Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI1494(ACE-inhibitory peptide)

DFBP ID	DFBPACEI1494
Peptide sequence	YVP
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Tyr-Val-Pro

Single-letter amino acid

YVP

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	377.44 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.92 ^c

IC₅₀

200 μM

pIC₅₀

-2.301

GRAVY

0.4333^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Human
Organism/Source	Human milk protein
Precursor protein	κ-Casein
Residue position	f(21-23)
Precursor protein(s) search	Source.1: DFBPPR0812 ---- Plant proteins ---- ATP-dependent DNA helicase MER3 homolog Source.2: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.3: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.4: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.5: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2 Source.6: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5 Source.7: DFBPPR0922 ---- Plant proteins ---- Obg-like ATPase 1 Source.8: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.9: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2 Source.10: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1 Source.11: DFBPPR1047 ---- Plant proteins ---- Rac-like GTP-binding protein 5 Source.12: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL Source.13: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG Source.14: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic Source.15: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.16: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.17: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.18: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.19: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3 Source.20: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39 Source.21: DFBPPR1310 ---- Plant proteins ---- Rac-like GTP-binding protein 6 Source.22: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.23: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1 Source.24: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain Source.25: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7 Source.26: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1 Source.27: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.28: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.29: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.30: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.31: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.32: DFBPPR1415 ---- Plant proteins ---- Rac-like GTP-binding protein 7 Source.33: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.34: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4 Source.35: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1 Source.36: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.37: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5 Source.38: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81 Source.39: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2 Source.40: DFBPPR1491 ---- Plant proteins ---- Rac-like GTP-binding protein 4 Source.41: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4 Source.42: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.43: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.44: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase Source.45: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.46: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C Source.47: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3 Source.48: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.49: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2 Source.50: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3 Source.51: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain Source.52: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.53: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal Source.54: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.55: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1 Source.56: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.57: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic Source.58: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a Source.59: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b Source.60: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.61: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B Source.62: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3 Source.63: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO Source.64: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial Source.65: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial Source.66: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase Source.67: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.68: DFBPPR1990 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 38 Source.69: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A Source.70: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic Source.71: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B Source.72: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.73: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.74: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial Source.75: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 Source.76: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1 Source.77: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase Source.78: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37 Source.79: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26 Source.80: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.81: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.82: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.83: DFBPPR2279 ---- Plant proteins ---- Thioredoxin-like protein CITRX, chloroplastic Source.84: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5 Source.85: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.86: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic Source.87: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.88: DFBPPR2364 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta Source.89: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6 Source.90: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.91: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2 Source.92: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial Source.93: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.94: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog Source.95: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.96: DFBPPR2651 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL3 Source.97: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1 Source.98: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2 Source.99: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1 Source.100: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase Source.101: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B Source.102: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5 Source.103: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8 Source.104: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9 Source.105: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3 Source.106: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.107: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase Source.108: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.109: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2 Source.110: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.111: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.112: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1 Source.113: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3 Source.114: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2 Source.115: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B Source.116: DFBPPR3048 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL10 Source.117: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.118: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.119: DFBPPR3129 ---- Plant proteins ---- Protein disulfide isomerase-like 5-4 Source.120: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11 Source.121: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1 Source.122: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.123: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37 Source.124: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.125: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3 Source.126: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37 Source.127: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B Source.128: DFBPPR3295 ---- Plant proteins ---- Replication factor C subunit 4 Source.129: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2 Source.130: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.131: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2 Source.132: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1 Source.133: DFBPPR3411 ---- Plant proteins ---- Auxin-responsive protein IAA15 Source.134: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15 Source.135: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1 Source.136: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14 Source.137: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2 Source.138: DFBPPR3494 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS32 Source.139: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2 Source.140: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3 Source.141: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4 Source.142: DFBPPR3647 ---- Plant proteins ---- Dof zinc finger protein 2 Source.143: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3 Source.144: DFBPPR3695 ---- Plant proteins ---- Auxin-responsive protein IAA23 Source.145: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8 Source.146: DFBPPR3754 ---- Plant proteins ---- Auxin-responsive protein IAA30 Source.147: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C Source.148: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.149: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3 Source.150: DFBPPR3834 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS35 Source.151: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21 Source.152: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23 Source.153: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4 Source.154: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4 Source.155: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.156: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.157: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27 Source.158: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2 Source.159: DFBPPR4030 ---- Plant proteins ---- Cytochrome b5 Source.160: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.161: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8 Source.162: DFBPPR4135 ---- Plant proteins ---- Probable protein phosphatase 2C 31 Source.163: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600 Source.164: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6 Source.165: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C Source.166: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.167: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial Source.168: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial Source.169: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10 Source.170: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21 Source.171: DFBPPR4284 ---- Plant proteins ---- Protein IN2-1 homolog B Source.172: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16 Source.173: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1 Source.174: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.175: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.176: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.177: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.178: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial Source.179: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3 Source.180: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.181: DFBPPR4561 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 5 Source.182: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32 Source.183: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65 Source.184: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease Source.185: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7 Source.186: DFBPPR4664 ---- Plant proteins ---- 40S ribosomal protein S21 Source.187: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57 Source.188: DFBPPR4807 ---- Plant proteins ---- Protein MEI2-like 6 Source.189: DFBPPR4810 ---- Plant proteins ---- Hydrophobic protein OSR8 Source.190: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2 Source.191: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.192: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23 Source.193: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650 Source.194: DFBPPR4967 ---- Plant proteins ---- Beta-amylase Source.195: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1 Source.196: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.197: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase Source.198: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.199: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.200: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit Source.201: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.202: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain Source.203: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1 Source.204: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain Source.205: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase Source.206: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6 Source.207: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.208: DFBPPR5271 ---- Plant proteins ---- Auxin-induced protein AUX28 Source.209: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.210: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase Source.211: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.212: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase Source.213: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.214: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.215: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic Source.216: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.217: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase Source.218: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.219: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.220: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.221: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.222: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.223: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6 Source.224: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1 Source.225: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic Source.226: DFBPPR5648 ---- Plant proteins ---- AP-2 complex subunit sigma Source.227: DFBPPR5669 ---- Plant proteins ---- Cytochrome b Source.228: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1 Source.229: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.230: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.231: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain Source.232: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain Source.233: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1 Source.234: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.235: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.236: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele Source.237: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase Source.238: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.239: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.240: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL Source.241: DFBPPR5903 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta Source.242: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2 Source.243: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1 Source.244: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.245: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.246: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2 Source.247: DFBPPR6086 ---- Plant proteins ---- Cell number regulator 5 Source.248: DFBPPR6132 ---- Plant proteins ---- 40S ribosomal protein S21 Source.249: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.250: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.251: DFBPPR6265 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit Source.252: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.253: DFBPPR6309 ---- Plant proteins ---- Cytochrome b Source.254: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase Source.255: DFBPPR6331 ---- Plant proteins ---- Rac-like GTP-binding protein RHO1 Source.256: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain Source.257: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.258: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.259: DFBPPR6391 ---- Plant proteins ---- Cytochrome b6 Source.260: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.261: DFBPPR6407 ---- Plant proteins ---- Pyruvate decarboxylase 1 Source.262: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.263: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.264: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1 Source.265: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.266: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase Source.267: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.268: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.269: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase Source.270: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6 Source.271: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.272: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.273: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1 Source.274: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.275: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5 Source.276: DFBPPR6965 ---- Plant proteins ---- Gamma-gliadin B Source.277: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6 Source.278: DFBPPR6967 ---- Plant proteins ---- Gamma-gliadin Source.279: DFBPPR6968 ---- Plant proteins ---- Gamma-gliadin Source.280: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7 Source.281: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4 Source.282: DFBPPR6986 ---- Plant proteins ---- Avenin-like b11 Source.283: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10 Source.284: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9 Source.285: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8 Source.286: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2 Source.287: DFBPPR6993 ---- Plant proteins ---- Avenin-like b3 Source.288: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.289: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.290: DFBPPR7015 ---- Plant proteins ---- Phytepsin Source.291: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic Source.292: DFBPPR7028 ---- Plant proteins ---- Agmatine coumaroyltransferase-1 Source.293: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.294: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.295: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic Source.296: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6 Source.297: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8 Source.298: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3 Source.299: DFBPPR7166 ---- Plant proteins ---- Serine carboxypeptidase II-2 Source.300: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1 Source.301: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.302: DFBPPR7240 ---- Plant proteins ---- Agmatine coumaroyltransferase-2 Source.303: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.304: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4 Source.305: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2 Source.306: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6 Source.307: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7 Source.308: DFBPPR7349 ---- Plant proteins ---- Cold-regulated protein 2 Source.309: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase Source.310: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.311: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.312: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1 Source.313: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein Source.314: DFBPPR7608 ---- Milk proteins ---- Kappa-casein Source.315: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.316: DFBPPR7622 ---- Milk proteins ---- Mucin-1 Source.317: DFBPPR7680 ---- Milk proteins ---- Alpha-S1-casein Source.318: DFBPPR7709 ---- Milk proteins ---- Alpha-S1-casein, Alpha-casein Source.319: DFBPPR7717 ---- Milk proteins ---- Alpha-S1-casein Source.320: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.321: DFBPPR7725 ---- Plant proteins ---- Avenin-3 Source.322: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.323: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5 Source.324: DFBPPR7739 ---- Plant proteins ---- Avenin-E Source.325: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1 Source.326: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2 Source.327: DFBPPR8407 ---- Plant proteins ---- Endochitinase 2 Source.328: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.329: DFBPPR8488 ---- Milk proteins ---- Alpha-S1-casein Source.330: DFBPPR8496 ---- Milk proteins ---- Mucin-1 Source.331: DFBPPR15939 ---- Animal proteins ---- Rhodopsin Source.332: DFBPPR15951 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.333: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.334: DFBPPR15965 ---- Animal proteins ---- Dystroglycan Source.335: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.336: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.337: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.338: DFBPPR16025 ---- Animal proteins ---- Transforming protein RhoA Source.339: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.340: DFBPPR16051 ---- Animal proteins ---- Cell division control protein 42 homolog Source.341: DFBPPR16064 ---- Animal proteins ---- Calnexin Source.342: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5 Source.343: DFBPPR16115 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1 Source.344: DFBPPR16116 ---- Animal proteins ---- Kit ligand Source.345: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.346: DFBPPR16140 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha Source.347: DFBPPR16189 ---- Animal proteins ---- Albumin Source.348: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.349: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.350: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.351: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.352: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.353: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1 Source.354: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.355: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.356: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4 Source.357: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.358: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.359: DFBPPR16299 ---- Animal proteins ---- Odontogenic ameloblast-associated protein Source.360: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor Source.361: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein Source.362: DFBPPR16503 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase Source.363: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog Source.364: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31 Source.365: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.366: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial Source.367: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2 Source.368: DFBPPR16610 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.369: DFBPPR16615 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1 Source.370: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.371: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.372: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.373: DFBPPR16733 ---- Animal proteins ---- 40S ribosomal protein S17 Source.374: DFBPPR16766 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.375: DFBPPR16775 ---- Animal proteins ---- Pinopsin Source.376: DFBPPR16797 ---- Animal proteins ---- Albumin Source.377: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.378: DFBPPR16809 ---- Animal proteins ---- Rhodopsin Source.379: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic Source.380: DFBPPR16860 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.381: DFBPPR16871 ---- Animal proteins ---- Plasminogen Source.382: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2 Source.383: DFBPPR16895 ---- Animal proteins ---- Coagulation factor VII Source.384: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.385: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease Source.386: DFBPPR16945 ---- Animal proteins ---- Transforming protein RhoA Source.387: DFBPPR16967 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta Source.388: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1 Source.389: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2 Source.390: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.391: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.392: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21 Source.393: DFBPPR17086 ---- Animal proteins ---- Cell division control protein 42 homolog Source.394: DFBPPR17102 ---- Animal proteins ---- Dystroglycan Source.395: DFBPPR17103 ---- Animal proteins ---- Dystroglycan Source.396: DFBPPR17108 ---- Animal proteins ---- Coronin-1A Source.397: DFBPPR17118 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-1 Source.398: DFBPPR17125 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha isoforms short Source.399: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.400: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.401: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor Source.402: DFBPPR17192 ---- Animal proteins ---- Kit ligand Source.403: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1 Source.404: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.405: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.406: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal Source.407: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.408: DFBPPR17349 ---- Animal proteins ---- Sialidase-3 Source.409: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1 Source.410: DFBPPR17382 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 5 Source.411: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36 Source.412: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3 Source.413: DFBPPR17402 ---- Animal proteins ---- High mobility group protein B2 Source.414: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4 Source.415: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.416: DFBPPR17694 ---- Animal proteins ---- Pyridoxal kinase Source.417: DFBPPR17736 ---- Animal proteins ---- Rho-related GTP-binding protein Rho6 Source.418: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.419: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.420: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.421: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1 Source.422: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B Source.423: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B Source.424: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.425: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.426: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.427: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain Source.428: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain Source.429: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.430: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial Source.431: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor Source.432: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.433: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.434: DFBPPR18011 ---- Animal proteins ---- Afamin Source.435: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.436: DFBPPR18064 ---- Animal proteins ---- Sperm flagellar protein 1 Source.437: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Source.438: DFBPPR18112 ---- Animal proteins ---- Poly(A) RNA polymerase GLD2 Source.439: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.440: DFBPPR18202 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.441: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40 Source.442: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi Source.443: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.444: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1 Source.445: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.446: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7 Source.447: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2 Source.448: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1 Source.449: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.450: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.451: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1 Source.452: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A Source.453: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.454: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2 Source.455: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein Source.456: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.457: DFBPPR18635 ---- Animal proteins ---- Rho-related GTP-binding protein RhoB Source.458: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2 Source.459: DFBPPR18720 ---- Animal proteins ---- Protein quaking Source.460: DFBPPR18727 ---- Animal proteins ---- Interleukin-2 Source.461: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.462: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein Source.463: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.464: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4 Source.465: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type Source.466: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain Source.467: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial Source.468: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.469: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.470: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.471: DFBPPR18910 ---- Animal proteins ---- Aspartyl aminopeptidase Source.472: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.473: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta Source.474: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1 Source.475: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase Source.476: DFBPPR18981 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.477: DFBPPR19007 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1 Source.478: DFBPPR19073 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 21 Source.479: DFBPPR19124 ---- Animal proteins ---- Neuroguidin Source.480: DFBPPR19125 ---- Animal proteins ---- Alpha-fetoprotein Source.481: DFBPPR19133 ---- Animal proteins ---- Brain ribonuclease Source.482: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5 Source.483: DFBPPR19185 ---- Animal proteins ---- Partner of Y14 and mago Source.484: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4 Source.485: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial Source.486: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6 Source.487: DFBPPR19237 ---- Animal proteins ---- Cadherin-18 Source.488: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.489: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B Source.490: DFBPPR19284 ---- Animal proteins ---- Protein lifeguard 2 Source.491: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain Source.492: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2 Source.493: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1 Source.494: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59 Source.495: DFBPPR19442 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit G Source.496: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.497: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.498: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7 Source.499: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.500: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.501: DFBPPR19521 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 12 Source.502: DFBPPR19525 ---- Animal proteins ---- Tomoregulin-2 Source.503: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2 Source.504: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4 Source.505: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase Source.506: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain Source.507: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.508: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.509: DFBPPR19794 ---- Animal proteins ---- Bone morphogenetic protein 15 Source.510: DFBPPR19810 ---- Animal proteins ---- Seipin Source.511: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase Source.512: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial Source.513: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial Source.514: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain Source.515: DFBPPR19895 ---- Animal proteins ---- 39S ribosomal protein L24, mitochondrial Source.516: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase Source.517: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2 Source.518: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor Source.519: DFBPPR19942 ---- Animal proteins ---- AP-1 complex subunit sigma-2 Source.520: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1 Source.521: DFBPPR19972 ---- Animal proteins ---- Prefoldin subunit 5 Source.522: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3 Source.523: DFBPPR20010 ---- Animal proteins ---- Craniofacial development protein 1 Source.524: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase Source.525: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A Source.526: DFBPPR20102 ---- Animal proteins ---- Cylicin-2 Source.527: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.528: DFBPPR20257 ---- Animal proteins ---- Targeting protein for Xklp2 Source.529: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta Source.530: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1 Source.531: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.532: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2 Source.533: DFBPPR20458 ---- Animal proteins ---- Putative transcription factor Ovo-like 1 Source.534: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial Source.535: DFBPPR20541 ---- Animal proteins ---- Lambda-crystallin homolog Source.536: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A Source.537: DFBPPR20671 ---- Animal proteins ---- 39S ribosomal protein L27, mitochondrial Source.538: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog Source.539: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial Source.540: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial Source.541: DFBPPR20748 ---- Animal proteins ---- Protein ABHD14B Source.542: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial Source.543: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog Source.544: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase Source.545: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta Source.546: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14 Source.547: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.548: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48 Source.549: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.550: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1 Source.551: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor Source.552: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7 Source.553: DFBPPR21102 ---- Animal proteins ---- Gamma-glutamylcyclotransferase Source.554: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1 Source.555: DFBPPR21205 ---- Animal proteins ---- ATP synthase mitochondrial F1 complex assembly factor 2 Source.556: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog Source.557: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3 Source.558: DFBPPR21258 ---- Animal proteins ---- Insulin-like growth factor-binding protein 6 Source.559: DFBPPR21260 ---- Animal proteins ---- 40S ribosomal protein S21 Source.560: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1 Source.561: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1 Source.562: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial Source.563: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog Source.564: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A Source.565: DFBPPR21491 ---- Animal proteins ---- CUE domain-containing protein 2 Source.566: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S Source.567: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1 Source.568: DFBPPR21516 ---- Animal proteins ---- Cysteine and histidine-rich protein 1 Source.569: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase Source.570: DFBPPR21560 ---- Animal proteins ---- Sperm equatorial segment protein 1 Source.571: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.572: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein Source.573: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.574: DFBPPR21711 ---- Animal proteins ---- Hydrolethalus syndrome protein 1 homolog Source.575: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.576: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2 Source.577: DFBPPR21727 ---- Animal proteins ---- 39S ribosomal protein L1, mitochondrial Source.578: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.579: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2 Source.580: DFBPPR21827 ---- Animal proteins ---- LETM1 domain-containing protein 1 Source.581: DFBPPR21840 ---- Animal proteins ---- Keratin-associated protein 3-1 Source.582: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein Source.583: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor Source.584: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1 Source.585: DFBPPR22002 ---- Animal proteins ---- Histidine protein methyltransferase 1 homolog Source.586: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5 Source.587: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like Source.588: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1 Source.589: DFBPPR22065 ---- Animal proteins ---- 60S ribosomal protein L10-like Source.590: DFBPPR22077 ---- Animal proteins ---- 39S ribosomal protein L21, mitochondrial Source.591: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial Source.592: DFBPPR22298 ---- Animal proteins ---- 40S ribosomal protein S17 Source.593: DFBPPR22345 ---- Animal proteins ---- Small muscular protein Source.594: DFBPPR22376 ---- Animal proteins ---- 60S ribosomal protein L31 Source.595: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B Source.596: DFBPPR22581 ---- Animal proteins ---- UPF0690 protein C1orf52 homolog Source.597: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog Source.598: DFBPPR22666 ---- Animal proteins ---- Uncharacterized protein C12orf50 homolog Source.599: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C Source.600: DFBPPR22689 ---- Animal proteins ---- Protein FAM166B Source.601: DFBPPR22754 ---- Animal proteins ---- Uncharacterized protein C1orf158 homolog Source.602: DFBPPR22758 ---- Animal proteins ---- Uncharacterized protein C14orf28 homolog Source.603: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1 Source.604: DFBPPR8545 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.605: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.606: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 Source.607: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.608: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.609: DFBPPR8651 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.610: DFBPPR8658 ---- Animal proteins ---- Cell division control protein 42 homolog Source.611: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.612: DFBPPR8665 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit beta Source.613: DFBPPR8667 ---- Animal proteins ---- High mobility group protein B2 Source.614: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.615: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase Source.616: DFBPPR8717 ---- Animal proteins ---- Rhodopsin Source.617: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.618: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.619: DFBPPR8772 ---- Animal proteins ---- Dystroglycan Source.620: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.621: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.622: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.623: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.624: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase Source.625: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance Source.626: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.627: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.628: DFBPPR8939 ---- Animal proteins ---- Kit ligand Source.629: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.630: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.631: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.632: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.633: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain Source.634: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase Source.635: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.636: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.637: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.638: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.639: DFBPPR9185 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase Source.640: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.641: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial Source.642: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.643: DFBPPR9312 ---- Animal proteins ---- 40S ribosomal protein S21 Source.644: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein Source.645: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase Source.646: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D Source.647: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4 Source.648: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1 Source.649: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin Source.650: DFBPPR9427 ---- Animal proteins ---- Protein quaking Source.651: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59 Source.652: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59 Source.653: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain Source.654: DFBPPR9496 ---- Animal proteins ---- C-X-C motif chemokine 16 Source.655: DFBPPR9530 ---- Animal proteins ---- Rho-related GTP-binding protein RhoE Source.656: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6 Source.657: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2 Source.658: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.659: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.660: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.661: DFBPPR9627 ---- Animal proteins ---- Odontogenic ameloblast-associated protein Source.662: DFBPPR9672 ---- Animal proteins ---- Elongation factor 1-beta Source.663: DFBPPR9759 ---- Animal proteins ---- Palmdelphin Source.664: DFBPPR9807 ---- Animal proteins ---- Galectin-4 Source.665: DFBPPR9818 ---- Animal proteins ---- Calpain-7 Source.666: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1 Source.667: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.668: DFBPPR9870 ---- Animal proteins ---- 40S ribosomal protein S17 Source.669: DFBPPR9881 ---- Animal proteins ---- 60S ribosomal protein L31 Source.670: DFBPPR9923 ---- Animal proteins ---- Small muscular protein Source.671: DFBPPR9957 ---- Animal proteins ---- Ovoinhibitor Source.672: DFBPPR9973 ---- Animal proteins ---- High mobility group protein B1 Source.673: DFBPPR10016 ---- Animal proteins ---- High mobility group protein B2 Source.674: DFBPPR10020 ---- Animal proteins ---- PDZ and LIM domain protein 7 Source.675: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.676: DFBPPR10045 ---- Animal proteins ---- Albumin Source.677: DFBPPR10054 ---- Animal proteins ---- Kit ligand Source.678: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.679: DFBPPR10072 ---- Animal proteins ---- Cell division control protein 42 homolog Source.680: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.681: DFBPPR10082 ---- Animal proteins ---- Pinopsin Source.682: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type Source.683: DFBPPR10118 ---- Animal proteins ---- GATA-binding factor 3 Source.684: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.685: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.686: DFBPPR10150 ---- Animal proteins ---- Tenascin Source.687: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha Source.688: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1 Source.689: DFBPPR10218 ---- Animal proteins ---- Occludin Source.690: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1 Source.691: DFBPPR10259 ---- Animal proteins ---- Frizzled-4 Source.692: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2 Source.693: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6 Source.694: DFBPPR10304 ---- Animal proteins ---- Rhodopsin Source.695: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK Source.696: DFBPPR10336 ---- Animal proteins ---- Rho-related GTP-binding protein RhoC Source.697: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.698: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.699: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.700: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.701: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1 Source.702: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin Source.703: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.704: DFBPPR10436 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 Source.705: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.706: DFBPPR10529 ---- Animal proteins ---- Cadherin-20 Source.707: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.708: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin Source.709: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain Source.710: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain Source.711: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain Source.712: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein Source.713: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.714: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2 Source.715: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain Source.716: DFBPPR10780 ---- Animal proteins ---- Caspase-2 Source.717: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain Source.718: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.719: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2 Source.720: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1 Source.721: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.722: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain Source.723: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48 Source.724: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain Source.725: DFBPPR10952 ---- Animal proteins ---- Protein XRP2 Source.726: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain Source.727: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain Source.728: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.729: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1 Source.730: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326 Source.731: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1 Source.732: DFBPPR11112 ---- Animal proteins ---- Protein quaking Source.733: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.734: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.735: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein Source.736: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type Source.737: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2 Source.738: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1 Source.739: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase Source.740: DFBPPR11245 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein Source.741: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15 Source.742: DFBPPR11283 ---- Animal proteins ---- Centromere protein U Source.743: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1 Source.744: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1 Source.745: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7 Source.746: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.747: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231 Source.748: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5 Source.749: DFBPPR11502 ---- Animal proteins ---- Transcription factor GATA-4 Source.750: DFBPPR11526 ---- Animal proteins ---- Fibromodulin Source.751: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD Source.752: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein Source.753: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.754: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic Source.755: DFBPPR11655 ---- Animal proteins ---- 60S ribosomal protein L10 Source.756: DFBPPR11660 ---- Animal proteins ---- Cathepsin K Source.757: DFBPPR11662 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase Source.758: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13 Source.759: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.760: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.761: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A Source.762: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta Source.763: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog Source.764: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1 Source.765: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.766: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein Source.767: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein Source.768: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like Source.769: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.770: DFBPPR11889 ---- Animal proteins ---- Olfactory receptor-like protein COR8 Source.771: DFBPPR11908 ---- Animal proteins ---- Centrosomal protein kizuna Source.772: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.773: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130 Source.774: DFBPPR11992 ---- Animal proteins ---- Craniofacial development protein 1 Source.775: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a Source.776: DFBPPR12014 ---- Animal proteins ---- Raftlin Source.777: DFBPPR12072 ---- Animal proteins ---- 40S ribosomal protein S17 Source.778: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein Source.779: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14 Source.780: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.781: DFBPPR12171 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-3 Source.782: DFBPPR12180 ---- Animal proteins ---- Arylamine N-acetyltransferase, liver isozyme Source.783: DFBPPR12216 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial Source.784: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog Source.785: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.786: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.787: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.788: DFBPPR12320 ---- Animal proteins ---- Dystroglycan Source.789: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.790: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.791: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.792: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.793: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase Source.794: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1 Source.795: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.796: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII Source.797: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein Source.798: DFBPPR12536 ---- Animal proteins ---- Albumin Source.799: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.800: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.801: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.802: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.803: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.804: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase Source.805: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.806: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta Source.807: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.808: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta Source.809: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16 Source.810: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14 Source.811: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.812: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13 Source.813: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2 Source.814: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.815: DFBPPR12962 ---- Animal proteins ---- Coronin-1B Source.816: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1 Source.817: DFBPPR13020 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1 Source.818: DFBPPR13042 ---- Animal proteins ---- Thiopurine S-methyltransferase Source.819: DFBPPR13049 ---- Animal proteins ---- Alpha-S1-casein Source.820: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1 Source.821: DFBPPR13195 ---- Animal proteins ---- Albumin Source.822: DFBPPR13219 ---- Animal proteins ---- Kit ligand Source.823: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic Source.824: DFBPPR13276 ---- Animal proteins ---- Protein quaking Source.825: DFBPPR13294 ---- Animal proteins ---- Alpha-fetoprotein Source.826: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2 Source.827: DFBPPR13430 ---- Animal proteins ---- Ribonuclease pancreatic Source.828: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1 Source.829: DFBPPR13443 ---- Animal proteins ---- Kit ligand Source.830: DFBPPR13450 ---- Animal proteins ---- Keratin-associated protein 3-1 Source.831: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.832: DFBPPR13542 ---- Animal proteins ---- Pyridoxal kinase Source.833: DFBPPR13562 ---- Animal proteins ---- cAMP-dependent protein kinase catalytic subunit alpha Source.834: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2 Source.835: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.836: DFBPPR13605 ---- Animal proteins ---- Rhodopsin Source.837: DFBPPR13607 ---- Animal proteins ---- Ribonuclease pancreatic Source.838: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.839: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.840: DFBPPR13665 ---- Animal proteins ---- Kit ligand Source.841: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.842: DFBPPR13688 ---- Animal proteins ---- Keratin-associated protein 3-1 Source.843: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.844: DFBPPR13713 ---- Animal proteins ---- Plasminogen Source.845: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.846: DFBPPR13777 ---- Animal proteins ---- Centromere protein C Source.847: DFBPPR13785 ---- Animal proteins ---- Bone morphogenetic protein 15 Source.848: DFBPPR13788 ---- Animal proteins ---- Albumin Source.849: DFBPPR13789 ---- Animal proteins ---- Tryptase-2 Source.850: DFBPPR13798 ---- Animal proteins ---- Pregnancy-associated glycoprotein 6 Source.851: DFBPPR13887 ---- Animal proteins ---- Keratin-associated protein 3-2 Source.852: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.853: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter Source.854: DFBPPR13921 ---- Animal proteins ---- Brain ribonuclease Source.855: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.856: DFBPPR13992 ---- Animal proteins ---- Rhodopsin Source.857: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.858: DFBPPR14044 ---- Animal proteins ---- Transcription factor jun-B Source.859: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase Source.860: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog Source.861: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein Source.862: DFBPPR14180 ---- Marine protein ---- Prostamide/prostaglandin F synthase Source.863: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein Source.864: DFBPPR14215 ---- Marine protein ---- Protein SMG9 Source.865: DFBPPR14266 ---- Marine protein ---- Gonadotropin subunit beta-1 Source.866: DFBPPR14272 ---- Marine protein ---- Cytochrome c oxidase subunit 7A, mitochondrial Source.867: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.868: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain Source.869: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.870: DFBPPR14373 ---- Marine protein ---- Cytochrome b6 Source.871: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta Source.872: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A Source.873: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1 Source.874: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.875: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain Source.876: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form Source.877: DFBPPR14881 ---- Microorganism protein ---- Decapping and exoribonuclease protein 1 Source.878: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta Source.879: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5 Source.880: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase Source.881: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6 Source.882: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial Source.883: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial Source.884: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4 Source.885: DFBPPR14964 ---- Microorganism protein ---- Arginine biosynthesis bifunctional protein ArgJ, mitochondrial Source.886: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.887: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.888: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.889: DFBPPR15020 ---- Microorganism protein ---- ATP-dependent rRNA helicase SPB4 Source.890: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1 Source.891: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)] Source.892: DFBPPR15105 ---- Microorganism protein ---- Arginase Source.893: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.894: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.895: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28 Source.896: DFBPPR15125 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit G Source.897: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3 Source.898: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3 Source.899: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase Source.900: DFBPPR15243 ---- Microorganism protein ---- Coupling of ubiquitin conjugation to ER degradation protein 1 Source.901: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4 Source.902: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.903: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.904: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B Source.905: DFBPPR15363 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit F, mitochondrial Source.906: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14 Source.907: DFBPPR15399 ---- Microorganism protein ---- 40S ribosomal protein S21 Source.908: DFBPPR15413 ---- Microorganism protein ---- U1 small nuclear ribonucleoprotein component SNU71 Source.909: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1 Source.910: DFBPPR15439 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI1 Source.911: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22 Source.912: DFBPPR15513 ---- Microorganism protein ---- Killer toxin subunit gamma Source.913: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3 Source.914: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23 Source.915: DFBPPR15542 ---- Microorganism protein ---- Protein STE12 Source.916: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13 Source.917: DFBPPR15591 ---- Microorganism protein ---- Ras modification protein ERF4 Source.918: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase Source.919: DFBPPR15697 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 2 Source.920: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial Source.921: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1 Source.922: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10 Source.923: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component Source.924: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase Source.925: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta Source.926: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase Source.927: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase Source.928: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase Source.929: DFBPPR7794 ---- Plant protein ---- Cytochrome b6 Source.930: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.931: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.932: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.933: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1 Source.934: DFBPPR7935 ---- Plant protein ---- Cytochrome b Source.935: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic Source.936: DFBPPR7991 ---- Plant protein ---- Phenylcoumaran benzylic ether reductase IRL1 Source.937: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase Source.938: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.939: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase Source.940: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.941: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.942: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.943: DFBPPR8271 ---- Plant protein ---- Cytochrome b6
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

ACE-inhibitory activity	The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC₅₀ value of 200 μM.
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O

Preparation method

Mode of preparation	Synthesis
Enzyme(s)/starter culture	The peptide was synthesized by the stepwise solid-phase method, using Fmoc amino acids and mild acid labile side chain protection.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

N.D

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Kohmura, M., Nio, N., Ariyoshi, Y. Inhibition of Angiotensin-Converting Enzyme by Synthetic Peptide Fragments of Human κ-Casein. Agricultural and Biological Chemistry. 2014, 54, 835-6. DOI: 10.1080/00021369.1990.10870018
Other literature(s)	[1] Shimizu M. Nutraceutical proteins and peptides in health and disease[J]. ACE Inhibitory Peptides, 2006:269-315.
PubDate	2014