Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI1646(ACE-inhibitory peptide)

DFBP ID	DFBPACEI1646
Peptide sequence	IRP
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Ile-Arg-Pro

Single-letter amino acid

IRP

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	384.47 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

11.04 ^c

IC₅₀

1.8 uM

pIC₅₀

-0.255

GRAVY

-0.5333^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal, Marine, Fish
Organism/Source	Bonito, Katsuobushi
Precursor protein	Bonito Bowels Autolysate
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0163 ---- Plant proteins ---- Monellin chain B Source.2: DFBPPR0833 ---- Plant proteins ---- Allene oxide cyclase, chloroplastic Source.3: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1 Source.4: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.5: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18 Source.6: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.7: DFBPPR0900 ---- Plant proteins ---- GTPase activating protein 1 Source.8: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.9: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.10: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial Source.11: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.12: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic Source.13: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.14: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog Source.15: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2 Source.16: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA Source.17: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic Source.18: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming] Source.19: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.20: DFBPPR1017 ---- Plant proteins ---- Glucosamine 6-phosphate N-acetyltransferase 1 Source.21: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56 Source.22: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A Source.23: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3 Source.24: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic Source.25: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic Source.26: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic Source.27: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19 Source.28: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15 Source.29: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.30: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.31: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1 Source.32: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.33: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1 Source.34: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1 Source.35: DFBPPR1340 ---- Plant proteins ---- F-box protein GID2 Source.36: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.37: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.38: DFBPPR1365 ---- Plant proteins ---- Replication protein A 32 kDa subunit A Source.39: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.40: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156 Source.41: DFBPPR1427 ---- Plant proteins ---- Probable esterase D14L Source.42: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.43: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1 Source.44: DFBPPR1468 ---- Plant proteins ---- Serotonin N-acetyltransferase 2, chloroplastic Source.45: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.46: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2 Source.47: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2 Source.48: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.49: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C Source.50: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.51: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.52: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2 Source.53: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic Source.54: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2 Source.55: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1 Source.56: DFBPPR1727 ---- Plant proteins ---- Cyclin-dependent kinase C-3 Source.57: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2 Source.58: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11 Source.59: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4 Source.60: DFBPPR1806 ---- Plant proteins ---- Laccase-19 Source.61: DFBPPR1823 ---- Plant proteins ---- Protein YABBY 1 Source.62: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.63: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.64: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17 Source.65: DFBPPR1861 ---- Plant proteins ---- Laccase-25 Source.66: DFBPPR1867 ---- Plant proteins ---- Laccase-21 Source.67: DFBPPR1870 ---- Plant proteins ---- Laccase-20 Source.68: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1 Source.69: DFBPPR1889 ---- Plant proteins ---- Laccase-18 Source.70: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1 Source.71: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4 Source.72: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial Source.73: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6 Source.74: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.75: DFBPPR1916 ---- Plant proteins ---- Protein PYRICULARIA ORYZAE RESISTANCE 21 Source.76: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A Source.77: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3 Source.78: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.79: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.80: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.81: DFBPPR2013 ---- Plant proteins ---- Laccase-6 Source.82: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.83: DFBPPR2028 ---- Plant proteins ---- Laccase-7 Source.84: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16 Source.85: DFBPPR2040 ---- Plant proteins ---- Laccase-3 Source.86: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15 Source.87: DFBPPR2052 ---- Plant proteins ---- Laccase-23 Source.88: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA Source.89: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.90: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9 Source.91: DFBPPR2131 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 2, chloroplastic Source.92: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic Source.93: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11 Source.94: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.95: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic Source.96: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.97: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30 Source.98: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C Source.99: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1 Source.100: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.101: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28 Source.102: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5 Source.103: DFBPPR2445 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 3 Source.104: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4 Source.105: DFBPPR2474 ---- Plant proteins ---- Two-component response regulator ORR10 Source.106: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase Source.107: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14 Source.108: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic Source.109: DFBPPR2519 ---- Plant proteins ---- Probable protein phosphatase 2C 9 Source.110: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase Source.111: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.112: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1 Source.113: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic Source.114: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.115: DFBPPR2626 ---- Plant proteins ---- ADP-ribosylation factor 1 Source.116: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2 Source.117: DFBPPR2638 ---- Plant proteins ---- Two-component response regulator ORR9 Source.118: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26 Source.119: DFBPPR2711 ---- Plant proteins ---- ADP-ribosylation factor 2 Source.120: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.121: DFBPPR2722 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 20 Source.122: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.123: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.124: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.125: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2 Source.126: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.127: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.128: DFBPPR2866 ---- Plant proteins ---- Phosphomannomutase Source.129: DFBPPR2886 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.130: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3 Source.131: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b Source.132: DFBPPR2935 ---- Plant proteins ---- Germin-like protein 8-13 Source.133: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1 Source.134: DFBPPR2985 ---- Plant proteins ---- Coatomer subunit delta-3 Source.135: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog Source.136: DFBPPR2995 ---- Plant proteins ---- Eukaryotic translation initiation factor 4E-1 Source.137: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B Source.138: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17 Source.139: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1 Source.140: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.141: DFBPPR3075 ---- Plant proteins ---- Thiamine pyrophosphokinase 2 Source.142: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.143: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33 Source.144: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.145: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.146: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7 Source.147: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic Source.148: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1 Source.149: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51 Source.150: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.151: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32 Source.152: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.153: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic Source.154: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.155: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1 Source.156: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.157: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.158: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3 Source.159: DFBPPR3271 ---- Plant proteins ---- Eukaryotic translation initiation factor NCBP Source.160: DFBPPR3313 ---- Plant proteins ---- Protein NINJA homolog 1 Source.161: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8 Source.162: DFBPPR3347 ---- Plant proteins ---- Thiamine pyrophosphokinase 1 Source.163: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic Source.164: DFBPPR3371 ---- Plant proteins ---- Kinesin-like protein KIN-14R Source.165: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.166: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2 Source.167: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1 Source.168: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.169: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.170: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49 Source.171: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic Source.172: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9 Source.173: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4 Source.174: DFBPPR3530 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL2 Source.175: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.176: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3 Source.177: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5 Source.178: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.179: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase Source.180: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6 Source.181: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6 Source.182: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1 Source.183: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic Source.184: DFBPPR3655 ---- Plant proteins ---- Fe-S cluster assembly factor HCF101, chloroplastic Source.185: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.186: DFBPPR3686 ---- Plant proteins ---- NifU-like protein 1, chloroplastic Source.187: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39 Source.188: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.189: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic Source.190: DFBPPR3739 ---- Plant proteins ---- Kinesin-like protein KIN-14B Source.191: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A Source.192: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6 Source.193: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D Source.194: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic Source.195: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog Source.196: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic Source.197: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.198: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10 Source.199: DFBPPR3949 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-2, mitochondrial Source.200: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9 Source.201: DFBPPR3965 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta-1, mitochondrial Source.202: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.203: DFBPPR4060 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic Source.204: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6 Source.205: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8 Source.206: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5 Source.207: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4 Source.208: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.209: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C Source.210: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3 Source.211: DFBPPR4176 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 3 Source.212: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH Source.213: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.214: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial Source.215: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4 Source.216: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.217: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.218: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1 Source.219: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10 Source.220: DFBPPR4318 ---- Plant proteins ---- Golgin-84 Source.221: DFBPPR4333 ---- Plant proteins ---- Putative potassium channel KAT5 Source.222: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1 Source.223: DFBPPR4398 ---- Plant proteins ---- 40S ribosomal protein S16 Source.224: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.225: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP Source.226: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2 Source.227: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1 Source.228: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.229: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog Source.230: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1 Source.231: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.232: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.233: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.234: DFBPPR4631 ---- Plant proteins ---- B3 domain-containing protein Os03g0620500 Source.235: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24 Source.236: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5 Source.237: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.238: DFBPPR4859 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40090 Source.239: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3 Source.240: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1 Source.241: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase Source.242: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.243: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.244: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.245: DFBPPR5151 ---- Plant proteins ---- Phosphomannomutase Source.246: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.247: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.248: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase Source.249: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.250: DFBPPR5264 ---- Plant proteins ---- Casparian strip membrane protein 4 Source.251: DFBPPR5267 ---- Plant proteins ---- Casparian strip membrane protein 3 Source.252: DFBPPR5268 ---- Plant proteins ---- Casparian strip membrane protein 2 Source.253: DFBPPR5278 ---- Plant proteins ---- 40S ribosomal protein SA Source.254: DFBPPR5304 ---- Plant proteins ---- Maturase K Source.255: DFBPPR5342 ---- Plant proteins ---- Nodulin-44 Source.256: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.257: DFBPPR5450 ---- Plant proteins ---- Adenylate kinase, chloroplastic Source.258: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.259: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.260: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3 Source.261: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.262: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.263: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.264: DFBPPR5728 ---- Plant proteins ---- Calreticulin Source.265: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.266: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A Source.267: DFBPPR5772 ---- Plant proteins ---- Eukaryotic translation initiation factor 4E-1 Source.268: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1 Source.269: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.270: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2 Source.271: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.272: DFBPPR5876 ---- Plant proteins ---- ADP-ribosylation factor Source.273: DFBPPR5897 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.274: DFBPPR5927 ---- Plant proteins ---- Aquaporin SIP2-1 Source.275: DFBPPR5941 ---- Plant proteins ---- 50S ribosomal protein L16, chloroplastic Source.276: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2 Source.277: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP) Source.278: DFBPPR6089 ---- Plant proteins ---- Cell number regulator 6 Source.279: DFBPPR6105 ---- Plant proteins ---- CASP-like protein 2U1 Source.280: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.281: DFBPPR6153 ---- Plant proteins ---- Ninja-family protein 8 Source.282: DFBPPR6154 ---- Plant proteins ---- Ninja-family protein 7 Source.283: DFBPPR6208 ---- Plant proteins ---- Cysteine proteinase 2 Source.284: DFBPPR6289 ---- Plant proteins ---- Protein farnesyltransferase subunit beta Source.285: DFBPPR6353 ---- Plant proteins ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.286: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.287: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.288: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.289: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase Source.290: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A Source.291: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D Source.292: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B Source.293: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A Source.294: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase Source.295: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.296: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.297: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B Source.298: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.299: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.300: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A Source.301: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.302: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1 Source.303: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.304: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2 Source.305: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.306: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.307: DFBPPR7204 ---- Plant proteins ---- Thiol protease aleurain Source.308: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic Source.309: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4 Source.310: DFBPPR7417 ---- Plant proteins ---- Cruciferin Source.311: DFBPPR7444 ---- Plant proteins ---- Cruciferin BnC2 Source.312: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1 Source.313: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic Source.314: DFBPPR7469 ---- Plant proteins ---- Germin-like protein 1 Source.315: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.316: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.317: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA Source.318: DFBPPR7520 ---- Plant proteins ---- 40S ribosomal protein S15a Source.319: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.320: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein Source.321: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase Source.322: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4 Source.323: DFBPPR7642 ---- Milk proteins ---- Inactive pancreatic lipase-related protein 1 Source.324: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta Source.325: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal Source.326: DFBPPR8192 ---- Plant proteins ---- 2S albumin Source.327: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.328: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal Source.329: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B Source.330: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17 Source.331: DFBPPR8428 ---- Plant proteins ---- 11S globulin seed storage protein 2 Source.332: DFBPPR8429 ---- Plant proteins ---- Oleosin H2 Source.333: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.334: DFBPPR15965 ---- Animal proteins ---- Dystroglycan Source.335: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8 Source.336: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1 Source.337: DFBPPR16000 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.338: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.339: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV Source.340: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.341: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.342: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.343: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.344: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1 Source.345: DFBPPR16108 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.346: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase Source.347: DFBPPR16173 ---- Animal proteins ---- Aromatase Source.348: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.349: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.350: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.351: DFBPPR16240 ---- Animal proteins ---- Fibronectin Source.352: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.353: DFBPPR16263 ---- Animal proteins ---- Protein 4.1 Source.354: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.355: DFBPPR16378 ---- Animal proteins ---- Arginine esterase Source.356: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.357: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2 Source.358: DFBPPR16467 ---- Animal proteins ---- Opticin Source.359: DFBPPR16480 ---- Animal proteins ---- Interleukin-13 receptor subunit alpha-2 Source.360: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.361: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1 Source.362: DFBPPR16632 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.363: DFBPPR16656 ---- Animal proteins ---- 60S ribosomal protein L4 Source.364: DFBPPR16662 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.365: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.366: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2 Source.367: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase Source.368: DFBPPR16831 ---- Animal proteins ---- Fibrinogen beta chain Source.369: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.370: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.371: DFBPPR16847 ---- Animal proteins ---- Fibrinogen alpha chain Source.372: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase Source.373: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.374: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase Source.375: DFBPPR16915 ---- Animal proteins ---- Vitamin K-dependent protein S Source.376: DFBPPR16959 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.377: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1 Source.378: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.379: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.380: DFBPPR17102 ---- Animal proteins ---- Dystroglycan Source.381: DFBPPR17103 ---- Animal proteins ---- Dystroglycan Source.382: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2 Source.383: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta Source.384: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1 Source.385: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain Source.386: DFBPPR17168 ---- Animal proteins ---- Angiopoietin-1 Source.387: DFBPPR17198 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.388: DFBPPR17237 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide Source.389: DFBPPR17296 ---- Animal proteins ---- Dynamin-2 Source.390: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI Source.391: DFBPPR17339 ---- Animal proteins ---- Pre-mRNA-processing factor 19 Source.392: DFBPPR17340 ---- Animal proteins ---- Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating Source.393: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.394: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1 Source.395: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.396: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.397: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Source.398: DFBPPR17478 ---- Animal proteins ---- Carboxypeptidase B2 Source.399: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1 Source.400: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.401: DFBPPR17484 ---- Animal proteins ---- Histone H1.8 Source.402: DFBPPR17491 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3 Source.403: DFBPPR17518 ---- Animal proteins ---- ADP-ribosylation factor 1 Source.404: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5 Source.405: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.406: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.407: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor Source.408: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.409: DFBPPR17661 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3 Source.410: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial Source.411: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1 Source.412: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1 Source.413: DFBPPR17792 ---- Animal proteins ---- Glycine N-acyltransferase Source.414: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.415: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial Source.416: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.417: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1 Source.418: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1 Source.419: DFBPPR17968 ---- Animal proteins ---- Cathelicidin-2 Source.420: DFBPPR18033 ---- Animal proteins ---- Cathelicidin-3 Source.421: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase Source.422: DFBPPR18079 ---- Animal proteins ---- DNA polymerase beta Source.423: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1 Source.424: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.425: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1 Source.426: DFBPPR18190 ---- Animal proteins ---- Serine/threonine-protein kinase 25 Source.427: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5 Source.428: DFBPPR18242 ---- Animal proteins ---- Heparanase Source.429: DFBPPR18252 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.430: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1 Source.431: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.432: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B Source.433: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20 Source.434: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1 Source.435: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.436: DFBPPR18437 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.437: DFBPPR18492 ---- Animal proteins ---- ADP-ribosylation factor-like protein 1 Source.438: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.439: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130 Source.440: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1 Source.441: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.442: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.443: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1 Source.444: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2 Source.445: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.446: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog Source.447: DFBPPR18839 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 12 Source.448: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.449: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.450: DFBPPR18880 ---- Animal proteins ---- Protein Jade-1 Source.451: DFBPPR18897 ---- Animal proteins ---- Kelch-like protein 20 Source.452: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1 Source.453: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase Source.454: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3 Source.455: DFBPPR18919 ---- Animal proteins ---- Dual specificity protein phosphatase 18 Source.456: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.457: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2 Source.458: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.459: DFBPPR18960 ---- Animal proteins ---- Spondin-1 Source.460: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.461: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1 Source.462: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I Source.463: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial Source.464: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.465: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E Source.466: DFBPPR19084 ---- Animal proteins ---- V-type proton ATPase subunit G 1 Source.467: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5 Source.468: DFBPPR19176 ---- Animal proteins ---- Collagen alpha-2(IV) chain Source.469: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase Source.470: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog Source.471: DFBPPR19237 ---- Animal proteins ---- Cadherin-18 Source.472: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.473: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.474: DFBPPR19277 ---- Animal proteins ---- Prolactin-releasing peptide Source.475: DFBPPR19299 ---- Animal proteins ---- Annexin A7 Source.476: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.477: DFBPPR19368 ---- Animal proteins ---- Prion-like protein doppel Source.478: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.479: DFBPPR19375 ---- Animal proteins ---- ATPase family AAA domain-containing protein 1 Source.480: DFBPPR19419 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit Source.481: DFBPPR19510 ---- Animal proteins ---- Transportin-1 Source.482: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2 Source.483: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase Source.484: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog Source.485: DFBPPR19557 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3 Source.486: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2 Source.487: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.488: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4 Source.489: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS Source.490: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2 Source.491: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform Source.492: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.493: DFBPPR19681 ---- Animal proteins ---- Fibroleukin Source.494: DFBPPR19735 ---- Animal proteins ---- Complement component C7 Source.495: DFBPPR19771 ---- Animal proteins ---- Rho-related GTP-binding protein RhoH Source.496: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.497: DFBPPR19806 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial Source.498: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.499: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.500: DFBPPR19834 ---- Animal proteins ---- Harmonin Source.501: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1 Source.502: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6 Source.503: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6 Source.504: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B Source.505: DFBPPR19959 ---- Animal proteins ---- Complement C1q subcomponent subunit B Source.506: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27 Source.507: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7 Source.508: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1 Source.509: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase Source.510: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2 Source.511: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A Source.512: DFBPPR20051 ---- Animal proteins ---- 28S ribosomal protein S18a, mitochondrial Source.513: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2 Source.514: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6 Source.515: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.516: DFBPPR20258 ---- Animal proteins ---- Ribosome biogenesis regulatory protein homolog Source.517: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2 Source.518: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1 Source.519: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein Source.520: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3 Source.521: DFBPPR20513 ---- Animal proteins ---- Rho GTPase-activating protein 29 Source.522: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42 Source.523: DFBPPR20528 ---- Animal proteins ---- Thiamin pyrophosphokinase 1 Source.524: DFBPPR20542 ---- Animal proteins ---- ADP-ribosylation factor 2 Source.525: DFBPPR20544 ---- Animal proteins ---- 28S ribosomal protein S34, mitochondrial Source.526: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3 Source.527: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A Source.528: DFBPPR20576 ---- Animal proteins ---- 60S ribosomal protein L23a Source.529: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.530: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1 Source.531: DFBPPR20643 ---- Animal proteins ---- Fibrinogen-like protein 1 Source.532: DFBPPR20660 ---- Animal proteins ---- ADP-ribosylation factor 3 Source.533: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11 Source.534: DFBPPR20740 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 6 Source.535: DFBPPR20763 ---- Animal proteins ---- Dual specificity protein phosphatase 14 Source.536: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2 Source.537: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial Source.538: DFBPPR20790 ---- Animal proteins ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1 Source.539: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.540: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial Source.541: DFBPPR20907 ---- Animal proteins ---- Prostaglandin D2 receptor Source.542: DFBPPR20924 ---- Animal proteins ---- Cyclin-dependent kinase 2-associated protein 2 Source.543: DFBPPR20927 ---- Animal proteins ---- ADP-ribosylation factor 4 Source.544: DFBPPR20941 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC1 Source.545: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1 Source.546: DFBPPR20975 ---- Animal proteins ---- 39S ribosomal protein L2, mitochondrial Source.547: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1 Source.548: DFBPPR21023 ---- Animal proteins ---- Ribosome biogenesis protein NSA2 homolog Source.549: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3 Source.550: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6 Source.551: DFBPPR21110 ---- Animal proteins ---- Pro-adrenomedullin Source.552: DFBPPR21118 ---- Animal proteins ---- NADH-cytochrome b5 reductase 1 Source.553: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7 Source.554: DFBPPR21159 ---- Animal proteins ---- Origin recognition complex subunit 4 Source.555: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase Source.556: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4 Source.557: DFBPPR21276 ---- Animal proteins ---- DnaJ homolog subfamily C member 11 Source.558: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4 Source.559: DFBPPR21352 ---- Animal proteins ---- Glutathione peroxidase 7 Source.560: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18 Source.561: DFBPPR21389 ---- Animal proteins ---- N-terminal EF-hand calcium-binding protein 3 Source.562: DFBPPR21469 ---- Animal proteins ---- Probable glutathione peroxidase 8 Source.563: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like Source.564: DFBPPR21510 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7 Source.565: DFBPPR21628 ---- Animal proteins ---- G patch domain-containing protein 11 Source.566: DFBPPR21751 ---- Animal proteins ---- Oocyte-expressed protein homolog Source.567: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10 Source.568: DFBPPR21864 ---- Animal proteins ---- Arpin Source.569: DFBPPR21917 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 2 Source.570: DFBPPR21991 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC7-like Source.571: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2 Source.572: DFBPPR22031 ---- Animal proteins ---- KxDL motif-containing protein 1 Source.573: DFBPPR22083 ---- Animal proteins ---- 40S ribosomal protein S15a Source.574: DFBPPR22183 ---- Animal proteins ---- Retrotransposon Gag-like protein 8 Source.575: DFBPPR22192 ---- Animal proteins ---- Receptor expression-enhancing protein 5 Source.576: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2 Source.577: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C Source.578: DFBPPR22302 ---- Animal proteins ---- Protein angel homolog 2 Source.579: DFBPPR22453 ---- Animal proteins ---- Protein FAM107B Source.580: DFBPPR22497 ---- Animal proteins ---- Enkurin domain-containing protein 1 Source.581: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183 Source.582: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15 Source.583: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.584: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.585: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.586: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.587: DFBPPR22736 ---- Animal proteins ---- Uncharacterized protein C16orf71 homolog Source.588: DFBPPR8537 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3 Source.589: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.590: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.591: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.592: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.593: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.594: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.595: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.596: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3 Source.597: DFBPPR8699 ---- Animal proteins ---- ADP-ribosylation factor 6 Source.598: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.599: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.600: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.601: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase Source.602: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.603: DFBPPR8772 ---- Animal proteins ---- Dystroglycan Source.604: DFBPPR8795 ---- Animal proteins ---- Pro-adrenomedullin Source.605: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.606: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.607: DFBPPR8833 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide Source.608: DFBPPR8849 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3 Source.609: DFBPPR8850 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3 Source.610: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase Source.611: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.612: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B Source.613: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.614: DFBPPR9016 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.615: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.616: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase Source.617: DFBPPR9053 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF19A Source.618: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase Source.619: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.620: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A Source.621: DFBPPR9140 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.622: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1 Source.623: DFBPPR9156 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.624: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20 Source.625: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.626: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type Source.627: DFBPPR9306 ---- Animal proteins ---- Complement component C7 Source.628: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26 Source.629: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1 Source.630: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4 Source.631: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase Source.632: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase Source.633: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase Source.634: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.635: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2 Source.636: DFBPPR9515 ---- Animal proteins ---- PDZ and LIM domain protein 3 Source.637: DFBPPR9527 ---- Animal proteins ---- Nuclear factor 1 Source.638: DFBPPR9560 ---- Animal proteins ---- Protein maelstrom homolog Source.639: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.640: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2 Source.641: DFBPPR9699 ---- Animal proteins ---- Angiopoietin-1 Source.642: DFBPPR9708 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7 Source.643: DFBPPR9758 ---- Animal proteins ---- Galanin-like peptide Source.644: DFBPPR9759 ---- Animal proteins ---- Palmdelphin Source.645: DFBPPR9762 ---- Animal proteins ---- Prenylated Rab acceptor protein 1 Source.646: DFBPPR9773 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.647: DFBPPR9948 ---- Animal proteins ---- Vertnin Source.648: DFBPPR9949 ---- Animal proteins ---- Coiled-coil domain-containing protein 127 Source.649: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1 Source.650: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.651: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain Source.652: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.653: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3 Source.654: DFBPPR10033 ---- Animal proteins ---- Apolipoprotein A-I Source.655: DFBPPR10052 ---- Animal proteins ---- Protein Wnt-11 Source.656: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1 Source.657: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.658: DFBPPR10105 ---- Animal proteins ---- ADP-ribosylation factor 6 Source.659: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2 Source.660: DFBPPR10114 ---- Animal proteins ---- Cadherin-5 Source.661: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.662: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.663: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.664: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.665: DFBPPR10140 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1 Source.666: DFBPPR10183 ---- Animal proteins ---- Villin-1 Source.667: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.668: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.669: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1 Source.670: DFBPPR10267 ---- Animal proteins ---- Gephyrin Source.671: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.672: DFBPPR10329 ---- Animal proteins ---- Activity-regulated cytoskeleton-associated protein Source.673: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.674: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2 Source.675: DFBPPR10376 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.676: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5 Source.677: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.678: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19 Source.679: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog Source.680: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4 Source.681: DFBPPR10466 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.682: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.683: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase Source.684: DFBPPR10542 ---- Animal proteins ---- Erythroid transcription factor Source.685: DFBPPR10563 ---- Animal proteins ---- Optineurin Source.686: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1 Source.687: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B Source.688: DFBPPR10594 ---- Animal proteins ---- Aromatase Source.689: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6 Source.690: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1 Source.691: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.692: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai Source.693: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.694: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1 Source.695: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase Source.696: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.697: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.698: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E Source.699: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4 Source.700: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.701: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1 Source.702: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.703: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.704: DFBPPR10882 ---- Animal proteins ---- Noggin Source.705: DFBPPR10899 ---- Animal proteins ---- Acyl-CoA dehydrogenase family member 11 Source.706: DFBPPR10908 ---- Animal proteins ---- G1/S-specific cyclin-D1 Source.707: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.708: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28 Source.709: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2 Source.710: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.711: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type Source.712: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type Source.713: DFBPPR10964 ---- Animal proteins ---- Protein artemis Source.714: DFBPPR10965 ---- Animal proteins ---- Nuclear factor 1 X-type Source.715: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.716: DFBPPR10971 ---- Animal proteins ---- 5' exonuclease Apollo Source.717: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.718: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit Source.719: DFBPPR11019 ---- Animal proteins ---- Cadherin-4 Source.720: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.721: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1 Source.722: DFBPPR11062 ---- Animal proteins ---- Regucalcin Source.723: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a Source.724: DFBPPR11084 ---- Animal proteins ---- Magnesium transporter protein 1 Source.725: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1 Source.726: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2 Source.727: DFBPPR11205 ---- Animal proteins ---- Protein 4.1 Source.728: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.729: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6 Source.730: DFBPPR11277 ---- Animal proteins ---- Abasic site processing protein HMCES Source.731: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.732: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1 Source.733: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.734: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.735: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B Source.736: DFBPPR11396 ---- Animal proteins ---- 26S proteasome regulatory subunit 4 Source.737: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47 Source.738: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.739: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.740: DFBPPR11593 ---- Animal proteins ---- Syndetin Source.741: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.742: DFBPPR11606 ---- Animal proteins ---- 60S ribosomal protein L13 Source.743: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1 Source.744: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.745: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.746: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.747: DFBPPR11679 ---- Animal proteins ---- Spondin-1 Source.748: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.749: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1 Source.750: DFBPPR11738 ---- Animal proteins ---- Ensconsin Source.751: DFBPPR11758 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17B Source.752: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein Source.753: DFBPPR11785 ---- Animal proteins ---- ADP-ribosylation factor 5 Source.754: DFBPPR11805 ---- Animal proteins ---- Tudor domain-containing protein 3 Source.755: DFBPPR11834 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3 Source.756: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17 Source.757: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1 Source.758: DFBPPR11913 ---- Animal proteins ---- Bcl-2-related ovarian killer protein Source.759: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3 Source.760: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.761: DFBPPR11942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1 Source.762: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.763: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2 Source.764: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.765: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.766: DFBPPR11987 ---- Animal proteins ---- NEDD4-binding protein 3 homolog Source.767: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9 Source.768: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C Source.769: DFBPPR12129 ---- Animal proteins ---- 39S ribosomal protein L15, mitochondrial Source.770: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.771: DFBPPR12193 ---- Animal proteins ---- Protein FAM122A Source.772: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.773: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1 Source.774: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.775: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.776: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.777: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.778: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2 Source.779: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.780: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.781: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.782: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.783: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.784: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase Source.785: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.786: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.787: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.788: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1 Source.789: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S Source.790: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.791: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.792: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.793: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor Source.794: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin Source.795: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.796: DFBPPR12925 ---- Animal proteins ---- Methylmalonic aciduria type A homolog, mitochondrial Source.797: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter Source.798: DFBPPR13178 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.799: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.800: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.801: DFBPPR13263 ---- Animal proteins ---- Serotransferrin Source.802: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.803: DFBPPR13299 ---- Animal proteins ---- Interleukin-1 alpha Source.804: DFBPPR13429 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.805: DFBPPR13463 ---- Animal proteins ---- Cathelicidin-2 Source.806: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase Source.807: DFBPPR13553 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.808: DFBPPR13610 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide Source.809: DFBPPR13619 ---- Animal proteins ---- ATP synthase F(0) complex subunit C1, mitochondrial Source.810: DFBPPR13727 ---- Animal proteins ---- Prolactin-releasing peptide Source.811: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase Source.812: DFBPPR13750 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, cytosolic Source.813: DFBPPR13777 ---- Animal proteins ---- Centromere protein C Source.814: DFBPPR13796 ---- Animal proteins ---- Prion-like protein doppel Source.815: DFBPPR13799 ---- Animal proteins ---- Cytochrome P450 3A24 Source.816: DFBPPR13815 ---- Animal proteins ---- Mast cell protease 2 Source.817: DFBPPR13874 ---- Animal proteins ---- Cathelicidin-2 Source.818: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a Source.819: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B Source.820: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A Source.821: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183 Source.822: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase Source.823: DFBPPR14132 ---- Marine protein ---- Calumenin-A Source.824: DFBPPR14134 ---- Marine protein ---- CDGSH iron-sulfur domain-containing protein 2B Source.825: DFBPPR14135 ---- Marine protein ---- CDGSH iron-sulfur domain-containing protein 2A Source.826: DFBPPR14146 ---- Marine protein ---- ATP synthase subunit a Source.827: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8 Source.828: DFBPPR14263 ---- Marine protein ---- ATP synthase subunit a Source.829: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein Source.830: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.831: DFBPPR14352 ---- Marine protein ---- Magnesium-chelatase subunit ChlI Source.832: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.833: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.834: DFBPPR14424 ---- Marine protein ---- Nitrogen regulatory protein P-II Source.835: DFBPPR14434 ---- Marine protein ---- 50S ribosomal protein L6, chloroplastic Source.836: DFBPPR14442 ---- Marine protein ---- 50S ribosomal protein L18, chloroplastic Source.837: DFBPPR14447 ---- Marine protein ---- Protein translocase subunit SecY Source.838: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.839: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a Source.840: DFBPPR14612 ---- Marine protein ---- Complement component C9 Source.841: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.842: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.843: DFBPPR14643 ---- Marine protein ---- CDGSH iron-sulfur domain-containing protein 2B Source.844: DFBPPR14644 ---- Marine protein ---- CDGSH iron-sulfur domain-containing protein 2A Source.845: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme Source.846: DFBPPR14755 ---- Marine protein ---- Techylectin-5A Source.847: DFBPPR14758 ---- Marine protein ---- Techylectin-5B Source.848: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific Source.849: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific Source.850: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific Source.851: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.852: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4 Source.853: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.854: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.855: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1 Source.856: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1 Source.857: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1 Source.858: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2 Source.859: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1 Source.860: DFBPPR15079 ---- Microorganism protein ---- Autophagy-related protein 3 Source.861: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1 Source.862: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial Source.863: DFBPPR15148 ---- Microorganism protein ---- Riboflavin kinase Source.864: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2 Source.865: DFBPPR15163 ---- Microorganism protein ---- Ubiquitin-related modifier 1 Source.866: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3 Source.867: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.868: DFBPPR15235 ---- Microorganism protein ---- Pre-mRNA-processing ATP-dependent RNA helicase PRP5 Source.869: DFBPPR15262 ---- Microorganism protein ---- Inner kinetochore subunit NKP1 Source.870: DFBPPR15292 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.871: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B Source.872: DFBPPR15376 ---- Microorganism protein ---- Potential protein lysine methyltransferase SET5 Source.873: DFBPPR15451 ---- Microorganism protein ---- GrpE protein homolog, mitochondrial Source.874: DFBPPR15469 ---- Microorganism protein ---- SWR1-complex protein 4 Source.875: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP) Source.876: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1 Source.877: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3 Source.878: DFBPPR15531 ---- Microorganism protein ---- DNA replication complex GINS protein SLD5 Source.879: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.880: DFBPPR15564 ---- Microorganism protein ---- Protein ZIP2 Source.881: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1 Source.882: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9 Source.883: DFBPPR15605 ---- Microorganism protein ---- Ribosome biogenesis protein NSA2 Source.884: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6 Source.885: DFBPPR15663 ---- Microorganism protein ---- Spindle pole component BBP1 Source.886: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2 Source.887: DFBPPR15716 ---- Microorganism protein ---- 40S ribosomal protein S22 Source.888: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5 Source.889: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g Source.890: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase Source.891: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.892: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic Source.893: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.894: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.895: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.896: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.897: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial Source.898: DFBPPR7873 ---- Plant protein ---- Casparian strip membrane protein 4 Source.899: DFBPPR7898 ---- Plant protein ---- 50S ribosomal protein L16, chloroplastic Source.900: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase Source.901: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic Source.902: DFBPPR7950 ---- Plant protein ---- Unknown seed protein USP Source.903: DFBPPR7965 ---- Plant protein ---- Embryonic abundant protein VF30.1 Source.904: DFBPPR7968 ---- Plant protein ---- Embryonic abundant protein USP92 Source.905: DFBPPR7969 ---- Plant protein ---- Embryonic abundant protein USP87 Source.906: DFBPPR7982 ---- Plant protein ---- Unknown seed protein 30.1 Source.907: DFBPPR8037 ---- Plant protein ---- Arcelin-1 Source.908: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.909: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase Source.910: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.911: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.912: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.913: DFBPPR8114 ---- Plant protein ---- Arcelin-2 Source.914: DFBPPR8122 ---- Plant protein ---- Arcelin-4 Source.915: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1 Source.916: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2 Source.917: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.918: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.919: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

ACE-inhibitory activity	The peptide exhibited strong Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC₅₀ value of 1.8 uM.
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N1[C@@]([H])(CCC1)C(=O)O

Preparation method

Mode of preparation	Autolysis
Enzyme(s)/starter culture	The peptide was isolated from a bonito bowels autolysate.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

N.D

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Matsumura N, Fujii M, Takeda Y, Sugita K, Shimizu T. Angiotensin I-converting enzyme inhibitory peptides derived from bonito bowels autolysate. Biosci Biotechnol Biochem. 1993 May;57(5):695-7. PMID: 7763772 DOI: 10.1271/bbb.57.695
Other literature(s)	[1] Loponen J. Angiotensin converting enzyme inhibitory peptides in Finnish cereals: A database survey[J]. Agricultural & Food Science, 2004, 13(1):39-45.
PubDate	1993