Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI1573(ACE-inhibitory peptide)

DFBP ID	DFBPACEI1573
Peptide sequence	AGS
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Ala-Gly-Ser

Single-letter amino acid

AGS

Peptide length

Peptide mass

Experimental mass	Theoretical mass
234.1 Da	233.22 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

527.9 μM

pIC₅₀

-2.723

GRAVY

0.2000^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal, Marine, Fish
Organism/Source	Cuttlefish (Sepia officinalis)
Precursor protein	Cuttlefish muscle protein
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1 Source.2: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2 Source.3: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25 Source.4: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4 Source.5: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9 Source.6: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.7: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6 Source.8: DFBPPR0840 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 2 Source.9: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14 Source.10: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.11: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2 Source.12: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.13: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.14: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4 Source.15: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase Source.16: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q Source.17: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.18: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1 Source.19: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11 Source.20: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.21: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A Source.22: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog Source.23: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.24: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2 Source.25: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.26: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic Source.27: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.28: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1 Source.29: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.30: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10 Source.31: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1 Source.32: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic Source.33: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.34: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1 Source.35: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5 Source.36: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3 Source.37: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog Source.38: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC Source.39: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.40: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1 Source.41: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1 Source.42: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda Source.43: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1 Source.44: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1 Source.45: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2 Source.46: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1 Source.47: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.48: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.49: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic Source.50: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.51: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2 Source.52: DFBPPR1024 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK4 Source.53: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1 Source.54: DFBPPR1031 ---- Plant proteins ---- Transcription factor EAT1 Source.55: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.56: DFBPPR1034 ---- Plant proteins ---- bZIP transcription factor 50 Source.57: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1 Source.58: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3 Source.59: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase Source.60: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.61: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial Source.62: DFBPPR1060 ---- Plant proteins ---- WRKY transcription factor WRKY62 Source.63: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2 Source.64: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A Source.65: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1 Source.66: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic Source.67: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7 Source.68: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.69: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL Source.70: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1 Source.71: DFBPPR1097 ---- Plant proteins ---- Thioredoxin M5, chloroplastic Source.72: DFBPPR1103 ---- Plant proteins ---- Villin-2 Source.73: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10 Source.74: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic Source.75: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic Source.76: DFBPPR1116 ---- Plant proteins ---- Polycomb group protein EMF2B Source.77: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.78: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.79: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform Source.80: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1 Source.81: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A Source.82: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13 Source.83: DFBPPR1153 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein A Source.84: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.85: DFBPPR1167 ---- Plant proteins ---- Phototropin-2 Source.86: DFBPPR1171 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 2 Source.87: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30 Source.88: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.89: DFBPPR1208 ---- Plant proteins ---- RNA polymerase sigma factor sigA Source.90: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2 Source.91: DFBPPR1223 ---- Plant proteins ---- Elicitor-responsive protein 1 Source.92: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic Source.93: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1 Source.94: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28 Source.95: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.96: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.97: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3 Source.98: DFBPPR1257 ---- Plant proteins ---- Transcription factor MYB2 Source.99: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1 Source.100: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.101: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2 Source.102: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase Source.103: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1 Source.104: DFBPPR1281 ---- Plant proteins ---- Arsenate reductase 2.2 Source.105: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D Source.106: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39 Source.107: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic Source.108: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.109: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A Source.110: DFBPPR1311 ---- Plant proteins ---- Synaptonemal complex protein ZEP1 Source.111: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic Source.112: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic Source.113: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14 Source.114: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.115: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.116: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.117: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1 Source.118: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.119: DFBPPR1358 ---- Plant proteins ---- Fructose-bisphosphate aldolase, chloroplastic Source.120: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.121: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F Source.122: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.123: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2 Source.124: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5 Source.125: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic Source.126: DFBPPR1396 ---- Plant proteins ---- Peroxidase 2 Source.127: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.128: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.129: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5 Source.130: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2 Source.131: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.132: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1 Source.133: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2 Source.134: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.135: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.136: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B Source.137: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.138: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156 Source.139: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic Source.140: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3 Source.141: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1 Source.142: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic Source.143: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37 Source.144: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2 Source.145: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.146: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming] Source.147: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.148: DFBPPR1464 ---- Plant proteins ---- Remorin 4.1 Source.149: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1 Source.150: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic Source.151: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase Source.152: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A Source.153: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3 Source.154: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1 Source.155: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2 Source.156: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.157: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4 Source.158: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.159: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial Source.160: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.161: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d Source.162: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15 Source.163: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5 Source.164: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1 Source.165: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3 Source.166: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.167: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.168: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3 Source.169: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.170: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial Source.171: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15 Source.172: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2 Source.173: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.174: DFBPPR1580 ---- Plant proteins ---- Expansin-A4 Source.175: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2 Source.176: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.177: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1 Source.178: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11 Source.179: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.180: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.181: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.182: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.183: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.184: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial Source.185: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.186: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic Source.187: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.188: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.189: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3 Source.190: DFBPPR1654 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.191: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C Source.192: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C Source.193: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.194: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1 Source.195: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A Source.196: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.197: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4 Source.198: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.199: DFBPPR1687 ---- Plant proteins ---- Transcription factor ILI1 Source.200: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.201: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase Source.202: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.203: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic Source.204: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4 Source.205: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.206: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1 Source.207: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic Source.208: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.209: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic Source.210: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2 Source.211: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2 Source.212: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a Source.213: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.214: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial Source.215: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b Source.216: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial Source.217: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1 Source.218: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.219: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.220: DFBPPR1807 ---- Plant proteins ---- Two-component response regulator ORR1 Source.221: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.222: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1 Source.223: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase Source.224: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic Source.225: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C Source.226: DFBPPR1840 ---- Plant proteins ---- Shugoshin-1 Source.227: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic Source.228: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic Source.229: DFBPPR1854 ---- Plant proteins ---- Ferredoxin-1, chloroplastic Source.230: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b Source.231: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A Source.232: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c Source.233: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8 Source.234: DFBPPR1881 ---- Plant proteins ---- Protein TIFY 11d Source.235: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog Source.236: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3 Source.237: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.238: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic Source.239: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.240: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.241: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A Source.242: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.243: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7 Source.244: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2 Source.245: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1 Source.246: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase Source.247: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial Source.248: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.249: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase Source.250: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.251: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.252: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2 Source.253: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.254: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.255: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4 Source.256: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic Source.257: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1 Source.258: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.259: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.260: DFBPPR2013 ---- Plant proteins ---- Laccase-6 Source.261: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1 Source.262: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9 Source.263: DFBPPR2028 ---- Plant proteins ---- Laccase-7 Source.264: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5 Source.265: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B Source.266: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2 Source.267: DFBPPR2048 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ23 Source.268: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19 Source.269: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5 Source.270: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10 Source.271: DFBPPR2056 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 176 Source.272: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.273: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C Source.274: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.275: DFBPPR2081 ---- Plant proteins ---- Expansin-A1 Source.276: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic Source.277: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.278: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1 Source.279: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5 Source.280: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.281: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein Source.282: DFBPPR2100 ---- Plant proteins ---- Germin-like protein 1-1 Source.283: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 Source.284: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1 Source.285: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45 Source.286: DFBPPR2122 ---- Plant proteins ---- FAD-linked sulfhydryl oxidase ERV1 Source.287: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C Source.288: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic Source.289: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain Source.290: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.291: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2 Source.292: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic Source.293: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic Source.294: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2 Source.295: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.296: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.297: DFBPPR2176 ---- Plant proteins ---- Expansin-B11 Source.298: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2 Source.299: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase Source.300: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5 Source.301: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37 Source.302: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1 Source.303: DFBPPR2223 ---- Plant proteins ---- Urease Source.304: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.305: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12 Source.306: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial Source.307: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.308: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.309: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6 Source.310: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.311: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3 Source.312: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8 Source.313: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase Source.314: DFBPPR2286 ---- Plant proteins ---- Proteasome subunit alpha type-4-1 Source.315: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14 Source.316: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic Source.317: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7 Source.318: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA Source.319: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase Source.320: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.321: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain Source.322: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2 Source.323: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic Source.324: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3 Source.325: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic Source.326: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b Source.327: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.328: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2 Source.329: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic Source.330: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.331: DFBPPR2353 ---- Plant proteins ---- Expansin-B12 Source.332: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic Source.333: DFBPPR2356 ---- Plant proteins ---- Ubiquitin-like protein-NEDD8-like protein RUB3 Source.334: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB Source.335: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic Source.336: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6 Source.337: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3 Source.338: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23 Source.339: DFBPPR2390 ---- Plant proteins ---- Proteasome subunit alpha type-4-2 Source.340: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5 Source.341: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C Source.342: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase Source.343: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B Source.344: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.345: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73 Source.346: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33 Source.347: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic Source.348: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16 Source.349: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A Source.350: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1 Source.351: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase Source.352: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS Source.353: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.354: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6 Source.355: DFBPPR2448 ---- Plant proteins ---- Expansin-A9 Source.356: DFBPPR2457 ---- Plant proteins ---- Proteasome subunit alpha type-4-3 Source.357: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2 Source.358: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1 Source.359: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 Source.360: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.361: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5 Source.362: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900 Source.363: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13 Source.364: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5 Source.365: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1 Source.366: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9 Source.367: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.368: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4 Source.369: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300 Source.370: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c Source.371: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.372: DFBPPR2544 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.373: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1 Source.374: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial Source.375: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.376: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.377: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4 Source.378: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.379: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4 Source.380: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B Source.381: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic Source.382: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9 Source.383: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5 Source.384: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10 Source.385: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.386: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2 Source.387: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4 Source.388: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.389: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b Source.390: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2 Source.391: DFBPPR2653 ---- Plant proteins ---- Putative germin-like protein 12-4 Source.392: DFBPPR2656 ---- Plant proteins ---- Expansin-A15 Source.393: DFBPPR2662 ---- Plant proteins ---- Putative germin-like protein 12-3 Source.394: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8 Source.395: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33 Source.396: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1 Source.397: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein Source.398: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1 Source.399: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase Source.400: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.401: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A Source.402: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16 Source.403: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H Source.404: DFBPPR2712 ---- Plant proteins ---- Expansin-A20 Source.405: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1 Source.406: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.407: DFBPPR2721 ---- Plant proteins ---- Expansin-A18 Source.408: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic Source.409: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit Source.410: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic Source.411: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5 Source.412: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.413: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.414: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.415: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7 Source.416: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25 Source.417: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.418: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3 Source.419: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.420: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA Source.421: DFBPPR2788 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.422: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A Source.423: DFBPPR2796 ---- Plant proteins ---- Protein TIFY 11c Source.424: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.425: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.426: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like Source.427: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a Source.428: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10 Source.429: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.430: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23 Source.431: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2 Source.432: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6 Source.433: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.434: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.435: DFBPPR2851 ---- Plant proteins ---- Non-specific lipid-transfer protein 2B Source.436: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9 Source.437: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53 Source.438: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11 Source.439: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2 Source.440: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.441: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A Source.442: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.443: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2 Source.444: DFBPPR2884 ---- Plant proteins ---- Expansin-B2 Source.445: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1 Source.446: DFBPPR2887 ---- Plant proteins ---- Probable protein phosphatase 2C 32 Source.447: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic Source.448: DFBPPR2898 ---- Plant proteins ---- Germin-like protein 12-1 Source.449: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7 Source.450: DFBPPR2900 ---- Plant proteins ---- Expansin-A23 Source.451: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB Source.452: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2 Source.453: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2 Source.454: DFBPPR2910 ---- Plant proteins ---- Expansin-B5 Source.455: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2 Source.456: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.457: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14 Source.458: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1 Source.459: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13 Source.460: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A Source.461: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1 Source.462: DFBPPR2942 ---- Plant proteins ---- Germin-like protein 12-2 Source.463: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27 Source.464: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.465: DFBPPR2948 ---- Plant proteins ---- Expansin-A25 Source.466: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.467: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.468: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2 Source.469: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1 Source.470: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7 Source.471: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3 Source.472: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.473: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19 Source.474: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23 Source.475: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13 Source.476: DFBPPR3005 ---- Plant proteins ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]-like Source.477: DFBPPR3006 ---- Plant proteins ---- 3'(2'),5'-bisphosphate nucleotidase Source.478: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1 Source.479: DFBPPR3015 ---- Plant proteins ---- Expansin-A13 Source.480: DFBPPR3016 ---- Plant proteins ---- Expansin-A29 Source.481: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31 Source.482: DFBPPR3027 ---- Plant proteins ---- Expansin-A31 Source.483: DFBPPR3028 ---- Plant proteins ---- Expansin-A19 Source.484: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15 Source.485: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3 Source.486: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3 Source.487: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1 Source.488: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24 Source.489: DFBPPR3047 ---- Plant proteins ---- Zinc finger protein 36 Source.490: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17 Source.491: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H Source.492: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.493: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2 Source.494: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7 Source.495: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase Source.496: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.497: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E Source.498: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12 Source.499: DFBPPR3102 ---- Plant proteins ---- Expansin-B18 Source.500: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21 Source.501: DFBPPR3106 ---- Plant proteins ---- Protein HIRA Source.502: DFBPPR3109 ---- Plant proteins ---- Beta-glucosidase 28 Source.503: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7 Source.504: DFBPPR3133 ---- Plant proteins ---- Double-stranded RNA-binding protein 8 Source.505: DFBPPR3135 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 1 Source.506: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1 Source.507: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic Source.508: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.509: DFBPPR3148 ---- Plant proteins ---- Growth-regulating factor 8 Source.510: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3 Source.511: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11 Source.512: DFBPPR3166 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.513: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic Source.514: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I Source.515: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1 Source.516: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32 Source.517: DFBPPR3191 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial Source.518: DFBPPR3198 ---- Plant proteins ---- Probable protein phosphatase 2C 59 Source.519: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3 Source.520: DFBPPR3206 ---- Plant proteins ---- Expansin-B15 Source.521: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B Source.522: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2 Source.523: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A Source.524: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic Source.525: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3 Source.526: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.527: DFBPPR3232 ---- Plant proteins ---- Expansin-A28 Source.528: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1 Source.529: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic Source.530: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2 Source.531: DFBPPR3239 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-4, chloroplastic Source.532: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.533: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B Source.534: DFBPPR3246 ---- Plant proteins ---- Probable histone H2A.7 Source.535: DFBPPR3254 ---- Plant proteins ---- Probable protein phosphatase 2C 10 Source.536: DFBPPR3257 ---- Plant proteins ---- Ras-related protein RIC2 Source.537: DFBPPR3260 ---- Plant proteins ---- Probable histone H2A.1 Source.538: DFBPPR3263 ---- Plant proteins ---- N-carbamoylputrescine amidase Source.539: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18 Source.540: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.541: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein Source.542: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18 Source.543: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1 Source.544: DFBPPR3294 ---- Plant proteins ---- Probable histone H2A.3 Source.545: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4 Source.546: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2 Source.547: DFBPPR3311 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 2 Source.548: DFBPPR3317 ---- Plant proteins ---- Beta-glucosidase 13 Source.549: DFBPPR3335 ---- Plant proteins ---- Molybdopterin synthase sulfur carrier subunit Source.550: DFBPPR3336 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic Source.551: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2 Source.552: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase Source.553: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68 Source.554: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22 Source.555: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.556: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2 Source.557: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic Source.558: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R Source.559: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28 Source.560: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6 Source.561: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.562: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2 Source.563: DFBPPR3393 ---- Plant proteins ---- Auxin-responsive protein IAA20 Source.564: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.565: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16 Source.566: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5 Source.567: DFBPPR3417 ---- Plant proteins ---- Protein CutA 1, chloroplastic Source.568: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12 Source.569: DFBPPR3422 ---- Plant proteins ---- Putative beta-galactosidase 10 Source.570: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1 Source.571: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic Source.572: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49 Source.573: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2 Source.574: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial Source.575: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2 Source.576: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.577: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7 Source.578: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14 Source.579: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1 Source.580: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic Source.581: DFBPPR3485 ---- Plant proteins ---- Auxin-responsive protein IAA31 Source.582: DFBPPR3494 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS32 Source.583: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.584: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N Source.585: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.586: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14 Source.587: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic Source.588: DFBPPR3518 ---- Plant proteins ---- Thioredoxin-like 3-3 Source.589: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56 Source.590: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36 Source.591: DFBPPR3535 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.592: DFBPPR3538 ---- Plant proteins ---- Probable protein phosphatase 2C 7 Source.593: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5 Source.594: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3 Source.595: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2 Source.596: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33 Source.597: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60 Source.598: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600 Source.599: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36 Source.600: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65 Source.601: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8 Source.602: DFBPPR3573 ---- Plant proteins ---- Protein TIFY 5 Source.603: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76 Source.604: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.605: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19 Source.606: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.607: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2 Source.608: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.609: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog Source.610: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3 Source.611: DFBPPR3619 ---- Plant proteins ---- Cyclin-D3-1 Source.612: DFBPPR3620 ---- Plant proteins ---- Kinesin-like protein KIN-7L Source.613: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K Source.614: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.615: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2 Source.616: DFBPPR3640 ---- Plant proteins ---- Dof zinc finger protein 1 Source.617: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic Source.618: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic Source.619: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5 Source.620: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C Source.621: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3 Source.622: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J Source.623: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6 Source.624: DFBPPR3678 ---- Plant proteins ---- Kinesin-like protein KIN-14F Source.625: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14 Source.626: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3 Source.627: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.628: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1 Source.629: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1 Source.630: DFBPPR3713 ---- Plant proteins ---- Probable NADH kinase Source.631: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G Source.632: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3 Source.633: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic Source.634: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64 Source.635: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4 Source.636: DFBPPR3756 ---- Plant proteins ---- Squamosa promoter-binding-like protein 12 Source.637: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71 Source.638: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog Source.639: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.640: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A Source.641: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G Source.642: DFBPPR3782 ---- Plant proteins ---- Auxin-responsive protein IAA16 Source.643: DFBPPR3783 ---- Plant proteins ---- Patatin-like protein 2 Source.644: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D Source.645: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77 Source.646: DFBPPR3798 ---- Plant proteins ---- Actin-related protein 7 Source.647: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.648: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic Source.649: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B Source.650: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6 Source.651: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.652: DFBPPR3810 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.653: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B Source.654: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1 Source.655: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G Source.656: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4 Source.657: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22 Source.658: DFBPPR3834 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS35 Source.659: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C Source.660: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7 Source.661: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29 Source.662: DFBPPR3861 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.663: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1 Source.664: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2 Source.665: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.666: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31 Source.667: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.668: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20 Source.669: DFBPPR3901 ---- Plant proteins ---- Growth-regulating factor 9 Source.670: DFBPPR3902 ---- Plant proteins ---- Probable serine acetyltransferase 5 Source.671: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5 Source.672: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7 Source.673: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.674: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4 Source.675: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.676: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1 Source.677: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2 Source.678: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.679: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2 Source.680: DFBPPR3957 ---- Plant proteins ---- Probable aquaporin TIP4-2 Source.681: DFBPPR3961 ---- Plant proteins ---- Zinc-finger homeodomain protein 8 Source.682: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7 Source.683: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.684: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9 Source.685: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.686: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.687: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J Source.688: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A Source.689: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6 Source.690: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9 Source.691: DFBPPR4005 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.692: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6 Source.693: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic Source.694: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3 Source.695: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4 Source.696: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1 Source.697: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19 Source.698: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein Source.699: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog Source.700: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8 Source.701: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9 Source.702: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase Source.703: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.704: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1 Source.705: DFBPPR4057 ---- Plant proteins ---- Non-specific lipid-transfer protein 2A Source.706: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic Source.707: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.708: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1 Source.709: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D Source.710: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6 Source.711: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.712: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3 Source.713: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8 Source.714: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5 Source.715: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic Source.716: DFBPPR4098 ---- Plant proteins ---- ESCRT-related protein CHMP1 Source.717: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2 Source.718: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95 Source.719: DFBPPR4137 ---- Plant proteins ---- Casparian strip membrane protein 7 Source.720: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2 Source.721: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.722: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.723: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1 Source.724: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H Source.725: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c Source.726: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3 Source.727: DFBPPR4171 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 4 Source.728: DFBPPR4172 ---- Plant proteins ---- Dof zinc finger protein 4 Source.729: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16 Source.730: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1 Source.731: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18 Source.732: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1 Source.733: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1 Source.734: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2 Source.735: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22 Source.736: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic Source.737: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4 Source.738: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic Source.739: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1 Source.740: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.741: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.742: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3 Source.743: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1 Source.744: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4 Source.745: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2 Source.746: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D Source.747: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4 Source.748: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.749: DFBPPR4293 ---- Plant proteins ---- Double-stranded RNA-binding protein 7 Source.750: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5 Source.751: DFBPPR4297 ---- Plant proteins ---- Protein translation factor SUI1 homolog Source.752: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10 Source.753: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17 Source.754: DFBPPR4304 ---- Plant proteins ---- Signal recognition particle 14 kDa protein Source.755: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28 Source.756: DFBPPR4318 ---- Plant proteins ---- Golgin-84 Source.757: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11 Source.758: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.759: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.760: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic Source.761: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4 Source.762: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.763: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6 Source.764: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog Source.765: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2 Source.766: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5 Source.767: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7 Source.768: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9 Source.769: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2 Source.770: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.771: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4 Source.772: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.773: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5 Source.774: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.775: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.776: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.777: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic Source.778: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.779: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.780: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.781: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24 Source.782: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1 Source.783: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.784: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.785: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2 Source.786: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog Source.787: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1 Source.788: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.789: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3 Source.790: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63 Source.791: DFBPPR4532 ---- Plant proteins ---- CASP-like protein 1U2 Source.792: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A Source.793: DFBPPR4539 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 3 Source.794: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59 Source.795: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12 Source.796: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3 Source.797: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7 Source.798: DFBPPR4565 ---- Plant proteins ---- CASP-like protein 5B1 Source.799: DFBPPR4566 ---- Plant proteins ---- CASP-like protein 5C1 Source.800: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3 Source.801: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1 Source.802: DFBPPR4570 ---- Plant proteins ---- CASP-like protein 2C1 Source.803: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32 Source.804: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13 Source.805: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2 Source.806: DFBPPR4628 ---- Plant proteins ---- Probable inactive carboxylesterase Os04g0669700 Source.807: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1 Source.808: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700 Source.809: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12 Source.810: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2 Source.811: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic Source.812: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62 Source.813: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1 Source.814: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3 Source.815: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic Source.816: DFBPPR4691 ---- Plant proteins ---- Probable protein ABIL3 Source.817: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B Source.818: DFBPPR4701 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 15 Source.819: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17 Source.820: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.821: DFBPPR4723 ---- Plant proteins ---- Zinc finger A20 domain-containing stress-associated protein 18 Source.822: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19 Source.823: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.824: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1 Source.825: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11 Source.826: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8 Source.827: DFBPPR4758 ---- Plant proteins ---- BURP domain-containing protein 7 Source.828: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31 Source.829: DFBPPR4791 ---- Plant proteins ---- B3 domain-containing protein Os02g0683500 Source.830: DFBPPR4793 ---- Plant proteins ---- B3 domain-containing protein LOC_Os02g10420 Source.831: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200 Source.832: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000 Source.833: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100 Source.834: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55 Source.835: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b Source.836: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500 Source.837: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6 Source.838: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36 Source.839: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56 Source.840: DFBPPR4844 ---- Plant proteins ---- B3 domain-containing protein Os05g0481400 Source.841: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800 Source.842: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600 Source.843: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37 Source.844: DFBPPR4864 ---- Plant proteins ---- Putative B3 domain-containing protein Os11g0625400 Source.845: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog Source.846: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1 Source.847: DFBPPR4871 ---- Plant proteins ---- Putative B3 domain-containing protein Os11g0242900 Source.848: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500 Source.849: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48 Source.850: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4 Source.851: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.852: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5 Source.853: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10 Source.854: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic Source.855: DFBPPR4930 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic Source.856: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7 Source.857: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1 Source.858: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.859: DFBPPR4965 ---- Plant proteins ---- Glycinin G1 Source.860: DFBPPR4973 ---- Plant proteins ---- Glycinin G2 Source.861: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.862: DFBPPR4983 ---- Plant proteins ---- Protein SRC2 Source.863: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.864: DFBPPR4992 ---- Plant proteins ---- Glycinin G3 Source.865: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.866: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic Source.867: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.868: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.869: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1 Source.870: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform Source.871: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform Source.872: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic Source.873: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2 Source.874: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.875: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase Source.876: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2 Source.877: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.878: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.879: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.880: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal Source.881: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1 Source.882: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic Source.883: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.884: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.885: DFBPPR5194 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.886: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.887: DFBPPR5205 ---- Plant proteins ---- Urease Source.888: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic Source.889: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.890: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.891: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase Source.892: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic Source.893: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme Source.894: DFBPPR5243 ---- Plant proteins ---- 50S ribosomal protein L2-A, chloroplastic Source.895: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70 Source.896: DFBPPR5257 ---- Plant proteins ---- 50S ribosomal protein L2-B, chloroplastic Source.897: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8 Source.898: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.899: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2 Source.900: DFBPPR5308 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein Source.901: DFBPPR5344 ---- Plant proteins ---- Nodulin-16 Source.902: DFBPPR5351 ---- Plant proteins ---- 40S ribosomal protein S11 Source.903: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic Source.904: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1 Source.905: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase Source.906: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.907: DFBPPR5393 ---- Plant proteins ---- Endochitinase A Source.908: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8 Source.909: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.910: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3 Source.911: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.912: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.913: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.914: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic Source.915: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase Source.916: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein Source.917: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase Source.918: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.919: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit Source.920: DFBPPR5435 ---- Plant proteins ---- Ferredoxin-1, chloroplastic Source.921: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8 Source.922: DFBPPR5443 ---- Plant proteins ---- Protein BUNDLE SHEATH DEFECTIVE 2, chloroplastic Source.923: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.924: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic Source.925: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2 Source.926: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.927: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.928: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic Source.929: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic Source.930: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic Source.931: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.932: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8 Source.933: DFBPPR5497 ---- Plant proteins ---- Peroxidase 66 Source.934: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.935: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase Source.936: DFBPPR5518 ---- Plant proteins ---- Ferredoxin-2, chloroplastic Source.937: DFBPPR5520 ---- Plant proteins ---- Photosystem II reaction center protein H Source.938: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.939: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.940: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3 Source.941: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic Source.942: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1 Source.943: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic Source.944: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic Source.945: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase Source.946: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.947: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.948: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic Source.949: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3 Source.950: DFBPPR5601 ---- Plant proteins ---- Protein HIRA Source.951: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase Source.952: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.953: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW Source.954: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.955: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1 Source.956: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.957: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.958: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase Source.959: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.960: DFBPPR5642 ---- Plant proteins ---- Zeamatin Source.961: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2 Source.962: DFBPPR5670 ---- Plant proteins ---- Endochitinase B Source.963: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.964: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic Source.965: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.966: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.967: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic Source.968: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.969: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.970: DFBPPR5747 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.971: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1 Source.972: DFBPPR5761 ---- Plant proteins ---- Ferredoxin-6, chloroplastic Source.973: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.974: DFBPPR5769 ---- Plant proteins ---- Ferredoxin-5, chloroplastic Source.975: DFBPPR5772 ---- Plant proteins ---- Eukaryotic translation initiation factor 4E-1 Source.976: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele Source.977: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic Source.978: DFBPPR5796 ---- Plant proteins ---- Shugoshin-1 Source.979: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.980: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.981: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6 Source.982: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.983: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19 Source.984: DFBPPR5853 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.985: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.986: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.987: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein Source.988: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.989: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1 Source.990: DFBPPR5887 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.991: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1 Source.992: DFBPPR5899 ---- Plant proteins ---- Ras-related protein Rab-2-B Source.993: DFBPPR5901 ---- Plant proteins ---- GTP-binding protein YPTM1 Source.994: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.995: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3 Source.996: DFBPPR5906 ---- Plant proteins ---- Ras-related protein Rab-2-A Source.997: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein Source.998: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2 Source.999: DFBPPR5922 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.1000: DFBPPR5925 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic Source.1001: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2 Source.1002: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1003: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A Source.1004: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1 Source.1005: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2 Source.1006: DFBPPR5962 ---- Plant proteins ---- Protein RIK Source.1007: DFBPPR5980 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.1008: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1 Source.1009: DFBPPR5990 ---- Plant proteins ---- Sex determination protein tasselseed-2 Source.1010: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1 Source.1011: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2 Source.1012: DFBPPR6009 ---- Plant proteins ---- CASP-like protein 5C1 Source.1013: DFBPPR6047 ---- Plant proteins ---- CASP-like protein 1D1 Source.1014: DFBPPR6051 ---- Plant proteins ---- CASP-like protein 2C2 Source.1015: DFBPPR6066 ---- Plant proteins ---- Protein translation factor SUI1 homolog Source.1016: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2 Source.1017: DFBPPR6075 ---- Plant proteins ---- MFS18 protein Source.1018: DFBPPR6086 ---- Plant proteins ---- Cell number regulator 5 Source.1019: DFBPPR6102 ---- Plant proteins ---- CASP-like protein 2C3 Source.1020: DFBPPR6109 ---- Plant proteins ---- CASP-like protein 2C1 Source.1021: DFBPPR6120 ---- Plant proteins ---- 40S ribosomal protein S11 Source.1022: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein Source.1023: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5 Source.1024: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.1025: DFBPPR6214 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.1026: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic Source.1027: DFBPPR6227 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.1028: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic Source.1029: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic Source.1030: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.1031: DFBPPR6249 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.1032: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial Source.1033: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase Source.1034: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96 Source.1035: DFBPPR6275 ---- Plant proteins ---- Ferredoxin-1, chloroplastic Source.1036: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.1037: DFBPPR6300 ---- Plant proteins ---- Strigolactone esterase RMS3 Source.1038: DFBPPR6304 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.1039: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic Source.1040: DFBPPR6359 ---- Plant proteins ---- ATP synthase delta chain, chloroplastic Source.1041: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1 Source.1042: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic Source.1043: DFBPPR6368 ---- Plant proteins ---- Provicilin Source.1044: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic Source.1045: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.1046: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic Source.1047: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.1048: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1049: DFBPPR6441 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic Source.1050: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic Source.1051: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase Source.1052: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase Source.1053: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.1054: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW Source.1055: DFBPPR6504 ---- Plant proteins ---- Cysteine proteinase 15A Source.1056: DFBPPR6513 ---- Plant proteins ---- Plastoglobulin-1, chloroplastic Source.1057: DFBPPR6539 ---- Plant proteins ---- Defensin-like protein 230 Source.1058: DFBPPR6545 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.1059: DFBPPR6549 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.1060: DFBPPR6566 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.1061: DFBPPR6567 ---- Plant proteins ---- ABA-responsive protein ABR17 Source.1062: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.1063: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.1064: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic Source.1065: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.1066: DFBPPR6708 ---- Plant proteins ---- Photosystem II reaction center protein H Source.1067: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.1068: DFBPPR6753 ---- Plant proteins ---- Ferredoxin, chloroplastic Source.1069: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.1070: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A Source.1071: DFBPPR6791 ---- Plant proteins ---- DNA-binding protein EMBP-1 Source.1072: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B Source.1073: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1) Source.1074: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B Source.1075: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38) Source.1076: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1077: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1078: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.1079: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.1080: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A Source.1081: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C Source.1082: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1083: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B Source.1084: DFBPPR6830 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.1085: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1086: DFBPPR6846 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.1087: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1088: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.1089: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.1090: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1091: DFBPPR6880 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.1092: DFBPPR6898 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.1093: DFBPPR6957 ---- Plant proteins ---- Protein WIR1B Source.1094: DFBPPR6970 ---- Plant proteins ---- 40S ribosomal protein S29 Source.1095: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1 Source.1096: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1 Source.1097: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7 Source.1098: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.1099: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic Source.1100: DFBPPR7050 ---- Plant proteins ---- Lichenase-2 Source.1101: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.1102: DFBPPR7053 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMa Source.1103: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1104: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1105: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.1106: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.1107: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1 Source.1108: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII Source.1109: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic Source.1110: DFBPPR7114 ---- Plant proteins ---- Acyl carrier protein 3, chloroplastic Source.1111: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor Source.1112: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.1113: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1114: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial Source.1115: DFBPPR7134 ---- Plant proteins ---- Photosystem II reaction center protein H Source.1116: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV Source.1117: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic Source.1118: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX Source.1119: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase Source.1120: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1121: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1122: DFBPPR7201 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic Source.1123: DFBPPR7208 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.1124: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.1125: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.1126: DFBPPR7215 ---- Plant proteins ---- Aldose reductase Source.1127: DFBPPR7223 ---- Plant proteins ---- Ferredoxin Source.1128: DFBPPR7231 ---- Plant proteins ---- ATP synthase subunit b, chloroplastic Source.1129: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1 Source.1130: DFBPPR7276 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic Source.1131: DFBPPR7313 ---- Plant proteins ---- 30S ribosomal protein S11, chloroplastic Source.1132: DFBPPR7351 ---- Plant proteins ---- 23 kDa jasmonate-induced protein Source.1133: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic Source.1134: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic Source.1135: DFBPPR7400 ---- Plant proteins ---- Myrosinase Source.1136: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic Source.1137: DFBPPR7422 ---- Plant proteins ---- Napin-1A Source.1138: DFBPPR7433 ---- Plant proteins ---- Peptidyl-prolyl cis-trans isomerase Source.1139: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.1140: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1 Source.1141: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.1142: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.1143: DFBPPR7463 ---- Plant proteins ---- Oleosin S2-2 Source.1144: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal Source.1145: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.1146: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal Source.1147: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.1148: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic Source.1149: DFBPPR7499 ---- Plant proteins ---- Ferredoxin Source.1150: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA Source.1151: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG Source.1152: DFBPPR7539 ---- Plant proteins ---- Metallothionein-like protein LSC54 Source.1153: DFBPPR7594 ---- Milk proteins ---- Lactadherin Source.1154: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase Source.1155: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1 Source.1156: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b Source.1157: DFBPPR7618 ---- Milk proteins ---- Plasminogen Source.1158: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor Source.1159: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.1160: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2 Source.1161: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2 Source.1162: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform Source.1163: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.1164: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1 Source.1165: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1 Source.1166: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor Source.1167: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4 Source.1168: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51 Source.1169: DFBPPR7688 ---- Milk proteins ---- Alpha-S1-casein Source.1170: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.1171: DFBPPR7694 ---- Milk proteins ---- Alpha-S1-casein Source.1172: DFBPPR7716 ---- Milk proteins ---- Lingual antimicrobial peptide Source.1173: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic Source.1174: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.1175: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase Source.1176: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta Source.1177: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.1178: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1179: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.1180: DFBPPR8373 ---- Plant proteins ---- Non-specific lipid-transfer protein Source.1181: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase Source.1182: DFBPPR8381 ---- Plant proteins ---- Conglutin-7 Source.1183: DFBPPR8390 ---- Plant proteins ---- Galactose-binding lectin Source.1184: DFBPPR8391 ---- Plant proteins ---- Oleosin Ara h 15.0101 Source.1185: DFBPPR8413 ---- Plant proteins ---- Arachin Ahy-3 Source.1186: DFBPPR8425 ---- Plant proteins ---- Oleosin L Source.1187: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.1188: DFBPPR8438 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.1189: DFBPPR8440 ---- Plant proteins ---- Non-specific lipid-transfer protein 4 Source.1190: DFBPPR8441 ---- Plant proteins ---- Non-specific lipid-transfer protein 6 Source.1191: DFBPPR8443 ---- Plant proteins ---- Non-specific lipid-transfer protein 1 Source.1192: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic Source.1193: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.1194: DFBPPR8461 ---- Plant proteins ---- Photosystem II reaction center protein H Source.1195: DFBPPR8466 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.1196: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein Source.1197: DFBPPR8486 ---- Milk proteins ---- Lactadherin Source.1198: DFBPPR8496 ---- Milk proteins ---- Mucin-1 Source.1199: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase Source.1200: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.1201: DFBPPR8511 ---- Milk proteins ---- Transcobalamin-2 Source.1202: DFBPPR8518 ---- Milk proteins ---- MICAL-like protein 1 Source.1203: DFBPPR15937 ---- Animal proteins ---- Appetite-regulating hormone Source.1204: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1 Source.1205: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.1206: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.1207: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.1208: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.1209: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.1210: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1211: DFBPPR15968 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.1212: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8 Source.1213: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T Source.1214: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.1215: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9 Source.1216: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.1217: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1 Source.1218: DFBPPR16001 ---- Animal proteins ---- Battenin Source.1219: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.1220: DFBPPR16007 ---- Animal proteins ---- Myocilin Source.1221: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.1222: DFBPPR16038 ---- Animal proteins ---- Protein amnionless Source.1223: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta Source.1224: DFBPPR16045 ---- Animal proteins ---- Endoplasmin Source.1225: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.1226: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2 Source.1227: DFBPPR16069 ---- Animal proteins ---- T-cell surface glycoprotein CD4 Source.1228: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein Source.1229: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2 Source.1230: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.1231: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2 Source.1232: DFBPPR16094 ---- Animal proteins ---- Mastin Source.1233: DFBPPR16099 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase FTO Source.1234: DFBPPR16103 ---- Animal proteins ---- Laforin Source.1235: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1236: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.1237: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain Source.1238: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C Source.1239: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1240: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.1241: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.1242: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor Source.1243: DFBPPR16135 ---- Animal proteins ---- Gap junction alpha-1 protein Source.1244: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.1245: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3 Source.1246: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase Source.1247: DFBPPR16148 ---- Animal proteins ---- Haptoglobin Source.1248: DFBPPR16155 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.1249: DFBPPR16157 ---- Animal proteins ---- Protein transport protein Sec61 subunit beta Source.1250: DFBPPR16165 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase Source.1251: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.1252: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 Source.1253: DFBPPR16170 ---- Animal proteins ---- Inversin Source.1254: DFBPPR16190 ---- Animal proteins ---- Aprataxin Source.1255: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1 Source.1256: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.1257: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.1258: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator Source.1259: DFBPPR16203 ---- Animal proteins ---- E3 ubiquitin-protein ligase RING1 Source.1260: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1 Source.1261: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.1262: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.1263: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1264: DFBPPR16225 ---- Animal proteins ---- C-C motif chemokine 24 Source.1265: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.1266: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog Source.1267: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.1268: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.1269: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.1270: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.1271: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.1272: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4 Source.1273: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.1274: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.1275: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.1276: DFBPPR16281 ---- Animal proteins ---- Signal recognition particle subunit SRP68 Source.1277: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.1278: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain Source.1279: DFBPPR16295 ---- Animal proteins ---- Zinc finger protein Gfi-1 Source.1280: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.1281: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4 Source.1282: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4 Source.1283: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein Source.1284: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.1285: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.1286: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.1287: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2 Source.1288: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11 Source.1289: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.1290: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1291: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.1292: DFBPPR16464 ---- Animal proteins ---- Interferon alpha-1/2 Source.1293: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin Source.1294: DFBPPR16484 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain Source.1295: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein Source.1296: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor Source.1297: DFBPPR16517 ---- Animal proteins ---- Cholinesterase Source.1298: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator Source.1299: DFBPPR16538 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 1B Source.1300: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.1301: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.1302: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor Source.1303: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.1304: DFBPPR16572 ---- Animal proteins ---- Gamma-sarcoglycan Source.1305: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3 Source.1306: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2 Source.1307: DFBPPR16598 ---- Animal proteins ---- Keratin, type I cytoskeletal 9 Source.1308: DFBPPR16616 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1 Source.1309: DFBPPR16632 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.1310: DFBPPR16638 ---- Animal proteins ---- Synapsin-1 Source.1311: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.1312: DFBPPR16660 ---- Animal proteins ---- Gamma-crystallin C Source.1313: DFBPPR16679 ---- Animal proteins ---- Mitochondrial uncoupling protein 3 Source.1314: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.1315: DFBPPR16695 ---- Animal proteins ---- UDP-galactose translocator Source.1316: DFBPPR16696 ---- Animal proteins ---- von Hippel-Lindau disease tumor suppressor Source.1317: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.1318: DFBPPR16708 ---- Animal proteins ---- Transmembrane protein 190 Source.1319: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.1320: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252 Source.1321: DFBPPR16715 ---- Animal proteins ---- Submaxillary mucin Source.1322: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.1323: DFBPPR16721 ---- Animal proteins ---- Testin Source.1324: DFBPPR16750 ---- Animal proteins ---- 60S ribosomal protein L23 Source.1325: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10 Source.1326: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor Source.1327: DFBPPR16784 ---- Animal proteins ---- Metallothionein-2 Source.1328: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.1329: DFBPPR16800 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn] Source.1330: DFBPPR16808 ---- Animal proteins ---- Fibroblast growth factor 2 Source.1331: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1332: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X Source.1333: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.1334: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.1335: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor Source.1336: DFBPPR16859 ---- Animal proteins ---- Ubiquitin-like protein ISG15 Source.1337: DFBPPR16872 ---- Animal proteins ---- Oxytocin-neurophysin 1 Source.1338: DFBPPR16877 ---- Animal proteins ---- Peptidoglycan recognition protein 1 Source.1339: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase Source.1340: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.1341: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial Source.1342: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.1343: DFBPPR16903 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate Source.1344: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.1345: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha Source.1346: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV Source.1347: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial Source.1348: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.1349: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.1350: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.1351: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase Source.1352: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.1353: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.1354: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2 Source.1355: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.1356: DFBPPR17046 ---- Animal proteins ---- Appetite-regulating hormone Source.1357: DFBPPR17047 ---- Animal proteins ---- Neuromodulin Source.1358: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.1359: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.1360: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.1361: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1 Source.1362: DFBPPR17085 ---- Animal proteins ---- Cadherin-2 Source.1363: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.1364: DFBPPR17090 ---- Animal proteins ---- Phakinin Source.1365: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.1366: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A Source.1367: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.1368: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme Source.1369: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha Source.1370: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2 Source.1371: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2 Source.1372: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.1373: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.1374: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain Source.1375: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.1376: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.1377: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.1378: DFBPPR17198 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.1379: DFBPPR17256 ---- Animal proteins ---- X-box-binding protein 1 Source.1380: DFBPPR17261 ---- Animal proteins ---- NAD-dependent protein lipoamidase sirtuin-4, mitochondrial Source.1381: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33 Source.1382: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.1383: DFBPPR17274 ---- Animal proteins ---- U8 snoRNA-decapping enzyme Source.1384: DFBPPR17279 ---- Animal proteins ---- Stimulator of interferon genes protein Source.1385: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1 Source.1386: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D Source.1387: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.1388: DFBPPR17302 ---- Animal proteins ---- Serine/threonine-protein kinase PAK 1 Source.1389: DFBPPR17313 ---- Animal proteins ---- Exostosin-1 Source.1390: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.1391: DFBPPR17323 ---- Animal proteins ---- Myc proto-oncogene protein Source.1392: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1 Source.1393: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1 Source.1394: DFBPPR17333 ---- Animal proteins ---- Nuclear inhibitor of protein phosphatase 1 Source.1395: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.1396: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI Source.1397: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B Source.1398: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112 Source.1399: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.1400: DFBPPR17352 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 2 Source.1401: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N Source.1402: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog Source.1403: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.1404: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2 Source.1405: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10 Source.1406: DFBPPR17391 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-4 Source.1407: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3 Source.1408: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme Source.1409: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2 Source.1410: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.1411: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1 Source.1412: DFBPPR17425 ---- Animal proteins ---- Dynamin-1 Source.1413: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.1414: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.1415: DFBPPR17439 ---- Animal proteins ---- Folliculin Source.1416: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1417: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.1418: DFBPPR17448 ---- Animal proteins ---- Gap junction alpha-1 protein Source.1419: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1420: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1 Source.1421: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.1422: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.1423: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K Source.1424: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase Source.1425: DFBPPR17484 ---- Animal proteins ---- Histone H1.8 Source.1426: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta Source.1427: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4 Source.1428: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.1429: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.1430: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase Source.1431: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein Source.1432: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1 Source.1433: DFBPPR17534 ---- Animal proteins ---- RISC-loading complex subunit TARBP2 Source.1434: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2 Source.1435: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial Source.1436: DFBPPR17566 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial Source.1437: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1 Source.1438: DFBPPR17570 ---- Animal proteins ---- Clathrin light chain B Source.1439: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.1440: DFBPPR17580 ---- Animal proteins ---- Insulin-like growth factor-binding protein 5 Source.1441: DFBPPR17609 ---- Animal proteins ---- Fructose-1,6-bisphosphatase isozyme 2 Source.1442: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1443: DFBPPR17626 ---- Animal proteins ---- Elastin Source.1444: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.1445: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.1446: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.1447: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2 Source.1448: DFBPPR17713 ---- Animal proteins ---- Urokinase plasminogen activator surface receptor Source.1449: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B Source.1450: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B Source.1451: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.1452: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme Source.1453: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.1454: DFBPPR17757 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.1455: DFBPPR17762 ---- Animal proteins ---- Chloride intracellular channel protein 4 Source.1456: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta Source.1457: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3 Source.1458: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.1459: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.1460: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial Source.1461: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.1462: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2 Source.1463: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha Source.1464: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial Source.1465: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.1466: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3 Source.1467: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase Source.1468: DFBPPR17865 ---- Animal proteins ---- Protein phosphatase 1A Source.1469: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.1470: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.1471: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9 Source.1472: DFBPPR17881 ---- Animal proteins ---- Myoblast determination protein 1 Source.1473: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial Source.1474: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4 Source.1475: DFBPPR17905 ---- Animal proteins ---- DNA endonuclease RBBP8 Source.1476: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A Source.1477: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.1478: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3 Source.1479: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1480: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.1481: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate Source.1482: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.1483: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10 Source.1484: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin Source.1485: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.1486: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.1487: DFBPPR18000 ---- Animal proteins ---- Very-long-chain enoyl-CoA reductase Source.1488: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2 Source.1489: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5 Source.1490: DFBPPR18029 ---- Animal proteins ---- Collagen alpha-3(IV) chain Source.1491: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.1492: DFBPPR18047 ---- Animal proteins ---- ATP synthase F(0) complex subunit C3, mitochondrial Source.1493: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.1494: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12 Source.1495: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.1496: DFBPPR18064 ---- Animal proteins ---- Sperm flagellar protein 1 Source.1497: DFBPPR18067 ---- Animal proteins ---- Metallothionein-1A Source.1498: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.1499: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8 Source.1500: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8 Source.1501: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator Source.1502: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.1503: DFBPPR18088 ---- Animal proteins ---- Aprataxin Source.1504: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.1505: DFBPPR18095 ---- Animal proteins ---- Metallothionein-2 Source.1506: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33 Source.1507: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit Source.1508: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.1509: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.1510: DFBPPR18108 ---- Animal proteins ---- Vesicular glutamate transporter 1 Source.1511: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29 Source.1512: DFBPPR18110 ---- Animal proteins ---- Protein inturned Source.1513: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.1514: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.1515: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.1516: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein Source.1517: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII Source.1518: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.1519: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2 Source.1520: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.1521: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform Source.1522: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5 Source.1523: DFBPPR18208 ---- Animal proteins ---- THO complex subunit 4 Source.1524: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter Source.1525: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2 Source.1526: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.1527: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.1528: DFBPPR18252 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.1529: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7 Source.1530: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.1531: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6 Source.1532: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2 Source.1533: DFBPPR18285 ---- Animal proteins ---- ADP-ribose glycohydrolase OARD1 Source.1534: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20 Source.1535: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C Source.1536: DFBPPR18299 ---- Animal proteins ---- Synapsin-1 Source.1537: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.1538: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2 Source.1539: DFBPPR18326 ---- Animal proteins ---- Metallothionein-1 Source.1540: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor Source.1541: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial Source.1542: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2 Source.1543: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3 Source.1544: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.1545: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.1546: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.1547: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.1548: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z Source.1549: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.1550: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.1551: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.1552: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.1553: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin Source.1554: DFBPPR18447 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease 2 Source.1555: DFBPPR18458 ---- Animal proteins ---- Fatty acid-binding protein, liver Source.1556: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2 Source.1557: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3 Source.1558: DFBPPR18473 ---- Animal proteins ---- Sharpin Source.1559: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial Source.1560: DFBPPR18484 ---- Animal proteins ---- Charged multivesicular body protein 3 Source.1561: DFBPPR18485 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.1562: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7 Source.1563: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor Source.1564: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5 Source.1565: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1 Source.1566: DFBPPR18524 ---- Animal proteins ---- Beta-defensin 5 Source.1567: DFBPPR18526 ---- Animal proteins ---- Beta-defensin 4 Source.1568: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1 Source.1569: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.1570: DFBPPR18555 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 1 Source.1571: DFBPPR18556 ---- Animal proteins ---- Transketolase Source.1572: DFBPPR18559 ---- Animal proteins ---- Kinesin-like protein KIF22 Source.1573: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.1574: DFBPPR18593 ---- Animal proteins ---- Pigment epithelium-derived factor Source.1575: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1 Source.1576: DFBPPR18626 ---- Animal proteins ---- Thymidylate synthase Source.1577: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4 Source.1578: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.1579: DFBPPR18700 ---- Animal proteins ---- Beta-defensin 7 Source.1580: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.1581: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.1582: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7 Source.1583: DFBPPR18742 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor II Source.1584: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.1585: DFBPPR18763 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.1586: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50 Source.1587: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1 Source.1588: DFBPPR18780 ---- Animal proteins ---- Homeobox protein Hox-A3 Source.1589: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4 Source.1590: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4 Source.1591: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav Source.1592: DFBPPR18793 ---- Animal proteins ---- BPI fold-containing family A member 1 Source.1593: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8 Source.1594: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type Source.1595: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5 Source.1596: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1 Source.1597: DFBPPR18812 ---- Animal proteins ---- Vesicle-associated membrane protein 3 Source.1598: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial Source.1599: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.1600: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.1601: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B Source.1602: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.1603: DFBPPR18847 ---- Animal proteins ---- Heme oxygenase 1 Source.1604: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A Source.1605: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.1606: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain Source.1607: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A Source.1608: DFBPPR18868 ---- Animal proteins ---- Haptoglobin Source.1609: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.1610: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.1611: DFBPPR18884 ---- Animal proteins ---- Beta-defensin 3 Source.1612: DFBPPR18885 ---- Animal proteins ---- Beta-defensin 9 Source.1613: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.1614: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4 Source.1615: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED Source.1616: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.1617: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.1618: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108 Source.1619: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2 Source.1620: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.1621: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase Source.1622: DFBPPR18966 ---- Animal proteins ---- Lupus La protein homolog Source.1623: DFBPPR18970 ---- Animal proteins ---- Mitochondrial fission 1 protein Source.1624: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5 Source.1625: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74 Source.1626: DFBPPR19002 ---- Animal proteins ---- Mitochondrial basic amino acids transporter Source.1627: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746 Source.1628: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D Source.1629: DFBPPR19029 ---- Animal proteins ---- Homeobox protein Hox-B4 Source.1630: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain Source.1631: DFBPPR19037 ---- Animal proteins ---- Transthyretin Source.1632: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.1633: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E Source.1634: DFBPPR19065 ---- Animal proteins ---- Cadherin-6 Source.1635: DFBPPR19073 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 21 Source.1636: DFBPPR19076 ---- Animal proteins ---- Protein MGARP Source.1637: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1 Source.1638: DFBPPR19080 ---- Animal proteins ---- Beta-defensin 11 Source.1639: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1 Source.1640: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2 Source.1641: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain Source.1642: DFBPPR19131 ---- Animal proteins ---- Nectin-4 Source.1643: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2 Source.1644: DFBPPR19172 ---- Animal proteins ---- Persulfide dioxygenase ETHE1, mitochondrial Source.1645: DFBPPR19176 ---- Animal proteins ---- Collagen alpha-2(IV) chain Source.1646: DFBPPR19181 ---- Animal proteins ---- Solute carrier family 25 member 33 Source.1647: DFBPPR19184 ---- Animal proteins ---- Alpha-soluble NSF attachment protein Source.1648: DFBPPR19197 ---- Animal proteins ---- Protein LSM14 homolog A Source.1649: DFBPPR19208 ---- Animal proteins ---- Sushi repeat-containing protein SRPX2 Source.1650: DFBPPR19209 ---- Animal proteins ---- mRNA export factor Source.1651: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6 Source.1652: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha Source.1653: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase Source.1654: DFBPPR19237 ---- Animal proteins ---- Cadherin-18 Source.1655: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.1656: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.1657: DFBPPR19254 ---- Animal proteins ---- Periaxin Source.1658: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3 Source.1659: DFBPPR19264 ---- Animal proteins ---- Claudin-16 Source.1660: DFBPPR19269 ---- Animal proteins ---- HCLS1-associated protein X-1 Source.1661: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33 Source.1662: DFBPPR19287 ---- Animal proteins ---- Rab-like protein 3 Source.1663: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D Source.1664: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1 Source.1665: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.1666: DFBPPR19313 ---- Animal proteins ---- Vitamin K epoxide reductase complex subunit 1 Source.1667: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB Source.1668: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal Source.1669: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1 Source.1670: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD Source.1671: DFBPPR19351 ---- Animal proteins ---- Caveolae-associated protein 3 Source.1672: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.1673: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.1674: DFBPPR19362 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 5 Source.1675: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1 Source.1676: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor Source.1677: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1 Source.1678: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71 Source.1679: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.1680: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.1681: DFBPPR19451 ---- Animal proteins ---- Proline/serine-rich coiled-coil protein 1 Source.1682: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2 Source.1683: DFBPPR19471 ---- Animal proteins ---- Ribosome biogenesis protein WDR12 Source.1684: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.1685: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.1686: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73 Source.1687: DFBPPR19501 ---- Animal proteins ---- CD320 antigen Source.1688: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.1689: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2 Source.1690: DFBPPR19519 ---- Animal proteins ---- DnaJ homolog subfamily C member 24 Source.1691: DFBPPR19522 ---- Animal proteins ---- PCNA-associated factor Source.1692: DFBPPR19525 ---- Animal proteins ---- Tomoregulin-2 Source.1693: DFBPPR19529 ---- Animal proteins ---- Cbp/p300-interacting transactivator 1 Source.1694: DFBPPR19530 ---- Animal proteins ---- Tuftelin Source.1695: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.1696: DFBPPR19538 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A1, mitochondrial Source.1697: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9 Source.1698: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial Source.1699: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B Source.1700: DFBPPR19574 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit 2 Source.1701: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.1702: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2 Source.1703: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.1704: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2 Source.1705: DFBPPR19617 ---- Animal proteins ---- Suppressor of cytokine signaling 2 Source.1706: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1 Source.1707: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5 Source.1708: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2 Source.1709: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta Source.1710: DFBPPR19627 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain Source.1711: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3 Source.1712: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform Source.1713: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.1714: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2 Source.1715: DFBPPR19675 ---- Animal proteins ---- INO80 complex subunit E Source.1716: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A Source.1717: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.1718: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3 Source.1719: DFBPPR19713 ---- Animal proteins ---- Shadow of prion protein Source.1720: DFBPPR19722 ---- Animal proteins ---- Cdc42 effector protein 1 Source.1721: DFBPPR19724 ---- Animal proteins ---- Lingual antimicrobial peptide Source.1722: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.1723: DFBPPR19735 ---- Animal proteins ---- Complement component C7 Source.1724: DFBPPR19748 ---- Animal proteins ---- 60S ribosomal protein L23 Source.1725: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.1726: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1 Source.1727: DFBPPR19765 ---- Animal proteins ---- Pulmonary surfactant-associated protein C Source.1728: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1 Source.1729: DFBPPR19768 ---- Animal proteins ---- Peroxynitrite isomerase THAP4 Source.1730: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase Source.1731: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma Source.1732: DFBPPR19794 ---- Animal proteins ---- Bone morphogenetic protein 15 Source.1733: DFBPPR19804 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 2 Source.1734: DFBPPR19810 ---- Animal proteins ---- Seipin Source.1735: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2 Source.1736: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog Source.1737: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial Source.1738: DFBPPR19828 ---- Animal proteins ---- Transmembrane protein 14C Source.1739: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3 Source.1740: DFBPPR19837 ---- Animal proteins ---- Ribonuclease P protein subunit p30 Source.1741: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5 Source.1742: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.1743: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2 Source.1744: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2 Source.1745: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.1746: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.1747: DFBPPR19882 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.1748: DFBPPR19897 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial Source.1749: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase Source.1750: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6 Source.1751: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.1752: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2 Source.1753: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80 Source.1754: DFBPPR19944 ---- Animal proteins ---- Histone H1.0 Source.1755: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40 Source.1756: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14 Source.1757: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z Source.1758: DFBPPR19997 ---- Animal proteins ---- Anaphase-promoting complex subunit 16 Source.1759: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer Source.1760: DFBPPR20006 ---- Animal proteins ---- Protein Abitram Source.1761: DFBPPR20010 ---- Animal proteins ---- Craniofacial development protein 1 Source.1762: DFBPPR20020 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3 Source.1763: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.1764: DFBPPR20036 ---- Animal proteins ---- Urocortin-3 Source.1765: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta Source.1766: DFBPPR20038 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 20 Source.1767: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1 Source.1768: DFBPPR20058 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2 Source.1769: DFBPPR20061 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 8 Source.1770: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein Source.1771: DFBPPR20074 ---- Animal proteins ---- Target of EGR1 protein 1 Source.1772: DFBPPR20075 ---- Animal proteins ---- UBX domain-containing protein 4 Source.1773: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.1774: DFBPPR20083 ---- Animal proteins ---- GPN-loop GTPase 1 Source.1775: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.1776: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2 Source.1777: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C Source.1778: DFBPPR20148 ---- Animal proteins ---- Integrin-linked kinase-associated serine/threonine phosphatase 2C Source.1779: DFBPPR20163 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G6f Source.1780: DFBPPR20167 ---- Animal proteins ---- Protein BANP Source.1781: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta Source.1782: DFBPPR20177 ---- Animal proteins ---- TIMELESS-interacting protein Source.1783: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12 Source.1784: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2 Source.1785: DFBPPR20187 ---- Animal proteins ---- Nitric oxide synthase-interacting protein Source.1786: DFBPPR20197 ---- Animal proteins ---- Ribonuclease P protein subunit p20 Source.1787: DFBPPR20199 ---- Animal proteins ---- Claudin-7 Source.1788: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6 Source.1789: DFBPPR20209 ---- Animal proteins ---- Ran-specific GTPase-activating protein Source.1790: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B Source.1791: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2 Source.1792: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase Source.1793: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3 Source.1794: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1 Source.1795: DFBPPR20254 ---- Animal proteins ---- Leukemia inhibitory factor Source.1796: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1 Source.1797: DFBPPR20261 ---- Animal proteins ---- Protein SCO1 homolog, mitochondrial Source.1798: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial Source.1799: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214 Source.1800: DFBPPR20289 ---- Animal proteins ---- Di-N-acetylchitobiase Source.1801: DFBPPR20301 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 3 Source.1802: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3 Source.1803: DFBPPR20306 ---- Animal proteins ---- Gamma-sarcoglycan Source.1804: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.1805: DFBPPR20312 ---- Animal proteins ---- 39S ribosomal protein L52, mitochondrial Source.1806: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel Source.1807: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.1808: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14 Source.1809: DFBPPR20339 ---- Animal proteins ---- 28S ribosomal protein S23, mitochondrial Source.1810: DFBPPR20356 ---- Animal proteins ---- RNA-binding protein 7 Source.1811: DFBPPR20357 ---- Animal proteins ---- Snurportin-1 Source.1812: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta Source.1813: DFBPPR20364 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3 Source.1814: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4 Source.1815: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.1816: DFBPPR20386 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59 Source.1817: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7 Source.1818: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2 Source.1819: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.1820: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2 Source.1821: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2 Source.1822: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1823: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein Source.1824: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein Source.1825: DFBPPR20432 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 4 Source.1826: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1 Source.1827: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile Source.1828: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1 Source.1829: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1 Source.1830: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10 Source.1831: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102 Source.1832: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42 Source.1833: DFBPPR20536 ---- Animal proteins ---- Trophoblast Kunitz domain protein 1 Source.1834: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6 Source.1835: DFBPPR20550 ---- Animal proteins ---- G-protein coupled receptor family C group 6 member A Source.1836: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3 Source.1837: DFBPPR20560 ---- Animal proteins ---- Draxin Source.1838: DFBPPR20564 ---- Animal proteins ---- Ras-related protein Rab-26 Source.1839: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta Source.1840: DFBPPR20591 ---- Animal proteins ---- WD repeat-containing protein 74 Source.1841: DFBPPR20597 ---- Animal proteins ---- Protein FAM162A Source.1842: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1 Source.1843: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2 Source.1844: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56 Source.1845: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10 Source.1846: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog Source.1847: DFBPPR20613 ---- Animal proteins ---- Gamma-crystallin D Source.1848: DFBPPR20633 ---- Animal proteins ---- Transmembrane protein 47 Source.1849: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.1850: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A Source.1851: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.1852: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2 Source.1853: DFBPPR20692 ---- Animal proteins ---- ELMO domain-containing protein 3 Source.1854: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.1855: DFBPPR20700 ---- Animal proteins ---- General transcription factor IIE subunit 1 Source.1856: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial Source.1857: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2 Source.1858: DFBPPR20725 ---- Animal proteins ---- RBPJ-interacting and tubulin-associated protein 1 Source.1859: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11 Source.1860: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1 Source.1861: DFBPPR20754 ---- Animal proteins ---- Transcription factor Maf Source.1862: DFBPPR20760 ---- Animal proteins ---- Beta-defensin C7 Source.1863: DFBPPR20792 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 17 Source.1864: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase Source.1865: DFBPPR20806 ---- Animal proteins ---- Transcriptional adapter 1 Source.1866: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13 Source.1867: DFBPPR20816 ---- Animal proteins ---- Ribosomal L1 domain-containing protein 1 Source.1868: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.1869: DFBPPR20829 ---- Animal proteins ---- Phospholipid phosphatase 6 Source.1870: DFBPPR20837 ---- Animal proteins ---- Keratin, type I cytoskeletal 27 Source.1871: DFBPPR20843 ---- Animal proteins ---- ARL14 effector protein Source.1872: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.1873: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial Source.1874: DFBPPR20866 ---- Animal proteins ---- PRKR-interacting protein 1 Source.1875: DFBPPR20881 ---- Animal proteins ---- Filamin-binding LIM protein 1 Source.1876: DFBPPR20885 ---- Animal proteins ---- Zinc transporter ZIP3 Source.1877: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.1878: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.1879: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.1880: DFBPPR20924 ---- Animal proteins ---- Cyclin-dependent kinase 2-associated protein 2 Source.1881: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8 Source.1882: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4 Source.1883: DFBPPR20937 ---- Animal proteins ---- Leucine-rich repeat-containing protein 25 Source.1884: DFBPPR20940 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.1885: DFBPPR20948 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 9 Source.1886: DFBPPR20967 ---- Animal proteins ---- Phosducin-like protein Source.1887: DFBPPR20972 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP11 Source.1888: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5 Source.1889: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.1890: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1 Source.1891: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2 Source.1892: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17 Source.1893: DFBPPR21022 ---- Animal proteins ---- Transmembrane 4 L6 family member 5 Source.1894: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein Source.1895: DFBPPR21038 ---- Animal proteins ---- Sodium channel modifier 1 Source.1896: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28 Source.1897: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter Source.1898: DFBPPR21069 ---- Animal proteins ---- Nuclear transcription factor Y subunit gamma Source.1899: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.1900: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.1901: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6 Source.1902: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43 Source.1903: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein Source.1904: DFBPPR21106 ---- Animal proteins ---- 40S ribosomal protein S10 Source.1905: DFBPPR21108 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.1906: DFBPPR21111 ---- Animal proteins ---- Zinc finger protein-like 1 Source.1907: DFBPPR21116 ---- Animal proteins ---- Suppressor of cytokine signaling 5 Source.1908: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier Source.1909: DFBPPR21166 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1 Source.1910: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.1911: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial Source.1912: DFBPPR21181 ---- Animal proteins ---- Calpastatin Source.1913: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3 Source.1914: DFBPPR21250 ---- Animal proteins ---- Enteric beta-defensin Source.1915: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7 Source.1916: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2 Source.1917: DFBPPR21259 ---- Animal proteins ---- Elongation factor 1-delta Source.1918: DFBPPR21272 ---- Animal proteins ---- Testin Source.1919: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein Source.1920: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1 Source.1921: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3 Source.1922: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15 Source.1923: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein Source.1924: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C Source.1925: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein Source.1926: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.1927: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2 Source.1928: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2 Source.1929: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B Source.1930: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.1931: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1 Source.1932: DFBPPR21396 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM6 homolog Source.1933: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1 Source.1934: DFBPPR21430 ---- Animal proteins ---- Calmodulin regulator protein PCP4 Source.1935: DFBPPR21436 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1A Source.1936: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1 Source.1937: DFBPPR21454 ---- Animal proteins ---- Cyclin-dependent kinase 2-interacting protein Source.1938: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163 Source.1939: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein Source.1940: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.1941: DFBPPR21490 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.1942: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.1943: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1 Source.1944: DFBPPR21526 ---- Animal proteins ---- Interferon alpha-inducible protein 27-like protein 2 Source.1945: DFBPPR21545 ---- Animal proteins ---- Musculoskeletal embryonic nuclear protein 1 Source.1946: DFBPPR21547 ---- Animal proteins ---- Osteoclast-stimulating factor 1 Source.1947: DFBPPR21557 ---- Animal proteins ---- WD repeat-containing protein 55 Source.1948: DFBPPR21567 ---- Animal proteins ---- NIF3-like protein 1 Source.1949: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A Source.1950: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4 Source.1951: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma Source.1952: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3 Source.1953: DFBPPR21637 ---- Animal proteins ---- 60S acidic ribosomal protein P2 Source.1954: DFBPPR21641 ---- Animal proteins ---- U5 small nuclear ribonucleoprotein 40 kDa protein Source.1955: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein Source.1956: DFBPPR21648 ---- Animal proteins ---- Keratin, type I cytoskeletal 26 Source.1957: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11 Source.1958: DFBPPR21668 ---- Animal proteins ---- Putative deoxyribonuclease TATDN1 Source.1959: DFBPPR21678 ---- Animal proteins ---- Transmembrane protein 35A Source.1960: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1 Source.1961: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase Source.1962: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.1963: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.1964: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15 Source.1965: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2 Source.1966: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8 Source.1967: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1 Source.1968: DFBPPR21754 ---- Animal proteins ---- BLOC-1-related complex subunit 6 Source.1969: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1 Source.1970: DFBPPR21761 ---- Animal proteins ---- NADH dehydrogenase (ubiquinone) complex I, assembly factor 6 Source.1971: DFBPPR21765 ---- Animal proteins ---- DDB1- and CUL4-associated factor 12 Source.1972: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.1973: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4 Source.1974: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.1975: DFBPPR21782 ---- Animal proteins ---- Surfactant-associated protein 2 Source.1976: DFBPPR21787 ---- Animal proteins ---- PRA1 family protein 2 Source.1977: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.1978: DFBPPR21806 ---- Animal proteins ---- Keratin, type II cuticular Hb1 Source.1979: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1 Source.1980: DFBPPR21813 ---- Animal proteins ---- Ribosomal RNA processing protein 36 homolog Source.1981: DFBPPR21818 ---- Animal proteins ---- Zinc finger protein 410 Source.1982: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750 Source.1983: DFBPPR21847 ---- Animal proteins ---- Protein Mpv17 Source.1984: DFBPPR21861 ---- Animal proteins ---- Succinate dehydrogenase assembly factor 3, mitochondrial Source.1985: DFBPPR21873 ---- Animal proteins ---- Vitrin Source.1986: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2 Source.1987: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor Source.1988: DFBPPR21891 ---- Animal proteins ---- 39S ribosomal protein L54, mitochondrial Source.1989: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog Source.1990: DFBPPR21920 ---- Animal proteins ---- Protein DPCD Source.1991: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog Source.1992: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1 Source.1993: DFBPPR21945 ---- Animal proteins ---- Dermokine Source.1994: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48 Source.1995: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor Source.1996: DFBPPR21957 ---- Animal proteins ---- LIM domain transcription factor LMO4 Source.1997: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.1998: DFBPPR21981 ---- Animal proteins ---- Polyamine-modulated factor 1 Source.1999: DFBPPR21984 ---- Animal proteins ---- Leucine-rich repeat-containing protein 10 Source.2000: DFBPPR21992 ---- Animal proteins ---- Intraflagellar transport-associated protein Source.2001: DFBPPR22013 ---- Animal proteins ---- DDB1- and CUL4-associated factor 4 Source.2002: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3 Source.2003: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.2004: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma Source.2005: DFBPPR22066 ---- Animal proteins ---- Pyridoxal phosphate homeostasis protein Source.2006: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512 Source.2007: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41 Source.2008: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2 Source.2009: DFBPPR22110 ---- Animal proteins ---- Nucleolar protein 12 Source.2010: DFBPPR22111 ---- Animal proteins ---- Homeobox protein Hox-A5 Source.2011: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein Source.2012: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog Source.2013: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2 Source.2014: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31 Source.2015: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1 Source.2016: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1 Source.2017: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5 Source.2018: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.2019: DFBPPR22199 ---- Animal proteins ---- SCAN domain-containing protein 1 Source.2020: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.2021: DFBPPR22211 ---- Animal proteins ---- Ribonuclease P protein subunit p25-like protein Source.2022: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein Source.2023: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1 Source.2024: DFBPPR22229 ---- Animal proteins ---- Spermatogenesis-associated protein 22 Source.2025: DFBPPR22245 ---- Animal proteins ---- Thyroid transcription factor 1-associated protein 26 Source.2026: DFBPPR22276 ---- Animal proteins ---- Protein MEMO1 Source.2027: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2 Source.2028: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A Source.2029: DFBPPR22312 ---- Animal proteins ---- BolA-like protein 1 Source.2030: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like Source.2031: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2 Source.2032: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7 Source.2033: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B Source.2034: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6 Source.2035: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1 Source.2036: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180 Source.2037: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal Source.2038: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92 Source.2039: DFBPPR22374 ---- Animal proteins ---- Cysteine-rich protein 2 Source.2040: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.2041: DFBPPR22400 ---- Animal proteins ---- Stromal cell-derived factor 2-like protein 1 Source.2042: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog Source.2043: DFBPPR22408 ---- Animal proteins ---- Serine-rich coiled-coil domain-containing protein 1 Source.2044: DFBPPR22412 ---- Animal proteins ---- PHD finger protein 20-like protein 1 Source.2045: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2 Source.2046: DFBPPR22450 ---- Animal proteins ---- Leucine-rich single-pass membrane protein 1 Source.2047: DFBPPR22469 ---- Animal proteins ---- Protein FAM136A Source.2048: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1 Source.2049: DFBPPR22478 ---- Animal proteins ---- Trichohyalin-like protein 1 Source.2050: DFBPPR22512 ---- Animal proteins ---- IQ domain-containing protein C Source.2051: DFBPPR22516 ---- Animal proteins ---- Transmembrane protein 141 Source.2052: DFBPPR22526 ---- Animal proteins ---- Testis-expressed protein 29 Source.2053: DFBPPR22529 ---- Animal proteins ---- Purkinje cell protein 4-like protein 1 Source.2054: DFBPPR22536 ---- Animal proteins ---- Suprabasin Source.2055: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.2056: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B Source.2057: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog Source.2058: DFBPPR22587 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog Source.2059: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B Source.2060: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4 Source.2061: DFBPPR22643 ---- Animal proteins ---- Coiled-coil domain-containing protein 157 Source.2062: DFBPPR22657 ---- Animal proteins ---- Protein FAM110D Source.2063: DFBPPR22663 ---- Animal proteins ---- Erythrodihydroneopterin triphosphate synthetase Source.2064: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog Source.2065: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32 Source.2066: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog Source.2067: DFBPPR22690 ---- Animal proteins ---- Proline-rich protein 19 Source.2068: DFBPPR22700 ---- Animal proteins ---- Protein FAM89A Source.2069: DFBPPR22703 ---- Animal proteins ---- Arrestin domain-containing protein 5 Source.2070: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16 Source.2071: DFBPPR22719 ---- Animal proteins ---- Uncharacterized protein C12orf45 homolog Source.2072: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog Source.2073: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2074: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4 Source.2075: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase Source.2076: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.2077: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.2078: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2 Source.2079: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1 Source.2080: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.2081: DFBPPR8560 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial Source.2082: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.2083: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.2084: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.2085: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha Source.2086: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1 Source.2087: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4 Source.2088: DFBPPR8604 ---- Animal proteins ---- Alpha-synuclein Source.2089: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.2090: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B Source.2091: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.2092: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.2093: DFBPPR8625 ---- Animal proteins ---- Appetite-regulating hormone Source.2094: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.2095: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase Source.2096: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.2097: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein Source.2098: DFBPPR8669 ---- Animal proteins ---- Heme oxygenase 1 Source.2099: DFBPPR8683 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn] Source.2100: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.2101: DFBPPR8686 ---- Animal proteins ---- NAD(+) hydrolase SARM1 Source.2102: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.2103: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI Source.2104: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.2105: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase Source.2106: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor Source.2107: DFBPPR8739 ---- Animal proteins ---- Metallothionein-3 Source.2108: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1 Source.2109: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.2110: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase Source.2111: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.2112: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2113: DFBPPR8757 ---- Animal proteins ---- Gap junction alpha-1 protein Source.2114: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.2115: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.2116: DFBPPR8766 ---- Animal proteins ---- Myoblast determination protein 1 Source.2117: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.2118: DFBPPR8775 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.2119: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.2120: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.2121: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.2122: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.2123: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.2124: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.2125: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase Source.2126: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4 Source.2127: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.2128: DFBPPR8846 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6 Source.2129: DFBPPR8865 ---- Animal proteins ---- Haptoglobin Source.2130: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor Source.2131: DFBPPR8898 ---- Animal proteins ---- NAD(P)H-hydrate epimerase Source.2132: DFBPPR8899 ---- Animal proteins ---- Thyroid hormone receptor alpha Source.2133: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.2134: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.2135: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.2136: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.2137: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.2138: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1 Source.2139: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.2140: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.2141: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.2142: DFBPPR9016 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.2143: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.2144: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta Source.2145: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A Source.2146: DFBPPR9058 ---- Animal proteins ---- Metallothionein-2A Source.2147: DFBPPR9062 ---- Animal proteins ---- Methylsterol monooxygenase 1 Source.2148: DFBPPR9064 ---- Animal proteins ---- Metallothionein-1A Source.2149: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.2150: DFBPPR9078 ---- Animal proteins ---- Neurofilament medium polypeptide Source.2151: DFBPPR9087 ---- Animal proteins ---- CD59 glycoprotein Source.2152: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta Source.2153: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.2154: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.2155: DFBPPR9121 ---- Animal proteins ---- Endoplasmin Source.2156: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.2157: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2158: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.2159: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.2160: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.2161: DFBPPR9158 ---- Animal proteins ---- Interferon-stimulated gene 20 kDa protein Source.2162: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.2163: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.2164: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2165: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase Source.2166: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.2167: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.2168: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase Source.2169: DFBPPR9199 ---- Animal proteins ---- 60S ribosomal protein L23 Source.2170: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII Source.2171: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.2172: DFBPPR9221 ---- Animal proteins ---- Catalase Source.2173: DFBPPR9228 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.2174: DFBPPR9235 ---- Animal proteins ---- Apomucin Source.2175: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 Source.2176: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4 Source.2177: DFBPPR9306 ---- Animal proteins ---- Complement component C7 Source.2178: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor Source.2179: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase Source.2180: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1 Source.2181: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1 Source.2182: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.2183: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.2184: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor Source.2185: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein Source.2186: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.2187: DFBPPR9388 ---- Animal proteins ---- Metallothionein-2B Source.2188: DFBPPR9389 ---- Animal proteins ---- Metallothionein-1E Source.2189: DFBPPR9390 ---- Animal proteins ---- Metallothionein-1F Source.2190: DFBPPR9392 ---- Animal proteins ---- mRNA export factor Source.2191: DFBPPR9404 ---- Animal proteins ---- Tryptase Source.2192: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.2193: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.2194: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2 Source.2195: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha Source.2196: DFBPPR9425 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase Source.2197: DFBPPR9428 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.2198: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.2199: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2 Source.2200: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.2201: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.2202: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B Source.2203: DFBPPR9453 ---- Animal proteins ---- Metallothionein-1C Source.2204: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.2205: DFBPPR9496 ---- Animal proteins ---- C-X-C motif chemokine 16 Source.2206: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6 Source.2207: DFBPPR9538 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.2208: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic Source.2209: DFBPPR9551 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3 Source.2210: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2 Source.2211: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1 Source.2212: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.2213: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.2214: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.2215: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.2216: DFBPPR9626 ---- Animal proteins ---- Adenylyl cyclase-associated protein 1 Source.2217: DFBPPR9643 ---- Animal proteins ---- Apolipoprotein M Source.2218: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6 Source.2219: DFBPPR9660 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2 Source.2220: DFBPPR9683 ---- Animal proteins ---- Calpastatin Source.2221: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein Source.2222: DFBPPR9696 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1 Source.2223: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.2224: DFBPPR9713 ---- Animal proteins ---- Hepcidin Source.2225: DFBPPR9719 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.2226: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2 Source.2227: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial Source.2228: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2229: DFBPPR9762 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.2230: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.2231: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha Source.2232: DFBPPR9791 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.2233: DFBPPR9808 ---- Animal proteins ---- Epidermal growth factor-like protein 8 Source.2234: DFBPPR9814 ---- Animal proteins ---- Testin Source.2235: DFBPPR9818 ---- Animal proteins ---- Calpain-7 Source.2236: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.2237: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2238: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3 Source.2239: DFBPPR9843 ---- Animal proteins ---- P protein Source.2240: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1 Source.2241: DFBPPR9862 ---- Animal proteins ---- Osteoclast-stimulating factor 1 Source.2242: DFBPPR9867 ---- Animal proteins ---- Phostensin Source.2243: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17 Source.2244: DFBPPR9890 ---- Animal proteins ---- 60S acidic ribosomal protein P2 Source.2245: DFBPPR9938 ---- Animal proteins ---- FUN14 domain-containing protein 2 Source.2246: DFBPPR9953 ---- Animal proteins ---- Gallinacin-1 alpha Source.2247: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.2248: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2249: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor Source.2250: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain Source.2251: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.2252: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit Source.2253: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL Source.2254: DFBPPR10004 ---- Animal proteins ---- Spastin Source.2255: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b Source.2256: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16 Source.2257: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.2258: DFBPPR10016 ---- Animal proteins ---- High mobility group protein B2 Source.2259: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog Source.2260: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116 Source.2261: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3 Source.2262: DFBPPR10061 ---- Animal proteins ---- Ovocleidin-17 Source.2263: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9 Source.2264: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.2265: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase Source.2266: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type Source.2267: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.2268: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog Source.2269: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.2270: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.2271: DFBPPR10121 ---- Animal proteins ---- Fibroblast growth factor 2 Source.2272: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3 Source.2273: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.2274: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.2275: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1 Source.2276: DFBPPR10142 ---- Animal proteins ---- Calpain-3 Source.2277: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.2278: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.2279: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos Source.2280: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1 Source.2281: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3 Source.2282: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.2283: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.2284: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.2285: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.2286: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5 Source.2287: DFBPPR10222 ---- Animal proteins ---- Podocalyxin Source.2288: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2 Source.2289: DFBPPR10270 ---- Animal proteins ---- Agrin Source.2290: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2 Source.2291: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.2292: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.2293: DFBPPR10298 ---- Animal proteins ---- Caldesmon Source.2294: DFBPPR10303 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.2295: DFBPPR10311 ---- Animal proteins ---- Homeobox protein engrailed-2 Source.2296: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme Source.2297: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.2298: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7 Source.2299: DFBPPR10325 ---- Animal proteins ---- Alpha-crystallin B chain Source.2300: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.2301: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.2302: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.2303: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel Source.2304: DFBPPR10361 ---- Animal proteins ---- Protein HIRA Source.2305: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.2306: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1 Source.2307: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type Source.2308: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2 Source.2309: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.2310: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65 Source.2311: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.2312: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf Source.2313: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1 Source.2314: DFBPPR10401 ---- Animal proteins ---- Heparanase Source.2315: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.2316: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.2317: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.2318: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.2319: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor Source.2320: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.2321: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2 Source.2322: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.2323: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.2324: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3 Source.2325: DFBPPR10459 ---- Animal proteins ---- Reelin Source.2326: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.2327: DFBPPR10467 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.2328: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1 Source.2329: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.2330: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21 Source.2331: DFBPPR10473 ---- Animal proteins ---- Gallinacin-1 Source.2332: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1 Source.2333: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.2334: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein Source.2335: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6 Source.2336: DFBPPR10490 ---- Animal proteins ---- Tudor-interacting repair regulator protein Source.2337: DFBPPR10494 ---- Animal proteins ---- Interferon lambda receptor 1 Source.2338: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.2339: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.2340: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase Source.2341: DFBPPR10535 ---- Animal proteins ---- Protein SPT2 homolog Source.2342: DFBPPR10536 ---- Animal proteins ---- Inhibin beta B chain Source.2343: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C Source.2344: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor Source.2345: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3 Source.2346: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.2347: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial Source.2348: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.2349: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.2350: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.2351: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.2352: DFBPPR10562 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 2 Source.2353: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1 Source.2354: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein Source.2355: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.2356: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.2357: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit Source.2358: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1 Source.2359: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.2360: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.2361: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog Source.2362: DFBPPR10616 ---- Animal proteins ---- Cholecystokinin Source.2363: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2 Source.2364: DFBPPR10620 ---- Animal proteins ---- Centromere protein T Source.2365: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit Source.2366: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.2367: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.2368: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B Source.2369: DFBPPR10645 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 5 Source.2370: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.2371: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1 Source.2372: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.2373: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.2374: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1 Source.2375: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.2376: DFBPPR10703 ---- Animal proteins ---- Tensin Source.2377: DFBPPR10711 ---- Animal proteins ---- Endonuclease III-like protein 1 Source.2378: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.2379: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2 Source.2380: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.2381: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha Source.2382: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3 Source.2383: DFBPPR10765 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2 Source.2384: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2385: DFBPPR10769 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.2386: DFBPPR10770 ---- Animal proteins ---- Mannose-binding protein Source.2387: DFBPPR10776 ---- Animal proteins ---- GTP cyclohydrolase 1 Source.2388: DFBPPR10786 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase radical fringe Source.2389: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B Source.2390: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A Source.2391: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.2392: DFBPPR10812 ---- Animal proteins ---- Cadherin-11 Source.2393: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.2394: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain Source.2395: DFBPPR10841 ---- Animal proteins ---- Gallinacin-13 Source.2396: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein Source.2397: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.2398: DFBPPR10851 ---- Animal proteins ---- Wee1-like protein kinase 2 Source.2399: DFBPPR10852 ---- Animal proteins ---- Wee1-like protein kinase 2 Source.2400: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.2401: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.2402: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7 Source.2403: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.2404: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha' Source.2405: DFBPPR10892 ---- Animal proteins ---- Myogenic factor 5 Source.2406: DFBPPR10902 ---- Animal proteins ---- Metallothionein Source.2407: DFBPPR10904 ---- Animal proteins ---- Signal transducing adapter molecule 2 Source.2408: DFBPPR10908 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.2409: DFBPPR10911 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.2410: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1 Source.2411: DFBPPR10925 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1 Source.2412: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1 Source.2413: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.2414: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2 Source.2415: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y Source.2416: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like Source.2417: DFBPPR10960 ---- Animal proteins ---- Myristoylated alanine-rich C-kinase substrate Source.2418: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.2419: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1 Source.2420: DFBPPR10987 ---- Animal proteins ---- Charged multivesicular body protein 6 Source.2421: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2 Source.2422: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.2423: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.2424: DFBPPR10996 ---- Animal proteins ---- Semaphorin-4D Source.2425: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D Source.2426: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.2427: DFBPPR11018 ---- Animal proteins ---- Transcriptional coactivator YAP1 Source.2428: DFBPPR11019 ---- Animal proteins ---- Cadherin-4 Source.2429: DFBPPR11024 ---- Animal proteins ---- Gap junction alpha-1 protein Source.2430: DFBPPR11028 ---- Animal proteins ---- Interleukin-6 Source.2431: DFBPPR11035 ---- Animal proteins ---- Protein Dr1 Source.2432: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2 Source.2433: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase Source.2434: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase Source.2435: DFBPPR11058 ---- Animal proteins ---- Proteasome subunit beta type-5 Source.2436: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.2437: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1 Source.2438: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.2439: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase Source.2440: DFBPPR11094 ---- Animal proteins ---- Transcription factor MafA Source.2441: DFBPPR11099 ---- Animal proteins ---- Acylphosphatase-1 Source.2442: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A Source.2443: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2 Source.2444: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1 Source.2445: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma Source.2446: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1 Source.2447: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1 Source.2448: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B Source.2449: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1 Source.2450: DFBPPR11194 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.2451: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1 Source.2452: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T Source.2453: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2 Source.2454: DFBPPR11219 ---- Animal proteins ---- Cytospin-A Source.2455: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.2456: DFBPPR11226 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K Source.2457: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1 Source.2458: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED Source.2459: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog Source.2460: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1 Source.2461: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6 Source.2462: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.2463: DFBPPR11272 ---- Animal proteins ---- Iroquois-class homeodomain protein IRX-4 Source.2464: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15 Source.2465: DFBPPR11276 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 5 Source.2466: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42 Source.2467: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.2468: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2 Source.2469: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5 Source.2470: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1 Source.2471: DFBPPR11304 ---- Animal proteins ---- Vitamin D3 hydroxylase-associated protein Source.2472: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6 Source.2473: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2 Source.2474: DFBPPR11317 ---- Animal proteins ---- Dickkopf-related protein 3 Source.2475: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.2476: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.2477: DFBPPR11331 ---- Animal proteins ---- Homeobox protein Hox-A4 Source.2478: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog Source.2479: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3 Source.2480: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.2481: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.2482: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8 Source.2483: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.2484: DFBPPR11356 ---- Animal proteins ---- Homeobox protein AKR Source.2485: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3 Source.2486: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2 Source.2487: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Source.2488: DFBPPR11376 ---- Animal proteins ---- Lamin-A Source.2489: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.2490: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1 Source.2491: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B Source.2492: DFBPPR11397 ---- Animal proteins ---- Frizzled-3 Source.2493: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1 Source.2494: DFBPPR11407 ---- Animal proteins ---- RAD52 motif-containing protein 1 Source.2495: DFBPPR11424 ---- Animal proteins ---- ATP-dependent RNA helicase DDX55 Source.2496: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1 Source.2497: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.2498: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator Source.2499: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48 Source.2500: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.2501: DFBPPR11466 ---- Animal proteins ---- GDNF family receptor alpha-2 Source.2502: DFBPPR11471 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 11 Source.2503: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4 Source.2504: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5 Source.2505: DFBPPR11479 ---- Animal proteins ---- Rab-like protein 3 Source.2506: DFBPPR11500 ---- Animal proteins ---- Ovalbumin-related protein X Source.2507: DFBPPR11506 ---- Animal proteins ---- Homeobox protein BarH-like 1b Source.2508: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13 Source.2509: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A Source.2510: DFBPPR11531 ---- Animal proteins ---- Protein AATF Source.2511: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD Source.2512: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2 Source.2513: DFBPPR11548 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit DAD1 Source.2514: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.2515: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70 Source.2516: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic Source.2517: DFBPPR11567 ---- Animal proteins ---- Ovocalyxin-32 Source.2518: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.2519: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1 Source.2520: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1 Source.2521: DFBPPR11581 ---- Animal proteins ---- PRKR-interacting protein 1 homolog Source.2522: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.2523: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.2524: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4 Source.2525: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43 Source.2526: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.2527: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.2528: DFBPPR11670 ---- Animal proteins ---- Snurportin-1 Source.2529: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1 Source.2530: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1 Source.2531: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog Source.2532: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.2533: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.2534: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.2535: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.2536: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D Source.2537: DFBPPR11722 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.2538: DFBPPR11724 ---- Animal proteins ---- Protein TENP Source.2539: DFBPPR11725 ---- Animal proteins ---- D-dopachrome decarboxylase Source.2540: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61 Source.2541: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa Source.2542: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3 Source.2543: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein Source.2544: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid Source.2545: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.2546: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.2547: DFBPPR11799 ---- Animal proteins ---- Homeobox protein Hox-B5 Source.2548: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1 Source.2549: DFBPPR11810 ---- Animal proteins ---- Homeobox protein BarH-like 1 Source.2550: DFBPPR11812 ---- Animal proteins ---- Phosphorylated adapter RNA export protein Source.2551: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A Source.2552: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.2553: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1 Source.2554: DFBPPR11822 ---- Animal proteins ---- Inversin Source.2555: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.2556: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein Source.2557: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1 Source.2558: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.2559: DFBPPR11889 ---- Animal proteins ---- Olfactory receptor-like protein COR8 Source.2560: DFBPPR11893 ---- Animal proteins ---- Laminin subunit beta-1 variant Source.2561: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13 Source.2562: DFBPPR11919 ---- Animal proteins ---- Feather keratin 1 Source.2563: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2 Source.2564: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3 Source.2565: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A Source.2566: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8 Source.2567: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog Source.2568: DFBPPR11954 ---- Animal proteins ---- SIN3-HDAC complex-associated factor Source.2569: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.2570: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4 Source.2571: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase Source.2572: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2 Source.2573: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1 Source.2574: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130 Source.2575: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3 Source.2576: DFBPPR11993 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2 Source.2577: DFBPPR11994 ---- Animal proteins ---- Surfeit locus protein 1 Source.2578: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein Source.2579: DFBPPR12017 ---- Animal proteins ---- Zinc finger protein CKR1 Source.2580: DFBPPR12019 ---- Animal proteins ---- Cobalamin trafficking protein CblD Source.2581: DFBPPR12021 ---- Animal proteins ---- DNA repair protein RAD52 homolog Source.2582: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2 Source.2583: DFBPPR12027 ---- Animal proteins ---- Centromere protein L Source.2584: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29 Source.2585: DFBPPR12040 ---- Animal proteins ---- Neurochondrin Source.2586: DFBPPR12042 ---- Animal proteins ---- Mapk-regulated corepressor-interacting protein 1 Source.2587: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog Source.2588: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1 Source.2589: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.2590: DFBPPR12060 ---- Animal proteins ---- Neurobeachin Source.2591: DFBPPR12061 ---- Animal proteins ---- Otoraplin Source.2592: DFBPPR12065 ---- Animal proteins ---- Testin Source.2593: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog Source.2594: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2 Source.2595: DFBPPR12107 ---- Animal proteins ---- CTD small phosphatase-like protein 2 Source.2596: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1 Source.2597: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.2598: DFBPPR12143 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 2 Source.2599: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.2600: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.2601: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A Source.2602: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog Source.2603: DFBPPR12175 ---- Animal proteins ---- Ashwin Source.2604: DFBPPR12177 ---- Animal proteins ---- Beta-keratin-related protein Source.2605: DFBPPR12193 ---- Animal proteins ---- Protein FAM122A Source.2606: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.2607: DFBPPR12236 ---- Animal proteins ---- Protein FAM133 Source.2608: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM Source.2609: DFBPPR12250 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.2610: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.2611: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.2612: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.2613: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1 Source.2614: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.2615: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.2616: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.2617: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor Source.2618: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.2619: DFBPPR12294 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.2620: DFBPPR12299 ---- Animal proteins ---- Myocilin Source.2621: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase Source.2622: DFBPPR12307 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn] Source.2623: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2624: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.2625: DFBPPR12324 ---- Animal proteins ---- Androgen receptor Source.2626: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor Source.2627: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.2628: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain Source.2629: DFBPPR12352 ---- Animal proteins ---- Podocalyxin Source.2630: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.2631: DFBPPR12364 ---- Animal proteins ---- Protein Wnt-5a Source.2632: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.2633: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform Source.2634: DFBPPR12371 ---- Animal proteins ---- Y-box-binding protein 1 Source.2635: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.2636: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor Source.2637: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial Source.2638: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2639: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein Source.2640: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.2641: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1 Source.2642: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma Source.2643: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.2644: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor Source.2645: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.2646: DFBPPR12399 ---- Animal proteins ---- Gap junction alpha-1 protein Source.2647: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.2648: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon Source.2649: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1 Source.2650: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1 Source.2651: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.2652: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 Source.2653: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N Source.2654: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2655: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein Source.2656: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.2657: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2 Source.2658: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1 Source.2659: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2660: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain Source.2661: DFBPPR12478 ---- Animal proteins ---- Protein phosphatase 1A Source.2662: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator Source.2663: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha Source.2664: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor Source.2665: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase Source.2666: DFBPPR12504 ---- Animal proteins ---- Collagenase 3 Source.2667: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.2668: DFBPPR12514 ---- Animal proteins ---- Transmembrane protein 109 Source.2669: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.2670: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.2671: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.2672: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.2673: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2674: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.2675: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K Source.2676: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D Source.2677: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2 Source.2678: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6 Source.2679: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K Source.2680: DFBPPR12580 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2 Source.2681: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.2682: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.2683: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT Source.2684: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT Source.2685: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S Source.2686: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1 Source.2687: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.2688: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.2689: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11 Source.2690: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin Source.2691: DFBPPR12642 ---- Animal proteins ---- Haptoglobin Source.2692: DFBPPR12643 ---- Animal proteins ---- Haptoglobin Source.2693: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.2694: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.2695: DFBPPR12709 ---- Animal proteins ---- Somatotropin Source.2696: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.2697: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.2698: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.2699: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.2700: DFBPPR12760 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 3 Source.2701: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform Source.2702: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3 Source.2703: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6 Source.2704: DFBPPR12770 ---- Animal proteins ---- Filamin-B Source.2705: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.2706: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.2707: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.2708: DFBPPR12807 ---- Animal proteins ---- Chloride intracellular channel protein 1 Source.2709: DFBPPR12811 ---- Animal proteins ---- Heme oxygenase 2 Source.2710: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.2711: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.2712: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.2713: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1 Source.2714: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B Source.2715: DFBPPR12882 ---- Animal proteins ---- Parathyroid hormone-related protein Source.2716: DFBPPR12901 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I Source.2717: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.2718: DFBPPR12921 ---- Animal proteins ---- Cytochrome P450 2C30 Source.2719: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.2720: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2721: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter Source.2722: DFBPPR12978 ---- Animal proteins ---- Endothelin-3 Source.2723: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.2724: DFBPPR12988 ---- Animal proteins ---- Calpastatin Source.2725: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.2726: DFBPPR13002 ---- Animal proteins ---- Complement component C8 gamma chain Source.2727: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.2728: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2 Source.2729: DFBPPR13020 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1 Source.2730: DFBPPR13047 ---- Animal proteins ---- Elongation factor 1-delta Source.2731: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2 Source.2732: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2733: DFBPPR13092 ---- Animal proteins ---- Testin Source.2734: DFBPPR13094 ---- Animal proteins ---- Atherin Source.2735: DFBPPR13122 ---- Animal proteins ---- Ig kappa-b9 chain C region Source.2736: DFBPPR13123 ---- Animal proteins ---- Ig kappa-b5 chain C region Source.2737: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.2738: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2739: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2740: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2741: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.2742: DFBPPR13186 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn] Source.2743: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.2744: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.2745: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2 Source.2746: DFBPPR13218 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.2747: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.2748: DFBPPR13243 ---- Animal proteins ---- Metallothionein-1A Source.2749: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1 Source.2750: DFBPPR13263 ---- Animal proteins ---- Serotransferrin Source.2751: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.2752: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.2753: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1 Source.2754: DFBPPR13321 ---- Animal proteins ---- Metallothionein-1B Source.2755: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.2756: DFBPPR13337 ---- Animal proteins ---- Calcitonin gene-related peptide 1 Source.2757: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.2758: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.2759: DFBPPR13371 ---- Animal proteins ---- Calcitonin gene-related peptide 2 Source.2760: DFBPPR13372 ---- Animal proteins ---- Sperm histone P2b Source.2761: DFBPPR13401 ---- Animal proteins ---- Sperm histone P2a Source.2762: DFBPPR13405 ---- Animal proteins ---- 60S acidic ribosomal protein P2 Source.2763: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2764: DFBPPR13409 ---- Animal proteins ---- Testin Source.2765: DFBPPR13428 ---- Animal proteins ---- Appetite-regulating hormone Source.2766: DFBPPR13459 ---- Animal proteins ---- Superoxide dismutase [Cu-Zn] Source.2767: DFBPPR13486 ---- Animal proteins ---- Beta-defensin 1 Source.2768: DFBPPR13503 ---- Animal proteins ---- Keratin, type I cytoskeletal 27 Source.2769: DFBPPR13522 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2 Source.2770: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2771: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2 Source.2772: DFBPPR13543 ---- Animal proteins ---- Myoblast determination protein 1 Source.2773: DFBPPR13544 ---- Animal proteins ---- U8 snoRNA-decapping enzyme Source.2774: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase Source.2775: DFBPPR13569 ---- Animal proteins ---- Fibroblast growth factor 2 Source.2776: DFBPPR13580 ---- Animal proteins ---- Myc proto-oncogene protein Source.2777: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.2778: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein Source.2779: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2780: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2781: DFBPPR13619 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.2782: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.2783: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor Source.2784: DFBPPR13637 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial Source.2785: DFBPPR13659 ---- Animal proteins ---- Oxytocin-neurophysin 1 Source.2786: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2 Source.2787: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1 Source.2788: DFBPPR13700 ---- Animal proteins ---- Metallothionein-1A Source.2789: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.2790: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.2791: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.2792: DFBPPR13758 ---- Animal proteins ---- Metallothionein-2 Source.2793: DFBPPR13774 ---- Animal proteins ---- Trophoblast Kunitz domain protein 1 Source.2794: DFBPPR13776 ---- Animal proteins ---- Keratin, type II microfibrillar, component 7C Source.2795: DFBPPR13785 ---- Animal proteins ---- Bone morphogenetic protein 15 Source.2796: DFBPPR13807 ---- Animal proteins ---- Metallothionein-1C Source.2797: DFBPPR13813 ---- Animal proteins ---- Metallothionein-1B Source.2798: DFBPPR13821 ---- Animal proteins ---- Calcitonin Source.2799: DFBPPR13822 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.2800: DFBPPR13831 ---- Animal proteins ---- Beta-defensin 1 Source.2801: DFBPPR13836 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.2802: DFBPPR13853 ---- Animal proteins ---- Keratin, type II microfibrillar, component 5 Source.2803: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11 Source.2804: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.2805: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein Source.2806: DFBPPR13900 ---- Animal proteins ---- Keratin, type I cytoskeletal 15 Source.2807: DFBPPR13907 ---- Animal proteins ---- Shadow of prion protein Source.2808: DFBPPR13908 ---- Animal proteins ---- Shadow of prion protein Source.2809: DFBPPR13909 ---- Animal proteins ---- Homeobox protein Hox-C9 Source.2810: DFBPPR13910 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.2811: DFBPPR13918 ---- Animal proteins ---- Testin Source.2812: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.2813: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter Source.2814: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2815: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.2816: DFBPPR13955 ---- Animal proteins ---- Beta-defensin 2 Source.2817: DFBPPR13959 ---- Animal proteins ---- Calpastatin Source.2818: DFBPPR13961 ---- Animal proteins ---- Elongation factor 1-delta Source.2819: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1 Source.2820: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.2821: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.2822: DFBPPR14005 ---- Animal proteins ---- Fish-egg lectin Source.2823: DFBPPR14016 ---- Animal proteins ---- Gonadotropin subunit beta-1 Source.2824: DFBPPR14082 ---- Marine protein ---- Estrogen receptor Source.2825: DFBPPR14112 ---- Marine protein ---- Proteasome subunit beta type-6-A like protein Source.2826: DFBPPR14114 ---- Marine protein ---- Proteasome subunit beta type-6-B like protein Source.2827: DFBPPR14123 ---- Marine protein ---- Albumin 1 Source.2828: DFBPPR14124 ---- Marine protein ---- Albumin 2 Source.2829: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.2830: DFBPPR14157 ---- Marine protein ---- Ribosome biogenesis protein wdr12 Source.2831: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2 Source.2832: DFBPPR14215 ---- Marine protein ---- Protein SMG9 Source.2833: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial Source.2834: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE Source.2835: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.2836: DFBPPR14329 ---- Marine protein ---- Photosystem II protein D1 Source.2837: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase Source.2838: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.2839: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE Source.2840: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.2841: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein Source.2842: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic Source.2843: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.2844: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog Source.2845: DFBPPR14401 ---- Marine protein ---- 50S ribosomal protein L4, chloroplastic Source.2846: DFBPPR14407 ---- Marine protein ---- Allophycocyanin alpha-B chain Source.2847: DFBPPR14410 ---- Marine protein ---- Uncharacterized sensor-like histidine kinase ycf26 Source.2848: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic Source.2849: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic Source.2850: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator Source.2851: DFBPPR14443 ---- Marine protein ---- 30S ribosomal protein S14, chloroplastic Source.2852: DFBPPR14447 ---- Marine protein ---- Protein translocase subunit SecY Source.2853: DFBPPR14538 ---- Marine protein ---- Estrogen receptor Source.2854: DFBPPR14545 ---- Marine protein ---- Ghrelin Source.2855: DFBPPR14553 ---- Marine protein ---- Glucocorticoid receptor Source.2856: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2 Source.2857: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.2858: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain Source.2859: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain Source.2860: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.2861: DFBPPR14679 ---- Marine protein ---- Otolith matrix protein 1 Source.2862: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64 Source.2863: DFBPPR14753 ---- Marine protein ---- Clotting factor B Source.2864: DFBPPR14754 ---- Marine protein ---- Clotting factor C Source.2865: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit Source.2866: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic Source.2867: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2 Source.2868: DFBPPR14812 ---- Marine protein ---- Alpha-2-macroglobulin homolog Source.2869: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2870: DFBPPR14866 ---- Marine protein ---- Tyrosine 3-monooxygenase Source.2871: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.2872: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.2873: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1 Source.2874: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.2875: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific Source.2876: DFBPPR14929 ---- Microorganism protein ---- Histone H2A Source.2877: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial Source.2878: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1 Source.2879: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1 Source.2880: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1 Source.2881: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.2882: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.2883: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.2884: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like Source.2885: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2 Source.2886: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.2887: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1 Source.2888: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1 Source.2889: DFBPPR15008 ---- Microorganism protein ---- ATP-dependent RNA helicase ROK1 Source.2890: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase Source.2891: DFBPPR15014 ---- Microorganism protein ---- AP-1-like transcription factor YAP1 Source.2892: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.2893: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial Source.2894: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase Source.2895: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial Source.2896: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase Source.2897: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2 Source.2898: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1 Source.2899: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1 Source.2900: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13 Source.2901: DFBPPR15090 ---- Microorganism protein ---- Transketolase Source.2902: DFBPPR15093 ---- Microorganism protein ---- Inner kinetochore subunit AME1 Source.2903: DFBPPR15094 ---- Microorganism protein ---- Thioredoxin reductase, mitochondrial Source.2904: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2 Source.2905: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1 Source.2906: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.2907: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase Source.2908: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial Source.2909: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter Source.2910: DFBPPR15158 ---- Microorganism protein ---- DASH complex subunit DAM1 Source.2911: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3 Source.2912: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.2913: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3 Source.2914: DFBPPR15168 ---- Microorganism protein ---- Chromatin modification-related protein YNG2 Source.2915: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.2916: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial Source.2917: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3 Source.2918: DFBPPR15198 ---- Microorganism protein ---- tRNA:m(4)X modification enzyme TRM13 Source.2919: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23 Source.2920: DFBPPR15223 ---- Microorganism protein ---- FK506-binding protein 2 Source.2921: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial Source.2922: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.2923: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20 Source.2924: DFBPPR15267 ---- Microorganism protein ---- Cofilin Source.2925: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7 Source.2926: DFBPPR15279 ---- Microorganism protein ---- Nuclear fusion protein KAR5 Source.2927: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2 Source.2928: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1 Source.2929: DFBPPR15306 ---- Microorganism protein ---- UDP-N-acetylglucosamine transferase subunit ALG14 Source.2930: DFBPPR15309 ---- Microorganism protein ---- Respiratory supercomplex factor 1, mitochondrial Source.2931: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21 Source.2932: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1 Source.2933: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1 Source.2934: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.2935: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1 Source.2936: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2 Source.2937: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial Source.2938: DFBPPR15408 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI3 Source.2939: DFBPPR15415 ---- Microorganism protein ---- Transcription initiation factor TFIID subunit 4 Source.2940: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial Source.2941: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10 Source.2942: DFBPPR15472 ---- Microorganism protein ---- Enhancer of polycomb-like protein 1 Source.2943: DFBPPR15481 ---- Microorganism protein ---- Probable cytosolic iron-sulfur protein assembly protein 1 Source.2944: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46 Source.2945: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1 Source.2946: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54 Source.2947: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1 Source.2948: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1 Source.2949: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23 Source.2950: DFBPPR15540 ---- Microorganism protein ---- Probable intron-encoded endonuclease aI3 Source.2951: DFBPPR15547 ---- Microorganism protein ---- SWR1-complex protein 5 Source.2952: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.2953: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32 Source.2954: DFBPPR15567 ---- Microorganism protein ---- Mating-type protein A2 Source.2955: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1 Source.2956: DFBPPR15597 ---- Microorganism protein ---- DNA damage-binding protein CMR1 Source.2957: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1 Source.2958: DFBPPR15630 ---- Microorganism protein ---- Ribosome biogenesis protein RLP7 Source.2959: DFBPPR15644 ---- Microorganism protein ---- Cytoplasmic dynein intermediate light chain DYN3 Source.2960: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit Source.2961: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2 Source.2962: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3 Source.2963: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8 Source.2964: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2 Source.2965: DFBPPR15730 ---- Microorganism protein ---- Suppressor of hydroxyurea sensitivity protein 2 Source.2966: DFBPPR15746 ---- Microorganism protein ---- Topoisomerase I damage affected protein 11 Source.2967: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111 Source.2968: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3 Source.2969: DFBPPR15797 ---- Microorganism protein ---- Dihydrofolate reductase Source.2970: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase Source.2971: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase Source.2972: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta Source.2973: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase Source.2974: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3 Source.2975: DFBPPR15850 ---- Microorganism protein ---- Histone H2A Source.2976: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.2977: DFBPPR15860 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial Source.2978: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase Source.2979: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase Source.2980: DFBPPR15888 ---- Marine protein ---- Photosystem II protein D1 Source.2981: DFBPPR0003 ---- Plant protein ---- Conglutin beta 2 Source.2982: DFBPPR0009 ---- Plant protein ---- Conglutin beta 1 Source.2983: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase Source.2984: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic Source.2985: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.2986: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic Source.2987: DFBPPR7789 ---- Plant protein ---- Thiamine thiazole synthase 2, chloroplastic Source.2988: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2989: DFBPPR7815 ---- Plant protein ---- Photosystem II reaction center protein H Source.2990: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.2991: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.2992: DFBPPR7850 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.2993: DFBPPR7857 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic Source.2994: DFBPPR7861 ---- Plant protein ---- 30S ribosomal protein S11, chloroplastic Source.2995: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1 Source.2996: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1 Source.2997: DFBPPR7907 ---- Plant protein ---- CASP-like protein 2C1 Source.2998: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3 Source.2999: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.3000: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.3001: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic Source.3002: DFBPPR7947 ---- Plant protein ---- Legumin type B Source.3003: DFBPPR7956 ---- Plant protein ---- Legumin type B Source.3004: DFBPPR7957 ---- Plant protein ---- Legumin type B Source.3005: DFBPPR7958 ---- Plant protein ---- Legumin type B Source.3006: DFBPPR7964 ---- Plant protein ---- Sucrose synthase Source.3007: DFBPPR7987 ---- Plant protein ---- Antifungal protein ginkbilobin-2 Source.3008: DFBPPR8029 ---- Plant protein ---- Vignain Source.3009: DFBPPR8064 ---- Plant protein ---- Endochitinase PR4 Source.3010: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3011: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.3012: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme Source.3013: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.3014: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.3015: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.3016: DFBPPR8113 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.3017: DFBPPR8121 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.8 Source.3018: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme Source.3019: DFBPPR8130 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic Source.3020: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.3021: DFBPPR8158 ---- Plant protein ---- Glycine-rich cell wall structural protein 1.0 Source.3022: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase Source.3023: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.3024: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3 Source.3025: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.3026: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.3027: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein Source.3028: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3029: DFBPPR8286 ---- Plant protein ---- Oleosin Source.3030: DFBPPR8289 ---- Plant protein ---- ATP synthase subunit b, chloroplastic Source.3031: DFBPPR8290 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic Source.3032: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.3033: DFBPPR8303 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Link-research Inductive analysis	Link 1: DFBPACEI0131----Smooth hound (Mustelus mustelus)----Muscle protein hydrolysates

Biological/Functional activity & target protein

ACE-inhibitory activity	The peptide exhibited low Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC₅₀ value of 527.9 uM.
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Non-bitter taste ^prediction

SMILES

N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(CO)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	The peptides were isolated from the hydrolysate obtained by treatment with crude protease extract from Bacillus mojavensis A21.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

Cuttlefish muscle is a promising protein source for the production of ACE inhibitory peptides that could be utilized to develop functional foods for prevention of hypertension.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Balti, R., Nedjar-Arroume, N., Adje, E.Y., Guillochon, D., Nasri, M. Analysis of novel angiotensin I-converting enzyme inhibitory peptides from enzymatic hydrolysates of cuttlefish (Sepia officinalis) muscle proteins. J Agric Food Chem. 2010, 58, 3840-6. DOI: 10.1021/jf904300q
Other literature(s)	N.D
PubDate	2010