| DFBP ID - DFBPACEI1549(ACE-inhibitory peptide) |
| DFBP ID |
DFBPACEI1549 |
| Peptide sequence |
VKAGF |
| Type |
Native peptide |
| Peptide/Function name |
ACE-inhibitory peptide |
|
| Function-activity relationship |
| Main bioactivity |
ACE-inhibitory activity |
| Otheir bioactivity |
Antihypertensive activity [D1], Multifunctional activity [D2] |
|
| Calculated physicochemical properties |
| Three-letter amino acid |
Val-Lys-Ala-Gly-Phe |
| Single-letter amino acid |
VKAGF |
| Peptide length |
5 |
| Peptide mass |
| Experimental mass |
Theoretical mass |
| N.D |
520.63 Da c |
|
| Net charge |
0.00 c |
| Isoelectric point (pI) |
10.04 c |
| IC50 |
83 uM |
| pIC50 |
-1.919 |
| GRAVY |
0.9000 c |
| Hydrophilic residue ratio |
80% c |
| Peptide calculator |
|
|
| Biological/Functional activity & target protein |
| ACE-inhibitory activity |
The peptide exhibited strong Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50
value of 83 uM. |
| Specific target protein(s) |
Specific Target Protein(s): Angiotensin-converting enzyme |
|
| Taste properties & Structure |
| Bitterness |
| Literature report |
N.D |
| Bitter prediction tools |
No prediction can be made about the peptide bitterness. prediction |
|
| SMILES |
N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O |
|
| Preparation method |
| Mode of preparation |
Enzymatic hydrolysis
|
| Enzyme(s)/starter culture |
The peptide was isolated from a peptic hydrolyzate of heated sardine muscle.
|
|
| Stability & Cytotoxicity |
| Peptide stability |
|
| Peptide cytotoxicity |
|
|
| Additional information |
| Additional information |
N.D |
|
| Database cross-references |
|
|
|
|
|
|
|
|
|
|
| Reference(s) |
| Primary literature |
Ukeda, H., Matsuda, H., Osajima, K., Matsufuji, H., Matsui, T., Osajima, Y. Peptides from Peptic Hydrolyzate of Heated Sardine Meat That Inhibit Angiotensin I Converting Enzyme. Journal of the agricultural chemical society of Japan. 1992, 66, 25-9.
|
| Other literature(s) |
N.D |
| PubDate |
1992 |
|