748 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 3
Source.207: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.208: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.209: DFBPPR8368 ---- Plant proteins ---- 13S globulin basic chain
Source.210: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.211: DFBPPR8485 ---- Milk proteins ---- Folate receptor alpha
Source.212: DFBPPR8508 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.213: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.214: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN
Source.215: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.216: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2
Source.217: DFBPPR16103 ---- Animal proteins ---- Laforin
Source.218: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.219: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.220: DFBPPR16138 ---- Animal proteins ---- Claudin-3
Source.221: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.222: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.223: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.224: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.225: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.226: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.227: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.228: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.229: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.230: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2
Source.231: DFBPPR16487 ---- Animal proteins ---- Claudin-2
Source.232: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.233: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.234: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.235: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.236: DFBPPR16661 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.237: DFBPPR16689 ---- Animal proteins ---- Gamma-crystallin B
Source.238: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor
Source.239: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.240: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.241: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.242: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor
Source.243: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase
Source.244: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.245: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.246: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.247: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.248: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic
Source.249: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.250: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.251: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.252: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.253: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.254: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.255: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.256: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein
Source.257: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.258: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.259: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.260: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.261: DFBPPR17237 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.262: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.263: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.264: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.265: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.266: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.267: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.268: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.269: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5
Source.270: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.271: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.272: DFBPPR17466 ---- Animal proteins ---- N-alpha-acetyltransferase 50
Source.273: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2
Source.274: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.275: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.276: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.277: DFBPPR17592 ---- Animal proteins ---- Claudin-3
Source.278: DFBPPR17593 ---- Animal proteins ---- Claudin-3
Source.279: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor
Source.280: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.281: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.282: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A
Source.283: DFBPPR17769 ---- Animal proteins ---- Polycomb complex protein BMI-1
Source.284: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.285: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.286: DFBPPR17881 ---- Animal proteins ---- Myoblast determination protein 1
Source.287: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.288: DFBPPR17918 ---- Animal proteins ---- Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial
Source.289: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.290: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.291: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.292: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.293: DFBPPR18090 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1
Source.294: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.295: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha
Source.296: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.297: DFBPPR18221 ---- Animal proteins ---- Gamma-crystallin B
Source.298: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.299: DFBPPR18307 ---- Animal proteins ---- Claudin-4
Source.300: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.301: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.302: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.303: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.304: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.305: DFBPPR18593 ---- Animal proteins ---- Pigment epithelium-derived factor
Source.306: DFBPPR18612 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2
Source.307: DFBPPR18727 ---- Animal proteins ---- Interleukin-2
Source.308: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9
Source.309: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.310: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.311: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.312: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B
Source.313: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.314: DFBPPR18848 ---- Animal proteins ---- Ras-related protein Rab-15
Source.315: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.316: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain
Source.317: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.318: DFBPPR18933 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.319: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13
Source.320: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.321: DFBPPR18964 ---- Animal proteins ---- Placental prolactin-related protein 1
Source.322: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.323: DFBPPR18996 ---- Animal proteins ---- Serine/threonine-protein kinase 40
Source.324: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I
Source.325: DFBPPR19011 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF138
Source.326: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.327: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2
Source.328: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta
Source.329: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.330: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.331: DFBPPR19196 ---- Animal proteins ---- Melanoma-derived growth regulatory protein
Source.332: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1
Source.333: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1
Source.334: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.335: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.336: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.337: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.338: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase
Source.339: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.340: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1
Source.341: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2
Source.342: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.343: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.344: DFBPPR19787 ---- Animal proteins ---- 60S ribosomal protein L11
Source.345: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.346: DFBPPR19806 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial
Source.347: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.348: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5
Source.349: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.350: DFBPPR19884 ---- Animal proteins ---- Activator of basal transcription 1
Source.351: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic
Source.352: DFBPPR19905 ---- Animal proteins ---- Complement component C6
Source.353: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.354: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.355: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.356: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.357: DFBPPR20091 ---- Animal proteins ---- Carboxypeptidase O
Source.358: DFBPPR20199 ---- Animal proteins ---- Claudin-7
Source.359: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial
Source.360: DFBPPR20218 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL9
Source.361: DFBPPR20225 ---- Animal proteins ---- Claudin-2
Source.362: DFBPPR20235 ---- Animal proteins ---- Gamma-crystallin A
Source.363: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2
Source.364: DFBPPR20319 ---- Animal proteins ---- Protein pelota homolog
Source.365: DFBPPR20353 ---- Animal proteins ---- Protein mago nashi homolog 2
Source.366: DFBPPR20374 ---- Animal proteins ---- 5'-deoxynucleotidase HDDC2
Source.367: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase
Source.368: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2
Source.369: DFBPPR20494 ---- Animal proteins ---- Protein mago nashi homolog
Source.370: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.371: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.372: DFBPPR20546 ---- Animal proteins ---- Odorant-binding protein
Source.373: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A
Source.374: DFBPPR20564 ---- Animal proteins ---- Ras-related protein Rab-26
Source.375: DFBPPR20568 ---- Animal proteins ---- Phenazine biosynthesis-like domain-containing protein
Source.376: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related
Source.377: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1
Source.378: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain
Source.379: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease
Source.380: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11
Source.381: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1
Source.382: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.383: DFBPPR20711 ---- Animal proteins ---- Transcription elongation factor, mitochondrial
Source.384: DFBPPR20720 ---- Animal proteins ---- BoLa class II histocompatibility antigen, DQB*0101 beta chain
Source.385: DFBPPR20730 ---- Animal proteins ---- Gamma-crystallin F
Source.386: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial
Source.387: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1
Source.388: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.389: DFBPPR20937 ---- Animal proteins ---- Leucine-rich repeat-containing protein 25
Source.390: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.391: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.392: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17
Source.393: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein
Source.394: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial
Source.395: DFBPPR21082 ---- Animal proteins ---- Sentrin-specific protease 7
Source.396: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.397: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.398: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.399: DFBPPR21330 ---- Animal proteins ---- 60S ribosomal export protein NMD3
Source.400: DFBPPR21352 ---- Animal proteins ---- Glutathione peroxidase 7
Source.401: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein
Source.402: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.403: DFBPPR21427 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 2
Source.404: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1
Source.405: DFBPPR21449 ---- Animal proteins ---- Magnesium transporter NIPA2
Source.406: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.407: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.408: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2
Source.409: DFBPPR21561 ---- Animal proteins ---- Vesicle-trafficking protein SEC22c
Source.410: DFBPPR21562 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.411: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2
Source.412: DFBPPR21727 ---- Animal proteins ---- 39S ribosomal protein L1, mitochondrial
Source.413: DFBPPR21769 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 21
Source.414: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like
Source.415: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein
Source.416: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.417: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2
Source.418: DFBPPR21977 ---- Animal proteins ---- Protein ARV1
Source.419: DFBPPR22070 ---- Animal proteins ---- Maturin
Source.420: DFBPPR22081 ---- Animal proteins ---- DnaJ homolog subfamily C member 5B
Source.421: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7
Source.422: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.423: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A
Source.424: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog
Source.425: DFBPPR22159 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 24
Source.426: DFBPPR22197 ---- Animal proteins ---- Nuclear receptor 2C2-associated protein
Source.427: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.428: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.429: DFBPPR22289 ---- Animal proteins ---- Heme-binding protein 1
Source.430: DFBPPR22292 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial
Source.431: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2
Source.432: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7
Source.433: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.434: DFBPPR22394 ---- Animal proteins ---- RNA-binding Raly-like protein
Source.435: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.436: DFBPPR22557 ---- Animal proteins ---- Ataxin-7-like protein 1
Source.437: DFBPPR22627 ---- Animal proteins ---- Leucine-rich repeat-containing protein 61
Source.438: DFBPPR22671 ---- Animal proteins ---- Uncharacterized protein C1orf185 homolog
Source.439: DFBPPR22698 ---- Animal proteins ---- Protein FAM228A
Source.440: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.441: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1
Source.442: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.443: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.444: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.445: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.446: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.447: DFBPPR8766 ---- Animal proteins ---- Myoblast determination protein 1
Source.448: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.449: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.450: DFBPPR8833 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.451: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.452: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.453: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.454: DFBPPR9072 ---- Animal proteins ---- CD9 antigen
Source.455: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.456: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6
Source.457: DFBPPR9148 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1
Source.458: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.459: DFBPPR9174 ---- Animal proteins ---- Ficolin-1
Source.460: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10
Source.461: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B
Source.462: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.463: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.464: DFBPPR9391 ---- Animal proteins ---- 60S ribosomal protein L11
Source.465: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.466: DFBPPR9633 ---- Animal proteins ---- Claudin-17
Source.467: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.468: DFBPPR9684 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.469: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain
Source.470: DFBPPR9723 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D alpha chain
Source.471: DFBPPR9735 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C alpha chain
Source.472: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain
Source.473: DFBPPR9754 ---- Animal proteins ---- Ig lambda chain C region
Source.474: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.475: DFBPPR9789 ---- Animal proteins ---- Calsequestrin-2
Source.476: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.477: DFBPPR9821 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.478: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.479: DFBPPR9857 ---- Animal proteins ---- Cytochrome c oxidase subunit 6C
Source.480: DFBPPR9905 ---- Animal proteins ---- DnaJ homolog subfamily C member 5B
Source.481: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor
Source.482: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1
Source.483: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.484: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.485: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase
Source.486: DFBPPR10141 ---- Animal proteins ---- Chondroitin sulfate proteoglycan 5
Source.487: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.488: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.489: DFBPPR10299 ---- Animal proteins ---- Myoblast determination protein 1 homolog
Source.490: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.491: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.492: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.493: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.494: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.495: DFBPPR10428 ---- Animal proteins ---- Polycomb complex protein BMI-1
Source.496: DFBPPR10441 ---- Animal proteins ---- Laminin subunit beta-1
Source.497: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4
Source.498: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.499: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.500: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.501: DFBPPR10613 ---- Animal proteins ---- Diamine acetyltransferase 1
Source.502: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin
Source.503: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.504: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin
Source.505: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4
Source.506: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.507: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.508: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.509: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.510: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.511: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.512: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.513: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.514: DFBPPR11017 ---- Animal proteins ---- Collectin-12
Source.515: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.516: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.517: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.518: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta
Source.519: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein
Source.520: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.521: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.522: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5
Source.523: DFBPPR11279 ---- Animal proteins ---- Zinc finger protein neuro-d4
Source.524: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.525: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2
Source.526: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A
Source.527: DFBPPR11398 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.528: DFBPPR11465 ---- Animal proteins ---- Serine/threonine-protein kinase 40
Source.529: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog
Source.530: DFBPPR11520 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 2
Source.531: DFBPPR11531 ---- Animal proteins ---- Protein AATF
Source.532: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.533: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.534: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog
Source.535: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein
Source.536: DFBPPR11579 ---- Animal proteins ---- Actin-related protein 6
Source.537: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.538: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622
Source.539: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.540: DFBPPR11610 ---- Animal proteins ---- MOB-like protein phocein
Source.541: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.542: DFBPPR11682 ---- Animal proteins ---- DCN1-like protein 1
Source.543: DFBPPR11711 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.544: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D
Source.545: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial
Source.546: DFBPPR11826 ---- Animal proteins ---- Protein mago nashi homolog
Source.547: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17
Source.548: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.549: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.550: DFBPPR11908 ---- Animal proteins ---- Centrosomal protein kizuna
Source.551: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.552: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.553: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.554: DFBPPR12012 ---- Animal proteins ---- Galectin-related protein
Source.555: DFBPPR12106 ---- Animal proteins ---- Ig lambda chain C region
Source.556: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1
Source.557: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.558: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.559: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.560: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.561: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1
Source.562: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.563: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.564: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.565: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.566: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.567: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.568: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.569: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.570: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.571: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.572: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.573: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.574: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.575: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.576: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.577: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.578: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.579: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase
Source.580: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.581: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.582: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.583: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1
Source.584: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.585: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.586: DFBPPR12914 ---- Animal proteins ---- Lipase member H
Source.587: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain
Source.588: DFBPPR13103 ---- Animal proteins ---- T-cell receptor beta chain C region
Source.589: DFBPPR13120 ---- Animal proteins ---- Ig lambda chain C region
Source.590: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.591: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.592: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.593: DFBPPR13385 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.594: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.595: DFBPPR13493 ---- Animal proteins ---- ATP synthase protein 8
Source.596: DFBPPR13506 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.597: DFBPPR13543 ---- Animal proteins ---- Myoblast determination protein 1
Source.598: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.599: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.600: DFBPPR13610 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.601: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.602: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.603: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21
Source.604: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.605: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.606: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.607: DFBPPR14014 ---- Animal proteins ---- Somatotropin
Source.608: DFBPPR14022 ---- Animal proteins ---- Transcriptional regulator Myc-1
Source.609: DFBPPR14023 ---- Animal proteins ---- Transcriptional regulator Myc-2
Source.610: DFBPPR14165 ---- Marine protein ---- Protein mago nashi homolog
Source.611: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.612: DFBPPR14215 ---- Marine protein ---- Protein SMG9
Source.613: DFBPPR14265 ---- Marine protein ---- Gonadotropin subunit beta-2
Source.614: DFBPPR14268 ---- Marine protein ---- Cytochrome c oxidase subunit 6C-1
Source.615: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.616: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.617: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein
Source.618: DFBPPR14344 ---- Marine protein ---- Probable molybdopterin-synthase adenylyltransferase
Source.619: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase
Source.620: DFBPPR14393 ---- Marine protein ---- Ribonuclease E/G-like protein
Source.621: DFBPPR14417 ---- Marine protein ---- Histidine--tRNA ligase, chloroplastic
Source.622: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.623: DFBPPR14606 ---- Marine protein ---- Myoblast determination protein 1 homolog 1
Source.624: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.625: DFBPPR14661 ---- Marine protein ---- Myoblast determination protein 1 homolog 2
Source.626: DFBPPR14663 ---- Marine protein ---- Transcriptional regulator Myc
Source.627: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.628: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.629: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.630: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.631: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.632: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.633: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.634: DFBPPR14956 ---- Microorganism protein ---- ATP-dependent RNA helicase DHH1
Source.635: DFBPPR14976 ---- Microorganism protein ---- Adenylate kinase
Source.636: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8
Source.637: DFBPPR15018 ---- Microorganism protein ---- Sorting nexin-4
Source.638: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.639: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.640: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.641: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13
Source.642: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.643: DFBPPR15182 ---- Microorganism protein ---- Mitochondrial transcription factor 1
Source.644: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.645: DFBPPR15264 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX1
Source.646: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2
Source.647: DFBPPR15301 ---- Microorganism protein ---- Protein N-terminal and lysine N-methyltransferase EFM7
Source.648: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5
Source.649: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.650: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase
Source.651: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.652: DFBPPR15411 ---- Microorganism protein ---- GPI-anchored wall transfer protein 1
Source.653: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.654: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.655: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10
Source.656: DFBPPR15545 ---- Microorganism protein ---- Ubiquinone biosynthesis protein COQ4, mitochondrial
Source.657: DFBPPR15595 ---- Microorganism protein ---- MICOS complex subunit MIC27
Source.658: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.659: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23
Source.660: DFBPPR15720 ---- Microorganism protein ---- Protein BFR2
Source.661: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5
Source.662: DFBPPR15792 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 32
Source.663: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase
Source.664: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.665: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.666: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3
Source.667: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase
Source.668: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.669: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase
Source.670: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2
Source.671: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1
Source.672: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4
Source.673: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase
Source.674: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.675: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.676: DFBPPR7822 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.677: DFBPPR7829 ---- Plant protein ---- Cyanate hydratase
Source.678: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.679: DFBPPR8078 ---- Plant protein ---- Phenylalanine ammonia-lyase class 1
Source.680: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.681: DFBPPR8119 ---- Plant protein ---- Chalcone--flavonone isomerase
Source.682: DFBPPR8144 ---- Plant protein ---- Maturase K
Source.683: DFBPPR8231 ---- Plant protein ---- Phenylalanine ammonia-lyase
Source.684: DFBPPR8285 ---- Plant protein ---- 26S proteasome regulatory subunit 6B homolog
Source.685: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 44.35 ± 3.93 μM.

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydrolysis

Enzyme(s)/starter culture

The peptide was released following hydrolysis with the enzyme papain, ficain or bromelain.

Stability & Cytotoxicity
Peptide stability
Literature report:

During the simulated GI digestion (including pepsin, trypsin and chymotrypsin) in silico, the peptide DFY was cleaved into the di-peptides FY, DF.

EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information N.D
Database cross-references
BIOPEP-UWM [D1] 9696
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Lafarga T, O'Connor P, Hayes M. Identification of novel dipeptidyl peptidase-IV and angiotensin-I-converting enzyme inhibitory peptides from meat proteins using in silico analysis. Peptides. 2014 Sep;59:53-62.
PMID: 25020248
Other literature(s) N.D
PubDate 2014
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214