Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI1760(ACE-inhibitory peptide)

DFBP ID	DFBPACEI1760
Peptide sequence	VPA
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Val-Pro-Ala

Single-letter amino acid

VPA

Peptide length

Peptide mass

Experimental mass	Theoretical mass
285 Da	285.34 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

4.4 uM

pIC₅₀

-0.643

GRAVY

1.4667^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal, Marine
Organism/Source	Marine shrimp (Acetes chinensis)
Precursor protein	A. chinensis protein hydrolysates
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0809 ---- Plant proteins ---- bZIP transcription factor RISBZ1 Source.2: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2 Source.3: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1 Source.4: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25 Source.5: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3 Source.6: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9 Source.7: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.8: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1 Source.9: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14 Source.10: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.11: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1 Source.12: DFBPPR0867 ---- Plant proteins ---- Ras-related protein Rab5A Source.13: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.14: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1 Source.15: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1 Source.16: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53 Source.17: DFBPPR0901 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 2 Source.18: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A Source.19: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.20: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.21: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.22: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.23: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.24: DFBPPR0941 ---- Plant proteins ---- Phosphopantothenoylcysteine decarboxylase Source.25: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1 Source.26: DFBPPR0955 ---- Plant proteins ---- Gibberellin receptor GID1 Source.27: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1 Source.28: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3 Source.29: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.30: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.31: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1 Source.32: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.33: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.34: DFBPPR1009 ---- Plant proteins ---- SPX domain-containing protein 4 Source.35: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75 Source.36: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2 Source.37: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.38: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform Source.39: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1 Source.40: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic Source.41: DFBPPR1050 ---- Plant proteins ---- Mitogen-activated protein kinase kinase 1 Source.42: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2 Source.43: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING Source.44: DFBPPR1083 ---- Plant proteins ---- WRKY transcription factor WRKY24 Source.45: DFBPPR1088 ---- Plant proteins ---- Lysine-specific demethylase JMJ706 Source.46: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24 Source.47: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic Source.48: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E Source.49: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase Source.50: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.51: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.52: DFBPPR1165 ---- Plant proteins ---- Chaperone protein dnaJ A7A, chloroplastic Source.53: DFBPPR1175 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2 Source.54: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT Source.55: DFBPPR1178 ---- Plant proteins ---- Chaperone protein dnaJ A7B, chloroplastic Source.56: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.57: DFBPPR1185 ---- Plant proteins ---- PHD finger protein EHD3 Source.58: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog Source.59: DFBPPR1219 ---- Plant proteins ---- Guanylate kinase 2, chloroplastic/mitochondrial Source.60: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35 Source.61: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b Source.62: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11 Source.63: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1 Source.64: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.65: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.66: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog Source.67: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.68: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3 Source.69: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C Source.70: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D Source.71: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5 Source.72: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B Source.73: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b Source.74: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.75: DFBPPR1308 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 4 Source.76: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22 Source.77: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic Source.78: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.79: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic Source.80: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1 Source.81: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.82: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.83: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.84: DFBPPR1356 ---- Plant proteins ---- Non-symbiotic hemoglobin 1 Source.85: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L Source.86: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING Source.87: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.88: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.89: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5 Source.90: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2 Source.91: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.92: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.93: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic Source.94: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5 Source.95: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E Source.96: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2 Source.97: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3 Source.98: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.99: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1 Source.100: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.101: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5 Source.102: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase Source.103: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1 Source.104: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4 Source.105: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.106: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15 Source.107: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5 Source.108: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.109: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39 Source.110: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1 Source.111: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53 Source.112: DFBPPR1537 ---- Plant proteins ---- Zinc transporter 8 Source.113: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.114: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial Source.115: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148 Source.116: DFBPPR1557 ---- Plant proteins ---- WRKY transcription factor WRKY51 Source.117: DFBPPR1563 ---- Plant proteins ---- TPD1 protein homolog 1A Source.118: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic Source.119: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic Source.120: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic Source.121: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2 Source.122: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C Source.123: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.124: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A Source.125: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.126: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic Source.127: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4 Source.128: DFBPPR1641 ---- Plant proteins ---- Enolase Source.129: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic Source.130: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.131: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10 Source.132: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4 Source.133: DFBPPR1675 ---- Plant proteins ---- Protein LSD1 Source.134: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.135: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2 Source.136: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.137: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1 Source.138: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase Source.139: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.140: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic Source.141: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1 Source.142: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.143: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.144: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1 Source.145: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2 Source.146: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1 Source.147: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2 Source.148: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2 Source.149: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial Source.150: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.151: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11 Source.152: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3 Source.153: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase Source.154: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic Source.155: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3 Source.156: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase Source.157: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic Source.158: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5 Source.159: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog Source.160: DFBPPR1835 ---- Plant proteins ---- Laccase-15 Source.161: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type Source.162: DFBPPR1843 ---- Plant proteins ---- Laccase-13 Source.163: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2 Source.164: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.165: DFBPPR1847 ---- Plant proteins ---- Amidase 1 Source.166: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1 Source.167: DFBPPR1851 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1 Source.168: DFBPPR1853 ---- Plant proteins ---- Laccase-4 Source.169: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a Source.170: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A Source.171: DFBPPR1863 ---- Plant proteins ---- Chitinase 6 Source.172: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial Source.173: DFBPPR1868 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.174: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5 Source.175: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6 Source.176: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2 Source.177: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4 Source.178: DFBPPR1882 ---- Plant proteins ---- Laccase-12 Source.179: DFBPPR1889 ---- Plant proteins ---- Laccase-18 Source.180: DFBPPR1891 ---- Plant proteins ---- Transcription factor MYBS2 Source.181: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.182: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3 Source.183: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.184: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.185: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2 Source.186: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.187: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.188: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.189: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6 Source.190: DFBPPR1962 ---- Plant proteins ---- Expansin-A2 Source.191: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.192: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.193: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial Source.194: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4 Source.195: DFBPPR1988 ---- Plant proteins ---- Protein FLORAL ORGAN NUMBER2 Source.196: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.197: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase Source.198: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6 Source.199: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1 Source.200: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9 Source.201: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.202: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic Source.203: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3 Source.204: DFBPPR2033 ---- Plant proteins ---- Laccase-2 Source.205: DFBPPR2037 ---- Plant proteins ---- Laccase-10 Source.206: DFBPPR2040 ---- Plant proteins ---- Laccase-3 Source.207: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.208: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA Source.209: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2 Source.210: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa Source.211: DFBPPR2076 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-2 Source.212: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C Source.213: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1 Source.214: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5 Source.215: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein Source.216: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 Source.217: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6 Source.218: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.219: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial Source.220: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57 Source.221: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.222: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.223: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3 Source.224: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23 Source.225: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.226: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4 Source.227: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2 Source.228: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3 Source.229: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.230: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.231: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37 Source.232: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9 Source.233: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.234: DFBPPR2226 ---- Plant proteins ---- Two-component response regulator ORR7 Source.235: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.236: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3 Source.237: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.238: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30 Source.239: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.240: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1 Source.241: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1 Source.242: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.243: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type Source.244: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8 Source.245: DFBPPR2283 ---- Plant proteins ---- Oleosin 18 kDa Source.246: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3 Source.247: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7 Source.248: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.249: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial Source.250: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic Source.251: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3 Source.252: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b Source.253: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.254: DFBPPR2342 ---- Plant proteins ---- Peroxiredoxin Q, chloroplastic Source.255: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.256: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic Source.257: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1 Source.258: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15 Source.259: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.260: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2 Source.261: DFBPPR2374 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2 Source.262: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.263: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3 Source.264: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23 Source.265: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C Source.266: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.267: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1 Source.268: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.269: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4 Source.270: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1 Source.271: DFBPPR2438 ---- Plant proteins ---- Arabinogalactan protein 1 Source.272: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic Source.273: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9 Source.274: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic Source.275: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25 Source.276: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase Source.277: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2 Source.278: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2 Source.279: DFBPPR2492 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.280: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic Source.281: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1 Source.282: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10 Source.283: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c Source.284: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.285: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18 Source.286: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1 Source.287: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.288: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.289: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4 Source.290: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40 Source.291: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2 Source.292: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b Source.293: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B Source.294: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a Source.295: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic Source.296: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.297: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15 Source.298: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1 Source.299: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5 Source.300: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial Source.301: DFBPPR2621 ---- Plant proteins ---- Germin-like protein 4-1 Source.302: DFBPPR2623 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 3 Source.303: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2 Source.304: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.305: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.306: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b Source.307: DFBPPR2656 ---- Plant proteins ---- Expansin-A15 Source.308: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3 Source.309: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1 Source.310: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog Source.311: DFBPPR2712 ---- Plant proteins ---- Expansin-A20 Source.312: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11 Source.313: DFBPPR2721 ---- Plant proteins ---- Expansin-A18 Source.314: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic Source.315: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic Source.316: DFBPPR2728 ---- Plant proteins ---- Autophagy-related protein 8B Source.317: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.318: DFBPPR2738 ---- Plant proteins ---- Autophagy-related protein 8C Source.319: DFBPPR2740 ---- Plant proteins ---- Autophagy-related protein 8A Source.320: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25 Source.321: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog Source.322: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26 Source.323: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9 Source.324: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.325: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2 Source.326: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.327: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.328: DFBPPR2787 ---- Plant proteins ---- Protein TIFY 10a Source.329: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A Source.330: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.331: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.332: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic Source.333: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like Source.334: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic Source.335: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D Source.336: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.337: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4 Source.338: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2 Source.339: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8 Source.340: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.341: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.342: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.343: DFBPPR2860 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 3 Source.344: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.345: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1 Source.346: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.347: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1 Source.348: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40 Source.349: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.350: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 Source.351: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4 Source.352: DFBPPR2985 ---- Plant proteins ---- Coatomer subunit delta-3 Source.353: DFBPPR2989 ---- Plant proteins ---- Actin-2 Source.354: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1 Source.355: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L Source.356: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit Source.357: DFBPPR3028 ---- Plant proteins ---- Expansin-A19 Source.358: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic Source.359: DFBPPR3042 ---- Plant proteins ---- Deoxyuridine 5'-triphosphate nucleotidohydrolase Source.360: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9 Source.361: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2 Source.362: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.363: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3 Source.364: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2 Source.365: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1 Source.366: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12 Source.367: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2 Source.368: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7 Source.369: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic Source.370: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1 Source.371: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.372: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1 Source.373: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1 Source.374: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5 Source.375: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.376: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2 Source.377: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1 Source.378: DFBPPR3177 ---- Plant proteins ---- Two-component response regulator ORR4 Source.379: DFBPPR3181 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX15 Source.380: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.381: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog Source.382: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1 Source.383: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3 Source.384: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic Source.385: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15 Source.386: DFBPPR3212 ---- Plant proteins ---- Kinesin-like protein KIN-8A Source.387: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5 Source.388: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750 Source.389: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37 Source.390: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic Source.391: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.392: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein Source.393: DFBPPR3305 ---- Plant proteins ---- Non-symbiotic hemoglobin 3 Source.394: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2 Source.395: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.396: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9 Source.397: DFBPPR3335 ---- Plant proteins ---- Molybdopterin synthase sulfur carrier subunit Source.398: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8 Source.399: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.400: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.401: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28 Source.402: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6 Source.403: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2 Source.404: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.405: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16 Source.406: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5 Source.407: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.408: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1 Source.409: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1 Source.410: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic Source.411: DFBPPR3431 ---- Plant proteins ---- Squamosa promoter-binding-like protein 2 Source.412: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F Source.413: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8 Source.414: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5 Source.415: DFBPPR3467 ---- Plant proteins ---- Squamosa promoter-binding-like protein 16 Source.416: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34 Source.417: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2 Source.418: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17 Source.419: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5 Source.420: DFBPPR3490 ---- Plant proteins ---- WUSCHEL-related homeobox 4 Source.421: DFBPPR3505 ---- Plant proteins ---- Ribosome biogenesis protein WDR12 homolog Source.422: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.423: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial Source.424: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2 Source.425: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3 Source.426: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3 Source.427: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8 Source.428: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22 Source.429: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8 Source.430: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.431: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500 Source.432: DFBPPR3578 ---- Plant proteins ---- Glutaredoxin-C13 Source.433: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog Source.434: DFBPPR3581 ---- Plant proteins ---- Auxin-responsive protein IAA17 Source.435: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.436: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12 Source.437: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog Source.438: DFBPPR3604 ---- Plant proteins ---- Aquaporin NIP1-3 Source.439: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6 Source.440: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20 Source.441: DFBPPR3627 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR1 Source.442: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.443: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.444: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5 Source.445: DFBPPR3657 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL3 Source.446: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic Source.447: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3 Source.448: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8 Source.449: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7 Source.450: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.451: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39 Source.452: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1 Source.453: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1 Source.454: DFBPPR3705 ---- Plant proteins ---- Protein YABBY 2 Source.455: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.456: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8 Source.457: DFBPPR3742 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.458: DFBPPR3743 ---- Plant proteins ---- Putative auxin-responsive protein IAA28 Source.459: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9 Source.460: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.461: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2 Source.462: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C Source.463: DFBPPR3791 ---- Plant proteins ---- Putative glutaredoxin-C12 Source.464: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E Source.465: DFBPPR3806 ---- Plant proteins ---- LOB domain-containing protein 6 Source.466: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B Source.467: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G Source.468: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52 Source.469: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7 Source.470: DFBPPR3844 ---- Plant proteins ---- Probable protein phosphatase 2C 41 Source.471: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2 Source.472: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57 Source.473: DFBPPR3871 ---- Plant proteins ---- Putative glutaredoxin-C11 Source.474: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3 Source.475: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.476: DFBPPR3882 ---- Plant proteins ---- Squamosa promoter-binding-like protein 7 Source.477: DFBPPR3902 ---- Plant proteins ---- Probable serine acetyltransferase 5 Source.478: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3 Source.479: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g Source.480: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.481: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5 Source.482: DFBPPR3961 ---- Plant proteins ---- Zinc-finger homeodomain protein 8 Source.483: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9 Source.484: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.485: DFBPPR3975 ---- Plant proteins ---- Aquaporin NIP3-1 Source.486: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.487: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7 Source.488: DFBPPR3982 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 25 Source.489: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3 Source.490: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500 Source.491: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27 Source.492: DFBPPR4006 ---- Plant proteins ---- Glutaredoxin-C7 Source.493: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6 Source.494: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5 Source.495: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic Source.496: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19 Source.497: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein Source.498: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog Source.499: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2 Source.500: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2 Source.501: DFBPPR4065 ---- Plant proteins ---- Cyclase-like protein 1 Source.502: DFBPPR4072 ---- Plant proteins ---- Putative squamosa promoter-binding-like protein 19 Source.503: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic Source.504: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8 Source.505: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4 Source.506: DFBPPR4089 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1D Source.507: DFBPPR4091 ---- Plant proteins ---- Putative auxin-responsive protein IAA29 Source.508: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic Source.509: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400 Source.510: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74 Source.511: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75 Source.512: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22 Source.513: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15 Source.514: DFBPPR4134 ---- Plant proteins ---- Glutaredoxin-C1 Source.515: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.516: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1 Source.517: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1 Source.518: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6 Source.519: DFBPPR4163 ---- Plant proteins ---- Barley B recombinant-like protein A Source.520: DFBPPR4170 ---- Plant proteins ---- CMP-sialic acid transporter 3 Source.521: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1 Source.522: DFBPPR4180 ---- Plant proteins ---- Barley B recombinant-like protein B Source.523: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18 Source.524: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C Source.525: DFBPPR4193 ---- Plant proteins ---- Peptidyl-tRNA hydrolase, mitochondrial Source.526: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22 Source.527: DFBPPR4198 ---- Plant proteins ---- Glutaredoxin-C15 Source.528: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27 Source.529: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.530: DFBPPR4215 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 54 Source.531: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4 Source.532: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22 Source.533: DFBPPR4231 ---- Plant proteins ---- CMP-sialic acid transporter 4 Source.534: DFBPPR4233 ---- Plant proteins ---- Putative glutaredoxin-C2 Source.535: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1 Source.536: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE Source.537: DFBPPR4247 ---- Plant proteins ---- GDT1-like protein 2, chloroplastic Source.538: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1 Source.539: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.540: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.541: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6 Source.542: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.543: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.544: DFBPPR4324 ---- Plant proteins ---- Elongation factor Ts, mitochondrial Source.545: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5 Source.546: DFBPPR4339 ---- Plant proteins ---- Protein LHCP TRANSLOCATION DEFECT Source.547: DFBPPR4342 ---- Plant proteins ---- Nucleolin 1 Source.548: DFBPPR4353 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR2 Source.549: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2 Source.550: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10 Source.551: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E Source.552: DFBPPR4387 ---- Plant proteins ---- Dof zinc finger protein 5 Source.553: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7 Source.554: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9 Source.555: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31 Source.556: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5 Source.557: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53 Source.558: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2 Source.559: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4 Source.560: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2 Source.561: DFBPPR4429 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS3, chloroplastic Source.562: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18 Source.563: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4 Source.564: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6 Source.565: DFBPPR4445 ---- Plant proteins ---- CASP-like protein 4B2 Source.566: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic Source.567: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.568: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2 Source.569: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic Source.570: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11 Source.571: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.572: DFBPPR4491 ---- Plant proteins ---- 30S ribosomal protein S16, chloroplastic Source.573: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein Source.574: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic Source.575: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic Source.576: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14 Source.577: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63 Source.578: DFBPPR4539 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 3 Source.579: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.580: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23 Source.581: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.582: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7 Source.583: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1 Source.584: DFBPPR4584 ---- Plant proteins ---- Probable calcium-binding protein CML29 Source.585: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13 Source.586: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65 Source.587: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39 Source.588: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic Source.589: DFBPPR4620 ---- Plant proteins ---- Protein LOL1 Source.590: DFBPPR4634 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 9 Source.591: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B Source.592: DFBPPR4679 ---- Plant proteins ---- Thaumatin-like protein Source.593: DFBPPR4685 ---- Plant proteins ---- 30S ribosomal protein S31, mitochondrial Source.594: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B Source.595: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700 Source.596: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19 Source.597: DFBPPR4726 ---- Plant proteins ---- 40S ribosomal protein S10-2 Source.598: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.599: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.600: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8 Source.601: DFBPPR4758 ---- Plant proteins ---- BURP domain-containing protein 7 Source.602: DFBPPR4764 ---- Plant proteins ---- 14-3-3-like protein GF14-A Source.603: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900 Source.604: DFBPPR4779 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 31 Source.605: DFBPPR4787 ---- Plant proteins ---- 60S ribosomal protein L7a-1 Source.606: DFBPPR4798 ---- Plant proteins ---- B3 domain-containing protein Os03g0622200 Source.607: DFBPPR4804 ---- Plant proteins ---- Putative B3 domain-containing protein Os10g0537100 Source.608: DFBPPR4807 ---- Plant proteins ---- Protein MEI2-like 6 Source.609: DFBPPR4811 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 55 Source.610: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47 Source.611: DFBPPR4815 ---- Plant proteins ---- 40S ribosomal protein S10-1 Source.612: DFBPPR4823 ---- Plant proteins ---- 60S ribosomal protein L7a-2 Source.613: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6 Source.614: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66 Source.615: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400 Source.616: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500 Source.617: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4 Source.618: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.619: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic Source.620: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic Source.621: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2 Source.622: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1 Source.623: DFBPPR4941 ---- Plant proteins ---- Chaperone protein dnaJ A8, chloroplastic Source.624: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.625: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650 Source.626: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial Source.627: DFBPPR4983 ---- Plant proteins ---- Protein SRC2 Source.628: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.629: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial Source.630: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.631: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A Source.632: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.633: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic Source.634: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B Source.635: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial Source.636: DFBPPR5060 ---- Plant proteins ---- Ferritin-4, chloroplastic Source.637: DFBPPR5061 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.638: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.639: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic Source.640: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.641: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.642: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial Source.643: DFBPPR5124 ---- Plant proteins ---- Nodulin-26 Source.644: DFBPPR5126 ---- Plant proteins ---- P24 oleosin isoform A Source.645: DFBPPR5180 ---- Plant proteins ---- Biotin carboxyl carrier protein of acetyl-CoA carboxylase, chloroplastic Source.646: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.647: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C Source.648: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.649: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase Source.650: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein Source.651: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2 Source.652: DFBPPR5283 ---- Plant proteins ---- Actin-3 Source.653: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.654: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3 Source.655: DFBPPR5354 ---- Plant proteins ---- Protein P21 Source.656: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1 Source.657: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.658: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic Source.659: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.660: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1 Source.661: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.662: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.663: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.664: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.665: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase Source.666: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2 Source.667: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6 Source.668: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase Source.669: DFBPPR5441 ---- Plant proteins ---- Peroxidase 1 Source.670: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial Source.671: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.672: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.673: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase Source.674: DFBPPR5469 ---- Plant proteins ---- Indole-3-glycerol phosphate lyase, chloroplastic Source.675: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2 Source.676: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.677: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase Source.678: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic Source.679: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9 Source.680: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.681: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8 Source.682: DFBPPR5505 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme Source.683: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.684: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.685: DFBPPR5526 ---- Plant proteins ---- Oleosin Zm-II Source.686: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic Source.687: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3 Source.688: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial Source.689: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.690: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.691: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1 Source.692: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.693: DFBPPR5596 ---- Plant proteins ---- Serine--glyoxylate aminotransferase Source.694: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I Source.695: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic Source.696: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.697: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW Source.698: DFBPPR5630 ---- Plant proteins ---- LOB domain-containing protein 6 Source.699: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.700: DFBPPR5641 ---- Plant proteins ---- Histone H2B.2 Source.701: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.702: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.703: DFBPPR5650 ---- Plant proteins ---- Enolase 1 Source.704: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase Source.705: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1 Source.706: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6 Source.707: DFBPPR5675 ---- Plant proteins ---- Enolase 2 Source.708: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.709: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.710: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.711: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase Source.712: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.713: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.714: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1 Source.715: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2 Source.716: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2 Source.717: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic Source.718: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.719: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.720: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele Source.721: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase Source.722: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.723: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1 Source.724: DFBPPR5851 ---- Plant proteins ---- 22 kDa alpha-zein 4 Source.725: DFBPPR5868 ---- Plant proteins ---- 22 kDa alpha-zein 16 Source.726: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein Source.727: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1 Source.728: DFBPPR5873 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.729: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.730: DFBPPR5905 ---- Plant proteins ---- Cyanate hydratase Source.731: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein Source.732: DFBPPR5912 ---- Plant proteins ---- Histone deacetylase HDT3 Source.733: DFBPPR5922 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.734: DFBPPR5957 ---- Plant proteins ---- Protein FLOURY 2 Source.735: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein Source.736: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1 Source.737: DFBPPR5992 ---- Plant proteins ---- Aquaporin NIP3-1 Source.738: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1 Source.739: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.740: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.741: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b Source.742: DFBPPR6041 ---- Plant proteins ---- 22 kDa alpha-zein 14 Source.743: DFBPPR6052 ---- Plant proteins ---- Cystatin-1 Source.744: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.745: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2 Source.746: DFBPPR6077 ---- Plant proteins ---- Pollen-specific protein C13 Source.747: DFBPPR6086 ---- Plant proteins ---- Cell number regulator 5 Source.748: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.749: DFBPPR6121 ---- Plant proteins ---- 30S ribosomal protein S16, chloroplastic Source.750: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8 Source.751: DFBPPR6127 ---- Plant proteins ---- 22 kDa alpha-zein 14 Source.752: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1 Source.753: DFBPPR6157 ---- Plant proteins ---- Ninja-family protein 5 Source.754: DFBPPR6159 ---- Plant proteins ---- MFS14 protein Source.755: DFBPPR6164 ---- Plant proteins ---- Oil body-associated protein 2B Source.756: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase Source.757: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.758: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96 Source.759: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic Source.760: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.761: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64 Source.762: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.763: DFBPPR6300 ---- Plant proteins ---- Strigolactone esterase RMS3 Source.764: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.765: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1 Source.766: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.767: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.768: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.769: DFBPPR6380 ---- Plant proteins ---- Legumin A Source.770: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.771: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.772: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.773: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.774: DFBPPR6425 ---- Plant proteins ---- Legumin A2 Source.775: DFBPPR6441 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic Source.776: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3 Source.777: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4 Source.778: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5 Source.779: DFBPPR6458 ---- Plant proteins ---- Convicilin Source.780: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic Source.781: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2 Source.782: DFBPPR6486 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 1 Source.783: DFBPPR6493 ---- Plant proteins ---- Serine carboxypeptidase-like Source.784: DFBPPR6517 ---- Plant proteins ---- Cytochrome b6-f complex subunit 4 Source.785: DFBPPR6551 ---- Plant proteins ---- Actin-2 Source.786: DFBPPR6552 ---- Plant proteins ---- Actin-1 Source.787: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.788: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.789: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A Source.790: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial Source.791: DFBPPR6645 ---- Plant proteins ---- Catalase-1 Source.792: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A Source.793: DFBPPR6666 ---- Plant proteins ---- Cytochrome b6-f complex iron-sulfur subunit, chloroplastic Source.794: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic Source.795: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19 Source.796: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.797: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic Source.798: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1 Source.799: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.800: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B Source.801: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase Source.802: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53 Source.803: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D Source.804: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic Source.805: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.806: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2 Source.807: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3 Source.808: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1 Source.809: DFBPPR6769 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1 Source.810: DFBPPR6773 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2 Source.811: DFBPPR6776 ---- Plant proteins ---- Alpha-amylase inhibitor WDAI-3 Source.812: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.813: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.814: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a Source.815: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A Source.816: DFBPPR6844 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.817: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.818: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.819: DFBPPR6874 ---- Plant proteins ---- Dehydrin COR410 Source.820: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.821: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1 Source.822: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.823: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.824: DFBPPR6955 ---- Plant proteins ---- Protein WIR1A Source.825: DFBPPR6957 ---- Plant proteins ---- Protein WIR1B Source.826: DFBPPR6977 ---- Plant proteins ---- 30S ribosomal protein S16, chloroplastic Source.827: DFBPPR6984 ---- Plant proteins ---- Thaumatin-like protein PWIR2 Source.828: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2 Source.829: DFBPPR7013 ---- Plant proteins ---- Protein MLO Source.830: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic Source.831: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1 Source.832: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.833: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.834: DFBPPR7050 ---- Plant proteins ---- Lichenase-2 Source.835: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.836: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.837: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI Source.838: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase Source.839: DFBPPR7078 ---- Plant proteins ---- Alpha-amylase inhibitor BDAI-1 Source.840: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic Source.841: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic Source.842: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic Source.843: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.844: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3 Source.845: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial Source.846: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic Source.847: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.848: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase Source.849: DFBPPR7170 ---- Plant proteins ---- Maturase K Source.850: DFBPPR7176 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GV Source.851: DFBPPR7185 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.852: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog Source.853: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.854: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.855: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.856: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.857: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2 Source.858: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1 Source.859: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1 Source.860: DFBPPR7278 ---- Plant proteins ---- Protein BLT4 Source.861: DFBPPR7298 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.862: DFBPPR7321 ---- Plant proteins ---- 30S ribosomal protein S16, chloroplastic Source.863: DFBPPR7324 ---- Plant proteins ---- Antifungal protein S Source.864: DFBPPR7339 ---- Plant proteins ---- Pathogenesis-related protein 1C Source.865: DFBPPR7341 ---- Plant proteins ---- Pathogenesis-related protein 1A/1B Source.866: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic Source.867: DFBPPR7407 ---- Plant proteins ---- Oleosin-B1 Source.868: DFBPPR7418 ---- Plant proteins ---- Oleosin-B6 Source.869: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.870: DFBPPR7449 ---- Plant proteins ---- Oleosin-B2 Source.871: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.872: DFBPPR7463 ---- Plant proteins ---- Oleosin S2-2 Source.873: DFBPPR7465 ---- Plant proteins ---- Oleosin S1-2 Source.874: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.875: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic Source.876: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III Source.877: DFBPPR7485 ---- Plant proteins ---- Oleosin Bn-V Source.878: DFBPPR7486 ---- Plant proteins ---- Major oleosin NAP-II Source.879: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial Source.880: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2 Source.881: DFBPPR7503 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic Source.882: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG Source.883: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.884: DFBPPR7615 ---- Milk proteins ---- Nicotinamide phosphoribosyltransferase Source.885: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.886: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein Source.887: DFBPPR7635 ---- Milk proteins ---- Prosaposin Source.888: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein Source.889: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2 Source.890: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.891: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin Source.892: DFBPPR7686 ---- Milk proteins ---- Kappa-casein Source.893: DFBPPR7695 ---- Milk proteins ---- Kappa-casein Source.894: DFBPPR7696 ---- Milk proteins ---- Uterine milk protein Source.895: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin Source.896: DFBPPR7715 ---- Milk proteins ---- Kappa-casein Source.897: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.898: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.899: DFBPPR7732 ---- Plant proteins ---- Plasma membrane ATPase Source.900: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4 Source.901: DFBPPR7746 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 2 Source.902: DFBPPR7747 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 1 Source.903: DFBPPR7748 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 3 Source.904: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta Source.905: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.906: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal Source.907: DFBPPR8203 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial Source.908: DFBPPR8204 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.909: DFBPPR8388 ---- Plant proteins ---- Oleosin Ara h 14.0101 Source.910: DFBPPR8389 ---- Plant proteins ---- Oleosin Ara h 14.0102 Source.911: DFBPPR8391 ---- Plant proteins ---- Oleosin Ara h 15.0101 Source.912: DFBPPR8395 ---- Plant proteins ---- Oleosin Ara h 14.0103 Source.913: DFBPPR8399 ---- Plant proteins ---- Oleosin Ara h 11.0101 Source.914: DFBPPR8400 ---- Plant proteins ---- Oleosin Ara h 11.0102 Source.915: DFBPPR8411 ---- Plant proteins ---- Oleosin Ara h 10.0101 Source.916: DFBPPR8412 ---- Plant proteins ---- Oleosin Ara h 10.0102 Source.917: DFBPPR8424 ---- Plant proteins ---- Oleosin H1 Source.918: DFBPPR8425 ---- Plant proteins ---- Oleosin L Source.919: DFBPPR8429 ---- Plant proteins ---- Oleosin H2 Source.920: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase Source.921: DFBPPR8492 ---- Milk proteins ---- Kappa-casein Source.922: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1 Source.923: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin Source.924: DFBPPR8511 ---- Milk proteins ---- Transcobalamin-2 Source.925: DFBPPR8522 ---- Milk proteins ---- Uterine milk protein Source.926: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.927: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.928: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.929: DFBPPR15963 ---- Animal proteins ---- Cadherin-1 Source.930: DFBPPR15975 ---- Animal proteins ---- Paired box protein Pax-8 Source.931: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T Source.932: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.933: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9 Source.934: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9 Source.935: DFBPPR16002 ---- Animal proteins ---- Podoplanin Source.936: DFBPPR16007 ---- Animal proteins ---- Myocilin Source.937: DFBPPR16024 ---- Animal proteins ---- Podocalyxin Source.938: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.939: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.940: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.941: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.942: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2 Source.943: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.944: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.945: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase Source.946: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1 Source.947: DFBPPR16094 ---- Animal proteins ---- Mastin Source.948: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein Source.949: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4 Source.950: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.951: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase Source.952: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1 Source.953: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase Source.954: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2 Source.955: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1 Source.956: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.957: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator Source.958: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.959: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.960: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72 Source.961: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.962: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.963: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.964: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15 Source.965: DFBPPR16255 ---- Animal proteins ---- Frizzled-6 Source.966: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type Source.967: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.968: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.969: DFBPPR16271 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.970: DFBPPR16312 ---- Animal proteins ---- C-C motif chemokine 13 Source.971: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1 Source.972: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.973: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.974: DFBPPR16468 ---- Animal proteins ---- Sodium channel subunit beta-2 Source.975: DFBPPR16478 ---- Animal proteins ---- Chymotrypsinogen 2 Source.976: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B Source.977: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog Source.978: DFBPPR16516 ---- Animal proteins ---- Cytospin-A Source.979: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.980: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.981: DFBPPR16538 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 1B Source.982: DFBPPR16568 ---- Animal proteins ---- Beta-lactoglobulin-1 Source.983: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.984: DFBPPR16578 ---- Animal proteins ---- 60S ribosomal protein L13a Source.985: DFBPPR16584 ---- Animal proteins ---- Alpha-centractin Source.986: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4 Source.987: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19 Source.988: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.989: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.990: DFBPPR16663 ---- Animal proteins ---- Involucrin Source.991: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22 Source.992: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8 Source.993: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.994: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.995: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46 Source.996: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase Source.997: DFBPPR16786 ---- Animal proteins ---- Ubiquitin-fold modifier 1 Source.998: DFBPPR16787 ---- Animal proteins ---- Histone H5 Source.999: DFBPPR16788 ---- Animal proteins ---- Alpha-crystallin A chain Source.1000: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.1001: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.1002: DFBPPR16840 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.1003: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.1004: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.1005: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1 Source.1006: DFBPPR16856 ---- Animal proteins ---- Tumor necrosis factor Source.1007: DFBPPR16859 ---- Animal proteins ---- Ubiquitin-like protein ISG15 Source.1008: DFBPPR16861 ---- Animal proteins ---- Adenylate kinase 2, mitochondrial Source.1009: DFBPPR16863 ---- Animal proteins ---- Biglycan Source.1010: DFBPPR16869 ---- Animal proteins ---- Bile salt-activated lipase Source.1011: DFBPPR16871 ---- Animal proteins ---- Plasminogen Source.1012: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle Source.1013: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A Source.1014: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha Source.1015: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase Source.1016: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial Source.1017: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.1018: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.1019: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.1020: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4 Source.1021: DFBPPR16972 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-2 Source.1022: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.1023: DFBPPR16985 ---- Animal proteins ---- Filensin Source.1024: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.1025: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP Source.1026: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter Source.1027: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.1028: DFBPPR17029 ---- Animal proteins ---- Cytochrome b-245 light chain Source.1029: DFBPPR17040 ---- Animal proteins ---- Myocilin Source.1030: DFBPPR17047 ---- Animal proteins ---- Neuromodulin Source.1031: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.1032: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.1033: DFBPPR17069 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.1034: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1 Source.1035: DFBPPR17102 ---- Animal proteins ---- Dystroglycan Source.1036: DFBPPR17103 ---- Animal proteins ---- Dystroglycan Source.1037: DFBPPR17104 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.1038: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta Source.1039: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1 Source.1040: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.1041: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.1042: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.1043: DFBPPR17189 ---- Animal proteins ---- Troponin I, cardiac muscle Source.1044: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6 Source.1045: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.1046: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.1047: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.1048: DFBPPR17280 ---- Animal proteins ---- Serine racemase Source.1049: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1 Source.1050: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.1051: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.1052: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial Source.1053: DFBPPR17310 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1 Source.1054: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2 Source.1055: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.1056: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase Source.1057: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1 Source.1058: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2 Source.1059: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB Source.1060: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1 Source.1061: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.1062: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2 Source.1063: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5 Source.1064: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4 Source.1065: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1 Source.1066: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.1067: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.1068: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta Source.1069: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.1070: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase Source.1071: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase Source.1072: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1073: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial Source.1074: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A Source.1075: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1 Source.1076: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1 Source.1077: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.1078: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.1079: DFBPPR17622 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif-like protein Source.1080: DFBPPR17626 ---- Animal proteins ---- Elastin Source.1081: DFBPPR17629 ---- Animal proteins ---- Thiamine-triphosphatase Source.1082: DFBPPR17630 ---- Animal proteins ---- Thiamine-triphosphatase Source.1083: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta Source.1084: DFBPPR17663 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 4, mitochondrial Source.1085: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.1086: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.1087: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1 Source.1088: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform Source.1089: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1 Source.1090: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3 Source.1091: DFBPPR17774 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein Source.1092: DFBPPR17782 ---- Animal proteins ---- Ras GTPase-activating protein-binding protein 1 Source.1093: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma Source.1094: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.1095: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2 Source.1096: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.1097: DFBPPR17822 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde dehydrogenase Source.1098: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.1099: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3 Source.1100: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.1101: DFBPPR17854 ---- Animal proteins ---- Tyrosine 3-monooxygenase Source.1102: DFBPPR17859 ---- Animal proteins ---- Beta-nerve growth factor Source.1103: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3 Source.1104: DFBPPR17861 ---- Animal proteins ---- 3-hydroxyanthranilate 3,4-dioxygenase Source.1105: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.1106: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.1107: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.1108: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.1109: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.1110: DFBPPR17879 ---- Animal proteins ---- Menin Source.1111: DFBPPR17888 ---- Animal proteins ---- Cation-dependent mannose-6-phosphate receptor Source.1112: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.1113: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.1114: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A Source.1115: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3 Source.1116: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1 Source.1117: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1118: DFBPPR17962 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1 Source.1119: DFBPPR17966 ---- Animal proteins ---- Clathrin light chain A Source.1120: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase Source.1121: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase Source.1122: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7 Source.1123: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.1124: DFBPPR17998 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.1125: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.1126: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.1127: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.1128: DFBPPR18059 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.1129: DFBPPR18064 ---- Animal proteins ---- Sperm flagellar protein 1 Source.1130: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1 Source.1131: DFBPPR18094 ---- Animal proteins ---- Neutrophil cytosol factor 1 Source.1132: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33 Source.1133: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3 Source.1134: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4 Source.1135: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15 Source.1136: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7 Source.1137: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44 Source.1138: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.1139: DFBPPR18191 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-2 Source.1140: DFBPPR18203 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(O) subunit gamma-7 Source.1141: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter Source.1142: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40 Source.1143: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.1144: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1 Source.1145: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi Source.1146: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.1147: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial Source.1148: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2 Source.1149: DFBPPR18280 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1B Source.1150: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20 Source.1151: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.1152: DFBPPR18308 ---- Animal proteins ---- Chymotrypsinogen A Source.1153: DFBPPR18314 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-B Source.1154: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog Source.1155: DFBPPR18353 ---- Animal proteins ---- Lactosylceramide alpha-2,3-sialyltransferase Source.1156: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.1157: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.1158: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.1159: DFBPPR18401 ---- Animal proteins ---- Protrudin Source.1160: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14 Source.1161: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1 Source.1162: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.1163: DFBPPR18447 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease 2 Source.1164: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor Source.1165: DFBPPR18470 ---- Animal proteins ---- Perilipin-5 Source.1166: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1 Source.1167: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47 Source.1168: DFBPPR18490 ---- Animal proteins ---- N-terminal Xaa-Pro-Lys N-methyltransferase 1 Source.1169: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7 Source.1170: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.1171: DFBPPR18506 ---- Animal proteins ---- Beta-1,3-N-acetylglucosaminyltransferase lunatic fringe Source.1172: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent Source.1173: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial Source.1174: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.1175: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1 Source.1176: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor Source.1177: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3 Source.1178: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4 Source.1179: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2 Source.1180: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.1181: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.1182: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit Source.1183: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2 Source.1184: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.1185: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1 Source.1186: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3 Source.1187: DFBPPR18614 ---- Animal proteins ---- Beta-enolase Source.1188: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta Source.1189: DFBPPR18622 ---- Animal proteins ---- CYFIP-related Rac1 interactor B Source.1190: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2 Source.1191: DFBPPR18648 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.1192: DFBPPR18720 ---- Animal proteins ---- Protein quaking Source.1193: DFBPPR18724 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial Source.1194: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.1195: DFBPPR18731 ---- Animal proteins ---- 39S ribosomal protein L10, mitochondrial Source.1196: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.1197: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa Source.1198: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3 Source.1199: DFBPPR18759 ---- Animal proteins ---- Neuronal-specific septin-3 Source.1200: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1 Source.1201: DFBPPR18762 ---- Animal proteins ---- DDRGK domain-containing protein 1 Source.1202: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.1203: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9 Source.1204: DFBPPR18783 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-A Source.1205: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4 Source.1206: DFBPPR18794 ---- Animal proteins ---- LIM domain-containing protein ajuba Source.1207: DFBPPR18805 ---- Animal proteins ---- Nascent polypeptide-associated complex subunit alpha Source.1208: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1 Source.1209: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.1210: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.1211: DFBPPR18830 ---- Animal proteins ---- Gamma-secretase subunit PEN-2 Source.1212: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1 Source.1213: DFBPPR18834 ---- Animal proteins ---- ATP-dependent (S)-NAD(P)H-hydrate dehydratase Source.1214: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.1215: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor Source.1216: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor Source.1217: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain Source.1218: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase Source.1219: DFBPPR18874 ---- Animal proteins ---- Acyl-protein thioesterase 1 Source.1220: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1 Source.1221: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial Source.1222: DFBPPR18909 ---- Animal proteins ---- Enolase-phosphatase E1 Source.1223: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED Source.1224: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.1225: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108 Source.1226: DFBPPR18937 ---- Animal proteins ---- ADP-ribosylation factor-like protein 2-binding protein Source.1227: DFBPPR18939 ---- Animal proteins ---- Acylpyruvase FAHD1, mitochondrial Source.1228: DFBPPR18991 ---- Animal proteins ---- Transcription factor E2F6 Source.1229: DFBPPR18997 ---- Animal proteins ---- Striatin-3 Source.1230: DFBPPR19001 ---- Animal proteins ---- General transcription factor II-I Source.1231: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746 Source.1232: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1 Source.1233: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2 Source.1234: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5 Source.1235: DFBPPR19027 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.1236: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3 Source.1237: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1 Source.1238: DFBPPR19072 ---- Animal proteins ---- Growth/differentiation factor 9 Source.1239: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1 Source.1240: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.1241: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E Source.1242: DFBPPR19153 ---- Animal proteins ---- Copine-6 Source.1243: DFBPPR19172 ---- Animal proteins ---- Persulfide dioxygenase ETHE1, mitochondrial Source.1244: DFBPPR19205 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF169 Source.1245: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase Source.1246: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.1247: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6 Source.1248: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3 Source.1249: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A Source.1250: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha Source.1251: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.1252: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase Source.1253: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.1254: DFBPPR19254 ---- Animal proteins ---- Periaxin Source.1255: DFBPPR19268 ---- Animal proteins ---- BAG family molecular chaperone regulator 2 Source.1256: DFBPPR19277 ---- Animal proteins ---- Prolactin-releasing peptide Source.1257: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1 Source.1258: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Source.1259: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1 Source.1260: DFBPPR19297 ---- Animal proteins ---- Hexosaminidase D Source.1261: DFBPPR19306 ---- Animal proteins ---- Splicing factor 3A subunit 1 Source.1262: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A Source.1263: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB Source.1264: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial Source.1265: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1 Source.1266: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.1267: DFBPPR19343 ---- Animal proteins ---- Interferon alpha-inducible protein 6 Source.1268: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.1269: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.1270: DFBPPR19382 ---- Animal proteins ---- Arrestin-C Source.1271: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2 Source.1272: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129 Source.1273: DFBPPR19409 ---- Animal proteins ---- Hyaluronan-binding protein 2 Source.1274: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein Source.1275: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2 Source.1276: DFBPPR19429 ---- Animal proteins ---- Protein Spindly Source.1277: DFBPPR19431 ---- Animal proteins ---- Aminoacyl tRNA synthase complex-interacting multifunctional protein 2 Source.1278: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial Source.1279: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.1280: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20 Source.1281: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137 Source.1282: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.1283: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7 Source.1284: DFBPPR19505 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein N Source.1285: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase Source.1286: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A Source.1287: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Source.1288: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3 Source.1289: DFBPPR19557 ---- Animal proteins ---- Heterochromatin protein 1-binding protein 3 Source.1290: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial Source.1291: DFBPPR19599 ---- Animal proteins ---- Thrombomodulin Source.1292: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase Source.1293: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS Source.1294: DFBPPR19620 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.1295: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1 Source.1296: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase Source.1297: DFBPPR19640 ---- Animal proteins ---- Prolargin Source.1298: DFBPPR19653 ---- Animal proteins ---- Chymotrypsinogen B Source.1299: DFBPPR19656 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.1300: DFBPPR19671 ---- Animal proteins ---- C-X-C motif chemokine 9 Source.1301: DFBPPR19680 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.1302: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2 Source.1303: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor Source.1304: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.1305: DFBPPR19733 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1 Source.1306: DFBPPR19738 ---- Animal proteins ---- Translocator protein Source.1307: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3 Source.1308: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2 Source.1309: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase Source.1310: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1 Source.1311: DFBPPR19770 ---- Animal proteins ---- Heat shock 70 kDa protein 13 Source.1312: DFBPPR19785 ---- Animal proteins ---- Calcyclin-binding protein Source.1313: DFBPPR19810 ---- Animal proteins ---- Seipin Source.1314: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L Source.1315: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma Source.1316: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2 Source.1317: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.1318: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5 Source.1319: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.1320: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3 Source.1321: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8 Source.1322: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27 Source.1323: DFBPPR19905 ---- Animal proteins ---- Complement component C6 Source.1324: DFBPPR19916 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1 Source.1325: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase Source.1326: DFBPPR19930 ---- Animal proteins ---- F-box only protein 6 Source.1327: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform Source.1328: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14 Source.1329: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1 Source.1330: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1 Source.1331: DFBPPR20036 ---- Animal proteins ---- Urocortin-3 Source.1332: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase Source.1333: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1 Source.1334: DFBPPR20052 ---- Animal proteins ---- Pleiotropic regulator 1 Source.1335: DFBPPR20060 ---- Animal proteins ---- Fibulin-5 Source.1336: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2 Source.1337: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein Source.1338: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93 Source.1339: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47 Source.1340: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1 Source.1341: DFBPPR20123 ---- Animal proteins ---- Securin Source.1342: DFBPPR20158 ---- Animal proteins ---- Histone chaperone ASF1A Source.1343: DFBPPR20163 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G6f Source.1344: DFBPPR20170 ---- Animal proteins ---- EEF1A lysine methyltransferase 4 Source.1345: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1 Source.1346: DFBPPR20193 ---- Animal proteins ---- T-complex protein 1 subunit theta Source.1347: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6 Source.1348: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.1349: DFBPPR20289 ---- Animal proteins ---- Di-N-acetylchitobiase Source.1350: DFBPPR20314 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC3 Source.1351: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial Source.1352: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.1353: DFBPPR20357 ---- Animal proteins ---- Snurportin-1 Source.1354: DFBPPR20372 ---- Animal proteins ---- WASH complex subunit 3 Source.1355: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog Source.1356: DFBPPR20387 ---- Animal proteins ---- 60S ribosomal protein L13a Source.1357: DFBPPR20406 ---- Animal proteins ---- 28S ribosomal protein S11, mitochondrial Source.1358: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial Source.1359: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase Source.1360: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase Source.1361: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1 Source.1362: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8 Source.1363: DFBPPR20466 ---- Animal proteins ---- Ribonuclease P protein subunit p38 Source.1364: DFBPPR20475 ---- Animal proteins ---- Replication factor C subunit 3 Source.1365: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2 Source.1366: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42 Source.1367: DFBPPR20519 ---- Animal proteins ---- Spermatogenesis-associated protein 6 Source.1368: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.1369: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1 Source.1370: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1 Source.1371: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3 Source.1372: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3 Source.1373: DFBPPR20607 ---- Animal proteins ---- Spliceosome-associated protein CWC27 homolog Source.1374: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2 Source.1375: DFBPPR20627 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M Source.1376: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1 Source.1377: DFBPPR20638 ---- Animal proteins ---- DPH3 homolog Source.1378: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein Source.1379: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.1380: DFBPPR20666 ---- Animal proteins ---- Tektin-2 Source.1381: DFBPPR20671 ---- Animal proteins ---- 39S ribosomal protein L27, mitochondrial Source.1382: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5 Source.1383: DFBPPR20681 ---- Animal proteins ---- G-protein coupled bile acid receptor 1 Source.1384: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10 Source.1385: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.1386: DFBPPR20700 ---- Animal proteins ---- General transcription factor IIE subunit 1 Source.1387: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2 Source.1388: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21 Source.1389: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11 Source.1390: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial Source.1391: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6 Source.1392: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14 Source.1393: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase Source.1394: DFBPPR20832 ---- Animal proteins ---- Metalloproteinase inhibitor 4 Source.1395: DFBPPR20851 ---- Animal proteins ---- Fucose mutarotase Source.1396: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1 Source.1397: DFBPPR20882 ---- Animal proteins ---- Histone chaperone ASF1B Source.1398: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein Source.1399: DFBPPR20900 ---- Animal proteins ---- F-box/LRR-repeat protein 12 Source.1400: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1 Source.1401: DFBPPR20904 ---- Animal proteins ---- Zinc finger protein 143 Source.1402: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein Source.1403: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.1404: DFBPPR20921 ---- Animal proteins ---- TRAF-type zinc finger domain-containing protein 1 Source.1405: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2 Source.1406: DFBPPR20953 ---- Animal proteins ---- Ubiquitin-fold modifier 1 Source.1407: DFBPPR20957 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial Source.1408: DFBPPR20958 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial Source.1409: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta Source.1410: DFBPPR20972 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP11 Source.1411: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.1412: DFBPPR20983 ---- Animal proteins ---- Plakophilin-3 Source.1413: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1 Source.1414: DFBPPR21002 ---- Animal proteins ---- Olfactomedin-like protein 2B Source.1415: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.1416: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A Source.1417: DFBPPR21023 ---- Animal proteins ---- Ribosome biogenesis protein NSA2 homolog Source.1418: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574 Source.1419: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10 Source.1420: DFBPPR21085 ---- Animal proteins ---- Pentatricopeptide repeat-containing protein 2, mitochondrial Source.1421: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor Source.1422: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7 Source.1423: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.1424: DFBPPR21106 ---- Animal proteins ---- 40S ribosomal protein S10 Source.1425: DFBPPR21122 ---- Animal proteins ---- Derlin-3 Source.1426: DFBPPR21125 ---- Animal proteins ---- Male-enhanced antigen 1 Source.1427: DFBPPR21166 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1 Source.1428: DFBPPR21169 ---- Animal proteins ---- GA-binding protein subunit beta-2 Source.1429: DFBPPR21181 ---- Animal proteins ---- Calpastatin Source.1430: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173 Source.1431: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal Source.1432: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22 Source.1433: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3 Source.1434: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog Source.1435: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase Source.1436: DFBPPR21206 ---- Animal proteins ---- D-dopachrome decarboxylase Source.1437: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog Source.1438: DFBPPR21216 ---- Animal proteins ---- UDP-GlcNAc:betaGal beta-1,3-N-acetylglucosaminyltransferase 9 Source.1439: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1 Source.1440: DFBPPR21225 ---- Animal proteins ---- 28S ribosomal protein S31, mitochondrial Source.1441: DFBPPR21253 ---- Animal proteins ---- Sorting nexin-8 Source.1442: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5 Source.1443: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1 Source.1444: DFBPPR21323 ---- Animal proteins ---- Trefoil factor 3 Source.1445: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial Source.1446: DFBPPR21336 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4 Source.1447: DFBPPR21339 ---- Animal proteins ---- Zinc finger protein 692 Source.1448: DFBPPR21346 ---- Animal proteins ---- Ameloblastin Source.1449: DFBPPR21347 ---- Animal proteins ---- Zinc finger protein 397 Source.1450: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter Source.1451: DFBPPR21350 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1 Source.1452: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1 Source.1453: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158 Source.1454: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog Source.1455: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.1456: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2 Source.1457: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D Source.1458: DFBPPR21395 ---- Animal proteins ---- Elongation factor Ts, mitochondrial Source.1459: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1 Source.1460: DFBPPR21414 ---- Animal proteins ---- Neuromedin-B Source.1461: DFBPPR21421 ---- Animal proteins ---- Protein SMG8 Source.1462: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B Source.1463: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform Source.1464: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8 Source.1465: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.1466: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.1467: DFBPPR21485 ---- Animal proteins ---- Proline-rich protein 14 Source.1468: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47 Source.1469: DFBPPR21500 ---- Animal proteins ---- Docking protein 2 Source.1470: DFBPPR21526 ---- Animal proteins ---- Interferon alpha-inducible protein 27-like protein 2 Source.1471: DFBPPR21558 ---- Animal proteins ---- Solute carrier family 25 member 39 Source.1472: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3 Source.1473: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A Source.1474: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4 Source.1475: DFBPPR21606 ---- Animal proteins ---- Surfeit locus protein 6 Source.1476: DFBPPR21633 ---- Animal proteins ---- DNA fragmentation factor subunit beta Source.1477: DFBPPR21637 ---- Animal proteins ---- 60S acidic ribosomal protein P2 Source.1478: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial Source.1479: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein Source.1480: DFBPPR21691 ---- Animal proteins ---- Protein LRATD1 Source.1481: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.1482: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2 Source.1483: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15 Source.1484: DFBPPR21759 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D Source.1485: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1 Source.1486: DFBPPR21768 ---- Animal proteins ---- Tektin-4 Source.1487: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.1488: DFBPPR21779 ---- Animal proteins ---- Serpin B8 Source.1489: DFBPPR21795 ---- Animal proteins ---- CCAAT/enhancer-binding protein gamma Source.1490: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog Source.1491: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.1492: DFBPPR21817 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 2 Source.1493: DFBPPR21893 ---- Animal proteins ---- Somatomedin-B and thrombospondin type-1 domain-containing protein Source.1494: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma Source.1495: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6 Source.1496: DFBPPR21998 ---- Animal proteins ---- Putative monooxygenase p33MONOX Source.1497: DFBPPR22010 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21E Source.1498: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein Source.1499: DFBPPR22032 ---- Animal proteins ---- Armadillo-like helical domain-containing protein 4 Source.1500: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12 Source.1501: DFBPPR22043 ---- Animal proteins ---- Leukocyte antigen CD37 Source.1502: DFBPPR22052 ---- Animal proteins ---- Caspase activity and apoptosis inhibitor 1 Source.1503: DFBPPR22053 ---- Animal proteins ---- Protein FAM118B Source.1504: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1 Source.1505: DFBPPR22082 ---- Animal proteins ---- Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 2 protein Source.1506: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512 Source.1507: DFBPPR22087 ---- Animal proteins ---- RNA-binding protein PNO1 Source.1508: DFBPPR22088 ---- Animal proteins ---- Protein YIPF7 Source.1509: DFBPPR22099 ---- Animal proteins ---- Beta-centractin Source.1510: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein Source.1511: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2 Source.1512: DFBPPR22140 ---- Animal proteins ---- RNA-binding protein 48 Source.1513: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2 Source.1514: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11 Source.1515: DFBPPR22153 ---- Animal proteins ---- Leucine-rich repeat-containing protein 3 Source.1516: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B Source.1517: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.1518: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2 Source.1519: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5 Source.1520: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.1521: DFBPPR22204 ---- Animal proteins ---- Ubiquitin-like protein 3 Source.1522: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.1523: DFBPPR22211 ---- Animal proteins ---- Ribonuclease P protein subunit p25-like protein Source.1524: DFBPPR22218 ---- Animal proteins ---- Galectin-4 Source.1525: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1 Source.1526: DFBPPR22226 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 2 Source.1527: DFBPPR22252 ---- Animal proteins ---- Glutamine amidotransferase-like class 1 domain-containing protein 1 Source.1528: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40 Source.1529: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.1530: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2 Source.1531: DFBPPR22311 ---- Animal proteins ---- Calcium-binding and spermatid-specific protein 1 Source.1532: DFBPPR22333 ---- Animal proteins ---- Ubiquitin-like protein 7 Source.1533: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog Source.1534: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2 Source.1535: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23 Source.1536: DFBPPR22369 ---- Animal proteins ---- Transmembrane protein 247 Source.1537: DFBPPR22434 ---- Animal proteins ---- UPF0692 protein C19orf54 homolog Source.1538: DFBPPR22441 ---- Animal proteins ---- Isochorismatase domain-containing protein 2 Source.1539: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2 Source.1540: DFBPPR22486 ---- Animal proteins ---- Transmembrane protein 223 Source.1541: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183 Source.1542: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8 Source.1543: DFBPPR22534 ---- Animal proteins ---- Protein FAM162B Source.1544: DFBPPR22545 ---- Animal proteins ---- Protein FAM214B Source.1545: DFBPPR22547 ---- Animal proteins ---- Actin-related protein T2 Source.1546: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1 Source.1547: DFBPPR22560 ---- Animal proteins ---- Mesenteric estrogen-dependent adipogenesis protein Source.1548: DFBPPR22587 ---- Animal proteins ---- Neuropeptide-like protein C4orf48 homolog Source.1549: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19 Source.1550: DFBPPR22595 ---- Animal proteins ---- Transmembrane protein 268 Source.1551: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B Source.1552: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4 Source.1553: DFBPPR22618 ---- Animal proteins ---- BSD domain-containing protein 1 Source.1554: DFBPPR22646 ---- Animal proteins ---- Coiled-coil domain-containing protein 184 Source.1555: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog Source.1556: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog Source.1557: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.1558: DFBPPR22714 ---- Animal proteins ---- Protein FAM71E1 Source.1559: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein Source.1560: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog Source.1561: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial Source.1562: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1563: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1564: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.1565: DFBPPR8550 ---- Animal proteins ---- Complement C3 Source.1566: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein Source.1567: DFBPPR8564 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1 Source.1568: DFBPPR8565 ---- Animal proteins ---- Villin-1 Source.1569: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1 Source.1570: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.1571: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.1572: DFBPPR8586 ---- Animal proteins ---- Aurora kinase B Source.1573: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial Source.1574: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha Source.1575: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.1576: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein Source.1577: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2 Source.1578: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.1579: DFBPPR8688 ---- Animal proteins ---- Vinculin Source.1580: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1 Source.1581: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53 Source.1582: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor Source.1583: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial Source.1584: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9 Source.1585: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.1586: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.1587: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2 Source.1588: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.1589: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.1590: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase Source.1591: DFBPPR8772 ---- Animal proteins ---- Dystroglycan Source.1592: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.1593: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.1594: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.1595: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1 Source.1596: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase Source.1597: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.1598: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.1599: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.1600: DFBPPR8846 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 6 Source.1601: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.1602: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.1603: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein Source.1604: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.1605: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.1606: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.1607: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1 Source.1608: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80 Source.1609: DFBPPR9055 ---- Animal proteins ---- Ameloblastin Source.1610: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1 Source.1611: DFBPPR9073 ---- Animal proteins ---- Vitronectin Source.1612: DFBPPR9076 ---- Animal proteins ---- Histone H1t Source.1613: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor Source.1614: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.1615: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.1616: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase Source.1617: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.1618: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6 Source.1619: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like Source.1620: DFBPPR9207 ---- Animal proteins ---- Beta-enolase Source.1621: DFBPPR9209 ---- Animal proteins ---- Cytochrome b-245 light chain Source.1622: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3 Source.1623: DFBPPR9254 ---- Animal proteins ---- Complement factor D Source.1624: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase Source.1625: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.1626: DFBPPR9297 ---- Animal proteins ---- Cas scaffolding protein family member 4 Source.1627: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase Source.1628: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.1629: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase Source.1630: DFBPPR9337 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.1631: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1 Source.1632: DFBPPR9349 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.1633: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.1634: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.1635: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.1636: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase Source.1637: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type Source.1638: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type Source.1639: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.1640: DFBPPR9427 ---- Animal proteins ---- Protein quaking Source.1641: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.1642: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.1643: DFBPPR9445 ---- Animal proteins ---- Securin Source.1644: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.1645: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24 Source.1646: DFBPPR9525 ---- Animal proteins ---- Pregnancy-associated glycoprotein 1 Source.1647: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25 Source.1648: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.1649: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.1650: DFBPPR9550 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 2 Source.1651: DFBPPR9552 ---- Animal proteins ---- Electron transfer flavoprotein subunit beta Source.1652: DFBPPR9578 ---- Animal proteins ---- Biglycan Source.1653: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1 Source.1654: DFBPPR9617 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.1655: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor Source.1656: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma Source.1657: DFBPPR9676 ---- Animal proteins ---- Pregnancy-associated glycoprotein 2 Source.1658: DFBPPR9683 ---- Animal proteins ---- Calpastatin Source.1659: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta Source.1660: DFBPPR9698 ---- Animal proteins ---- Ciliary neurotrophic factor Source.1661: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2 Source.1662: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.1663: DFBPPR9772 ---- Animal proteins ---- 60S ribosomal protein L13a Source.1664: DFBPPR9796 ---- Animal proteins ---- Arrestin-C Source.1665: DFBPPR9807 ---- Animal proteins ---- Galectin-4 Source.1666: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.1667: DFBPPR9839 ---- Animal proteins ---- Nurim Source.1668: DFBPPR9842 ---- Animal proteins ---- Insulin-like growth factor-binding protein 1 Source.1669: DFBPPR9865 ---- Animal proteins ---- Male-enhanced antigen 1 Source.1670: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.1671: DFBPPR9880 ---- Animal proteins ---- Trefoil factor 3 Source.1672: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D Source.1673: DFBPPR9924 ---- Animal proteins ---- Neuronal protein NP-190 Source.1674: DFBPPR9939 ---- Animal proteins ---- Tctex1 domain-containing protein 4 Source.1675: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor Source.1676: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.1677: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.1678: DFBPPR9974 ---- Animal proteins ---- RAF proto-oncogene serine/threonine-protein kinase Source.1679: DFBPPR9988 ---- Animal proteins ---- Vinculin Source.1680: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88 Source.1681: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL Source.1682: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.1683: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta Source.1684: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4 Source.1685: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15 Source.1686: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.1687: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9 Source.1688: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.1689: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein Source.1690: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2 Source.1691: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.1692: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.1693: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S Source.1694: DFBPPR10101 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12 Source.1695: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.1696: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.1697: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.1698: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.1699: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1 Source.1700: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.1701: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos Source.1702: DFBPPR10174 ---- Animal proteins ---- Serine/threonine-protein kinase SIK2 Source.1703: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha Source.1704: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5 Source.1705: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.1706: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.1707: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1 Source.1708: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.1709: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X Source.1710: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1 Source.1711: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2 Source.1712: DFBPPR10215 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1 Source.1713: DFBPPR10220 ---- Animal proteins ---- Paxillin Source.1714: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein Source.1715: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3 Source.1716: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6 Source.1717: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.1718: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6 Source.1719: DFBPPR10259 ---- Animal proteins ---- Frizzled-4 Source.1720: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2 Source.1721: DFBPPR10267 ---- Animal proteins ---- Gephyrin Source.1722: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.1723: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1724: DFBPPR10296 ---- Animal proteins ---- Mucin-5B Source.1725: DFBPPR10298 ---- Animal proteins ---- Caldesmon Source.1726: DFBPPR10302 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-1 Source.1727: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.1728: DFBPPR10313 ---- Animal proteins ---- Endoplasmic reticulum chaperone BiP Source.1729: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1 Source.1730: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1 Source.1731: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1 Source.1732: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.1733: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.1734: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.1735: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.1736: DFBPPR10368 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.1737: DFBPPR10369 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.1738: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.1739: DFBPPR10391 ---- Animal proteins ---- Annexin A5 Source.1740: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf Source.1741: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5 Source.1742: DFBPPR10407 ---- Animal proteins ---- Beta-enolase Source.1743: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.1744: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin Source.1745: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.1746: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle Source.1747: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.1748: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.1749: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.1750: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.1751: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein Source.1752: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase Source.1753: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1 Source.1754: DFBPPR10495 ---- Animal proteins ---- Y-box-binding protein 1 Source.1755: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.1756: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.1757: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2 Source.1758: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2 Source.1759: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein Source.1760: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.1761: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.1762: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.1763: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3 Source.1764: DFBPPR10567 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial Source.1765: DFBPPR10577 ---- Animal proteins ---- Frizzled-10 Source.1766: DFBPPR10582 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B' Source.1767: DFBPPR10598 ---- Animal proteins ---- Histone chaperone ASF1 Source.1768: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.1769: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A Source.1770: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6 Source.1771: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.1772: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B Source.1773: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.1774: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1 Source.1775: DFBPPR10658 ---- Animal proteins ---- Stress-70 protein, mitochondrial Source.1776: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.1777: DFBPPR10662 ---- Animal proteins ---- CCN family member 3 Source.1778: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3 Source.1779: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.1780: DFBPPR10672 ---- Animal proteins ---- Nibrin Source.1781: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.1782: DFBPPR10694 ---- Animal proteins ---- Dihydrofolate reductase Source.1783: DFBPPR10703 ---- Animal proteins ---- Tensin Source.1784: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase Source.1785: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.1786: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha Source.1787: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB Source.1788: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1 Source.1789: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2 Source.1790: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1791: DFBPPR10769 ---- Animal proteins ---- Ubiquitin thioesterase OTU1 Source.1792: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase Source.1793: DFBPPR10805 ---- Animal proteins ---- Interferon type A1/A2 Source.1794: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.1795: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1796: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5 Source.1797: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.1798: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase Source.1799: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10 Source.1800: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.1801: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.1802: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.1803: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.1804: DFBPPR10918 ---- Animal proteins ---- Frizzled-2 Source.1805: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2 Source.1806: DFBPPR10927 ---- Animal proteins ---- Frizzled-7 Source.1807: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1 Source.1808: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.1809: DFBPPR10945 ---- Animal proteins ---- Prosaposin Source.1810: DFBPPR10974 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.1811: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1 Source.1812: DFBPPR10981 ---- Animal proteins ---- Kinectin Source.1813: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.1814: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.1815: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.1816: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.1817: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11 Source.1818: DFBPPR11047 ---- Animal proteins ---- Nucleolin Source.1819: DFBPPR11079 ---- Animal proteins ---- Frizzled-1 Source.1820: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326 Source.1821: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1 Source.1822: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.1823: DFBPPR11102 ---- Animal proteins ---- Interferon type A3 Source.1824: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.1825: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D Source.1826: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4 Source.1827: DFBPPR11134 ---- Animal proteins ---- Keratocan Source.1828: DFBPPR11141 ---- Animal proteins ---- Serine/threonine-protein kinase ULK3 Source.1829: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1 Source.1830: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1 Source.1831: DFBPPR11219 ---- Animal proteins ---- Cytospin-A Source.1832: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.1833: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase Source.1834: DFBPPR11237 ---- Animal proteins ---- Fibroblast growth factor 3 Source.1835: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2 Source.1836: DFBPPR11265 ---- Animal proteins ---- Integral membrane protein 2B Source.1837: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B Source.1838: DFBPPR11283 ---- Animal proteins ---- Centromere protein U Source.1839: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1 Source.1840: DFBPPR11294 ---- Animal proteins ---- Frizzled-8 Source.1841: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1 Source.1842: DFBPPR11323 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.1843: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.1844: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10 Source.1845: DFBPPR11350 ---- Animal proteins ---- Homeobox protein Hox-D13 Source.1846: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47 Source.1847: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.1848: DFBPPR11377 ---- Animal proteins ---- UBX domain-containing protein 2B Source.1849: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7 Source.1850: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B Source.1851: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner Source.1852: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47 Source.1853: DFBPPR11407 ---- Animal proteins ---- RAD52 motif-containing protein 1 Source.1854: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF Source.1855: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.1856: DFBPPR11435 ---- Animal proteins ---- Eyes absent homolog 3 Source.1857: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48 Source.1858: DFBPPR11451 ---- Animal proteins ---- Proteasomal ubiquitin receptor ADRM1 Source.1859: DFBPPR11456 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-2 Source.1860: DFBPPR11463 ---- Animal proteins ---- Ubiquitin-fold modifier 1 Source.1861: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1 Source.1862: DFBPPR11526 ---- Animal proteins ---- Fibromodulin Source.1863: DFBPPR11547 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit J Source.1864: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.1865: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg Source.1866: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622 Source.1867: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.1868: DFBPPR11596 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.1869: DFBPPR11604 ---- Animal proteins ---- Centromere protein I Source.1870: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.1871: DFBPPR11621 ---- Animal proteins ---- T-cell leukemia homeobox protein 3 Source.1872: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial Source.1873: DFBPPR11640 ---- Animal proteins ---- Transmembrane protein 170A Source.1874: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19 Source.1875: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4 Source.1876: DFBPPR11646 ---- Animal proteins ---- Frizzled-9 Source.1877: DFBPPR11659 ---- Animal proteins ---- Matrix remodeling-associated protein 8 Source.1878: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.1879: DFBPPR11670 ---- Animal proteins ---- Snurportin-1 Source.1880: DFBPPR11693 ---- Animal proteins ---- T-cell leukemia homeobox protein 1 Source.1881: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1 Source.1882: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog Source.1883: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.1884: DFBPPR11717 ---- Animal proteins ---- DNA polymerase delta subunit 3 Source.1885: DFBPPR11724 ---- Animal proteins ---- Protein TENP Source.1886: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.1887: DFBPPR11759 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M Source.1888: DFBPPR11769 ---- Animal proteins ---- Cytokine-inducible SH2-containing protein Source.1889: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.1890: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen Source.1891: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1 Source.1892: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.1893: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.1894: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog Source.1895: DFBPPR11854 ---- Animal proteins ---- Claw keratin Source.1896: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.1897: DFBPPR11879 ---- Animal proteins ---- Nicalin Source.1898: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1 Source.1899: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.1900: DFBPPR11889 ---- Animal proteins ---- Olfactory receptor-like protein COR8 Source.1901: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8 Source.1902: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1 Source.1903: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.1904: DFBPPR11929 ---- Animal proteins ---- Probable RNA-binding protein EIF1AD Source.1905: DFBPPR11938 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1 Source.1906: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3 Source.1907: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2 Source.1908: DFBPPR11975 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein Source.1909: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130 Source.1910: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog Source.1911: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a Source.1912: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7 Source.1913: DFBPPR12043 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 5 Source.1914: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24 Source.1915: DFBPPR12065 ---- Animal proteins ---- Testin Source.1916: DFBPPR12074 ---- Animal proteins ---- Paired box protein Pax-9 Source.1917: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme Source.1918: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1 Source.1919: DFBPPR12102 ---- Animal proteins ---- Nuclear envelope integral membrane protein 2 Source.1920: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1 Source.1921: DFBPPR12124 ---- Animal proteins ---- RNA-binding protein PNO1 Source.1922: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.1923: DFBPPR12145 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1-like Source.1924: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1 Source.1925: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A Source.1926: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.1927: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5 Source.1928: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein Source.1929: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3 Source.1930: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B Source.1931: DFBPPR12215 ---- Animal proteins ---- UPF0669 protein C6orf120 homolog Source.1932: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein Source.1933: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68 Source.1934: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1 Source.1935: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.1936: DFBPPR12259 ---- Animal proteins ---- Lambda-crystallin Source.1937: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase Source.1938: DFBPPR12261 ---- Animal proteins ---- Tumor necrosis factor Source.1939: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle Source.1940: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.1941: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.1942: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.1943: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.1944: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2 Source.1945: DFBPPR12299 ---- Animal proteins ---- Myocilin Source.1946: DFBPPR12304 ---- Animal proteins ---- Cellular tumor antigen p53 Source.1947: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.1948: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor Source.1949: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1 Source.1950: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.1951: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain Source.1952: DFBPPR12352 ---- Animal proteins ---- Podocalyxin Source.1953: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein Source.1954: DFBPPR12357 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1 Source.1955: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.1956: DFBPPR12425 ---- Animal proteins ---- Beta-enolase Source.1957: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1958: DFBPPR12441 ---- Animal proteins ---- Triadin Source.1959: DFBPPR12449 ---- Animal proteins ---- Cholesteryl ester transfer protein Source.1960: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1961: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type Source.1962: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator Source.1963: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha Source.1964: DFBPPR12489 ---- Animal proteins ---- Monocyte differentiation antigen CD14 Source.1965: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor Source.1966: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII Source.1967: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.1968: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.1969: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.1970: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.1971: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle Source.1972: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.1973: DFBPPR12573 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.1974: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.1975: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5 Source.1976: DFBPPR12626 ---- Animal proteins ---- E-selectin Source.1977: DFBPPR12641 ---- Animal proteins ---- Cytochrome b-245 light chain Source.1978: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.1979: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase Source.1980: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta Source.1981: DFBPPR12737 ---- Animal proteins ---- T-lymphocyte activation antigen CD86 Source.1982: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1 Source.1983: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain Source.1984: DFBPPR12756 ---- Animal proteins ---- Aromatase Source.1985: DFBPPR12768 ---- Animal proteins ---- Pepsin-3 Source.1986: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.1987: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin Source.1988: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.1989: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.1990: DFBPPR12823 ---- Animal proteins ---- Pepsin F Source.1991: DFBPPR12831 ---- Animal proteins ---- Serine--pyruvate aminotransferase Source.1992: DFBPPR12837 ---- Animal proteins ---- Tissue factor pathway inhibitor Source.1993: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.1994: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B Source.1995: DFBPPR12898 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.1996: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1 Source.1997: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.1998: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1 Source.1999: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform Source.2000: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma Source.2001: DFBPPR12988 ---- Animal proteins ---- Calpastatin Source.2002: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1 Source.2003: DFBPPR12991 ---- Animal proteins ---- Eukaryotic translation initiation factor 2D Source.2004: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein Source.2005: DFBPPR13064 ---- Animal proteins ---- Metalloproteinase inhibitor 4 Source.2006: DFBPPR13068 ---- Animal proteins ---- Biglycan Source.2007: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.2008: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.2009: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2010: DFBPPR13119 ---- Animal proteins ---- Ig alpha chain C region Source.2011: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.2012: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2013: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2014: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein Source.2015: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.2016: DFBPPR13233 ---- Animal proteins ---- Fibronectin Source.2017: DFBPPR13242 ---- Animal proteins ---- E-selectin Source.2018: DFBPPR13261 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1 Source.2019: DFBPPR13263 ---- Animal proteins ---- Serotransferrin Source.2020: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.2021: DFBPPR13271 ---- Animal proteins ---- Alpha-defensin 1 Source.2022: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform Source.2023: DFBPPR13276 ---- Animal proteins ---- Protein quaking Source.2024: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.2025: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.2026: DFBPPR13309 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.2027: DFBPPR13312 ---- Animal proteins ---- Alpha-2B adrenergic receptor Source.2028: DFBPPR13315 ---- Animal proteins ---- Ski oncogene Source.2029: DFBPPR13320 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial Source.2030: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.2031: DFBPPR13362 ---- Animal proteins ---- Biglycan Source.2032: DFBPPR13377 ---- Animal proteins ---- Pregnancy-associated glycoprotein Source.2033: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma Source.2034: DFBPPR13405 ---- Animal proteins ---- 60S acidic ribosomal protein P2 Source.2035: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2036: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2 Source.2037: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9 Source.2038: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.2039: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2040: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9 Source.2041: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.2042: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor Source.2043: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase Source.2044: DFBPPR13678 ---- Animal proteins ---- Fructose-bisphosphate aldolase B Source.2045: DFBPPR13701 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.2046: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.2047: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.2048: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9 Source.2049: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3 Source.2050: DFBPPR13801 ---- Animal proteins ---- Pregnancy-associated glycoprotein 4 Source.2051: DFBPPR13806 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.2052: DFBPPR13826 ---- Animal proteins ---- Translocator protein Source.2053: DFBPPR13834 ---- Animal proteins ---- Biglycan Source.2054: DFBPPR13861 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1 Source.2055: DFBPPR13945 ---- Animal proteins ---- Keratin, ultra high-sulfur matrix protein Source.2056: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.2057: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.2058: DFBPPR13959 ---- Animal proteins ---- Calpastatin Source.2059: DFBPPR13992 ---- Animal proteins ---- Rhodopsin Source.2060: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.2061: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.2062: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase Source.2063: DFBPPR14063 ---- Animal proteins ---- Homeobox protein Hox-B1 Source.2064: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1 Source.2065: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2 Source.2066: DFBPPR14156 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit E Source.2067: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.2068: DFBPPR14161 ---- Marine protein ---- GTPase Era, mitochondrial Source.2069: DFBPPR14174 ---- Marine protein ---- Ubiquitin-fold modifier 1 Source.2070: DFBPPR14180 ---- Marine protein ---- Prostamide/prostaglandin F synthase Source.2071: DFBPPR14187 ---- Marine protein ---- Secreted phosphoprotein 24 Source.2072: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2 Source.2073: DFBPPR14211 ---- Marine protein ---- WASH complex subunit 3 Source.2074: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial Source.2075: DFBPPR14237 ---- Marine protein ---- Stanniocalcin Source.2076: DFBPPR14255 ---- Marine protein ---- L-rhamnose-binding lectin CSL3 Source.2077: DFBPPR14259 ---- Marine protein ---- L-rhamnose-binding lectin CSL2 Source.2078: DFBPPR14300 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.2079: DFBPPR14328 ---- Marine protein ---- Sulfate adenylyltransferase Source.2080: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain Source.2081: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.2082: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta Source.2083: DFBPPR14414 ---- Marine protein ---- Cytochrome b6-f complex subunit 4 Source.2084: DFBPPR14420 ---- Marine protein ---- Chaperone protein dnaK Source.2085: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic Source.2086: DFBPPR14441 ---- Marine protein ---- 30S ribosomal protein S8, chloroplastic Source.2087: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA Source.2088: DFBPPR14458 ---- Marine protein ---- 50S ribosomal protein L12, chloroplastic Source.2089: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24 Source.2090: DFBPPR14546 ---- Marine protein ---- Stanniocalcin Source.2091: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.2092: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.2093: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II Source.2094: DFBPPR14600 ---- Marine protein ---- Transforming growth factor beta-1 proprotein Source.2095: DFBPPR14606 ---- Marine protein ---- Myoblast determination protein 1 homolog 1 Source.2096: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing] Source.2097: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.2098: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.2099: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein Source.2100: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1 Source.2101: DFBPPR14679 ---- Marine protein ---- Otolith matrix protein 1 Source.2102: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64 Source.2103: DFBPPR14716 ---- Marine protein ---- Secreted phosphoprotein 24 Source.2104: DFBPPR14732 ---- Marine protein ---- Cytochrome c oxidase subunit 6C Source.2105: DFBPPR14735 ---- Marine protein ---- Salmocidin-1 Source.2106: DFBPPR14783 ---- Marine protein ---- Enolase Source.2107: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic Source.2108: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2109: DFBPPR14876 ---- Microorganism protein ---- Hexokinase Source.2110: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.2111: DFBPPR14892 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-4 specific Source.2112: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase Source.2113: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.2114: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.2115: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1 Source.2116: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial Source.2117: DFBPPR14935 ---- Microorganism protein ---- Actin Source.2118: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1 Source.2119: DFBPPR14964 ---- Microorganism protein ---- Arginine biosynthesis bifunctional protein ArgJ, mitochondrial Source.2120: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1 Source.2121: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.2122: DFBPPR14998 ---- Microorganism protein ---- Galactokinase Source.2123: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1 Source.2124: DFBPPR15013 ---- Microorganism protein ---- Inorganic pyrophosphatase Source.2125: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase Source.2126: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase Source.2127: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2 Source.2128: DFBPPR15089 ---- Microorganism protein ---- F-actin-capping protein subunit beta Source.2129: DFBPPR15105 ---- Microorganism protein ---- Arginase Source.2130: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28 Source.2131: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1 Source.2132: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2 Source.2133: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase Source.2134: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10 Source.2135: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3 Source.2136: DFBPPR15169 ---- Microorganism protein ---- Protein VTS1 Source.2137: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111 Source.2138: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog Source.2139: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3 Source.2140: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.2141: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1 Source.2142: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial Source.2143: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.2144: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4 Source.2145: DFBPPR15290 ---- Microorganism protein ---- Peptidyl-prolyl cis-trans isomerase D Source.2146: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter Source.2147: DFBPPR15302 ---- Microorganism protein ---- mRNA cleavage and polyadenylation factor CLP1 Source.2148: DFBPPR15316 ---- Microorganism protein ---- Protein URE2 Source.2149: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial Source.2150: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31 Source.2151: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.2152: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1 Source.2153: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.2154: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase Source.2155: DFBPPR15406 ---- Microorganism protein ---- Leucine carboxyl methyltransferase 1 Source.2156: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2 Source.2157: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101 Source.2158: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2 Source.2159: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP) Source.2160: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1 Source.2161: DFBPPR15494 ---- Microorganism protein ---- Protein STU1 Source.2162: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62 Source.2163: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22 Source.2164: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1 Source.2165: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1 Source.2166: DFBPPR15541 ---- Microorganism protein ---- F-actin-capping protein subunit alpha Source.2167: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.2168: DFBPPR15553 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX4 Source.2169: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1 Source.2170: DFBPPR15591 ---- Microorganism protein ---- Ras modification protein ERF4 Source.2171: DFBPPR15597 ---- Microorganism protein ---- DNA damage-binding protein CMR1 Source.2172: DFBPPR15609 ---- Microorganism protein ---- Shugoshin Source.2173: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1 Source.2174: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1 Source.2175: DFBPPR15632 ---- Microorganism protein ---- Ribosome biogenesis protein NSA1 Source.2176: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4 Source.2177: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial Source.2178: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1 Source.2179: DFBPPR15723 ---- Microorganism protein ---- Regulator of free ubiquitin chains 1 Source.2180: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2 Source.2181: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3 Source.2182: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21 Source.2183: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8 Source.2184: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1 Source.2185: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10 Source.2186: DFBPPR15787 ---- Microorganism protein ---- Required for respiratory growth protein 7, mitochondrial Source.2187: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase Source.2188: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase Source.2189: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta Source.2190: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit Source.2191: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1 Source.2192: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase Source.2193: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease Source.2194: DFBPPR15886 ---- Microorganism protein ---- Capsid protein Source.2195: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4 Source.2196: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic Source.2197: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic Source.2198: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase Source.2199: DFBPPR7786 ---- Plant protein ---- tRNA (guanine(37)-N1)-methyltransferase Source.2200: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase Source.2201: DFBPPR7808 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2202: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.2203: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.2204: DFBPPR7829 ---- Plant protein ---- Cyanate hydratase Source.2205: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a Source.2206: DFBPPR7856 ---- Plant protein ---- Maturase K Source.2207: DFBPPR7873 ---- Plant protein ---- Casparian strip membrane protein 4 Source.2208: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.2209: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1 Source.2210: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1 Source.2211: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2 Source.2212: DFBPPR7913 ---- Plant protein ---- CASP-like protein 1U4 Source.2213: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3 Source.2214: DFBPPR7919 ---- Plant protein ---- 30S ribosomal protein S16, chloroplastic Source.2215: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase Source.2216: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1 Source.2217: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase Source.2218: DFBPPR8002 ---- Plant protein ---- Plastocyanin Source.2219: DFBPPR8029 ---- Plant protein ---- Vignain Source.2220: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase Source.2221: DFBPPR8042 ---- Plant protein ---- Pyridoxal 5'-phosphate synthase subunit PDX1 Source.2222: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic Source.2223: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.2224: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2225: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.2226: DFBPPR8125 ---- Plant protein ---- Eukaryotic translation initiation factor 5 Source.2227: DFBPPR8146 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.2228: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial Source.2229: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic Source.2230: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.2231: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.2232: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic Source.2233: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.2234: DFBPPR8286 ---- Plant protein ---- Oleosin Source.2235: DFBPPR8298 ---- Plant protein ---- Cytochrome b6-f complex subunit 4 Source.2236: DFBPPR8311 ---- Plant protein ---- DEAD-box ATP-dependent RNA helicase 3 Source.2237: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.2238: DFBPPR8348 ---- Plant protein ---- 30S ribosomal protein S16, chloroplastic
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

ACE-inhibitory activity	The peptide exhibited strong Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC₅₀ value of 4.4 uM.
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)O

Preparation method

Mode of preparation	Synthesis
Enzyme(s)/starter culture	Peptides were synthesized using a solid-phase method on a CS536 peptide synthesizer (CS Bio Company, USA) by CL.(XIAN)Bio-Scientfic.Co., LTD.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The novel peptides from hydrolysate of A. chinensis and some of their derived peptides with high ACE inhibitory activity probably have potential in the treatment of hypertension or in clinical nutrition.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Hai-Lun H, Xiu-Lan C, Cai-Yun S, Yu-Zhong Z, Bai-Cheng Z. Analysis of novel angiotensin-I-converting enzyme inhibitory peptides from protease-hydrolyzed marine shrimp Acetes chinensis. J Pept Sci. 2006 Nov;12(11):726-33. PMID: 16981241 DOI: 10.1002/psc.789
Other literature(s)	N.D
PubDate	2006