Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI1764(ACE-inhibitory peptide)

DFBP ID	DFBPACEI1764
Peptide sequence	LRY
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Leu-Arg-Tyr

Single-letter amino acid

LRY

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	450.53 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

9.82 ^c

IC₅₀

0.044 uM

pIC₅₀

1.357

GRAVY

-0.6667^c

Hydrophilic residue ratio

33.33%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Marine, Red alga
Organism/Source	Dulse (Palmaria palmata)
Precursor protein	Phycoerythrin β-subunit, Phycocyanin β-subunit, Allophycocyanin β-subunit
Residue position	f(90-92), f(90-92), f(89-91)
Precursor protein(s) search	Source.1: DFBPPR0748 ---- Plant proteins ---- Agglutinin Source.2: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8 Source.3: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7 Source.4: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4 Source.5: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1 Source.6: DFBPPR0899 ---- Plant proteins ---- Cyclin-dependent kinase A-1 Source.7: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.8: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic Source.9: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a Source.10: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.11: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21 Source.12: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.13: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2 Source.14: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1 Source.15: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming] Source.16: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.17: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5 Source.18: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform Source.19: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2 Source.20: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25 Source.21: DFBPPR1056 ---- Plant proteins ---- Delta-1-pyrroline-5-carboxylate synthase 1 Source.22: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING Source.23: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic Source.24: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A Source.25: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6 Source.26: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B Source.27: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.28: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.29: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog Source.30: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM Source.31: DFBPPR1253 ---- Plant proteins ---- Phospholipase A2 homolog 3 Source.32: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.33: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.34: DFBPPR1300 ---- Plant proteins ---- Protein G1 Source.35: DFBPPR1301 ---- Plant proteins ---- Proliferating cell nuclear antigen Source.36: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6 Source.37: DFBPPR1348 ---- Plant proteins ---- Cytochrome b Source.38: DFBPPR1351 ---- Plant proteins ---- Probable phospholipase A2 homolog 2 Source.39: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.40: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1 Source.41: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.42: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2 Source.43: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1 Source.44: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3 Source.45: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.46: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.47: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.48: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a Source.49: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase Source.50: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial Source.51: DFBPPR1701 ---- Plant proteins ---- Protein mago nashi homolog 1 Source.52: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1 Source.53: DFBPPR1711 ---- Plant proteins ---- Protein mago nashi homolog 2 Source.54: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2 Source.55: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1 Source.56: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1 Source.57: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase Source.58: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain Source.59: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3 Source.60: DFBPPR1820 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2B Source.61: DFBPPR1825 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 3 Source.62: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3 Source.63: DFBPPR1831 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 1 Source.64: DFBPPR1853 ---- Plant proteins ---- Laccase-4 Source.65: DFBPPR1861 ---- Plant proteins ---- Laccase-25 Source.66: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4 Source.67: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1 Source.68: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2 Source.69: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial Source.70: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.71: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.72: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.73: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial Source.74: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15 Source.75: DFBPPR1992 ---- Plant proteins ---- Probable UDP-arabinose 4-epimerase 2 Source.76: DFBPPR1999 ---- Plant proteins ---- Signal peptide peptidase-like 4 Source.77: DFBPPR2004 ---- Plant proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase PASTICCINO 2A Source.78: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase Source.79: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.80: DFBPPR2013 ---- Plant proteins ---- Laccase-6 Source.81: DFBPPR2058 ---- Plant proteins ---- Cytokinin dehydrogenase 9 Source.82: DFBPPR2061 ---- Plant proteins ---- Probable ion channel POLLUX Source.83: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.84: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2 Source.85: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1 Source.86: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.87: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.88: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14 Source.89: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4 Source.90: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3 Source.91: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic Source.92: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.93: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7 Source.94: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2 Source.95: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.96: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2 Source.97: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4 Source.98: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5 Source.99: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3 Source.100: DFBPPR2247 ---- Plant proteins ---- Phytochrome C Source.101: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial Source.102: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1 Source.103: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.104: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5 Source.105: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1 Source.106: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic Source.107: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30 Source.108: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2 Source.109: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1 Source.110: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6 Source.111: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2 Source.112: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8 Source.113: DFBPPR2421 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS33 Source.114: DFBPPR2440 ---- Plant proteins ---- Casein kinase II subunit alpha-2 Source.115: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain Source.116: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9 Source.117: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25 Source.118: DFBPPR2466 ---- Plant proteins ---- MADS-box transcription factor 26 Source.119: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic Source.120: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10 Source.121: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2 Source.122: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b Source.123: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b Source.124: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1 Source.125: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase Source.126: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2 Source.127: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2 Source.128: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.129: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3 Source.130: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.131: DFBPPR2822 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICMEL1 Source.132: DFBPPR2866 ---- Plant proteins ---- Phosphomannomutase Source.133: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME Source.134: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1 Source.135: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic Source.136: DFBPPR2994 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic Source.137: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1 Source.138: DFBPPR3012 ---- Plant proteins ---- UDP-glucose 4-epimerase 2 Source.139: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit Source.140: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18 Source.141: DFBPPR3058 ---- Plant proteins ---- UDP-glucose 4-epimerase 1 Source.142: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33 Source.143: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4 Source.144: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic Source.145: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1 Source.146: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32 Source.147: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.148: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13 Source.149: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3 Source.150: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3 Source.151: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic Source.152: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6 Source.153: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6 Source.154: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70 Source.155: DFBPPR3311 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 2 Source.156: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.157: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16 Source.158: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.159: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic Source.160: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2 Source.161: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial Source.162: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22 Source.163: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5 Source.164: DFBPPR3507 ---- Plant proteins ---- Coronatine-insensitive protein homolog 2 Source.165: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.166: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.167: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11 Source.168: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.169: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1 Source.170: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic Source.171: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5 Source.172: DFBPPR3700 ---- Plant proteins ---- Protein G1-like3 Source.173: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3 Source.174: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2 Source.175: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.176: DFBPPR3816 ---- Plant proteins ---- Ribonuclease 3-like protein 2 Source.177: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic Source.178: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5 Source.179: DFBPPR3905 ---- Plant proteins ---- Protein G1-like7 Source.180: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.181: DFBPPR3952 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase BAH1-like 1 Source.182: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16 Source.183: DFBPPR3964 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 1 Source.184: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4 Source.185: DFBPPR4001 ---- Plant proteins ---- Protein G1-like2 Source.186: DFBPPR4012 ---- Plant proteins ---- Protein G1-like5 Source.187: DFBPPR4017 ---- Plant proteins ---- Protein G1-like4 Source.188: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3 Source.189: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2 Source.190: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8 Source.191: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5 Source.192: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic Source.193: DFBPPR4140 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3, chloroplastic Source.194: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1 Source.195: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.196: DFBPPR4209 ---- Plant proteins ---- Probable chromo domain-containing protein LHP1 Source.197: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1 Source.198: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.199: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2 Source.200: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7 Source.201: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic Source.202: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14 Source.203: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.204: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6 Source.205: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.206: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.207: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1 Source.208: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic Source.209: DFBPPR4508 ---- Plant proteins ---- Photosystem II stability/assembly factor HCF136, chloroplastic Source.210: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.211: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A Source.212: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3 Source.213: DFBPPR4606 ---- Plant proteins ---- ACT domain-containing protein DS12, chloroplastic Source.214: DFBPPR4610 ---- Plant proteins ---- Protein LOL3 Source.215: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B Source.216: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700 Source.217: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600 Source.218: DFBPPR4745 ---- Plant proteins ---- BURP domain-containing protein 9 Source.219: DFBPPR4759 ---- Plant proteins ---- 60S ribosomal protein L18a Source.220: DFBPPR4793 ---- Plant proteins ---- B3 domain-containing protein LOC_Os02g10420 Source.221: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b Source.222: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000 Source.223: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200 Source.224: DFBPPR4868 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0325100 Source.225: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940 Source.226: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic Source.227: DFBPPR4940 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic Source.228: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1 Source.229: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic Source.230: DFBPPR4967 ---- Plant proteins ---- Beta-amylase Source.231: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial Source.232: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.233: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1 Source.234: DFBPPR5074 ---- Plant proteins ---- Phytochrome B Source.235: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.236: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase Source.237: DFBPPR5151 ---- Plant proteins ---- Phosphomannomutase Source.238: DFBPPR5187 ---- Plant proteins ---- Proliferating cell nuclear antigen Source.239: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3 Source.240: DFBPPR5293 ---- Plant proteins ---- 30S ribosomal protein S8, chloroplastic Source.241: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.242: DFBPPR5304 ---- Plant proteins ---- Maturase K Source.243: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.244: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.245: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic Source.246: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.247: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog Source.248: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic Source.249: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.250: DFBPPR5452 ---- Plant proteins ---- Casein kinase II subunit alpha Source.251: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial Source.252: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic Source.253: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.254: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1 Source.255: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.256: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic Source.257: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3 Source.258: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain Source.259: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain Source.260: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain Source.261: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase Source.262: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic Source.263: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1 Source.264: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic Source.265: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.266: DFBPPR5669 ---- Plant proteins ---- Cytochrome b Source.267: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic Source.268: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.269: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.270: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.271: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5 Source.272: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.273: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2 Source.274: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.275: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3 Source.276: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82 Source.277: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1 Source.278: DFBPPR5892 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic Source.279: DFBPPR5893 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-1, chloroplastic Source.280: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase Source.281: DFBPPR5929 ---- Plant proteins ---- Non-symbiotic hemoglobin Source.282: DFBPPR5944 ---- Plant proteins ---- Proliferating cell nuclear antigen Source.283: DFBPPR5955 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-2, chloroplastic Source.284: DFBPPR5959 ---- Plant proteins ---- Ribosomal protein S13, mitochondrial Source.285: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2 Source.286: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1 Source.287: DFBPPR6137 ---- Plant proteins ---- Defensin-like protein 2 Source.288: DFBPPR6138 ---- Plant proteins ---- Anther-specific protein MZm3-3 Source.289: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.290: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase Source.291: DFBPPR6223 ---- Plant proteins ---- Bifunctional UDP-glucose 4-epimerase and UDP-xylose 4-epimerase 1 Source.292: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.293: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.294: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.295: DFBPPR6266 ---- Plant proteins ---- Outer envelope pore protein 21, chloroplastic Source.296: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.297: DFBPPR6295 ---- Plant proteins ---- Outer envelope pore protein 37, chloroplastic Source.298: DFBPPR6309 ---- Plant proteins ---- Cytochrome b Source.299: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase Source.300: DFBPPR6339 ---- Plant proteins ---- Phytochrome A Source.301: DFBPPR6349 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.302: DFBPPR6393 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic Source.303: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic Source.304: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.305: DFBPPR6425 ---- Plant proteins ---- Legumin A2 Source.306: DFBPPR6430 ---- Plant proteins ---- Legumin J Source.307: DFBPPR6455 ---- Plant proteins ---- Legumin K Source.308: DFBPPR6457 ---- Plant proteins ---- UDP-glucose 4-epimerase Source.309: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.310: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.311: DFBPPR6479 ---- Plant proteins ---- Non-functional protein STAY-GREEN, chloroplastic Source.312: DFBPPR6483 ---- Plant proteins ---- Proliferating cell nuclear antigen Source.313: DFBPPR6542 ---- Plant proteins ---- Maturase K Source.314: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic Source.315: DFBPPR6668 ---- Plant proteins ---- Cytochrome b Source.316: DFBPPR6712 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM16 Source.317: DFBPPR6717 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM3 Source.318: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.319: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.320: DFBPPR6817 ---- Plant proteins ---- Phosphomannomutase Source.321: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.322: DFBPPR6866 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic Source.323: DFBPPR6883 ---- Plant proteins ---- Ribosomal protein S13, mitochondrial Source.324: DFBPPR6888 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.325: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd Source.326: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.327: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase Source.328: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2 Source.329: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial Source.330: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.331: DFBPPR7250 ---- Plant proteins ---- 30S ribosomal protein S4, chloroplastic Source.332: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C Source.333: DFBPPR7299 ---- Plant proteins ---- Low temperature-induced protein lt101.1 Source.334: DFBPPR7337 ---- Plant proteins ---- Low temperature-induced protein lt101.2 Source.335: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.336: DFBPPR7419 ---- Plant proteins ---- Cytochrome b Source.337: DFBPPR7472 ---- Plant proteins ---- Acyl-lipid omega-3 desaturase (cytochrome b5), endoplasmic reticulum Source.338: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic Source.339: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.340: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog Source.341: DFBPPR7518 ---- Plant proteins ---- Agamous-like MADS-box protein AGL15 Source.342: DFBPPR7522 ---- Plant proteins ---- Proliferating cell nuclear antigen Source.343: DFBPPR7595 ---- Milk proteins ---- Bile salt-activated lipase Source.344: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein Source.345: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein Source.346: DFBPPR7625 ---- Milk proteins ---- Leucine-rich alpha-2-glycoprotein Source.347: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.348: DFBPPR7662 ---- Milk proteins ---- Alpha-S1-casein Source.349: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein Source.350: DFBPPR7709 ---- Milk proteins ---- Alpha-S1-casein, Alpha-casein Source.351: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.352: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.353: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5 Source.354: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal Source.355: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1 Source.356: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2 Source.357: DFBPPR8413 ---- Plant proteins ---- Arachin Ahy-3 Source.358: DFBPPR8445 ---- Plant proteins ---- Maturase K Source.359: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.360: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.361: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1 Source.362: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9 Source.363: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1 Source.364: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.365: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.366: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.367: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.368: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1 Source.369: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1 Source.370: DFBPPR16102 ---- Animal proteins ---- 40S ribosomal protein S3 Source.371: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2 Source.372: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor Source.373: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.374: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1 Source.375: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1 Source.376: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.377: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha Source.378: DFBPPR16215 ---- Animal proteins ---- Cytochrome P450 2B11 Source.379: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.380: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.381: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.382: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain Source.383: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.384: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a Source.385: DFBPPR16277 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase Source.386: DFBPPR16290 ---- Animal proteins ---- Cytochrome P450 2C21 Source.387: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain Source.388: DFBPPR16308 ---- Animal proteins ---- Cytochrome P450 2C41 Source.389: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel Source.390: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.391: DFBPPR16325 ---- Animal proteins ---- Peripherin-2 Source.392: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.393: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.394: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2 Source.395: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1 Source.396: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8 Source.397: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.398: DFBPPR16604 ---- Animal proteins ---- Biglycan Source.399: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog Source.400: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.401: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b Source.402: DFBPPR16681 ---- Animal proteins ---- Olfactory receptor-like protein OLF3 Source.403: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.404: DFBPPR16738 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17 Source.405: DFBPPR16822 ---- Animal proteins ---- Kininogen-2 Source.406: DFBPPR16830 ---- Animal proteins ---- Kininogen-1 Source.407: DFBPPR16841 ---- Animal proteins ---- Peroxiredoxin-6 Source.408: DFBPPR16863 ---- Animal proteins ---- Biglycan Source.409: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha Source.410: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.411: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.412: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.413: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta Source.414: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.415: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.416: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1 Source.417: DFBPPR17040 ---- Animal proteins ---- Myocilin Source.418: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.419: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.420: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.421: DFBPPR17085 ---- Animal proteins ---- Cadherin-2 Source.422: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1 Source.423: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha Source.424: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha Source.425: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.426: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1 Source.427: DFBPPR17163 ---- Animal proteins ---- Coxsackievirus and adenovirus receptor homolog Source.428: DFBPPR17172 ---- Animal proteins ---- Cartilage oligomeric matrix protein Source.429: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.430: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4 Source.431: DFBPPR17274 ---- Animal proteins ---- U8 snoRNA-decapping enzyme Source.432: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2 Source.433: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D Source.434: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein Source.435: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.436: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.437: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI Source.438: DFBPPR17355 ---- Animal proteins ---- Proliferating cell nuclear antigen Source.439: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain Source.440: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36 Source.441: DFBPPR17437 ---- Animal proteins ---- DNA excision repair protein ERCC-1 Source.442: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.443: DFBPPR17454 ---- Animal proteins ---- Peripherin-2 Source.444: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.445: DFBPPR17458 ---- Animal proteins ---- Methylmalonate-semialdehyde dehydrogenase [acylating], mitochondrial Source.446: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.447: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1 Source.448: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.449: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.450: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.451: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 Source.452: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1 Source.453: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6 Source.454: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4 Source.455: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.456: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1 Source.457: DFBPPR17595 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.458: DFBPPR17607 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 7 Source.459: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B Source.460: DFBPPR17665 ---- Animal proteins ---- Prostaglandin F synthase 2 Source.461: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.462: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.463: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16 Source.464: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial Source.465: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.466: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B Source.467: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.468: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.469: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain Source.470: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C Source.471: DFBPPR17783 ---- Animal proteins ---- 40S ribosomal protein S3 Source.472: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6 Source.473: DFBPPR17815 ---- Animal proteins ---- 40S ribosomal protein SA Source.474: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial Source.475: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.476: DFBPPR17861 ---- Animal proteins ---- 3-hydroxyanthranilate 3,4-dioxygenase Source.477: DFBPPR17862 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase Source.478: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.479: DFBPPR17865 ---- Animal proteins ---- Protein phosphatase 1A Source.480: DFBPPR17887 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.481: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.482: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1 Source.483: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.484: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.485: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13 Source.486: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.487: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1 Source.488: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2 Source.489: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1 Source.490: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.491: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7 Source.492: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon Source.493: DFBPPR18028 ---- Animal proteins ---- Atlastin-1 Source.494: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5 Source.495: DFBPPR18061 ---- Animal proteins ---- Glutathione S-transferase Mu 1 Source.496: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2 Source.497: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.498: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.499: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3 Source.500: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.501: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1 Source.502: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.503: DFBPPR18169 ---- Animal proteins ---- Vesicle transport through interaction with t-SNAREs homolog 1B Source.504: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6 Source.505: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.506: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3 Source.507: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7 Source.508: DFBPPR18266 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-6 Source.509: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog Source.510: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.511: DFBPPR18322 ---- Animal proteins ---- Stomatin-like protein 2, mitochondrial Source.512: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2 Source.513: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3 Source.514: DFBPPR18361 ---- Animal proteins ---- Casein kinase I isoform gamma-1 Source.515: DFBPPR18367 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3, mitochondrial Source.516: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain Source.517: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6 Source.518: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29 Source.519: DFBPPR18430 ---- Animal proteins ---- cAMP-responsive element-binding protein-like 2 Source.520: DFBPPR18443 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase Source.521: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial Source.522: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3 Source.523: DFBPPR18480 ---- Animal proteins ---- Casein kinase I isoform gamma-3 Source.524: DFBPPR18519 ---- Animal proteins ---- Ras-related protein Rab-21 Source.525: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1 Source.526: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5 Source.527: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.528: DFBPPR18593 ---- Animal proteins ---- Pigment epithelium-derived factor Source.529: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.530: DFBPPR18622 ---- Animal proteins ---- CYFIP-related Rac1 interactor B Source.531: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2 Source.532: DFBPPR18641 ---- Animal proteins ---- Cadherin-5 Source.533: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.534: DFBPPR18685 ---- Animal proteins ---- Inactive peptidyl-prolyl cis-trans isomerase FKBP6 Source.535: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4 Source.536: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa Source.537: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7 Source.538: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1 Source.539: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase Source.540: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4 Source.541: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B Source.542: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.543: DFBPPR18871 ---- Animal proteins ---- Methionine synthase Source.544: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.545: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.546: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2 Source.547: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b Source.548: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A Source.549: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase Source.550: DFBPPR18987 ---- Animal proteins ---- Methionine synthase reductase Source.551: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.552: DFBPPR19019 ---- Animal proteins ---- Casein kinase II subunit alpha' Source.553: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase Source.554: DFBPPR19024 ---- Animal proteins ---- UDP-glucose 4-epimerase Source.555: DFBPPR19027 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.556: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D Source.557: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9 Source.558: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11 Source.559: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.560: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic Source.561: DFBPPR19060 ---- Animal proteins ---- Kinesin-like protein KIF2B Source.562: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.563: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1 Source.564: DFBPPR19100 ---- Animal proteins ---- Interleukin-34 Source.565: DFBPPR19114 ---- Animal proteins ---- Protein C-ets-2 Source.566: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like Source.567: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16 Source.568: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7 Source.569: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase Source.570: DFBPPR19245 ---- Animal proteins ---- Glutamate--cysteine ligase regulatory subunit Source.571: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.572: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1 Source.573: DFBPPR19311 ---- Animal proteins ---- Dihydrodiol dehydrogenase 3 Source.574: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2 Source.575: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2 Source.576: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1 Source.577: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog Source.578: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2 Source.579: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase Source.580: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.581: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.582: DFBPPR19489 ---- Animal proteins ---- Keratocan Source.583: DFBPPR19514 ---- Animal proteins ---- tRNA (cytosine(38)-C(5))-methyltransferase Source.584: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.585: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1 Source.586: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2 Source.587: DFBPPR19640 ---- Animal proteins ---- Prolargin Source.588: DFBPPR19668 ---- Animal proteins ---- Calicin Source.589: DFBPPR19693 ---- Animal proteins ---- Type 2 lactosamine alpha-2,3-sialyltransferase Source.590: DFBPPR19695 ---- Animal proteins ---- Protein UXT Source.591: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10 Source.592: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.593: DFBPPR19761 ---- Animal proteins ---- N-chimaerin Source.594: DFBPPR19766 ---- Animal proteins ---- V-type proton ATPase subunit C 1 Source.595: DFBPPR19794 ---- Animal proteins ---- Bone morphogenetic protein 15 Source.596: DFBPPR19810 ---- Animal proteins ---- Seipin Source.597: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial Source.598: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3 Source.599: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial Source.600: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1 Source.601: DFBPPR19871 ---- Animal proteins ---- Deoxyribonuclease-2-alpha Source.602: DFBPPR19875 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 26A Source.603: DFBPPR19909 ---- Animal proteins ---- Probable C->U-editing enzyme APOBEC-2 Source.604: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial Source.605: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1 Source.606: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2 Source.607: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3 Source.608: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3 Source.609: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer Source.610: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1 Source.611: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit Source.612: DFBPPR20017 ---- Animal proteins ---- Lysoplasmalogenase Source.613: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.614: DFBPPR20093 ---- Animal proteins ---- Natural cytotoxicity triggering receptor 1 Source.615: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9 Source.616: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12 Source.617: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2 Source.618: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.619: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan Source.620: DFBPPR20263 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 54 Source.621: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2 Source.622: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator Source.623: DFBPPR20314 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC3 Source.624: DFBPPR20317 ---- Animal proteins ---- Cadherin-13 Source.625: DFBPPR20339 ---- Animal proteins ---- 28S ribosomal protein S23, mitochondrial Source.626: DFBPPR20351 ---- Animal proteins ---- Replication factor C subunit 2 Source.627: DFBPPR20353 ---- Animal proteins ---- Protein mago nashi homolog 2 Source.628: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2 Source.629: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.630: DFBPPR20494 ---- Animal proteins ---- Protein mago nashi homolog Source.631: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1 Source.632: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial Source.633: DFBPPR20541 ---- Animal proteins ---- Lambda-crystallin homolog Source.634: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase Source.635: DFBPPR20572 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2 Source.636: DFBPPR20596 ---- Animal proteins ---- Colostrum trypsin inhibitor Source.637: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.638: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2 Source.639: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.640: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2 Source.641: DFBPPR20626 ---- Animal proteins ---- Melanocortin receptor 5 Source.642: DFBPPR20639 ---- Animal proteins ---- NmrA-like family domain-containing protein 1 Source.643: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain Source.644: DFBPPR20668 ---- Animal proteins ---- BLOC-1-related complex subunit 5 Source.645: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog Source.646: DFBPPR20712 ---- Animal proteins ---- Melatonin receptor type 1A Source.647: DFBPPR20745 ---- Animal proteins ---- ETS-related transcription factor Elf-1 Source.648: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1 Source.649: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13 Source.650: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.651: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog Source.652: DFBPPR20874 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC2 Source.653: DFBPPR20878 ---- Animal proteins ---- Protein SMG9 Source.654: DFBPPR20883 ---- Animal proteins ---- Pre-mRNA-splicing factor 38A Source.655: DFBPPR20935 ---- Animal proteins ---- Peroxisomal membrane protein 11A Source.656: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase Source.657: DFBPPR21026 ---- Animal proteins ---- Fetal and adult testis-expressed transcript protein homolog Source.658: DFBPPR21035 ---- Animal proteins ---- 39S ribosomal protein L38, mitochondrial Source.659: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21 Source.660: DFBPPR21043 ---- Animal proteins ---- Modulator of macroautophagy TMEM150B Source.661: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.662: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43 Source.663: DFBPPR21090 ---- Animal proteins ---- Developmental pluripotency-associated protein 3 Source.664: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor Source.665: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7 Source.666: DFBPPR21173 ---- Animal proteins ---- Sorting nexin-11 Source.667: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3 Source.668: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2 Source.669: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4 Source.670: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial Source.671: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65 Source.672: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter Source.673: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog Source.674: DFBPPR21422 ---- Animal proteins ---- DNA polymerase alpha subunit B Source.675: DFBPPR21431 ---- Animal proteins ---- Non-structural maintenance of chromosomes element 4 homolog A Source.676: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform Source.677: DFBPPR21435 ---- Animal proteins ---- ETS-related transcription factor Elf-5 Source.678: DFBPPR21451 ---- Animal proteins ---- Nurim Source.679: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein Source.680: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2 Source.681: DFBPPR21554 ---- Animal proteins ---- Transcription factor 23 Source.682: DFBPPR21555 ---- Animal proteins ---- Zinc finger and SCAN domain-containing protein 26 Source.683: DFBPPR21594 ---- Animal proteins ---- SH3 domain-binding protein 5-like Source.684: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.685: DFBPPR21633 ---- Animal proteins ---- DNA fragmentation factor subunit beta Source.686: DFBPPR21653 ---- Animal proteins ---- Cytochrome P450 20A1 Source.687: DFBPPR21654 ---- Animal proteins ---- DET1- and DDB1-associated protein 1 Source.688: DFBPPR21673 ---- Animal proteins ---- U3 small nucleolar ribonucleoprotein protein IMP4 Source.689: DFBPPR21693 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 18 Source.690: DFBPPR21717 ---- Animal proteins ---- Transmembrane protein 134 Source.691: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2 Source.692: DFBPPR21740 ---- Animal proteins ---- 60S ribosomal protein L36 Source.693: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1 Source.694: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18 Source.695: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7 Source.696: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein Source.697: DFBPPR21863 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 3 Source.698: DFBPPR21928 ---- Animal proteins ---- Protein canopy homolog 4 Source.699: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2 Source.700: DFBPPR21942 ---- Animal proteins ---- Neurexophilin-1 Source.701: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein Source.702: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6 Source.703: DFBPPR21968 ---- Animal proteins ---- F-box only protein 28 Source.704: DFBPPR21970 ---- Animal proteins ---- Testis-specific Y-encoded-like protein 1 Source.705: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A Source.706: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14 Source.707: DFBPPR22018 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.708: DFBPPR22050 ---- Animal proteins ---- Protein lin-37 homolog Source.709: DFBPPR22058 ---- Animal proteins ---- Constitutive coactivator of peroxisome proliferator-activated receptor gamma Source.710: DFBPPR22061 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX16 homolog, mitochondrial Source.711: DFBPPR22132 ---- Animal proteins ---- 60S ribosomal protein L18a Source.712: DFBPPR22157 ---- Animal proteins ---- Protein BEX5 Source.713: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1 Source.714: DFBPPR22171 ---- Animal proteins ---- Leucine-rich repeat flightless-interacting protein 2 Source.715: DFBPPR22180 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 17 Source.716: DFBPPR22202 ---- Animal proteins ---- Protein FMC1 homolog Source.717: DFBPPR22212 ---- Animal proteins ---- Protein Asterix Source.718: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1 Source.719: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3 Source.720: DFBPPR22263 ---- Animal proteins ---- Protein C1orf43 homolog Source.721: DFBPPR22269 ---- Animal proteins ---- Protein preY, mitochondrial Source.722: DFBPPR22287 ---- Animal proteins ---- BAG family molecular chaperone regulator 5 Source.723: DFBPPR22306 ---- Animal proteins ---- p53 and DNA damage-regulated protein 1 Source.724: DFBPPR22327 ---- Animal proteins ---- Small integral membrane protein 7 Source.725: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168 Source.726: DFBPPR22367 ---- Animal proteins ---- 60S ribosomal protein L22-like 1 Source.727: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.728: DFBPPR22433 ---- Animal proteins ---- Transmembrane protein 186 Source.729: DFBPPR22454 ---- Animal proteins ---- R3H domain-containing protein 4 Source.730: DFBPPR22523 ---- Animal proteins ---- Leucine-rich repeat-containing protein 42 Source.731: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54 Source.732: DFBPPR22550 ---- Animal proteins ---- Leucine-rich repeat-containing protein 23 Source.733: DFBPPR22556 ---- Animal proteins ---- Protein maestro Source.734: DFBPPR22626 ---- Animal proteins ---- Transmembrane protein 253 Source.735: DFBPPR22649 ---- Animal proteins ---- IQ domain-containing protein F5 Source.736: DFBPPR22686 ---- Animal proteins ---- Vertnin Source.737: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11 Source.738: DFBPPR22750 ---- Animal proteins ---- Uncharacterized protein C4orf45 homolog Source.739: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.740: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.741: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.742: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha Source.743: DFBPPR8612 ---- Animal proteins ---- Peroxiredoxin-6 Source.744: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor Source.745: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.746: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9 Source.747: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.748: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI Source.749: DFBPPR8710 ---- Animal proteins ---- Leptin receptor Source.750: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.751: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.752: DFBPPR8785 ---- Animal proteins ---- 40S ribosomal protein S3 Source.753: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.754: DFBPPR8806 ---- Animal proteins ---- Cadherin-5 Source.755: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3 Source.756: DFBPPR8816 ---- Animal proteins ---- 40S ribosomal protein SA Source.757: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.758: DFBPPR8836 ---- Animal proteins ---- Myogenin Source.759: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2 Source.760: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.761: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1 Source.762: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.763: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.764: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.765: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.766: DFBPPR9091 ---- Animal proteins ---- Antileukoproteinase Source.767: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.768: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.769: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.770: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.771: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4 Source.772: DFBPPR9245 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.773: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29 Source.774: DFBPPR9269 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.775: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2 Source.776: DFBPPR9347 ---- Animal proteins ---- C-reactive protein Source.777: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.778: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4 Source.779: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase Source.780: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase Source.781: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase Source.782: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha Source.783: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.784: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.785: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.786: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.787: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.788: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2 Source.789: DFBPPR9570 ---- Animal proteins ---- Gastrokine-1 Source.790: DFBPPR9578 ---- Animal proteins ---- Biglycan Source.791: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.792: DFBPPR9601 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial Source.793: DFBPPR9613 ---- Animal proteins ---- Cathelin Source.794: DFBPPR9641 ---- Animal proteins ---- 60S ribosomal protein L22 Source.795: DFBPPR9644 ---- Animal proteins ---- Lambda-crystallin homolog Source.796: DFBPPR9658 ---- Animal proteins ---- Melanocortin receptor 5 Source.797: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.798: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.799: DFBPPR9808 ---- Animal proteins ---- Epidermal growth factor-like protein 8 Source.800: DFBPPR9839 ---- Animal proteins ---- Nurim Source.801: DFBPPR9911 ---- Animal proteins ---- Protein Asterix Source.802: DFBPPR9928 ---- Animal proteins ---- Galectin-2 Source.803: DFBPPR9948 ---- Animal proteins ---- Vertnin Source.804: DFBPPR9973 ---- Animal proteins ---- High mobility group protein B1 Source.805: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.806: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor Source.807: DFBPPR10026 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.808: DFBPPR10065 ---- Animal proteins ---- Bifunctional purine biosynthesis protein ATIC Source.809: DFBPPR10066 ---- Animal proteins ---- Peroxiredoxin-6 Source.810: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.811: DFBPPR10074 ---- Animal proteins ---- Lysocardiolipin acyltransferase 1 Source.812: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.813: DFBPPR10094 ---- Animal proteins ---- Proliferating cell nuclear antigen Source.814: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1 Source.815: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.816: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.817: DFBPPR10154 ---- Animal proteins ---- Glutathione S-transferase 2 Source.818: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.819: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1 Source.820: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.821: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.822: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1 Source.823: DFBPPR10187 ---- Animal proteins ---- Myogenin Source.824: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.825: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.826: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5 Source.827: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1 Source.828: DFBPPR10243 ---- Animal proteins ---- Core histone macro-H2A.1 Source.829: DFBPPR10261 ---- Animal proteins ---- Cadherin-13 Source.830: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.831: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.832: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.833: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase Source.834: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.835: DFBPPR10343 ---- Animal proteins ---- Cytochrome P450 2H1 Source.836: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.837: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.838: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase Source.839: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1 Source.840: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.841: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.842: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha Source.843: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.844: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.845: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5 Source.846: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.847: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2 Source.848: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.849: DFBPPR10486 ---- Animal proteins ---- Cytochrome P450 2H2 Source.850: DFBPPR10490 ---- Animal proteins ---- Tudor-interacting repair regulator protein Source.851: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4 Source.852: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.853: DFBPPR10503 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.854: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.855: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2 Source.856: DFBPPR10535 ---- Animal proteins ---- Protein SPT2 homolog Source.857: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.858: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.859: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B Source.860: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.861: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D Source.862: DFBPPR10617 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-6 Source.863: DFBPPR10619 ---- Animal proteins ---- Adenosine receptor A2b Source.864: DFBPPR10624 ---- Animal proteins ---- 40S ribosomal protein SA Source.865: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.866: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain Source.867: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.868: DFBPPR10649 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha Source.869: DFBPPR10660 ---- Animal proteins ---- Tsukushin Source.870: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.871: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9 Source.872: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha Source.873: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2 Source.874: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1 Source.875: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5 Source.876: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha Source.877: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1 Source.878: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10 Source.879: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.880: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1 Source.881: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase Source.882: DFBPPR10867 ---- Animal proteins ---- 7-methylguanosine phosphate-specific 5'-nucleotidase Source.883: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha' Source.884: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.885: DFBPPR10887 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.886: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149 Source.887: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.888: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A Source.889: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2 Source.890: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta Source.891: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C Source.892: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.893: DFBPPR11023 ---- Animal proteins ---- 43 kDa receptor-associated protein of the synapse Source.894: DFBPPR11025 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.895: DFBPPR11030 ---- Animal proteins ---- Protein C-ets-2 Source.896: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2 Source.897: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease Source.898: DFBPPR11069 ---- Animal proteins ---- Casein kinase I isoform gamma-1 Source.899: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.900: DFBPPR11134 ---- Animal proteins ---- Keratocan Source.901: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.902: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial Source.903: DFBPPR11173 ---- Animal proteins ---- Replication factor C subunit 2 Source.904: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1 Source.905: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1 Source.906: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2 Source.907: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1 Source.908: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.909: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2 Source.910: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF Source.911: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1 Source.912: DFBPPR11526 ---- Animal proteins ---- Fibromodulin Source.913: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial Source.914: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg Source.915: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.916: DFBPPR11596 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit E Source.917: DFBPPR11604 ---- Animal proteins ---- Centromere protein I Source.918: DFBPPR11634 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.919: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43 Source.920: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13 Source.921: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.922: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.923: DFBPPR11743 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1 Source.924: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.925: DFBPPR11786 ---- Animal proteins ---- Leucine-rich repeat protein SHOC-2 Source.926: DFBPPR11826 ---- Animal proteins ---- Protein mago nashi homolog Source.927: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase Source.928: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like Source.929: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog Source.930: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.931: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein Source.932: DFBPPR12036 ---- Animal proteins ---- BLOC-1-related complex subunit 5 Source.933: DFBPPR12041 ---- Animal proteins ---- Paladin Source.934: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7 Source.935: DFBPPR12086 ---- Animal proteins ---- DET1- and DDB1-associated protein 1 Source.936: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121 Source.937: DFBPPR12116 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.938: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.939: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein Source.940: DFBPPR12207 ---- Animal proteins ---- WD repeat, SAM and U-box domain-containing protein 1 Source.941: DFBPPR12209 ---- Animal proteins ---- 60S ribosomal protein L22 Source.942: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11 Source.943: DFBPPR12238 ---- Animal proteins ---- Programmed cell death protein 2-like Source.944: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.945: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2 Source.946: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.947: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.948: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5 Source.949: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1 Source.950: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1 Source.951: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor Source.952: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.953: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.954: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.955: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.956: DFBPPR12345 ---- Animal proteins ---- Prostaglandin-E(2) 9-reductase Source.957: DFBPPR12353 ---- Animal proteins ---- Cytochrome P450 2E1 Source.958: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5 Source.959: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.960: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.961: DFBPPR12406 ---- Animal proteins ---- Cytochrome P450 2B4 Source.962: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.963: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.964: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.965: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2 Source.966: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.967: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.968: DFBPPR12478 ---- Animal proteins ---- Protein phosphatase 1A Source.969: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.970: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha Source.971: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2 Source.972: DFBPPR12547 ---- Animal proteins ---- Cytochrome P450 2C2 Source.973: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.974: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan Source.975: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1 Source.976: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11 Source.977: DFBPPR12627 ---- Animal proteins ---- Morphine 6-dehydrogenase Source.978: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12 Source.979: DFBPPR12651 ---- Animal proteins ---- Cytochrome P450 2B5 Source.980: DFBPPR12661 ---- Animal proteins ---- Cytochrome P450 2C5 Source.981: DFBPPR12690 ---- Animal proteins ---- Cytochrome P450 2C4 Source.982: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1 Source.983: DFBPPR12719 ---- Animal proteins ---- Cytochrome P450 2C16 Source.984: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1 Source.985: DFBPPR12736 ---- Animal proteins ---- Cytochrome P450 2C1 Source.986: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14 Source.987: DFBPPR12751 ---- Animal proteins ---- Glutathione S-transferase Mu 1 Source.988: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.989: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6 Source.990: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.991: DFBPPR12833 ---- Animal proteins ---- Cullin-5 Source.992: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka Source.993: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.994: DFBPPR12913 ---- Animal proteins ---- 15 kDa protein A Source.995: DFBPPR12922 ---- Animal proteins ---- 15 kDa protein B Source.996: DFBPPR12954 ---- Animal proteins ---- Apolipoprotein B Source.997: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter Source.998: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein Source.999: DFBPPR13068 ---- Animal proteins ---- Biglycan Source.1000: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9 Source.1001: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.1002: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1003: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4 Source.1004: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha Source.1005: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.1006: DFBPPR13208 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23 Source.1007: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein Source.1008: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.1009: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a Source.1010: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial Source.1011: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.1012: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.1013: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.1014: DFBPPR13362 ---- Animal proteins ---- Biglycan Source.1015: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.1016: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase Source.1017: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9 Source.1018: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.1019: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1 Source.1020: DFBPPR13544 ---- Animal proteins ---- U8 snoRNA-decapping enzyme Source.1021: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1 Source.1022: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9 Source.1023: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.1024: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1025: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase Source.1026: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor Source.1027: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6 Source.1028: DFBPPR13660 ---- Animal proteins ---- 40S ribosomal protein SA Source.1029: DFBPPR13675 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.1030: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.1031: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase Source.1032: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form Source.1033: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9 Source.1034: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form Source.1035: DFBPPR13785 ---- Animal proteins ---- Bone morphogenetic protein 15 Source.1036: DFBPPR13828 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.1037: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A Source.1038: DFBPPR13834 ---- Animal proteins ---- Biglycan Source.1039: DFBPPR13863 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.1040: DFBPPR13892 ---- Animal proteins ---- Melanocortin receptor 5 Source.1041: DFBPPR13948 ---- Animal proteins ---- Calcium and integrin-binding family member 4 Source.1042: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase Source.1043: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.1044: DFBPPR14074 ---- Marine protein ---- Zona pellucida-like domain-containing protein 1 Source.1045: DFBPPR14091 ---- Marine protein ---- 40S ribosomal protein SA Source.1046: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B Source.1047: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C Source.1048: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A Source.1049: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3 Source.1050: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase Source.1051: DFBPPR14156 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit E Source.1052: DFBPPR14165 ---- Marine protein ---- Protein mago nashi homolog Source.1053: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2 Source.1054: DFBPPR14285 ---- Marine protein ---- C-phycocyanin beta chain Source.1055: DFBPPR14288 ---- Marine protein ---- Allophycocyanin beta chain Source.1056: DFBPPR14292 ---- Marine protein ---- Phosphomannomutase Source.1057: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE Source.1058: DFBPPR14304 ---- Marine protein ---- ATP synthase subunit a, chloroplastic Source.1059: DFBPPR14327 ---- Marine protein ---- Allophycocyanin beta chain Source.1060: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE Source.1061: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain Source.1062: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta Source.1063: DFBPPR14386 ---- Marine protein ---- R-phycoerythrin beta chain Source.1064: DFBPPR14399 ---- Marine protein ---- Allophycocyanin subunit beta-18 Source.1065: DFBPPR14407 ---- Marine protein ---- Allophycocyanin alpha-B chain Source.1066: DFBPPR14426 ---- Marine protein ---- Probable RuBisCO transcriptional regulator Source.1067: DFBPPR14446 ---- Marine protein ---- 50S ribosomal protein L20, chloroplastic Source.1068: DFBPPR14526 ---- Marine protein ---- Uncharacterized protein ycf91 Source.1069: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621 Source.1070: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1 Source.1071: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3 Source.1072: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor Source.1073: DFBPPR14592 ---- Marine protein ---- Intelectin Source.1074: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3 Source.1075: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I Source.1076: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II Source.1077: DFBPPR14711 ---- Marine protein ---- UI Source.1078: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme Source.1079: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.1080: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.1081: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1 Source.1082: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80 Source.1083: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.1084: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6 Source.1085: DFBPPR14905 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit CBF5 Source.1086: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10 Source.1087: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1 Source.1088: DFBPPR14935 ---- Microorganism protein ---- Actin Source.1089: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit Source.1090: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1 Source.1091: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.1092: DFBPPR14990 ---- Microorganism protein ---- Nuclear distribution protein PAC1 Source.1093: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.1094: DFBPPR15003 ---- Microorganism protein ---- FACT complex subunit SPT16 Source.1095: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1 Source.1096: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase Source.1097: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1 Source.1098: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1 Source.1099: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2 Source.1100: DFBPPR15055 ---- Microorganism protein ---- DNA damage-inducible protein 1 Source.1101: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2 Source.1102: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial Source.1103: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.1104: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial Source.1105: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.1106: DFBPPR15131 ---- Microorganism protein ---- tRNA (guanine(9)-N1)-methyltransferase Source.1107: DFBPPR15151 ---- Microorganism protein ---- 2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-phosphate reductase Source.1108: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3 Source.1109: DFBPPR15199 ---- Microorganism protein ---- mRNA-capping enzyme subunit alpha Source.1110: DFBPPR15236 ---- Microorganism protein ---- Protein PBN1 Source.1111: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase Source.1112: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1 Source.1113: DFBPPR15273 ---- Microorganism protein ---- 21S rRNA pseudouridine(2819) synthase Source.1114: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7 Source.1115: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1 Source.1116: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2 Source.1117: DFBPPR15295 ---- Microorganism protein ---- Galactose/lactose metabolism regulatory protein GAL80 Source.1118: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1 Source.1119: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3 Source.1120: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog Source.1121: DFBPPR15343 ---- Microorganism protein ---- Protein BIG1 Source.1122: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2 Source.1123: DFBPPR15373 ---- Microorganism protein ---- Protoheme IX farnesyltransferase, mitochondrial Source.1124: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme Source.1125: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1 Source.1126: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2 Source.1127: DFBPPR15440 ---- Microorganism protein ---- Mitochondrial homologous recombination protein 1 Source.1128: DFBPPR15458 ---- Microorganism protein ---- Mitochondrial glycine transporter Source.1129: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6 Source.1130: DFBPPR15463 ---- Microorganism protein ---- Protein LST4 Source.1131: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3 Source.1132: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10 Source.1133: DFBPPR15496 ---- Microorganism protein ---- Cell division cycle protein 123 Source.1134: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1 Source.1135: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.1136: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1 Source.1137: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1 Source.1138: DFBPPR15589 ---- Microorganism protein ---- Spindle pole body component KRE28 Source.1139: DFBPPR15609 ---- Microorganism protein ---- Shugoshin Source.1140: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13 Source.1141: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2 Source.1142: DFBPPR15641 ---- Microorganism protein ---- Ribosomal lysine N-methyltransferase 5 Source.1143: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial Source.1144: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1 Source.1145: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2 Source.1146: DFBPPR15741 ---- Microorganism protein ---- Increased recombination centers protein 19 Source.1147: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5 Source.1148: DFBPPR15771 ---- Microorganism protein ---- Required for respiratory growth protein 1, mitochondrial Source.1149: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3 Source.1150: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3 Source.1151: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.1152: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g Source.1153: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase Source.1154: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2 Source.1155: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4 Source.1156: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1 Source.1157: DFBPPR15856 ---- Microorganism protein ---- Laccase-2 Source.1158: DFBPPR15857 ---- Microorganism protein ---- Laccase-1 Source.1159: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.1160: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.1161: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.1162: DFBPPR7837 ---- Plant protein ---- 30S ribosomal protein S4, chloroplastic Source.1163: DFBPPR7900 ---- Plant protein ---- Defensin-like protein 1 Source.1164: DFBPPR7918 ---- Plant protein ---- CASP-like protein 1U1 Source.1165: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.1166: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase Source.1167: DFBPPR7935 ---- Plant protein ---- Cytochrome b Source.1168: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.1169: DFBPPR7947 ---- Plant protein ---- Legumin type B Source.1170: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase Source.1171: DFBPPR7956 ---- Plant protein ---- Legumin type B Source.1172: DFBPPR7957 ---- Plant protein ---- Legumin type B Source.1173: DFBPPR7958 ---- Plant protein ---- Legumin type B Source.1174: DFBPPR7973 ---- Plant protein ---- Maturase K Source.1175: DFBPPR7977 ---- Plant protein ---- Ribosomal protein S14, mitochondrial Source.1176: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase Source.1177: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase Source.1178: DFBPPR8135 ---- Plant protein ---- 30S ribosomal protein S8, chloroplastic Source.1179: DFBPPR8144 ---- Plant protein ---- Maturase K Source.1180: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.1181: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase Source.1182: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.1183: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.1184: DFBPPR8304 ---- Plant protein ---- Protein TIC 214 Source.1185: DFBPPR8314 ---- Plant protein ---- Maturase K
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

ACE-inhibitory activity	The peptide exhibited very strong Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC₅₀ value of 0.044 uM.
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	Dulse proteins were hydrolyzed with thermolysin.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

N.D

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Furuta T, Miyabe Y, Yasui H, Kinoshita Y, Kishimura H. Angiotensin I Converting Enzyme Inhibitory Peptides Derived from Phycobiliproteins of Dulse Palmaria palmata. Mar Drugs. 2016 Feb 4;14(2):32. PMID: 26861357 DOI: 10.3390/md14020032
Other literature(s)	N.D
PubDate	2016