Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPACEI1781(ACE-inhibitory peptide)

DFBP ID	DFBPACEI1781
Peptide sequence	MM
Type	Native peptide
Peptide/Function name	ACE-inhibitory peptide

Function-activity relationship

Main bioactivity	ACE-inhibitory activity
Otheir bioactivity	Antioxidative activity ^[D1], DPP IV-inhibitory activity ^[D2], Multifunctional activity ^[D3]

Calculated physicochemical properties

Three-letter amino acid

Met-Met

Single-letter amino acid

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	280.40 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.97 ^c

IC₅₀

547.5 ± 51.3 μM

pIC₅₀

-2.738

GRAVY

1.9000^c

Hydrophilic residue ratio

100%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Poultry, Chicken
Precursor protein	α-Actin
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein Source.2: DFBPPR0776 ---- Plant proteins ---- 11S globulin Source.3: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1 Source.4: DFBPPR0820 ---- Plant proteins ---- bZIP transcription factor RISBZ5 Source.5: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2 Source.6: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8 Source.7: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6 Source.8: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1 Source.9: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic Source.10: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.11: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7 Source.12: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13 Source.13: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1 Source.14: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a Source.15: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5 Source.16: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic Source.17: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.18: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase Source.19: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q Source.20: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16 Source.21: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.22: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1 Source.23: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6 Source.24: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1 Source.25: DFBPPR0897 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-11 Source.26: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.27: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.28: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2 Source.29: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog Source.30: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5 Source.31: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.32: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1 Source.33: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.34: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2 Source.35: DFBPPR0931 ---- Plant proteins ---- Ornithine aminotransferase, mitochondrial Source.36: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic Source.37: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.38: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1 Source.39: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.40: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1 Source.41: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.42: DFBPPR0960 ---- Plant proteins ---- Peroxisomal fatty acid beta-oxidation multifunctional protein Source.43: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase Source.44: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1 Source.45: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.46: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.47: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2 Source.48: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70 Source.49: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1 Source.50: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2 Source.51: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21 Source.52: DFBPPR1001 ---- Plant proteins ---- GRF-interacting factor 1 Source.53: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23 Source.54: DFBPPR1006 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 4 [UDP-forming] Source.55: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75 Source.56: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic Source.57: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.58: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2 Source.59: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12 Source.60: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type Source.61: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A Source.62: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.63: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase Source.64: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2 Source.65: DFBPPR1051 ---- Plant proteins ---- MADS-box transcription factor 14 Source.66: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56 Source.67: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12 Source.68: DFBPPR1062 ---- Plant proteins ---- Transcription factor LAX PANICLE 1 Source.69: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6 Source.70: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c Source.71: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1 Source.72: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1 Source.73: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic Source.74: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING Source.75: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24 Source.76: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5 Source.77: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1 Source.78: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.79: DFBPPR1087 ---- Plant proteins ---- Protein TPR1 Source.80: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2 Source.81: DFBPPR1090 ---- Plant proteins ---- Probable transcription factor FL Source.82: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2 Source.83: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.84: DFBPPR1103 ---- Plant proteins ---- Villin-2 Source.85: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3 Source.86: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.87: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform Source.88: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic Source.89: DFBPPR1134 ---- Plant proteins ---- Ethylene-responsive transcription factor FZP Source.90: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13 Source.91: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3 Source.92: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial Source.93: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19 Source.94: DFBPPR1157 ---- Plant proteins ---- MADS-box transcription factor 17 Source.95: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2 Source.96: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.97: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23 Source.98: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic Source.99: DFBPPR1173 ---- Plant proteins ---- Shikimate kinase 3, chloroplastic Source.100: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20 Source.101: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3 Source.102: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.103: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.104: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1 Source.105: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase Source.106: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM Source.107: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic Source.108: DFBPPR1222 ---- Plant proteins ---- Protein CYTOKININ-RESPONSIVE GATA TRANSCRIPTION FACTOR 1 Source.109: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3 Source.110: DFBPPR1244 ---- Plant proteins ---- MADS-box transcription factor 58 Source.111: DFBPPR1246 ---- Plant proteins ---- Probable protein phosphatase 2C member 13, mitochondrial Source.112: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15 Source.113: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28 Source.114: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15 Source.115: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3 Source.116: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27 Source.117: DFBPPR1259 ---- Plant proteins ---- Beta-carotene isomerase D27, chloroplastic Source.118: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.119: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog Source.120: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog Source.121: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.122: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.123: DFBPPR1272 ---- Plant proteins ---- MADS-box transcription factor 15 Source.124: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.125: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.126: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5 Source.127: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5 Source.128: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B Source.129: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.130: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B Source.131: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8 Source.132: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.133: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22 Source.134: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17 Source.135: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16 Source.136: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11 Source.137: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.138: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain Source.139: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.140: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain Source.141: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1 Source.142: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14 Source.143: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.144: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.145: DFBPPR1365 ---- Plant proteins ---- Replication protein A 32 kDa subunit A Source.146: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.147: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6 Source.148: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog Source.149: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.150: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2 Source.151: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic Source.152: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3 Source.153: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase Source.154: DFBPPR1397 ---- Plant proteins ---- Calcium-dependent protein kinase 29 Source.155: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1 Source.156: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.157: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.158: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic Source.159: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2 Source.160: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.161: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1 Source.162: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23 Source.163: DFBPPR1411 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-2 Source.164: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.165: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C Source.166: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.167: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14 Source.168: DFBPPR1425 ---- Plant proteins ---- Transcription factor BHLH156 Source.169: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4 Source.170: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain Source.171: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29 Source.172: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.173: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1 Source.174: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37 Source.175: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b Source.176: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8 Source.177: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.178: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming] Source.179: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase Source.180: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming] Source.181: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming] Source.182: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2 Source.183: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1 Source.184: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic Source.185: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9 Source.186: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic Source.187: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.188: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5 Source.189: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.190: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4 Source.191: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.192: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d Source.193: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.194: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic Source.195: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1 Source.196: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.197: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.198: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53 Source.199: DFBPPR1538 ---- Plant proteins ---- Heat stress transcription factor A-2e Source.200: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1 Source.201: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1 Source.202: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.203: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial Source.204: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148 Source.205: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase Source.206: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2 Source.207: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.208: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain Source.209: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15 Source.210: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1 Source.211: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2 Source.212: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9 Source.213: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2 Source.214: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4 Source.215: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic Source.216: DFBPPR1586 ---- Plant proteins ---- E3 ubiquitin-protein ligase GW2 Source.217: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase Source.218: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b Source.219: DFBPPR1593 ---- Plant proteins ---- WUSCHEL-related homeobox 11 Source.220: DFBPPR1596 ---- Plant proteins ---- Photosystem II 22 kDa protein 2, chloroplastic Source.221: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.222: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase Source.223: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic Source.224: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3 Source.225: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.226: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic Source.227: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic Source.228: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.229: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4 Source.230: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.231: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1 Source.232: DFBPPR1636 ---- Plant proteins ---- Mitogen-activated protein kinase 2 Source.233: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.234: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic Source.235: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain Source.236: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial Source.237: DFBPPR1647 ---- Plant proteins ---- Rac-like GTP-binding protein 3 Source.238: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic Source.239: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain Source.240: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein Source.241: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic Source.242: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.243: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1 Source.244: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b Source.245: DFBPPR1671 ---- Plant proteins ---- MADS-box transcription factor 4 Source.246: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.247: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase Source.248: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.249: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.250: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21 Source.251: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG Source.252: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4 Source.253: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming] Source.254: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2 Source.255: DFBPPR1700 ---- Plant proteins ---- Probable monofunctional riboflavin biosynthesis protein RIBA 3, chloroplastic Source.256: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1 Source.257: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase Source.258: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28 Source.259: DFBPPR1723 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.260: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2 Source.261: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54 Source.262: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4 Source.263: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase Source.264: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.265: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2 Source.266: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1 Source.267: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1 Source.268: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic Source.269: DFBPPR1753 ---- Plant proteins ---- Protein TPR3 Source.270: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic Source.271: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic Source.272: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain Source.273: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.274: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2 Source.275: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.276: DFBPPR1773 ---- Plant proteins ---- Ubiquinol oxidase 1c, mitochondrial Source.277: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1 Source.278: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase Source.279: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic Source.280: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1 Source.281: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3 Source.282: DFBPPR1806 ---- Plant proteins ---- Laccase-19 Source.283: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2 Source.284: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a Source.285: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1 Source.286: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase Source.287: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3 Source.288: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type Source.289: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic Source.290: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b Source.291: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c Source.292: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6 Source.293: DFBPPR1875 ---- Plant proteins ---- Protein PHOSPHATE STARVATION RESPONSE 2 Source.294: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8 Source.295: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11 Source.296: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1 Source.297: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1 Source.298: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha Source.299: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4 Source.300: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2 Source.301: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic Source.302: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8 Source.303: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.304: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.305: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase Source.306: DFBPPR1942 ---- Plant proteins ---- Transcription factor CSA Source.307: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase Source.308: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type Source.309: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.310: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.311: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.312: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial Source.313: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2 Source.314: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1 Source.315: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5 Source.316: DFBPPR1975 ---- Plant proteins ---- Non-specific lipid-transfer protein 2 Source.317: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A Source.318: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4 Source.319: DFBPPR1991 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase catalytic chain, chloroplastic Source.320: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.321: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase Source.322: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase Source.323: DFBPPR2011 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.324: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1 Source.325: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic Source.326: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain Source.327: DFBPPR2022 ---- Plant proteins ---- S-adenosylmethionine synthase 2 Source.328: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.329: DFBPPR2028 ---- Plant proteins ---- Laccase-7 Source.330: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3 Source.331: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B Source.332: DFBPPR2037 ---- Plant proteins ---- Laccase-10 Source.333: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.334: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19 Source.335: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15 Source.336: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.337: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3 Source.338: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2 Source.339: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2 Source.340: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa Source.341: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7 Source.342: DFBPPR2070 ---- Plant proteins ---- Calmodulin-1 Source.343: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11 Source.344: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.345: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.346: DFBPPR2076 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-2 Source.347: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c Source.348: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10 Source.349: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain Source.350: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 Source.351: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2 Source.352: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.353: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1 Source.354: DFBPPR2123 ---- Plant proteins ---- Ninja-family protein MODD Source.355: DFBPPR2124 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 1, mitochondrial Source.356: DFBPPR2125 ---- Plant proteins ---- Protein YABBY 5 Source.357: DFBPPR2129 ---- Plant proteins ---- Kinesin-like protein KIN-5C Source.358: DFBPPR2130 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.359: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain Source.360: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3 Source.361: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic Source.362: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic Source.363: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.364: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial Source.365: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1 Source.366: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11 Source.367: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7 Source.368: DFBPPR2163 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic Source.369: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.370: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2 Source.371: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3 Source.372: DFBPPR2173 ---- Plant proteins ---- Cullin-1 Source.373: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.374: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase Source.375: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1 Source.376: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B Source.377: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2 Source.378: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase Source.379: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.380: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1 Source.381: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5 Source.382: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2 Source.383: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37 Source.384: DFBPPR2207 ---- Plant proteins ---- Mitogen-activated protein kinase 16 Source.385: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.386: DFBPPR2223 ---- Plant proteins ---- Urease Source.387: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9 Source.388: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.389: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5 Source.390: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain Source.391: DFBPPR2234 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX6 Source.392: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12 Source.393: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.394: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3 Source.395: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.396: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase Source.397: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11 Source.398: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1 Source.399: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1 Source.400: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.401: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog Source.402: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3 Source.403: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase Source.404: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type Source.405: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic Source.406: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3 Source.407: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS Source.408: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3 Source.409: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B Source.410: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic Source.411: DFBPPR2305 ---- Plant proteins ---- Actin-depolymerizing factor 4 Source.412: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1 Source.413: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5 Source.414: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.415: DFBPPR2319 ---- Plant proteins ---- Thioredoxin M2, chloroplastic Source.416: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3 Source.417: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic Source.418: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26 Source.419: DFBPPR2331 ---- Plant proteins ---- Protein TIFY 6b Source.420: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2 Source.421: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2 Source.422: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1 Source.423: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.424: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5 Source.425: DFBPPR2359 ---- Plant proteins ---- Probable ion channel CASTOR Source.426: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5 Source.427: DFBPPR2368 ---- Plant proteins ---- Thioredoxin M1, chloroplastic Source.428: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein Source.429: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3 Source.430: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial Source.431: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic Source.432: DFBPPR2397 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2A Source.433: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6 Source.434: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22 Source.435: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.436: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1 Source.437: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6 Source.438: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7 Source.439: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2 Source.440: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4 Source.441: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28 Source.442: DFBPPR2419 ---- Plant proteins ---- U-box domain-containing protein 73 Source.443: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase Source.444: DFBPPR2430 ---- Plant proteins ---- Vacuolar cation/proton exchanger 3 Source.445: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic Source.446: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6 Source.447: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic Source.448: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4 Source.449: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25 Source.450: DFBPPR2466 ---- Plant proteins ---- MADS-box transcription factor 26 Source.451: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase Source.452: DFBPPR2477 ---- Plant proteins ---- Inorganic phosphate transporter 1-2 Source.453: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14 Source.454: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1 Source.455: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 Source.456: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1 Source.457: DFBPPR2494 ---- Plant proteins ---- Homeobox protein knotted-1-like 3 Source.458: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.459: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A Source.460: DFBPPR2510 ---- Plant proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.461: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase Source.462: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21 Source.463: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1 Source.464: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.465: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1 Source.466: DFBPPR2551 ---- Plant proteins ---- Pyruvate decarboxylase 2 Source.467: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.468: DFBPPR2564 ---- Plant proteins ---- Pyruvate decarboxylase 3 Source.469: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog Source.470: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase Source.471: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1 Source.472: DFBPPR2601 ---- Plant proteins ---- Clathrin light chain 1 Source.473: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.474: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15 Source.475: DFBPPR2610 ---- Plant proteins ---- Aquaporin NIP2-2 Source.476: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1 Source.477: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3 Source.478: DFBPPR2627 ---- Plant proteins ---- Long chain base biosynthesis protein 2a Source.479: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.480: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18 Source.481: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2 Source.482: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8 Source.483: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1 Source.484: DFBPPR2655 ---- Plant proteins ---- Probable N-acetyl-gamma-glutamyl-phosphate reductase, chloroplastic Source.485: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1 Source.486: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b Source.487: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3 Source.488: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic Source.489: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H Source.490: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b Source.491: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2 Source.492: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1 Source.493: DFBPPR2717 ---- Plant proteins ---- DnaJ protein P58IPK homolog A Source.494: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.495: DFBPPR2729 ---- Plant proteins ---- Protein BZR1 homolog 2 Source.496: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5 Source.497: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.498: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.499: DFBPPR2737 ---- Plant proteins ---- Putative beta-glucosidase 9 Source.500: DFBPPR2742 ---- Plant proteins ---- Uncharacterized protein Os08g0359500 Source.501: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.502: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3 Source.503: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10 Source.504: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700 Source.505: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3 Source.506: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic Source.507: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9 Source.508: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.509: DFBPPR2793 ---- Plant proteins ---- MADS-box transcription factor 33 Source.510: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6 Source.511: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.512: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like Source.513: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10 Source.514: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.515: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.516: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A Source.517: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.518: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4 Source.519: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B Source.520: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.521: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2 Source.522: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.523: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.524: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4 Source.525: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D Source.526: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.527: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9 Source.528: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.529: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2 Source.530: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2 Source.531: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.532: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.533: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A Source.534: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2 Source.535: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1 Source.536: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c Source.537: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic Source.538: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2 Source.539: DFBPPR2908 ---- Plant proteins ---- Auxin-responsive protein IAA8 Source.540: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d Source.541: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b Source.542: DFBPPR2917 ---- Plant proteins ---- Two-component response regulator ORR28 Source.543: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.544: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3 Source.545: DFBPPR2922 ---- Plant proteins ---- Probable glycosyltransferase 2 Source.546: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1 Source.547: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14 Source.548: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1 Source.549: DFBPPR2951 ---- Plant proteins ---- MADS-box transcription factor 23 Source.550: DFBPPR2961 ---- Plant proteins ---- Probable serine acetyltransferase 2 Source.551: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14 Source.552: DFBPPR2974 ---- Plant proteins ---- Derlin-1 Source.553: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.554: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic Source.555: DFBPPR2996 ---- Plant proteins ---- Transcription factor PCF1 Source.556: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L Source.557: DFBPPR3019 ---- Plant proteins ---- Long chain base biosynthesis protein 2c Source.558: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1 Source.559: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17 Source.560: DFBPPR3057 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL6 Source.561: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9 Source.562: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.563: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.564: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.565: DFBPPR3078 ---- Plant proteins ---- Transcription factor TGAL3 Source.566: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3 Source.567: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.568: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7 Source.569: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13 Source.570: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.571: DFBPPR3098 ---- Plant proteins ---- GTPase ERA-like, chloroplastic Source.572: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12 Source.573: DFBPPR3106 ---- Plant proteins ---- Protein HIRA Source.574: DFBPPR3118 ---- Plant proteins ---- DNA polymerase delta small subunit Source.575: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.576: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.577: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1 Source.578: DFBPPR3138 ---- Plant proteins ---- Villin-1 Source.579: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic Source.580: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51 Source.581: DFBPPR3145 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.2 Source.582: DFBPPR3146 ---- Plant proteins ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1.1 Source.583: DFBPPR3148 ---- Plant proteins ---- Growth-regulating factor 8 Source.584: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3 Source.585: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic Source.586: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11 Source.587: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20 Source.588: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.589: DFBPPR3175 ---- Plant proteins ---- Kinesin-like protein KIN-7I Source.590: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700 Source.591: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.592: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10 Source.593: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27 Source.594: DFBPPR3190 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX17 Source.595: DFBPPR3192 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.596: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1 Source.597: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2 Source.598: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15 Source.599: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.600: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750 Source.601: DFBPPR3222 ---- Plant proteins ---- Germin-like protein 9-1 Source.602: DFBPPR3225 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit M, chloroplastic Source.603: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.604: DFBPPR3232 ---- Plant proteins ---- Expansin-A28 Source.605: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1 Source.606: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2 Source.607: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.608: DFBPPR3241 ---- Plant proteins ---- Elongation factor 1-delta 2 Source.609: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4 Source.610: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70 Source.611: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3 Source.612: DFBPPR3270 ---- Plant proteins ---- Calmodulin-like protein 1 Source.613: DFBPPR3288 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 2 Source.614: DFBPPR3316 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 7 Source.615: DFBPPR3326 ---- Plant proteins ---- Thioredoxin H2-1 Source.616: DFBPPR3332 ---- Plant proteins ---- Vacuolar iron transporter homolog 5 Source.617: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12 Source.618: DFBPPR3338 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1a Source.619: DFBPPR3339 ---- Plant proteins ---- Bidirectional sugar transporter SWEET2a Source.620: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.621: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4 Source.622: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase Source.623: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1 Source.624: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.625: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2 Source.626: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38 Source.627: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.628: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1 Source.629: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6 Source.630: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2 Source.631: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7 Source.632: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7 Source.633: DFBPPR3398 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1 Source.634: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4 Source.635: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.636: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2 Source.637: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1 Source.638: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15 Source.639: DFBPPR3421 ---- Plant proteins ---- Cyanate hydratase Source.640: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.641: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.642: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2 Source.643: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1 Source.644: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.645: DFBPPR3443 ---- Plant proteins ---- Calmodulin-2 Source.646: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.647: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic Source.648: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6 Source.649: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73 Source.650: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68 Source.651: DFBPPR3478 ---- Plant proteins ---- GATA transcription factor 17 Source.652: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4 Source.653: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13 Source.654: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic Source.655: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N Source.656: DFBPPR3527 ---- Plant proteins ---- Elongation factor 1-delta 1 Source.657: DFBPPR3528 ---- Plant proteins ---- Zinc transporter 2 Source.658: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3 Source.659: DFBPPR3546 ---- Plant proteins ---- Growth-regulating factor 3 Source.660: DFBPPR3552 ---- Plant proteins ---- Auxin-responsive protein IAA4 Source.661: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8 Source.662: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61 Source.663: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600 Source.664: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B'' Source.665: DFBPPR3569 ---- Plant proteins ---- Probable protein phosphatase 2C 58 Source.666: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8 Source.667: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.668: DFBPPR3575 ---- Plant proteins ---- Kinesin-like protein KIN-10B Source.669: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.670: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2 Source.671: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.672: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3 Source.673: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11 Source.674: DFBPPR3601 ---- Plant proteins ---- Growth-regulating factor 1 Source.675: DFBPPR3606 ---- Plant proteins ---- COBRA-like protein 7 Source.676: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6 Source.677: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3 Source.678: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6 Source.679: DFBPPR3623 ---- Plant proteins ---- Kinesin-like protein KIN-14K Source.680: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.681: DFBPPR3639 ---- Plant proteins ---- Calmodulin-3 Source.682: DFBPPR3641 ---- Plant proteins ---- Protein G1-like1 Source.683: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic Source.684: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic Source.685: DFBPPR3660 ---- Plant proteins ---- Calcineurin B-like protein 5 Source.686: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41 Source.687: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3 Source.688: DFBPPR3674 ---- Plant proteins ---- Putative calmodulin-like protein 2 Source.689: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5 Source.690: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14 Source.691: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8 Source.692: DFBPPR3705 ---- Plant proteins ---- Protein YABBY 2 Source.693: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G Source.694: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7 Source.695: DFBPPR3728 ---- Plant proteins ---- 10 kDa prolamin Source.696: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.697: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24 Source.698: DFBPPR3742 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.699: DFBPPR3755 ---- Plant proteins ---- Putative vacuolar cation/proton exchanger 4 Source.700: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1 Source.701: DFBPPR3765 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 1 Source.702: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.703: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G Source.704: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6 Source.705: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D Source.706: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3 Source.707: DFBPPR3794 ---- Plant proteins ---- UDP-D-apiose/UDP-D-xylose synthase Source.708: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1 Source.709: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.710: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic Source.711: DFBPPR3812 ---- Plant proteins ---- Growth-regulating factor 2 Source.712: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.713: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22 Source.714: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.715: DFBPPR3840 ---- Plant proteins ---- Growth-regulating factor 7 Source.716: DFBPPR3842 ---- Plant proteins ---- Probable protein phosphatase 2C 39 Source.717: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic Source.718: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46 Source.719: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5 Source.720: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23 Source.721: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic Source.722: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.723: DFBPPR3880 ---- Plant proteins ---- Monothiol glutaredoxin-S2 Source.724: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26 Source.725: DFBPPR3895 ---- Plant proteins ---- COBRA-like protein 2 Source.726: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13 Source.727: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4 Source.728: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2 Source.729: DFBPPR3914 ---- Plant proteins ---- Derlin-2 Source.730: DFBPPR3920 ---- Plant proteins ---- Glutaredoxin-C9 Source.731: DFBPPR3923 ---- Plant proteins ---- Protein PHOTOSYSTEM I ASSEMBLY 2, chloroplastic Source.732: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17 Source.733: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5 Source.734: DFBPPR3934 ---- Plant proteins ---- Probable calcium-binding protein CML8 Source.735: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.736: DFBPPR3938 ---- Plant proteins ---- Calmodulin-like protein 3 Source.737: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3 Source.738: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic Source.739: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16 Source.740: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9 Source.741: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12 Source.742: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2 Source.743: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7 Source.744: DFBPPR3983 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.2 Source.745: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.746: DFBPPR3992 ---- Plant proteins ---- Probable uridine nucleosidase 2 Source.747: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J Source.748: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18 Source.749: DFBPPR4002 ---- Plant proteins ---- Protein G1-like6 Source.750: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12 Source.751: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6 Source.752: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3 Source.753: DFBPPR4030 ---- Plant proteins ---- Cytochrome b5 Source.754: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8 Source.755: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3 Source.756: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9 Source.757: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6 Source.758: DFBPPR4049 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1C Source.759: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.760: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.761: DFBPPR4058 ---- Plant proteins ---- Probable protein phosphatase 2C 11 Source.762: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic Source.763: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F Source.764: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D Source.765: DFBPPR4074 ---- Plant proteins ---- PHD finger protein ALFIN-LIKE 4 Source.766: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4 Source.767: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900 Source.768: DFBPPR4102 ---- Plant proteins ---- Cyclase-like protein 3 Source.769: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2 Source.770: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2 Source.771: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C Source.772: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74 Source.773: DFBPPR4124 ---- Plant proteins ---- Ras-related protein RGP2 Source.774: DFBPPR4125 ---- Plant proteins ---- Calmodulin-like protein 4 Source.775: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95 Source.776: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22 Source.777: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16 Source.778: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6 Source.779: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2 Source.780: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.781: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.782: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.783: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1 Source.784: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3 Source.785: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10 Source.786: DFBPPR4163 ---- Plant proteins ---- Barley B recombinant-like protein A Source.787: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1 Source.788: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5 Source.789: DFBPPR4180 ---- Plant proteins ---- Barley B recombinant-like protein B Source.790: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic Source.791: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18 Source.792: DFBPPR4187 ---- Plant proteins ---- Barley B recombinant-like protein C Source.793: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7 Source.794: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22 Source.795: DFBPPR4196 ---- Plant proteins ---- Cyclin-D5-3 Source.796: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24 Source.797: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial Source.798: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26 Source.799: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2 Source.800: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic Source.801: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22 Source.802: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A Source.803: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1 Source.804: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14 Source.805: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10 Source.806: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE Source.807: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4 Source.808: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.809: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11 Source.810: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900 Source.811: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600 Source.812: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13 Source.813: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1 Source.814: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6 Source.815: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3 Source.816: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1 Source.817: DFBPPR4277 ---- Plant proteins ---- Acyl transferase 15 Source.818: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4 Source.819: DFBPPR4288 ---- Plant proteins ---- Probable calcium-binding protein CML20 Source.820: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5 Source.821: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28 Source.822: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase Source.823: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.824: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic Source.825: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1 Source.826: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2 Source.827: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic Source.828: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2 Source.829: DFBPPR4366 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 12 Source.830: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1 Source.831: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.832: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10 Source.833: DFBPPR4376 ---- Plant proteins ---- Probable calcium-binding protein CML13 Source.834: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6 Source.835: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2 Source.836: DFBPPR4393 ---- Plant proteins ---- Late embryogenesis abundant protein 14 Source.837: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31 Source.838: DFBPPR4400 ---- Plant proteins ---- Putative calmodulin-like protein 6 Source.839: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32 Source.840: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8 Source.841: DFBPPR4407 ---- Plant proteins ---- Mini zinc finger protein 4 Source.842: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53 Source.843: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2 Source.844: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.845: DFBPPR4421 ---- Plant proteins ---- Photosystem I reaction center subunit VIII Source.846: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.847: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.848: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.849: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11 Source.850: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18 Source.851: DFBPPR4439 ---- Plant proteins ---- Copper transporter 5.1 Source.852: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic Source.853: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B Source.854: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.855: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45 Source.856: DFBPPR4457 ---- Plant proteins ---- Probable calcium-binding protein CML28 Source.857: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.858: DFBPPR4461 ---- Plant proteins ---- Probable calcium-binding protein CML18 Source.859: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3 Source.860: DFBPPR4463 ---- Plant proteins ---- Probable calcium-binding protein CML17 Source.861: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2 Source.862: DFBPPR4474 ---- Plant proteins ---- Probable calcium-binding protein CML16 Source.863: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24 Source.864: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.865: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1 Source.866: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.867: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.868: DFBPPR4482 ---- Plant proteins ---- Probable calcium-binding protein CML30 Source.869: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12 Source.870: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4 Source.871: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2 Source.872: DFBPPR4495 ---- Plant proteins ---- Zinc finger protein STOP1 homolog Source.873: DFBPPR4507 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1 homolog, chloroplastic Source.874: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic Source.875: DFBPPR4518 ---- Plant proteins ---- Probable calcium-binding protein CML14 Source.876: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33 Source.877: DFBPPR4522 ---- Plant proteins ---- Probable calcium-binding protein CML25/26 Source.878: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14 Source.879: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic Source.880: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.881: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.882: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27 Source.883: DFBPPR4547 ---- Plant proteins ---- Probable calcium-binding protein CML31 Source.884: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog Source.885: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3 Source.886: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23 Source.887: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.888: DFBPPR4562 ---- Plant proteins ---- Mini zinc finger protein 2 Source.889: DFBPPR4566 ---- Plant proteins ---- CASP-like protein 5C1 Source.890: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3 Source.891: DFBPPR4577 ---- Plant proteins ---- Probable calcium-binding protein CML10 Source.892: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.893: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32 Source.894: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200 Source.895: DFBPPR4582 ---- Plant proteins ---- Probable calcium-binding protein CML12 Source.896: DFBPPR4583 ---- Plant proteins ---- Probable calcium-binding protein CML15 Source.897: DFBPPR4589 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.898: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5 Source.899: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21 Source.900: DFBPPR4596 ---- Plant proteins ---- Putative calcium-binding protein CML19 Source.901: DFBPPR4597 ---- Plant proteins ---- Putative calcium-binding protein CML23 Source.902: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520 Source.903: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D Source.904: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.905: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900 Source.906: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7 Source.907: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B Source.908: DFBPPR4662 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor SMR1 Source.909: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24 Source.910: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3 Source.911: DFBPPR4672 ---- Plant proteins ---- Ninja-family protein Os03g0419100 Source.912: DFBPPR4676 ---- Plant proteins ---- PP2A regulatory subunit TAP46 Source.913: DFBPPR4680 ---- Plant proteins ---- Dehydrin Rab16B Source.914: DFBPPR4686 ---- Plant proteins ---- Dehydrin Rab16C Source.915: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2 Source.916: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17 Source.917: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5 Source.918: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5 Source.919: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8 Source.920: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700 Source.921: DFBPPR4729 ---- Plant proteins ---- Protein PLASTID REDOX INSENSITIVE 2, chloroplastic Source.922: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5 Source.923: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700 Source.924: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.925: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2 Source.926: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30 Source.927: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18 Source.928: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35 Source.929: DFBPPR4769 ---- Plant proteins ---- Putative 14-3-3-like protein GF14-H Source.930: DFBPPR4774 ---- Plant proteins ---- B3 domain-containing protein Os01g0234100 Source.931: DFBPPR4789 ---- Plant proteins ---- B3 domain-containing protein Os11g0197600 Source.932: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900 Source.933: DFBPPR4819 ---- Plant proteins ---- B3 domain-containing protein Os08g0324300 Source.934: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a Source.935: DFBPPR4837 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 5 Source.936: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2 Source.937: DFBPPR4848 ---- Plant proteins ---- B3 domain-containing protein Os02g0455800 Source.938: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400 Source.939: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080 Source.940: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500 Source.941: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400 Source.942: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37 Source.943: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog Source.944: DFBPPR4866 ---- Plant proteins ---- Putative B3 domain-containing protein Os02g0455900 Source.945: DFBPPR4867 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 42 Source.946: DFBPPR4868 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0325100 Source.947: DFBPPR4875 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 64 Source.948: DFBPPR4878 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 10 Source.949: DFBPPR4887 ---- Plant proteins ---- Protein RICE SALT SENSITIVE 3 Source.950: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3 Source.951: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1 Source.952: DFBPPR4909 ---- Plant proteins ---- Calcium-dependent protein kinase 26 Source.953: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10 Source.954: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID Source.955: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1 Source.956: DFBPPR4923 ---- Plant proteins ---- Calcium-dependent protein kinase 25 Source.957: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.958: DFBPPR4935 ---- Plant proteins ---- UPF0014 membrane protein STAR2 Source.959: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.960: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.961: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic Source.962: DFBPPR4948 ---- Plant proteins ---- Long chain base biosynthesis protein 2d Source.963: DFBPPR4970 ---- Plant proteins ---- Ubiquinol oxidase 1, mitochondrial Source.964: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1 Source.965: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1 Source.966: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B Source.967: DFBPPR4987 ---- Plant proteins ---- Hydroxyisourate hydrolase Source.968: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.969: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.970: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase Source.971: DFBPPR4998 ---- Plant proteins ---- Alternative oxidase 3, mitochondrial Source.972: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase Source.973: DFBPPR5004 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.974: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic Source.975: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5 Source.976: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a Source.977: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.978: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.979: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit Source.980: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1 Source.981: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform Source.982: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform Source.983: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2 Source.984: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2 Source.985: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.986: DFBPPR5048 ---- Plant proteins ---- Ubiquinol oxidase 2, mitochondrial Source.987: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1 Source.988: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase Source.989: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.990: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein Source.991: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain Source.992: DFBPPR5074 ---- Plant proteins ---- Phytochrome B Source.993: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.994: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.995: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.996: DFBPPR5084 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.997: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme Source.998: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain Source.999: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain Source.1000: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase Source.1001: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog Source.1002: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2 Source.1003: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1 Source.1004: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic Source.1005: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase Source.1006: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1 Source.1007: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.1008: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6 Source.1009: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7 Source.1010: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.1011: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.1012: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.1013: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1 Source.1014: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.1015: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1016: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1 Source.1017: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1018: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6 Source.1019: DFBPPR5197 ---- Plant proteins ---- Nodulin-21 Source.1020: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6 Source.1021: DFBPPR5201 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic Source.1022: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7 Source.1023: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1 Source.1024: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5 Source.1025: DFBPPR5206 ---- Plant proteins ---- Calmodulin-2 Source.1026: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2 Source.1027: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3 Source.1028: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic Source.1029: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic Source.1030: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214 Source.1031: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.1032: DFBPPR5231 ---- Plant proteins ---- Casparian strip membrane protein 5 Source.1033: DFBPPR5234 ---- Plant proteins ---- 17.9 kDa class II heat shock protein Source.1034: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme Source.1035: DFBPPR5244 ---- Plant proteins ---- Early nodulin-55-2 Source.1036: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0 Source.1037: DFBPPR5266 ---- Plant proteins ---- Cyanate hydratase Source.1038: DFBPPR5278 ---- Plant proteins ---- 40S ribosomal protein SA Source.1039: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8 Source.1040: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.1041: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.1042: DFBPPR5295 ---- Plant proteins ---- Early nodulin-55-1 Source.1043: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10 Source.1044: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3 Source.1045: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3 Source.1046: DFBPPR5329 ---- Plant proteins ---- CASP-like protein 2A2 Source.1047: DFBPPR5340 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.1048: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic Source.1049: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1 Source.1050: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase Source.1051: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.1052: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase Source.1053: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.1054: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.1055: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8 Source.1056: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.1057: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1 Source.1058: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic Source.1059: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.1060: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic Source.1061: DFBPPR5442 ---- Plant proteins ---- GRF-interacting factor 1 Source.1062: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic Source.1063: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.1064: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.1065: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.1066: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.1067: DFBPPR5457 ---- Plant proteins ---- Protein PLASTID TRANSCRIPTIONALLY ACTIVE 12, chloroplastic Source.1068: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic Source.1069: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.1070: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase Source.1071: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1072: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic Source.1073: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1074: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein Source.1075: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic Source.1076: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic Source.1077: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9 Source.1078: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic Source.1079: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain Source.1080: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.1081: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain Source.1082: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain Source.1083: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1 Source.1084: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.1085: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.1086: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.1087: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain Source.1088: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain Source.1089: DFBPPR5546 ---- Plant proteins ---- Thiamine thiazole synthase 1, chloroplastic Source.1090: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1 Source.1091: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B Source.1092: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic Source.1093: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A Source.1094: DFBPPR5556 ---- Plant proteins ---- Thiamine thiazole synthase 2, chloroplastic Source.1095: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase Source.1096: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic Source.1097: DFBPPR5575 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.1098: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic Source.1099: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2 Source.1100: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.1101: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6 Source.1102: DFBPPR5601 ---- Plant proteins ---- Protein HIRA Source.1103: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.1104: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I Source.1105: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase Source.1106: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic Source.1107: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.1108: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase Source.1109: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1 Source.1110: DFBPPR5617 ---- Plant proteins ---- Mitochondrial carrier protein CoAc1 Source.1111: DFBPPR5618 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial Source.1112: DFBPPR5619 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.1113: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic Source.1114: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1 Source.1115: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic Source.1116: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1 Source.1117: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic Source.1118: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.1119: DFBPPR5649 ---- Plant proteins ---- 60S acidic ribosomal protein P3 Source.1120: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1 Source.1121: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1 Source.1122: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain Source.1123: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1 Source.1124: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic Source.1125: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2 Source.1126: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.1127: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3 Source.1128: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.1129: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.1130: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain Source.1131: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3 Source.1132: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain Source.1133: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain Source.1134: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain Source.1135: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain Source.1136: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1 Source.1137: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2 Source.1138: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1139: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain Source.1140: DFBPPR5723 ---- Plant proteins ---- Single myb histone 3 Source.1141: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.1142: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.1143: DFBPPR5735 ---- Plant proteins ---- Lipoyl synthase 1, chloroplastic Source.1144: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1 Source.1145: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2 Source.1146: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1 Source.1147: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2 Source.1148: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1 Source.1149: DFBPPR5753 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic Source.1150: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.1151: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2 Source.1152: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain Source.1153: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A Source.1154: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.1155: DFBPPR5795 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.1156: DFBPPR5802 ---- Plant proteins ---- Dof zinc finger protein PBF Source.1157: DFBPPR5811 ---- Plant proteins ---- ATP synthase subunit a Source.1158: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2 Source.1159: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1160: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic Source.1161: DFBPPR5820 ---- Plant proteins ---- Protein EGG APPARATUS-1 Source.1162: DFBPPR5823 ---- Plant proteins ---- Regulatory protein opaque-2 Source.1163: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.1164: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6 Source.1165: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3 Source.1166: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.1167: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase Source.1168: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2 Source.1169: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.1170: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.1171: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.1172: DFBPPR5870 ---- Plant proteins ---- Protein WRKY1 Source.1173: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1 Source.1174: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1 Source.1175: DFBPPR5905 ---- Plant proteins ---- Cyanate hydratase Source.1176: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase Source.1177: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1 Source.1178: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.1179: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2 Source.1180: DFBPPR5934 ---- Plant proteins ---- Aquaporin NIP2-1 Source.1181: DFBPPR5945 ---- Plant proteins ---- Calmodulin Source.1182: DFBPPR5966 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP1 Source.1183: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2 Source.1184: DFBPPR6008 ---- Plant proteins ---- Zein-beta Source.1185: DFBPPR6009 ---- Plant proteins ---- CASP-like protein 5C1 Source.1186: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9 Source.1187: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.1188: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3 Source.1189: DFBPPR6030 ---- Plant proteins ---- DNA polymerase Source.1190: DFBPPR6075 ---- Plant proteins ---- MFS18 protein Source.1191: DFBPPR6108 ---- Plant proteins ---- Protein MATERNALLY EXPRESSED GENE 5 Source.1192: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8 Source.1193: DFBPPR6118 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.1194: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A Source.1195: DFBPPR6145 ---- Plant proteins ---- Ninja-family protein 6 Source.1196: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein Source.1197: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1 Source.1198: DFBPPR6160 ---- Plant proteins ---- Ninja-family protein 2 Source.1199: DFBPPR6161 ---- Plant proteins ---- Ninja-family protein 4 Source.1200: DFBPPR6163 ---- Plant proteins ---- Ninja-family protein 3 Source.1201: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.1202: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.1203: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein Source.1204: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.1205: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.1206: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase Source.1207: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.1208: DFBPPR6242 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.1209: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.1210: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase Source.1211: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic Source.1212: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.1213: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.1214: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain Source.1215: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8 Source.1216: DFBPPR6304 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.1217: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1218: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic Source.1219: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase Source.1220: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.1221: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing] Source.1222: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing] Source.1223: DFBPPR6346 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.1224: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic Source.1225: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic Source.1226: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain Source.1227: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain Source.1228: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain Source.1229: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.1230: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.1231: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.1232: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.1233: DFBPPR6391 ---- Plant proteins ---- Cytochrome b6 Source.1234: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic Source.1235: DFBPPR6406 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase Source.1236: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1237: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial Source.1238: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial Source.1239: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.1240: DFBPPR6422 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1241: DFBPPR6442 ---- Plant proteins ---- Seed trypsin/chymotrypsin inhibitor TI5-72 Source.1242: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6 Source.1243: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B Source.1244: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2 Source.1245: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A Source.1246: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3 Source.1247: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4 Source.1248: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5 Source.1249: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1 Source.1250: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA Source.1251: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.1252: DFBPPR6494 ---- Plant proteins ---- 50S ribosomal protein L1, chloroplastic Source.1253: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2 Source.1254: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1 Source.1255: DFBPPR6583 ---- Plant proteins ---- Organ-specific protein P4 Source.1256: DFBPPR6617 ---- Plant proteins ---- 30S ribosomal protein S2, chloroplastic Source.1257: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1258: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.1259: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.1260: DFBPPR6646 ---- Plant proteins ---- Protein-L-isoaspartate O-methyltransferase Source.1261: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.1262: DFBPPR6655 ---- Plant proteins ---- Agglutinin isolectin 1 Source.1263: DFBPPR6657 ---- Plant proteins ---- Agglutinin isolectin 2 Source.1264: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic Source.1265: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1 Source.1266: DFBPPR6679 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.1267: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2 Source.1268: DFBPPR6697 ---- Plant proteins ---- Non-specific lipid-transfer protein 2G Source.1269: DFBPPR6700 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein Source.1270: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain Source.1271: DFBPPR6705 ---- Plant proteins ---- Calmodulin Source.1272: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein Source.1273: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa Source.1274: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1275: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase Source.1276: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase Source.1277: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain Source.1278: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain Source.1279: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain Source.1280: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain Source.1281: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain Source.1282: DFBPPR6752 ---- Plant proteins ---- Probable non-specific lipid-transfer protein 3 Source.1283: DFBPPR6757 ---- Plant proteins ---- ADP,ATP carrier protein 2, mitochondrial Source.1284: DFBPPR6758 ---- Plant proteins ---- ADP,ATP carrier protein 1, mitochondrial Source.1285: DFBPPR6768 ---- Plant proteins ---- Eukaryotic translation initiation factor 4B1 Source.1286: DFBPPR6770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic Source.1287: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6 Source.1288: DFBPPR6786 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.1289: DFBPPR6789 ---- Plant proteins ---- ATP synthase subunit a Source.1290: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a Source.1291: DFBPPR6821 ---- Plant proteins ---- bZIP transcription factor 1-B Source.1292: DFBPPR6825 ---- Plant proteins ---- bZIP transcription factor 1-D Source.1293: DFBPPR6827 ---- Plant proteins ---- bZIP transcription factor 1-A Source.1294: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1295: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.1296: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta Source.1297: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic Source.1298: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1299: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.1300: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1301: DFBPPR6888 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.1302: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1 Source.1303: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.1304: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.1305: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.1306: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2 Source.1307: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1 Source.1308: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3 Source.1309: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2 Source.1310: DFBPPR7007 ---- Plant proteins ---- Protein Barley B recombinant Source.1311: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme Source.1312: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1313: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.1314: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic Source.1315: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.1316: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic Source.1317: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.1318: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase Source.1319: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein Source.1320: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3 Source.1321: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1322: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain Source.1323: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1324: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain Source.1325: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.1326: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.1327: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1 Source.1328: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2 Source.1329: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain Source.1330: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2 Source.1331: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1 Source.1332: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic Source.1333: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2 Source.1334: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6 Source.1335: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase Source.1336: DFBPPR7142 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic Source.1337: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic Source.1338: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain Source.1339: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic Source.1340: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.1341: DFBPPR7164 ---- Plant proteins ---- Probable non-specific lipid-transfer protein Source.1342: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic Source.1343: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.1344: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI Source.1345: DFBPPR7184 ---- Plant proteins ---- Root-specific lectin Source.1346: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1347: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.1348: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1 Source.1349: DFBPPR7228 ---- Plant proteins ---- Calmodulin Source.1350: DFBPPR7258 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV90, chloroplastic Source.1351: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic Source.1352: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic Source.1353: DFBPPR7298 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA Source.1354: DFBPPR7310 ---- Plant proteins ---- ABA-inducible protein PHV A1 Source.1355: DFBPPR7311 ---- Plant proteins ---- B1-hordein Source.1356: DFBPPR7396 ---- Plant proteins ---- MAP3K epsilon protein kinase 1 Source.1357: DFBPPR7398 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase BAT2, chloroplastic Source.1358: DFBPPR7400 ---- Plant proteins ---- Myrosinase Source.1359: DFBPPR7403 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 1, chloroplastic Source.1360: DFBPPR7421 ---- Plant proteins ---- ATP synthase subunit a Source.1361: DFBPPR7423 ---- Plant proteins ---- ATP synthase subunit 9, mitochondrial Source.1362: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic Source.1363: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic Source.1364: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase Source.1365: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412 Source.1366: DFBPPR7431 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 2, chloroplastic Source.1367: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405 Source.1368: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.1369: DFBPPR7442 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 3, chloroplastic Source.1370: DFBPPR7447 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 5, chloroplastic Source.1371: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1 Source.1372: DFBPPR7451 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.1373: DFBPPR7456 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.1374: DFBPPR7457 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase 4 Source.1375: DFBPPR7458 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] reductase Source.1376: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2 Source.1377: DFBPPR7474 ---- Plant proteins ---- Squalene monooxygenase 1,1 Source.1378: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic Source.1379: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III Source.1380: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1 Source.1381: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2 Source.1382: DFBPPR7501 ---- Plant proteins ---- Deoxyhypusine synthase Source.1383: DFBPPR7504 ---- Plant proteins ---- 10 kDa chaperonin Source.1384: DFBPPR7515 ---- Plant proteins ---- 40S ribosomal protein SA Source.1385: DFBPPR7532 ---- Plant proteins ---- Anther-specific proline-rich protein APG Source.1386: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial Source.1387: DFBPPR7541 ---- Plant proteins ---- Polcalcin Bra n 1 Source.1388: DFBPPR7543 ---- Plant proteins ---- Polcalcin Bra n 2 Source.1389: DFBPPR7551 ---- Plant proteins ---- Protein BP4A Source.1390: DFBPPR7552 ---- Plant proteins ---- Protein BP4C Source.1391: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1 Source.1392: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase Source.1393: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein Source.1394: DFBPPR7611 ---- Milk proteins ---- Clusterin Source.1395: DFBPPR7621 ---- Milk proteins ---- Mucin-4 Source.1396: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4 Source.1397: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.1398: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4 Source.1399: DFBPPR7635 ---- Milk proteins ---- Prosaposin Source.1400: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein Source.1401: DFBPPR7637 ---- Milk proteins ---- Perilipin-2 Source.1402: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform Source.1403: DFBPPR7644 ---- Milk proteins ---- Plasma protease C1 inhibitor Source.1404: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor Source.1405: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.1406: DFBPPR7657 ---- Milk proteins ---- Chymosin Source.1407: DFBPPR7675 ---- Milk proteins ---- Alpha-lactalbumin Source.1408: DFBPPR7676 ---- Milk proteins ---- Kappa-casein Source.1409: DFBPPR7685 ---- Milk proteins ---- Alpha-lactalbumin Source.1410: DFBPPR7686 ---- Milk proteins ---- Kappa-casein Source.1411: DFBPPR7695 ---- Milk proteins ---- Kappa-casein Source.1412: DFBPPR7696 ---- Milk proteins ---- Uterine milk protein Source.1413: DFBPPR7697 ---- Milk proteins ---- Alpha-lactalbumin Source.1414: DFBPPR7699 ---- Milk proteins ---- Chymosin Source.1415: DFBPPR7702 ---- Milk proteins ---- Alpha-lactalbumin (Lactose synthase B protein) Source.1416: DFBPPR7706 ---- Milk proteins ---- Beta-casein Source.1417: DFBPPR7711 ---- Milk proteins ---- Alpha-lactalbumin Source.1418: DFBPPR7715 ---- Milk proteins ---- Kappa-casein Source.1419: DFBPPR7722 ---- Plant proteins ---- Peroxygenase 1 Source.1420: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain Source.1421: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain Source.1422: DFBPPR7735 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.1423: DFBPPR7736 ---- Plant proteins ---- T-complex protein 1 subunit epsilon Source.1424: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase Source.1425: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1426: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase Source.1427: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase Source.1428: DFBPPR8201 ---- Plant proteins ---- 16 kDa phloem protein 1 Source.1429: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2 Source.1430: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP Source.1431: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B Source.1432: DFBPPR8357 ---- Plant proteins ---- 2S albumin Source.1433: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1 Source.1434: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2 Source.1435: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1436: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.1437: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3 Source.1438: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2 Source.1439: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1 Source.1440: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B Source.1441: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17 Source.1442: DFBPPR8414 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.1443: DFBPPR8426 ---- Plant proteins ---- 2S seed storage protein 1 Source.1444: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.1445: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1446: DFBPPR8431 ---- Plant proteins ---- Antimicrobial protein 2 Source.1447: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein Source.1448: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase Source.1449: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2 Source.1450: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1 Source.1451: DFBPPR8490 ---- Milk proteins ---- Alpha-lactalbumin Source.1452: DFBPPR8492 ---- Milk proteins ---- Kappa-casein Source.1453: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1 Source.1454: DFBPPR8495 ---- Milk proteins ---- Angiogenin-1 Source.1455: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.1456: DFBPPR8505 ---- Milk proteins ---- Chymosin Source.1457: DFBPPR8507 ---- Milk proteins ---- Polycystin-2 Source.1458: DFBPPR8509 ---- Milk proteins ---- Angiogenin-2 Source.1459: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.1460: DFBPPR8515 ---- Milk proteins ---- Vitamin D3 receptor Source.1461: DFBPPR8522 ---- Milk proteins ---- Uterine milk protein Source.1462: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase Source.1463: DFBPPR15939 ---- Animal proteins ---- Rhodopsin Source.1464: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.1465: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.1466: DFBPPR15953 ---- Animal proteins ---- Occludin Source.1467: DFBPPR15958 ---- Animal proteins ---- Myosin-9 Source.1468: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.1469: DFBPPR15963 ---- Animal proteins ---- Cadherin-1 Source.1470: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1471: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1 Source.1472: DFBPPR15974 ---- Animal proteins ---- Androgen receptor Source.1473: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T Source.1474: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.1475: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta Source.1476: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1 Source.1477: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.1478: DFBPPR15986 ---- Animal proteins ---- Toll-like receptor 2 Source.1479: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.1480: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.1481: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.1482: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.1483: DFBPPR16015 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.1484: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1 Source.1485: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1486: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.1487: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1488: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN Source.1489: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor Source.1490: DFBPPR16041 ---- Animal proteins ---- Transcription factor AP-2-beta Source.1491: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6 Source.1492: DFBPPR16045 ---- Animal proteins ---- Endoplasmin Source.1493: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.1494: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B Source.1495: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1 Source.1496: DFBPPR16072 ---- Animal proteins ---- Clusterin Source.1497: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.1498: DFBPPR16088 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.1499: DFBPPR16090 ---- Animal proteins ---- MAGUK p55 subfamily member 5 Source.1500: DFBPPR16095 ---- Animal proteins ---- Myosin-7 Source.1501: DFBPPR16100 ---- Animal proteins ---- Nucleoside diphosphate kinase B Source.1502: DFBPPR16101 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.1503: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain Source.1504: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein Source.1505: DFBPPR16122 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit Source.1506: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1507: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer Source.1508: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.1509: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR Source.1510: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1511: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor Source.1512: DFBPPR16137 ---- Animal proteins ---- Signaling lymphocytic activation molecule Source.1513: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1 Source.1514: DFBPPR16151 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.1515: DFBPPR16153 ---- Animal proteins ---- Death domain-associated protein 6 Source.1516: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.1517: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.1518: DFBPPR16173 ---- Animal proteins ---- Aromatase Source.1519: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2 Source.1520: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.1521: DFBPPR16186 ---- Animal proteins ---- Parathyroid hormone Source.1522: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1523: DFBPPR16190 ---- Animal proteins ---- Aprataxin Source.1524: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.1525: DFBPPR16198 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Source.1526: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator Source.1527: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.1528: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.1529: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B Source.1530: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.1531: DFBPPR16216 ---- Animal proteins ---- Troponin I, cardiac muscle Source.1532: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.1533: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.1534: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.1535: DFBPPR16240 ---- Animal proteins ---- Fibronectin Source.1536: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.1537: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain Source.1538: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1 Source.1539: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.1540: DFBPPR16262 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.1541: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C Source.1542: DFBPPR16273 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor Source.1543: DFBPPR16278 ---- Animal proteins ---- Major prion protein Source.1544: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3 Source.1545: DFBPPR16294 ---- Animal proteins ---- Signal peptidase complex subunit 2 Source.1546: DFBPPR16300 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.1547: DFBPPR16302 ---- Animal proteins ---- Myosin-2 Source.1548: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor Source.1549: DFBPPR16317 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.1550: DFBPPR16318 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.1551: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1 Source.1552: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1 Source.1553: DFBPPR16326 ---- Animal proteins ---- Desmin Source.1554: DFBPPR16329 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.1555: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.1556: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1557: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.1558: DFBPPR16418 ---- Animal proteins ---- Myosin-1 Source.1559: DFBPPR16437 ---- Animal proteins ---- Myosin-4 Source.1560: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.1561: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2 Source.1562: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11 Source.1563: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2 Source.1564: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor Source.1565: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1566: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.1567: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6 Source.1568: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B Source.1569: DFBPPR16483 ---- Animal proteins ---- Neurotensin/neuromedin N Source.1570: DFBPPR16486 ---- Animal proteins ---- Natriuretic peptides B Source.1571: DFBPPR16487 ---- Animal proteins ---- Claudin-2 Source.1572: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII Source.1573: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog Source.1574: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1 Source.1575: DFBPPR16498 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring Source.1576: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein Source.1577: DFBPPR16506 ---- Animal proteins ---- Pepsin B Source.1578: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin Source.1579: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5 Source.1580: DFBPPR16520 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C Source.1581: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.1582: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A Source.1583: DFBPPR16530 ---- Animal proteins ---- ATP synthase subunit a Source.1584: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.1585: DFBPPR16533 ---- Animal proteins ---- Adenosine receptor A3 Source.1586: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.1587: DFBPPR16552 ---- Animal proteins ---- Rhophilin-2 Source.1588: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.1589: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.1590: DFBPPR16566 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta Source.1591: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1592: DFBPPR16573 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.1593: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.1594: DFBPPR16576 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.1595: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1596: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein Source.1597: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K Source.1598: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4 Source.1599: DFBPPR16593 ---- Animal proteins ---- Calcyphosin Source.1600: DFBPPR16595 ---- Animal proteins ---- Annexin A4 Source.1601: DFBPPR16597 ---- Animal proteins ---- Cholecystokinin receptor type A Source.1602: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1 Source.1603: DFBPPR16614 ---- Animal proteins ---- Protein S100-A4 Source.1604: DFBPPR16619 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1605: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1 Source.1606: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.1607: DFBPPR16630 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.1608: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7 Source.1609: DFBPPR16653 ---- Animal proteins ---- Clusterin-like protein 1 Source.1610: DFBPPR16661 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.1611: DFBPPR16678 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1A Source.1612: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT Source.1613: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4 Source.1614: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.1615: DFBPPR16712 ---- Animal proteins ---- RNA-binding protein 47 Source.1616: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.1617: DFBPPR16721 ---- Animal proteins ---- Testin Source.1618: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.1619: DFBPPR16796 ---- Animal proteins ---- Major prion protein Source.1620: DFBPPR16799 ---- Animal proteins ---- Somatotropin Source.1621: DFBPPR16807 ---- Animal proteins ---- Seminal ribonuclease Source.1622: DFBPPR16809 ---- Animal proteins ---- Rhodopsin Source.1623: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic Source.1624: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.1625: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.1626: DFBPPR16843 ---- Animal proteins ---- Calmodulin Source.1627: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor Source.1628: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial Source.1629: DFBPPR16852 ---- Animal proteins ---- Cytochrome b Source.1630: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.1631: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor Source.1632: DFBPPR16866 ---- Animal proteins ---- Endothelin receptor type B Source.1633: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2 Source.1634: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1 Source.1635: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.1636: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Source.1637: DFBPPR16890 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase F, mitochondrial Source.1638: DFBPPR16893 ---- Animal proteins ---- Annexin A4 Source.1639: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha Source.1640: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.1641: DFBPPR16918 ---- Animal proteins ---- Spastin Source.1642: DFBPPR16923 ---- Animal proteins ---- TNF receptor-associated factor 6 Source.1643: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase Source.1644: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.1645: DFBPPR16935 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 13 Source.1646: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease Source.1647: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.1648: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.1649: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1650: DFBPPR16948 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.1651: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin Source.1652: DFBPPR16960 ---- Animal proteins ---- Catalase Source.1653: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.1654: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor Source.1655: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta Source.1656: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos Source.1657: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase Source.1658: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase Source.1659: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1 Source.1660: DFBPPR16993 ---- Animal proteins ---- Protein S100-A10 Source.1661: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.1662: DFBPPR17006 ---- Animal proteins ---- Syntaxin-17 Source.1663: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.1664: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator Source.1665: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1 Source.1666: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2 Source.1667: DFBPPR17036 ---- Animal proteins ---- Parkinson disease protein 7 homolog Source.1668: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.1669: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type Source.1670: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase Source.1671: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.1672: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.1673: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.1674: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21 Source.1675: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.1676: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36 Source.1677: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase Source.1678: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4 Source.1679: DFBPPR17113 ---- Animal proteins ---- Calcineurin B homologous protein 1 Source.1680: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta Source.1681: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2 Source.1682: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha Source.1683: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1684: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta Source.1685: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2 Source.1686: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.1687: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor Source.1688: DFBPPR17167 ---- Animal proteins ---- Calcineurin subunit B type 1 Source.1689: DFBPPR17168 ---- Animal proteins ---- Angiopoietin-1 Source.1690: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2 Source.1691: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.1692: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1 Source.1693: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.1694: DFBPPR17189 ---- Animal proteins ---- Troponin I, cardiac muscle Source.1695: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4 Source.1696: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.1697: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial Source.1698: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3 Source.1699: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1 Source.1700: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A Source.1701: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2 Source.1702: DFBPPR17294 ---- Animal proteins ---- Ezrin Source.1703: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein Source.1704: DFBPPR17313 ---- Animal proteins ---- Exostosin-1 Source.1705: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1 Source.1706: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1 Source.1707: DFBPPR17327 ---- Animal proteins ---- Myotubularin Source.1708: DFBPPR17336 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.1709: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI Source.1710: DFBPPR17341 ---- Animal proteins ---- Radixin Source.1711: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.1712: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.1713: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2 Source.1714: DFBPPR17352 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 2 Source.1715: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog Source.1716: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H Source.1717: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1 Source.1718: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.1719: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase Source.1720: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2 Source.1721: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2 Source.1722: DFBPPR17387 ---- Animal proteins ---- ATP-dependent DNA/RNA helicase DHX36 Source.1723: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.1724: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2 Source.1725: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1 Source.1726: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1 Source.1727: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type Source.1728: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1 Source.1729: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial Source.1730: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit Source.1731: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4 Source.1732: DFBPPR17433 ---- Animal proteins ---- Caveolin-3 Source.1733: DFBPPR17439 ---- Animal proteins ---- Folliculin Source.1734: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1 Source.1735: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.1736: DFBPPR17443 ---- Animal proteins ---- Beclin-1 Source.1737: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.1738: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1739: DFBPPR17452 ---- Animal proteins ---- CD81 antigen Source.1740: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.1741: DFBPPR17457 ---- Animal proteins ---- 15-hydroxyprostaglandin dehydrogenase [NAD(+)] Source.1742: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3 Source.1743: DFBPPR17460 ---- Animal proteins ---- Endoplasmin Source.1744: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1 Source.1745: DFBPPR17476 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K Source.1746: DFBPPR17477 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-gamma catalytic subunit Source.1747: DFBPPR17482 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.1748: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4 Source.1749: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.1750: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1 Source.1751: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C Source.1752: DFBPPR17497 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.1753: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha Source.1754: DFBPPR17499 ---- Animal proteins ---- Allograft inflammatory factor 1 Source.1755: DFBPPR17500 ---- Animal proteins ---- Lecithin retinol acyltransferase Source.1756: DFBPPR17504 ---- Animal proteins ---- Duodenase-1 Source.1757: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.1758: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1 Source.1759: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.1760: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 Source.1761: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E Source.1762: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.1763: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1 Source.1764: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA Source.1765: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog Source.1766: DFBPPR17560 ---- Animal proteins ---- Flap endonuclease 1 Source.1767: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1 Source.1768: DFBPPR17568 ---- Animal proteins ---- Interferon tau-2 Source.1769: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.1770: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter Source.1771: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta Source.1772: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1 Source.1773: DFBPPR17579 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Source.1774: DFBPPR17585 ---- Animal proteins ---- Calcium-transporting ATPase type 2C member 1 Source.1775: DFBPPR17594 ---- Animal proteins ---- E-selectin Source.1776: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1777: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1 Source.1778: DFBPPR17636 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.1779: DFBPPR17637 ---- Animal proteins ---- Cytochrome c oxidase subunit 7C, mitochondrial Source.1780: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.1781: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B Source.1782: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial Source.1783: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14 Source.1784: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1 Source.1785: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.1786: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.1787: DFBPPR17749 ---- Animal proteins ---- CD9 antigen Source.1788: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform Source.1789: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.1790: DFBPPR17771 ---- Animal proteins ---- Thyrotropin subunit beta Source.1791: DFBPPR17773 ---- Animal proteins ---- Adenosylhomocysteinase 3 Source.1792: DFBPPR17775 ---- Animal proteins ---- Elongator complex protein 3 Source.1793: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain Source.1794: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C Source.1795: DFBPPR17787 ---- Animal proteins ---- Septin-6 Source.1796: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.1797: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.1798: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2 Source.1799: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.1800: DFBPPR17827 ---- Animal proteins ---- Short/branched chain specific acyl-CoA dehydrogenase, mitochondrial Source.1801: DFBPPR17828 ---- Animal proteins ---- Aromatase Source.1802: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.1803: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial Source.1804: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial Source.1805: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.1806: DFBPPR17846 ---- Animal proteins ---- (Lyso)-N-acylphosphatidylethanolamine lipase Source.1807: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial Source.1808: DFBPPR17858 ---- Animal proteins ---- Calsenilin Source.1809: DFBPPR17863 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.1810: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.1811: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.1812: DFBPPR17877 ---- Animal proteins ---- Syntaxin-7 Source.1813: DFBPPR17881 ---- Animal proteins ---- Myoblast determination protein 1 Source.1814: DFBPPR17888 ---- Animal proteins ---- Cation-dependent mannose-6-phosphate receptor Source.1815: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.1816: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1 Source.1817: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1 Source.1818: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.1819: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain Source.1820: DFBPPR17903 ---- Animal proteins ---- Transcription initiation factor IIB Source.1821: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain Source.1822: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7 Source.1823: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase Source.1824: DFBPPR17918 ---- Animal proteins ---- Kynurenine/alpha-aminoadipate aminotransferase, mitochondrial Source.1825: DFBPPR17923 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.1826: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2 Source.1827: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1828: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3 Source.1829: DFBPPR17933 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.1830: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.1831: DFBPPR17938 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IA Source.1832: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.1833: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10 Source.1834: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1 Source.1835: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1 Source.1836: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial Source.1837: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.1838: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase Source.1839: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial Source.1840: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.1841: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor Source.1842: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.1843: DFBPPR17989 ---- Animal proteins ---- VIP36-like protein Source.1844: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2 Source.1845: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.1846: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase Source.1847: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10 Source.1848: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase Source.1849: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial Source.1850: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17 Source.1851: DFBPPR18008 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF144B Source.1852: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase Source.1853: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5 Source.1854: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1855: DFBPPR18034 ---- Animal proteins ---- E3 SUMO-protein ligase NSE2 Source.1856: DFBPPR18039 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor Source.1857: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.1858: DFBPPR18048 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial Source.1859: DFBPPR18054 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 9 Source.1860: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2 Source.1861: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.1862: DFBPPR18070 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.1863: DFBPPR18072 ---- Animal proteins ---- Postacrosomal sheath WW domain-binding protein Source.1864: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2 Source.1865: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8 Source.1866: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Source.1867: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.1868: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.1869: DFBPPR18088 ---- Animal proteins ---- Aprataxin Source.1870: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.1871: DFBPPR18097 ---- Animal proteins ---- Deoxycytidine kinase Source.1872: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3 Source.1873: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1 Source.1874: DFBPPR18106 ---- Animal proteins ---- Natriuretic peptides B Source.1875: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38 Source.1876: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.1877: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.1878: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4 Source.1879: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3 Source.1880: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog Source.1881: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.1882: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.1883: DFBPPR18169 ---- Animal proteins ---- Vesicle transport through interaction with t-SNAREs homolog 1B Source.1884: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A Source.1885: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.1886: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.1887: DFBPPR18197 ---- Animal proteins ---- Bax inhibitor 1 Source.1888: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter Source.1889: DFBPPR18227 ---- Animal proteins ---- Desmin Source.1890: DFBPPR18234 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B' Source.1891: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3 Source.1892: DFBPPR18245 ---- Animal proteins ---- ATP synthase subunit a Source.1893: DFBPPR18251 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2 Source.1894: DFBPPR18273 ---- Animal proteins ---- Selenide, water dikinase 1 Source.1895: DFBPPR18275 ---- Animal proteins ---- Enoyl-CoA hydratase, mitochondrial Source.1896: DFBPPR18278 ---- Animal proteins ---- ATP synthase F(0) complex subunit B1, mitochondrial Source.1897: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3 Source.1898: DFBPPR18282 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1899: DFBPPR18303 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.1900: DFBPPR18314 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-B Source.1901: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7 Source.1902: DFBPPR18328 ---- Animal proteins ---- Delta-aminolevulinic acid dehydratase Source.1903: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial Source.1904: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor Source.1905: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1 Source.1906: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q Source.1907: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.1908: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.1909: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain Source.1910: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.1911: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.1912: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.1913: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1 Source.1914: DFBPPR18385 ---- Animal proteins ---- CTD nuclear envelope phosphatase 1 Source.1915: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor Source.1916: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos Source.1917: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.1918: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1 Source.1919: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2 Source.1920: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3 Source.1921: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4 Source.1922: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase Source.1923: DFBPPR18475 ---- Animal proteins ---- Myosin-2 Source.1924: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein Source.1925: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1 Source.1926: DFBPPR18484 ---- Animal proteins ---- Charged multivesicular body protein 3 Source.1927: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7 Source.1928: DFBPPR18504 ---- Animal proteins ---- Syntaxin-5 Source.1929: DFBPPR18510 ---- Animal proteins ---- Myogenic factor 5 Source.1930: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.1931: DFBPPR18538 ---- Animal proteins ---- Vesicle-associated membrane protein 1 Source.1932: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.1933: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1 Source.1934: DFBPPR18553 ---- Animal proteins ---- Factor XIIa inhibitor Source.1935: DFBPPR18558 ---- Animal proteins ---- Troponin T, cardiac muscle Source.1936: DFBPPR18562 ---- Animal proteins ---- Neuronal calcium sensor 1 Source.1937: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4 Source.1938: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2 Source.1939: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.1940: DFBPPR18587 ---- Animal proteins ---- Proteasome subunit beta type-6 Source.1941: DFBPPR18592 ---- Animal proteins ---- Alpha-1-antiproteinase Source.1942: DFBPPR18593 ---- Animal proteins ---- Pigment epithelium-derived factor Source.1943: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.1944: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3 Source.1945: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.1946: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial Source.1947: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.1948: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.1949: DFBPPR18633 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 14 Source.1950: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.1951: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4 Source.1952: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2 Source.1953: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial Source.1954: DFBPPR18698 ---- Animal proteins ---- ATPase GET3 Source.1955: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4 Source.1956: DFBPPR18701 ---- Animal proteins ---- Manganese-dependent ADP-ribose/CDP-alcohol diphosphatase Source.1957: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1 Source.1958: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3 Source.1959: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.1960: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2 Source.1961: DFBPPR18735 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.1962: DFBPPR18736 ---- Animal proteins ---- Myosin regulatory light polypeptide 9 Source.1963: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4 Source.1964: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.1965: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1 Source.1966: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase Source.1967: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3 Source.1968: DFBPPR18767 ---- Animal proteins ---- Toll-interacting protein Source.1969: DFBPPR18771 ---- Animal proteins ---- Palmitoyltransferase ZDHHC9 Source.1970: DFBPPR18772 ---- Animal proteins ---- Myosin-7 Source.1971: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2 Source.1972: DFBPPR18781 ---- Animal proteins ---- Exosome complex component RRP4 Source.1973: DFBPPR18782 ---- Animal proteins ---- Parathyroid hormone Source.1974: DFBPPR18783 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF146-A Source.1975: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4 Source.1976: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4 Source.1977: DFBPPR18795 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C2 Source.1978: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1 Source.1979: DFBPPR18799 ---- Animal proteins ---- Myosin-1 Source.1980: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8 Source.1981: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type Source.1982: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog Source.1983: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1 Source.1984: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5 Source.1985: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain Source.1986: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial Source.1987: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3 Source.1988: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2 Source.1989: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.1990: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.1991: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.1992: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B Source.1993: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.1994: DFBPPR18852 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 8 Source.1995: DFBPPR18853 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor D Source.1996: DFBPPR18855 ---- Animal proteins ---- Tubulin-specific chaperone A Source.1997: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.1998: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase Source.1999: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2 Source.2000: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1 Source.2001: DFBPPR18870 ---- Animal proteins ---- DBIRD complex subunit ZNF326 Source.2002: DFBPPR18874 ---- Animal proteins ---- Acyl-protein thioesterase 1 Source.2003: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.2004: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2 Source.2005: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED Source.2006: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1 Source.2007: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3 Source.2008: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1 Source.2009: DFBPPR18933 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.2010: DFBPPR18934 ---- Animal proteins ---- Transmembrane protein 108 Source.2011: DFBPPR18935 ---- Animal proteins ---- Beta-citrylglutamate synthase B Source.2012: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial Source.2013: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2 Source.2014: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein Source.2015: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2 Source.2016: DFBPPR18953 ---- Animal proteins ---- T-complex protein 1 subunit gamma Source.2017: DFBPPR18960 ---- Animal proteins ---- Spondin-1 Source.2018: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7 Source.2019: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase Source.2020: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.2021: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease Source.2022: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.2023: DFBPPR19009 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 1 Source.2024: DFBPPR19015 ---- Animal proteins ---- HEPACAM family member 2 Source.2025: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B Source.2026: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2 Source.2027: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.2028: DFBPPR19045 ---- Animal proteins ---- Retinal rod rhodopsin-sensitive cGMP 3',5'-cyclic phosphodiesterase subunit delta Source.2029: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B Source.2030: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta Source.2031: DFBPPR19055 ---- Animal proteins ---- Complement factor D Source.2032: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5 Source.2033: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6 Source.2034: DFBPPR19078 ---- Animal proteins ---- Cystatin-B Source.2035: DFBPPR19079 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha Source.2036: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3 Source.2037: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A Source.2038: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1 Source.2039: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial Source.2040: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.2041: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B Source.2042: DFBPPR19123 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.2043: DFBPPR19124 ---- Animal proteins ---- Neuroguidin Source.2044: DFBPPR19127 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H Source.2045: DFBPPR19132 ---- Animal proteins ---- DNA oxidative demethylase ALKBH2 Source.2046: DFBPPR19133 ---- Animal proteins ---- Brain ribonuclease Source.2047: DFBPPR19137 ---- Animal proteins ---- Serpin H1 Source.2048: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.2049: DFBPPR19148 ---- Animal proteins ---- Ribonuclease 4 Source.2050: DFBPPR19151 ---- Animal proteins ---- 28S ribosomal protein S27, mitochondrial Source.2051: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase Source.2052: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3 Source.2053: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin Source.2054: DFBPPR19176 ---- Animal proteins ---- Collagen alpha-2(IV) chain Source.2055: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3 Source.2056: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1 Source.2057: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.2058: DFBPPR19209 ---- Animal proteins ---- mRNA export factor Source.2059: DFBPPR19212 ---- Animal proteins ---- Nucleosome assembly protein 1-like 1 Source.2060: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6 Source.2061: DFBPPR19232 ---- Animal proteins ---- Nuclear transcription factor Y subunit alpha Source.2062: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A Source.2063: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.2064: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase Source.2065: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.2066: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2 Source.2067: DFBPPR19280 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF183 Source.2068: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33 Source.2069: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5 Source.2070: DFBPPR19295 ---- Animal proteins ---- 26S proteasome regulatory subunit 7 Source.2071: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.2072: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8 Source.2073: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB Source.2074: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47 Source.2075: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain Source.2076: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1 Source.2077: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2 Source.2078: DFBPPR19327 ---- Animal proteins ---- DNA repair protein RAD51 homolog 4 Source.2079: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85 Source.2080: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.2081: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD Source.2082: DFBPPR19349 ---- Animal proteins ---- Zinc transporter 3 Source.2083: DFBPPR19350 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.2084: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.2085: DFBPPR19368 ---- Animal proteins ---- Prion-like protein doppel Source.2086: DFBPPR19375 ---- Animal proteins ---- ATPase family AAA domain-containing protein 1 Source.2087: DFBPPR19387 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 2 Source.2088: DFBPPR19391 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein A Source.2089: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1 Source.2090: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6 Source.2091: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18 Source.2092: DFBPPR19406 ---- Animal proteins ---- [3-methyl-2-oxobutanoate dehydrogenase [lipoamide]] kinase, mitochondrial Source.2093: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F Source.2094: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2 Source.2095: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1 Source.2096: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2 Source.2097: DFBPPR19429 ---- Animal proteins ---- Protein Spindly Source.2098: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71 Source.2099: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.2100: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1 Source.2101: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial Source.2102: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase Source.2103: DFBPPR19469 ---- Animal proteins ---- Cholinesterase Source.2104: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1 Source.2105: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain Source.2106: DFBPPR19481 ---- Animal proteins ---- RNA/RNP complex-1-interacting phosphatase Source.2107: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13 Source.2108: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.2109: DFBPPR19495 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial Source.2110: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73 Source.2111: DFBPPR19500 ---- Animal proteins ---- Complement C2 Source.2112: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72 Source.2113: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase Source.2114: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.2115: DFBPPR19519 ---- Animal proteins ---- DnaJ homolog subfamily C member 24 Source.2116: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1 Source.2117: DFBPPR19524 ---- Animal proteins ---- Interleukin-1 beta Source.2118: DFBPPR19531 ---- Animal proteins ---- Interferon omega-1 Source.2119: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Source.2120: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3 Source.2121: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A Source.2122: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3 Source.2123: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2 Source.2124: DFBPPR19559 ---- Animal proteins ---- CCN family member 2 Source.2125: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2 Source.2126: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase Source.2127: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2 Source.2128: DFBPPR19590 ---- Animal proteins ---- Norrin Source.2129: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.2130: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4 Source.2131: DFBPPR19610 ---- Animal proteins ---- RING finger protein 11 Source.2132: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.2133: DFBPPR19613 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2 Source.2134: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta Source.2135: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein Source.2136: DFBPPR19640 ---- Animal proteins ---- Prolargin Source.2137: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3 Source.2138: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.2139: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform Source.2140: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1 Source.2141: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2 Source.2142: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase Source.2143: DFBPPR19681 ---- Animal proteins ---- Fibroleukin Source.2144: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor Source.2145: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.2146: DFBPPR19698 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 7 Source.2147: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain Source.2148: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10 Source.2149: DFBPPR19707 ---- Animal proteins ---- Neurotensin/neuromedin N Source.2150: DFBPPR19718 ---- Animal proteins ---- Type 2 phosphatidylinositol 4,5-bisphosphate 4-phosphatase Source.2151: DFBPPR19726 ---- Animal proteins ---- Sorting nexin-2 Source.2152: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B Source.2153: DFBPPR19742 ---- Animal proteins ---- Phosphoglucomutase-1 Source.2154: DFBPPR19743 ---- Animal proteins ---- C-X-C motif chemokine 16 Source.2155: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase Source.2156: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1 Source.2157: DFBPPR19769 ---- Animal proteins ---- Septin-14 Source.2158: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase Source.2159: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25 Source.2160: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.2161: DFBPPR19788 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1 Source.2162: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.2163: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4 Source.2164: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.2165: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.2166: DFBPPR19809 ---- Animal proteins ---- Hippocalcin-like protein 4 Source.2167: DFBPPR19815 ---- Animal proteins ---- V-type proton ATPase subunit E 1 Source.2168: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase Source.2169: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial Source.2170: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain Source.2171: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial Source.2172: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1 Source.2173: DFBPPR19843 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial Source.2174: DFBPPR19850 ---- Animal proteins ---- Protein YIPF5 Source.2175: DFBPPR19852 ---- Animal proteins ---- Transmembrane and immunoglobulin domain-containing protein 1 Source.2176: DFBPPR19854 ---- Animal proteins ---- Nuclear migration protein nudC Source.2177: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial Source.2178: DFBPPR19874 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor B Source.2179: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor Source.2180: DFBPPR19894 ---- Animal proteins ---- Reactive oxygen species modulator 1 Source.2181: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase Source.2182: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.2183: DFBPPR19911 ---- Animal proteins ---- Guided entry of tail-anchored proteins factor 1 Source.2184: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.2185: DFBPPR19925 ---- Animal proteins ---- Complement factor H Source.2186: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial Source.2187: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1 Source.2188: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14 Source.2189: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1 Source.2190: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2 Source.2191: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z Source.2192: DFBPPR19972 ---- Animal proteins ---- Prefoldin subunit 5 Source.2193: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3 Source.2194: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2 Source.2195: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39 Source.2196: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3 Source.2197: DFBPPR19990 ---- Animal proteins ---- Synaptonemal complex protein 3 Source.2198: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein Source.2199: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3 Source.2200: DFBPPR20011 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM17 Source.2201: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2 Source.2202: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7 Source.2203: DFBPPR20028 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.2204: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1 Source.2205: DFBPPR20030 ---- Animal proteins ---- Calumenin Source.2206: DFBPPR20031 ---- Animal proteins ---- ADP/ATP translocase 4 Source.2207: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2 Source.2208: DFBPPR20060 ---- Animal proteins ---- Fibulin-5 Source.2209: DFBPPR20069 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.2210: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase Source.2211: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B Source.2212: DFBPPR20086 ---- Animal proteins ---- Coiled-coil domain-containing protein 47 Source.2213: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.2214: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.2215: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1 Source.2216: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.2217: DFBPPR20104 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D Source.2218: DFBPPR20106 ---- Animal proteins ---- Visinin-like protein 1 Source.2219: DFBPPR20127 ---- Animal proteins ---- Protein BTG1 Source.2220: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase Source.2221: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14 Source.2222: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C Source.2223: DFBPPR20143 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C Source.2224: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1 Source.2225: DFBPPR20167 ---- Animal proteins ---- Protein BANP Source.2226: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta Source.2227: DFBPPR20173 ---- Animal proteins ---- Poly(rC)-binding protein 1 Source.2228: DFBPPR20178 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog Source.2229: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12 Source.2230: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7 Source.2231: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1 Source.2232: DFBPPR20198 ---- Animal proteins ---- Calcium-binding protein 2 Source.2233: DFBPPR20199 ---- Animal proteins ---- Claudin-7 Source.2234: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A Source.2235: DFBPPR20208 ---- Animal proteins ---- Myeloid leukemia factor 1 Source.2236: DFBPPR20209 ---- Animal proteins ---- Ran-specific GTPase-activating protein Source.2237: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator Source.2238: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.2239: DFBPPR20225 ---- Animal proteins ---- Claudin-2 Source.2240: DFBPPR20226 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.2241: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.2242: DFBPPR20233 ---- Animal proteins ---- Beta-catenin-like protein 1 Source.2243: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein Source.2244: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.2245: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A Source.2246: DFBPPR20267 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1 Source.2247: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1 Source.2248: DFBPPR20285 ---- Animal proteins ---- Probable G-protein coupled receptor 158 Source.2249: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4 Source.2250: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein Source.2251: DFBPPR20292 ---- Animal proteins ---- Caltrin Source.2252: DFBPPR20301 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 3 Source.2253: DFBPPR20317 ---- Animal proteins ---- Cadherin-13 Source.2254: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2 Source.2255: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa Source.2256: DFBPPR20323 ---- Animal proteins ---- Myosin light chain 3 Source.2257: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.2258: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase Source.2259: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1 Source.2260: DFBPPR20341 ---- Animal proteins ---- Peptide YY Source.2261: DFBPPR20346 ---- Animal proteins ---- Serpin B6 Source.2262: DFBPPR20367 ---- Animal proteins ---- Follistatin-related protein 1 Source.2263: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein Source.2264: DFBPPR20373 ---- Animal proteins ---- Calcineurin subunit B type 2 Source.2265: DFBPPR20381 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1 homolog Source.2266: DFBPPR20395 ---- Animal proteins ---- GDP-fucose transporter 1 Source.2267: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.2268: DFBPPR20399 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC4 Source.2269: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.2270: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma Source.2271: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4 Source.2272: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial Source.2273: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3 Source.2274: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3 Source.2275: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial Source.2276: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase Source.2277: DFBPPR20430 ---- Animal proteins ---- Zinc finger protein 69 homolog Source.2278: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2 Source.2279: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus Source.2280: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein Source.2281: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein Source.2282: DFBPPR20512 ---- Animal proteins ---- Transcription elongation factor A protein 2 Source.2283: DFBPPR20517 ---- Animal proteins ---- RNA-binding protein 42 Source.2284: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2 Source.2285: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial Source.2286: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein Source.2287: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.2288: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3 Source.2289: DFBPPR20547 ---- Animal proteins ---- Transmembrane protein 230 Source.2290: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6 Source.2291: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A Source.2292: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5 Source.2293: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1 Source.2294: DFBPPR20604 ---- Animal proteins ---- Phosphoinositide-3-kinase-interacting protein 1 Source.2295: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor Source.2296: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2 Source.2297: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.2298: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1 Source.2299: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1 Source.2300: DFBPPR20652 ---- Animal proteins ---- HAUS augmin-like complex subunit 1 Source.2301: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A Source.2302: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein Source.2303: DFBPPR20664 ---- Animal proteins ---- General transcription factor IIH subunit 2 Source.2304: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.2305: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10 Source.2306: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12 Source.2307: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11 Source.2308: DFBPPR20705 ---- Animal proteins ---- Anaphase-promoting complex subunit 10 Source.2309: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9 Source.2310: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like Source.2311: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase Source.2312: DFBPPR20720 ---- Animal proteins ---- BoLa class II histocompatibility antigen, DQB*0101 beta chain Source.2313: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial Source.2314: DFBPPR20723 ---- Animal proteins ---- Histamine N-methyltransferase Source.2315: DFBPPR20724 ---- Animal proteins ---- Exportin-2 Source.2316: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4 Source.2317: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase Source.2318: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206 Source.2319: DFBPPR20742 ---- Animal proteins ---- Tetratricopeptide repeat protein 5 Source.2320: DFBPPR20756 ---- Animal proteins ---- Myosin regulatory light chain 12B Source.2321: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9 Source.2322: DFBPPR20759 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform Source.2323: DFBPPR20761 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 2 Source.2324: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1 Source.2325: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha Source.2326: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein Source.2327: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein Source.2328: DFBPPR20787 ---- Animal proteins ---- UBX domain-containing protein 8 Source.2329: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6 Source.2330: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.2331: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7 Source.2332: DFBPPR20803 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 4 Source.2333: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase Source.2334: DFBPPR20806 ---- Animal proteins ---- Transcriptional adapter 1 Source.2335: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2 Source.2336: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216 Source.2337: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.2338: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13 Source.2339: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog Source.2340: DFBPPR20842 ---- Animal proteins ---- Translocating chain-associated membrane protein 1 Source.2341: DFBPPR20843 ---- Animal proteins ---- ARL14 effector protein Source.2342: DFBPPR20844 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase Source.2343: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog Source.2344: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog Source.2345: DFBPPR20856 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim10 Source.2346: DFBPPR20862 ---- Animal proteins ---- Leucine carboxyl methyltransferase 1 Source.2347: DFBPPR20869 ---- Animal proteins ---- Putative aspartate aminotransferase, cytoplasmic 2 Source.2348: DFBPPR20903 ---- Animal proteins ---- 40S ribosomal protein S3a Source.2349: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2350: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2351: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial Source.2352: DFBPPR20939 ---- Animal proteins ---- Kv channel-interacting protein 4 Source.2353: DFBPPR20944 ---- Animal proteins ---- Pikachurin Source.2354: DFBPPR20954 ---- Animal proteins ---- Secretagogin Source.2355: DFBPPR20989 ---- Animal proteins ---- Ubiquinone biosynthesis protein COQ9, mitochondrial Source.2356: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821 Source.2357: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.2358: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6 Source.2359: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2 Source.2360: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein Source.2361: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B Source.2362: DFBPPR21036 ---- Animal proteins ---- Short transient receptor potential channel 5 Source.2363: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574 Source.2364: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7 Source.2365: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein Source.2366: DFBPPR21061 ---- Animal proteins ---- Mitochondrial glycine transporter Source.2367: DFBPPR21068 ---- Animal proteins ---- 40S ribosomal protein S5 Source.2368: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein Source.2369: DFBPPR21081 ---- Animal proteins ---- Uteroglobin Source.2370: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.2371: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6 Source.2372: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein Source.2373: DFBPPR21100 ---- Animal proteins ---- Cochlin Source.2374: DFBPPR21105 ---- Animal proteins ---- Calcipressin-3 Source.2375: DFBPPR21115 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor-like protein Source.2376: DFBPPR21121 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-3 Source.2377: DFBPPR21124 ---- Animal proteins ---- Prostaglandin F2-alpha receptor Source.2378: DFBPPR21130 ---- Animal proteins ---- Transmembrane protein 17 Source.2379: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7 Source.2380: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2 Source.2381: DFBPPR21141 ---- Animal proteins ---- Biotinidase Source.2382: DFBPPR21145 ---- Animal proteins ---- Transcription elongation factor SPT4 Source.2383: DFBPPR21151 ---- Animal proteins ---- Zinc finger protein 350 Source.2384: DFBPPR21166 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1 Source.2385: DFBPPR21175 ---- Animal proteins ---- Adenosine receptor A3 Source.2386: DFBPPR21186 ---- Animal proteins ---- 40S ribosomal protein S2 Source.2387: DFBPPR21188 ---- Animal proteins ---- High mobility group protein B4 Source.2388: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin Source.2389: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1 Source.2390: DFBPPR21201 ---- Animal proteins ---- mRNA turnover protein 4 homolog Source.2391: DFBPPR21204 ---- Animal proteins ---- ADP-ribosylation factor-like protein 5A Source.2392: DFBPPR21213 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2 Source.2393: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2 Source.2394: DFBPPR21226 ---- Animal proteins ---- GPN-loop GTPase 2 Source.2395: DFBPPR21237 ---- Animal proteins ---- MIF4G domain-containing protein Source.2396: DFBPPR21245 ---- Animal proteins ---- Cilia- and flagella-associated protein 36 Source.2397: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5 Source.2398: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1 Source.2399: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3 Source.2400: DFBPPR21272 ---- Animal proteins ---- Testin Source.2401: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein Source.2402: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2 Source.2403: DFBPPR21281 ---- Animal proteins ---- 28S ribosomal protein S36, mitochondrial Source.2404: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6 Source.2405: DFBPPR21285 ---- Animal proteins ---- Inactive ribonuclease-like protein 10 Source.2406: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2 Source.2407: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5 Source.2408: DFBPPR21292 ---- Animal proteins ---- Probable inactive serine protease 58 Source.2409: DFBPPR21299 ---- Animal proteins ---- Secretogranin-3 Source.2410: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein Source.2411: DFBPPR21321 ---- Animal proteins ---- Zinc finger matrin-type protein 3 Source.2412: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4 Source.2413: DFBPPR21330 ---- Animal proteins ---- 60S ribosomal export protein NMD3 Source.2414: DFBPPR21332 ---- Animal proteins ---- ER membrane protein complex subunit 4 Source.2415: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15 Source.2416: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C Source.2417: DFBPPR21348 ---- Animal proteins ---- Transmembrane protein 204 Source.2418: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter Source.2419: DFBPPR21350 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1 Source.2420: DFBPPR21356 ---- Animal proteins ---- Sideroflexin-2 Source.2421: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24 Source.2422: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2 Source.2423: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D Source.2424: DFBPPR21379 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2 Source.2425: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1 Source.2426: DFBPPR21404 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 1 Source.2427: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2 Source.2428: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A Source.2429: DFBPPR21418 ---- Animal proteins ---- Angiopoietin-related protein 1 Source.2430: DFBPPR21428 ---- Animal proteins ---- Protein LBH Source.2431: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1 Source.2432: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform Source.2433: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4 Source.2434: DFBPPR21453 ---- Animal proteins ---- Centrosomal protein of 19 kDa Source.2435: DFBPPR21457 ---- Animal proteins ---- Zinc finger protein 330 Source.2436: DFBPPR21463 ---- Animal proteins ---- Protein BEX2 Source.2437: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.2438: DFBPPR21466 ---- Animal proteins ---- Trafficking protein particle complex subunit 2-like protein Source.2439: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.2440: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4 Source.2441: DFBPPR21477 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 35 Source.2442: DFBPPR21481 ---- Animal proteins ---- EF-hand domain-containing protein D2 Source.2443: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1 Source.2444: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8 Source.2445: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4 Source.2446: DFBPPR21491 ---- Animal proteins ---- CUE domain-containing protein 2 Source.2447: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1 Source.2448: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47 Source.2449: DFBPPR21501 ---- Animal proteins ---- Peroxisomal biogenesis factor 3 Source.2450: DFBPPR21502 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 17 Source.2451: DFBPPR21504 ---- Animal proteins ---- Ribonuclease P protein subunit p40 Source.2452: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1 Source.2453: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S Source.2454: DFBPPR21510 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7 Source.2455: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1 Source.2456: DFBPPR21526 ---- Animal proteins ---- Interferon alpha-inducible protein 27-like protein 2 Source.2457: DFBPPR21530 ---- Animal proteins ---- Rhophilin-2 Source.2458: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19 Source.2459: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8 Source.2460: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9 Source.2461: DFBPPR21552 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 3 Source.2462: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135 Source.2463: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.2464: DFBPPR21578 ---- Animal proteins ---- Calcium-binding protein 5 Source.2465: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.2466: DFBPPR21590 ---- Animal proteins ---- Rhombotin-1 Source.2467: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma Source.2468: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase Source.2469: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1 Source.2470: DFBPPR21630 ---- Animal proteins ---- Maspardin Source.2471: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1 Source.2472: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44 Source.2473: DFBPPR21646 ---- Animal proteins ---- HSPB1-associated protein 1 Source.2474: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein Source.2475: DFBPPR21666 ---- Animal proteins ---- Importin-13 Source.2476: DFBPPR21670 ---- Animal proteins ---- V-type proton ATPase subunit E 2 Source.2477: DFBPPR21689 ---- Animal proteins ---- ADP-ribosylation factor-like protein 11 Source.2478: DFBPPR21693 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 18 Source.2479: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1 Source.2480: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3 Source.2481: DFBPPR21703 ---- Animal proteins ---- RRP15-like protein Source.2482: DFBPPR21710 ---- Animal proteins ---- Differentially expressed in FDCP 8 homolog Source.2483: DFBPPR21712 ---- Animal proteins ---- Serpin E3 Source.2484: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic Source.2485: DFBPPR21731 ---- Animal proteins ---- DnaJ homolog subfamily C member 17 Source.2486: DFBPPR21733 ---- Animal proteins ---- RUN domain-containing protein 3A Source.2487: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1 Source.2488: DFBPPR21735 ---- Animal proteins ---- Serpin A3-7 Source.2489: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1 Source.2490: DFBPPR21741 ---- Animal proteins ---- Meiotic nuclear division protein 1 homolog Source.2491: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2 Source.2492: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8 Source.2493: DFBPPR21756 ---- Animal proteins ---- Probable allantoicase Source.2494: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.2495: DFBPPR21779 ---- Animal proteins ---- Serpin B8 Source.2496: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1 Source.2497: DFBPPR21792 ---- Animal proteins ---- 39S ribosomal protein L19, mitochondrial Source.2498: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44 Source.2499: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial Source.2500: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2 Source.2501: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein Source.2502: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7 Source.2503: DFBPPR21825 ---- Animal proteins ---- Meiosis-specific nuclear structural protein 1 Source.2504: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B Source.2505: DFBPPR21845 ---- Animal proteins ---- PAK4-inhibitor INKA2 Source.2506: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein Source.2507: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14 Source.2508: DFBPPR21871 ---- Animal proteins ---- Serpin B10 Source.2509: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B Source.2510: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog Source.2511: DFBPPR21884 ---- Animal proteins ---- Calcium-binding protein 39 Source.2512: DFBPPR21896 ---- Animal proteins ---- Protein CNPPD1 Source.2513: DFBPPR21901 ---- Animal proteins ---- Calcyphosin Source.2514: DFBPPR21902 ---- Animal proteins ---- Centromere protein N Source.2515: DFBPPR21914 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 13 Source.2516: DFBPPR21934 ---- Animal proteins ---- Transcription elongation factor A protein-like 8 Source.2517: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1 Source.2518: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7 Source.2519: DFBPPR21952 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 6 Source.2520: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor Source.2521: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3 Source.2522: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.2523: DFBPPR21992 ---- Animal proteins ---- Intraflagellar transport-associated protein Source.2524: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1 Source.2525: DFBPPR22018 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.2526: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2 Source.2527: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein Source.2528: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.2529: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6 Source.2530: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1 Source.2531: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9 Source.2532: DFBPPR22083 ---- Animal proteins ---- 40S ribosomal protein S15a Source.2533: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36 Source.2534: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like Source.2535: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3 Source.2536: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2 Source.2537: DFBPPR22107 ---- Animal proteins ---- TLD domain-containing protein 2 Source.2538: DFBPPR22109 ---- Animal proteins ---- Host cell factor C1 regulator 1 Source.2539: DFBPPR22112 ---- Animal proteins ---- DPY30 domain-containing protein 1 Source.2540: DFBPPR22113 ---- Animal proteins ---- DPY30 domain-containing protein 1 Source.2541: DFBPPR22114 ---- Animal proteins ---- Specifically androgen-regulated gene protein Source.2542: DFBPPR22118 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 16C member 6 Source.2543: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein Source.2544: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31 Source.2545: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1 Source.2546: DFBPPR22148 ---- Animal proteins ---- Hemogen Source.2547: DFBPPR22151 ---- Animal proteins ---- RNA pseudouridylate synthase domain-containing protein 1 Source.2548: DFBPPR22154 ---- Animal proteins ---- Terminal nucleotidyltransferase 5B Source.2549: DFBPPR22172 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX14 Source.2550: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3 Source.2551: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6 Source.2552: DFBPPR22212 ---- Animal proteins ---- Protein Asterix Source.2553: DFBPPR22227 ---- Animal proteins ---- Tetraspanin-8 Source.2554: DFBPPR22240 ---- Animal proteins ---- Ataxin-10 Source.2555: DFBPPR22248 ---- Animal proteins ---- rRNA-processing protein FCF1 homolog Source.2556: DFBPPR22300 ---- Animal proteins ---- S100P-binding protein Source.2557: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2 Source.2558: DFBPPR22327 ---- Animal proteins ---- Small integral membrane protein 7 Source.2559: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.2560: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2 Source.2561: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63 Source.2562: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29 Source.2563: DFBPPR22360 ---- Animal proteins ---- Mitochondrial fission regulator 1-like Source.2564: DFBPPR22369 ---- Animal proteins ---- Transmembrane protein 247 Source.2565: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4 Source.2566: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39 Source.2567: DFBPPR22388 ---- Animal proteins ---- Oxidative stress-responsive serine-rich protein 1 Source.2568: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10 Source.2569: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.2570: DFBPPR22410 ---- Animal proteins ---- Small acidic protein Source.2571: DFBPPR22419 ---- Animal proteins ---- Prolyl-tRNA synthetase associated domain-containing protein 1 Source.2572: DFBPPR22422 ---- Animal proteins ---- UPF0428 protein CXorf56 homolog Source.2573: DFBPPR22438 ---- Animal proteins ---- Transmembrane 4 L6 family member 18 Source.2574: DFBPPR22439 ---- Animal proteins ---- PI-PLC X domain-containing protein 3 Source.2575: DFBPPR22461 ---- Animal proteins ---- Ashwin Source.2576: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1 Source.2577: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19 Source.2578: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3 Source.2579: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144 Source.2580: DFBPPR22507 ---- Animal proteins ---- Secernin-3 Source.2581: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1 Source.2582: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54 Source.2583: DFBPPR22528 ---- Animal proteins ---- Transmembrane protein 251 Source.2584: DFBPPR22539 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 18 Source.2585: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1 Source.2586: DFBPPR22550 ---- Animal proteins ---- Leucine-rich repeat-containing protein 23 Source.2587: DFBPPR22561 ---- Animal proteins ---- Pre-rRNA-processing protein TSR2 homolog Source.2588: DFBPPR22563 ---- Animal proteins ---- Methenyltetrahydrofolate synthase domain-containing protein Source.2589: DFBPPR22564 ---- Animal proteins ---- cAMP-dependent protein kinase inhibitor gamma Source.2590: DFBPPR22565 ---- Animal proteins ---- Probable RNA-binding protein 18 Source.2591: DFBPPR22573 ---- Animal proteins ---- UPF0461 protein C5orf24 homolog Source.2592: DFBPPR22589 ---- Animal proteins ---- Transmembrane protein 171 Source.2593: DFBPPR22590 ---- Animal proteins ---- Transmembrane protein 267 Source.2594: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42 Source.2595: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164 Source.2596: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1 Source.2597: DFBPPR22637 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 61 Source.2598: DFBPPR22642 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD4 Source.2599: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18 Source.2600: DFBPPR22645 ---- Animal proteins ---- UPF0602 protein C4orf47 homolog Source.2601: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32 Source.2602: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein Source.2603: DFBPPR22680 ---- Animal proteins ---- Proline-rich protein 32 Source.2604: DFBPPR22683 ---- Animal proteins ---- LYR motif-containing protein 2 Source.2605: DFBPPR22702 ---- Animal proteins ---- Coiled-coil domain-containing protein 83 Source.2606: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16 Source.2607: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11 Source.2608: DFBPPR22727 ---- Animal proteins ---- Uncharacterized protein C6orf163 homolog Source.2609: DFBPPR22753 ---- Animal proteins ---- Uncharacterized protein C3orf26 homolog Source.2610: DFBPPR8527 ---- Animal proteins ---- Tumor necrosis factor ligand superfamily member 6 Source.2611: DFBPPR8540 ---- Animal proteins ---- 4-aminobutyrate aminotransferase, mitochondrial Source.2612: DFBPPR8547 ---- Animal proteins ---- Prostaglandin reductase 1 Source.2613: DFBPPR8550 ---- Animal proteins ---- Complement C3 Source.2614: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein Source.2615: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1 Source.2616: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.2617: DFBPPR8570 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.2618: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1 Source.2619: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.2620: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.2621: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.2622: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1 Source.2623: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial Source.2624: DFBPPR8595 ---- Animal proteins ---- Annexin A4 Source.2625: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.2626: DFBPPR8602 ---- Animal proteins ---- TGF-beta receptor type-2 Source.2627: DFBPPR8605 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein Source.2628: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.2629: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial Source.2630: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.2631: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor Source.2632: DFBPPR8626 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.2633: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.2634: DFBPPR8639 ---- Animal proteins ---- Mannose-binding protein A Source.2635: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2 Source.2636: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3 Source.2637: DFBPPR8647 ---- Animal proteins ---- Beclin-1 Source.2638: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2 Source.2639: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein Source.2640: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase Source.2641: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.2642: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform Source.2643: DFBPPR8688 ---- Animal proteins ---- Vinculin Source.2644: DFBPPR8689 ---- Animal proteins ---- Wee1-like protein kinase 2 Source.2645: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.2646: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6 Source.2647: DFBPPR8694 ---- Animal proteins ---- Spastin Source.2648: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.2649: DFBPPR8696 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.2650: DFBPPR8698 ---- Animal proteins ---- Prorelaxin Source.2651: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI Source.2652: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial Source.2653: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.2654: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.2655: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2 Source.2656: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6 Source.2657: DFBPPR8717 ---- Animal proteins ---- Rhodopsin Source.2658: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.2659: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5 Source.2660: DFBPPR8734 ---- Animal proteins ---- Clusterin Source.2661: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor Source.2662: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1 Source.2663: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.2664: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2 Source.2665: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.2666: DFBPPR8753 ---- Animal proteins ---- Androgen receptor Source.2667: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I Source.2668: DFBPPR8759 ---- Animal proteins ---- Caveolin-3 Source.2669: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.2670: DFBPPR8766 ---- Animal proteins ---- Myoblast determination protein 1 Source.2671: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.2672: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.2673: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.2674: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.2675: DFBPPR8799 ---- Animal proteins ---- Parathyroid hormone Source.2676: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1 Source.2677: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.2678: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.2679: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.2680: DFBPPR8857 ---- Animal proteins ---- Allograft inflammatory factor 1 Source.2681: DFBPPR8871 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.2682: DFBPPR8872 ---- Animal proteins ---- Lanosterol 14-alpha demethylase Source.2683: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2 Source.2684: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor Source.2685: DFBPPR8897 ---- Animal proteins ---- Cytochrome b Source.2686: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.2687: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.2688: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase Source.2689: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.2690: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1 Source.2691: DFBPPR9006 ---- Animal proteins ---- Ribonuclease pancreatic Source.2692: DFBPPR9021 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.2693: DFBPPR9023 ---- Animal proteins ---- Forkhead box protein L2 Source.2694: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.2695: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.2696: DFBPPR9039 ---- Animal proteins ---- Desmin Source.2697: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.2698: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain Source.2699: DFBPPR9056 ---- Animal proteins ---- Protein S100-A11 Source.2700: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.2701: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.2702: DFBPPR9072 ---- Animal proteins ---- CD9 antigen Source.2703: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.2704: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.2705: DFBPPR9091 ---- Animal proteins ---- Antileukoproteinase Source.2706: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1 Source.2707: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2 Source.2708: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.2709: DFBPPR9121 ---- Animal proteins ---- Endoplasmin Source.2710: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2711: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.2712: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.2713: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A Source.2714: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.2715: DFBPPR9137 ---- Animal proteins ---- Microsomal glutathione S-transferase 1 Source.2716: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase Source.2717: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase Source.2718: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.2719: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.2720: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.2721: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.2722: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10 Source.2723: DFBPPR9208 ---- Animal proteins ---- Uteroferrin-associated protein Source.2724: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4 Source.2725: DFBPPR9216 ---- Animal proteins ---- Netrin-1 Source.2726: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII Source.2727: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.2728: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.2729: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta Source.2730: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.2731: DFBPPR9240 ---- Animal proteins ---- Thyrotropin subunit beta Source.2732: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2 Source.2733: DFBPPR9254 ---- Animal proteins ---- Complement factor D Source.2734: DFBPPR9257 ---- Animal proteins ---- Ribonuclease 4 Source.2735: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3 Source.2736: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.2737: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase Source.2738: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11 Source.2739: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3 Source.2740: DFBPPR9285 ---- Animal proteins ---- Saposin-B-Val Source.2741: DFBPPR9292 ---- Animal proteins ---- Protein S100-A10 Source.2742: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.2743: DFBPPR9308 ---- Animal proteins ---- Aromatase 3 Source.2744: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.2745: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3 Source.2746: DFBPPR9320 ---- Animal proteins ---- Aromatase 1 Source.2747: DFBPPR9330 ---- Animal proteins ---- Receptor activity-modifying protein 3 Source.2748: DFBPPR9331 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.2749: DFBPPR9339 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.2750: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1 Source.2751: DFBPPR9343 ---- Animal proteins ---- Alpha-1-antitrypsin Source.2752: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein Source.2753: DFBPPR9365 ---- Animal proteins ---- Aromatase 2 Source.2754: DFBPPR9369 ---- Animal proteins ---- Nuclear receptor subfamily 6 group A member 1 Source.2755: DFBPPR9373 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.2756: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.2757: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor Source.2758: DFBPPR9377 ---- Animal proteins ---- Myosin regulatory light polypeptide 9 Source.2759: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C Source.2760: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1 Source.2761: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D Source.2762: DFBPPR9392 ---- Animal proteins ---- mRNA export factor Source.2763: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5 Source.2764: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase Source.2765: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.2766: DFBPPR9399 ---- Animal proteins ---- High affinity copper uptake protein 1 Source.2767: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.2768: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.2769: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.2770: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin Source.2771: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2 Source.2772: DFBPPR9421 ---- Animal proteins ---- Inactive ribonuclease-like protein 10 Source.2773: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B Source.2774: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain Source.2775: DFBPPR9455 ---- Animal proteins ---- Cystatin-B Source.2776: DFBPPR9461 ---- Animal proteins ---- CCN family member 2 Source.2777: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.2778: DFBPPR9486 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase Source.2779: DFBPPR9487 ---- Animal proteins ---- Troponin C, slow skeletal and cardiac muscles Source.2780: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2 Source.2781: DFBPPR9505 ---- Animal proteins ---- Cytochrome c oxidase subunit 7C, mitochondrial Source.2782: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.2783: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa Source.2784: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3 Source.2785: DFBPPR9522 ---- Animal proteins ---- ATP synthase subunit a Source.2786: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1 Source.2787: DFBPPR9536 ---- Animal proteins ---- ATP synthase subunit O, mitochondrial Source.2788: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.2789: DFBPPR9542 ---- Animal proteins ---- Amine oxidase [flavin-containing] B Source.2790: DFBPPR9544 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.2791: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.2792: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1 Source.2793: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.2794: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.2795: DFBPPR9590 ---- Animal proteins ---- Bax inhibitor 1 Source.2796: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin Source.2797: DFBPPR9609 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.2798: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2 Source.2799: DFBPPR9623 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2 Source.2800: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.2801: DFBPPR9637 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.2802: DFBPPR9645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.2803: DFBPPR9652 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit gamma, mitochondrial Source.2804: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6 Source.2805: DFBPPR9664 ---- Animal proteins ---- Perilipin-2 Source.2806: DFBPPR9668 ---- Animal proteins ---- Reactive oxygen species modulator 1 Source.2807: DFBPPR9682 ---- Animal proteins ---- Cytidine monophosphate-N-acetylneuraminic acid hydroxylase Source.2808: DFBPPR9684 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.2809: DFBPPR9697 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial Source.2810: DFBPPR9699 ---- Animal proteins ---- Angiopoietin-1 Source.2811: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39 Source.2812: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein Source.2813: DFBPPR9708 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 7 Source.2814: DFBPPR9718 ---- Animal proteins ---- Troponin C, skeletal muscle Source.2815: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.2816: DFBPPR9725 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.2817: DFBPPR9726 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.2818: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.2819: DFBPPR9729 ---- Animal proteins ---- Secretagogin Source.2820: DFBPPR9752 ---- Animal proteins ---- GPN-loop GTPase 2 Source.2821: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2822: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.2823: DFBPPR9769 ---- Animal proteins ---- Lipocalin-1 Source.2824: DFBPPR9814 ---- Animal proteins ---- Testin Source.2825: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.2826: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2827: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A Source.2828: DFBPPR9836 ---- Animal proteins ---- Forkhead box protein N3 Source.2829: DFBPPR9843 ---- Animal proteins ---- P protein Source.2830: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6 Source.2831: DFBPPR9884 ---- Animal proteins ---- Cartilage intermediate layer protein 1 Source.2832: DFBPPR9889 ---- Animal proteins ---- Cystatin-A1 Source.2833: DFBPPR9891 ---- Animal proteins ---- T-complex protein 1 subunit gamma Source.2834: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D Source.2835: DFBPPR9898 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Source.2836: DFBPPR9906 ---- Animal proteins ---- Tetraspanin-9 Source.2837: DFBPPR9911 ---- Animal proteins ---- Protein Asterix Source.2838: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2 Source.2839: DFBPPR9922 ---- Animal proteins ---- cAMP-dependent protein kinase inhibitor gamma Source.2840: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.2841: DFBPPR9943 ---- Animal proteins ---- Transmembrane protein 251 Source.2842: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3 Source.2843: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1 Source.2844: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor Source.2845: DFBPPR9971 ---- Animal proteins ---- Ovotransferrin Source.2846: DFBPPR9987 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein Source.2847: DFBPPR9988 ---- Animal proteins ---- Vinculin Source.2848: DFBPPR9993 ---- Animal proteins ---- Ovalbumin Source.2849: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.2850: DFBPPR10004 ---- Animal proteins ---- Spastin Source.2851: DFBPPR10019 ---- Animal proteins ---- Extracellular fatty acid-binding protein Source.2852: DFBPPR10024 ---- Animal proteins ---- Myosin light polypeptide 6 Source.2853: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.2854: DFBPPR10031 ---- Animal proteins ---- Calcineurin B homologous protein 1 Source.2855: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor Source.2856: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase Source.2857: DFBPPR10045 ---- Animal proteins ---- Albumin Source.2858: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.2859: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4 Source.2860: DFBPPR10058 ---- Animal proteins ---- Prospero homeobox protein 1 Source.2861: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.2862: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.2863: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6 Source.2864: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2 Source.2865: DFBPPR10083 ---- Animal proteins ---- Myosin-9 Source.2866: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type Source.2867: DFBPPR10085 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1 Source.2868: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial Source.2869: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.2870: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S Source.2871: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog Source.2872: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3 Source.2873: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase Source.2874: DFBPPR10114 ---- Animal proteins ---- Cadherin-5 Source.2875: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.2876: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.2877: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase Source.2878: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.2879: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2 Source.2880: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.2881: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3 Source.2882: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.2883: DFBPPR10152 ---- Animal proteins ---- Vitamin D3 receptor Source.2884: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.2885: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial Source.2886: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos Source.2887: DFBPPR10171 ---- Animal proteins ---- Heterochromatin-associated protein MENT Source.2888: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.2889: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha Source.2890: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.2891: DFBPPR10184 ---- Animal proteins ---- LIM/homeobox protein Lhx1 Source.2892: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1 Source.2893: DFBPPR10188 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.2894: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.2895: DFBPPR10203 ---- Animal proteins ---- Protein/nucleic acid deglycase DJ-1 Source.2896: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule Source.2897: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.2898: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1 Source.2899: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1 Source.2900: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2 Source.2901: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1 Source.2902: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4 Source.2903: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3 Source.2904: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1 Source.2905: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2 Source.2906: DFBPPR10244 ---- Animal proteins ---- Inhibin beta A chain Source.2907: DFBPPR10250 ---- Animal proteins ---- Macrophage migration inhibitory factor Source.2908: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5 Source.2909: DFBPPR10268 ---- Animal proteins ---- CD166 antigen Source.2910: DFBPPR10270 ---- Animal proteins ---- Agrin Source.2911: DFBPPR10274 ---- Animal proteins ---- CCN family member 1 Source.2912: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B Source.2913: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2914: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.2915: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.2916: DFBPPR10299 ---- Animal proteins ---- Myoblast determination protein 1 homolog Source.2917: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.2918: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2 Source.2919: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.2920: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase Source.2921: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2 Source.2922: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme Source.2923: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4 Source.2924: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK Source.2925: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.2926: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK Source.2927: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.2928: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta Source.2929: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2 Source.2930: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase Source.2931: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA Source.2932: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.2933: DFBPPR10389 ---- Animal proteins ---- Neuronal PAS domain-containing protein 2 Source.2934: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.2935: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1 Source.2936: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1 Source.2937: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2 Source.2938: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.2939: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.2940: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.2941: DFBPPR10416 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.2942: DFBPPR10418 ---- Animal proteins ---- Green-sensitive opsin Source.2943: DFBPPR10421 ---- Animal proteins ---- Prostaglandin E synthase 3 Source.2944: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.2945: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog Source.2946: DFBPPR10427 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle major isoform Source.2947: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2948: DFBPPR10432 ---- Animal proteins ---- Endoplasmin Source.2949: DFBPPR10434 ---- Animal proteins ---- Parathyroid hormone Source.2950: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.2951: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.2952: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial Source.2953: DFBPPR10448 ---- Animal proteins ---- Serine/threonine-protein kinase 4 Source.2954: DFBPPR10456 ---- Animal proteins ---- Neuroserpin Source.2955: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3 Source.2956: DFBPPR10459 ---- Animal proteins ---- Reelin Source.2957: DFBPPR10468 ---- Animal proteins ---- KH domain-containing, RNA-binding, signal transduction-associated protein 1 Source.2958: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.2959: DFBPPR10472 ---- Animal proteins ---- Cytosolic 5'-nucleotidase 3A Source.2960: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.2961: DFBPPR10485 ---- Animal proteins ---- LIM domain-binding protein 1 Source.2962: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6 Source.2963: DFBPPR10491 ---- Animal proteins ---- Neuronal calcium sensor 1 Source.2964: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7 Source.2965: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4 Source.2966: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon Source.2967: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.2968: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3 Source.2969: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.2970: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.2971: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9 Source.2972: DFBPPR10531 ---- Animal proteins ---- Serpin H1 Source.2973: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase Source.2974: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1 Source.2975: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4 Source.2976: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein Source.2977: DFBPPR10541 ---- Animal proteins ---- Glypican-1 Source.2978: DFBPPR10545 ---- Animal proteins ---- Transcriptional activator GLI3 Source.2979: DFBPPR10546 ---- Animal proteins ---- Calmodulin Source.2980: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2 Source.2981: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.2982: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2 Source.2983: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71 Source.2984: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein Source.2985: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b Source.2986: DFBPPR10577 ---- Animal proteins ---- Frizzled-10 Source.2987: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B Source.2988: DFBPPR10582 ---- Animal proteins ---- Small nuclear ribonucleoprotein-associated protein B' Source.2989: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.2990: DFBPPR10594 ---- Animal proteins ---- Aromatase Source.2991: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit Source.2992: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1 Source.2993: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.2994: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.2995: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM Source.2996: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.2997: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit Source.2998: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.2999: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2 Source.3000: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai Source.3001: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.3002: DFBPPR10640 ---- Animal proteins ---- Caveolin-1 Source.3003: DFBPPR10642 ---- Animal proteins ---- Protein disulfide-isomerase A3 Source.3004: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.3005: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain Source.3006: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.3007: DFBPPR10662 ---- Animal proteins ---- CCN family member 3 Source.3008: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain Source.3009: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.3010: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.3011: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein Source.3012: DFBPPR10676 ---- Animal proteins ---- Dual specificity protein phosphatase 4 Source.3013: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.3014: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.3015: DFBPPR10691 ---- Animal proteins ---- Beclin-1 Source.3016: DFBPPR10702 ---- Animal proteins ---- Telomeric repeat-binding factor 2 Source.3017: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.3018: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain Source.3019: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2 Source.3020: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1 Source.3021: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha Source.3022: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.3023: DFBPPR10744 ---- Animal proteins ---- Troponin C, skeletal muscle Source.3024: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.3025: DFBPPR10758 ---- Animal proteins ---- Tubulin-specific chaperone A Source.3026: DFBPPR10765 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2 Source.3027: DFBPPR10770 ---- Animal proteins ---- Mannose-binding protein Source.3028: DFBPPR10779 ---- Animal proteins ---- Natriuretic peptides A Source.3029: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain Source.3030: DFBPPR10787 ---- Animal proteins ---- Angiogenin Source.3031: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1 Source.3032: DFBPPR10799 ---- Animal proteins ---- Adenylosuccinate lyase Source.3033: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V Source.3034: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.3035: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A Source.3036: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.3037: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5 Source.3038: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.3039: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3 Source.3040: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26 Source.3041: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein Source.3042: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11 Source.3043: DFBPPR10871 ---- Animal proteins ---- Carnosine N-methyltransferase 2 Source.3044: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.3045: DFBPPR10885 ---- Animal proteins ---- Pepsin A Source.3046: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1 Source.3047: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T Source.3048: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain Source.3049: DFBPPR10896 ---- Animal proteins ---- Contactin-5 Source.3050: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.3051: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149 Source.3052: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A Source.3053: DFBPPR10918 ---- Animal proteins ---- Frizzled-2 Source.3054: DFBPPR10924 ---- Animal proteins ---- Spliceosome RNA helicase DDX39B Source.3055: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28 Source.3056: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein Source.3057: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.3058: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.3059: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1 Source.3060: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain Source.3061: DFBPPR10945 ---- Animal proteins ---- Prosaposin Source.3062: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y Source.3063: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta Source.3064: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta Source.3065: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.3066: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1 Source.3067: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5 Source.3068: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.3069: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2 Source.3070: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2 Source.3071: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2 Source.3072: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.3073: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain Source.3074: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D Source.3075: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1 Source.3076: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1 Source.3077: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.3078: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji Source.3079: DFBPPR11031 ---- Animal proteins ---- Ribonuclease homolog Source.3080: DFBPPR11036 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily B member 1 Source.3081: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2 Source.3082: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.3083: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1 Source.3084: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.3085: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2 Source.3086: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.3087: DFBPPR11068 ---- Animal proteins ---- ATP synthase subunit a Source.3088: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein Source.3089: DFBPPR11073 ---- Animal proteins ---- Axin-1 Source.3090: DFBPPR11079 ---- Animal proteins ---- Frizzled-1 Source.3091: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1 Source.3092: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.3093: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.3094: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326 Source.3095: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.3096: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin Source.3097: DFBPPR11117 ---- Animal proteins ---- Transcription factor jun-D Source.3098: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14 Source.3099: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.3100: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform Source.3101: DFBPPR11134 ---- Animal proteins ---- Keratocan Source.3102: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1 Source.3103: DFBPPR11142 ---- Animal proteins ---- Type I iodothyronine deiodinase Source.3104: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.3105: DFBPPR11153 ---- Animal proteins ---- Toll-interacting protein Source.3106: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain Source.3107: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein Source.3108: DFBPPR11185 ---- Animal proteins ---- Adenosine deaminase 2 Source.3109: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1 Source.3110: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3 Source.3111: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase Source.3112: DFBPPR11198 ---- Animal proteins ---- Transforming protein p68/c-ets-1 Source.3113: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.3114: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1 Source.3115: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T Source.3116: DFBPPR11209 ---- Animal proteins ---- Protein S100-A11 Source.3117: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.3118: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase Source.3119: DFBPPR11226 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K Source.3120: DFBPPR11227 ---- Animal proteins ---- Malate dehydrogenase, cytoplasmic Source.3121: DFBPPR11229 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit H Source.3122: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2 Source.3123: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5 Source.3124: DFBPPR11253 ---- Animal proteins ---- Peripherin-2 Source.3125: DFBPPR11254 ---- Animal proteins ---- Intracellular hyaluronan-binding protein 4 Source.3126: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B Source.3127: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1 Source.3128: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog Source.3129: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.3130: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.3131: DFBPPR11307 ---- Animal proteins ---- Thyrotropin subunit beta Source.3132: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog Source.3133: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.3134: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog Source.3135: DFBPPR11337 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 1 Source.3136: DFBPPR11340 ---- Animal proteins ---- Transforming protein p54/c-ets-1 Source.3137: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial Source.3138: DFBPPR11345 ---- Animal proteins ---- LIM/homeobox protein LMX-1.2 Source.3139: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.3140: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase Source.3141: DFBPPR11352 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.3142: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3 Source.3143: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14 Source.3144: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10 Source.3145: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1 Source.3146: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.3147: DFBPPR11397 ---- Animal proteins ---- Frizzled-3 Source.3148: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial Source.3149: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47 Source.3150: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF Source.3151: DFBPPR11410 ---- Animal proteins ---- Target of Myb protein 1 Source.3152: DFBPPR11411 ---- Animal proteins ---- Zinc finger protein ubi-d4 Source.3153: DFBPPR11417 ---- Animal proteins ---- LRP chaperone MESD Source.3154: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0 Source.3155: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1 Source.3156: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1 Source.3157: DFBPPR11433 ---- Animal proteins ---- Peroxiredoxin-like 2A Source.3158: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic Source.3159: DFBPPR11437 ---- Animal proteins ---- 45 kDa calcium-binding protein Source.3160: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform Source.3161: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48 Source.3162: DFBPPR11450 ---- Animal proteins ---- Potassium voltage-gated channel subfamily G member 2 Source.3163: DFBPPR11453 ---- Animal proteins ---- Charged multivesicular body protein 2a Source.3164: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog Source.3165: DFBPPR11472 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein Source.3166: DFBPPR11476 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2 Source.3167: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9 Source.3168: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein Source.3169: DFBPPR11493 ---- Animal proteins ---- Interferon regulatory factor 1 Source.3170: DFBPPR11498 ---- Animal proteins ---- Troponin C, slow skeletal and cardiac muscles Source.3171: DFBPPR11500 ---- Animal proteins ---- Ovalbumin-related protein X Source.3172: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2 Source.3173: DFBPPR11508 ---- Animal proteins ---- Cellular retinoic acid-binding protein 2 Source.3174: DFBPPR11512 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog Source.3175: DFBPPR11518 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.3176: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.3177: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1 Source.3178: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4 Source.3179: DFBPPR11531 ---- Animal proteins ---- Protein AATF Source.3180: DFBPPR11532 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle minor isoform Source.3181: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80 Source.3182: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein Source.3183: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.3184: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2 Source.3185: DFBPPR11549 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein C Source.3186: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial Source.3187: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.3188: DFBPPR11554 ---- Animal proteins ---- Troponin I, cardiac muscle Source.3189: DFBPPR11557 ---- Animal proteins ---- Regulator of G-protein signaling 17 Source.3190: DFBPPR11558 ---- Animal proteins ---- Nuclear migration protein nudC Source.3191: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2 Source.3192: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.3193: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.3194: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.3195: DFBPPR11589 ---- Animal proteins ---- Epithelial cell adhesion molecule Source.3196: DFBPPR11593 ---- Animal proteins ---- Syndetin Source.3197: DFBPPR11594 ---- Animal proteins ---- Transmembrane protein 230 Source.3198: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.3199: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.3200: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A Source.3201: DFBPPR11612 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.3202: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2 Source.3203: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C Source.3204: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1 Source.3205: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2 Source.3206: DFBPPR11638 ---- Animal proteins ---- Coatomer subunit epsilon Source.3207: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4 Source.3208: DFBPPR11645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.3209: DFBPPR11649 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3 Source.3210: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus Source.3211: DFBPPR11657 ---- Animal proteins ---- Protein BTG1 Source.3212: DFBPPR11658 ---- Animal proteins ---- TAR DNA-binding protein 43 Source.3213: DFBPPR11678 ---- Animal proteins ---- Protein ABHD13 Source.3214: DFBPPR11679 ---- Animal proteins ---- Spondin-1 Source.3215: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H Source.3216: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1 Source.3217: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit Source.3218: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.3219: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.3220: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.3221: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1 Source.3222: DFBPPR11724 ---- Animal proteins ---- Protein TENP Source.3223: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1 Source.3224: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1 Source.3225: DFBPPR11742 ---- Animal proteins ---- 28S ribosomal protein S7, mitochondrial Source.3226: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog Source.3227: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1 Source.3228: DFBPPR11749 ---- Animal proteins ---- Homeobox protein Hox-A3 Source.3229: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.3230: DFBPPR11755 ---- Animal proteins ---- Single-stranded DNA-binding protein 3 Source.3231: DFBPPR11756 ---- Animal proteins ---- Glutaredoxin-1 Source.3232: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.3233: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B Source.3234: DFBPPR11772 ---- Animal proteins ---- Cbp/p300-interacting transactivator 3 Source.3235: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.3236: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor Source.3237: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta Source.3238: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B Source.3239: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2 Source.3240: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog Source.3241: DFBPPR11803 ---- Animal proteins ---- Translocation protein SEC62 Source.3242: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3 Source.3243: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1 Source.3244: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A Source.3245: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.3246: DFBPPR11818 ---- Animal proteins ---- Nuclear nucleic acid-binding protein C1D Source.3247: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.3248: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog Source.3249: DFBPPR11821 ---- Animal proteins ---- Thymocyte nuclear protein 1 Source.3250: DFBPPR11823 ---- Animal proteins ---- Solute carrier family 25 member 36 Source.3251: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.3252: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.3253: DFBPPR11828 ---- Animal proteins ---- Spindlin-Z Source.3254: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13 Source.3255: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6 Source.3256: DFBPPR11843 ---- Animal proteins ---- Visinin-like protein 1 Source.3257: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9 Source.3258: DFBPPR11850 ---- Animal proteins ---- COP9 signalosome complex subunit 3 Source.3259: DFBPPR11851 ---- Animal proteins ---- Borealin Source.3260: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase Source.3261: DFBPPR11856 ---- Animal proteins ---- Spindlin-W Source.3262: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24 Source.3263: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10 Source.3264: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3 Source.3265: DFBPPR11864 ---- Animal proteins ---- Radixin Source.3266: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog Source.3267: DFBPPR11871 ---- Animal proteins ---- RAD51-associated protein 1 Source.3268: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.3269: DFBPPR11874 ---- Animal proteins ---- Serum response factor Source.3270: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like Source.3271: DFBPPR11879 ---- Animal proteins ---- Nicalin Source.3272: DFBPPR11884 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein Source.3273: DFBPPR11885 ---- Animal proteins ---- ELL-associated factor 2 Source.3274: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8 Source.3275: DFBPPR11891 ---- Animal proteins ---- TBCC domain-containing protein 1 Source.3276: DFBPPR11900 ---- Animal proteins ---- Calcipressin-3 Source.3277: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A Source.3278: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog Source.3279: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59 Source.3280: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2 Source.3281: DFBPPR11938 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1 Source.3282: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase Source.3283: DFBPPR11940 ---- Animal proteins ---- Calmodulin, striated muscle Source.3284: DFBPPR11941 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 1 Source.3285: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog Source.3286: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein Source.3287: DFBPPR11963 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.3288: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase Source.3289: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1 Source.3290: DFBPPR11981 ---- Animal proteins ---- Histone deacetylase complex subunit SAP130 Source.3291: DFBPPR11986 ---- Animal proteins ---- Zinc finger Ran-binding domain-containing protein 2 Source.3292: DFBPPR11989 ---- Animal proteins ---- BUD13 homolog Source.3293: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1 Source.3294: DFBPPR11993 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 variant 2 Source.3295: DFBPPR11999 ---- Animal proteins ---- Dymeclin Source.3296: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a Source.3297: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2 Source.3298: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7 Source.3299: DFBPPR12031 ---- Animal proteins ---- Exportin-7 Source.3300: DFBPPR12050 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1 Source.3301: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24 Source.3302: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog Source.3303: DFBPPR12055 ---- Animal proteins ---- Importin-13 Source.3304: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1 Source.3305: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog Source.3306: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9 Source.3307: DFBPPR12065 ---- Animal proteins ---- Testin Source.3308: DFBPPR12068 ---- Animal proteins ---- Serine/arginine repetitive matrix protein 1 Source.3309: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14 Source.3310: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2 Source.3311: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121 Source.3312: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16 Source.3313: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like Source.3314: DFBPPR12093 ---- Animal proteins ---- 28S ribosomal protein S6, mitochondrial Source.3315: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1 Source.3316: DFBPPR12112 ---- Animal proteins ---- Protein LBH Source.3317: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21 Source.3318: DFBPPR12116 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.3319: DFBPPR12118 ---- Animal proteins ---- Protein EURL Source.3320: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A Source.3321: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.3322: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.3323: DFBPPR12131 ---- Animal proteins ---- Exportin-4 Source.3324: DFBPPR12133 ---- Animal proteins ---- Protein Asterix Source.3325: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.3326: DFBPPR12139 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 6 Source.3327: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C Source.3328: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2 Source.3329: DFBPPR12163 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2 Source.3330: DFBPPR12164 ---- Animal proteins ---- Neo-calmodulin Source.3331: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A Source.3332: DFBPPR12174 ---- Animal proteins ---- Protein CNPPD1 Source.3333: DFBPPR12175 ---- Animal proteins ---- Ashwin Source.3334: DFBPPR12184 ---- Animal proteins ---- GRIN2-like protein Source.3335: DFBPPR12190 ---- Animal proteins ---- Transmembrane protein 251 Source.3336: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B Source.3337: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B Source.3338: DFBPPR12203 ---- Animal proteins ---- Small acidic protein Source.3339: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11 Source.3340: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9 Source.3341: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog Source.3342: DFBPPR12222 ---- Animal proteins ---- Coiled-coil domain-containing protein 43 Source.3343: DFBPPR12226 ---- Animal proteins ---- Protein DGCR6 Source.3344: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10 Source.3345: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.3346: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.3347: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.3348: DFBPPR12252 ---- Animal proteins ---- Phosphoglucomutase-1 Source.3349: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.3350: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2 Source.3351: DFBPPR12266 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-alpha catalytic subunit Source.3352: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.3353: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1 Source.3354: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.3355: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.3356: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.3357: DFBPPR12289 ---- Animal proteins ---- Serine/threonine-protein phosphatase PP1-beta catalytic subunit Source.3358: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.3359: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type Source.3360: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1 Source.3361: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.3362: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.3363: DFBPPR12318 ---- Animal proteins ---- Endothelin-1 Source.3364: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.3365: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5 Source.3366: DFBPPR12324 ---- Animal proteins ---- Androgen receptor Source.3367: DFBPPR12327 ---- Animal proteins ---- Protein kinase C zeta type Source.3368: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type Source.3369: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.3370: DFBPPR12333 ---- Animal proteins ---- Angiogenin Source.3371: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.3372: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.3373: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14 Source.3374: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.3375: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor Source.3376: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta Source.3377: DFBPPR12350 ---- Animal proteins ---- Troponin T, cardiac muscle Source.3378: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.3379: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.3380: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5 Source.3381: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.3382: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.3383: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.3384: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type Source.3385: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1 Source.3386: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.3387: DFBPPR12389 ---- Animal proteins ---- Clusterin Source.3388: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor Source.3389: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.3390: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.3391: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase Source.3392: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1 Source.3393: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.3394: DFBPPR12409 ---- Animal proteins ---- Glycogen [starch] synthase, muscle Source.3395: DFBPPR12417 ---- Animal proteins ---- Rhodopsin Source.3396: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.3397: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.3398: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 Source.3399: DFBPPR12437 ---- Animal proteins ---- Trehalase Source.3400: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.3401: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.3402: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1 Source.3403: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase Source.3404: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1 Source.3405: DFBPPR12468 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.3406: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1 Source.3407: DFBPPR12474 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-2 Source.3408: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha Source.3409: DFBPPR12484 ---- Animal proteins ---- Myosin-4 Source.3410: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.3411: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle Source.3412: DFBPPR12488 ---- Animal proteins ---- 7-alpha-hydroxycholest-4-en-3-one 12-alpha-hydroxylase Source.3413: DFBPPR12495 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma Source.3414: DFBPPR12501 ---- Animal proteins ---- Ezrin Source.3415: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain Source.3416: DFBPPR12513 ---- Animal proteins ---- Serine--tRNA ligase, cytoplasmic Source.3417: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.3418: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase Source.3419: DFBPPR12522 ---- Animal proteins ---- Alpha-lactalbumin Source.3420: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.3421: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase Source.3422: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.3423: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor Source.3424: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.3425: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.3426: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.3427: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2 Source.3428: DFBPPR12560 ---- Animal proteins ---- Calumenin Source.3429: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.3430: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11 Source.3431: DFBPPR12577 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein K Source.3432: DFBPPR12578 ---- Animal proteins ---- Troponin I, cardiac muscle Source.3433: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.3434: DFBPPR12585 ---- Animal proteins ---- Calmodulin Source.3435: DFBPPR12588 ---- Animal proteins ---- Phosphoserine aminotransferase Source.3436: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.3437: DFBPPR12611 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1A Source.3438: DFBPPR12624 ---- Animal proteins ---- Heparin cofactor 2 Source.3439: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4 Source.3440: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0) Source.3441: DFBPPR12635 ---- Animal proteins ---- Prostaglandin E synthase 3 Source.3442: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1 Source.3443: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3 Source.3444: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.3445: DFBPPR12680 ---- Animal proteins ---- Tubulin-specific chaperone A Source.3446: DFBPPR12710 ---- Animal proteins ---- Endoplasmin Source.3447: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform Source.3448: DFBPPR12728 ---- Animal proteins ---- Cytochrome b Source.3449: DFBPPR12731 ---- Animal proteins ---- Cholinesterase Source.3450: DFBPPR12733 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 2 Source.3451: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.3452: DFBPPR12735 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.3453: DFBPPR12746 ---- Animal proteins ---- Collagen alpha-4(IV) chain Source.3454: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2 Source.3455: DFBPPR12756 ---- Animal proteins ---- Aromatase Source.3456: DFBPPR12759 ---- Animal proteins ---- Interleukin-1 beta Source.3457: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5 Source.3458: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.3459: DFBPPR12775 ---- Animal proteins ---- Troponin C, skeletal muscle Source.3460: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.3461: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.3462: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase Source.3463: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10 Source.3464: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6 Source.3465: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain Source.3466: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1 Source.3467: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta Source.3468: DFBPPR12814 ---- Animal proteins ---- Ileal sodium/bile acid cotransporter Source.3469: DFBPPR12817 ---- Animal proteins ---- Cathepsin E Source.3470: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin Source.3471: DFBPPR12825 ---- Animal proteins ---- Bleomycin hydrolase Source.3472: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B Source.3473: DFBPPR12841 ---- Animal proteins ---- Forkhead box protein L2 Source.3474: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.3475: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4 Source.3476: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1 Source.3477: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase Source.3478: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.3479: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13 Source.3480: DFBPPR12905 ---- Animal proteins ---- ATP synthase subunit a Source.3481: DFBPPR12930 ---- Animal proteins ---- Kappa-casein Source.3482: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.3483: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C Source.3484: DFBPPR12945 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.3485: DFBPPR12949 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.3486: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.3487: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor Source.3488: DFBPPR12963 ---- Animal proteins ---- Adenosine receptor A3 Source.3489: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter Source.3490: DFBPPR12980 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.3491: DFBPPR12990 ---- Animal proteins ---- Poly(rC)-binding protein 1 Source.3492: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1 Source.3493: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.3494: DFBPPR13003 ---- Animal proteins ---- Calcyphosin Source.3495: DFBPPR13004 ---- Animal proteins ---- Protein S100-A10 Source.3496: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.3497: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.3498: DFBPPR13009 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.3499: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter Source.3500: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A Source.3501: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2 Source.3502: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.3503: DFBPPR13027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.3504: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter Source.3505: DFBPPR13048 ---- Animal proteins ---- Myosin regulatory light chain 2, skeletal muscle isoform type 1 Source.3506: DFBPPR13054 ---- Animal proteins ---- Relaxin-like protein SQ10 Source.3507: DFBPPR13080 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.3508: DFBPPR13092 ---- Animal proteins ---- Testin Source.3509: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236 Source.3510: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.3511: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta Source.3512: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.3513: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor Source.3514: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.3515: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2 Source.3516: DFBPPR13176 ---- Animal proteins ---- Aromatase Source.3517: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2 Source.3518: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type Source.3519: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4 Source.3520: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.3521: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11 Source.3522: DFBPPR13205 ---- Animal proteins ---- Collagenase 3 Source.3523: DFBPPR13209 ---- Animal proteins ---- Parathyroid hormone Source.3524: DFBPPR13210 ---- Animal proteins ---- Angiogenin Source.3525: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.3526: DFBPPR13233 ---- Animal proteins ---- Fibronectin Source.3527: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic Source.3528: DFBPPR13256 ---- Animal proteins ---- Interleukin-1 beta Source.3529: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.3530: DFBPPR13277 ---- Animal proteins ---- Cholinesterase Source.3531: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.3532: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor Source.3533: DFBPPR13291 ---- Animal proteins ---- Myosin-7 Source.3534: DFBPPR13295 ---- Animal proteins ---- Alpha-1-antiproteinase 2 Source.3535: DFBPPR13305 ---- Animal proteins ---- Cytochrome b Source.3536: DFBPPR13310 ---- Animal proteins ---- Thyrotropin subunit beta Source.3537: DFBPPR13314 ---- Animal proteins ---- Myosin-1 Source.3538: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.3539: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.3540: DFBPPR13330 ---- Animal proteins ---- Uterocalin Source.3541: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2 Source.3542: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.3543: DFBPPR13338 ---- Animal proteins ---- Troponin I, cardiac muscle Source.3544: DFBPPR13341 ---- Animal proteins ---- ATP synthase subunit a Source.3545: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.3546: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.3547: DFBPPR13363 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.3548: DFBPPR13365 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.3549: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.3550: DFBPPR13369 ---- Animal proteins ---- Inactive ribonuclease-like protein 10 Source.3551: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2 Source.3552: DFBPPR13385 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.3553: DFBPPR13386 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.3554: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.3555: DFBPPR13393 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.3556: DFBPPR13409 ---- Animal proteins ---- Testin Source.3557: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.3558: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2 Source.3559: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.3560: DFBPPR13430 ---- Animal proteins ---- Ribonuclease pancreatic Source.3561: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase Source.3562: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2 Source.3563: DFBPPR13434 ---- Animal proteins ---- Aromatase Source.3564: DFBPPR13435 ---- Animal proteins ---- Forkhead box protein L2 Source.3565: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1 Source.3566: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.3567: DFBPPR13464 ---- Animal proteins ---- Interferon tau Source.3568: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase Source.3569: DFBPPR13469 ---- Animal proteins ---- Cytochrome b Source.3570: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.3571: DFBPPR13473 ---- Animal proteins ---- Glycoprotein hormones alpha chain Source.3572: DFBPPR13481 ---- Animal proteins ---- Somatotropin Source.3573: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.3574: DFBPPR13492 ---- Animal proteins ---- ATP synthase subunit a Source.3575: DFBPPR13498 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.3576: DFBPPR13500 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.3577: DFBPPR13506 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.3578: DFBPPR13540 ---- Animal proteins ---- Somatotropin Source.3579: DFBPPR13543 ---- Animal proteins ---- Myoblast determination protein 1 Source.3580: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.3581: DFBPPR13555 ---- Animal proteins ---- Mitochondrial brown fat uncoupling protein 1 Source.3582: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.3583: DFBPPR13564 ---- Animal proteins ---- Calmodulin Source.3584: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.3585: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2 Source.3586: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.3587: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.3588: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.3589: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.3590: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2 Source.3591: DFBPPR13601 ---- Animal proteins ---- Cathepsin B Source.3592: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.3593: DFBPPR13605 ---- Animal proteins ---- Rhodopsin Source.3594: DFBPPR13607 ---- Animal proteins ---- Ribonuclease pancreatic Source.3595: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial Source.3596: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.3597: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta Source.3598: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2 Source.3599: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2 Source.3600: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor Source.3601: DFBPPR13633 ---- Animal proteins ---- Interferon tau-2 Source.3602: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1 Source.3603: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2 Source.3604: DFBPPR13645 ---- Animal proteins ---- Interferon tau-6 Source.3605: DFBPPR13653 ---- Animal proteins ---- Interferon tau-11 Source.3606: DFBPPR13666 ---- Animal proteins ---- Prostaglandin F2-alpha receptor Source.3607: DFBPPR13667 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor Source.3608: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic Source.3609: DFBPPR13679 ---- Animal proteins ---- Interferon tau-3 Source.3610: DFBPPR13687 ---- Animal proteins ---- Flap endonuclease 1 Source.3611: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III Source.3612: DFBPPR13694 ---- Animal proteins ---- Interferon tau-1 Source.3613: DFBPPR13706 ---- Animal proteins ---- Alpha-1-antiproteinase Source.3614: DFBPPR13712 ---- Animal proteins ---- Cytochrome b Source.3615: DFBPPR13720 ---- Animal proteins ---- Interferon tau-10 Source.3616: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.3617: DFBPPR13742 ---- Animal proteins ---- Interferon tau-5 Source.3618: DFBPPR13743 ---- Animal proteins ---- Interferon tau-9 Source.3619: DFBPPR13744 ---- Animal proteins ---- Interferon tau-8 Source.3620: DFBPPR13745 ---- Animal proteins ---- Interferon tau-7 Source.3621: DFBPPR13748 ---- Animal proteins ---- Interferon tau-4 Source.3622: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A Source.3623: DFBPPR13755 ---- Animal proteins ---- Aromatase Source.3624: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A Source.3625: DFBPPR13764 ---- Animal proteins ---- Mast cell protease 1A Source.3626: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin Source.3627: DFBPPR13775 ---- Animal proteins ---- Progesterone receptor Source.3628: DFBPPR13796 ---- Animal proteins ---- Prion-like protein doppel Source.3629: DFBPPR13825 ---- Animal proteins ---- ATP synthase subunit a Source.3630: DFBPPR13830 ---- Animal proteins ---- Adenosine receptor A3 Source.3631: DFBPPR13832 ---- Animal proteins ---- Cystatin-B Source.3632: DFBPPR13846 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2 Source.3633: DFBPPR13856 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.3634: DFBPPR13857 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.3635: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin Source.3636: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.3637: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.3638: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.3639: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.3640: DFBPPR13885 ---- Animal proteins ---- Mast cell protease 3 Source.3641: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1 Source.3642: DFBPPR13897 ---- Animal proteins ---- Inactive ribonuclease-like protein 10 Source.3643: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.3644: DFBPPR13899 ---- Animal proteins ---- Natriuretic peptides B Source.3645: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter Source.3646: DFBPPR13912 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.3647: DFBPPR13916 ---- Animal proteins ---- Neuropeptide Y receptor type 1 Source.3648: DFBPPR13918 ---- Animal proteins ---- Testin Source.3649: DFBPPR13920 ---- Animal proteins ---- Troponin T, cardiac muscle Source.3650: DFBPPR13921 ---- Animal proteins ---- Brain ribonuclease Source.3651: DFBPPR13940 ---- Animal proteins ---- Mitochondrial glycine transporter Source.3652: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.3653: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.3654: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle Source.3655: DFBPPR13991 ---- Animal proteins ---- Osteocalcin Source.3656: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B Source.3657: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A Source.3658: DFBPPR14002 ---- Animal proteins ---- Cytochrome b Source.3659: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.3660: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.3661: DFBPPR14008 ---- Animal proteins ---- ATP synthase subunit a Source.3662: DFBPPR14016 ---- Animal proteins ---- Gonadotropin subunit beta-1 Source.3663: DFBPPR14029 ---- Animal proteins ---- Gamma-crystallin M1 Source.3664: DFBPPR14030 ---- Animal proteins ---- Prepro-urotensin II-gamma Source.3665: DFBPPR14031 ---- Animal proteins ---- Prepro-urotensin II-alpha Source.3666: DFBPPR14035 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.3667: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.3668: DFBPPR14043 ---- Animal proteins ---- Prolactin Source.3669: DFBPPR14045 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.3670: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos Source.3671: DFBPPR14060 ---- Animal proteins ---- Gamma-crystallin M2 Source.3672: DFBPPR14062 ---- Animal proteins ---- Alpha-1-antitrypsin homolog Source.3673: DFBPPR14072 ---- Marine protein ---- Prolactin Source.3674: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36 Source.3675: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.3676: DFBPPR14082 ---- Marine protein ---- Estrogen receptor Source.3677: DFBPPR14100 ---- Marine protein ---- Cytochrome b Source.3678: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2 Source.3679: DFBPPR14123 ---- Marine protein ---- Albumin 1 Source.3680: DFBPPR14124 ---- Marine protein ---- Albumin 2 Source.3681: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.3682: DFBPPR14127 ---- Marine protein ---- RNA-binding protein 8A Source.3683: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase Source.3684: DFBPPR14132 ---- Marine protein ---- Calumenin-A Source.3685: DFBPPR14145 ---- Marine protein ---- Eukaryotic translation initiation factor 3 subunit H Source.3686: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.3687: DFBPPR14152 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4L Source.3688: DFBPPR14153 ---- Marine protein ---- Progonadoliberin-3 Source.3689: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.3690: DFBPPR14157 ---- Marine protein ---- Ribosome biogenesis protein wdr12 Source.3691: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog Source.3692: DFBPPR14166 ---- Marine protein ---- Draxin-A Source.3693: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6 Source.3694: DFBPPR14193 ---- Marine protein ---- ER membrane protein complex subunit 4 Source.3695: DFBPPR14198 ---- Marine protein ---- Trafficking protein particle complex subunit 2-like protein Source.3696: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2 Source.3697: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2 Source.3698: DFBPPR14209 ---- Marine protein ---- 40S ribosomal protein S3a Source.3699: DFBPPR14212 ---- Marine protein ---- Proline-rich nuclear receptor coactivator 2 Source.3700: DFBPPR14221 ---- Marine protein ---- LYR motif-containing protein 2 Source.3701: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1 Source.3702: DFBPPR14232 ---- Marine protein ---- Prolactin-2 Source.3703: DFBPPR14233 ---- Marine protein ---- Prolactin-1 Source.3704: DFBPPR14235 ---- Marine protein ---- Calcitonin-1 Source.3705: DFBPPR14238 ---- Marine protein ---- Insulin Source.3706: DFBPPR14242 ---- Marine protein ---- Cytochrome b Source.3707: DFBPPR14257 ---- Marine protein ---- Somatolactin Source.3708: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1 Source.3709: DFBPPR14262 ---- Marine protein ---- Pro-opiomelanocortin Source.3710: DFBPPR14286 ---- Marine protein ---- Photosystem II protein D1 Source.3711: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein Source.3712: DFBPPR14297 ---- Marine protein ---- Probable transcriptional regulator ycf27 Source.3713: DFBPPR14301 ---- Marine protein ---- ATP synthase subunit b', chloroplastic Source.3714: DFBPPR14304 ---- Marine protein ---- ATP synthase subunit a, chloroplastic Source.3715: DFBPPR14315 ---- Marine protein ---- Protein CfxQ homolog Source.3716: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic Source.3717: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3718: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase Source.3719: DFBPPR14335 ---- Marine protein ---- Carbamoyl-phosphate synthase small chain Source.3720: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein Source.3721: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N Source.3722: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain Source.3723: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27 Source.3724: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.3725: DFBPPR14373 ---- Marine protein ---- Cytochrome b6 Source.3726: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta Source.3727: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA Source.3728: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA Source.3729: DFBPPR14456 ---- Marine protein ---- Uncharacterized protein ycf17 Source.3730: DFBPPR14457 ---- Marine protein ---- Probable transcriptional regulator ycf29 Source.3731: DFBPPR14458 ---- Marine protein ---- 50S ribosomal protein L12, chloroplastic Source.3732: DFBPPR14476 ---- Marine protein ---- Protein CfxQ homolog Source.3733: DFBPPR14489 ---- Marine protein ---- Elongation factor Ts, chloroplastic Source.3734: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60 Source.3735: DFBPPR14538 ---- Marine protein ---- Estrogen receptor Source.3736: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.3737: DFBPPR14556 ---- Marine protein ---- Interleukin-1 beta Source.3738: DFBPPR14558 ---- Marine protein ---- Steroid 17-alpha-hydroxylase/17,20 lyase Source.3739: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.3740: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta Source.3741: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.3742: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1 Source.3743: DFBPPR14573 ---- Marine protein ---- Cytochrome P450 3A27 Source.3744: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53 Source.3745: DFBPPR14578 ---- Marine protein ---- Prolactin Source.3746: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1 Source.3747: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase Source.3748: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros Source.3749: DFBPPR14590 ---- Marine protein ---- Cytochrome b Source.3750: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II Source.3751: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b Source.3752: DFBPPR14595 ---- Marine protein ---- V(D)J recombination-activating protein 2 Source.3753: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2 Source.3754: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.3755: DFBPPR14603 ---- Marine protein ---- ATP synthase subunit a Source.3756: DFBPPR14604 ---- Marine protein ---- Anamorsin Source.3757: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2 Source.3758: DFBPPR14606 ---- Marine protein ---- Myoblast determination protein 1 homolog 1 Source.3759: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1 Source.3760: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta Source.3761: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.3762: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a Source.3763: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3 Source.3764: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha Source.3765: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4 Source.3766: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1 Source.3767: DFBPPR14659 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4L Source.3768: DFBPPR14661 ---- Marine protein ---- Myoblast determination protein 1 homolog 2 Source.3769: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5 Source.3770: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2 Source.3771: DFBPPR14697 ---- Marine protein ---- Progonadoliberin-3 Source.3772: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64 Source.3773: DFBPPR14716 ---- Marine protein ---- Secreted phosphoprotein 24 Source.3774: DFBPPR14731 ---- Marine protein ---- Cytochrome c oxidase polypeptide VIIc Source.3775: DFBPPR14744 ---- Marine protein ---- Nucleoside diphosphate kinase B Source.3776: DFBPPR14752 ---- Marine protein ---- Proclotting enzyme Source.3777: DFBPPR14754 ---- Marine protein ---- Clotting factor C Source.3778: DFBPPR14761 ---- Marine protein ---- Intracellular coagulation inhibitor 2 Source.3779: DFBPPR14763 ---- Marine protein ---- Tachyplesin-1 Source.3780: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1 Source.3781: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3 Source.3782: DFBPPR14766 ---- Marine protein ---- Tachyplesin-2 Source.3783: DFBPPR14775 ---- Marine protein ---- Troponin C Source.3784: DFBPPR14787 ---- Marine protein ---- Crustacean hyperglycemic hormones isoform A Source.3785: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain Source.3786: DFBPPR14805 ---- Marine protein ---- Probable molt-inhibiting hormone Source.3787: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.3788: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain Source.3789: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1 Source.3790: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2 Source.3791: DFBPPR14820 ---- Marine protein ---- Troponin C, isoform 1 Source.3792: DFBPPR14832 ---- Marine protein ---- Troponin C, isoform 2B Source.3793: DFBPPR14833 ---- Marine protein ---- Troponin C, isoform 2A Source.3794: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.3795: DFBPPR14861 ---- Marine protein ---- Cytochrome b Source.3796: DFBPPR14868 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.3797: DFBPPR14869 ---- Marine protein ---- Glycoprotein hormones alpha chain Source.3798: DFBPPR14871 ---- Marine protein ---- Troponin C, skeletal muscle Source.3799: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1 Source.3800: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.3801: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1 Source.3802: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta Source.3803: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.3804: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80 Source.3805: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase Source.3806: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.3807: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein Source.3808: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1 Source.3809: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific Source.3810: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10 Source.3811: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase Source.3812: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4 Source.3813: DFBPPR14942 ---- Microorganism protein ---- Transcription initiation factor IIB Source.3814: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.3815: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit Source.3816: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1 Source.3817: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.3818: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15 Source.3819: DFBPPR14975 ---- Microorganism protein ---- Inner kinetochore subunit CTF19 Source.3820: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase Source.3821: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.3822: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1 Source.3823: DFBPPR14992 ---- Microorganism protein ---- DNA repair protein RAD5 Source.3824: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.3825: DFBPPR15000 ---- Microorganism protein ---- D-lactate dehydrogenase [cytochrome], mitochondrial Source.3826: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase Source.3827: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.3828: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial Source.3829: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1 Source.3830: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein Source.3831: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5 Source.3832: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial Source.3833: DFBPPR15034 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 2, mitochondrial Source.3834: DFBPPR15039 ---- Microorganism protein ---- ATP-dependent RNA helicase SUB2 Source.3835: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1 Source.3836: DFBPPR15050 ---- Microorganism protein ---- ATP-dependent RNA helicase DRS1 Source.3837: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2 Source.3838: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3 Source.3839: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1 Source.3840: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1 Source.3841: DFBPPR15087 ---- Microorganism protein ---- Transcriptional activator HAP3 Source.3842: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.3843: DFBPPR15112 ---- Microorganism protein ---- Pre-mRNA-splicing ATP-dependent RNA helicase PRP28 Source.3844: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1 Source.3845: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10 Source.3846: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha Source.3847: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A Source.3848: DFBPPR15141 ---- Microorganism protein ---- Probable cysteine protease ATG4 Source.3849: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter Source.3850: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.3851: DFBPPR15155 ---- Microorganism protein ---- Crossover junction endonuclease MUS81 Source.3852: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.3853: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.3854: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2 Source.3855: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111 Source.3856: DFBPPR15174 ---- Microorganism protein ---- ATP-dependent rRNA helicase RRP3 Source.3857: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5 Source.3858: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84 Source.3859: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog Source.3860: DFBPPR15192 ---- Microorganism protein ---- D-aminoacyl-tRNA deacylase Source.3861: DFBPPR15198 ---- Microorganism protein ---- tRNA:m(4)X modification enzyme TRM13 Source.3862: DFBPPR15200 ---- Microorganism protein ---- Protein SPT3 Source.3863: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal Source.3864: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3 Source.3865: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1 Source.3866: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2 Source.3867: DFBPPR15231 ---- Microorganism protein ---- Protein SSH4 Source.3868: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase Source.3869: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1 Source.3870: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4 Source.3871: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1 Source.3872: DFBPPR15274 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP7 Source.3873: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2 Source.3874: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1 Source.3875: DFBPPR15294 ---- Microorganism protein ---- Lactose permease Source.3876: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter Source.3877: DFBPPR15307 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 21 Source.3878: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone Source.3879: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone Source.3880: DFBPPR15316 ---- Microorganism protein ---- Protein URE2 Source.3881: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor Source.3882: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1 Source.3883: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.3884: DFBPPR15332 ---- Microorganism protein ---- GDP-mannose transporter Source.3885: DFBPPR15333 ---- Microorganism protein ---- GDP-mannose transporter Source.3886: DFBPPR15334 ---- Microorganism protein ---- Probable kinetochore protein NUF2 Source.3887: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog Source.3888: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial Source.3889: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase Source.3890: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B Source.3891: DFBPPR15366 ---- Microorganism protein ---- DNA-directed RNA polymerases I, II, and III subunit RPABC1 Source.3892: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.3893: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1 Source.3894: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1 Source.3895: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase Source.3896: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1 Source.3897: DFBPPR15406 ---- Microorganism protein ---- Leucine carboxyl methyltransferase 1 Source.3898: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2 Source.3899: DFBPPR15445 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM22 Source.3900: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3 Source.3901: DFBPPR15470 ---- Microorganism protein ---- Protein BUR2 Source.3902: DFBPPR15478 ---- Microorganism protein ---- COP9 signalosome complex subunit 9 Source.3903: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2 Source.3904: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46 Source.3905: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1 Source.3906: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12 Source.3907: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1 Source.3908: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1 Source.3909: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1 Source.3910: DFBPPR15515 ---- Microorganism protein ---- Tethering factor for nuclear proteasome STS1 Source.3911: DFBPPR15517 ---- Microorganism protein ---- rRNA biogenesis protein RRP36 Source.3912: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10 Source.3913: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3 Source.3914: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23 Source.3915: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20 Source.3916: DFBPPR15542 ---- Microorganism protein ---- Protein STE12 Source.3917: DFBPPR15545 ---- Microorganism protein ---- Ubiquinone biosynthesis protein COQ4, mitochondrial Source.3918: DFBPPR15563 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 1 Source.3919: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1 Source.3920: DFBPPR15577 ---- Microorganism protein ---- Chromatin modification-related protein EAF7 Source.3921: DFBPPR15579 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit CNL1 Source.3922: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1 Source.3923: DFBPPR15587 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 3 Source.3924: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3 Source.3925: DFBPPR15594 ---- Microorganism protein ---- Pre-mRNA polyadenylation factor FIP1 Source.3926: DFBPPR15596 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit BLS1 Source.3927: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1 Source.3928: DFBPPR15607 ---- Microorganism protein ---- Histone H2A.Z-specific chaperone CHZ1 Source.3929: DFBPPR15609 ---- Microorganism protein ---- Shugoshin Source.3930: DFBPPR15612 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 2 Source.3931: DFBPPR15629 ---- Microorganism protein ---- Transcription activator MSS11 Source.3932: DFBPPR15635 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLU7 Source.3933: DFBPPR15637 ---- Microorganism protein ---- Pre-mRNA-splicing factor SLT11 Source.3934: DFBPPR15644 ---- Microorganism protein ---- Cytoplasmic dynein intermediate light chain DYN3 Source.3935: DFBPPR15647 ---- Microorganism protein ---- Protein IBD2 Source.3936: DFBPPR15648 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 2 Source.3937: DFBPPR15650 ---- Microorganism protein ---- Mating-type protein ALPHA3 Source.3938: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6 Source.3939: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11 Source.3940: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial Source.3941: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3 Source.3942: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1 Source.3943: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3 Source.3944: DFBPPR15706 ---- Microorganism protein ---- Mitochondrial translation factor ATP22 Source.3945: DFBPPR15718 ---- Microorganism protein ---- RF4 protein Source.3946: DFBPPR15748 ---- Microorganism protein ---- Vacuolar membrane protein KLLA0F03465g Source.3947: DFBPPR15759 ---- Microorganism protein ---- Transcriptional regulatory protein LGE1 Source.3948: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5 Source.3949: DFBPPR15768 ---- Microorganism protein ---- Pheromone-regulated membrane protein 10 Source.3950: DFBPPR15769 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 11 Source.3951: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9 Source.3952: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component Source.3953: DFBPPR15800 ---- Microorganism protein ---- PTS system lactose-specific EIIA component Source.3954: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.3955: DFBPPR15802 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurQ Source.3956: DFBPPR15806 ---- Microorganism protein ---- Malonate-semialdehyde dehydrogenase Source.3957: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase Source.3958: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase Source.3959: DFBPPR15817 ---- Microorganism protein ---- PTS system sorbose-specific EIIC component Source.3960: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase Source.3961: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1 Source.3962: DFBPPR15837 ---- Microorganism protein ---- Acetyl-CoA:oxalate CoA-transferase Source.3963: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase Source.3964: DFBPPR15845 ---- Microorganism protein ---- Calmodulin Source.3965: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase Source.3966: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease Source.3967: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain Source.3968: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain Source.3969: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase Source.3970: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase Source.3971: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3 Source.3972: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase Source.3973: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase Source.3974: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase Source.3975: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1 Source.3976: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein Source.3977: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase Source.3978: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.3979: DFBPPR7788 ---- Plant protein ---- Thiamine thiazole synthase 1, chloroplastic Source.3980: DFBPPR7789 ---- Plant protein ---- Thiamine thiazole synthase 2, chloroplastic Source.3981: DFBPPR7790 ---- Plant protein ---- 4-hydroxyphenylacetaldehyde oxime monooxygenase Source.3982: DFBPPR7794 ---- Plant protein ---- Cytochrome b6 Source.3983: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.3984: DFBPPR7799 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic Source.3985: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2 Source.3986: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.3987: DFBPPR7829 ---- Plant protein ---- Cyanate hydratase Source.3988: DFBPPR7832 ---- Plant protein ---- Extensin Source.3989: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6 Source.3990: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7 Source.3991: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1 Source.3992: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4 Source.3993: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3 Source.3994: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5 Source.3995: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2 Source.3996: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1 Source.3997: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1 Source.3998: DFBPPR7868 ---- Plant protein ---- Alpha-amylase inhibitor 4 Source.3999: DFBPPR7869 ---- Plant protein ---- Alpha-amylase inhibitor 5 Source.4000: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.4001: DFBPPR7941 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial Source.4002: DFBPPR7943 ---- Plant protein ---- ATP synthase subunit a Source.4003: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.4004: DFBPPR7986 ---- Plant protein ---- Uncharacterized mitochondrial protein ORF154 Source.4005: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.4006: DFBPPR7999 ---- Plant protein ---- Probable pyridoxal 5'-phosphate synthase subunit PDX1 Source.4007: DFBPPR8035 ---- Plant protein ---- Endochitinase Source.4008: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2 Source.4009: DFBPPR8042 ---- Plant protein ---- Pyridoxal 5'-phosphate synthase subunit PDX1 Source.4010: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.4011: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type Source.4012: DFBPPR8049 ---- Plant protein ---- Bowman-Birk type proteinase inhibitor 2 Source.4013: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein Source.4014: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type Source.4015: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B Source.4016: DFBPPR8069 ---- Plant protein ---- Endoglucanase Source.4017: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform Source.4018: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.4019: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1 Source.4020: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.4021: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.4022: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.4023: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17 Source.4024: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A Source.4025: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.4026: DFBPPR8120 ---- Plant protein ---- Protein TIC 214 Source.4027: DFBPPR8146 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.4028: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.4029: DFBPPR8162 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic Source.4030: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase Source.4031: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.4032: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2 Source.4033: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein Source.4034: DFBPPR8228 ---- Plant protein ---- Albumin-8 Source.4035: DFBPPR8229 ---- Plant protein ---- Delta(8)-fatty-acid desaturase Source.4036: DFBPPR8232 ---- Plant protein ---- ATP synthase subunit 9, mitochondrial Source.4037: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic Source.4038: DFBPPR8246 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic Source.4039: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.4040: DFBPPR8252 ---- Plant protein ---- NADH-ubiquinone oxidoreductase chain 3 Source.4041: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic Source.4042: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.4043: DFBPPR8271 ---- Plant protein ---- Cytochrome b6 Source.4044: DFBPPR8284 ---- Plant protein ---- Calmodulin Source.4045: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.4046: DFBPPR8304 ---- Plant protein ---- Protein TIC 214 Source.4047: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA Source.4048: DFBPPR8318 ---- Plant protein ---- 17.6 kDa class I heat shock protein Source.4049: DFBPPR8342 ---- Plant protein ---- Non-specific lipid-transfer protein Source.4050: DFBPPR8346 ---- Plant protein ---- 30S ribosomal protein S2, chloroplastic
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

ACE-inhibitory activity	The peptide exhibited low Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC₅₀ value of 547.5 ± 51.3 uM.
Specific target protein(s)	Specific Target Protein(s): Angiotensin-converting enzyme

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	No prediction can be made about the peptide bitterness. ^prediction

SMILES

N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CCSC)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	In vitro simulated gastrointestinal digestion (Trypsin + Pepsin + α-Chymotrypsin) was performed to evaluate changes in bioactive properties of Poultry protein hydrolysate HCP Premium P150 (PPH) showing strong antioxidant and moderate ACE-inhibitory activity.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

The digested Poultry protein hydrolysate HCP Premium P150 proved to be a rich source of antioxidant and ACE inhibiting molecules and could be a potential new food ingredient used for prevention or treatment of socially significant diseases.

Database cross-references

DFBP

[D1]	DFBPANOX0727
[D2]	DFBPDPIV0209
[D3]	DFBPMUFU0525

BIOPEP-UWM

[D4]

8833, 9085, 9086

APD

[D5]

BioPepDB

[D6]

MBPDB

[D7]

Reference(s)

Primary literature	Anna, T., Alexey, K., Anna, B., Vyacheslav, K., Mikhail, T., Ulia, M. Effect of in Vitro Gastrointestinal Digestion on Bioactivity of Poultry Protein Hydrolysate. Current Research in Nutrition and Food Science Journal. 2016, 4, 77-86. DOI: 10.12944/CRNFSJ.4.Special-Issue-October.10
Other literature(s)	N.D
PubDate	2016