Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI1409(ACE-inhibitory peptide)

DFBP ID	DFBPACEI1409
Peptide sequence	LDV
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	Renin-inhibitory activity ^[D1], Antihypertensive activity ^[D2], Multifunctional activity ^[D3]

Calculated physicochemical properties

Three-letter amino acid

Leu-Asp-Val

Single-letter amino acid

LDV

Peptide length

Peptide mass

Experimental mass	Theoretical mass
345 Da	345.39 Da ^c

Net charge

-1

Isoelectric point (pI)

3.1

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

1.5000^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Plant
Organism/Source	Rapeseed
Precursor protein	Cruciferin
Residue position	f(42-44)
Precursor protein(s) search	Source.1: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8 Source.2: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog Source.3: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4 Source.4: DFBPPR0823 ---- Plant proteins ---- bZIP transcription factor RISBZ3 Source.5: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C Source.6: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1 Source.7: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.8: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B Source.9: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11 Source.10: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.11: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1 Source.12: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.13: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1 Source.14: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1 Source.15: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase Source.16: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a Source.17: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.18: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1 Source.19: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.20: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10 Source.21: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1 Source.22: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a Source.23: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1 Source.24: DFBPPR0959 ---- Plant proteins ---- Probable serine/threonine-protein kinase BSK3 Source.25: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein Source.26: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.27: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21 Source.28: DFBPPR0971 ---- Plant proteins ---- Protein STAR1 Source.29: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.30: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.31: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B Source.32: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1 Source.33: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.34: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1 Source.35: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4 Source.36: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1 Source.37: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A Source.38: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4 Source.39: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1 Source.40: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2 Source.41: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9 Source.42: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.43: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic Source.44: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.45: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic Source.46: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B Source.47: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.48: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A Source.49: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.50: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2 Source.51: DFBPPR1167 ---- Plant proteins ---- Phototropin-2 Source.52: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic Source.53: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2 Source.54: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic Source.55: DFBPPR1179 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 1, mitochondrial Source.56: DFBPPR1215 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A4, chloroplastic Source.57: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic Source.58: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3 Source.59: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic Source.60: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a Source.61: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.62: DFBPPR1308 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 4 Source.63: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.64: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3 Source.65: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic Source.66: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.67: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.68: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain Source.69: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain Source.70: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7 Source.71: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1 Source.72: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1 Source.73: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.74: DFBPPR1346 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 5 Source.75: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.76: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial Source.77: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic Source.78: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1 Source.79: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5 Source.80: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING Source.81: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.82: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10 Source.83: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.84: DFBPPR1396 ---- Plant proteins ---- Peroxidase 2 Source.85: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29 Source.86: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1 Source.87: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5 Source.88: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.89: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C Source.90: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.91: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain Source.92: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3 Source.93: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic Source.94: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.95: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase Source.96: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic Source.97: DFBPPR1468 ---- Plant proteins ---- Serotonin N-acetyltransferase 2, chloroplastic Source.98: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5 Source.99: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4 Source.100: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1 Source.101: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.102: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic Source.103: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.104: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase Source.105: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1 Source.106: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.107: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50 Source.108: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3 Source.109: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1 Source.110: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.111: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6 Source.112: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80 Source.113: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.114: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3 Source.115: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain Source.116: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1 Source.117: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2 Source.118: DFBPPR1579 ---- Plant proteins ---- O-methyltransferase 1, chloroplastic Source.119: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.120: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.121: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.122: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic Source.123: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.124: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.125: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.126: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic Source.127: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.128: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial Source.129: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.130: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.131: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain Source.132: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain Source.133: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.134: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.135: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.136: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase Source.137: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4 Source.138: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.139: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.140: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.141: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a Source.142: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase Source.143: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1 Source.144: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4 Source.145: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.146: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a Source.147: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain Source.148: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2 Source.149: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2 Source.150: DFBPPR1770 ---- Plant proteins ---- Probable tyrosine-protein phosphatase DSP2 Source.151: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b Source.152: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.153: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic Source.154: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial Source.155: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12 Source.156: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.157: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.158: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain Source.159: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase Source.160: DFBPPR1806 ---- Plant proteins ---- Laccase-19 Source.161: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a Source.162: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.163: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic Source.164: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.165: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2 Source.166: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17 Source.167: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.168: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B Source.169: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D Source.170: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial Source.171: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5 Source.172: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6 Source.173: DFBPPR1879 ---- Plant proteins ---- Germin-like protein 1-3 Source.174: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11 Source.175: DFBPPR1889 ---- Plant proteins ---- Laccase-18 Source.176: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1 Source.177: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha Source.178: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2 Source.179: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.180: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A Source.181: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.182: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1 Source.183: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase Source.184: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.185: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.186: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1 Source.187: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic Source.188: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.189: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.190: DFBPPR2040 ---- Plant proteins ---- Laccase-3 Source.191: DFBPPR2052 ---- Plant proteins ---- Laccase-23 Source.192: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.193: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2 Source.194: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.195: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c Source.196: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.197: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1 Source.198: DFBPPR2081 ---- Plant proteins ---- Expansin-A1 Source.199: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6 Source.200: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10 Source.201: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.202: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic Source.203: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.204: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain Source.205: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1 Source.206: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.207: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial Source.208: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.209: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial Source.210: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1 Source.211: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.212: DFBPPR2185 ---- Plant proteins ---- Inositol-pentakisphosphate 2-kinase IPK1 Source.213: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4 Source.214: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37 Source.215: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.216: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial Source.217: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5 Source.218: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2 Source.219: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1 Source.220: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.221: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.222: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2 Source.223: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase Source.224: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.225: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic Source.226: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1 Source.227: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic Source.228: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase Source.229: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic Source.230: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5 Source.231: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2 Source.232: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic Source.233: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5 Source.234: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30 Source.235: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase Source.236: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23 Source.237: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial Source.238: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100 Source.239: DFBPPR2399 ---- Plant proteins ---- Germin-like protein 5-1 Source.240: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2 Source.241: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2 Source.242: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2 Source.243: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1 Source.244: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS Source.245: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic Source.246: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial Source.247: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.248: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A Source.249: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22 Source.250: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.251: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21 Source.252: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta Source.253: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.254: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18 Source.255: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.256: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.257: DFBPPR2625 ---- Plant proteins ---- 18.6 kDa class III heat shock protein Source.258: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a Source.259: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.260: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1 Source.261: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b Source.262: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10 Source.263: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.264: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog Source.265: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2 Source.266: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase Source.267: DFBPPR2694 ---- Plant proteins ---- Monothiol glutaredoxin-S7, chloroplastic Source.268: DFBPPR2701 ---- Plant proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.269: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2 Source.270: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20 Source.271: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B Source.272: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.273: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.274: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3 Source.275: DFBPPR2753 ---- Plant proteins ---- Transportin-1 Source.276: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1 Source.277: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.278: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.279: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3 Source.280: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.281: DFBPPR2795 ---- Plant proteins ---- Protein THYLAKOID FORMATION1, chloroplastic Source.282: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.283: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.284: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.285: DFBPPR2826 ---- Plant proteins ---- Replication factor C subunit 3 Source.286: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23 Source.287: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4 Source.288: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.289: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.290: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.291: DFBPPR2847 ---- Plant proteins ---- Glutaredoxin-C4, chloroplastic Source.292: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.293: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase Source.294: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2 Source.295: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.296: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.297: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A Source.298: DFBPPR2879 ---- Plant proteins ---- Germin-like protein 3-3 Source.299: DFBPPR2884 ---- Plant proteins ---- Expansin-B2 Source.300: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1 Source.301: DFBPPR2890 ---- Plant proteins ---- Germin-like protein 3-6 Source.302: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic Source.303: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.304: DFBPPR2917 ---- Plant proteins ---- Two-component response regulator ORR28 Source.305: DFBPPR2919 ---- Plant proteins ---- Germin-like protein 3-5 Source.306: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3 Source.307: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2 Source.308: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.309: DFBPPR2930 ---- Plant proteins ---- Putative germin-like protein 3-4 Source.310: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A Source.311: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5 Source.312: DFBPPR2951 ---- Plant proteins ---- MADS-box transcription factor 23 Source.313: DFBPPR2955 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 3 Source.314: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14 Source.315: DFBPPR2974 ---- Plant proteins ---- Derlin-1 Source.316: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.317: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1 Source.318: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L Source.319: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like Source.320: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1 Source.321: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800 Source.322: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31 Source.323: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B Source.324: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.325: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.326: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.327: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2 Source.328: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.329: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E Source.330: DFBPPR3117 ---- Plant proteins ---- Replication factor C subunit 2 Source.331: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.332: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5 Source.333: DFBPPR3138 ---- Plant proteins ---- Villin-1 Source.334: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic Source.335: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300 Source.336: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3 Source.337: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog Source.338: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15 Source.339: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.340: DFBPPR3241 ---- Plant proteins ---- Elongation factor 1-delta 2 Source.341: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B Source.342: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18 Source.343: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.344: DFBPPR3278 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 3 Source.345: DFBPPR3284 ---- Plant proteins ---- Probable voltage-gated potassium channel subunit beta Source.346: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4 Source.347: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2 Source.348: DFBPPR3324 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2C Source.349: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.350: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8 Source.351: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22 Source.352: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A Source.353: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22 Source.354: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2 Source.355: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic Source.356: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.357: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7 Source.358: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.359: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1 Source.360: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2 Source.361: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.362: DFBPPR3452 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit K Source.363: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6 Source.364: DFBPPR3474 ---- Plant proteins ---- NAC domain-containing protein 76 Source.365: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog Source.366: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4 Source.367: DFBPPR3498 ---- Plant proteins ---- Actin-related protein 6 Source.368: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2 Source.369: DFBPPR3508 ---- Plant proteins ---- 60S ribosomal protein L5-1 Source.370: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4 Source.371: DFBPPR3527 ---- Plant proteins ---- Elongation factor 1-delta 1 Source.372: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.373: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3 Source.374: DFBPPR3547 ---- Plant proteins ---- Probable BRI1 kinase inhibitor 1 Source.375: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8 Source.376: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61 Source.377: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B'' Source.378: DFBPPR3570 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-1 Source.379: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500 Source.380: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2 Source.381: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19 Source.382: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.383: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2 Source.384: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20 Source.385: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3 Source.386: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K Source.387: DFBPPR3634 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A2-2 Source.388: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6 Source.389: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2 Source.390: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29 Source.391: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39 Source.392: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.393: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2 Source.394: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1 Source.395: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1 Source.396: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.397: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2 Source.398: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6 Source.399: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3 Source.400: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1 Source.401: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.402: DFBPPR3811 ---- Plant proteins ---- Cytochrome c-type biogenesis CcmH-like mitochondrial protein Source.403: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.404: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3 Source.405: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4 Source.406: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C Source.407: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23 Source.408: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2 Source.409: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1 Source.410: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5 Source.411: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13 Source.412: DFBPPR3898 ---- Plant proteins ---- Squamosa promoter-binding-like protein 11 Source.413: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.414: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5 Source.415: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.416: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.417: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.418: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7 Source.419: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2 Source.420: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.421: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4 Source.422: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3 Source.423: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase Source.424: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.425: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1 Source.426: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1 Source.427: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.428: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic Source.429: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8 Source.430: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog Source.431: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1 Source.432: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2 Source.433: DFBPPR4109 ---- Plant proteins ---- 60S ribosomal protein L5-2 Source.434: DFBPPR4112 ---- Plant proteins ---- Casparian strip membrane protein 3 Source.435: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5 Source.436: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95 Source.437: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.438: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16 Source.439: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6 Source.440: DFBPPR4161 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 1 Source.441: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16 Source.442: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5 Source.443: DFBPPR4201 ---- Plant proteins ---- Cyclin-D6-1 Source.444: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1 Source.445: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5 Source.446: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A Source.447: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3 Source.448: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1 Source.449: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H Source.450: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1 Source.451: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1 Source.452: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900 Source.453: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2 Source.454: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15 Source.455: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D Source.456: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1 Source.457: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16 Source.458: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5 Source.459: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.460: DFBPPR4354 ---- Plant proteins ---- Probable calcium-binding protein CML9 Source.461: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4 Source.462: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A Source.463: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1 Source.464: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10 Source.465: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B Source.466: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2 Source.467: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.468: DFBPPR4389 ---- Plant proteins ---- CASP-like protein 5B2 Source.469: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2 Source.470: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32 Source.471: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5 Source.472: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2 Source.473: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2 Source.474: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7 Source.475: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B Source.476: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.477: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.478: DFBPPR4465 ---- Plant proteins ---- Electron transfer flavoprotein subunit beta, mitochondrial Source.479: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14 Source.480: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24 Source.481: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1 Source.482: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6 Source.483: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2 Source.484: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1 Source.485: DFBPPR4502 ---- Plant proteins ---- Actin-depolymerizing factor 7 Source.486: DFBPPR4508 ---- Plant proteins ---- Photosystem II stability/assembly factor HCF136, chloroplastic Source.487: DFBPPR4512 ---- Plant proteins ---- Actin-depolymerizing factor 3 Source.488: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3 Source.489: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6 Source.490: DFBPPR4535 ---- Plant proteins ---- Protein NLP2 Source.491: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.492: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3 Source.493: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1 Source.494: DFBPPR4584 ---- Plant proteins ---- Probable calcium-binding protein CML29 Source.495: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4 Source.496: DFBPPR4597 ---- Plant proteins ---- Putative calcium-binding protein CML23 Source.497: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.498: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1 Source.499: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1 Source.500: DFBPPR4691 ---- Plant proteins ---- Probable protein ABIL3 Source.501: DFBPPR4706 ---- Plant proteins ---- Tubby-like protein 4 Source.502: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17 Source.503: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.504: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9 Source.505: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30 Source.506: DFBPPR4753 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 2 Source.507: DFBPPR4755 ---- Plant proteins ---- 40S ribosomal protein S8 Source.508: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900 Source.509: DFBPPR4812 ---- Plant proteins ---- Hypersensitive-induced response protein-like protein 1 Source.510: DFBPPR4888 ---- Plant proteins ---- bZIP transcription factor RISBZ4 Source.511: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein Source.512: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic Source.513: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.514: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1 Source.515: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2 Source.516: DFBPPR4938 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 2, mitochondrial Source.517: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.518: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I Source.519: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.520: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.521: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.522: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.523: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.524: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.525: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2 Source.526: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.527: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1 Source.528: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase Source.529: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain Source.530: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic Source.531: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.532: DFBPPR5082 ---- Plant proteins ---- Catalase-4 Source.533: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.534: DFBPPR5086 ---- Plant proteins ---- Catalase-3 Source.535: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain Source.536: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain Source.537: DFBPPR5120 ---- Plant proteins ---- 17.3 kDa class I heat shock protein Source.538: DFBPPR5132 ---- Plant proteins ---- 18.5 kDa class I heat shock protein Source.539: DFBPPR5143 ---- Plant proteins ---- 17.5 kDa class I heat shock protein Source.540: DFBPPR5145 ---- Plant proteins ---- 22.0 kDa class IV heat shock protein Source.541: DFBPPR5167 ---- Plant proteins ---- Probable aldo-keto reductase 1 Source.542: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.543: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3 Source.544: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein Source.545: DFBPPR5264 ---- Plant proteins ---- Casparian strip membrane protein 4 Source.546: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4 Source.547: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9 Source.548: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2 Source.549: DFBPPR5284 ---- Plant proteins ---- CASP-like protein 1E2 Source.550: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.551: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1 Source.552: DFBPPR5350 ---- Plant proteins ---- Wound-induced protein Source.553: DFBPPR5358 ---- Plant proteins ---- 14-3-3-like protein D Source.554: DFBPPR5368 ---- Plant proteins ---- Desiccation protectant protein Lea14 homolog Source.555: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2 Source.556: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.557: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.558: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.559: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1 Source.560: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic Source.561: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.562: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase Source.563: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1 Source.564: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1 Source.565: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic Source.566: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2 Source.567: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2 Source.568: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2 Source.569: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3 Source.570: DFBPPR5506 ---- Plant proteins ---- Ferredoxin-3, chloroplastic Source.571: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic Source.572: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.573: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3 Source.574: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B Source.575: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A Source.576: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.577: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.578: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.579: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.580: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1 Source.581: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.582: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.583: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain Source.584: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain Source.585: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic Source.586: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain Source.587: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.588: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1 Source.589: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic Source.590: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.591: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2 Source.592: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.593: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain Source.594: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1 Source.595: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic Source.596: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.597: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain Source.598: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain Source.599: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain Source.600: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain Source.601: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain Source.602: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1 Source.603: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2 Source.604: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain Source.605: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.606: DFBPPR5727 ---- Plant proteins ---- Protein disulfide-isomerase Source.607: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.608: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23 Source.609: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2 Source.610: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1 Source.611: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2 Source.612: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2 Source.613: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1 Source.614: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain Source.615: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2 Source.616: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A Source.617: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.618: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2 Source.619: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase Source.620: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.621: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.622: DFBPPR5846 ---- Plant proteins ---- Eukaryotic initiation factor 4A Source.623: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein Source.624: DFBPPR5888 ---- Plant proteins ---- 17.0 kDa class II heat shock protein Source.625: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL Source.626: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein Source.627: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase Source.628: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein Source.629: DFBPPR5981 ---- Plant proteins ---- 17.8 kDa class II heat shock protein Source.630: DFBPPR5986 ---- Plant proteins ---- Beta-amylase Source.631: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2 Source.632: DFBPPR5994 ---- Plant proteins ---- 17.5 kDa class II heat shock protein Source.633: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b Source.634: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3 Source.635: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein Source.636: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.637: DFBPPR6070 ---- Plant proteins ---- 40S ribosomal protein S8 Source.638: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.639: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.640: DFBPPR6131 ---- Plant proteins ---- Zein-alpha B49 Source.641: DFBPPR6149 ---- Plant proteins ---- 60S ribosomal protein L17 Source.642: DFBPPR6210 ---- Plant proteins ---- Cysteine synthase Source.643: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic Source.644: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial Source.645: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.646: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1 Source.647: DFBPPR6241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 1 protein Source.648: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.649: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.650: DFBPPR6276 ---- Plant proteins ---- Outer envelope pore protein 16, chloroplastic Source.651: DFBPPR6282 ---- Plant proteins ---- Rhicadhesin receptor Source.652: DFBPPR6287 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 2 protein Source.653: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8 Source.654: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic Source.655: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic Source.656: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.657: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.658: DFBPPR6310 ---- Plant proteins ---- Catalase Source.659: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase Source.660: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic Source.661: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic Source.662: DFBPPR6345 ---- Plant proteins ---- Aspartate carbamoyltransferase 1, chloroplastic Source.663: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.664: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic Source.665: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain Source.666: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain Source.667: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain Source.668: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.669: DFBPPR6374 ---- Plant proteins ---- 18.1 kDa class I heat shock protein Source.670: DFBPPR6380 ---- Plant proteins ---- Legumin A Source.671: DFBPPR6390 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic Source.672: DFBPPR6402 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic Source.673: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.674: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase Source.675: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial Source.676: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial Source.677: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.678: DFBPPR6424 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic Source.679: DFBPPR6425 ---- Plant proteins ---- Legumin A2 Source.680: DFBPPR6426 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.681: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic Source.682: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.683: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.684: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1 Source.685: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial Source.686: DFBPPR6560 ---- Plant proteins ---- 60S ribosomal protein L27 Source.687: DFBPPR6606 ---- Plant proteins ---- Unknown protein from spot 251 of 2D-PAGE of thylakoid Source.688: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1 Source.689: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.690: DFBPPR6645 ---- Plant proteins ---- Catalase-1 Source.691: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase Source.692: DFBPPR6650 ---- Plant proteins ---- Oxalate oxidase GF-2.8 Source.693: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A Source.694: DFBPPR6656 ---- Plant proteins ---- Catalase Source.695: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.696: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.697: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.698: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.699: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.700: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1 Source.701: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B Source.702: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa Source.703: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.704: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain Source.705: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain Source.706: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain Source.707: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain Source.708: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain Source.709: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic Source.710: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase Source.711: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A Source.712: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.713: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17 Source.714: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.715: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.716: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1 Source.717: DFBPPR6980 ---- Plant proteins ---- Translationally-controlled tumor protein homolog Source.718: DFBPPR7011 ---- Plant proteins ---- Oxalate oxidase 1 Source.719: DFBPPR7035 ---- Plant proteins ---- Oxalate oxidase 2 Source.720: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.721: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.722: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.723: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI Source.724: DFBPPR7068 ---- Plant proteins ---- Peroxidase 2 Source.725: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1 Source.726: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.727: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic Source.728: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.729: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A Source.730: DFBPPR7144 ---- Plant proteins ---- L-lactate dehydrogenase B Source.731: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain Source.732: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV Source.733: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.734: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.735: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33 Source.736: DFBPPR7332 ---- Plant proteins ---- 60S ribosomal protein L17-1 Source.737: DFBPPR7346 ---- Plant proteins ---- 60S ribosomal protein L17-2 Source.738: DFBPPR7350 ---- Plant proteins ---- Pathogen-related protein Source.739: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1 Source.740: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.741: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.742: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.743: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a Source.744: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412 Source.745: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405 Source.746: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.747: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1 Source.748: DFBPPR7454 ---- Plant proteins ---- Peptide methionine sulfoxide reductase Source.749: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal Source.750: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal Source.751: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.752: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial Source.753: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.754: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog Source.755: DFBPPR7506 ---- Plant proteins ---- Thioredoxin H-type 1 Source.756: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1 Source.757: DFBPPR7611 ---- Milk proteins ---- Clusterin Source.758: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2 Source.759: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1 Source.760: DFBPPR7646 ---- Milk proteins ---- Beta-1,4-galactosyltransferase 1 Source.761: DFBPPR7649 ---- Milk proteins ---- Cadherin-1 Source.762: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.763: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.764: DFBPPR7656 ---- Milk proteins ---- Putative glycosylation-dependent cell adhesion molecule 1 Source.765: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.766: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1 Source.767: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain Source.768: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase Source.769: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH] Source.770: DFBPPR8398 ---- Plant proteins ---- Conglutin Source.771: DFBPPR8496 ---- Milk proteins ---- Mucin-1 Source.772: DFBPPR8501 ---- Milk proteins ---- Platelet glycoprotein 4 Source.773: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.774: DFBPPR8507 ---- Milk proteins ---- Polycystin-2 Source.775: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.776: DFBPPR8517 ---- Milk proteins ---- Cathepsin D Source.777: DFBPPR8522 ---- Milk proteins ---- Uterine milk protein Source.778: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase Source.779: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.780: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.781: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.782: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.783: DFBPPR15963 ---- Animal proteins ---- Cadherin-1 Source.784: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.785: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1 Source.786: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.787: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2 Source.788: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9 Source.789: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.790: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1 Source.791: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14 Source.792: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.793: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.794: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.795: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.796: DFBPPR16066 ---- Animal proteins ---- Coagulation factor IX Source.797: DFBPPR16072 ---- Animal proteins ---- Clusterin Source.798: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.799: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2 Source.800: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor Source.801: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.802: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1 Source.803: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4 Source.804: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor Source.805: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3 Source.806: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.807: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1 Source.808: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.809: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1 Source.810: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.811: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2 Source.812: DFBPPR16240 ---- Animal proteins ---- Fibronectin Source.813: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain Source.814: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.815: DFBPPR16250 ---- Animal proteins ---- Alpha-crystallin A chain Source.816: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1 Source.817: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.818: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.819: DFBPPR16302 ---- Animal proteins ---- Myosin-2 Source.820: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor Source.821: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1 Source.822: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.823: DFBPPR16326 ---- Animal proteins ---- Desmin Source.824: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein Source.825: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.826: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain Source.827: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6 Source.828: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2 Source.829: DFBPPR16490 ---- Animal proteins ---- Translocon-associated protein subunit beta Source.830: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1 Source.831: DFBPPR16502 ---- Animal proteins ---- Natural killer cells antigen CD94 Source.832: DFBPPR16518 ---- Animal proteins ---- Keratin, type II cytoskeletal 2 epidermal Source.833: DFBPPR16521 ---- Animal proteins ---- Interleukin-3 Source.834: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.835: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor Source.836: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3 Source.837: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein Source.838: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor Source.839: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3 Source.840: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.841: DFBPPR16559 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.842: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31 Source.843: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.844: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.845: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.846: DFBPPR16610 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.847: DFBPPR16614 ---- Animal proteins ---- Protein S100-A4 Source.848: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1 Source.849: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.850: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b Source.851: DFBPPR16666 ---- Animal proteins ---- Pro-adrenomedullin Source.852: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.853: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46 Source.854: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase Source.855: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme Source.856: DFBPPR16764 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.857: DFBPPR16766 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.858: DFBPPR16788 ---- Animal proteins ---- Alpha-crystallin A chain Source.859: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1 Source.860: DFBPPR16801 ---- Animal proteins ---- Adrenodoxin, mitochondrial Source.861: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1 Source.862: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.863: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.864: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial Source.865: DFBPPR16854 ---- Animal proteins ---- Toll-like receptor 6 Source.866: DFBPPR16872 ---- Animal proteins ---- Oxytocin-neurophysin 1 Source.867: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2 Source.868: DFBPPR16890 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase F, mitochondrial Source.869: DFBPPR16896 ---- Animal proteins ---- Alpha-crystallin A chain Source.870: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A Source.871: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase Source.872: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.873: DFBPPR16913 ---- Animal proteins ---- Alpha-crystallin B chain Source.874: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.875: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6 Source.876: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase Source.877: DFBPPR16996 ---- Animal proteins ---- Retinol dehydrogenase 5 Source.878: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.879: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.880: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.881: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.882: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform Source.883: DFBPPR17060 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 1 Source.884: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.885: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.886: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21 Source.887: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1 Source.888: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.889: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.890: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.891: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.892: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha Source.893: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta Source.894: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit Source.895: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1 Source.896: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.897: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor Source.898: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog Source.899: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.900: DFBPPR17272 ---- Animal proteins ---- Dysbindin Source.901: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1 Source.902: DFBPPR17278 ---- Animal proteins ---- Rho-associated protein kinase 1 Source.903: DFBPPR17286 ---- Animal proteins ---- Septin-2 Source.904: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein Source.905: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1 Source.906: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha Source.907: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.908: DFBPPR17327 ---- Animal proteins ---- Myotubularin Source.909: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1 Source.910: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.911: DFBPPR17332 ---- Animal proteins ---- Protein odd-skipped-related 1 Source.912: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1 Source.913: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B Source.914: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.915: DFBPPR17355 ---- Animal proteins ---- Proliferating cell nuclear antigen Source.916: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.917: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin Source.918: DFBPPR17373 ---- Animal proteins ---- Monoacylglycerol lipase ABHD6 Source.919: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.920: DFBPPR17388 ---- Animal proteins ---- Beta-arrestin-2 Source.921: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB Source.922: DFBPPR17392 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1 Source.923: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2 Source.924: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme Source.925: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.926: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1 Source.927: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.928: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III Source.929: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1 Source.930: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1 Source.931: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.932: DFBPPR17446 ---- Animal proteins ---- Beta-arrestin-1 Source.933: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.934: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.935: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.936: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.937: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4 Source.938: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.939: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1 Source.940: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.941: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6 Source.942: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1 Source.943: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.944: DFBPPR17594 ---- Animal proteins ---- E-selectin Source.945: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.946: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.947: DFBPPR17635 ---- Animal proteins ---- Frataxin, mitochondrial Source.948: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B Source.949: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L Source.950: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.951: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1 Source.952: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme Source.953: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.954: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.955: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain Source.956: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V Source.957: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase Source.958: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3 Source.959: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.960: DFBPPR17792 ---- Animal proteins ---- Glycine N-acyltransferase Source.961: DFBPPR17807 ---- Animal proteins ---- Opticin Source.962: DFBPPR17815 ---- Animal proteins ---- 40S ribosomal protein SA Source.963: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.964: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1 Source.965: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial Source.966: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B Source.967: DFBPPR17867 ---- Animal proteins ---- Guanylate kinase Source.968: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1 Source.969: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase Source.970: DFBPPR17894 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 9 Source.971: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.972: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain Source.973: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain Source.974: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13 Source.975: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7 Source.976: DFBPPR17923 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.977: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.978: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.979: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.980: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA Source.981: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.982: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1 Source.983: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein Source.984: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.985: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN Source.986: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.987: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.988: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.989: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10 Source.990: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2 Source.991: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase Source.992: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2 Source.993: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3 Source.994: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.995: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6 Source.996: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.997: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2 Source.998: DFBPPR18057 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 T Source.999: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.1000: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase Source.1001: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8 Source.1002: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1 Source.1003: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.1004: DFBPPR18092 ---- Animal proteins ---- Carbonyl reductase family member 4 Source.1005: DFBPPR18097 ---- Animal proteins ---- Deoxycytidine kinase Source.1006: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29 Source.1007: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4 Source.1008: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase Source.1009: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1 Source.1010: DFBPPR18152 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein Source.1011: DFBPPR18153 ---- Animal proteins ---- Mitochondrial 2-oxoglutarate/malate carrier protein Source.1012: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44 Source.1013: DFBPPR18173 ---- Animal proteins ---- Cytokine receptor common subunit gamma Source.1014: DFBPPR18218 ---- Animal proteins ---- Dual specificity protein phosphatase 6 Source.1015: DFBPPR18227 ---- Animal proteins ---- Desmin Source.1016: DFBPPR18229 ---- Animal proteins ---- Protein S100-A13 Source.1017: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi Source.1018: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2 Source.1019: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.1020: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2 Source.1021: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.1022: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein Source.1023: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.1024: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10 Source.1025: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7 Source.1026: DFBPPR18332 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1 Source.1027: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a Source.1028: DFBPPR18340 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2 Source.1029: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog Source.1030: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.1031: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.1032: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain Source.1033: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3 Source.1034: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.1035: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa Source.1036: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10 Source.1037: DFBPPR18407 ---- Animal proteins ---- DNA damage-inducible transcript 4 protein Source.1038: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain Source.1039: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase Source.1040: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor Source.1041: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.1042: DFBPPR18427 ---- Animal proteins ---- Cystatin-C Source.1043: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H Source.1044: DFBPPR18440 ---- Animal proteins ---- Protein 4.2 Source.1045: DFBPPR18448 ---- Animal proteins ---- Septin-1 Source.1046: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22 Source.1047: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B Source.1048: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase Source.1049: DFBPPR18473 ---- Animal proteins ---- Sharpin Source.1050: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase Source.1051: DFBPPR18475 ---- Animal proteins ---- Myosin-2 Source.1052: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1 Source.1053: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2 Source.1054: DFBPPR18490 ---- Animal proteins ---- N-terminal Xaa-Pro-Lys N-methyltransferase 1 Source.1055: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1 Source.1056: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5 Source.1057: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8 Source.1058: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3 Source.1059: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial Source.1060: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase Source.1061: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu Source.1062: DFBPPR18548 ---- Animal proteins ---- Lipoyl synthase, mitochondrial Source.1063: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.1064: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5 Source.1065: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit Source.1066: DFBPPR18590 ---- Animal proteins ---- Retinol-binding protein 1 Source.1067: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2 Source.1068: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.1069: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2 Source.1070: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.1071: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14 Source.1072: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4 Source.1073: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.1074: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.1075: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.1076: DFBPPR18728 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 5 Source.1077: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2 Source.1078: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.1079: DFBPPR18742 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor II Source.1080: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase Source.1081: DFBPPR18774 ---- Animal proteins ---- Testis-specific serine/threonine-protein kinase 1 Source.1082: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3 Source.1083: DFBPPR18793 ---- Animal proteins ---- BPI fold-containing family A member 1 Source.1084: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8 Source.1085: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog Source.1086: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain Source.1087: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.1088: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.1089: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.1090: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1 Source.1091: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1 Source.1092: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase Source.1093: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.1094: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4 Source.1095: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.1096: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B Source.1097: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13 Source.1098: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2 Source.1099: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2 Source.1100: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.1101: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog Source.1102: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform Source.1103: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6 Source.1104: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.1105: DFBPPR18997 ---- Animal proteins ---- Striatin-3 Source.1106: DFBPPR19009 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 1 Source.1107: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5 Source.1108: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1 Source.1109: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.1110: DFBPPR19065 ---- Animal proteins ---- Cadherin-6 Source.1111: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1 Source.1112: DFBPPR19090 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2 Source.1113: DFBPPR19091 ---- Animal proteins ---- Ribonuclease H2 subunit A Source.1114: DFBPPR19100 ---- Animal proteins ---- Interleukin-34 Source.1115: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial Source.1116: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.1117: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2 Source.1118: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.1119: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.1120: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like Source.1121: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial Source.1122: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3 Source.1123: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.1124: DFBPPR19209 ---- Animal proteins ---- mRNA export factor Source.1125: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.1126: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase Source.1127: DFBPPR19224 ---- Animal proteins ---- Fetuin-B Source.1128: DFBPPR19227 ---- Animal proteins ---- Nuclear speckle splicing regulatory protein 1 Source.1129: DFBPPR19231 ---- Animal proteins ---- S-phase kinase-associated protein 1 Source.1130: DFBPPR19237 ---- Animal proteins ---- Cadherin-18 Source.1131: DFBPPR19254 ---- Animal proteins ---- Periaxin Source.1132: DFBPPR19286 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.1133: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.1134: DFBPPR19301 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF220 Source.1135: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1 Source.1136: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1 Source.1137: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial Source.1138: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain Source.1139: DFBPPR19327 ---- Animal proteins ---- DNA repair protein RAD51 homolog 4 Source.1140: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.1141: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2 Source.1142: DFBPPR19361 ---- Animal proteins ---- Retinol dehydrogenase 14 Source.1143: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.1144: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1 Source.1145: DFBPPR19374 ---- Animal proteins ---- Protein FAM92A Source.1146: DFBPPR19382 ---- Animal proteins ---- Arrestin-C Source.1147: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.1148: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129 Source.1149: DFBPPR19409 ---- Animal proteins ---- Hyaluronan-binding protein 2 Source.1150: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8 Source.1151: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2 Source.1152: DFBPPR19431 ---- Animal proteins ---- Aminoacyl tRNA synthase complex-interacting multifunctional protein 2 Source.1153: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70 Source.1154: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.1155: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.1156: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.1157: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7 Source.1158: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13 Source.1159: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1 Source.1160: DFBPPR19500 ---- Animal proteins ---- Complement C2 Source.1161: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.1162: DFBPPR19506 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.1163: DFBPPR19510 ---- Animal proteins ---- Transportin-1 Source.1164: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.1165: DFBPPR19516 ---- Animal proteins ---- Protein phosphatase 1L Source.1166: DFBPPR19520 ---- Animal proteins ---- Ferritin light chain Source.1167: DFBPPR19526 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase E Source.1168: DFBPPR19529 ---- Animal proteins ---- Cbp/p300-interacting transactivator 1 Source.1169: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3 Source.1170: DFBPPR19545 ---- Animal proteins ---- RNA 5'-monophosphate methyltransferase Source.1171: DFBPPR19554 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4 Source.1172: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial Source.1173: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7 Source.1174: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20 Source.1175: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C Source.1176: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.1177: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS Source.1178: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5 Source.1179: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform Source.1180: DFBPPR19663 ---- Animal proteins ---- Synembryn-A Source.1181: DFBPPR19668 ---- Animal proteins ---- Calicin Source.1182: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2 Source.1183: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1 Source.1184: DFBPPR19696 ---- Animal proteins ---- Keratin, type I cytoskeletal 14 Source.1185: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.1186: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain Source.1187: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17 Source.1188: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon Source.1189: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1 Source.1190: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13 Source.1191: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1 Source.1192: DFBPPR19777 ---- Animal proteins ---- Translin Source.1193: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma Source.1194: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.1195: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase Source.1196: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1 Source.1197: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2 Source.1198: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3 Source.1199: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2 Source.1200: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain Source.1201: DFBPPR19837 ---- Animal proteins ---- Ribonuclease P protein subunit p30 Source.1202: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.1203: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.1204: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.1205: DFBPPR19874 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor B Source.1206: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor Source.1207: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta Source.1208: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6 Source.1209: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial Source.1210: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18 Source.1211: DFBPPR19929 ---- Animal proteins ---- Ermin Source.1212: DFBPPR19935 ---- Animal proteins ---- Reticulon-3 Source.1213: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7 Source.1214: DFBPPR19975 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.1215: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27 Source.1216: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein Source.1217: DFBPPR20007 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETMAR Source.1218: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1 Source.1219: DFBPPR20032 ---- Animal proteins ---- Annexin A9 Source.1220: DFBPPR20036 ---- Animal proteins ---- Urocortin-3 Source.1221: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase Source.1222: DFBPPR20044 ---- Animal proteins ---- Secernin-1 Source.1223: DFBPPR20060 ---- Animal proteins ---- Fibulin-5 Source.1224: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.1225: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.1226: DFBPPR20099 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit WDR4 Source.1227: DFBPPR20123 ---- Animal proteins ---- Securin Source.1228: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C Source.1229: DFBPPR20149 ---- Animal proteins ---- Flotillin-2 Source.1230: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a Source.1231: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.1232: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1 Source.1233: DFBPPR20184 ---- Animal proteins ---- Centromere protein H Source.1234: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.1235: DFBPPR20210 ---- Animal proteins ---- Exonuclease V Source.1236: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B Source.1237: DFBPPR20214 ---- Animal proteins ---- Lipopolysaccharide-binding protein Source.1238: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1 Source.1239: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.1240: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79 Source.1241: DFBPPR20311 ---- Animal proteins ---- Peroxisomal membrane protein 11B Source.1242: DFBPPR20317 ---- Animal proteins ---- Cadherin-13 Source.1243: DFBPPR20318 ---- Animal proteins ---- Charged multivesicular body protein 1b Source.1244: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa Source.1245: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1 Source.1246: DFBPPR20357 ---- Animal proteins ---- Snurportin-1 Source.1247: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.1248: DFBPPR20381 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1 homolog Source.1249: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog Source.1250: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6 Source.1251: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2 Source.1252: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase Source.1253: DFBPPR20399 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC4 Source.1254: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2 Source.1255: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma Source.1256: DFBPPR20408 ---- Animal proteins ---- Phospholipid scramblase 2 Source.1257: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.1258: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase Source.1259: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.1260: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog Source.1261: DFBPPR20452 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB3 Source.1262: DFBPPR20476 ---- Animal proteins ---- Translocon-associated protein subunit beta Source.1263: DFBPPR20479 ---- Animal proteins ---- Ribonuclease P protein subunit p29 Source.1264: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase Source.1265: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6 Source.1266: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42 Source.1267: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3 Source.1268: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5 Source.1269: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial Source.1270: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2 Source.1271: DFBPPR20576 ---- Animal proteins ---- 60S ribosomal protein L23a Source.1272: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3 Source.1273: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6 Source.1274: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2 Source.1275: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56 Source.1276: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.1277: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1 Source.1278: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1 Source.1279: DFBPPR20641 ---- Animal proteins ---- Centrosomal protein of 41 kDa Source.1280: DFBPPR20644 ---- Animal proteins ---- Dynein regulatory complex protein 9 Source.1281: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91 Source.1282: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A Source.1283: DFBPPR20666 ---- Animal proteins ---- Tektin-2 Source.1284: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9 Source.1285: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14 Source.1286: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.1287: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11 Source.1288: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1 Source.1289: DFBPPR20750 ---- Animal proteins ---- 40S ribosomal protein S8 Source.1290: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog Source.1291: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.1292: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7 Source.1293: DFBPPR20766 ---- Animal proteins ---- Torsin-2A Source.1294: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial Source.1295: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6 Source.1296: DFBPPR20799 ---- Animal proteins ---- F-box/LRR-repeat protein 20 Source.1297: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216 Source.1298: DFBPPR20814 ---- Animal proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.1299: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial Source.1300: DFBPPR20831 ---- Animal proteins ---- Keratin, type II cytoskeletal 59 kDa, component IV Source.1301: DFBPPR20840 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 3 Source.1302: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog Source.1303: DFBPPR20864 ---- Animal proteins ---- Polycomb group RING finger protein 5 Source.1304: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2 Source.1305: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1 Source.1306: DFBPPR20909 ---- Animal proteins ---- Macrophage immunometabolism regulator Source.1307: DFBPPR20917 ---- Animal proteins ---- RNA binding protein fox-1 homolog 3 Source.1308: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase Source.1309: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta Source.1310: DFBPPR20930 ---- Animal proteins ---- Centromere protein U Source.1311: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial Source.1312: DFBPPR20937 ---- Animal proteins ---- Leucine-rich repeat-containing protein 25 Source.1313: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A Source.1314: DFBPPR20947 ---- Animal proteins ---- COP9 signalosome complex subunit 3 Source.1315: DFBPPR20963 ---- Animal proteins ---- Protein kintoun Source.1316: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3 Source.1317: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1 Source.1318: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.1319: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.1320: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7 Source.1321: DFBPPR21010 ---- Animal proteins ---- Store-operated calcium entry-associated regulatory factor Source.1322: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A Source.1323: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21 Source.1324: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2 Source.1325: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43 Source.1326: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1 Source.1327: DFBPPR21098 ---- Animal proteins ---- Pre T-cell antigen receptor alpha Source.1328: DFBPPR21110 ---- Animal proteins ---- Pro-adrenomedullin Source.1329: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16 Source.1330: DFBPPR21114 ---- Animal proteins ---- Keratin, type II cytoskeletal 60 kDa, component III Source.1331: DFBPPR21141 ---- Animal proteins ---- Biotinidase Source.1332: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier Source.1333: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.1334: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal Source.1335: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase Source.1336: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231 Source.1337: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.1338: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal Source.1339: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5 Source.1340: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2 Source.1341: DFBPPR21259 ---- Animal proteins ---- Elongation factor 1-delta Source.1342: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1 Source.1343: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1 Source.1344: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6 Source.1345: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2 Source.1346: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1 Source.1347: DFBPPR21303 ---- Animal proteins ---- Palmdelphin Source.1348: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4 Source.1349: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein Source.1350: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3 Source.1351: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog Source.1352: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.1353: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15 Source.1354: DFBPPR21420 ---- Animal proteins ---- Gem-associated protein 7 Source.1355: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163 Source.1356: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase Source.1357: DFBPPR21466 ---- Animal proteins ---- Trafficking protein particle complex subunit 2-like protein Source.1358: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4 Source.1359: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47 Source.1360: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.1361: DFBPPR21509 ---- Animal proteins ---- Myoneurin Source.1362: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19 Source.1363: DFBPPR21536 ---- Animal proteins ---- Alpha-1-acid glycoprotein Source.1364: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8 Source.1365: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135 Source.1366: DFBPPR21554 ---- Animal proteins ---- Transcription factor 23 Source.1367: DFBPPR21557 ---- Animal proteins ---- WD repeat-containing protein 55 Source.1368: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39 Source.1369: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2 Source.1370: DFBPPR21572 ---- Animal proteins ---- 39S ribosomal protein L43, mitochondrial Source.1371: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.1372: DFBPPR21589 ---- Animal proteins ---- Dynein regulatory complex protein 10 Source.1373: DFBPPR21606 ---- Animal proteins ---- Surfeit locus protein 6 Source.1374: DFBPPR21648 ---- Animal proteins ---- Keratin, type I cytoskeletal 26 Source.1375: DFBPPR21666 ---- Animal proteins ---- Importin-13 Source.1376: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog Source.1377: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3 Source.1378: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7 Source.1379: DFBPPR21742 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1 Source.1380: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2 Source.1381: DFBPPR21755 ---- Animal proteins ---- ELMO domain-containing protein 2 Source.1382: DFBPPR21757 ---- Animal proteins ---- Transmembrane protein 190 Source.1383: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1 Source.1384: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44 Source.1385: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.1386: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.1387: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial Source.1388: DFBPPR21829 ---- Animal proteins ---- Mitochondrial 2-oxodicarboxylate carrier Source.1389: DFBPPR21830 ---- Animal proteins ---- Guanine nucleotide exchange factor for Rab-3A Source.1390: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.1391: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein Source.1392: DFBPPR21853 ---- Animal proteins ---- F-box/LRR-repeat protein 14 Source.1393: DFBPPR21862 ---- Animal proteins ---- Probable RNA polymerase II nuclear localization protein SLC7A6OS Source.1394: DFBPPR21864 ---- Animal proteins ---- Arpin Source.1395: DFBPPR21865 ---- Animal proteins ---- Transcription factor EC Source.1396: DFBPPR21868 ---- Animal proteins ---- RAB6-interacting golgin Source.1397: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog Source.1398: DFBPPR21888 ---- Animal proteins ---- Serum response factor-binding protein 1 Source.1399: DFBPPR21892 ---- Animal proteins ---- COMM domain-containing protein 9 Source.1400: DFBPPR21901 ---- Animal proteins ---- Calcyphosin Source.1401: DFBPPR21932 ---- Animal proteins ---- Keratin, type II cytoskeletal 68 kDa, component IB Source.1402: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11 Source.1403: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2 Source.1404: DFBPPR22025 ---- Animal proteins ---- Putative deoxyribonuclease TATDN3 Source.1405: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4 Source.1406: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2 Source.1407: DFBPPR22084 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 49 Source.1408: DFBPPR22091 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2 Source.1409: DFBPPR22093 ---- Animal proteins ---- F-box only protein 3 Source.1410: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A Source.1411: DFBPPR22171 ---- Animal proteins ---- Leucine-rich repeat flightless-interacting protein 2 Source.1412: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.1413: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5 Source.1414: DFBPPR22191 ---- Animal proteins ---- Heat shock protein beta-3 Source.1415: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.1416: DFBPPR22207 ---- Animal proteins ---- Fas apoptotic inhibitory molecule 1 Source.1417: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1 Source.1418: DFBPPR22226 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 2 Source.1419: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36 Source.1420: DFBPPR22236 ---- Animal proteins ---- Coronin-2A Source.1421: DFBPPR22240 ---- Animal proteins ---- Ataxin-10 Source.1422: DFBPPR22275 ---- Animal proteins ---- 60S ribosomal protein L17 Source.1423: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3 Source.1424: DFBPPR22287 ---- Animal proteins ---- BAG family molecular chaperone regulator 5 Source.1425: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180 Source.1426: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29 Source.1427: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39 Source.1428: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B Source.1429: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1 Source.1430: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog Source.1431: DFBPPR22418 ---- Animal proteins ---- Transmembrane protein 160 Source.1432: DFBPPR22421 ---- Animal proteins ---- Placenta-specific protein 9 Source.1433: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68 Source.1434: DFBPPR22508 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 2 Source.1435: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8 Source.1436: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.1437: DFBPPR22545 ---- Animal proteins ---- Protein FAM214B Source.1438: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19 Source.1439: DFBPPR22597 ---- Animal proteins ---- Methyltransferase-like 26 Source.1440: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13 Source.1441: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.1442: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B Source.1443: DFBPPR22606 ---- Animal proteins ---- WD repeat-containing protein 53 Source.1444: DFBPPR22690 ---- Animal proteins ---- Proline-rich protein 19 Source.1445: DFBPPR22701 ---- Animal proteins ---- Fibronectin type III domain-containing protein 8 Source.1446: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.1447: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.1448: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.1449: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1 Source.1450: DFBPPR8550 ---- Animal proteins ---- Complement C3 Source.1451: DFBPPR8561 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.1452: DFBPPR8565 ---- Animal proteins ---- Villin-1 Source.1453: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.1454: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.1455: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.1456: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial Source.1457: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1 Source.1458: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B Source.1459: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.1460: DFBPPR8631 ---- Animal proteins ---- D-amino-acid oxidase Source.1461: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.1462: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.1463: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.1464: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1 Source.1465: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2 Source.1466: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III Source.1467: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1 Source.1468: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.1469: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.1470: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Source.1471: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.1472: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.1473: DFBPPR8688 ---- Animal proteins ---- Vinculin Source.1474: DFBPPR8700 ---- Animal proteins ---- Endoglin Source.1475: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.1476: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1 Source.1477: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase Source.1478: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.1479: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1480: DFBPPR8763 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit Source.1481: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.1482: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.1483: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1 Source.1484: DFBPPR8795 ---- Animal proteins ---- Pro-adrenomedullin Source.1485: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3 Source.1486: DFBPPR8816 ---- Animal proteins ---- 40S ribosomal protein SA Source.1487: DFBPPR8827 ---- Animal proteins ---- Guanylate kinase Source.1488: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2 Source.1489: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.1490: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.1491: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.1492: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.1493: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.1494: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.1495: DFBPPR8973 ---- Animal proteins ---- Caspase-3 Source.1496: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.1497: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain Source.1498: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain Source.1499: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.1500: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme Source.1501: DFBPPR9039 ---- Animal proteins ---- Desmin Source.1502: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain Source.1503: DFBPPR9059 ---- Animal proteins ---- Alpha-crystallin A chain Source.1504: DFBPPR9063 ---- Animal proteins ---- Oxytocin-neurophysin 1 Source.1505: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.1506: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase Source.1507: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2 Source.1508: DFBPPR9090 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.1509: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1 Source.1510: DFBPPR9111 ---- Animal proteins ---- Propionyl-CoA carboxylase beta chain, mitochondrial Source.1511: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase Source.1512: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.1513: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.1514: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6 Source.1515: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor Source.1516: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.1517: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.1518: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.1519: DFBPPR9202 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2B Source.1520: DFBPPR9204 ---- Animal proteins ---- T-cell surface glycoprotein CD1a Source.1521: DFBPPR9208 ---- Animal proteins ---- Uteroferrin-associated protein Source.1522: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.1523: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A Source.1524: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase Source.1525: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1 Source.1526: DFBPPR9286 ---- Animal proteins ---- BPI fold-containing family A member 1 Source.1527: DFBPPR9296 ---- Animal proteins ---- Transcobalamin-1 Source.1528: DFBPPR9300 ---- Animal proteins ---- Adrenodoxin, mitochondrial Source.1529: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.1530: DFBPPR9306 ---- Animal proteins ---- Complement component C7 Source.1531: DFBPPR9329 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 2 Source.1532: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase Source.1533: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1 Source.1534: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein Source.1535: DFBPPR9373 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.1536: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.1537: DFBPPR9381 ---- Animal proteins ---- Alpha-crystallin B chain Source.1538: DFBPPR9392 ---- Animal proteins ---- mRNA export factor Source.1539: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.1540: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2 Source.1541: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha Source.1542: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain Source.1543: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.1544: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.1545: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa Source.1546: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.1547: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase Source.1548: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase Source.1549: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic Source.1550: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog Source.1551: DFBPPR9562 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase C Source.1552: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1 Source.1553: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.1554: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.1555: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1 Source.1556: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5 Source.1557: DFBPPR9625 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.1558: DFBPPR9670 ---- Animal proteins ---- NF-kappa-B inhibitor-like protein 1 Source.1559: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein Source.1560: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8 Source.1561: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.1562: DFBPPR9796 ---- Animal proteins ---- Arrestin-C Source.1563: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.1564: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1 Source.1565: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D Source.1566: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor Source.1567: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.1568: DFBPPR9980 ---- Animal proteins ---- Cathelicidin-1 Source.1569: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.1570: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1 Source.1571: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.1572: DFBPPR10038 ---- Animal proteins ---- Deoxycytidine kinase 2 Source.1573: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.1574: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein Source.1575: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog Source.1576: DFBPPR10094 ---- Animal proteins ---- Proliferating cell nuclear antigen Source.1577: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog Source.1578: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2 Source.1579: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.1580: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.1581: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase Source.1582: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor Source.1583: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.1584: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.1585: DFBPPR10183 ---- Animal proteins ---- Villin-1 Source.1586: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3 Source.1587: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.1588: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.1589: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1 Source.1590: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2 Source.1591: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3 Source.1592: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7 Source.1593: DFBPPR10244 ---- Animal proteins ---- Inhibin beta A chain Source.1594: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4 Source.1595: DFBPPR10246 ---- Animal proteins ---- Heat shock protein beta-1 Source.1596: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.1597: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1 Source.1598: DFBPPR10270 ---- Animal proteins ---- Agrin Source.1599: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C Source.1600: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.1601: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.1602: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon Source.1603: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2 Source.1604: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.1605: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1606: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.1607: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme Source.1608: DFBPPR10325 ---- Animal proteins ---- Alpha-crystallin B chain Source.1609: DFBPPR10326 ---- Animal proteins ---- Alpha-crystallin A chain Source.1610: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1 Source.1611: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.1612: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.1613: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type Source.1614: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.1615: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9 Source.1616: DFBPPR10401 ---- Animal proteins ---- Heparanase Source.1617: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1618: DFBPPR10412 ---- Animal proteins ---- Dysbindin Source.1619: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin Source.1620: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1 Source.1621: DFBPPR10452 ---- Animal proteins ---- Desmin Source.1622: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.1623: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4 Source.1624: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1 Source.1625: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.1626: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1 Source.1627: DFBPPR10480 ---- Animal proteins ---- Cathepsin D Source.1628: DFBPPR10494 ---- Animal proteins ---- Interferon lambda receptor 1 Source.1629: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.1630: DFBPPR10508 ---- Animal proteins ---- Septin-2 Source.1631: DFBPPR10529 ---- Animal proteins ---- Cadherin-20 Source.1632: DFBPPR10536 ---- Animal proteins ---- Inhibin beta B chain Source.1633: DFBPPR10557 ---- Animal proteins ---- Neuronal vesicle trafficking-associated protein 1 Source.1634: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.1635: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B Source.1636: DFBPPR10581 ---- Animal proteins ---- Ephrin-A5 Source.1637: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit Source.1638: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.1639: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.1640: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1 Source.1641: DFBPPR10624 ---- Animal proteins ---- 40S ribosomal protein SA Source.1642: DFBPPR10627 ---- Animal proteins ---- Apovitellenin-1 Source.1643: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.1644: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai Source.1645: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase Source.1646: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1647: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.1648: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.1649: DFBPPR10654 ---- Animal proteins ---- Fibronectin Source.1650: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain Source.1651: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.1652: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8 Source.1653: DFBPPR10660 ---- Animal proteins ---- Tsukushin Source.1654: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.1655: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase Source.1656: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain Source.1657: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.1658: DFBPPR10672 ---- Animal proteins ---- Nibrin Source.1659: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.1660: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.1661: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.1662: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.1663: DFBPPR10703 ---- Animal proteins ---- Tensin Source.1664: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.1665: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain Source.1666: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3 Source.1667: DFBPPR10762 ---- Animal proteins ---- Cadherin-6 Source.1668: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain Source.1669: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase Source.1670: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain Source.1671: DFBPPR10806 ---- Animal proteins ---- Cathelicidin-3 Source.1672: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.1673: DFBPPR10808 ---- Animal proteins ---- S-phase kinase-associated protein 1 Source.1674: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A Source.1675: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide Source.1676: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.1677: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5 Source.1678: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa Source.1679: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.1680: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.1681: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.1682: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase Source.1683: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.1684: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.1685: DFBPPR10884 ---- Animal proteins ---- Tapasin Source.1686: DFBPPR10896 ---- Animal proteins ---- Contactin-5 Source.1687: DFBPPR10911 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.1688: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.1689: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.1690: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain Source.1691: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.1692: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.1693: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.1694: DFBPPR10976 ---- Animal proteins ---- Lamin-B2 Source.1695: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain Source.1696: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.1697: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein Source.1698: DFBPPR11009 ---- Animal proteins ---- Cathelicidin-B1 Source.1699: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.1700: DFBPPR11017 ---- Animal proteins ---- Collectin-12 Source.1701: DFBPPR11022 ---- Animal proteins ---- Lens epithelium-derived growth factor Source.1702: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu Source.1703: DFBPPR11032 ---- Animal proteins ---- B-cadherin Source.1704: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2 Source.1705: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1 Source.1706: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5 Source.1707: DFBPPR11110 ---- Animal proteins ---- Lamin-B1 Source.1708: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.1709: DFBPPR11121 ---- Animal proteins ---- Lysosomal amino acid transporter 1 homolog Source.1710: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta Source.1711: DFBPPR11135 ---- Animal proteins ---- Popeye domain-containing protein 3 Source.1712: DFBPPR11146 ---- Animal proteins ---- Formin Source.1713: DFBPPR11152 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2 Source.1714: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A Source.1715: DFBPPR11160 ---- Animal proteins ---- 16 kDa beta-galactoside-binding lectin Source.1716: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1 Source.1717: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3 Source.1718: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.1719: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.1720: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1 Source.1721: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type Source.1722: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2 Source.1723: DFBPPR11233 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.1724: DFBPPR11239 ---- Animal proteins ---- Charged multivesicular body protein 1b Source.1725: DFBPPR11244 ---- Animal proteins ---- Frizzled-6 Source.1726: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B Source.1727: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5 Source.1728: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin Source.1729: DFBPPR11283 ---- Animal proteins ---- Centromere protein U Source.1730: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog Source.1731: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein Source.1732: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha Source.1733: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.1734: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.1735: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14 Source.1736: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.1737: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1 Source.1738: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1 Source.1739: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.1740: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Source.1741: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.1742: DFBPPR11388 ---- Animal proteins ---- Matrilin-3 Source.1743: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1 Source.1744: DFBPPR11408 ---- Animal proteins ---- Cadherin-10 Source.1745: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.1746: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.1747: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.1748: DFBPPR11458 ---- Animal proteins ---- Sarcalumenin Source.1749: DFBPPR11467 ---- Animal proteins ---- Synembryn-A Source.1750: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10 Source.1751: DFBPPR11495 ---- Animal proteins ---- Calretinin Source.1752: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7 Source.1753: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2 Source.1754: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1 Source.1755: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A Source.1756: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.1757: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2 Source.1758: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein Source.1759: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.1760: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase Source.1761: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70 Source.1762: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.1763: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1 Source.1764: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.1765: DFBPPR11584 ---- Animal proteins ---- NF-kappa-B inhibitor alpha Source.1766: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.1767: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.1768: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.1769: DFBPPR11593 ---- Animal proteins ---- Syndetin Source.1770: DFBPPR11604 ---- Animal proteins ---- Centromere protein I Source.1771: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.1772: DFBPPR11618 ---- Animal proteins ---- Adrenodoxin, mitochondrial Source.1773: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8 Source.1774: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5 Source.1775: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4 Source.1776: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog Source.1777: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1 Source.1778: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.1779: DFBPPR11670 ---- Animal proteins ---- Snurportin-1 Source.1780: DFBPPR11682 ---- Animal proteins ---- DCN1-like protein 1 Source.1781: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H Source.1782: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.1783: DFBPPR11724 ---- Animal proteins ---- Protein TENP Source.1784: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta Source.1785: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.1786: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa Source.1787: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.1788: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.1789: DFBPPR11786 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2 Source.1790: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91 Source.1791: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.1792: DFBPPR11822 ---- Animal proteins ---- Inversin Source.1793: DFBPPR11824 ---- Animal proteins ---- DDB1- and CUL4-associated factor 13 Source.1794: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7 Source.1795: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein Source.1796: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3 Source.1797: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2 Source.1798: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.1799: DFBPPR11873 ---- Animal proteins ---- Ligand-dependent nuclear receptor corepressor-like protein Source.1800: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1 Source.1801: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A Source.1802: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.1803: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13 Source.1804: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog Source.1805: DFBPPR11936 ---- Animal proteins ---- Acyl-CoA-binding protein Source.1806: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7 Source.1807: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.1808: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2 Source.1809: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15 Source.1810: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein Source.1811: DFBPPR12041 ---- Animal proteins ---- Paladin Source.1812: DFBPPR12055 ---- Animal proteins ---- Importin-13 Source.1813: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237 Source.1814: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129 Source.1815: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14 Source.1816: DFBPPR12095 ---- Animal proteins ---- Proteasomal ATPase-associated factor 1 Source.1817: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1 Source.1818: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.1819: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C Source.1820: DFBPPR12148 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 3 Source.1821: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.1822: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5 Source.1823: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein Source.1824: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3 Source.1825: DFBPPR12195 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.1826: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40 Source.1827: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11 Source.1828: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174 Source.1829: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2 Source.1830: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.1831: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.1832: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.1833: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.1834: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2 Source.1835: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1 Source.1836: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.1837: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5 Source.1838: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.1839: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.1840: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.1841: DFBPPR12303 ---- Animal proteins ---- Histidine-rich glycoprotein Source.1842: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.1843: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1844: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF Source.1845: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.1846: DFBPPR12330 ---- Animal proteins ---- Alpha-crystallin B chain Source.1847: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein Source.1848: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.1849: DFBPPR12367 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 2 Source.1850: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.1851: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1 Source.1852: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.1853: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.1854: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase Source.1855: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.1856: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.1857: DFBPPR12389 ---- Animal proteins ---- Clusterin Source.1858: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.1859: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.1860: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase Source.1861: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.1862: DFBPPR12438 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.1863: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.1864: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1865: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.1866: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6 Source.1867: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7 Source.1868: DFBPPR12469 ---- Animal proteins ---- Hemopexin Source.1869: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4 Source.1870: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.1871: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.1872: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.1873: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.1874: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.1875: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5 Source.1876: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.1877: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.1878: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5 Source.1879: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase Source.1880: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4 Source.1881: DFBPPR12708 ---- Animal proteins ---- Pulmonary surfactant-associated protein B Source.1882: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform Source.1883: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16 Source.1884: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.1885: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.1886: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.1887: DFBPPR12742 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2 Source.1888: DFBPPR12744 ---- Animal proteins ---- Beta-arrestin-1 Source.1889: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.1890: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta Source.1891: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform Source.1892: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3 Source.1893: DFBPPR12772 ---- Animal proteins ---- Colipase Source.1894: DFBPPR12795 ---- Animal proteins ---- Cytochrome P450 2C15 Source.1895: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6 Source.1896: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor Source.1897: DFBPPR12824 ---- Animal proteins ---- Alpha-crystallin A chain Source.1898: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4 Source.1899: DFBPPR12873 ---- Animal proteins ---- Sarcalumenin Source.1900: DFBPPR12877 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.1901: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16 Source.1902: DFBPPR12897 ---- Animal proteins ---- Fibronectin Source.1903: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14 Source.1904: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13 Source.1905: DFBPPR12925 ---- Animal proteins ---- Methylmalonic aciduria type A homolog, mitochondrial Source.1906: DFBPPR12947 ---- Animal proteins ---- Aggrecan core protein Source.1907: DFBPPR12964 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-5 Source.1908: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform Source.1909: DFBPPR12981 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-4 Source.1910: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1 Source.1911: DFBPPR13000 ---- Animal proteins ---- Cystatin-C Source.1912: DFBPPR13047 ---- Animal proteins ---- Elongation factor 1-delta Source.1913: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2 Source.1914: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.1915: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.1916: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.1917: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.1918: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1919: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.1920: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2 Source.1921: DFBPPR13174 ---- Animal proteins ---- Clusterin Source.1922: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase Source.1923: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2 Source.1924: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.1925: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A Source.1926: DFBPPR13233 ---- Animal proteins ---- Fibronectin Source.1927: DFBPPR13234 ---- Animal proteins ---- Alpha-crystallin A chain Source.1928: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1929: DFBPPR13280 ---- Animal proteins ---- Oxytocin-neurophysin 1 Source.1930: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1 Source.1931: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.1932: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.1933: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein Source.1934: DFBPPR13303 ---- Animal proteins ---- Apolipoprotein C-III Source.1935: DFBPPR13312 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.1936: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.1937: DFBPPR13327 ---- Animal proteins ---- Metalloproteinase inhibitor 2 Source.1938: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2 Source.1939: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase Source.1940: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2 Source.1941: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.1942: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.1943: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9 Source.1944: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1945: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2 Source.1946: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2 Source.1947: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.1948: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.1949: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.1950: DFBPPR13658 ---- Animal proteins ---- Alpha-crystallin A chain Source.1951: DFBPPR13659 ---- Animal proteins ---- Oxytocin-neurophysin 1 Source.1952: DFBPPR13660 ---- Animal proteins ---- 40S ribosomal protein SA Source.1953: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2 Source.1954: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1955: DFBPPR13696 ---- Animal proteins ---- Cathepsin D Source.1956: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2 Source.1957: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.1958: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon Source.1959: DFBPPR13787 ---- Animal proteins ---- Alpha-crystallin B chain Source.1960: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1 Source.1961: DFBPPR13800 ---- Animal proteins ---- Keratin, type I cytoskeletal 25 Source.1962: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1 Source.1963: DFBPPR13824 ---- Animal proteins ---- Adrenodoxin Source.1964: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3 Source.1965: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa Source.1966: DFBPPR13863 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.1967: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.1968: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5 Source.1969: DFBPPR13961 ---- Animal proteins ---- Elongation factor 1-delta Source.1970: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A Source.1971: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.1972: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III Source.1973: DFBPPR14091 ---- Marine protein ---- 40S ribosomal protein SA Source.1974: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B Source.1975: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C Source.1976: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A Source.1977: DFBPPR14102 ---- Marine protein ---- Anamorsin-B Source.1978: DFBPPR14103 ---- Marine protein ---- Proteasome subunit beta type-9 Source.1979: DFBPPR14110 ---- Marine protein ---- BRCA1-A complex subunit Abraxas 1 Source.1980: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase Source.1981: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase Source.1982: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein Source.1983: DFBPPR14198 ---- Marine protein ---- Trafficking protein particle complex subunit 2-like protein Source.1984: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein Source.1985: DFBPPR14237 ---- Marine protein ---- Stanniocalcin Source.1986: DFBPPR14255 ---- Marine protein ---- L-rhamnose-binding lectin CSL3 Source.1987: DFBPPR14256 ---- Marine protein ---- L-rhamnose-binding lectin CSL1 Source.1988: DFBPPR14259 ---- Marine protein ---- L-rhamnose-binding lectin CSL2 Source.1989: DFBPPR14285 ---- Marine protein ---- C-phycocyanin beta chain Source.1990: DFBPPR14297 ---- Marine protein ---- Probable transcriptional regulator ycf27 Source.1991: DFBPPR14343 ---- Marine protein ---- Anthranilate synthase component 2 Source.1992: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain Source.1993: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI Source.1994: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27 Source.1995: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain Source.1996: DFBPPR14380 ---- Marine protein ---- tRNA(Ile)-lysidine synthase, chloroplastic Source.1997: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase Source.1998: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog Source.1999: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK Source.2000: DFBPPR14423 ---- Marine protein ---- ATP synthase subunit delta, chloroplastic Source.2001: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III Source.2002: DFBPPR14438 ---- Marine protein ---- 50S ribosomal protein L1, chloroplastic Source.2003: DFBPPR14479 ---- Marine protein ---- Photosystem I assembly protein Ycf4 Source.2004: DFBPPR14492 ---- Marine protein ---- Uncharacterized AAA domain-containing protein ycf46 Source.2005: DFBPPR14525 ---- Marine protein ---- Uncharacterized protein ycf55 Source.2006: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor Source.2007: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.2008: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1 Source.2009: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b Source.2010: DFBPPR14607 ---- Marine protein ---- Proteasome subunit beta type-9 Source.2011: DFBPPR14610 ---- Marine protein ---- Osteocalcin 2a Source.2012: DFBPPR14611 ---- Marine protein ---- Osteocalcin 2b Source.2013: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.2014: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein Source.2015: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a Source.2016: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2 Source.2017: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha Source.2018: DFBPPR14740 ---- Marine protein ---- DNA damage-inducible transcript 4-like protein Source.2019: DFBPPR14741 ---- Marine protein ---- Arrestin red cell isoform 3 Source.2020: DFBPPR14742 ---- Marine protein ---- Arrestin red cell isoform 2 Source.2021: DFBPPR14743 ---- Marine protein ---- Arrestin red cell isoform 1 Source.2022: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit Source.2023: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain Source.2024: DFBPPR14799 ---- Marine protein ---- Arginine kinase Source.2025: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.2026: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain Source.2027: DFBPPR14814 ---- Marine protein ---- Superoxide dismutase [Mn], mitochondrial Source.2028: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.2029: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta Source.2030: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20 Source.2031: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.2032: DFBPPR14898 ---- Microorganism protein ---- Transcription factor IIIB 70 kDa subunit Source.2033: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5 Source.2034: DFBPPR14907 ---- Microorganism protein ---- Adenylyltransferase and sulfurtransferase UBA4 Source.2035: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.2036: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.2037: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1 Source.2038: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific Source.2039: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10 Source.2040: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase Source.2041: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase Source.2042: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.2043: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4 Source.2044: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1 Source.2045: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase Source.2046: DFBPPR14981 ---- Microorganism protein ---- Enolase-phosphatase E1 Source.2047: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.2048: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial Source.2049: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.2050: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase Source.2051: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1 Source.2052: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial Source.2053: DFBPPR15001 ---- Microorganism protein ---- ARS-binding factor 1 Source.2054: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16 Source.2055: DFBPPR15013 ---- Microorganism protein ---- Inorganic pyrophosphatase Source.2056: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.2057: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2 Source.2058: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1 Source.2059: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase Source.2060: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2 Source.2061: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3 Source.2062: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B Source.2063: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1 Source.2064: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase Source.2065: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11 Source.2066: DFBPPR15086 ---- Microorganism protein ---- Pheromone-processing carboxypeptidase KEX1 Source.2067: DFBPPR15091 ---- Microorganism protein ---- Lipoyl synthase, mitochondrial Source.2068: DFBPPR15093 ---- Microorganism protein ---- Inner kinetochore subunit AME1 Source.2069: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1 Source.2070: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5 Source.2071: DFBPPR15105 ---- Microorganism protein ---- Arginase Source.2072: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.2073: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1 Source.2074: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1 Source.2075: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1 Source.2076: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.2077: DFBPPR15149 ---- Microorganism protein ---- Dynein light chain 1, cytoplasmic Source.2078: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase Source.2079: DFBPPR15159 ---- Microorganism protein ---- Centromere-binding protein 1 Source.2080: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.2081: DFBPPR15163 ---- Microorganism protein ---- Ubiquitin-related modifier 1 Source.2082: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111 Source.2083: DFBPPR15176 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NBP35 Source.2084: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase Source.2085: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial Source.2086: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C Source.2087: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase Source.2088: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3 Source.2089: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8 Source.2090: DFBPPR15197 ---- Microorganism protein ---- ATP-dependent RNA helicase FAL1 Source.2091: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase Source.2092: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase Source.2093: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase Source.2094: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase Source.2095: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.2096: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8 Source.2097: DFBPPR15257 ---- Microorganism protein ---- Ribosome biogenesis protein YTM1 Source.2098: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2 Source.2099: DFBPPR15294 ---- Microorganism protein ---- Lactose permease Source.2100: DFBPPR15295 ---- Microorganism protein ---- Galactose/lactose metabolism regulatory protein GAL80 Source.2101: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1 Source.2102: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1 Source.2103: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog Source.2104: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase Source.2105: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.2106: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1 Source.2107: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80 Source.2108: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1 Source.2109: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme Source.2110: DFBPPR15408 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI3 Source.2111: DFBPPR15419 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 34 Source.2112: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.2113: DFBPPR15426 ---- Microorganism protein ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit TRM82 Source.2114: DFBPPR15430 ---- Microorganism protein ---- Exportin-T Source.2115: DFBPPR15433 ---- Microorganism protein ---- DNA-directed RNA polymerase III subunit RPC3 Source.2116: DFBPPR15443 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 10 Source.2117: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1 Source.2118: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2 Source.2119: DFBPPR15496 ---- Microorganism protein ---- Cell division cycle protein 123 Source.2120: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22 Source.2121: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12 Source.2122: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1 Source.2123: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14 Source.2124: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20 Source.2125: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase Source.2126: DFBPPR15549 ---- Microorganism protein ---- Probable kinetochore protein SPC25 Source.2127: DFBPPR15552 ---- Microorganism protein ---- Autophagy-related protein 14 Source.2128: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1 Source.2129: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1 Source.2130: DFBPPR15563 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 1 Source.2131: DFBPPR15568 ---- Microorganism protein ---- Probable kinetochore protein SPC24 Source.2132: DFBPPR15569 ---- Microorganism protein ---- Phosphatidylglycerol/phosphatidylinositol transfer protein Source.2133: DFBPPR15574 ---- Microorganism protein ---- Protein PXR1 Source.2134: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1 Source.2135: DFBPPR15602 ---- Microorganism protein ---- Helper of Tim protein 13 Source.2136: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1 Source.2137: DFBPPR15616 ---- Microorganism protein ---- Chromatin modification-related protein EAF5 Source.2138: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1 Source.2139: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1 Source.2140: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1 Source.2141: DFBPPR15654 ---- Microorganism protein ---- N-(5'-phosphoribosyl)anthranilate isomerase Source.2142: DFBPPR15661 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 2 Source.2143: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2 Source.2144: DFBPPR15685 ---- Microorganism protein ---- Zinc-regulated protein 8 Source.2145: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22 Source.2146: DFBPPR15732 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 6, mitochondrial Source.2147: DFBPPR15739 ---- Microorganism protein ---- Long chronological lifespan protein 2 Source.2148: DFBPPR15756 ---- Microorganism protein ---- Inheritance of peroxisomes protein 1 Source.2149: DFBPPR15777 ---- Microorganism protein ---- FAS1 domain-containing protein KLLA0E16841g Source.2150: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.2151: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component Source.2152: DFBPPR15816 ---- Microorganism protein ---- Tyrosine recombinase XerD Source.2153: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1 Source.2154: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase Source.2155: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2 Source.2156: DFBPPR15852 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1 Source.2157: DFBPPR15859 ---- Microorganism protein ---- Histone H4 Source.2158: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase Source.2159: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.2160: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase Source.2161: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.2162: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease Source.2163: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1 Source.2164: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain Source.2165: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain Source.2166: DFBPPR0014 ---- Plant protein ---- Isoaspartyl peptidase/L-asparaginase Source.2167: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4 Source.2168: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase Source.2169: DFBPPR7765 ---- Plant protein ---- Flap endonuclease 1-A Source.2170: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1 Source.2171: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic Source.2172: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic Source.2173: DFBPPR7773 ---- Plant protein ---- Lipoyl synthase, chloroplastic Source.2174: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2175: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase Source.2176: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial Source.2177: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.2178: DFBPPR7874 ---- Plant protein ---- CASP-like protein 1D1 Source.2179: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase Source.2180: DFBPPR7936 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase, chloroplastic Source.2181: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase Source.2182: DFBPPR7951 ---- Plant protein ---- S-adenosylmethionine decarboxylase proenzyme Source.2183: DFBPPR7983 ---- Plant protein ---- 14-3-3-like protein B Source.2184: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase Source.2185: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase Source.2186: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1 Source.2187: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2 Source.2188: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase Source.2189: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.2190: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2191: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.2192: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial Source.2193: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase Source.2194: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic Source.2195: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2196: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.2197: DFBPPR8235 ---- Plant protein ---- Catalase Source.2198: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2199: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.2200: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

ACE-inhibitory activity	The final rapeseed protein hydrolysate (FRPH) exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC₅₀ value of 0.1034 ± 0.0024 mg/mL. The peptide LDV was isolated from the FRPH using electrodialysis with ultrafiltration membrane (EDUF) technology, so it was a potential ACE-inhibitory peptide (data not shown).
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	Rapeseed protein isolate was subjected to alcalase digestion to obtain a protein hydrolysate.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	Non-Toxin
Prediction:	ToxinPred

Additional information

N.D

Database cross-references

DFBP

[D1]	DFBPRENI0005
[D2]	DFBPANHY0031
[D3]	DFBPMUFU0362

[D4]

[D5]

[D6]

[D7]

Reference(s)

Primary literature	He R, Girgih AT, Rozoy E, Bazinet L, Ju XR, Aluko RE. Selective separation and concentration of antihypertensive peptides from rapeseed protein hydrolysate by electrodialysis with ultrafiltration membranes. Food Chem. 2016 Apr 15;197(Pt A):1008-14. PMID: 26617047 DOI: 10.1016/j.foodchem.2015.11.081
Other literature(s)	[1] He R , Alashi A , Malomo S A , et al. Antihypertensive and free radical scavenging properties of enzymatic rapeseed protein hydrolysates[J]. Food Chemistry, 2013, 141(1):153-159.
PubDate	2016