E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI1613(ACE-inhibitory peptide)
DFBP ID DFBPACEI1613
Peptide sequence RW
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity Antioxidative activity [D1], Other bioactive activity [D2], Multifunctional activity [D3]
Calculated physicochemical properties
Three-letter amino acid Arg-Trp
Single-letter amino acid RW
Peptide length 2
Peptide mass
Experimental mass Theoretical mass
N.D 360.41 Da c
Net charge 0.00 c
Isoelectric point (pI) 11.04 c
IC50 16 μM
pIC50 -1.204
GRAVY -2.7000 c
Hydrophilic residue ratio 50% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Synthesis
Organism/Source Synthesis peptide
Precursor protein Synthesis peptide
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0435 ---- Plant protein ---- 22kDa storage protein
Source.3: DFBPPR0748 ---- Plant proteins ---- Agglutinin
Source.4: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2
Source.5: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.6: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1
Source.7: DFBPPR0810 ---- Plant proteins ---- APETALA2-like protein 1
Source.8: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1
Source.9: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25
Source.10: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.11: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.12: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.13: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8
Source.14: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.15: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.16: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5
Source.17: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.18: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.19: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.20: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.21: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.22: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.23: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.24: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.25: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.26: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.27: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.28: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.29: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.30: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1
Source.31: DFBPPR0876 ---- Plant proteins ---- Protein BZR1 homolog 1
Source.32: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.33: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.34: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.35: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.36: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.37: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.38: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.39: DFBPPR0930 ---- Plant proteins ---- Abscisic acid receptor PYL3
Source.40: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic
Source.41: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.42: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.43: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.44: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1
Source.45: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.46: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.47: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A
Source.48: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.49: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.50: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.51: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.52: DFBPPR0958 ---- Plant proteins ---- APETALA2-like protein 5
Source.53: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.54: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC
Source.55: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.56: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.57: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7
Source.58: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.59: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.60: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1
Source.61: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.62: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.63: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.64: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.65: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic
Source.66: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.67: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.68: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.69: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.70: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming]
Source.71: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.72: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.73: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75
Source.74: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.75: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.76: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.77: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.78: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.79: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1
Source.80: DFBPPR1030 ---- Plant proteins ---- WUSCHEL-related homeobox 1
Source.81: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.82: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.83: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3
Source.84: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.85: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.86: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5
Source.87: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.88: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1
Source.89: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5
Source.90: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c
Source.91: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4
Source.92: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.93: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.94: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.95: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1
Source.96: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51
Source.97: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24
Source.98: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL
Source.99: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.100: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.101: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.102: DFBPPR1102 ---- Plant proteins ---- APETALA2-like protein 3
Source.103: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.104: DFBPPR1105 ---- Plant proteins ---- Solanesyl-diphosphate synthase 1, mitochondrial
Source.105: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.106: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.107: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic
Source.108: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic
Source.109: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.110: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4
Source.111: DFBPPR1126 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 6
Source.112: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.113: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.114: DFBPPR1136 ---- Plant proteins ---- Exosome complex exonuclease RRP46 homolog
Source.115: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.116: DFBPPR1142 ---- Plant proteins ---- Calreticulin
Source.117: DFBPPR1143 ---- Plant proteins ---- Mitogen-activated protein kinase 13
Source.118: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4
Source.119: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.120: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.121: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.122: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.123: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3
Source.124: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.125: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.126: DFBPPR1174 ---- Plant proteins ---- Probable protein phosphatase 2C 30
Source.127: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2
Source.128: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.129: DFBPPR1179 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 1, mitochondrial
Source.130: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.131: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.132: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35
Source.133: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3
Source.134: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b
Source.135: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.136: DFBPPR1243 ---- Plant proteins ---- Protein BIG GRAIN 1
Source.137: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10
Source.138: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.139: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.140: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.141: DFBPPR1257 ---- Plant proteins ---- Transcription factor MYB2
Source.142: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic
Source.143: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.144: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1
Source.145: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.146: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.147: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.148: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.149: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase
Source.150: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a
Source.151: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic
Source.152: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.153: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.154: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.155: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b
Source.156: DFBPPR1302 ---- Plant proteins ---- 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase, chloroplastic
Source.157: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.158: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.159: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.160: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.161: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.162: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22
Source.163: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.164: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.165: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d
Source.166: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.167: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.168: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.169: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.170: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12
Source.171: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1
Source.172: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.173: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.174: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.175: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.176: DFBPPR1365 ---- Plant proteins ---- Replication protein A 32 kDa subunit A
Source.177: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.178: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.179: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.180: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.181: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.182: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.183: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.184: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.185: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.186: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2
Source.187: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.188: DFBPPR1393 ---- Plant proteins ---- Serine/threonine-protein kinase Nek6
Source.189: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.190: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.191: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.192: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B
Source.193: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.194: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.195: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.196: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.197: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.198: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.199: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.200: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.201: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.202: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.203: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b
Source.204: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.205: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.206: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E
Source.207: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.208: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.209: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.210: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.211: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.212: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.213: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.214: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.215: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.216: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase
Source.217: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.218: DFBPPR1476 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 3, chloroplastic
Source.219: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.220: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.221: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.222: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.223: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.224: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.225: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1
Source.226: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.227: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase
Source.228: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.229: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.230: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.231: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d
Source.232: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.233: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.234: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.235: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3
Source.236: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.237: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.238: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3
Source.239: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39
Source.240: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.241: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.242: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.243: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.244: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.245: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.246: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.247: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19
Source.248: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.249: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3
Source.250: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.251: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF
Source.252: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9
Source.253: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4
Source.254: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.255: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C
Source.256: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.257: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11
Source.258: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.259: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.260: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.261: DFBPPR1618 ---- Plant proteins ---- Heat stress transcription factor C-1a
Source.262: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.263: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.264: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a
Source.265: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.266: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1
Source.267: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2
Source.268: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.269: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.270: DFBPPR1651 ---- Plant proteins ---- Protein KTI12 homolog
Source.271: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.272: DFBPPR1655 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.273: DFBPPR1656 ---- Plant proteins ---- Alpha-amylase isozyme C
Source.274: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.275: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1
Source.276: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1
Source.277: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.278: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.279: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A
Source.280: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7
Source.281: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.282: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.283: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.284: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.285: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.286: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.287: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a
Source.288: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.289: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.290: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.291: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.292: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.293: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.294: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.295: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.296: DFBPPR1735 ---- Plant proteins ---- Probable aminodeoxychorismate synthase, chloroplastic
Source.297: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic
Source.298: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.299: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.300: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.301: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.302: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.303: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.304: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1
Source.305: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial
Source.306: DFBPPR1771 ---- Plant proteins ---- Replication protein A 32 kDa subunit B
Source.307: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.308: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial
Source.309: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.310: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.311: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11
Source.312: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.313: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.314: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.315: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.316: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.317: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.318: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.319: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.320: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4
Source.321: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4
Source.322: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.323: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase
Source.324: DFBPPR1807 ---- Plant proteins ---- Two-component response regulator ORR1
Source.325: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9
Source.326: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5
Source.327: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.328: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.329: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3
Source.330: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.331: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.332: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.333: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.334: DFBPPR1848 ---- Plant proteins ---- Chitinase 7
Source.335: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.336: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.337: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.338: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.339: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.340: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.341: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.342: DFBPPR1871 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 17
Source.343: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.344: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4
Source.345: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2
Source.346: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4
Source.347: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.348: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.349: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.350: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.351: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.352: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.353: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6
Source.354: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.355: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.356: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.357: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.358: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2
Source.359: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.360: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.361: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase
Source.362: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.363: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA
Source.364: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.365: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.366: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.367: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.368: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.369: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.370: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.371: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.372: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2
Source.373: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.374: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5
Source.375: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.376: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.377: DFBPPR1970 ---- Plant proteins ---- UMP-CMP kinase 1
Source.378: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.379: DFBPPR1973 ---- Plant proteins ---- Transcription factor MYB30
Source.380: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.381: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A
Source.382: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.383: DFBPPR1996 ---- Plant proteins ---- Transcription initiation factor IIB
Source.384: DFBPPR1998 ---- Plant proteins ---- Probable pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.385: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4
Source.386: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.387: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.388: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.389: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1
Source.390: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.391: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a
Source.392: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.393: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1
Source.394: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.395: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.396: DFBPPR2032 ---- Plant proteins ---- Probable protein phosphatase 2C 5
Source.397: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.398: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial
Source.399: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.400: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.401: DFBPPR2045 ---- Plant proteins ---- Expansin-A5
Source.402: DFBPPR2047 ---- Plant proteins ---- 17.8 kDa heat shock protein
Source.403: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.404: DFBPPR2051 ---- Plant proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase
Source.405: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.406: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.407: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9
Source.408: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX
Source.409: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.410: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.411: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.412: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.413: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.414: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1
Source.415: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic
Source.416: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.417: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.418: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80
Source.419: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase
Source.420: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.421: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.422: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.423: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.424: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.425: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.426: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.427: DFBPPR2122 ---- Plant proteins ---- FAD-linked sulfhydryl oxidase ERV1
Source.428: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2
Source.429: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic
Source.430: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.431: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1
Source.432: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.433: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.434: DFBPPR2146 ---- Plant proteins ---- Expansin-B4
Source.435: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23
Source.436: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.437: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.438: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.439: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.440: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.441: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.442: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.443: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.444: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.445: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.446: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.447: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase
Source.448: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.449: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.450: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.451: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.452: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.453: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.454: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1
Source.455: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16
Source.456: DFBPPR2209 ---- Plant proteins ---- Succinate dehydrogenase subunit 4, mitochondrial
Source.457: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.458: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.459: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3
Source.460: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.461: DFBPPR2216 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit gamma 1
Source.462: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26
Source.463: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.464: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.465: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.466: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.467: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.468: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6
Source.469: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.470: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.471: DFBPPR2244 ---- Plant proteins ---- Expansin-A6
Source.472: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.473: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.474: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.475: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.476: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.477: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.478: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8
Source.479: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.480: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.481: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.482: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.483: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.484: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.485: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B
Source.486: DFBPPR2289 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 14
Source.487: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B
Source.488: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.489: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.490: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b
Source.491: DFBPPR2310 ---- Plant proteins ---- Heat stress transcription factor A-3
Source.492: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5
Source.493: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic
Source.494: DFBPPR2330 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN3
Source.495: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.496: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.497: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.498: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1
Source.499: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400
Source.500: DFBPPR2343 ---- Plant proteins ---- Protein kinase G11A
Source.501: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial
Source.502: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.503: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.504: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.505: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.506: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR
Source.507: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.508: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.509: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6
Source.510: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein
Source.511: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.512: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.513: DFBPPR2387 ---- Plant proteins ---- Chitinase 8
Source.514: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic
Source.515: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.516: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.517: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6
Source.518: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22
Source.519: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.520: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.521: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6
Source.522: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.523: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B
Source.524: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73
Source.525: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic
Source.526: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.527: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.528: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic
Source.529: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.530: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.531: DFBPPR2439 ---- Plant proteins ---- Esterase PIR7B
Source.532: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.533: DFBPPR2448 ---- Plant proteins ---- Expansin-A9
Source.534: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.535: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.536: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.537: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.538: DFBPPR2460 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.539: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1
Source.540: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.541: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial
Source.542: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.543: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.544: DFBPPR2487 ---- Plant proteins ---- Two-component response regulator ORR2
Source.545: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.546: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.547: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.548: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.549: DFBPPR2518 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit gamma 2
Source.550: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.551: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.552: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.553: DFBPPR2526 ---- Plant proteins ---- Chitinase 10
Source.554: DFBPPR2528 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN2
Source.555: DFBPPR2532 ---- Plant proteins ---- Elongation factor 1-beta
Source.556: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.557: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c
Source.558: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.559: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.560: DFBPPR2549 ---- Plant proteins ---- Heat stress transcription factor C-2a
Source.561: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.562: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.563: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.564: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.565: DFBPPR2562 ---- Plant proteins ---- WUSCHEL-related homeobox 9
Source.566: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40
Source.567: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.568: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200
Source.569: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4
Source.570: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.571: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.572: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a
Source.573: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.574: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.575: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.576: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.577: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.578: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.579: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1
Source.580: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.581: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.582: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24
Source.583: DFBPPR2636 ---- Plant proteins ---- Expansin-B8
Source.584: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.585: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.586: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic
Source.587: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25
Source.588: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2
Source.589: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.590: DFBPPR2656 ---- Plant proteins ---- Expansin-A15
Source.591: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.592: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.593: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase
Source.594: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1
Source.595: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.596: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.597: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.598: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16
Source.599: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.600: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.601: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.602: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9
Source.603: DFBPPR2708 ---- Plant proteins ---- Ras-related protein RGP1
Source.604: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.605: DFBPPR2714 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.606: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.607: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A
Source.608: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.609: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.610: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.611: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.612: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.613: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.614: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.615: DFBPPR2754 ---- Plant proteins ---- Adenylate kinase 3
Source.616: DFBPPR2755 ---- Plant proteins ---- Adenylate kinase 4
Source.617: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.618: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.619: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.620: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.621: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.622: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.623: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.624: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.625: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2
Source.626: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein
Source.627: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.628: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.629: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.630: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.631: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.632: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.633: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.634: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3
Source.635: DFBPPR2817 ---- Plant proteins ---- Early nodulin-like protein 1
Source.636: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.637: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1
Source.638: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.639: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.640: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.641: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.642: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.643: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.644: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.645: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.646: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9
Source.647: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.648: DFBPPR2863 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.649: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX
Source.650: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.651: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2
Source.652: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.653: DFBPPR2873 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL2
Source.654: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.655: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.656: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.657: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.658: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.659: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2
Source.660: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.661: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.662: DFBPPR2916 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 1
Source.663: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.664: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2
Source.665: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.666: DFBPPR2928 ---- Plant proteins ---- 18.9 kDa heat shock protein
Source.667: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.668: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.669: DFBPPR2939 ---- Plant proteins ---- Pseudo histidine-containing phosphotransfer protein 5
Source.670: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1
Source.671: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27
Source.672: DFBPPR2946 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.673: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic
Source.674: DFBPPR2958 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX21
Source.675: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.676: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.677: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.678: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.679: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.680: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.681: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23
Source.682: DFBPPR2984 ---- Plant proteins ---- Probable homogentisate phytyltransferase 2, chloroplastic
Source.683: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.684: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13
Source.685: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B
Source.686: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.687: DFBPPR3002 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX20
Source.688: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13
Source.689: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.690: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.691: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.692: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.693: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c
Source.694: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.695: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.696: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.697: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3
Source.698: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3
Source.699: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.700: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase
Source.701: DFBPPR3047 ---- Plant proteins ---- Zinc finger protein 36
Source.702: DFBPPR3056 ---- Plant proteins ---- Beta-glucosidase 10
Source.703: DFBPPR3061 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.704: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.705: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5
Source.706: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.707: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.708: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.709: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.710: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.711: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3
Source.712: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.713: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.714: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.715: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.716: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.717: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase
Source.718: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.719: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.720: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.721: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.722: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.723: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.724: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit
Source.725: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.726: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.727: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic
Source.728: DFBPPR3123 ---- Plant proteins ---- Probable mitochondrial import receptor subunit TOM20
Source.729: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.730: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.731: DFBPPR3131 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.732: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.733: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.734: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.735: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.736: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3
Source.737: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B
Source.738: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.739: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.740: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.741: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.742: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5
Source.743: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.744: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I
Source.745: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48
Source.746: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.747: DFBPPR3182 ---- Plant proteins ---- Thioredoxin-like 3-1, chloroplastic
Source.748: DFBPPR3183 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 32
Source.749: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.750: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10
Source.751: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.752: DFBPPR3191 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, chloroplastic/mitochondrial
Source.753: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.754: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.755: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.756: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.757: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1
Source.758: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.759: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7
Source.760: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.761: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26
Source.762: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.763: DFBPPR3241 ---- Plant proteins ---- Elongation factor 1-delta 2
Source.764: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.765: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.766: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.767: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.768: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.769: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.770: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.771: DFBPPR3257 ---- Plant proteins ---- Ras-related protein RIC2
Source.772: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.773: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.774: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.775: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.776: DFBPPR3278 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 3
Source.777: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.778: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.779: DFBPPR3302 ---- Plant proteins ---- Expansin-A21
Source.780: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.781: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.782: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.783: DFBPPR3316 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 7
Source.784: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8
Source.785: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.786: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.787: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial
Source.788: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.789: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8
Source.790: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.791: DFBPPR3347 ---- Plant proteins ---- Thiamine pyrophosphokinase 1
Source.792: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.793: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic
Source.794: DFBPPR3352 ---- Plant proteins ---- Probable protein phosphatase 2C 68
Source.795: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A
Source.796: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.797: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.798: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.799: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.800: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38
Source.801: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R
Source.802: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.803: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.804: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.805: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.806: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.807: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.808: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.809: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6
Source.810: DFBPPR3418 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 3
Source.811: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.812: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.813: DFBPPR3424 ---- Plant proteins ---- Beta-glucosidase 11
Source.814: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.815: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic
Source.816: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49
Source.817: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.818: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.819: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.820: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.821: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.822: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73
Source.823: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1
Source.824: DFBPPR3490 ---- Plant proteins ---- WUSCHEL-related homeobox 4
Source.825: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20
Source.826: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4
Source.827: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.828: DFBPPR3502 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 1
Source.829: DFBPPR3510 ---- Plant proteins ---- Thioredoxin-like protein Clot
Source.830: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3
Source.831: DFBPPR3526 ---- Plant proteins ---- Protein XAP5 CIRCADIAN TIMEKEEPER
Source.832: DFBPPR3527 ---- Plant proteins ---- Elongation factor 1-delta 1
Source.833: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2
Source.834: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial
Source.835: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.836: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3
Source.837: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3
Source.838: DFBPPR3547 ---- Plant proteins ---- Probable BRI1 kinase inhibitor 1
Source.839: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8
Source.840: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.841: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.842: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.843: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16
Source.844: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76
Source.845: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.846: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.847: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.848: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.849: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.850: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.851: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2
Source.852: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.853: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7
Source.854: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.855: DFBPPR3609 ---- Plant proteins ---- Thioredoxin-like 1-1, chloroplastic
Source.856: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A
Source.857: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.858: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.859: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K
Source.860: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.861: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1
Source.862: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.863: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.864: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.865: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.866: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.867: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.868: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9
Source.869: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3
Source.870: DFBPPR3663 ---- Plant proteins ---- Kinesin-like protein KIN-7J
Source.871: DFBPPR3667 ---- Plant proteins ---- Probable NAD kinase 2, chloroplastic
Source.872: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.873: DFBPPR3681 ---- Plant proteins ---- Transcription factor JAMYB
Source.874: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.875: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2
Source.876: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.877: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1
Source.878: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.879: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.880: DFBPPR3723 ---- Plant proteins ---- Inactive protein FON2 SPARE1
Source.881: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.882: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1
Source.883: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.884: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8
Source.885: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.886: DFBPPR3742 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.887: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.888: DFBPPR3752 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 7
Source.889: DFBPPR3758 ---- Plant proteins ---- Target of rapamycin complex subunit LST8
Source.890: DFBPPR3765 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 1
Source.891: DFBPPR3767 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 8
Source.892: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.893: DFBPPR3773 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 3
Source.894: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.895: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G
Source.896: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.897: DFBPPR3778 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 2
Source.898: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.899: DFBPPR3781 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 5
Source.900: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.901: DFBPPR3785 ---- Plant proteins ---- 23.6 kDa heat shock protein, mitochondrial
Source.902: DFBPPR3794 ---- Plant proteins ---- UDP-D-apiose/UDP-D-xylose synthase
Source.903: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E
Source.904: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.905: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B
Source.906: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.907: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.908: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.909: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2
Source.910: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.911: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1
Source.912: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.913: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.914: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.915: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12
Source.916: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2
Source.917: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78
Source.918: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66
Source.919: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.920: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29
Source.921: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.922: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.923: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.924: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.925: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.926: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20
Source.927: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.928: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.929: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.930: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11
Source.931: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial
Source.932: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.933: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2
Source.934: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.935: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.936: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.937: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14
Source.938: DFBPPR3941 ---- Plant proteins ---- KIN17-like protein
Source.939: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.940: DFBPPR3943 ---- Plant proteins ---- RNA pseudouridine synthase 7
Source.941: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.942: DFBPPR3945 ---- Plant proteins ---- Myb-related protein MYBAS1
Source.943: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.944: DFBPPR3962 ---- Plant proteins ---- Myb-related protein MYBAS2
Source.945: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.946: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.947: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.948: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.949: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.950: DFBPPR3984 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 7
Source.951: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.952: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27
Source.953: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5
Source.954: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.955: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4
Source.956: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.957: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9
Source.958: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.959: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1
Source.960: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog
Source.961: DFBPPR4035 ---- Plant proteins ---- Probable transcription factor MYB58
Source.962: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1
Source.963: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.964: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta
Source.965: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.966: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C
Source.967: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.968: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.969: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F
Source.970: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like
Source.971: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.972: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.973: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.974: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8
Source.975: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.976: DFBPPR4089 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1D
Source.977: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.978: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic
Source.979: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.980: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1
Source.981: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.982: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4
Source.983: DFBPPR4106 ---- Plant proteins ---- Homeobox protein knotted-1-like 4
Source.984: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2
Source.985: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1
Source.986: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.987: DFBPPR4124 ---- Plant proteins ---- Ras-related protein RGP2
Source.988: DFBPPR4132 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 49
Source.989: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.990: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.991: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.992: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6
Source.993: DFBPPR4154 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1H
Source.994: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1
Source.995: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.996: DFBPPR4163 ---- Plant proteins ---- Barley B recombinant-like protein A
Source.997: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.998: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3
Source.999: DFBPPR4180 ---- Plant proteins ---- Barley B recombinant-like protein B
Source.1000: DFBPPR4184 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 40
Source.1001: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.1002: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C
Source.1003: DFBPPR4189 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1004: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH
Source.1005: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3
Source.1006: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.1007: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.1008: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.1009: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.1010: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.1011: DFBPPR4245 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 2
Source.1012: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1
Source.1013: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2
Source.1014: DFBPPR4254 ---- Plant proteins ---- Cysteine proteinase inhibitor 6
Source.1015: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4
Source.1016: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900
Source.1017: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16
Source.1018: DFBPPR4263 ---- Plant proteins ---- Putative protein phosphatase 2C 63
Source.1019: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.1020: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.1021: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1
Source.1022: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1
Source.1023: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6
Source.1024: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.1025: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.1026: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.1027: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.1028: DFBPPR4292 ---- Plant proteins ---- Double-stranded RNA-binding protein 3
Source.1029: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.1030: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.1031: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like
Source.1032: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.1033: DFBPPR4310 ---- Plant proteins ---- NAP1-related protein 1
Source.1034: DFBPPR4311 ---- Plant proteins ---- WUSCHEL-related homeobox 6
Source.1035: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.1036: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like
Source.1037: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.1038: DFBPPR4333 ---- Plant proteins ---- Putative potassium channel KAT5
Source.1039: DFBPPR4341 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1J
Source.1040: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E
Source.1041: DFBPPR4346 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1G
Source.1042: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.1043: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2
Source.1044: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2
Source.1045: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12
Source.1046: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.1047: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.1048: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4
Source.1049: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10
Source.1050: DFBPPR4379 ---- Plant proteins ---- CASP-like protein 1B1
Source.1051: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.1052: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.1053: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5
Source.1054: DFBPPR4387 ---- Plant proteins ---- Dof zinc finger protein 5
Source.1055: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2
Source.1056: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.1057: DFBPPR4401 ---- Plant proteins ---- Phospholipase A1-II 2
Source.1058: DFBPPR4402 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 25
Source.1059: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8
Source.1060: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5
Source.1061: DFBPPR4417 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 3
Source.1062: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15
Source.1063: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9
Source.1064: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.1065: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.1066: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.1067: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein
Source.1068: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.1069: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.1070: DFBPPR4437 ---- Plant proteins ---- Ricin B-like lectin R40C1
Source.1071: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.1072: DFBPPR4439 ---- Plant proteins ---- Copper transporter 5.1
Source.1073: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.1074: DFBPPR4445 ---- Plant proteins ---- CASP-like protein 4B2
Source.1075: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.1076: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic
Source.1077: DFBPPR4454 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.1078: DFBPPR4456 ---- Plant proteins ---- Tubby-like F-box protein 13
Source.1079: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.1080: DFBPPR4464 ---- Plant proteins ---- CASP-like protein 4B4
Source.1081: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2
Source.1082: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.1083: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.1084: DFBPPR4472 ---- Plant proteins ---- BURP domain-containing protein 15
Source.1085: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.1086: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1
Source.1087: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.1088: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.1089: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.1090: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic
Source.1091: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.1092: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.1093: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.1094: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.1095: DFBPPR4533 ---- Plant proteins ---- Putative homeobox protein knotted-1-like 5
Source.1096: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.1097: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.1098: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3
Source.1099: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14
Source.1100: DFBPPR4544 ---- Plant proteins ---- Tubby-like F-box protein 7
Source.1101: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12
Source.1102: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.1103: DFBPPR4560 ---- Plant proteins ---- Tubby-like F-box protein 10
Source.1104: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1
Source.1105: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1
Source.1106: DFBPPR4573 ---- Plant proteins ---- CASP-like protein UU-1
Source.1107: DFBPPR4575 ---- Plant proteins ---- Ricin B-like lectin R40G2
Source.1108: DFBPPR4580 ---- Plant proteins ---- Ricin B-like lectin R40G3
Source.1109: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.1110: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.1111: DFBPPR4595 ---- Plant proteins ---- Tubby-like F-box protein 9
Source.1112: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.1113: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.1114: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2
Source.1115: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic
Source.1116: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.1117: DFBPPR4624 ---- Plant proteins ---- Actin-depolymerizing factor 5
Source.1118: DFBPPR4628 ---- Plant proteins ---- Probable inactive carboxylesterase Os04g0669700
Source.1119: DFBPPR4631 ---- Plant proteins ---- B3 domain-containing protein Os03g0620500
Source.1120: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3
Source.1121: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1
Source.1122: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900
Source.1123: DFBPPR4651 ---- Plant proteins ---- CASP-like protein 1U1
Source.1124: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7
Source.1125: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.1126: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1
Source.1127: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.1128: DFBPPR4672 ---- Plant proteins ---- Ninja-family protein Os03g0419100
Source.1129: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.1130: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.1131: DFBPPR4691 ---- Plant proteins ---- Probable protein ABIL3
Source.1132: DFBPPR4703 ---- Plant proteins ---- Tubby-like F-box protein 8
Source.1133: DFBPPR4708 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 5
Source.1134: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.1135: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11
Source.1136: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.1137: DFBPPR4737 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 14
Source.1138: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400
Source.1139: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1
Source.1140: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.1141: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.1142: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30
Source.1143: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400
Source.1144: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.1145: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700
Source.1146: DFBPPR4786 ---- Plant proteins ---- B3 domain-containing protein Os12g0592300
Source.1147: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.1148: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200
Source.1149: DFBPPR4802 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 34
Source.1150: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800
Source.1151: DFBPPR4807 ---- Plant proteins ---- Protein MEI2-like 6
Source.1152: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2
Source.1153: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000
Source.1154: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.1155: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400
Source.1156: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800
Source.1157: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.1158: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600
Source.1159: DFBPPR4859 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40090
Source.1160: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37
Source.1161: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.1162: DFBPPR4868 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0325100
Source.1163: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.1164: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.1165: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.1166: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12
Source.1167: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic
Source.1168: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.1169: DFBPPR4904 ---- Plant proteins ---- APETALA2-like protein 2
Source.1170: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1171: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1
Source.1172: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.1173: DFBPPR4915 ---- Plant proteins ---- Chitinase 2
Source.1174: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1
Source.1175: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1
Source.1176: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.1177: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.1178: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.1179: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.1180: DFBPPR4932 ---- Plant proteins ---- Two-component response regulator ORR30
Source.1181: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.1182: DFBPPR4938 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 2, mitochondrial
Source.1183: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1
Source.1184: DFBPPR4940 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.1185: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1
Source.1186: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.1187: DFBPPR4947 ---- Plant proteins ---- Putative magnesium transporter MRS2-G
Source.1188: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23
Source.1189: DFBPPR4951 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1I
Source.1190: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.1191: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase
Source.1192: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1193: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.1194: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1195: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.1196: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1197: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.1198: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.1199: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1200: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.1201: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.1202: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB
Source.1203: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase
Source.1204: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2
Source.1205: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.1206: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.1207: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.1208: DFBPPR5062 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 2
Source.1209: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.1210: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1211: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.1212: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1
Source.1213: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.1214: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.1215: DFBPPR5082 ---- Plant proteins ---- Catalase-4
Source.1216: DFBPPR5086 ---- Plant proteins ---- Catalase-3
Source.1217: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.1218: DFBPPR5099 ---- Plant proteins ---- Metalloendoproteinase 1
Source.1219: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.1220: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.1221: DFBPPR5105 ---- Plant proteins ---- Probable bifunctional TENA-E protein
Source.1222: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase
Source.1223: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial
Source.1224: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic
Source.1225: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1226: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.1227: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.1228: DFBPPR5141 ---- Plant proteins ---- Flavonoid 4'-O-methyltransferase
Source.1229: DFBPPR5146 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.1230: DFBPPR5152 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1231: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1232: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1233: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1234: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6
Source.1235: DFBPPR5192 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1236: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1237: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.1238: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.1239: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1240: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.1241: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.1242: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.1243: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.1244: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.1245: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1246: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.1247: DFBPPR5318 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1248: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1
Source.1249: DFBPPR5337 ---- Plant proteins ---- Heat shock 22 kDa protein, mitochondrial
Source.1250: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.1251: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.1252: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2
Source.1253: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.1254: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.1255: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.1256: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.1257: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.1258: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.1259: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.1260: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic
Source.1261: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1262: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1
Source.1263: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.1264: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase
Source.1265: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A
Source.1266: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.1267: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein
Source.1268: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.1269: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.1270: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.1271: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.1272: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.1273: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1
Source.1274: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.1275: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog
Source.1276: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.1277: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.1278: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.1279: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.1280: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic
Source.1281: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.1282: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.1283: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1284: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.1285: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.1286: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.1287: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.1288: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic
Source.1289: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic
Source.1290: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.1291: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.1292: DFBPPR5500 ---- Plant proteins ---- Trypsin/factor XIIA inhibitor
Source.1293: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1294: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.1295: DFBPPR5513 ---- Plant proteins ---- Bifunctional TENA2 protein
Source.1296: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.1297: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase
Source.1298: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1
Source.1299: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.1300: DFBPPR5523 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1301: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.1302: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1303: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase
Source.1304: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.1305: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.1306: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.1307: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.1308: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.1309: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1310: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.1311: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.1312: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6
Source.1313: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.1314: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.1315: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3
Source.1316: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.1317: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.1318: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.1319: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic
Source.1320: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9
Source.1321: DFBPPR5626 ---- Plant proteins ---- Single myb histone 6
Source.1322: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1323: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1324: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1325: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.1326: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.1327: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1328: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.1329: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1330: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1
Source.1331: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.1332: DFBPPR5664 ---- Plant proteins ---- Mitochondrial carrier protein CoAc2
Source.1333: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1334: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1335: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein
Source.1336: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.1337: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.1338: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.1339: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.1340: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.1341: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.1342: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.1343: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.1344: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.1345: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.1346: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5
Source.1347: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2
Source.1348: DFBPPR5728 ---- Plant proteins ---- Calreticulin
Source.1349: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.1350: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.1351: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1
Source.1352: DFBPPR5758 ---- Plant proteins ---- DNA-binding protein MNB1B
Source.1353: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1354: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.1355: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.1356: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.1357: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.1358: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase
Source.1359: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B
Source.1360: DFBPPR5801 ---- Plant proteins ---- Inactive 7-epi-sesquithujene synthase
Source.1361: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.1362: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1363: DFBPPR5823 ---- Plant proteins ---- Regulatory protein opaque-2
Source.1364: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.1365: DFBPPR5830 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.1366: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.1367: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1368: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.1369: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.1370: DFBPPR5860 ---- Plant proteins ---- Myb-related protein P
Source.1371: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.1372: DFBPPR5882 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1373: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.1374: DFBPPR5886 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.1375: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3
Source.1376: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.1377: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.1378: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.1379: DFBPPR5915 ---- Plant proteins ---- Homocysteine S-methyltransferase 2
Source.1380: DFBPPR5916 ---- Plant proteins ---- Homocysteine S-methyltransferase 3
Source.1381: DFBPPR5922 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.1382: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1383: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A
Source.1384: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1
Source.1385: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1
Source.1386: DFBPPR5950 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1387: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B
Source.1388: DFBPPR5960 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.1389: DFBPPR5963 ---- Plant proteins ---- Homeobox protein knotted-1-like 5
Source.1390: DFBPPR5965 ---- Plant proteins ---- Homeobox protein knotted-1-like 3
Source.1391: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.1392: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.1393: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3
Source.1394: DFBPPR5991 ---- Plant proteins ---- Myb-related protein Zm38
Source.1395: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1
Source.1396: DFBPPR5998 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.1397: DFBPPR6001 ---- Plant proteins ---- Homeobox protein liguleless 3
Source.1398: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2
Source.1399: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2
Source.1400: DFBPPR6009 ---- Plant proteins ---- CASP-like protein 5C1
Source.1401: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1402: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.1403: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1404: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.1405: DFBPPR6040 ---- Plant proteins ---- Mitotic spindle checkpoint protein MAD2
Source.1406: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.1407: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.1408: DFBPPR6065 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.1409: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1410: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.1411: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1
Source.1412: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.1413: DFBPPR6139 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 3
Source.1414: DFBPPR6145 ---- Plant proteins ---- Ninja-family protein 6
Source.1415: DFBPPR6149 ---- Plant proteins ---- 60S ribosomal protein L17
Source.1416: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.1417: DFBPPR6165 ---- Plant proteins ---- Uncharacterized 33.9 kDa protein in mitochondrial linear 2.3 KB plasmid
Source.1418: DFBPPR6186 ---- Plant proteins ---- Transposable element activator uncharacterized 23 kDa protein
Source.1419: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic
Source.1420: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1421: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.1422: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1423: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic
Source.1424: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1425: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic
Source.1426: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.1427: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.1428: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96
Source.1429: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic
Source.1430: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.1431: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.1432: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.1433: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic
Source.1434: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1435: DFBPPR6270 ---- Plant proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.1436: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.1437: DFBPPR6295 ---- Plant proteins ---- Outer envelope pore protein 37, chloroplastic
Source.1438: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1439: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.1440: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1441: DFBPPR6310 ---- Plant proteins ---- Catalase
Source.1442: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic
Source.1443: DFBPPR6335 ---- Plant proteins ---- Protein CYCLOPS
Source.1444: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.1445: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.1446: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.1447: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5
Source.1448: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.1449: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.1450: DFBPPR6355 ---- Plant proteins ---- Endochitinase
Source.1451: DFBPPR6358 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1452: DFBPPR6380 ---- Plant proteins ---- Legumin A
Source.1453: DFBPPR6391 ---- Plant proteins ---- Cytochrome b6
Source.1454: DFBPPR6421 ---- Plant proteins ---- 50S ribosomal protein L24, chloroplastic
Source.1455: DFBPPR6425 ---- Plant proteins ---- Legumin A2
Source.1456: DFBPPR6453 ---- Plant proteins ---- Convicilin
Source.1457: DFBPPR6458 ---- Plant proteins ---- Convicilin
Source.1458: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA
Source.1459: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.1460: DFBPPR6473 ---- Plant proteins ---- OBERON-like protein
Source.1461: DFBPPR6481 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.1462: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.1463: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.1464: DFBPPR6491 ---- Plant proteins ---- Early nodulin-5
Source.1465: DFBPPR6493 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.1466: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.1467: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.1468: DFBPPR6520 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.1469: DFBPPR6536 ---- Plant proteins ---- 50S ribosomal protein L2, chloroplastic
Source.1470: DFBPPR6559 ---- Plant proteins ---- Truncated basic helix-loop-helix protein A
Source.1471: DFBPPR6560 ---- Plant proteins ---- 60S ribosomal protein L27
Source.1472: DFBPPR6619 ---- Plant proteins ---- Outer envelope protein 80, chloroplastic
Source.1473: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1474: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.1475: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.1476: DFBPPR6639 ---- Plant proteins ---- Puroindoline-A
Source.1477: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D
Source.1478: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.1479: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase
Source.1480: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A
Source.1481: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.1482: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1483: DFBPPR6659 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit
Source.1484: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.1485: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic
Source.1486: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1487: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1488: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.1489: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1490: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B
Source.1491: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A
Source.1492: DFBPPR6687 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1493: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.1494: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase
Source.1495: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.1496: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1
Source.1497: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.1498: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B
Source.1499: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.1500: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1501: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D
Source.1502: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.1503: DFBPPR6760 ---- Plant proteins ---- Probable xyloglucan endotransglucosylase/hydrolase
Source.1504: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.1505: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.1506: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1
Source.1507: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1508: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6
Source.1509: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1510: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1511: DFBPPR6790 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 7
Source.1512: DFBPPR6795 ---- Plant proteins ---- Elongation factor 1-beta
Source.1513: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.1514: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38)
Source.1515: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1516: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1517: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1518: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.1519: DFBPPR6819 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.1520: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1521: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1522: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1523: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.1524: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.1525: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.1526: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.1527: DFBPPR6877 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.1528: DFBPPR6894 ---- Plant proteins ---- Ribosomal protein S7, mitochondrial
Source.1529: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1530: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1531: DFBPPR6951 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.1532: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2
Source.1533: DFBPPR6962 ---- Plant proteins ---- Dehydrin Rab15
Source.1534: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1
Source.1535: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3
Source.1536: DFBPPR6995 ---- Plant proteins ---- HMG1/2-like protein
Source.1537: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.1538: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant
Source.1539: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.1540: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.1541: DFBPPR7013 ---- Plant proteins ---- Protein MLO
Source.1542: DFBPPR7014 ---- Plant proteins ---- Serine carboxypeptidase 1
Source.1543: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2
Source.1544: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic
Source.1545: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1546: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic
Source.1547: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1548: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1549: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic
Source.1550: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.1551: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1552: DFBPPR7047 ---- Plant proteins ---- Hordoindoline-A
Source.1553: DFBPPR7052 ---- Plant proteins ---- Protein synthesis inhibitor II
Source.1554: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.1555: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1556: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1557: DFBPPR7063 ---- Plant proteins ---- Glycine-rich RNA-binding protein blt801
Source.1558: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1559: DFBPPR7072 ---- Plant proteins ---- Protein synthesis inhibitor I
Source.1560: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.1561: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1562: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.1563: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.1564: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.1565: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.1566: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.1567: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.1568: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.1569: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1570: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6
Source.1571: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1572: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.1573: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1574: DFBPPR7139 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1575: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1576: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.1577: DFBPPR7163 ---- Plant proteins ---- Xylose isomerase
Source.1578: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1579: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1580: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.1581: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.1582: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.1583: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1
Source.1584: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic
Source.1585: DFBPPR7270 ---- Plant proteins ---- 50S ribosomal protein L22, chloroplastic
Source.1586: DFBPPR7279 ---- Plant proteins ---- 60 kDa jasmonate-induced protein
Source.1587: DFBPPR7281 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.1588: DFBPPR7286 ---- Plant proteins ---- Myb-related protein Hv1
Source.1589: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33
Source.1590: DFBPPR7298 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1591: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1592: DFBPPR7319 ---- Plant proteins ---- Chloroplast envelope membrane protein
Source.1593: DFBPPR7323 ---- Plant proteins ---- Antifungal protein R
Source.1594: DFBPPR7332 ---- Plant proteins ---- 60S ribosomal protein L17-1
Source.1595: DFBPPR7345 ---- Plant proteins ---- Cold-regulated protein BLT14
Source.1596: DFBPPR7346 ---- Plant proteins ---- 60S ribosomal protein L17-2
Source.1597: DFBPPR7354 ---- Plant proteins ---- Cold-regulated protein 1
Source.1598: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.1599: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.1600: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.1601: DFBPPR7417 ---- Plant proteins ---- Cruciferin
Source.1602: DFBPPR7420 ---- Plant proteins ---- Polygalacturonase
Source.1603: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic
Source.1604: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.1605: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1606: DFBPPR7444 ---- Plant proteins ---- Cruciferin BnC2
Source.1607: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1
Source.1608: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic
Source.1609: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.1610: DFBPPR7490 ---- Plant proteins ---- Cysteine proteinase COT44
Source.1611: DFBPPR7494 ---- Plant proteins ---- Putative ATP synthase protein YMF19
Source.1612: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.1613: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.1614: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.1615: DFBPPR7502 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.1616: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION
Source.1617: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1618: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.1619: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.1620: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.1621: DFBPPR7610 ---- Milk proteins ---- Immunoglobulin heavy constant alpha 2
Source.1622: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.1623: DFBPPR7613 ---- Milk proteins ---- Kunitz-type protease inhibitor 1
Source.1624: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.1625: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.1626: DFBPPR7617 ---- Milk proteins ---- Protein Wnt-2b
Source.1627: DFBPPR7618 ---- Milk proteins ---- Plasminogen
Source.1628: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.1629: DFBPPR7625 ---- Milk proteins ---- Leucine-rich alpha-2-glycoprotein
Source.1630: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.1631: DFBPPR7629 ---- Milk proteins ---- Fibrinogen gamma chain
Source.1632: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.1633: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1
Source.1634: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.1635: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.1636: DFBPPR7654 ---- Milk proteins ---- Kallikrein-12
Source.1637: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.1638: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.1639: DFBPPR7674 ---- Milk proteins ---- Beta-lactoglobulin-2
Source.1640: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.1641: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.1642: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.1643: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.1644: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.1645: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.1646: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1647: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.1648: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon
Source.1649: DFBPPR7737 ---- Plant proteins ---- Endochitinase
Source.1650: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.1651: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.1652: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.1653: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1654: DFBPPR8362 ---- Plant proteins ---- Trypsin inhibitor 2c
Source.1655: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1
Source.1656: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3
Source.1657: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2
Source.1658: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1659: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1660: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase
Source.1661: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B
Source.1662: DFBPPR8403 ---- Plant proteins ---- Endochitinase 3
Source.1663: DFBPPR8404 ---- Plant proteins ---- Endochitinase 1A
Source.1664: DFBPPR8405 ---- Plant proteins ---- Endochitinase 1B
Source.1665: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17
Source.1666: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1667: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1668: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.1669: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase
Source.1670: DFBPPR8464 ---- Plant proteins ---- Cytochrome b559 subunit beta
Source.1671: DFBPPR8468 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1672: DFBPPR8485 ---- Milk proteins ---- Folate receptor alpha
Source.1673: DFBPPR8486 ---- Milk proteins ---- Lactadherin
Source.1674: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.1675: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.1676: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.1677: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.1678: DFBPPR8512 ---- Milk proteins ---- Lysozyme C, milk isozyme
Source.1679: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1680: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.1681: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase
Source.1682: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3
Source.1683: DFBPPR8523 ---- Milk proteins ---- Perilipin-2
Source.1684: DFBPPR15936 ---- Animal proteins ---- Apolipoprotein E
Source.1685: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.1686: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.1687: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.1688: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.1689: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.1690: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.1691: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.1692: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.1693: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1694: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.1695: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T
Source.1696: DFBPPR15978 ---- Animal proteins ---- 7,8-dihydro-8-oxoguanine triphosphatase
Source.1697: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.1698: DFBPPR15989 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.1699: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.1700: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1
Source.1701: DFBPPR15998 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.1702: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.1703: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.1704: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14
Source.1705: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1706: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1707: DFBPPR16021 ---- Animal proteins ---- Vesicular integral-membrane protein VIP36
Source.1708: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.1709: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1710: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.1711: DFBPPR16038 ---- Animal proteins ---- Protein amnionless
Source.1712: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.1713: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.1714: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.1715: DFBPPR16044 ---- Animal proteins ---- High mobility group protein B1
Source.1716: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1717: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.1718: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type
Source.1719: DFBPPR16061 ---- Animal proteins ---- Hepatocyte growth factor
Source.1720: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.1721: DFBPPR16067 ---- Animal proteins ---- CD40 ligand
Source.1722: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.1723: DFBPPR16069 ---- Animal proteins ---- T-cell surface glycoprotein CD4
Source.1724: DFBPPR16083 ---- Animal proteins ---- Annexin A13
Source.1725: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.1726: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.1727: DFBPPR16091 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.1728: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.1729: DFBPPR16094 ---- Animal proteins ---- Mastin
Source.1730: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.1731: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.1732: DFBPPR16103 ---- Animal proteins ---- Laforin
Source.1733: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.1734: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1735: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.1736: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.1737: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1738: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.1739: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.1740: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.1741: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4
Source.1742: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.1743: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.1744: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.1745: DFBPPR16140 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha
Source.1746: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.1747: DFBPPR16145 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.1748: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.1749: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.1750: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.1751: DFBPPR16162 ---- Animal proteins ---- Minor allergen Can f 2
Source.1752: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.1753: DFBPPR16165 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.1754: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.1755: DFBPPR16172 ---- Animal proteins ---- Translocator protein 2
Source.1756: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.1757: DFBPPR16181 ---- Animal proteins ---- Inositol polyphosphate-5-phosphatase A
Source.1758: DFBPPR16183 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase
Source.1759: DFBPPR16185 ---- Animal proteins ---- Cytokine receptor common subunit gamma
Source.1760: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.1761: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1762: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1763: DFBPPR16204 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.1764: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1765: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1766: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11
Source.1767: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.1768: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.1769: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.1770: DFBPPR16223 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.1771: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.1772: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.1773: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72
Source.1774: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.1775: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1776: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta
Source.1777: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1778: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15
Source.1779: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.1780: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.1781: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.1782: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.1783: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.1784: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.1785: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.1786: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.1787: DFBPPR16277 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase
Source.1788: DFBPPR16279 ---- Animal proteins ---- Galactokinase
Source.1789: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1790: DFBPPR16282 ---- Animal proteins ---- COMM domain-containing protein 1
Source.1791: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain
Source.1792: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.1793: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor
Source.1794: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.1795: DFBPPR16306 ---- Animal proteins ---- Ras-related protein Rab-25
Source.1796: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41
Source.1797: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.1798: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.1799: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.1800: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein
Source.1801: DFBPPR16340 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain
Source.1802: DFBPPR16341 ---- Animal proteins ---- Calmegin
Source.1803: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype
Source.1804: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.1805: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1806: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.1807: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.1808: DFBPPR16467 ---- Animal proteins ---- Opticin
Source.1809: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.1810: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.1811: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.1812: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.1813: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.1814: DFBPPR16489 ---- Animal proteins ---- Lymphotoxin-alpha
Source.1815: DFBPPR16491 ---- Animal proteins ---- Heat shock protein beta-1
Source.1816: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.1817: DFBPPR16497 ---- Animal proteins ---- Interleukin-5
Source.1818: DFBPPR16502 ---- Animal proteins ---- Natural killer cells antigen CD94
Source.1819: DFBPPR16503 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.1820: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.1821: DFBPPR16508 ---- Animal proteins ---- Protein crumbs homolog 3
Source.1822: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.1823: DFBPPR16513 ---- Animal proteins ---- Endothelin-1 receptor
Source.1824: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.1825: DFBPPR16537 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.1826: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1827: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2
Source.1828: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.1829: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.1830: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1831: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.1832: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.1833: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.1834: DFBPPR16577 ---- Animal proteins ---- Insulin-like 3
Source.1835: DFBPPR16579 ---- Animal proteins ---- Dynein light chain Tctex-type 3
Source.1836: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2
Source.1837: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.1838: DFBPPR16593 ---- Animal proteins ---- Calcyphosin
Source.1839: DFBPPR16596 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.1840: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype
Source.1841: DFBPPR16609 ---- Animal proteins ---- DLA class II histocompatibility antigen, DR-1 beta chain
Source.1842: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.1843: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.1844: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.1845: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.1846: DFBPPR16656 ---- Animal proteins ---- 60S ribosomal protein L4
Source.1847: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.1848: DFBPPR16703 ---- Animal proteins ---- Beta-defensin 119
Source.1849: DFBPPR16711 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.1850: DFBPPR16718 ---- Animal proteins ---- Zinc finger protein 331
Source.1851: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46
Source.1852: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.1853: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.1854: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor
Source.1855: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase
Source.1856: DFBPPR16801 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.1857: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.1858: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin
Source.1859: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.1860: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1861: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X
Source.1862: DFBPPR16834 ---- Animal proteins ---- Seminal plasma protein PDC-109
Source.1863: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.1864: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.1865: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.1866: DFBPPR16856 ---- Animal proteins ---- Tumor necrosis factor
Source.1867: DFBPPR16865 ---- Animal proteins ---- Apolipoprotein E
Source.1868: DFBPPR16871 ---- Animal proteins ---- Plasminogen
Source.1869: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.1870: DFBPPR16888 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.1871: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.1872: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.1873: DFBPPR16905 ---- Animal proteins ---- Fatty acid-binding protein 5
Source.1874: DFBPPR16906 ---- Animal proteins ---- High mobility group protein B1
Source.1875: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.1876: DFBPPR16909 ---- Animal proteins ---- Calreticulin
Source.1877: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.1878: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.1879: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.1880: DFBPPR16922 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.1881: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial
Source.1882: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.1883: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.1884: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.1885: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.1886: DFBPPR16935 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13
Source.1887: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.1888: DFBPPR16937 ---- Animal proteins ---- GTP:AMP phosphotransferase AK3, mitochondrial
Source.1889: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.1890: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.1891: DFBPPR16944 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase 2, cytoplasmic
Source.1892: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.1893: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin
Source.1894: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.1895: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.1896: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.1897: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.1898: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.1899: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase
Source.1900: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3
Source.1901: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.1902: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.1903: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.1904: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.1905: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1
Source.1906: DFBPPR17005 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5
Source.1907: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial
Source.1908: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2
Source.1909: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.1910: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.1911: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.1912: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.1913: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1914: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.1915: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.1916: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D
Source.1917: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1918: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.1919: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.1920: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.1921: DFBPPR17068 ---- Animal proteins ---- Mitogen-activated protein kinase 1
Source.1922: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.1923: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.1924: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.1925: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.1926: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.1927: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1
Source.1928: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.1929: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.1930: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A
Source.1931: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2
Source.1932: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.1933: DFBPPR17125 ---- Animal proteins ---- Guanine nucleotide-binding protein G(s) subunit alpha isoforms short
Source.1934: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1935: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta
Source.1936: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.1937: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.1938: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.1939: DFBPPR17172 ---- Animal proteins ---- Cartilage oligomeric matrix protein
Source.1940: DFBPPR17186 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.1941: DFBPPR17187 ---- Animal proteins ---- Ribonuclease K6
Source.1942: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.1943: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.1944: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.1945: DFBPPR17204 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.1946: DFBPPR17228 ---- Animal proteins ---- Lanosterol synthase
Source.1947: DFBPPR17231 ---- Animal proteins ---- Protein sprouty homolog 2
Source.1948: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.1949: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.1950: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.1951: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.1952: DFBPPR17273 ---- Animal proteins ---- Integrin-linked protein kinase
Source.1953: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1
Source.1954: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.1955: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7
Source.1956: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.1957: DFBPPR17300 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.1958: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial
Source.1959: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.1960: DFBPPR17309 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1
Source.1961: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.1962: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.1963: DFBPPR17320 ---- Animal proteins ---- Acid ceramidase
Source.1964: DFBPPR17324 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.1965: DFBPPR17325 ---- Animal proteins ---- Macrophage scavenger receptor types I and II
Source.1966: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.1967: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.1968: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.1969: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1970: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.1971: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.1972: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.1973: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.1974: DFBPPR17358 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.1975: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1
Source.1976: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.1977: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.1978: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.1979: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36
Source.1980: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.1981: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.1982: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD
Source.1983: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3
Source.1984: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2
Source.1985: DFBPPR17402 ---- Animal proteins ---- High mobility group protein B2
Source.1986: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.1987: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.1988: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type
Source.1989: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.1990: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial
Source.1991: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.1992: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.1993: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.1994: DFBPPR17432 ---- Animal proteins ---- Ephrin-A1
Source.1995: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.1996: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.1997: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.1998: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.1999: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.2000: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.2001: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2002: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1
Source.2003: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.2004: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.2005: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.2006: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1
Source.2007: DFBPPR17485 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain
Source.2008: DFBPPR17488 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.2009: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.2010: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.2011: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C
Source.2012: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.2013: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.2014: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.2015: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.2016: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.2017: DFBPPR17516 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.2018: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.2019: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3
Source.2020: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.2021: DFBPPR17530 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.2022: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.2023: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.2024: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.2025: DFBPPR17542 ---- Animal proteins ---- Acetylcholine receptor subunit beta
Source.2026: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1
Source.2027: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.2028: DFBPPR17552 ---- Animal proteins ---- Ceramide synthase 4
Source.2029: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog
Source.2030: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.2031: DFBPPR17561 ---- Animal proteins ---- Aquaporin-4
Source.2032: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.2033: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.2034: DFBPPR17583 ---- Animal proteins ---- Cathelicidin-1
Source.2035: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.2036: DFBPPR17594 ---- Animal proteins ---- E-selectin
Source.2037: DFBPPR17607 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 7
Source.2038: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.2039: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.2040: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.2041: DFBPPR17648 ---- Animal proteins ---- NAD-capped RNA hydrolase NUDT12
Source.2042: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.2043: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.2044: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1
Source.2045: DFBPPR17663 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 4, mitochondrial
Source.2046: DFBPPR17666 ---- Animal proteins ---- Diphosphoinositol polyphosphate phosphohydrolase 3-beta
Source.2047: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2
Source.2048: DFBPPR17676 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.2049: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2
Source.2050: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.2051: DFBPPR17692 ---- Animal proteins ---- Adenylate kinase 4, mitochondrial
Source.2052: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.2053: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.2054: DFBPPR17727 ---- Animal proteins ---- Insulin-like 3
Source.2055: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.2056: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1
Source.2057: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.2058: DFBPPR17758 ---- Animal proteins ---- Matrix Gla protein
Source.2059: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.2060: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3
Source.2061: DFBPPR17774 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.2062: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.2063: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.2064: DFBPPR17786 ---- Animal proteins ---- Cathelicidin-4
Source.2065: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.2066: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.2067: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.2068: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.2069: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.2070: DFBPPR17812 ---- Animal proteins ---- Dynein light chain Tctex-type 1
Source.2071: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.2072: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase
Source.2073: DFBPPR17824 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 9
Source.2074: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.2075: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.2076: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.2077: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1
Source.2078: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B
Source.2079: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.2080: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3
Source.2081: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.2082: DFBPPR17855 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.2083: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.2084: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.2085: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.2086: DFBPPR17871 ---- Animal proteins ---- Ras-related protein Rab-11B
Source.2087: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.2088: DFBPPR17874 ---- Animal proteins ---- Endonuclease 8-like 2
Source.2089: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.2090: DFBPPR17882 ---- Animal proteins ---- Heat shock protein beta-1
Source.2091: DFBPPR17883 ---- Animal proteins ---- Sialidase-1
Source.2092: DFBPPR17884 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase
Source.2093: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.2094: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.2095: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.2096: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial
Source.2097: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.2098: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein
Source.2099: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.2100: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A
Source.2101: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.2102: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.2103: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2
Source.2104: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT
Source.2105: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.2106: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.2107: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.2108: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA
Source.2109: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.2110: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.2111: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.2112: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1
Source.2113: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.2114: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.2115: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.2116: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein
Source.2117: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.2118: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.2119: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.2120: DFBPPR17996 ---- Animal proteins ---- UDP-N-acetylglucosamine--dolichyl-phosphate N-acetylglucosaminephosphotransferase
Source.2121: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.2122: DFBPPR18013 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.2123: DFBPPR18016 ---- Animal proteins ---- Protein Wnt-2
Source.2124: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.2125: DFBPPR18033 ---- Animal proteins ---- Cathelicidin-3
Source.2126: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.2127: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase
Source.2128: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.2129: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.2130: DFBPPR18062 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 G2
Source.2131: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.2132: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1
Source.2133: DFBPPR18087 ---- Animal proteins ---- Endothelin-1 receptor
Source.2134: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2135: DFBPPR18094 ---- Animal proteins ---- Neutrophil cytosol factor 1
Source.2136: DFBPPR18097 ---- Animal proteins ---- Deoxycytidine kinase
Source.2137: DFBPPR18100 ---- Animal proteins ---- Derlin-1
Source.2138: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.2139: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.2140: DFBPPR18111 ---- Animal proteins ---- Transcriptional adapter 3
Source.2141: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23
Source.2142: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.2143: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.2144: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.2145: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.2146: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.2147: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.2148: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.2149: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1
Source.2150: DFBPPR18142 ---- Animal proteins ---- Protein CASC3
Source.2151: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain
Source.2152: DFBPPR18158 ---- Animal proteins ---- Coagulation factor XII
Source.2153: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1
Source.2154: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.2155: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.2156: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.2157: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1
Source.2158: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.2159: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25
Source.2160: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.2161: DFBPPR18216 ---- Animal proteins ---- Collectin-12
Source.2162: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.2163: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.2164: DFBPPR18228 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.2165: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.2166: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.2167: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3
Source.2168: DFBPPR18241 ---- Animal proteins ---- Seminal plasma protein BSP-30 kDa
Source.2169: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi
Source.2170: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.2171: DFBPPR18246 ---- Animal proteins ---- High mobility group protein B3
Source.2172: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7
Source.2173: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6
Source.2174: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial
Source.2175: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.2176: DFBPPR18297 ---- Animal proteins ---- Casein kinase I isoform beta
Source.2177: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.2178: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.2179: DFBPPR18313 ---- Animal proteins ---- Septin-12
Source.2180: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.2181: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.2182: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon
Source.2183: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.2184: DFBPPR18332 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.2185: DFBPPR18334 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.2186: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1
Source.2187: DFBPPR18343 ---- Animal proteins ---- Inositol polyphosphate 1-phosphatase
Source.2188: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.2189: DFBPPR18345 ---- Animal proteins ---- Desmocollin-2
Source.2190: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.2191: DFBPPR18350 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.2192: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase
Source.2193: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3
Source.2194: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.2195: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.2196: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.2197: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.2198: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.2199: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3
Source.2200: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.2201: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z
Source.2202: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.2203: DFBPPR18395 ---- Animal proteins ---- Galactosylceramide sulfotransferase
Source.2204: DFBPPR18397 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4
Source.2205: DFBPPR18401 ---- Animal proteins ---- Protrudin
Source.2206: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3
Source.2207: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain
Source.2208: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1
Source.2209: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.2210: DFBPPR18416 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6
Source.2211: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.2212: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.2213: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.2214: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.2215: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.2216: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16
Source.2217: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.2218: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin
Source.2219: DFBPPR18433 ---- Animal proteins ---- Basigin
Source.2220: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1
Source.2221: DFBPPR18439 ---- Animal proteins ---- Retinol dehydrogenase 12
Source.2222: DFBPPR18443 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase
Source.2223: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.2224: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.2225: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.2226: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1
Source.2227: DFBPPR18457 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.2228: DFBPPR18464 ---- Animal proteins ---- Regucalcin
Source.2229: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor
Source.2230: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.2231: DFBPPR18471 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF113A
Source.2232: DFBPPR18473 ---- Animal proteins ---- Sharpin
Source.2233: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.2234: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.2235: DFBPPR18479 ---- Animal proteins ---- Pyruvate dehydrogenase protein X component
Source.2236: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein
Source.2237: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.2238: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase
Source.2239: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.2240: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5
Source.2241: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8
Source.2242: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.2243: DFBPPR18520 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.2244: DFBPPR18524 ---- Animal proteins ---- Beta-defensin 5
Source.2245: DFBPPR18526 ---- Animal proteins ---- Beta-defensin 4
Source.2246: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.2247: DFBPPR18540 ---- Animal proteins ---- Fibroblast growth factor-binding protein 1
Source.2248: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.2249: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.2250: DFBPPR18552 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 8
Source.2251: DFBPPR18558 ---- Animal proteins ---- Troponin T, cardiac muscle
Source.2252: DFBPPR18562 ---- Animal proteins ---- Neuronal calcium sensor 1
Source.2253: DFBPPR18566 ---- Animal proteins ---- Cytochrome c oxidase subunit 5A, mitochondrial
Source.2254: DFBPPR18572 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.2255: DFBPPR18581 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 7
Source.2256: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.2257: DFBPPR18600 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B
Source.2258: DFBPPR18603 ---- Animal proteins ---- Sodium channel subunit beta-4
Source.2259: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.2260: DFBPPR18609 ---- Animal proteins ---- ERO1-like protein alpha
Source.2261: DFBPPR18610 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.2262: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2263: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.2264: DFBPPR18626 ---- Animal proteins ---- Thymidylate synthase
Source.2265: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4
Source.2266: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.2267: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.2268: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.2269: DFBPPR18653 ---- Animal proteins ---- Palmitoyltransferase ZDHHC21
Source.2270: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.2271: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.2272: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.2273: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.2274: DFBPPR18718 ---- Animal proteins ---- Chondroadherin
Source.2275: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.2276: DFBPPR18723 ---- Animal proteins ---- Methionine aminopeptidase 2
Source.2277: DFBPPR18726 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF2
Source.2278: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.2279: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.2280: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.2281: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.2282: DFBPPR18756 ---- Animal proteins ---- Eukaryotic translation initiation factor 4E
Source.2283: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase
Source.2284: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.2285: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein
Source.2286: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1
Source.2287: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4
Source.2288: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.2289: DFBPPR18788 ---- Animal proteins ---- Ceramide-1-phosphate transfer protein
Source.2290: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.2291: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.2292: DFBPPR18814 ---- Animal proteins ---- Sulfotransferase 1A1
Source.2293: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.2294: DFBPPR18830 ---- Animal proteins ---- Gamma-secretase subunit PEN-2
Source.2295: DFBPPR18832 ---- Animal proteins ---- Shiftless antiviral inhibitor of ribosomal frameshifting protein homolog
Source.2296: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1
Source.2297: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.2298: DFBPPR18838 ---- Animal proteins ---- N-acetylglucosamine-1-phosphotransferase subunit gamma
Source.2299: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.2300: DFBPPR18847 ---- Animal proteins ---- Heme oxygenase 1
Source.2301: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A
Source.2302: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8
Source.2303: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.2304: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.2305: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.2306: DFBPPR18868 ---- Animal proteins ---- Haptoglobin
Source.2307: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.2308: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1
Source.2309: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.2310: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20
Source.2311: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase
Source.2312: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.2313: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless
Source.2314: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED
Source.2315: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.2316: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.2317: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.2318: DFBPPR18927 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 5
Source.2319: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.2320: DFBPPR18932 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase delta
Source.2321: DFBPPR18940 ---- Animal proteins ---- Mitogen-activated protein kinase 13
Source.2322: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.2323: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.2324: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3
Source.2325: DFBPPR18952 ---- Animal proteins ---- Serotransferrin
Source.2326: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma
Source.2327: DFBPPR18955 ---- Animal proteins ---- Lymphotoxin-alpha
Source.2328: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.2329: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.2330: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase
Source.2331: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb
Source.2332: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.2333: DFBPPR18980 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.2334: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.2335: DFBPPR18989 ---- Animal proteins ---- Secreted frizzled-related protein 5
Source.2336: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6
Source.2337: DFBPPR18998 ---- Animal proteins ---- E3 ubiquitin-protein ligase ZNRF1
Source.2338: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746
Source.2339: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D
Source.2340: DFBPPR19019 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.2341: DFBPPR19022 ---- Animal proteins ---- Spermatogenesis-defective protein 39 homolog
Source.2342: DFBPPR19024 ---- Animal proteins ---- UDP-glucose 4-epimerase
Source.2343: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1
Source.2344: DFBPPR19027 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E
Source.2345: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.2346: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2
Source.2347: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.2348: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.2349: DFBPPR19058 ---- Animal proteins ---- Phosphatidylserine decarboxylase proenzyme, mitochondrial
Source.2350: DFBPPR19059 ---- Animal proteins ---- Lysozyme C, non-stomach isozyme
Source.2351: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B
Source.2352: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.2353: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta
Source.2354: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.2355: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.2356: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5
Source.2357: DFBPPR19072 ---- Animal proteins ---- Growth/differentiation factor 9
Source.2358: DFBPPR19076 ---- Animal proteins ---- Protein MGARP
Source.2359: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1
Source.2360: DFBPPR19079 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.2361: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3
Source.2362: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.2363: DFBPPR19087 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.2364: DFBPPR19098 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 9
Source.2365: DFBPPR19105 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein
Source.2366: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.2367: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2
Source.2368: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.2369: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8
Source.2370: DFBPPR19152 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF186
Source.2371: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2
Source.2372: DFBPPR19157 ---- Animal proteins ---- Endothelial cell-specific chemotaxis regulator
Source.2373: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.2374: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16
Source.2375: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone
Source.2376: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase
Source.2377: DFBPPR19186 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.2378: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.2379: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4
Source.2380: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.2381: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.2382: DFBPPR19203 ---- Animal proteins ---- Mitochondrial inner membrane protease subunit 2
Source.2383: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7
Source.2384: DFBPPR19208 ---- Animal proteins ---- Sushi repeat-containing protein SRPX2
Source.2385: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase
Source.2386: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.2387: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.2388: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.2389: DFBPPR19225 ---- Animal proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase
Source.2390: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase
Source.2391: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A
Source.2392: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.2393: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.2394: DFBPPR19247 ---- Animal proteins ---- Calmegin
Source.2395: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.2396: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.2397: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3
Source.2398: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.2399: DFBPPR19261 ---- Animal proteins ---- Transcription factor ETV6
Source.2400: DFBPPR19269 ---- Animal proteins ---- HCLS1-associated protein X-1
Source.2401: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.2402: DFBPPR19273 ---- Animal proteins ---- Protein BEX3
Source.2403: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1
Source.2404: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.2405: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1
Source.2406: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33
Source.2407: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.2408: DFBPPR19287 ---- Animal proteins ---- Rab-like protein 3
Source.2409: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.2410: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1
Source.2411: DFBPPR19291 ---- Animal proteins ---- Multicilin
Source.2412: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.2413: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D
Source.2414: DFBPPR19305 ---- Animal proteins ---- Beta-crystallin B3
Source.2415: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1
Source.2416: DFBPPR19313 ---- Animal proteins ---- Vitamin K epoxide reductase complex subunit 1
Source.2417: DFBPPR19318 ---- Animal proteins ---- Ubiquinone biosynthesis O-methyltransferase, mitochondrial
Source.2418: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial
Source.2419: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2
Source.2420: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2
Source.2421: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85
Source.2422: DFBPPR19331 ---- Animal proteins ---- Cathelicidin-6
Source.2423: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.2424: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1
Source.2425: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.2426: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9
Source.2427: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.2428: DFBPPR19353 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.2429: DFBPPR19358 ---- Animal proteins ---- Beta-crystallin A3
Source.2430: DFBPPR19366 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.2431: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.2432: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.2433: DFBPPR19381 ---- Animal proteins ---- BRCA2 and CDKN1A-interacting protein
Source.2434: DFBPPR19385 ---- Animal proteins ---- Cathelicidin-5
Source.2435: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2
Source.2436: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1
Source.2437: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.2438: DFBPPR19402 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.2439: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.2440: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein
Source.2441: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.2442: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1
Source.2443: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.2444: DFBPPR19428 ---- Animal proteins ---- CAAX prenyl protease 2
Source.2445: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70
Source.2446: DFBPPR19439 ---- Animal proteins ---- Adenylate kinase isoenzyme 6
Source.2447: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2
Source.2448: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.2449: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.2450: DFBPPR19450 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J
Source.2451: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.2452: DFBPPR19453 ---- Animal proteins ---- Peptidyl-tRNA hydrolase ICT1, mitochondrial
Source.2453: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.2454: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.2455: DFBPPR19463 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide VF
Source.2456: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.2457: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.2458: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.2459: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.2460: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase
Source.2461: DFBPPR19489 ---- Animal proteins ---- Keratocan
Source.2462: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.2463: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.2464: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.2465: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase
Source.2466: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2
Source.2467: DFBPPR19521 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 12
Source.2468: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.2469: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.2470: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3
Source.2471: DFBPPR19540 ---- Animal proteins ---- Beta-defensin 6
Source.2472: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.2473: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3
Source.2474: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.2475: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.2476: DFBPPR19558 ---- Animal proteins ---- Polynucleotide 5'-hydroxyl-kinase NOL9
Source.2477: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.2478: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.2479: DFBPPR19563 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit K
Source.2480: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.2481: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2482: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.2483: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.2484: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20
Source.2485: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial
Source.2486: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.2487: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.2488: DFBPPR19589 ---- Animal proteins ---- 3-oxo-5-alpha-steroid 4-dehydrogenase 1
Source.2489: DFBPPR19597 ---- Animal proteins ---- Protein HEXIM1
Source.2490: DFBPPR19599 ---- Animal proteins ---- Thrombomodulin
Source.2491: DFBPPR19602 ---- Animal proteins ---- Dynactin subunit 3
Source.2492: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein
Source.2493: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.2494: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.2495: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2
Source.2496: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.2497: DFBPPR19640 ---- Animal proteins ---- Prolargin
Source.2498: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.2499: DFBPPR19648 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit
Source.2500: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.2501: DFBPPR19659 ---- Animal proteins ---- 39S ribosomal protein L9, mitochondrial
Source.2502: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator
Source.2503: DFBPPR19662 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit beta-1
Source.2504: DFBPPR19664 ---- Animal proteins ---- Protein OS-9
Source.2505: DFBPPR19665 ---- Animal proteins ---- Thioredoxin, mitochondrial
Source.2506: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.2507: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2
Source.2508: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor
Source.2509: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.2510: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3
Source.2511: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10
Source.2512: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.2513: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.2514: DFBPPR19727 ---- Animal proteins ---- Protein SGT1 homolog
Source.2515: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.2516: DFBPPR19738 ---- Animal proteins ---- Translocator protein
Source.2517: DFBPPR19740 ---- Animal proteins ---- Sin3 histone deacetylase corepressor complex component SDS3
Source.2518: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2
Source.2519: DFBPPR19760 ---- Animal proteins ---- Protein phosphatase 1K, mitochondrial
Source.2520: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1
Source.2521: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase
Source.2522: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.2523: DFBPPR19779 ---- Animal proteins ---- Hepatocyte nuclear factor 3-gamma
Source.2524: DFBPPR19785 ---- Animal proteins ---- Calcyclin-binding protein
Source.2525: DFBPPR19787 ---- Animal proteins ---- 60S ribosomal protein L11
Source.2526: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.2527: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4
Source.2528: DFBPPR19797 ---- Animal proteins ---- Inactive serine/threonine-protein kinase VRK3
Source.2529: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.2530: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.2531: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.2532: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein
Source.2533: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.2534: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial
Source.2535: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.2536: DFBPPR19830 ---- Animal proteins ---- Sesquipedalian-2
Source.2537: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.2538: DFBPPR19844 ---- Animal proteins ---- Prosalusin
Source.2539: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C
Source.2540: DFBPPR19848 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.2541: DFBPPR19851 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.2542: DFBPPR19854 ---- Animal proteins ---- Nuclear migration protein nudC
Source.2543: DFBPPR19855 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.2544: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.2545: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.2546: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14
Source.2547: DFBPPR19882 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.2548: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial
Source.2549: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta
Source.2550: DFBPPR19893 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3
Source.2551: DFBPPR19896 ---- Animal proteins ---- Poly(U)-binding-splicing factor PUF60
Source.2552: DFBPPR19897 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial
Source.2553: DFBPPR19898 ---- Animal proteins ---- Essential MCU regulator, mitochondrial
Source.2554: DFBPPR19902 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.2555: DFBPPR19911 ---- Animal proteins ---- Guided entry of tail-anchored proteins factor 1
Source.2556: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial
Source.2557: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.2558: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.2559: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.2560: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase
Source.2561: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1
Source.2562: DFBPPR19933 ---- Animal proteins ---- Oligoribonuclease, mitochondrial
Source.2563: DFBPPR19937 ---- Animal proteins ---- Prostamide/prostaglandin F synthase
Source.2564: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80
Source.2565: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1
Source.2566: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.2567: DFBPPR19962 ---- Animal proteins ---- Troponin T, slow skeletal muscle
Source.2568: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2
Source.2569: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.2570: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.2571: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.2572: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3
Source.2573: DFBPPR19993 ---- Animal proteins ---- MRN complex-interacting protein
Source.2574: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1
Source.2575: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.2576: DFBPPR20006 ---- Animal proteins ---- Protein Abitram
Source.2577: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.2578: DFBPPR20026 ---- Animal proteins ---- Mitochondrial ribosome-associated GTPase 1
Source.2579: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4
Source.2580: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta
Source.2581: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.2582: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase
Source.2583: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1
Source.2584: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.2585: DFBPPR20051 ---- Animal proteins ---- 28S ribosomal protein S18a, mitochondrial
Source.2586: DFBPPR20064 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical]
Source.2587: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.2588: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.2589: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26
Source.2590: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4
Source.2591: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.2592: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.2593: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.2594: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1
Source.2595: DFBPPR20103 ---- Animal proteins ---- Protein MAL2
Source.2596: DFBPPR20107 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 11, mitochondrial
Source.2597: DFBPPR20126 ---- Animal proteins ---- 39S ribosomal protein L44, mitochondrial
Source.2598: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.2599: DFBPPR20153 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.2600: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.2601: DFBPPR20170 ---- Animal proteins ---- EEF1A lysine methyltransferase 4
Source.2602: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.2603: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7
Source.2604: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.2605: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.2606: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial
Source.2607: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B
Source.2608: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1
Source.2609: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.2610: DFBPPR20221 ---- Animal proteins ---- CD99 antigen-like protein 2
Source.2611: DFBPPR20223 ---- Animal proteins ---- Protein cereblon
Source.2612: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.2613: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase
Source.2614: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1
Source.2615: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.2616: DFBPPR20258 ---- Animal proteins ---- Ribosome biogenesis regulatory protein homolog
Source.2617: DFBPPR20267 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.2618: DFBPPR20269 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor
Source.2619: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1
Source.2620: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.2621: DFBPPR20279 ---- Animal proteins ---- Lysozyme-like protein 4
Source.2622: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2
Source.2623: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158
Source.2624: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.2625: DFBPPR20288 ---- Animal proteins ---- Golgi phosphoprotein 3-like
Source.2626: DFBPPR20290 ---- Animal proteins ---- Dynein light chain 1, axonemal
Source.2627: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.2628: DFBPPR20304 ---- Animal proteins ---- Nuclear envelope phosphatase-regulatory subunit 1
Source.2629: DFBPPR20309 ---- Animal proteins ---- Cell death activator CIDE-3
Source.2630: DFBPPR20316 ---- Animal proteins ---- Rho-related GTP-binding protein RhoV
Source.2631: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2
Source.2632: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27
Source.2633: DFBPPR20344 ---- Animal proteins ---- Dynactin subunit 2
Source.2634: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.2635: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein
Source.2636: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.2637: DFBPPR20358 ---- Animal proteins ---- 39S ribosomal protein L34, mitochondrial
Source.2638: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.2639: DFBPPR20362 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase
Source.2640: DFBPPR20364 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3
Source.2641: DFBPPR20365 ---- Animal proteins ---- Interleukin-21
Source.2642: DFBPPR20367 ---- Animal proteins ---- Follistatin-related protein 1
Source.2643: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4
Source.2644: DFBPPR20383 ---- Animal proteins ---- Alpha-ketoglutarate-dependent dioxygenase alkB homolog 7, mitochondrial
Source.2645: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.2646: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2
Source.2647: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.2648: DFBPPR20406 ---- Animal proteins ---- 28S ribosomal protein S11, mitochondrial
Source.2649: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.2650: DFBPPR20415 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9
Source.2651: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.2652: DFBPPR20420 ---- Animal proteins ---- Hepatocyte growth factor
Source.2653: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.2654: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase
Source.2655: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.2656: DFBPPR20454 ---- Animal proteins ---- DNA polymerase delta subunit 2
Source.2657: DFBPPR20471 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.2658: DFBPPR20485 ---- Animal proteins ---- Beta-crystallin A2
Source.2659: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.2660: DFBPPR20495 ---- Animal proteins ---- Spliceosome-associated protein CWC15 homolog
Source.2661: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2
Source.2662: DFBPPR20498 ---- Animal proteins ---- Protein sprouty homolog 4
Source.2663: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.2664: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.2665: DFBPPR20512 ---- Animal proteins ---- Transcription elongation factor A protein 2
Source.2666: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36
Source.2667: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.2668: DFBPPR20540 ---- Animal proteins ---- Structure-specific endonuclease subunit SLX1
Source.2669: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.2670: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.2671: DFBPPR20558 ---- Animal proteins ---- N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase
Source.2672: DFBPPR20568 ---- Animal proteins ---- Phenazine biosynthesis-like domain-containing protein
Source.2673: DFBPPR20578 ---- Animal proteins ---- Protein rogdi homolog
Source.2674: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein
Source.2675: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.2676: DFBPPR20591 ---- Animal proteins ---- WD repeat-containing protein 74
Source.2677: DFBPPR20595 ---- Animal proteins ---- LHFPL tetraspan subfamily member 4 protein
Source.2678: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2
Source.2679: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.2680: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.2681: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.2682: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13
Source.2683: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.2684: DFBPPR20635 ---- Animal proteins ---- Transcription elongation factor A protein 1
Source.2685: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.2686: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.2687: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.2688: DFBPPR20659 ---- Animal proteins ---- Cystinosin
Source.2689: DFBPPR20664 ---- Animal proteins ---- General transcription factor IIH subunit 2
Source.2690: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.2691: DFBPPR20666 ---- Animal proteins ---- Tektin-2
Source.2692: DFBPPR20671 ---- Animal proteins ---- 39S ribosomal protein L27, mitochondrial
Source.2693: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.2694: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.2695: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.2696: DFBPPR20689 ---- Animal proteins ---- 28S ribosomal protein S14, mitochondrial
Source.2697: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12
Source.2698: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.2699: DFBPPR20704 ---- Animal proteins ---- C-X-C motif chemokine 17
Source.2700: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1
Source.2701: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.2702: DFBPPR20711 ---- Animal proteins ---- Transcription elongation factor, mitochondrial
Source.2703: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A
Source.2704: DFBPPR20714 ---- Animal proteins ---- Phosphomevalonate kinase
Source.2705: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21
Source.2706: DFBPPR20720 ---- Animal proteins ---- BoLa class II histocompatibility antigen, DQB*0101 beta chain
Source.2707: DFBPPR20723 ---- Animal proteins ---- Histamine N-methyltransferase
Source.2708: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4
Source.2709: DFBPPR20728 ---- Animal proteins ---- Serine protease 45
Source.2710: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.2711: DFBPPR20738 ---- Animal proteins ---- Ferritin, mitochondrial
Source.2712: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog
Source.2713: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9
Source.2714: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.2715: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2716: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2
Source.2717: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14
Source.2718: DFBPPR20817 ---- Animal proteins ---- 60S ribosomal protein L3
Source.2719: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.2720: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.2721: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2
Source.2722: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12
Source.2723: DFBPPR20835 ---- Animal proteins ---- TBC1 domain family member 24
Source.2724: DFBPPR20838 ---- Animal proteins ---- Cytochrome c oxidase subunit 6B2
Source.2725: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1
Source.2726: DFBPPR20845 ---- Animal proteins ---- Solute carrier family 22 member 9
Source.2727: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.2728: DFBPPR20853 ---- Animal proteins ---- Hemopexin
Source.2729: DFBPPR20860 ---- Animal proteins ---- Vesicle-associated membrane protein 5
Source.2730: DFBPPR20864 ---- Animal proteins ---- Polycomb group RING finger protein 5
Source.2731: DFBPPR20865 ---- Animal proteins ---- Methionine adenosyltransferase 2 subunit beta
Source.2732: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1
Source.2733: DFBPPR20875 ---- Animal proteins ---- Protein tweety homolog 1
Source.2734: DFBPPR20878 ---- Animal proteins ---- Protein SMG9
Source.2735: DFBPPR20887 ---- Animal proteins ---- UAP56-interacting factor
Source.2736: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.2737: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein
Source.2738: DFBPPR20898 ---- Animal proteins ---- Transaldolase
Source.2739: DFBPPR20900 ---- Animal proteins ---- F-box/LRR-repeat protein 12
Source.2740: DFBPPR20902 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 2 homolog
Source.2741: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.2742: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta
Source.2743: DFBPPR20935 ---- Animal proteins ---- Peroxisomal membrane protein 11A
Source.2744: DFBPPR20942 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.2745: DFBPPR20944 ---- Animal proteins ---- Pikachurin
Source.2746: DFBPPR20948 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 9
Source.2747: DFBPPR20956 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC10
Source.2748: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.2749: DFBPPR20975 ---- Animal proteins ---- 39S ribosomal protein L2, mitochondrial
Source.2750: DFBPPR20976 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.2751: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3
Source.2752: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.2753: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1
Source.2754: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7
Source.2755: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1
Source.2756: DFBPPR20995 ---- Animal proteins ---- Zinc finger protein 181
Source.2757: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B
Source.2758: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.2759: DFBPPR21017 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 26
Source.2760: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17
Source.2761: DFBPPR21028 ---- Animal proteins ---- Growth arrest and DNA damage-inducible proteins-interacting protein 1
Source.2762: DFBPPR21030 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit C
Source.2763: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial
Source.2764: DFBPPR21038 ---- Animal proteins ---- Sodium channel modifier 1
Source.2765: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.2766: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.2767: DFBPPR21056 ---- Animal proteins ---- Ras-like protein family member 11B
Source.2768: DFBPPR21057 ---- Animal proteins ---- KICSTOR complex protein ITFG2
Source.2769: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.2770: DFBPPR21072 ---- Animal proteins ---- 39S ribosomal protein L42, mitochondrial
Source.2771: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A
Source.2772: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1
Source.2773: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor
Source.2774: DFBPPR21100 ---- Animal proteins ---- Cochlin
Source.2775: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.2776: DFBPPR21116 ---- Animal proteins ---- Suppressor of cytokine signaling 5
Source.2777: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.2778: DFBPPR21133 ---- Animal proteins ---- Polycomb group RING finger protein 3
Source.2779: DFBPPR21139 ---- Animal proteins ---- Transcription elongation factor A protein 3
Source.2780: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.2781: DFBPPR21143 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 3 homolog
Source.2782: DFBPPR21151 ---- Animal proteins ---- Zinc finger protein 350
Source.2783: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.2784: DFBPPR21170 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 8A
Source.2785: DFBPPR21172 ---- Animal proteins ---- G-protein coupled receptor 52
Source.2786: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.2787: DFBPPR21193 ---- Animal proteins ---- Protein Wnt-16
Source.2788: DFBPPR21206 ---- Animal proteins ---- D-dopachrome decarboxylase
Source.2789: DFBPPR21213 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.2790: DFBPPR21214 ---- Animal proteins ---- Prostate tumor-overexpressed gene 1 protein homolog
Source.2791: DFBPPR21218 ---- Animal proteins ---- B-cell receptor-associated protein 29
Source.2792: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.2793: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.2794: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4
Source.2795: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.2796: DFBPPR21240 ---- Animal proteins ---- 6-phosphogluconolactonase
Source.2797: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.2798: DFBPPR21244 ---- Animal proteins ---- RELT-like protein 1
Source.2799: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal
Source.2800: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5
Source.2801: DFBPPR21248 ---- Animal proteins ---- 39S ribosomal protein L4, mitochondrial
Source.2802: DFBPPR21250 ---- Animal proteins ---- Enteric beta-defensin
Source.2803: DFBPPR21257 ---- Animal proteins ---- Mesoderm induction early response protein 2
Source.2804: DFBPPR21270 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim21
Source.2805: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.2806: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11
Source.2807: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1
Source.2808: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6
Source.2809: DFBPPR21286 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM7 homolog
Source.2810: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2
Source.2811: DFBPPR21294 ---- Animal proteins ---- Actin filament-associated protein 1-like 1
Source.2812: DFBPPR21297 ---- Animal proteins ---- 39S ribosomal protein L30, mitochondrial
Source.2813: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial
Source.2814: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.2815: DFBPPR21318 ---- Animal proteins ---- Troponin T, fast skeletal muscle
Source.2816: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4
Source.2817: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.2818: DFBPPR21343 ---- Animal proteins ---- DNA polymerase delta subunit 4
Source.2819: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein
Source.2820: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.2821: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.2822: DFBPPR21356 ---- Animal proteins ---- Sideroflexin-2
Source.2823: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1
Source.2824: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.2825: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24
Source.2826: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.2827: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.2828: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.2829: DFBPPR21389 ---- Animal proteins ---- N-terminal EF-hand calcium-binding protein 3
Source.2830: DFBPPR21398 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.2831: DFBPPR21401 ---- Animal proteins ---- THAP domain-containing protein 5
Source.2832: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog
Source.2833: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.2834: DFBPPR21428 ---- Animal proteins ---- Protein LBH
Source.2835: DFBPPR21433 ---- Animal proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.2836: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.2837: DFBPPR21446 ---- Animal proteins ---- Spermatid-specific manchette-related protein 1
Source.2838: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.2839: DFBPPR21460 ---- Animal proteins ---- SREBP regulating gene protein
Source.2840: DFBPPR21462 ---- Animal proteins ---- Vesicle transport protein GOT1A
Source.2841: DFBPPR21463 ---- Animal proteins ---- Protein BEX2
Source.2842: DFBPPR21469 ---- Animal proteins ---- Probable glutathione peroxidase 8
Source.2843: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.2844: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.2845: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.2846: DFBPPR21476 ---- Animal proteins ---- Lipase maturation factor 1
Source.2847: DFBPPR21477 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 35
Source.2848: DFBPPR21479 ---- Animal proteins ---- Pentraxin-related protein PTX3
Source.2849: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.2850: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial
Source.2851: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.2852: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47
Source.2853: DFBPPR21503 ---- Animal proteins ---- Sideroflexin-3
Source.2854: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.2855: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1
Source.2856: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2
Source.2857: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2
Source.2858: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8
Source.2859: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.2860: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A
Source.2861: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22
Source.2862: DFBPPR21551 ---- Animal proteins ---- Suppressor of cytokine signaling 4
Source.2863: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135
Source.2864: DFBPPR21554 ---- Animal proteins ---- Transcription factor 23
Source.2865: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.2866: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.2867: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.2868: DFBPPR21603 ---- Animal proteins ---- Beta-defensin 119
Source.2869: DFBPPR21605 ---- Animal proteins ---- Transmembrane protein 138
Source.2870: DFBPPR21606 ---- Animal proteins ---- Surfeit locus protein 6
Source.2871: DFBPPR21623 ---- Animal proteins ---- Notchless protein homolog 1
Source.2872: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.2873: DFBPPR21629 ---- Animal proteins ---- Annexin A3
Source.2874: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14
Source.2875: DFBPPR21644 ---- Animal proteins ---- Mpv17-like protein 2
Source.2876: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1
Source.2877: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein
Source.2878: DFBPPR21652 ---- Animal proteins ---- Protein Flattop
Source.2879: DFBPPR21655 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 7
Source.2880: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11
Source.2881: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial
Source.2882: DFBPPR21662 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1
Source.2883: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.2884: DFBPPR21671 ---- Animal proteins ---- Intraflagellar transport protein 43 homolog
Source.2885: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10
Source.2886: DFBPPR21673 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP4
Source.2887: DFBPPR21676 ---- Animal proteins ---- ER membrane protein complex subunit 6
Source.2888: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like
Source.2889: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.2890: DFBPPR21711 ---- Animal proteins ---- Hydrolethalus syndrome protein 1 homolog
Source.2891: DFBPPR21712 ---- Animal proteins ---- Serpin E3
Source.2892: DFBPPR21714 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.2893: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.2894: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.2895: DFBPPR21722 ---- Animal proteins ---- Protein DDI1 homolog 1
Source.2896: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7
Source.2897: DFBPPR21737 ---- Animal proteins ---- C-type lectin domain family 1 member A
Source.2898: DFBPPR21741 ---- Animal proteins ---- Meiotic nuclear division protein 1 homolog
Source.2899: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase
Source.2900: DFBPPR21761 ---- Animal proteins ---- NADH dehydrogenase (ubiquinone) complex I, assembly factor 6
Source.2901: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25
Source.2902: DFBPPR21766 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 12
Source.2903: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.2904: DFBPPR21773 ---- Animal proteins ---- Isoamyl acetate-hydrolyzing esterase 1 homolog
Source.2905: DFBPPR21776 ---- Animal proteins ---- Coiled-coil domain-containing protein 130
Source.2906: DFBPPR21784 ---- Animal proteins ---- O(6)-methylguanine-induced apoptosis 2
Source.2907: DFBPPR21785 ---- Animal proteins ---- Spermatogenesis-associated protein 19, mitochondrial
Source.2908: DFBPPR21787 ---- Animal proteins ---- PRA1 family protein 2
Source.2909: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.2910: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2
Source.2911: DFBPPR21792 ---- Animal proteins ---- 39S ribosomal protein L19, mitochondrial
Source.2912: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.2913: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.2914: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.2915: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.2916: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.2917: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.2918: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7
Source.2919: DFBPPR21823 ---- Animal proteins ---- Zinc finger protein 526
Source.2920: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein
Source.2921: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1
Source.2922: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.2923: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2
Source.2924: DFBPPR21859 ---- Animal proteins ---- Kelch domain-containing protein 8B
Source.2925: DFBPPR21865 ---- Animal proteins ---- Transcription factor EC
Source.2926: DFBPPR21868 ---- Animal proteins ---- RAB6-interacting golgin
Source.2927: DFBPPR21873 ---- Animal proteins ---- Vitrin
Source.2928: DFBPPR21875 ---- Animal proteins ---- Coiled-coil domain-containing protein 113
Source.2929: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.2930: DFBPPR21880 ---- Animal proteins ---- Zinc finger protein 22
Source.2931: DFBPPR21881 ---- Animal proteins ---- THUMP domain-containing protein 1
Source.2932: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2
Source.2933: DFBPPR21891 ---- Animal proteins ---- 39S ribosomal protein L54, mitochondrial
Source.2934: DFBPPR21893 ---- Animal proteins ---- Somatomedin-B and thrombospondin type-1 domain-containing protein
Source.2935: DFBPPR21894 ---- Animal proteins ---- COMM domain-containing protein 5
Source.2936: DFBPPR21898 ---- Animal proteins ---- Junctional sarcoplasmic reticulum protein 1
Source.2937: DFBPPR21901 ---- Animal proteins ---- Calcyphosin
Source.2938: DFBPPR21903 ---- Animal proteins ---- Inactive serine protease 35
Source.2939: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein
Source.2940: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2
Source.2941: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.2942: DFBPPR21924 ---- Animal proteins ---- Vacuolar protein sorting-associated protein VTA1 homolog
Source.2943: DFBPPR21926 ---- Animal proteins ---- N-acetyltransferase 14
Source.2944: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.2945: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11
Source.2946: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2
Source.2947: DFBPPR21938 ---- Animal proteins ---- Protein RER1
Source.2948: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.2949: DFBPPR21941 ---- Animal proteins ---- MOB kinase activator 3A
Source.2950: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11
Source.2951: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6
Source.2952: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.2953: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15
Source.2954: DFBPPR21966 ---- Animal proteins ---- DNA replication complex GINS protein PSF1
Source.2955: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein
Source.2956: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.2957: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101
Source.2958: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog
Source.2959: DFBPPR21977 ---- Animal proteins ---- Protein ARV1
Source.2960: DFBPPR21984 ---- Animal proteins ---- Leucine-rich repeat-containing protein 10
Source.2961: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like
Source.2962: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1
Source.2963: DFBPPR22007 ---- Animal proteins ---- Protein C8orf37 homolog
Source.2964: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.2965: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1
Source.2966: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.2967: DFBPPR22026 ---- Animal proteins ---- Cytoskeleton-associated protein 2
Source.2968: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.2969: DFBPPR22028 ---- Animal proteins ---- Endonuclease/exonuclease/phosphatase family domain-containing protein 1
Source.2970: DFBPPR22029 ---- Animal proteins ---- COMM domain-containing protein 7
Source.2971: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4
Source.2972: DFBPPR22034 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.2973: DFBPPR22035 ---- Animal proteins ---- Protein CCSMST1
Source.2974: DFBPPR22038 ---- Animal proteins ---- Kelch domain-containing protein 3
Source.2975: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.2976: DFBPPR22050 ---- Animal proteins ---- Protein lin-37 homolog
Source.2977: DFBPPR22054 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.2978: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.2979: DFBPPR22074 ---- Animal proteins ---- Golgi apparatus membrane protein TVP23 homolog B
Source.2980: DFBPPR22078 ---- Animal proteins ---- Ly6/PLAUR domain-containing protein 4
Source.2981: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.2982: DFBPPR22096 ---- Animal proteins ---- MOB kinase activator 3B
Source.2983: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2
Source.2984: DFBPPR22106 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.2985: DFBPPR22107 ---- Animal proteins ---- TLD domain-containing protein 2
Source.2986: DFBPPR22120 ---- Animal proteins ---- Outer dense fiber protein 4
Source.2987: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog
Source.2988: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein
Source.2989: DFBPPR22127 ---- Animal proteins ---- Tumor protein p53-inducible protein 11
Source.2990: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2
Source.2991: DFBPPR22133 ---- Animal proteins ---- MOB kinase activator 3C
Source.2992: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.2993: DFBPPR22136 ---- Animal proteins ---- RUN domain-containing protein 3B
Source.2994: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1
Source.2995: DFBPPR22144 ---- Animal proteins ---- Activator of 90 kDa heat shock protein ATPase homolog 2
Source.2996: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B
Source.2997: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.2998: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B
Source.2999: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.3000: DFBPPR22183 ---- Animal proteins ---- Retrotransposon Gag-like protein 8
Source.3001: DFBPPR22190 ---- Animal proteins ---- Protein NKG7
Source.3002: DFBPPR22194 ---- Animal proteins ---- Cystatin-9
Source.3003: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.3004: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.3005: DFBPPR22221 ---- Animal proteins ---- Ubiquitin-like protein 5
Source.3006: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.3007: DFBPPR22231 ---- Animal proteins ---- DnaJ homolog subfamily C member 12
Source.3008: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.3009: DFBPPR22249 ---- Animal proteins ---- CXXC motif containing zinc binding protein
Source.3010: DFBPPR22252 ---- Animal proteins ---- Glutamine amidotransferase-like class 1 domain-containing protein 1
Source.3011: DFBPPR22257 ---- Animal proteins ---- TLC domain-containing protein 5
Source.3012: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog
Source.3013: DFBPPR22266 ---- Animal proteins ---- Vexin
Source.3014: DFBPPR22275 ---- Animal proteins ---- 60S ribosomal protein L17
Source.3015: DFBPPR22290 ---- Animal proteins ---- Cell death activator CIDE-B
Source.3016: DFBPPR22295 ---- Animal proteins ---- Protein PROCA1
Source.3017: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2
Source.3018: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2
Source.3019: DFBPPR22320 ---- Animal proteins ---- Transmembrane protein 229B
Source.3020: DFBPPR22323 ---- Animal proteins ---- Meiosis expressed gene 1 protein homolog
Source.3021: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.3022: DFBPPR22330 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 39
Source.3023: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.3024: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.3025: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.3026: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog
Source.3027: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.3028: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6
Source.3029: DFBPPR22357 ---- Animal proteins ---- Transmembrane protein 180
Source.3030: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.3031: DFBPPR22364 ---- Animal proteins ---- Transcription elongation factor A N-terminal and central domain-containing protein 2
Source.3032: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4
Source.3033: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase
Source.3034: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92
Source.3035: DFBPPR22373 ---- Animal proteins ---- 60S ribosomal protein L3-like
Source.3036: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A
Source.3037: DFBPPR22388 ---- Animal proteins ---- Oxidative stress-responsive serine-rich protein 1
Source.3038: DFBPPR22402 ---- Animal proteins ---- Alternative prion protein
Source.3039: DFBPPR22412 ---- Animal proteins ---- PHD finger protein 20-like protein 1
Source.3040: DFBPPR22417 ---- Animal proteins ---- Spermatogenesis-associated protein 46
Source.3041: DFBPPR22432 ---- Animal proteins ---- Protein FAM124B
Source.3042: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186
Source.3043: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein
Source.3044: DFBPPR22448 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 5B
Source.3045: DFBPPR22451 ---- Animal proteins ---- RING finger protein 151
Source.3046: DFBPPR22461 ---- Animal proteins ---- Ashwin
Source.3047: DFBPPR22467 ---- Animal proteins ---- Coiled-coil domain-containing protein 42
Source.3048: DFBPPR22476 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 1
Source.3049: DFBPPR22486 ---- Animal proteins ---- Transmembrane protein 223
Source.3050: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.3051: DFBPPR22494 ---- Animal proteins ---- Protein FAM53C
Source.3052: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.3053: DFBPPR22500 ---- Animal proteins ---- Ubiquitin domain-containing protein 1
Source.3054: DFBPPR22501 ---- Animal proteins ---- Multiple myeloma tumor-associated protein 2 homolog
Source.3055: DFBPPR22506 ---- Animal proteins ---- Transport and Golgi organization protein 2 homolog
Source.3056: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101
Source.3057: DFBPPR22511 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 2
Source.3058: DFBPPR22512 ---- Animal proteins ---- IQ domain-containing protein C
Source.3059: DFBPPR22514 ---- Animal proteins ---- Transmembrane protein 205
Source.3060: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15
Source.3061: DFBPPR22520 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 2
Source.3062: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54
Source.3063: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8
Source.3064: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.3065: DFBPPR22538 ---- Animal proteins ---- Transmembrane protein 53
Source.3066: DFBPPR22546 ---- Animal proteins ---- ADP-ribosylation factor-like protein 15
Source.3067: DFBPPR22547 ---- Animal proteins ---- Actin-related protein T2
Source.3068: DFBPPR22562 ---- Animal proteins ---- Uncharacterized protein C2orf50 homolog
Source.3069: DFBPPR22565 ---- Animal proteins ---- Probable RNA-binding protein 18
Source.3070: DFBPPR22569 ---- Animal proteins ---- Testis-expressed sequence 37 protein
Source.3071: DFBPPR22570 ---- Animal proteins ---- Outer dense fiber protein 3-like protein 1
Source.3072: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.3073: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.3074: DFBPPR22596 ---- Animal proteins ---- Ubiquitin domain-containing protein 2
Source.3075: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4
Source.3076: DFBPPR22610 ---- Animal proteins ---- Transmembrane protein 215
Source.3077: DFBPPR22622 ---- Animal proteins ---- Coiled-coil domain-containing glutamate-rich protein 1
Source.3078: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164
Source.3079: DFBPPR22638 ---- Animal proteins ---- Coiled-coil domain-containing protein 175
Source.3080: DFBPPR22642 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD4
Source.3081: DFBPPR22643 ---- Animal proteins ---- Coiled-coil domain-containing protein 157
Source.3082: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65
Source.3083: DFBPPR22649 ---- Animal proteins ---- IQ domain-containing protein F5
Source.3084: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog
Source.3085: DFBPPR22668 ---- Animal proteins ---- Protein FAM243
Source.3086: DFBPPR22673 ---- Animal proteins ---- Uncharacterized protein C7orf61 homolog
Source.3087: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.3088: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog
Source.3089: DFBPPR22684 ---- Animal proteins ---- Protein FAM204A
Source.3090: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C
Source.3091: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.3092: DFBPPR22696 ---- Animal proteins ---- Protein FAM228B
Source.3093: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1
Source.3094: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16
Source.3095: DFBPPR22714 ---- Animal proteins ---- Protein FAM71E1
Source.3096: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11
Source.3097: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog
Source.3098: DFBPPR22737 ---- Animal proteins ---- UPF0705 protein C11orf49 homolog
Source.3099: DFBPPR22742 ---- Animal proteins ---- Uncharacterized protein C12orf71 homolog
Source.3100: DFBPPR22747 ---- Animal proteins ---- Uncharacterized protein C1orf100 homolog
Source.3101: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.3102: DFBPPR22754 ---- Animal proteins ---- Uncharacterized protein C1orf158 homolog
Source.3103: DFBPPR22755 ---- Animal proteins ---- Uncharacterized protein C11orf86 homolog
Source.3104: DFBPPR22756 ---- Animal proteins ---- Uncharacterized protein C1orf189 homolog
Source.3105: DFBPPR22762 ---- Animal proteins ---- Uncharacterized protein C6orf136 homolog
Source.3106: DFBPPR22763 ---- Animal proteins ---- Uncharacterized protein C19orf71 homolog
Source.3107: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.3108: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.3109: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3110: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.3111: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.3112: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase
Source.3113: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.3114: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1
Source.3115: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase
Source.3116: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.3117: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.3118: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.3119: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.3120: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1
Source.3121: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.3122: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.3123: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.3124: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.3125: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.3126: DFBPPR8573 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 1
Source.3127: DFBPPR8577 ---- Animal proteins ---- Nectin-1
Source.3128: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.3129: DFBPPR8587 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.3130: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.3131: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha
Source.3132: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.3133: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1
Source.3134: DFBPPR8606 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.3135: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.3136: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.3137: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.3138: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.3139: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.3140: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.3141: DFBPPR8623 ---- Animal proteins ---- High mobility group protein B1
Source.3142: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.3143: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.3144: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.3145: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.3146: DFBPPR8649 ---- Animal proteins ---- Acrosin
Source.3147: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.3148: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A
Source.3149: DFBPPR8667 ---- Animal proteins ---- High mobility group protein B2
Source.3150: DFBPPR8669 ---- Animal proteins ---- Heme oxygenase 1
Source.3151: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1
Source.3152: DFBPPR8673 ---- Animal proteins ---- Calreticulin
Source.3153: DFBPPR8674 ---- Animal proteins ---- Calpain-3
Source.3154: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.3155: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.3156: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.3157: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.3158: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.3159: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.3160: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1
Source.3161: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.3162: DFBPPR8697 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.3163: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.3164: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.3165: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.3166: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.3167: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.3168: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.3169: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.3170: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.3171: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.3172: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.3173: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.3174: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.3175: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.3176: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.3177: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3178: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.3179: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.3180: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.3181: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.3182: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.3183: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.3184: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.3185: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.3186: DFBPPR8791 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.3187: DFBPPR8792 ---- Animal proteins ---- Plasminogen
Source.3188: DFBPPR8797 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.3189: DFBPPR8807 ---- Animal proteins ---- Selenoprotein S
Source.3190: DFBPPR8811 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.3191: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.3192: DFBPPR8822 ---- Animal proteins ---- Apolipoprotein E
Source.3193: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase
Source.3194: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1
Source.3195: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.3196: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1
Source.3197: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4
Source.3198: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.3199: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.3200: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog
Source.3201: DFBPPR8869 ---- Animal proteins ---- Muscarinic acetylcholine receptor M1
Source.3202: DFBPPR8875 ---- Animal proteins ---- C-type lectin domain family 5 member A
Source.3203: DFBPPR8876 ---- Animal proteins ---- C-type lectin domain family 5 member A
Source.3204: DFBPPR8877 ---- Animal proteins ---- C-type lectin domain family 5 member A
Source.3205: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3206: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.3207: DFBPPR8906 ---- Animal proteins ---- Sialidase-1
Source.3208: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.3209: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.3210: DFBPPR8922 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.3211: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.3212: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.3213: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.3214: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.3215: DFBPPR8951 ---- Animal proteins ---- ERO1-like protein alpha
Source.3216: DFBPPR8952 ---- Animal proteins ---- ERO1-like protein alpha
Source.3217: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.3218: DFBPPR8970 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.3219: DFBPPR8975 ---- Animal proteins ---- Low affinity immunoglobulin gamma Fc region receptor III
Source.3220: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.3221: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.3222: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.3223: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.3224: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain
Source.3225: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain
Source.3226: DFBPPR9005 ---- Animal proteins ---- Protein amnionless
Source.3227: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain
Source.3228: DFBPPR9009 ---- Animal proteins ---- Prostamide/prostaglandin F synthase
Source.3229: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.3230: DFBPPR9015 ---- Animal proteins ---- Serotransferrin
Source.3231: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.3232: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.3233: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.3234: DFBPPR9037 ---- Animal proteins ---- T-cell surface glycoprotein CD3 gamma chain
Source.3235: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A
Source.3236: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf
Source.3237: DFBPPR9062 ---- Animal proteins ---- Methylsterol monooxygenase 1
Source.3238: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.3239: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.3240: DFBPPR9089 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.3241: DFBPPR9093 ---- Animal proteins ---- Hemopexin
Source.3242: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1
Source.3243: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.3244: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.3245: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.3246: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.3247: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.3248: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.3249: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase
Source.3250: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase
Source.3251: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.3252: DFBPPR9138 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.3253: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.3254: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase
Source.3255: DFBPPR9149 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.3256: DFBPPR9150 ---- Animal proteins ---- Protegrin-1
Source.3257: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.3258: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.3259: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.3260: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.3261: DFBPPR9173 ---- Animal proteins ---- Neurotrophin-3
Source.3262: DFBPPR9185 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.3263: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3264: DFBPPR9215 ---- Animal proteins ---- Phosphomevalonate kinase
Source.3265: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.3266: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII
Source.3267: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.3268: DFBPPR9239 ---- Animal proteins ---- Prophenin-2
Source.3269: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.3270: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.3271: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.3272: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor
Source.3273: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.3274: DFBPPR9256 ---- Animal proteins ---- Antibacterial protein PR-39
Source.3275: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.3276: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.3277: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase
Source.3278: DFBPPR9276 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.3279: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.3280: DFBPPR9300 ---- Animal proteins ---- Adrenodoxin, mitochondrial
Source.3281: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase
Source.3282: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.3283: DFBPPR9314 ---- Animal proteins ---- Regucalcin
Source.3284: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.3285: DFBPPR9323 ---- Animal proteins ---- Lymphotoxin-alpha
Source.3286: DFBPPR9325 ---- Animal proteins ---- Ephrin-A1
Source.3287: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.3288: DFBPPR9327 ---- Animal proteins ---- Multicilin
Source.3289: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor
Source.3290: DFBPPR9333 ---- Animal proteins ---- Protegrin-3
Source.3291: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.3292: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.3293: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1
Source.3294: DFBPPR9345 ---- Animal proteins ---- Relaxin-3
Source.3295: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.3296: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.3297: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3298: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase
Source.3299: DFBPPR9391 ---- Animal proteins ---- 60S ribosomal protein L11
Source.3300: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase
Source.3301: DFBPPR9396 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.3302: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.3303: DFBPPR9408 ---- Animal proteins ---- CD70 antigen
Source.3304: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3305: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3306: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3307: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.3308: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.3309: DFBPPR9418 ---- Animal proteins ---- N-acetylgalactosamine-6-sulfatase
Source.3310: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.3311: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2
Source.3312: DFBPPR9436 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.3313: DFBPPR9437 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.3314: DFBPPR9438 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9
Source.3315: DFBPPR9449 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical]
Source.3316: DFBPPR9457 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.3317: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase
Source.3318: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.3319: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1
Source.3320: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14
Source.3321: DFBPPR9495 ---- Animal proteins ---- Complement factor B
Source.3322: DFBPPR9502 ---- Animal proteins ---- Endothelin-1 receptor
Source.3323: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24
Source.3324: DFBPPR9517 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.3325: DFBPPR9518 ---- Animal proteins ---- Interleukin-5
Source.3326: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1
Source.3327: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25
Source.3328: DFBPPR9535 ---- Animal proteins ---- Ribonuclease inhibitor
Source.3329: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.3330: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase
Source.3331: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.3332: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic
Source.3333: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha
Source.3334: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2
Source.3335: DFBPPR9553 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L3
Source.3336: DFBPPR9568 ---- Animal proteins ---- Antibacterial peptide PMAP-23
Source.3337: DFBPPR9575 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.3338: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3339: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.3340: DFBPPR9594 ---- Animal proteins ---- Protein-L-isoaspartate(D-aspartate) O-methyltransferase
Source.3341: DFBPPR9597 ---- Animal proteins ---- Insulin-like 3
Source.3342: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2
Source.3343: DFBPPR9608 ---- Animal proteins ---- Interleukin-21
Source.3344: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.3345: DFBPPR9611 ---- Animal proteins ---- Protegrin-4
Source.3346: DFBPPR9617 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.3347: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.3348: DFBPPR9629 ---- Animal proteins ---- Antibacterial peptide PMAP-36
Source.3349: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.3350: DFBPPR9638 ---- Animal proteins ---- Troponin T, slow skeletal muscle
Source.3351: DFBPPR9640 ---- Animal proteins ---- Actin-binding Rho-activating protein
Source.3352: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.3353: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.3354: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.3355: DFBPPR9670 ---- Animal proteins ---- NF-kappa-B inhibitor-like protein 1
Source.3356: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.3357: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1
Source.3358: DFBPPR9698 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.3359: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.3360: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.3361: DFBPPR9706 ---- Animal proteins ---- Homeobox protein Hox-B8
Source.3362: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.3363: DFBPPR9725 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.3364: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.3365: DFBPPR9737 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 7
Source.3366: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.3367: DFBPPR9740 ---- Animal proteins ---- Neprilysin
Source.3368: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.3369: DFBPPR9747 ---- Animal proteins ---- Protegrin-5
Source.3370: DFBPPR9767 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6
Source.3371: DFBPPR9769 ---- Animal proteins ---- Lipocalin-1
Source.3372: DFBPPR9770 ---- Animal proteins ---- Melatonin receptor type 1A
Source.3373: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha
Source.3374: DFBPPR9775 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.3375: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15
Source.3376: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.3377: DFBPPR9793 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit beta-1
Source.3378: DFBPPR9802 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM7 homolog
Source.3379: DFBPPR9803 ---- Animal proteins ---- 60S ribosomal protein L3
Source.3380: DFBPPR9809 ---- Animal proteins ---- Antibacterial peptide PMAP-37
Source.3381: DFBPPR9813 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.3382: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.3383: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.3384: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A
Source.3385: DFBPPR9837 ---- Animal proteins ---- Troponin T, fast skeletal muscle
Source.3386: DFBPPR9838 ---- Animal proteins ---- Transcription factor PU.1
Source.3387: DFBPPR9857 ---- Animal proteins ---- Cytochrome c oxidase subunit 6C
Source.3388: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1
Source.3389: DFBPPR9863 ---- Animal proteins ---- Spermatid nuclear transition protein 3
Source.3390: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.3391: DFBPPR9877 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.3392: DFBPPR9892 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 3 homolog
Source.3393: DFBPPR9939 ---- Animal proteins ---- Tctex1 domain-containing protein 4
Source.3394: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.3395: DFBPPR9949 ---- Animal proteins ---- Coiled-coil domain-containing protein 127
Source.3396: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.3397: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.3398: DFBPPR9965 ---- Animal proteins ---- Lysozyme C
Source.3399: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor
Source.3400: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin
Source.3401: DFBPPR9973 ---- Animal proteins ---- High mobility group protein B1
Source.3402: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase
Source.3403: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.3404: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.3405: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.3406: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.3407: DFBPPR9996 ---- Animal proteins ---- Riboflavin-binding protein
Source.3408: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.3409: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.3410: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.3411: DFBPPR10007 ---- Animal proteins ---- Protein Wnt-1
Source.3412: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b
Source.3413: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.3414: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16
Source.3415: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.3416: DFBPPR10016 ---- Animal proteins ---- High mobility group protein B2
Source.3417: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.3418: DFBPPR10023 ---- Animal proteins ---- Glucagon family neuropeptides
Source.3419: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog
Source.3420: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.3421: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.3422: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.3423: DFBPPR10038 ---- Animal proteins ---- Deoxycytidine kinase 2
Source.3424: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.3425: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.3426: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.3427: DFBPPR10052 ---- Animal proteins ---- Protein Wnt-11
Source.3428: DFBPPR10055 ---- Animal proteins ---- Protein Wnt-3a
Source.3429: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.3430: DFBPPR10057 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.3431: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4
Source.3432: DFBPPR10061 ---- Animal proteins ---- Ovocleidin-17
Source.3433: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11
Source.3434: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.3435: DFBPPR10067 ---- Animal proteins ---- Thyroid hormone receptor alpha
Source.3436: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.3437: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1
Source.3438: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.3439: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor
Source.3440: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.3441: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.3442: DFBPPR10088 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.3443: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.3444: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.3445: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.3446: DFBPPR10100 ---- Animal proteins ---- STIP1 homology and U box-containing protein 1
Source.3447: DFBPPR10118 ---- Animal proteins ---- GATA-binding factor 3
Source.3448: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.3449: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.3450: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.3451: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.3452: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.3453: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.3454: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase
Source.3455: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.3456: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.3457: DFBPPR10142 ---- Animal proteins ---- Calpain-3
Source.3458: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.3459: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.3460: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3
Source.3461: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.3462: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.3463: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.3464: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5
Source.3465: DFBPPR10161 ---- Animal proteins ---- High mobility group protein B3
Source.3466: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.3467: DFBPPR10164 ---- Animal proteins ---- Insulin-like growth factor II
Source.3468: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.3469: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.3470: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.3471: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.3472: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.3473: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.3474: DFBPPR10191 ---- Animal proteins ---- Src substrate protein p85
Source.3475: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3
Source.3476: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.3477: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.3478: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.3479: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.3480: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.3481: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.3482: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1
Source.3483: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.3484: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.3485: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.3486: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.3487: DFBPPR10212 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-4
Source.3488: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5
Source.3489: DFBPPR10222 ---- Animal proteins ---- Podocalyxin
Source.3490: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.3491: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3
Source.3492: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1
Source.3493: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.3494: DFBPPR10247 ---- Animal proteins ---- Actin filament-associated protein 1
Source.3495: DFBPPR10249 ---- Animal proteins ---- Heparan sulfate 2-O-sulfotransferase 1
Source.3496: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.3497: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1
Source.3498: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.3499: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.3500: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1
Source.3501: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.3502: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.3503: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.3504: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.3505: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.3506: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.3507: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.3508: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.3509: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.3510: DFBPPR10305 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.3511: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.3512: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.3513: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.3514: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.3515: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.3516: DFBPPR10329 ---- Animal proteins ---- Activity-regulated cytoskeleton-associated protein
Source.3517: DFBPPR10335 ---- Animal proteins ---- RNA-binding protein with multiple splicing 2
Source.3518: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.3519: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.3520: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3
Source.3521: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.3522: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.3523: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.3524: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase
Source.3525: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.3526: DFBPPR10361 ---- Animal proteins ---- Protein HIRA
Source.3527: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.3528: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.3529: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR
Source.3530: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.3531: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.3532: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1
Source.3533: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.3534: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.3535: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.3536: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2
Source.3537: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.3538: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.3539: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.3540: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.3541: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.3542: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.3543: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.3544: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.3545: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin
Source.3546: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.3547: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.3548: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.3549: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.3550: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.3551: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.3552: DFBPPR10436 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.3553: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16
Source.3554: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.3555: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c
Source.3556: DFBPPR10447 ---- Animal proteins ---- Plastin-1
Source.3557: DFBPPR10453 ---- Animal proteins ---- Neurotrophin-3
Source.3558: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.3559: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.3560: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4
Source.3561: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3562: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.3563: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.3564: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.3565: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.3566: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.3567: DFBPPR10491 ---- Animal proteins ---- Neuronal calcium sensor 1
Source.3568: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.3569: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.3570: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.3571: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.3572: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.3573: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.3574: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2
Source.3575: DFBPPR10511 ---- Animal proteins ---- Vitellogenin-3
Source.3576: DFBPPR10527 ---- Animal proteins ---- Guanylyl cyclase-activating protein 1
Source.3577: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase
Source.3578: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3
Source.3579: DFBPPR10548 ---- Animal proteins ---- Syndecan-4
Source.3580: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1
Source.3581: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.3582: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.3583: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.3584: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase
Source.3585: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.3586: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b
Source.3587: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.3588: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.3589: DFBPPR10578 ---- Animal proteins ---- Syntaxin-6
Source.3590: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.3591: DFBPPR10581 ---- Animal proteins ---- Ephrin-A5
Source.3592: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.3593: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.3594: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.3595: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.3596: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.3597: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.3598: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.3599: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D
Source.3600: DFBPPR10614 ---- Animal proteins ---- Coagulation factor IX
Source.3601: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.3602: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.3603: DFBPPR10637 ---- Animal proteins ---- CTD small phosphatase-like protein
Source.3604: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.3605: DFBPPR10647 ---- Animal proteins ---- Gallinacin-4
Source.3606: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.3607: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.3608: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.3609: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.3610: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase
Source.3611: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.3612: DFBPPR10665 ---- Animal proteins ---- Mitochondrial fission regulator 1
Source.3613: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.3614: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3
Source.3615: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.3616: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13
Source.3617: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.3618: DFBPPR10692 ---- Animal proteins ---- Protein Wnt-9a
Source.3619: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.3620: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.3621: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.3622: DFBPPR10701 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.3623: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2
Source.3624: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.3625: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2
Source.3626: DFBPPR10706 ---- Animal proteins ---- BRISC and BRCA1-A complex member 2
Source.3627: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.3628: DFBPPR10719 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.3629: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.3630: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2
Source.3631: DFBPPR10726 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.3632: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.3633: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.3634: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1
Source.3635: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.3636: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.3637: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein
Source.3638: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3639: DFBPPR10768 ---- Animal proteins ---- Actin-histidine N-methyltransferase
Source.3640: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3641: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3642: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3643: DFBPPR10796 ---- Animal proteins ---- Protrudin
Source.3644: DFBPPR10805 ---- Animal proteins ---- Interferon type A1/A2
Source.3645: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.3646: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.3647: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1
Source.3648: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.3649: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.3650: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa
Source.3651: DFBPPR10835 ---- Animal proteins ---- Twisted gastrulation protein homolog 1
Source.3652: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.3653: DFBPPR10843 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H2
Source.3654: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.3655: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.3656: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.3657: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2
Source.3658: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.3659: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.3660: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.3661: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha'
Source.3662: DFBPPR10882 ---- Animal proteins ---- Noggin
Source.3663: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.3664: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1
Source.3665: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.3666: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.3667: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11
Source.3668: DFBPPR10916 ---- Animal proteins ---- Gallinacin-5
Source.3669: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.3670: DFBPPR10920 ---- Animal proteins ---- Troponin T, fast skeletal muscle isoforms
Source.3671: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.3672: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.3673: DFBPPR10929 ---- Animal proteins ---- Protein O-mannose kinase
Source.3674: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.3675: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2
Source.3676: DFBPPR10937 ---- Animal proteins ---- Urokinase-type plasminogen activator
Source.3677: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.3678: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.3679: DFBPPR10943 ---- Animal proteins ---- F-actin-capping protein subunit alpha-1
Source.3680: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.3681: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.3682: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.3683: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.3684: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1
Source.3685: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo
Source.3686: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.3687: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.3688: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2
Source.3689: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.3690: DFBPPR10984 ---- Animal proteins ---- Kelch-like protein 20
Source.3691: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.3692: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.3693: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.3694: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.3695: DFBPPR11009 ---- Animal proteins ---- Cathelicidin-B1
Source.3696: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.3697: DFBPPR11017 ---- Animal proteins ---- Collectin-12
Source.3698: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.3699: DFBPPR11020 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 2
Source.3700: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.3701: DFBPPR11030 ---- Animal proteins ---- Protein C-ets-2
Source.3702: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.3703: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.3704: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.3705: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.3706: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.3707: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.3708: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease
Source.3709: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.3710: DFBPPR11062 ---- Animal proteins ---- Regucalcin
Source.3711: DFBPPR11066 ---- Animal proteins ---- Protein sprouty homolog 2
Source.3712: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a
Source.3713: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.3714: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.3715: DFBPPR11081 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase 2
Source.3716: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.3717: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1
Source.3718: DFBPPR11102 ---- Animal proteins ---- Interferon type A3
Source.3719: DFBPPR11105 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF5
Source.3720: DFBPPR11116 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.3721: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1
Source.3722: DFBPPR11121 ---- Animal proteins ---- Lysosomal amino acid transporter 1 homolog
Source.3723: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.3724: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit
Source.3725: DFBPPR11134 ---- Animal proteins ---- Keratocan
Source.3726: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3727: DFBPPR11152 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.3728: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein
Source.3729: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.3730: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.3731: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.3732: DFBPPR11174 ---- Animal proteins ---- Gallinacin-6
Source.3733: DFBPPR11177 ---- Animal proteins ---- Gallinacin-11
Source.3734: DFBPPR11189 ---- Animal proteins ---- Pre-mRNA-splicing factor RBM22
Source.3735: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.3736: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1
Source.3737: DFBPPR11199 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.3738: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.3739: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.3740: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T
Source.3741: DFBPPR11212 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1
Source.3742: DFBPPR11218 ---- Animal proteins ---- Pancreatic hormone
Source.3743: DFBPPR11220 ---- Animal proteins ---- Metallophosphoesterase 1
Source.3744: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.3745: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1
Source.3746: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.3747: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2
Source.3748: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.3749: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.3750: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED
Source.3751: DFBPPR11255 ---- Animal proteins ---- Beta-crystallin A3
Source.3752: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.3753: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.3754: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.3755: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B
Source.3756: DFBPPR11269 ---- Animal proteins ---- Anosmin-1
Source.3757: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.3758: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3
Source.3759: DFBPPR11277 ---- Animal proteins ---- Abasic site processing protein HMCES
Source.3760: DFBPPR11278 ---- Animal proteins ---- ATP-dependent RNA helicase DDX42
Source.3761: DFBPPR11279 ---- Animal proteins ---- Zinc finger protein neuro-d4
Source.3762: DFBPPR11284 ---- Animal proteins ---- Methylsterol monooxygenase 1
Source.3763: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.3764: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.3765: DFBPPR11296 ---- Animal proteins ---- Aldo-keto reductase family 1 member A1
Source.3766: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.3767: DFBPPR11317 ---- Animal proteins ---- Dickkopf-related protein 3
Source.3768: DFBPPR11333 ---- Animal proteins ---- Leucine-rich repeat and immunoglobulin-like domain-containing nogo receptor-interacting protein 1
Source.3769: DFBPPR11334 ---- Animal proteins ---- Heme oxygenase 1
Source.3770: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1
Source.3771: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1
Source.3772: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.3773: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.3774: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10
Source.3775: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase
Source.3776: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4
Source.3777: DFBPPR11358 ---- Animal proteins ---- Lysozyme g
Source.3778: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.3779: DFBPPR11362 ---- Animal proteins ---- Beta-crystallin B2
Source.3780: DFBPPR11366 ---- Animal proteins ---- Secreted frizzled-related protein 2
Source.3781: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1
Source.3782: DFBPPR11379 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2
Source.3783: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B
Source.3784: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2
Source.3785: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.3786: DFBPPR11411 ---- Animal proteins ---- Zinc finger protein ubi-d4
Source.3787: DFBPPR11412 ---- Animal proteins ---- Hyaluronan synthase 3
Source.3788: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.3789: DFBPPR11417 ---- Animal proteins ---- LRP chaperone MESD
Source.3790: DFBPPR11419 ---- Animal proteins ---- Glutathione S-transferase
Source.3791: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1
Source.3792: DFBPPR11427 ---- Animal proteins ---- Protein Abitram
Source.3793: DFBPPR11437 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.3794: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3795: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator
Source.3796: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform
Source.3797: DFBPPR11444 ---- Animal proteins ---- Troponin T, cardiac muscle isoforms
Source.3798: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.3799: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7
Source.3800: DFBPPR11457 ---- Animal proteins ---- Homeobox protein DBX2
Source.3801: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog
Source.3802: DFBPPR11479 ---- Animal proteins ---- Rab-like protein 3
Source.3803: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.3804: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1
Source.3805: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1
Source.3806: DFBPPR11490 ---- Animal proteins ---- Twinfilin-2
Source.3807: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10
Source.3808: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L
Source.3809: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.3810: DFBPPR11503 ---- Animal proteins ---- Zinc finger protein GLI2
Source.3811: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.3812: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog
Source.3813: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.3814: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A
Source.3815: DFBPPR11517 ---- Animal proteins ---- Zinc transporter ZIP13
Source.3816: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.3817: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A
Source.3818: DFBPPR11526 ---- Animal proteins ---- Fibromodulin
Source.3819: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.3820: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.3821: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.3822: DFBPPR11547 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J
Source.3823: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.3824: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase
Source.3825: DFBPPR11558 ---- Animal proteins ---- Nuclear migration protein nudC
Source.3826: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.3827: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg
Source.3828: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.3829: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1
Source.3830: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein
Source.3831: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.3832: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.3833: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.3834: DFBPPR11596 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E
Source.3835: DFBPPR11600 ---- Animal proteins ---- Hyccin
Source.3836: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.3837: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.3838: DFBPPR11603 ---- Animal proteins ---- Syntaxin-binding protein 1
Source.3839: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.3840: DFBPPR11605 ---- Animal proteins ---- DNA repair protein complementing XP-A cells homolog
Source.3841: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.3842: DFBPPR11614 ---- Animal proteins ---- Beta-crystallin B3
Source.3843: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2
Source.3844: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3845: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2
Source.3846: DFBPPR11628 ---- Animal proteins ---- Beta-crystallin A2
Source.3847: DFBPPR11635 ---- Animal proteins ---- Cochlin
Source.3848: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19
Source.3849: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.3850: DFBPPR11655 ---- Animal proteins ---- 60S ribosomal protein L10
Source.3851: DFBPPR11656 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.3852: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43
Source.3853: DFBPPR11671 ---- Animal proteins ---- Glucoside xylosyltransferase 1
Source.3854: DFBPPR11673 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4
Source.3855: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13
Source.3856: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.3857: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.3858: DFBPPR11681 ---- Animal proteins ---- Ornithine decarboxylase antizyme 1
Source.3859: DFBPPR11686 ---- Animal proteins ---- Class II histocompatibility antigen, B-L beta chain
Source.3860: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.3861: DFBPPR11703 ---- Animal proteins ---- Transcription factor CP2
Source.3862: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.3863: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.3864: DFBPPR11708 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.3865: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.3866: DFBPPR11710 ---- Animal proteins ---- WAP four-disulfide core domain protein 1
Source.3867: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1
Source.3868: DFBPPR11719 ---- Animal proteins ---- Protein RER1
Source.3869: DFBPPR11723 ---- Animal proteins ---- Visinin
Source.3870: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor
Source.3871: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta
Source.3872: DFBPPR11737 ---- Animal proteins ---- 3-hydroxyisobutyryl-CoA hydrolase, mitochondrial
Source.3873: DFBPPR11738 ---- Animal proteins ---- Ensconsin
Source.3874: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.3875: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial
Source.3876: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.3877: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.3878: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3
Source.3879: DFBPPR11758 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17B
Source.3880: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein
Source.3881: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.3882: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.3883: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.3884: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.3885: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1
Source.3886: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.3887: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.3888: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.3889: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.3890: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.3891: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7
Source.3892: DFBPPR11840 ---- Animal proteins ---- RELT-like protein 1
Source.3893: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.3894: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2
Source.3895: DFBPPR11876 ---- Animal proteins ---- Terminal nucleotidyltransferase 5C
Source.3896: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region
Source.3897: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.3898: DFBPPR11879 ---- Animal proteins ---- Nicalin
Source.3899: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.3900: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.3901: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.3902: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.3903: DFBPPR11902 ---- Animal proteins ---- APC membrane recruitment protein 2
Source.3904: DFBPPR11903 ---- Animal proteins ---- SREBP regulating gene protein
Source.3905: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3
Source.3906: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19
Source.3907: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.3908: DFBPPR11941 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1
Source.3909: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3
Source.3910: DFBPPR11954 ---- Animal proteins ---- SIN3-HDAC complex-associated factor
Source.3911: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2
Source.3912: DFBPPR11975 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.3913: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.3914: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.3915: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog
Source.3916: DFBPPR11993 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2
Source.3917: DFBPPR11994 ---- Animal proteins ---- Surfeit locus protein 1
Source.3918: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.3919: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.3920: DFBPPR12015 ---- Animal proteins ---- Homeobox protein Hox-D1
Source.3921: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.3922: DFBPPR12028 ---- Animal proteins ---- Endoplasmic reticulum resident protein 29
Source.3923: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5
Source.3924: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2
Source.3925: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.3926: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.3927: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.3928: DFBPPR12053 ---- Animal proteins ---- Sugar phosphate exchanger 3
Source.3929: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1
Source.3930: DFBPPR12067 ---- Animal proteins ---- Transcription factor EC
Source.3931: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.3932: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.3933: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2
Source.3934: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.3935: DFBPPR12097 ---- Animal proteins ---- Photoreceptor outer segment membrane glycoprotein 2
Source.3936: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.3937: DFBPPR12099 ---- Animal proteins ---- tRNA (guanine(10)-N2)-methyltransferase homolog
Source.3938: DFBPPR12112 ---- Animal proteins ---- Protein LBH
Source.3939: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.3940: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.3941: DFBPPR12121 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial
Source.3942: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.3943: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.3944: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.3945: DFBPPR12132 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.3946: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.3947: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6
Source.3948: DFBPPR12145 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1-like
Source.3949: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.3950: DFBPPR12156 ---- Animal proteins ---- Putative monooxygenase p33MONOX
Source.3951: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.3952: DFBPPR12160 ---- Animal proteins ---- Transmembrane protein 229B
Source.3953: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45
Source.3954: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog
Source.3955: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5
Source.3956: DFBPPR12175 ---- Animal proteins ---- Ashwin
Source.3957: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein
Source.3958: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.3959: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40
Source.3960: DFBPPR12207 ---- Animal proteins ---- WD repeat, SAM and U-box domain-containing protein 1
Source.3961: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180
Source.3962: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.3963: DFBPPR12215 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog
Source.3964: DFBPPR12219 ---- Animal proteins ---- PHD finger protein 20-like protein 1
Source.3965: DFBPPR12223 ---- Animal proteins ---- SPRY domain-containing protein 7
Source.3966: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog
Source.3967: DFBPPR12230 ---- Animal proteins ---- Orofacial cleft 1 candidate gene 1 protein homolog
Source.3968: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.3969: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.3970: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.3971: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.3972: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2
Source.3973: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.3974: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.3975: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2
Source.3976: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.3977: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.3978: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1
Source.3979: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.3980: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.3981: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.3982: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.3983: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.3984: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.3985: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.3986: DFBPPR12296 ---- Animal proteins ---- Neprilysin
Source.3987: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.3988: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3989: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.3990: DFBPPR12319 ---- Animal proteins ---- Calreticulin
Source.3991: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5
Source.3992: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type
Source.3993: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.3994: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.3995: DFBPPR12336 ---- Animal proteins ---- Apolipoprotein D
Source.3996: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E
Source.3997: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2
Source.3998: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.3999: DFBPPR12350 ---- Animal proteins ---- Troponin T, cardiac muscle
Source.4000: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain
Source.4001: DFBPPR12352 ---- Animal proteins ---- Podocalyxin
Source.4002: DFBPPR12356 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.4003: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.4004: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.4005: DFBPPR12361 ---- Animal proteins ---- Ras-related protein Rab-11A
Source.4006: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.4007: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5
Source.4008: DFBPPR12364 ---- Animal proteins ---- Protein Wnt-5a
Source.4009: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.4010: DFBPPR12369 ---- Animal proteins ---- Inward rectifier potassium channel 2
Source.4011: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.4012: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.4013: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.4014: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.4015: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.4016: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.4017: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1
Source.4018: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.4019: DFBPPR12386 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.4020: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.4021: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.4022: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.4023: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.4024: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.4025: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.4026: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4
Source.4027: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle
Source.4028: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.4029: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.4030: DFBPPR12413 ---- Animal proteins ---- Potassium channel subfamily K member 1
Source.4031: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.4032: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1
Source.4033: DFBPPR12418 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.4034: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A
Source.4035: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.4036: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.4037: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.4038: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.4039: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.4040: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1
Source.4041: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.4042: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.4043: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.4044: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2
Source.4045: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.4046: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.4047: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.4048: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.4049: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.4050: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.4051: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.4052: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase
Source.4053: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.4054: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.4055: DFBPPR12469 ---- Animal proteins ---- Hemopexin
Source.4056: DFBPPR12475 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.4057: DFBPPR12476 ---- Animal proteins ---- Voltage-dependent anion-selective channel protein 1
Source.4058: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.4059: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha
Source.4060: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.4061: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase
Source.4062: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.4063: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.4064: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.4065: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.4066: DFBPPR12508 ---- Animal proteins ---- Interleukin-2
Source.4067: DFBPPR12514 ---- Animal proteins ---- Transmembrane protein 109
Source.4068: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.4069: DFBPPR12516 ---- Animal proteins ---- Indolethylamine N-methyltransferase
Source.4070: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.4071: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.4072: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.4073: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.4074: DFBPPR12538 ---- Animal proteins ---- Troponin T, fast skeletal muscle
Source.4075: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.4076: DFBPPR12541 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2
Source.4077: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2
Source.4078: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.4079: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4080: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.4081: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.4082: DFBPPR12560 ---- Animal proteins ---- Calumenin
Source.4083: DFBPPR12564 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.4084: DFBPPR12566 ---- Animal proteins ---- Eukaryotic translation initiation factor 4E
Source.4085: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.4086: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2
Source.4087: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.4088: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.4089: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.4090: DFBPPR12593 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 B
Source.4091: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan
Source.4092: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT
Source.4093: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT
Source.4094: DFBPPR12607 ---- Animal proteins ---- Basigin
Source.4095: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.4096: DFBPPR12624 ---- Animal proteins ---- Heparin cofactor 2
Source.4097: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.4098: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.4099: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4100: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.4101: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9
Source.4102: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.4103: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.4104: DFBPPR12676 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.4105: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase
Source.4106: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.4107: DFBPPR12707 ---- Animal proteins ---- Pro-opiomelanocortin
Source.4108: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1
Source.4109: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16
Source.4110: DFBPPR12723 ---- Animal proteins ---- Glutathione S-transferase alpha I
Source.4111: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.4112: DFBPPR12731 ---- Animal proteins ---- Cholinesterase
Source.4113: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.4114: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.4115: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1
Source.4116: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.4117: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14
Source.4118: DFBPPR12745 ---- Animal proteins ---- Ras-related protein Rab-25
Source.4119: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.4120: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain
Source.4121: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta
Source.4122: DFBPPR12761 ---- Animal proteins ---- Trichohyalin
Source.4123: DFBPPR12765 ---- Animal proteins ---- Chloride transport protein 6
Source.4124: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.4125: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.4126: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.4127: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.4128: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor
Source.4129: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.4130: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.4131: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.4132: DFBPPR12827 ---- Animal proteins ---- Matrix Gla protein
Source.4133: DFBPPR12829 ---- Animal proteins ---- Glutathione S-transferase Yc
Source.4134: DFBPPR12831 ---- Animal proteins ---- Serine--pyruvate aminotransferase
Source.4135: DFBPPR12837 ---- Animal proteins ---- Tissue factor pathway inhibitor
Source.4136: DFBPPR12847 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.4137: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein
Source.4138: DFBPPR12864 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.4139: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.4140: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.4141: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D
Source.4142: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.4143: DFBPPR12896 ---- Animal proteins ---- T-lymphocyte activation antigen CD80
Source.4144: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.4145: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.4146: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.4147: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.4148: DFBPPR12910 ---- Animal proteins ---- Neuropeptide Y receptor type 6
Source.4149: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.4150: DFBPPR12913 ---- Animal proteins ---- 15 kDa protein A
Source.4151: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.4152: DFBPPR12924 ---- Animal proteins ---- Adenylate kinase isoenzyme 6
Source.4153: DFBPPR12925 ---- Animal proteins ---- Methylmalonic aciduria type A homolog, mitochondrial
Source.4154: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.4155: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.4156: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.4157: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.4158: DFBPPR12945 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.4159: DFBPPR12948 ---- Animal proteins ---- Apolipoprotein C-IV
Source.4160: DFBPPR12952 ---- Animal proteins ---- Serum amyloid A-1 protein
Source.4161: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.4162: DFBPPR12960 ---- Animal proteins ---- Synaptophysin-like protein 2
Source.4163: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain
Source.4164: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.4165: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.4166: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.4167: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.4168: DFBPPR13002 ---- Animal proteins ---- Complement component C8 gamma chain
Source.4169: DFBPPR13003 ---- Animal proteins ---- Calcyphosin
Source.4170: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4171: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.4172: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2
Source.4173: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein
Source.4174: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.4175: DFBPPR13030 ---- Animal proteins ---- T-cell surface glycoprotein CD1b
Source.4176: DFBPPR13036 ---- Animal proteins ---- Gamma-crystallin S
Source.4177: DFBPPR13053 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.4178: DFBPPR13059 ---- Animal proteins ---- Protein Wnt-2
Source.4179: DFBPPR13062 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.4180: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5
Source.4181: DFBPPR13070 ---- Animal proteins ---- Beta-crystallin A2
Source.4182: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.4183: DFBPPR13075 ---- Animal proteins ---- 60S ribosomal protein L5
Source.4184: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.4185: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1
Source.4186: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog
Source.4187: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4188: DFBPPR13121 ---- Animal proteins ---- Ig heavy chain V-A2 region P-MU-3
Source.4189: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.4190: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.4191: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4192: DFBPPR13165 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.4193: DFBPPR13169 ---- Animal proteins ---- High mobility group protein B1
Source.4194: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase
Source.4195: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.4196: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A
Source.4197: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.4198: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.4199: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.4200: DFBPPR13204 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.4201: DFBPPR13212 ---- Animal proteins ---- Protein Wnt-2
Source.4202: DFBPPR13213 ---- Animal proteins ---- Seminal plasma protein HSP-1
Source.4203: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.4204: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.4205: DFBPPR13222 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.4206: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4207: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein
Source.4208: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.4209: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4210: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.4211: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.4212: DFBPPR13250 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3, truncated
Source.4213: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4214: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.4215: DFBPPR13263 ---- Animal proteins ---- Serotransferrin
Source.4216: DFBPPR13267 ---- Animal proteins ---- Interferon beta
Source.4217: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.4218: DFBPPR13271 ---- Animal proteins ---- Alpha-defensin 1
Source.4219: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.4220: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.4221: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.4222: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.4223: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.4224: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain
Source.4225: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1
Source.4226: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.4227: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.4228: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.4229: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4230: DFBPPR13376 ---- Animal proteins ---- Interleukin-5
Source.4231: DFBPPR13391 ---- Animal proteins ---- F-actin-capping protein subunit alpha-2
Source.4232: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.4233: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4234: DFBPPR13414 ---- Animal proteins ---- Melanotropin beta
Source.4235: DFBPPR13415 ---- Animal proteins ---- Melanotropin alpha
Source.4236: DFBPPR13421 ---- Animal proteins ---- Tumor necrosis factor
Source.4237: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.4238: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.4239: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4240: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4241: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4242: DFBPPR13463 ---- Animal proteins ---- Cathelicidin-2
Source.4243: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4244: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3
Source.4245: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.4246: DFBPPR13497 ---- Animal proteins ---- Plasminogen
Source.4247: DFBPPR13502 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.4248: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9
Source.4249: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin
Source.4250: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.4251: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.4252: DFBPPR13538 ---- Animal proteins ---- Apolipoprotein E
Source.4253: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1
Source.4254: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.4255: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.4256: DFBPPR13573 ---- Animal proteins ---- Tumor necrosis factor
Source.4257: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.4258: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1
Source.4259: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.4260: DFBPPR13584 ---- Animal proteins ---- Calpain-3
Source.4261: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4262: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.4263: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4264: DFBPPR13593 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.4265: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4266: DFBPPR13602 ---- Animal proteins ---- Acrosin
Source.4267: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.4268: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.4269: DFBPPR13620 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.4270: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.4271: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.4272: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.4273: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.4274: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4275: DFBPPR13669 ---- Animal proteins ---- Protein Wnt-2
Source.4276: DFBPPR13674 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase 3
Source.4277: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.4278: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.4279: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.4280: DFBPPR13716 ---- Animal proteins ---- Trichohyalin
Source.4281: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.4282: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase
Source.4283: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4284: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.4285: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.4286: DFBPPR13740 ---- Animal proteins ---- Lysozyme C, kidney isozyme
Source.4287: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.4288: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2
Source.4289: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.4290: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.4291: DFBPPR13759 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.4292: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor
Source.4293: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.4294: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.4295: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9
Source.4296: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.4297: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.4298: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.4299: DFBPPR13789 ---- Animal proteins ---- Tryptase-2
Source.4300: DFBPPR13794 ---- Animal proteins ---- Inhibin alpha chain
Source.4301: DFBPPR13797 ---- Animal proteins ---- Endothelin-1 receptor
Source.4302: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1
Source.4303: DFBPPR13820 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.4304: DFBPPR13826 ---- Animal proteins ---- Translocator protein
Source.4305: DFBPPR13828 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.4306: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A
Source.4307: DFBPPR13835 ---- Animal proteins ---- Dynein light chain Tctex-type 3
Source.4308: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3
Source.4309: DFBPPR13851 ---- Animal proteins ---- Keratin, high-sulfur matrix protein, B2A
Source.4310: DFBPPR13864 ---- Animal proteins ---- Interleukin-5
Source.4311: DFBPPR13870 ---- Animal proteins ---- Cathelicidin-3
Source.4312: DFBPPR13874 ---- Animal proteins ---- Cathelicidin-2
Source.4313: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.4314: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4315: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.4316: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1
Source.4317: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.4318: DFBPPR13911 ---- Animal proteins ---- Keratin, high-sulfur matrix protein, B2C
Source.4319: DFBPPR13915 ---- Animal proteins ---- Gastrin-releasing peptide
Source.4320: DFBPPR13920 ---- Animal proteins ---- Troponin T, cardiac muscle
Source.4321: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.4322: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter
Source.4323: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4324: DFBPPR13949 ---- Animal proteins ---- Keratin, high-sulfur matrix protein, B2B
Source.4325: DFBPPR13955 ---- Animal proteins ---- Beta-defensin 2
Source.4326: DFBPPR13961 ---- Animal proteins ---- Elongation factor 1-delta
Source.4327: DFBPPR13974 ---- Animal proteins ---- Alternative prion protein
Source.4328: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B
Source.4329: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A
Source.4330: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1
Source.4331: DFBPPR13984 ---- Animal proteins ---- Pro-opiomelanocortin-2
Source.4332: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4333: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.4334: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.4335: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.4336: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a
Source.4337: DFBPPR14024 ---- Animal proteins ---- Gamma-crystallin S
Source.4338: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1
Source.4339: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.4340: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.4341: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.4342: DFBPPR14083 ---- Marine protein ---- RING-box protein 1
Source.4343: DFBPPR14095 ---- Marine protein ---- Enolase-phosphatase E1
Source.4344: DFBPPR14106 ---- Marine protein ---- Thyroid hormone receptor alpha
Source.4345: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.4346: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase
Source.4347: DFBPPR14133 ---- Marine protein ---- Calumenin-B
Source.4348: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.4349: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.4350: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I
Source.4351: DFBPPR14146 ---- Marine protein ---- ATP synthase subunit a
Source.4352: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.4353: DFBPPR14156 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit E
Source.4354: DFBPPR14163 ---- Marine protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial
Source.4355: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator
Source.4356: DFBPPR14177 ---- Marine protein ---- Toll-interacting protein
Source.4357: DFBPPR14180 ---- Marine protein ---- Prostamide/prostaglandin F synthase
Source.4358: DFBPPR14197 ---- Marine protein ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.4359: DFBPPR14200 ---- Marine protein ---- Adipocyte plasma membrane-associated protein
Source.4360: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein
Source.4361: DFBPPR14230 ---- Marine protein ---- Pro-opiomelanocortin
Source.4362: DFBPPR14262 ---- Marine protein ---- Pro-opiomelanocortin
Source.4363: DFBPPR14263 ---- Marine protein ---- ATP synthase subunit a
Source.4364: DFBPPR14277 ---- Marine protein ---- Cytochrome c oxidase subunit 5A-2, mitochondrial
Source.4365: DFBPPR14280 ---- Marine protein ---- Cytochrome c oxidase subunit 5A-1, mitochondrial
Source.4366: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.4367: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.4368: DFBPPR14312 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.4369: DFBPPR14321 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.4370: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.4371: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.4372: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4373: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.4374: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.4375: DFBPPR14373 ---- Marine protein ---- Cytochrome b6
Source.4376: DFBPPR14375 ---- Marine protein ---- Cytochrome b559 subunit beta
Source.4377: DFBPPR14380 ---- Marine protein ---- tRNA(Ile)-lysidine synthase, chloroplastic
Source.4378: DFBPPR14398 ---- Marine protein ---- 30S ribosomal protein S7, chloroplastic
Source.4379: DFBPPR14401 ---- Marine protein ---- 50S ribosomal protein L4, chloroplastic
Source.4380: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.4381: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III
Source.4382: DFBPPR14448 ---- Marine protein ---- 50S ribosomal protein L2, chloroplastic
Source.4383: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.4384: DFBPPR14454 ---- Marine protein ---- Cytochrome c biogenesis protein Ccs1
Source.4385: DFBPPR14495 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.4386: DFBPPR14527 ---- Marine protein ---- Uncharacterized protein ycf35
Source.4387: DFBPPR14543 ---- Marine protein ---- Pro-opiomelanocortin A
Source.4388: DFBPPR14546 ---- Marine protein ---- Stanniocalcin
Source.4389: DFBPPR14549 ---- Marine protein ---- Pro-opiomelanocortin B
Source.4390: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.4391: DFBPPR14562 ---- Marine protein ---- Ladderlectin
Source.4392: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.4393: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.4394: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1
Source.4395: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.4396: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.4397: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4398: DFBPPR14600 ---- Marine protein ---- Transforming growth factor beta-1 proprotein
Source.4399: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a
Source.4400: DFBPPR14612 ---- Marine protein ---- Complement component C9
Source.4401: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.4402: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.4403: DFBPPR14625 ---- Marine protein ---- Somatostatin-2
Source.4404: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2
Source.4405: DFBPPR14647 ---- Marine protein ---- Retinol-binding protein 4-A
Source.4406: DFBPPR14648 ---- Marine protein ---- Retinol-binding protein 4-B
Source.4407: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.4408: DFBPPR14666 ---- Marine protein ---- High mobility group-T protein
Source.4409: DFBPPR14668 ---- Marine protein ---- Toll-interacting protein A
Source.4410: DFBPPR14671 ---- Marine protein ---- Toll-interacting protein B
Source.4411: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.4412: DFBPPR14701 ---- Marine protein ---- Hepcidin
Source.4413: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3
Source.4414: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.4415: DFBPPR14753 ---- Marine protein ---- Clotting factor B
Source.4416: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.4417: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.4418: DFBPPR14766 ---- Marine protein ---- Tachyplesin-2
Source.4419: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.4420: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.4421: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.4422: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain
Source.4423: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.4424: DFBPPR14795 ---- Marine protein ---- Guanine nucleotide-binding protein G(s) subunit alpha
Source.4425: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase
Source.4426: DFBPPR14803 ---- Marine protein ---- Crustacyanin-A2 subunit
Source.4427: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.4428: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.4429: DFBPPR14815 ---- Marine protein ---- Cytochrome P450 2L1
Source.4430: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.4431: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.4432: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.4433: DFBPPR14877 ---- Microorganism protein ---- Ubiquitin-conjugating enzyme E2 2
Source.4434: DFBPPR14883 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.4435: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.4436: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.4437: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1
Source.4438: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.4439: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.4440: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.4441: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.4442: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.4443: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5
Source.4444: DFBPPR14908 ---- Microorganism protein ---- Flap endonuclease 1
Source.4445: DFBPPR14909 ---- Microorganism protein ---- ATPase GET3
Source.4446: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.4447: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1
Source.4448: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase
Source.4449: DFBPPR14919 ---- Microorganism protein ---- Transcription elongation factor SPT4
Source.4450: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.4451: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.4452: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.4453: DFBPPR14954 ---- Microorganism protein ---- NAD(P)H-dependent D-xylose reductase
Source.4454: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1
Source.4455: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.4456: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.4457: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5
Source.4458: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.4459: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.4460: DFBPPR14999 ---- Microorganism protein ---- Histone H3-like centromeric protein CSE4
Source.4461: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.4462: DFBPPR15010 ---- Microorganism protein ---- N-acetyltransferase ECO1
Source.4463: DFBPPR15013 ---- Microorganism protein ---- Inorganic pyrophosphatase
Source.4464: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.4465: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase
Source.4466: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.4467: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1
Source.4468: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.4469: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.4470: DFBPPR15057 ---- Microorganism protein ---- Protein transport protein SEC13
Source.4471: DFBPPR15063 ---- Microorganism protein ---- Chitobiosyldiphosphodolichol beta-mannosyltransferase
Source.4472: DFBPPR15064 ---- Microorganism protein ---- Palmitoyltransferase SWF1
Source.4473: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.4474: DFBPPR15087 ---- Microorganism protein ---- Transcriptional activator HAP3
Source.4475: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13
Source.4476: DFBPPR15091 ---- Microorganism protein ---- Lipoyl synthase, mitochondrial
Source.4477: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.4478: DFBPPR15104 ---- Microorganism protein ---- COP9 signalosome complex subunit 5
Source.4479: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.4480: DFBPPR15114 ---- Microorganism protein ---- Methylated-DNA--protein-cysteine methyltransferase
Source.4481: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.4482: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial
Source.4483: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.4484: DFBPPR15124 ---- Microorganism protein ---- Autophagy protein 16
Source.4485: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4
Source.4486: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.4487: DFBPPR15144 ---- Microorganism protein ---- Palmitoyltransferase PFA4
Source.4488: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase
Source.4489: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81
Source.4490: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.4491: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.4492: DFBPPR15179 ---- Microorganism protein ---- ATP-dependent RNA helicase MRH4, mitochondrial
Source.4493: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.4494: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase
Source.4495: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog
Source.4496: DFBPPR15199 ---- Microorganism protein ---- mRNA-capping enzyme subunit alpha
Source.4497: DFBPPR15205 ---- Microorganism protein ---- Glucose-6-phosphate 1-dehydrogenase
Source.4498: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.4499: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.4500: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1
Source.4501: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.4502: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60
Source.4503: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5
Source.4504: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.4505: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3
Source.4506: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.4507: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.4508: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.4509: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.4510: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.4511: DFBPPR15282 ---- Microorganism protein ---- Peroxisomal biogenesis factor 3
Source.4512: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1
Source.4513: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2
Source.4514: DFBPPR15294 ---- Microorganism protein ---- Lactose permease
Source.4515: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter
Source.4516: DFBPPR15309 ---- Microorganism protein ---- Respiratory supercomplex factor 1, mitochondrial
Source.4517: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21
Source.4518: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.4519: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1
Source.4520: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.4521: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.4522: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10
Source.4523: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10
Source.4524: DFBPPR15328 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 31
Source.4525: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3
Source.4526: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.4527: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1
Source.4528: DFBPPR15353 ---- Microorganism protein ---- Pre-mRNA-splicing factor ISY1
Source.4529: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.4530: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.4531: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.4532: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.4533: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial
Source.4534: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5
Source.4535: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.4536: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.4537: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.4538: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2
Source.4539: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2
Source.4540: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2
Source.4541: DFBPPR15419 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 34
Source.4542: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial
Source.4543: DFBPPR15437 ---- Microorganism protein ---- Ubiquitin-like-conjugating enzyme ATG10
Source.4544: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase
Source.4545: DFBPPR15442 ---- Microorganism protein ---- Type 1 phosphatases regulator YPI1
Source.4546: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.4547: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.4548: DFBPPR15457 ---- Microorganism protein ---- Ribosome biogenesis protein RLP24
Source.4549: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.4550: DFBPPR15462 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM21
Source.4551: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.4552: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46
Source.4553: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.4554: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1
Source.4555: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.4556: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1
Source.4557: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.4558: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1
Source.4559: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.4560: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14
Source.4561: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10
Source.4562: DFBPPR15528 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC23
Source.4563: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.4564: DFBPPR15540 ---- Microorganism protein ---- Probable intron-encoded endonuclease aI3
Source.4565: DFBPPR15542 ---- Microorganism protein ---- Protein STE12
Source.4566: DFBPPR15548 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 25
Source.4567: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.4568: DFBPPR15555 ---- Microorganism protein ---- Spindle pole body component 110
Source.4569: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.4570: DFBPPR15559 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC26
Source.4571: DFBPPR15565 ---- Microorganism protein ---- 37S ribosomal protein S10, mitochondrial
Source.4572: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.4573: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1
Source.4574: DFBPPR15572 ---- Microorganism protein ---- Succinate dehydrogenase assembly factor 2, mitochondrial
Source.4575: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1
Source.4576: DFBPPR15597 ---- Microorganism protein ---- DNA damage-binding protein CMR1
Source.4577: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2
Source.4578: DFBPPR15606 ---- Microorganism protein ---- Assembly factor CBP4
Source.4579: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2
Source.4580: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.4581: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.4582: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7
Source.4583: DFBPPR15636 ---- Microorganism protein ---- ATP synthase subunit d, mitochondrial
Source.4584: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2
Source.4585: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3
Source.4586: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1
Source.4587: DFBPPR15676 ---- Microorganism protein ---- Antagonist of mitotic exit network protein 1
Source.4588: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21
Source.4589: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3
Source.4590: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23
Source.4591: DFBPPR15721 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 23, mitochondrial
Source.4592: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.4593: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.4594: DFBPPR15737 ---- Microorganism protein ---- Required for respiratory growth protein 9, mitochondrial
Source.4595: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8
Source.4596: DFBPPR15752 ---- Microorganism protein ---- Protein HRI1
Source.4597: DFBPPR15754 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 24, mitochondrial
Source.4598: DFBPPR15757 ---- Microorganism protein ---- Copper transport protein 86
Source.4599: DFBPPR15758 ---- Microorganism protein ---- Required for respiratory growth protein 8, mitochondrial
Source.4600: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10
Source.4601: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111
Source.4602: DFBPPR15780 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 8
Source.4603: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.4604: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.4605: DFBPPR15805 ---- Microorganism protein ---- Serine O-acetyltransferase
Source.4606: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.4607: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.4608: DFBPPR15841 ---- Microorganism protein ---- Agaricus bisporus lectin
Source.4609: DFBPPR15849 ---- Microorganism protein ---- Exoglucanase
Source.4610: DFBPPR15868 ---- Microorganism protein ---- Thymidylate synthase
Source.4611: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.4612: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase
Source.4613: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4614: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.4615: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.4616: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4617: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.4618: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.4619: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4620: DFBPPR7794 ---- Plant protein ---- Cytochrome b6
Source.4621: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.4622: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.4623: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.4624: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.4625: DFBPPR7812 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.4626: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.4627: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.4628: DFBPPR7823 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.4629: DFBPPR7853 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic
Source.4630: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.4631: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1
Source.4632: DFBPPR7875 ---- Plant protein ---- CASP-like protein 4B1
Source.4633: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.4634: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1
Source.4635: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1
Source.4636: DFBPPR7891 ---- Plant protein ---- CASP-like protein 1B1
Source.4637: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1
Source.4638: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.4639: DFBPPR7912 ---- Plant protein ---- Chloroplast envelope membrane protein
Source.4640: DFBPPR7913 ---- Plant protein ---- CASP-like protein 1U4
Source.4641: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.4642: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.4643: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.4644: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.4645: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.4646: DFBPPR7975 ---- Plant protein ---- Protein Ycf2
Source.4647: DFBPPR7985 ---- Plant protein ---- Uncharacterized 9.9 kDa protein
Source.4648: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.4649: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4650: DFBPPR7997 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.4651: DFBPPR8000 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.4652: DFBPPR8007 ---- Plant protein ---- Maturase K
Source.4653: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.4654: DFBPPR8029 ---- Plant protein ---- Vignain
Source.4655: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.4656: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4657: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.4658: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.4659: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.4660: DFBPPR8054 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin
Source.4661: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4662: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.4663: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.4664: DFBPPR8069 ---- Plant protein ---- Endoglucanase
Source.4665: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.4666: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.4667: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme
Source.4668: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.4669: DFBPPR8088 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.4670: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.4671: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.4672: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.4673: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A
Source.4674: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.4675: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.4676: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1
Source.4677: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.4678: DFBPPR8127 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.4679: DFBPPR8146 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.4680: DFBPPR8154 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.4681: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.4682: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.4683: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.4684: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.4685: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1
Source.4686: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.4687: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.4688: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4689: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.4690: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.4691: DFBPPR8243 ---- Plant protein ---- 11S globulin seed storage protein G3
Source.4692: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.4693: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic
Source.4694: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic
Source.4695: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.4696: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.4697: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.4698: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.4699: DFBPPR8270 ---- Plant protein ---- Cytochrome b559 subunit beta
Source.4700: DFBPPR8271 ---- Plant protein ---- Cytochrome b6
Source.4701: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.4702: DFBPPR8281 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.4703: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.4704: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.4705: DFBPPR8302 ---- Plant protein ---- 60S ribosomal protein L5
Source.4706: DFBPPR8303 ---- Plant protein ---- 50S ribosomal protein L2, chloroplastic
Source.4707: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.4708: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.4709: DFBPPR8323 ---- Plant protein ---- Cytochrome P450
Source.4710: DFBPPR8335 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 16 μM.

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(=CN2)C1=C2C=CC=C1)C(=O)O
Preparation method
Mode of preparation

Synthesis

Enzyme(s)/starter culture

Dipeptides were purchased from either Vega-Fox or Chemical DYnamics.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

Although the peptide is a synthetic peptide, it is present in many food-source proteins.

Database cross-references
DFBP
[D1] DFBPANOX0784
[D2] DFBPINPE0015
[D3] DFBPMUFU0457
BIOPEP-UWM [D4] 7580, 8214, 8890, 9477
APD [D5] -
BioPepDB [D6] -
MBPDB [D7] -
Reference(s)
Primary literature Cheung HS, Wang FL, Ondetti MA, Sabo EF, Cushman DW. Binding of peptide substrates and inhibitors of angiotensin-converting enzyme. Importance of the COOH-terminal dipeptide sequence. J Biol Chem. 1980 Jan 25;255(2):401-7.
PMID: 6243277
Other literature(s) N.D
PubDate 1980
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214