E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI1914(ACE-inhibitory peptide)
DFBP ID DFBPACEI1914
Peptide sequence LAA
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Leu-Ala-Ala
Single-letter amino acid LAA
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 273.32 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY 2.4667 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Amaranth seed proteins
Precursor protein Amaranth glutelins
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2
Source.3: DFBPPR0815 ---- Plant proteins ---- bZIP transcription factor RISBZ2
Source.4: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25
Source.5: DFBPPR0817 ---- Plant proteins ---- 1-Cys peroxiredoxin A
Source.6: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.7: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.8: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8
Source.9: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.10: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.11: DFBPPR0832 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 2
Source.12: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.13: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71
Source.14: DFBPPR0838 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, cytosolic
Source.15: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1
Source.16: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.17: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.18: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1
Source.19: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.20: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.21: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.22: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.23: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.24: DFBPPR0872 ---- Plant proteins ---- Beta-glucosidase 6
Source.25: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5
Source.26: DFBPPR0878 ---- Plant proteins ---- Homeobox protein knotted-1-like 6
Source.27: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.28: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.29: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.30: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.31: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53
Source.32: DFBPPR0902 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.33: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase
Source.34: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.35: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.36: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.37: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6
Source.38: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.39: DFBPPR0928 ---- Plant proteins ---- Cytochrome P450 90B2
Source.40: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.41: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial
Source.42: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2
Source.43: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.44: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.45: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.46: DFBPPR0941 ---- Plant proteins ---- Phosphopantothenoylcysteine decarboxylase
Source.47: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.48: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.49: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.50: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.51: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.52: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5
Source.53: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.54: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase
Source.55: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9
Source.56: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.57: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.58: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.59: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda
Source.60: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.61: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic
Source.62: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1
Source.63: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.64: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21
Source.65: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185
Source.66: DFBPPR0992 ---- Plant proteins ---- Zeaxanthin epoxidase, chloroplastic
Source.67: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.68: DFBPPR0997 ---- Plant proteins ---- Tricin synthase 1
Source.69: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.70: DFBPPR1001 ---- Plant proteins ---- GRF-interacting factor 1
Source.71: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.72: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1
Source.73: DFBPPR1009 ---- Plant proteins ---- SPX domain-containing protein 4
Source.74: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.75: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75
Source.76: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.77: DFBPPR1017 ---- Plant proteins ---- Glucosamine 6-phosphate N-acetyltransferase 1
Source.78: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.79: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.80: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A
Source.81: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.82: DFBPPR1029 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor SMOS1
Source.83: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.84: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP
Source.85: DFBPPR1034 ---- Plant proteins ---- bZIP transcription factor 50
Source.86: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3
Source.87: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.88: DFBPPR1045 ---- Plant proteins ---- Vacuolar iron transporter 2
Source.89: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8
Source.90: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.91: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.92: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.93: DFBPPR1070 ---- Plant proteins ---- Vacuolar iron transporter 1
Source.94: DFBPPR1072 ---- Plant proteins ---- Cytokinin dehydrogenase 2
Source.95: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.96: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.97: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.98: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.99: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.100: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1
Source.101: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51
Source.102: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.103: DFBPPR1086 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 46
Source.104: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.105: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.106: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1
Source.107: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.108: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic
Source.109: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2
Source.110: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.111: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.112: DFBPPR1104 ---- Plant proteins ---- 12-oxophytodienoate reductase 7
Source.113: DFBPPR1105 ---- Plant proteins ---- Solanesyl-diphosphate synthase 1, mitochondrial
Source.114: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.115: DFBPPR1109 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.116: DFBPPR1110 ---- Plant proteins ---- Superoxide dismutase [Cu-Zn], chloroplastic
Source.117: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic
Source.118: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.119: DFBPPR1116 ---- Plant proteins ---- Polycomb group protein EMF2B
Source.120: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.121: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.122: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.123: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic
Source.124: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.125: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B
Source.126: DFBPPR1136 ---- Plant proteins ---- Exosome complex exonuclease RRP46 homolog
Source.127: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.128: DFBPPR1140 ---- Plant proteins ---- Protein PARTING DANCERS homolog
Source.129: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.130: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A
Source.131: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.132: DFBPPR1150 ---- Plant proteins ---- Abscisic stress-ripening protein 5
Source.133: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.134: DFBPPR1155 ---- Plant proteins ---- tRNA:m(4)X modification enzyme TRM13
Source.135: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3
Source.136: DFBPPR1161 ---- Plant proteins ---- Photosystem II protein D1
Source.137: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.138: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.139: DFBPPR1167 ---- Plant proteins ---- Phototropin-2
Source.140: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.141: DFBPPR1176 ---- Plant proteins ---- Chitinase 12
Source.142: DFBPPR1177 ---- Plant proteins ---- Calmodulin-binding transcription activator CBT
Source.143: DFBPPR1180 ---- Plant proteins ---- Anthranilate synthase beta subunit 1, chloroplastic
Source.144: DFBPPR1185 ---- Plant proteins ---- PHD finger protein EHD3
Source.145: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog
Source.146: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.147: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.148: DFBPPR1214 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO4
Source.149: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic
Source.150: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b
Source.151: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.152: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.153: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.154: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.155: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic
Source.156: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.157: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.158: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.159: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.160: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.161: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.162: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.163: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2
Source.164: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3
Source.165: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.166: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase
Source.167: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a
Source.168: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.169: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.170: DFBPPR1286 ---- Plant proteins ---- Heme oxygenase 1, chloroplastic
Source.171: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.172: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.173: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic
Source.174: DFBPPR1296 ---- Plant proteins ---- Zinc finger protein STAMENLESS 1
Source.175: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.176: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b
Source.177: DFBPPR1300 ---- Plant proteins ---- Protein G1
Source.178: DFBPPR1302 ---- Plant proteins ---- 2-C-methyl-D-erythritol 2,4-cyclodiphosphate synthase, chloroplastic
Source.179: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22
Source.180: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.181: DFBPPR1308 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 4
Source.182: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B
Source.183: DFBPPR1311 ---- Plant proteins ---- Synaptonemal complex protein ZEP1
Source.184: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.185: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.186: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.187: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1
Source.188: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.189: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1
Source.190: DFBPPR1332 ---- Plant proteins ---- Flap endonuclease 1-B
Source.191: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.192: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.193: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12
Source.194: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1
Source.195: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.196: DFBPPR1340 ---- Plant proteins ---- F-box protein GID2
Source.197: DFBPPR1343 ---- Plant proteins ---- Transcription factor TB1
Source.198: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.199: DFBPPR1346 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 5
Source.200: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.201: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.202: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.203: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.204: DFBPPR1357 ---- Plant proteins ---- MADS-box transcription factor 47
Source.205: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.206: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.207: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.208: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.209: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic
Source.210: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.211: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.212: DFBPPR1380 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO2
Source.213: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.214: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase
Source.215: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.216: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.217: DFBPPR1389 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 10
Source.218: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.219: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.220: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic
Source.221: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.222: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.223: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.224: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5
Source.225: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.226: DFBPPR1407 ---- Plant proteins ---- Indole-3-acetate O-methyltransferase 1
Source.227: DFBPPR1409 ---- Plant proteins ---- Flavanone 3-dioxygenase 3
Source.228: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.229: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.230: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.231: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.232: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.233: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.234: DFBPPR1424 ---- Plant proteins ---- Germin-like protein 8-14
Source.235: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.236: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.237: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.238: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3
Source.239: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.240: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.241: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.242: DFBPPR1443 ---- Plant proteins ---- Probable thiamine biosynthetic bifunctional enzyme, chloroplastic
Source.243: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5
Source.244: DFBPPR1450 ---- Plant proteins ---- Heat stress transcription factor C-1b
Source.245: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.246: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.247: DFBPPR1460 ---- Plant proteins ---- Xylanase inhibitor protein 2
Source.248: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.249: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.250: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.251: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.252: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.253: DFBPPR1468 ---- Plant proteins ---- Serotonin N-acetyltransferase 2, chloroplastic
Source.254: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.255: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.256: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.257: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3
Source.258: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.259: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2
Source.260: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.261: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.262: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.263: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.264: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.265: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase
Source.266: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.267: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.268: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.269: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.270: DFBPPR1501 ---- Plant proteins ---- Polygalacturonase inhibitor 1
Source.271: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5
Source.272: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.273: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.274: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.275: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.276: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.277: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.278: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.279: DFBPPR1522 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP6
Source.280: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.281: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1
Source.282: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3
Source.283: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39
Source.284: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.285: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.286: DFBPPR1537 ---- Plant proteins ---- Zinc transporter 8
Source.287: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.288: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.289: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.290: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.291: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.292: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2
Source.293: DFBPPR1553 ---- Plant proteins ---- Transcription factor LG2
Source.294: DFBPPR1554 ---- Plant proteins ---- Signal peptidase complex-like protein DTM1
Source.295: DFBPPR1563 ---- Plant proteins ---- TPD1 protein homolog 1A
Source.296: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.297: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.298: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic
Source.299: DFBPPR1578 ---- Plant proteins ---- Cyclin-B2-2
Source.300: DFBPPR1579 ---- Plant proteins ---- O-methyltransferase 1, chloroplastic
Source.301: DFBPPR1581 ---- Plant proteins ---- Peroxiredoxin-2C
Source.302: DFBPPR1587 ---- Plant proteins ---- CBL-interacting protein kinase 8
Source.303: DFBPPR1588 ---- Plant proteins ---- Replication protein A 32 kDa subunit C
Source.304: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.305: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic
Source.306: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.307: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.308: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.309: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.310: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A
Source.311: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1
Source.312: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.313: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.314: DFBPPR1615 ---- Plant proteins ---- Phosphatidylinositol:ceramide inositolphosphotransferase
Source.315: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic
Source.316: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7
Source.317: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.318: DFBPPR1623 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 2, chloroplastic
Source.319: DFBPPR1624 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 9, chloroplastic/mitochondrial
Source.320: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71
Source.321: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.322: DFBPPR1628 ---- Plant proteins ---- Polyprotein of EF-Ts, chloroplastic
Source.323: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.324: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.325: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.326: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic
Source.327: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a
Source.328: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.329: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.330: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.331: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.332: DFBPPR1644 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 1, chloroplastic
Source.333: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.334: DFBPPR1651 ---- Plant proteins ---- Protein KTI12 homolog
Source.335: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.336: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1
Source.337: DFBPPR1663 ---- Plant proteins ---- Cyclin-H1-1
Source.338: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial
Source.339: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A
Source.340: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.341: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.342: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.343: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.344: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.345: DFBPPR1686 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 3, chloroplastic
Source.346: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.347: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic
Source.348: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.349: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.350: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.351: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.352: DFBPPR1703 ---- Plant proteins ---- Cyclin-B2-1
Source.353: DFBPPR1704 ---- Plant proteins ---- RNA-binding protein Y14B
Source.354: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.355: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.356: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.357: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic
Source.358: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.359: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.360: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.361: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.362: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.363: DFBPPR1733 ---- Plant proteins ---- Xylanase inhibitor protein XIP
Source.364: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.365: DFBPPR1736 ---- Plant proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], chloroplastic
Source.366: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic
Source.367: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.368: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.369: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.370: DFBPPR1752 ---- Plant proteins ---- TATA-binding protein 2
Source.371: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.372: DFBPPR1754 ---- Plant proteins ---- Transcription factor BHLH094
Source.373: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic
Source.374: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.375: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.376: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.377: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.378: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1
Source.379: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.380: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.381: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.382: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.383: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.384: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1
Source.385: DFBPPR1799 ---- Plant proteins ---- Aquaporin PIP1-1
Source.386: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase
Source.387: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1
Source.388: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9
Source.389: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5
Source.390: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.391: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a
Source.392: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.393: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.394: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.395: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.396: DFBPPR1842 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase DAO
Source.397: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.398: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.399: DFBPPR1847 ---- Plant proteins ---- Amidase 1
Source.400: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.401: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.402: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.403: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.404: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.405: DFBPPR1858 ---- Plant proteins ---- CBL-interacting protein kinase 4
Source.406: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.407: DFBPPR1869 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 8, mitochondrial
Source.408: DFBPPR1873 ---- Plant proteins ---- Cytokinin dehydrogenase 4
Source.409: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.410: DFBPPR1878 ---- Plant proteins ---- Squamosa promoter-binding-like protein 8
Source.411: DFBPPR1879 ---- Plant proteins ---- Germin-like protein 1-3
Source.412: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.413: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.414: DFBPPR1893 ---- Plant proteins ---- Probable glucosamine 6-phosphate N-acetyltransferase 2
Source.415: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.416: DFBPPR1897 ---- Plant proteins ---- Zinc transporter 4
Source.417: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.418: DFBPPR1899 ---- Plant proteins ---- High-affinity nitrate transporter 2.1
Source.419: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic
Source.420: DFBPPR1908 ---- Plant proteins ---- Proteasome subunit alpha type-1
Source.421: DFBPPR1909 ---- Plant proteins ---- High-affinity nitrate transporter 2.2
Source.422: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.423: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.424: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.425: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.426: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.427: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.428: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3
Source.429: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.430: DFBPPR1938 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.431: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.432: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.433: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.434: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.435: DFBPPR1954 ---- Plant proteins ---- Calcineurin B-like protein 4
Source.436: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.437: DFBPPR1957 ---- Plant proteins ---- Probable phospholipase A2 homolog 1
Source.438: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.439: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.440: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.441: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.442: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3
Source.443: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12
Source.444: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial
Source.445: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.446: DFBPPR1980 ---- Plant proteins ---- Germin-like protein 1-4
Source.447: DFBPPR1982 ---- Plant proteins ---- Histone H2B.6
Source.448: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A
Source.449: DFBPPR1986 ---- Plant proteins ---- Histone H2B.5
Source.450: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.451: DFBPPR1993 ---- Plant proteins ---- Histone H2B.9
Source.452: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28
Source.453: DFBPPR1996 ---- Plant proteins ---- Transcription initiation factor IIB
Source.454: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.455: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8
Source.456: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.457: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.458: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.459: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.460: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a
Source.461: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.462: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1
Source.463: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.464: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.465: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.466: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.467: DFBPPR2039 ---- Plant proteins ---- Protein MONOCULM 1
Source.468: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.469: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.470: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.471: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.472: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.473: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10
Source.474: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3
Source.475: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA
Source.476: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.477: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.478: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11
Source.479: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.480: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.481: DFBPPR2078 ---- Plant proteins ---- Two pore potassium channel c
Source.482: DFBPPR2083 ---- Plant proteins ---- Lectin
Source.483: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.484: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1
Source.485: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.486: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.487: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.488: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80
Source.489: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5
Source.490: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.491: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.492: DFBPPR2100 ---- Plant proteins ---- Germin-like protein 1-1
Source.493: DFBPPR2101 ---- Plant proteins ---- Cupincin
Source.494: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.495: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.496: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.497: DFBPPR2113 ---- Plant proteins ---- Neutral/alkaline invertase 1, mitochondrial
Source.498: DFBPPR2116 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 1
Source.499: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.500: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.501: DFBPPR2123 ---- Plant proteins ---- Ninja-family protein MODD
Source.502: DFBPPR2128 ---- Plant proteins ---- Thioredoxin M3, chloroplastic
Source.503: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic
Source.504: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.505: DFBPPR2137 ---- Plant proteins ---- Metallothionein-like protein 2C
Source.506: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1
Source.507: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.508: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.509: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic
Source.510: DFBPPR2146 ---- Plant proteins ---- Expansin-B4
Source.511: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.512: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.513: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.514: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.515: DFBPPR2163 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.516: DFBPPR2164 ---- Plant proteins ---- Sodium/calcium exchanger NCL2
Source.517: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.518: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.519: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.520: DFBPPR2183 ---- Plant proteins ---- Proteasome subunit beta type-1
Source.521: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.522: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.523: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.524: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4
Source.525: DFBPPR2198 ---- Plant proteins ---- Vacuolar cation/proton exchanger 2
Source.526: DFBPPR2201 ---- Plant proteins ---- Aspartyl protease 37
Source.527: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.528: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.529: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.530: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.531: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.532: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.533: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like
Source.534: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.535: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1
Source.536: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.537: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12
Source.538: DFBPPR2237 ---- Plant proteins ---- Probable glutathione S-transferase GSTU1
Source.539: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.540: DFBPPR2243 ---- Plant proteins ---- WRKY transcription factor WRKY76
Source.541: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.542: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3
Source.543: DFBPPR2252 ---- Plant proteins ---- MADS-box transcription factor 21
Source.544: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13
Source.545: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.546: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29
Source.547: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.548: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.549: DFBPPR2266 ---- Plant proteins ---- Metal tolerance protein 2
Source.550: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.551: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.552: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8
Source.553: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.554: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.555: DFBPPR2274 ---- Plant proteins ---- Wee1-like protein kinase
Source.556: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.557: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.558: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.559: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.560: DFBPPR2283 ---- Plant proteins ---- Oleosin 18 kDa
Source.561: DFBPPR2286 ---- Plant proteins ---- Proteasome subunit alpha type-4-1
Source.562: DFBPPR2290 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.563: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3
Source.564: DFBPPR2292 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.565: DFBPPR2293 ---- Plant proteins ---- Aquaporin PIP 1-3
Source.566: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.567: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.568: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4
Source.569: DFBPPR2302 ---- Plant proteins ---- Bowman-Birk type bran trypsin inhibitor
Source.570: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7
Source.571: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.572: DFBPPR2311 ---- Plant proteins ---- Histone acetyltransferase GCN5
Source.573: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA
Source.574: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.575: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.576: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.577: DFBPPR2319 ---- Plant proteins ---- Thioredoxin M2, chloroplastic
Source.578: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2
Source.579: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.580: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3
Source.581: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1
Source.582: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4
Source.583: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.584: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.585: DFBPPR2337 ---- Plant proteins ---- Protein TIFY 11b
Source.586: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.587: DFBPPR2340 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 1
Source.588: DFBPPR2345 ---- Plant proteins ---- Ubiquinol oxidase 1b, mitochondrial
Source.589: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.590: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.591: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.592: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.593: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.594: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.595: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.596: DFBPPR2363 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 30
Source.597: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.598: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.599: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5
Source.600: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.601: DFBPPR2371 ---- Plant proteins ---- Seed allergenic protein RAG1
Source.602: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.603: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.604: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6
Source.605: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.606: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase
Source.607: DFBPPR2381 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.608: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.609: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23
Source.610: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1
Source.611: DFBPPR2386 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0103100
Source.612: DFBPPR2387 ---- Plant proteins ---- Chitinase 8
Source.613: DFBPPR2390 ---- Plant proteins ---- Proteasome subunit alpha type-4-2
Source.614: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic
Source.615: DFBPPR2399 ---- Plant proteins ---- Germin-like protein 5-1
Source.616: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.617: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.618: DFBPPR2405 ---- Plant proteins ---- Transcription factor BHLH089
Source.619: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.620: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.621: DFBPPR2414 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.622: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.623: DFBPPR2416 ---- Plant proteins ---- Putative germin-like protein 3-2
Source.624: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.625: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.626: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1
Source.627: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.628: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5
Source.629: DFBPPR2434 ---- Plant proteins ---- Non-specific lipid transfer protein-like 1
Source.630: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.631: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1
Source.632: DFBPPR2441 ---- Plant proteins ---- Disease resistance protein Pikm1-TS
Source.633: DFBPPR2443 ---- Plant proteins ---- Oryzain alpha chain
Source.634: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic
Source.635: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial
Source.636: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.637: DFBPPR2457 ---- Plant proteins ---- Proteasome subunit alpha type-4-3
Source.638: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic
Source.639: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.640: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.641: DFBPPR2469 ---- Plant proteins ---- Germin-like protein 8-4
Source.642: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.643: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.644: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.645: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase
Source.646: DFBPPR2480 ---- Plant proteins ---- Germin-like protein 8-7
Source.647: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.648: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.649: DFBPPR2485 ---- Plant proteins ---- SKP1-like protein 1
Source.650: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2
Source.651: DFBPPR2493 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, cytoplasmic
Source.652: DFBPPR2496 ---- Plant proteins ---- Probable staphylococcal-like nuclease CAN4
Source.653: DFBPPR2497 ---- Plant proteins ---- Thioredoxin-like protein HCF164, chloroplastic
Source.654: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.655: DFBPPR2501 ---- Plant proteins ---- Germin-like protein 8-10
Source.656: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.657: DFBPPR2505 ---- Plant proteins ---- Germin-like protein 8-5
Source.658: DFBPPR2506 ---- Plant proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase 1, chloroplastic
Source.659: DFBPPR2507 ---- Plant proteins ---- Protein YABBY 4
Source.660: DFBPPR2508 ---- Plant proteins ---- Transcription factor RF2b
Source.661: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial
Source.662: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.663: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.664: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.665: DFBPPR2526 ---- Plant proteins ---- Chitinase 10
Source.666: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.667: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.668: DFBPPR2531 ---- Plant proteins ---- Putative cinnamyl alcohol dehydrogenase 4
Source.669: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.670: DFBPPR2535 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0650300
Source.671: DFBPPR2537 ---- Plant proteins ---- Uridine 5'-monophosphate synthase
Source.672: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.673: DFBPPR2540 ---- Plant proteins ---- 23.2 kDa heat shock protein
Source.674: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.675: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta
Source.676: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.677: DFBPPR2547 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 3, chloroplastic
Source.678: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.679: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.680: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.681: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.682: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase
Source.683: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4
Source.684: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.685: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.686: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200
Source.687: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic
Source.688: DFBPPR2583 ---- Plant proteins ---- Thioredoxin-like 2, chloroplastic
Source.689: DFBPPR2586 ---- Plant proteins ---- Probable protein-S-isoprenylcysteine O-methyltransferase
Source.690: DFBPPR2595 ---- Plant proteins ---- Expansin-B7
Source.691: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase
Source.692: DFBPPR2598 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 5
Source.693: DFBPPR2607 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.694: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57
Source.695: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1
Source.696: DFBPPR2616 ---- Plant proteins ---- Pectinesterase inhibitor 12
Source.697: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.698: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.699: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.700: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.701: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.702: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.703: DFBPPR2639 ---- Plant proteins ---- Seed allergenic protein RAG2
Source.704: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.705: DFBPPR2645 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase, chloroplastic
Source.706: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.707: DFBPPR2648 ---- Plant proteins ---- SKP1-like protein 20
Source.708: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2
Source.709: DFBPPR2653 ---- Plant proteins ---- Putative germin-like protein 12-4
Source.710: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.711: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.712: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5
Source.713: DFBPPR2662 ---- Plant proteins ---- Putative germin-like protein 12-3
Source.714: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.715: DFBPPR2666 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase 2
Source.716: DFBPPR2669 ---- Plant proteins ---- Arginine decarboxylase 1
Source.717: DFBPPR2670 ---- Plant proteins ---- Putative germin-like protein 2-2
Source.718: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein
Source.719: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.720: DFBPPR2675 ---- Plant proteins ---- Anamorsin homolog 2
Source.721: DFBPPR2678 ---- Plant proteins ---- Thioredoxin-like 1-2, chloroplastic
Source.722: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1
Source.723: DFBPPR2681 ---- Plant proteins ---- Probable histone H2A.6
Source.724: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.725: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.726: DFBPPR2694 ---- Plant proteins ---- Monothiol glutaredoxin-S7, chloroplastic
Source.727: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.728: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16
Source.729: DFBPPR2703 ---- Plant proteins ---- Homeobox protein knotted-1-like 10
Source.730: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.731: DFBPPR2705 ---- Plant proteins ---- Probable protein phosphatase 2C 72
Source.732: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.733: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.734: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B
Source.735: DFBPPR2724 ---- Plant proteins ---- Putative germin-like protein 8-1
Source.736: DFBPPR2725 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 1, chloroplastic
Source.737: DFBPPR2727 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH] 2, chloroplastic
Source.738: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.739: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.740: DFBPPR2736 ---- Plant proteins ---- Ethylene-responsive transcription factor ABI4
Source.741: DFBPPR2737 ---- Plant proteins ---- Putative beta-glucosidase 9
Source.742: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8
Source.743: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5
Source.744: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.745: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.746: DFBPPR2748 ---- Plant proteins ---- Secretory carrier-associated membrane protein 6
Source.747: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.748: DFBPPR2752 ---- Plant proteins ---- Secretory carrier-associated membrane protein 5
Source.749: DFBPPR2756 ---- Plant proteins ---- Probable aquaporin PIP1-2
Source.750: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700
Source.751: DFBPPR2760 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.752: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.753: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.754: DFBPPR2764 ---- Plant proteins ---- MADS-box transcription factor 30
Source.755: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.756: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2
Source.757: DFBPPR2769 ---- Plant proteins ---- Sialyltransferase-like protein 3
Source.758: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.759: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.760: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.761: DFBPPR2777 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 3
Source.762: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.763: DFBPPR2784 ---- Plant proteins ---- Chitinase 11
Source.764: DFBPPR2797 ---- Plant proteins ---- Anther-specific protein RTS
Source.765: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.766: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.767: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.768: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.769: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.770: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.771: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.772: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.773: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.774: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.775: DFBPPR2827 ---- Plant proteins ---- Germin-like protein 8-8
Source.776: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23
Source.777: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.778: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4
Source.779: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.780: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8
Source.781: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6
Source.782: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.783: DFBPPR2844 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.784: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.785: DFBPPR2847 ---- Plant proteins ---- Glutaredoxin-C4, chloroplastic
Source.786: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D
Source.787: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.788: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103
Source.789: DFBPPR2859 ---- Plant proteins ---- Proton pump-interactor BIP131
Source.790: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase
Source.791: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.792: DFBPPR2867 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 1
Source.793: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2
Source.794: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2
Source.795: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.796: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.797: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog
Source.798: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2
Source.799: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.800: DFBPPR2897 ---- Plant proteins ---- Homeobox protein knotted-1-like 1
Source.801: DFBPPR2899 ---- Plant proteins ---- Transcription factor PCF7
Source.802: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3
Source.803: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2
Source.804: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.805: DFBPPR2909 ---- Plant proteins ---- Probable isoprenylcysteine alpha-carbonyl methylesterase ICME
Source.806: DFBPPR2910 ---- Plant proteins ---- Expansin-B5
Source.807: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.808: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.809: DFBPPR2920 ---- Plant proteins ---- Putative germin-like protein 2-3
Source.810: DFBPPR2923 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.811: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.812: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.813: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14
Source.814: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.815: DFBPPR2936 ---- Plant proteins ---- Putative germin-like protein 2-1
Source.816: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A
Source.817: DFBPPR2942 ---- Plant proteins ---- Germin-like protein 12-2
Source.818: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27
Source.819: DFBPPR2945 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 2, chloroplastic
Source.820: DFBPPR2948 ---- Plant proteins ---- Expansin-A25
Source.821: DFBPPR2950 ---- Plant proteins ---- Probable homogentisate phytyltransferase 1, chloroplastic
Source.822: DFBPPR2952 ---- Plant proteins ---- Expansin-A17
Source.823: DFBPPR2953 ---- Plant proteins ---- Germin-like protein 5-1
Source.824: DFBPPR2954 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.825: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.826: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40
Source.827: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.828: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.829: DFBPPR2966 ---- Plant proteins ---- Probable histone H2A.5
Source.830: DFBPPR2968 ---- Plant proteins ---- Probable aquaporin PIP2-7
Source.831: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.832: DFBPPR2971 ---- Plant proteins ---- COBRA-like protein 3
Source.833: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.834: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4
Source.835: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.836: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic
Source.837: DFBPPR2982 ---- Plant proteins ---- SKP1-like protein 5
Source.838: DFBPPR2985 ---- Plant proteins ---- Coatomer subunit delta-3
Source.839: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.840: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.841: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13
Source.842: DFBPPR3006 ---- Plant proteins ---- 3'(2'),5'-bisphosphate nucleotidase
Source.843: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.844: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.845: DFBPPR3014 ---- Plant proteins ---- Homeobox protein knotted-1-like 2
Source.846: DFBPPR3015 ---- Plant proteins ---- Expansin-A13
Source.847: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.848: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit
Source.849: DFBPPR3023 ---- Plant proteins ---- RNA pseudouridine synthase 6, chloroplastic
Source.850: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.851: DFBPPR3025 ---- Plant proteins ---- Probable protein phosphatase 2C 26
Source.852: DFBPPR3030 ---- Plant proteins ---- Ammonium transporter 1 member 3
Source.853: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.854: DFBPPR3034 ---- Plant proteins ---- Anamorsin homolog 1
Source.855: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3
Source.856: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.857: DFBPPR3040 ---- Plant proteins ---- Translation factor GUF1 homolog, chloroplastic
Source.858: DFBPPR3042 ---- Plant proteins ---- Deoxyuridine 5'-triphosphate nucleotidohydrolase
Source.859: DFBPPR3047 ---- Plant proteins ---- Zinc finger protein 36
Source.860: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.861: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2
Source.862: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.863: DFBPPR3055 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 1
Source.864: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9
Source.865: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5
Source.866: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.867: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.868: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.869: DFBPPR3072 ---- Plant proteins ---- Probable histone H2A.4
Source.870: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1
Source.871: DFBPPR3083 ---- Plant proteins ---- Auxin response factor 7
Source.872: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.873: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.874: DFBPPR3091 ---- Plant proteins ---- Probable 1-acylglycerol-3-phosphate O-acyltransferase
Source.875: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.876: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.877: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4
Source.878: DFBPPR3095 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 4
Source.879: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.880: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.881: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.882: DFBPPR3103 ---- Plant proteins ---- Beta-glucosidase 4
Source.883: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.884: DFBPPR3112 ---- Plant proteins ---- Auxin-responsive protein IAA6
Source.885: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2
Source.886: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.887: DFBPPR3120 ---- Plant proteins ---- Zinc transporter 7
Source.888: DFBPPR3121 ---- Plant proteins ---- Endoglucanase 23
Source.889: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.890: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.891: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.892: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.893: DFBPPR3130 ---- Plant proteins ---- COP9 signalosome complex subunit 6
Source.894: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.895: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2
Source.896: DFBPPR3135 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 1
Source.897: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.898: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.899: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.900: DFBPPR3142 ---- Plant proteins ---- Squamosa promoter-binding-like protein 13
Source.901: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6
Source.902: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.903: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B
Source.904: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.905: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11
Source.906: DFBPPR3154 ---- Plant proteins ---- Endoglucanase 7
Source.907: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3
Source.908: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11
Source.909: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4
Source.910: DFBPPR3162 ---- Plant proteins ---- GATA transcription factor 20
Source.911: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.912: DFBPPR3164 ---- Plant proteins ---- Cysteine proteinase inhibitor 2
Source.913: DFBPPR3165 ---- Plant proteins ---- Aquaporin PIP2-5
Source.914: DFBPPR3169 ---- Plant proteins ---- Chaperone protein ClpD2, chloroplastic
Source.915: DFBPPR3170 ---- Plant proteins ---- Probable histone H2A.2
Source.916: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.917: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2
Source.918: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.919: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.920: DFBPPR3178 ---- Plant proteins ---- Probable aquaporin TIP5-1
Source.921: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48
Source.922: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.923: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.924: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.925: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27
Source.926: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13
Source.927: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.928: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3
Source.929: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1
Source.930: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3
Source.931: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.932: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B
Source.933: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.934: DFBPPR3209 ---- Plant proteins ---- Monodehydroascorbate reductase 4, cytosolic
Source.935: DFBPPR3210 ---- Plant proteins ---- Ammonium transporter 1 member 2
Source.936: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.937: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.938: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.939: DFBPPR3221 ---- Plant proteins ---- Probable acylpyruvase FAHD2, mitochondrial
Source.940: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3
Source.941: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1
Source.942: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain
Source.943: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1
Source.944: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.945: DFBPPR3232 ---- Plant proteins ---- Expansin-A28
Source.946: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.947: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26
Source.948: DFBPPR3235 ---- Plant proteins ---- Coleoptile phototropism protein 1
Source.949: DFBPPR3243 ---- Plant proteins ---- Endoglucanase 21
Source.950: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.951: DFBPPR3245 ---- Plant proteins ---- Endoglucanase 4
Source.952: DFBPPR3246 ---- Plant proteins ---- Probable histone H2A.7
Source.953: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.954: DFBPPR3248 ---- Plant proteins ---- Endoglucanase 16
Source.955: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.956: DFBPPR3260 ---- Plant proteins ---- Probable histone H2A.1
Source.957: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.958: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.959: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.960: DFBPPR3277 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor RA16
Source.961: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial
Source.962: DFBPPR3281 ---- Plant proteins ---- Ammonium transporter 1 member 1
Source.963: DFBPPR3286 ---- Plant proteins ---- Expansin-A32
Source.964: DFBPPR3288 ---- Plant proteins ---- Chitin-inducible gibberellin-responsive protein 2
Source.965: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500
Source.966: DFBPPR3294 ---- Plant proteins ---- Probable histone H2A.3
Source.967: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.968: DFBPPR3300 ---- Plant proteins ---- Calcineurin B-like protein 9
Source.969: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.970: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.971: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1
Source.972: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8
Source.973: DFBPPR3321 ---- Plant proteins ---- Glutaredoxin-C8
Source.974: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.975: DFBPPR3324 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2C
Source.976: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3
Source.977: DFBPPR3328 ---- Plant proteins ---- Putative expansin-A30
Source.978: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12
Source.979: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial
Source.980: DFBPPR3332 ---- Plant proteins ---- Vacuolar iron transporter homolog 5
Source.981: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.982: DFBPPR3335 ---- Plant proteins ---- Molybdopterin synthase sulfur carrier subunit
Source.983: DFBPPR3337 ---- Plant proteins ---- Probable acylpyruvase FAHD1, mitochondrial
Source.984: DFBPPR3338 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1a
Source.985: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.986: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4
Source.987: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.988: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2
Source.989: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.990: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.991: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6
Source.992: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1
Source.993: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.994: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.995: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.996: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.997: DFBPPR3367 ---- Plant proteins ---- Probable phytol kinase 1, chloroplastic
Source.998: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.999: DFBPPR3374 ---- Plant proteins ---- Auxin-responsive protein IAA19
Source.1000: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28
Source.1001: DFBPPR3377 ---- Plant proteins ---- Endoglucanase 3
Source.1002: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.1003: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.1004: DFBPPR3386 ---- Plant proteins ---- Auxin-responsive protein IAA2
Source.1005: DFBPPR3387 ---- Plant proteins ---- Endoglucanase 17
Source.1006: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.1007: DFBPPR3392 ---- Plant proteins ---- Auxin-responsive protein IAA9
Source.1008: DFBPPR3394 ---- Plant proteins ---- Auxin-responsive protein IAA7
Source.1009: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.1010: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.1011: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.1012: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.1013: DFBPPR3405 ---- Plant proteins ---- Auxin-responsive protein IAA1
Source.1014: DFBPPR3406 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL16
Source.1015: DFBPPR3407 ---- Plant proteins ---- Coatomer subunit delta-2
Source.1016: DFBPPR3408 ---- Plant proteins ---- Coatomer subunit delta-1
Source.1017: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9
Source.1018: DFBPPR3411 ---- Plant proteins ---- Auxin-responsive protein IAA15
Source.1019: DFBPPR3413 ---- Plant proteins ---- Probable histone H2AXa
Source.1020: DFBPPR3414 ---- Plant proteins ---- Seed allergenic protein RA5
Source.1021: DFBPPR3417 ---- Plant proteins ---- Protein CutA 1, chloroplastic
Source.1022: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.1023: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.1024: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.1025: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1
Source.1026: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.1027: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3
Source.1028: DFBPPR3434 ---- Plant proteins ---- Sec-independent protein translocase protein TATB, chloroplastic
Source.1029: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.1030: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.1031: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.1032: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.1033: DFBPPR3448 ---- Plant proteins ---- Endoglucanase 22
Source.1034: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12
Source.1035: DFBPPR3457 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.1036: DFBPPR3459 ---- Plant proteins ---- Squamosa promoter-binding-like protein 17
Source.1037: DFBPPR3462 ---- Plant proteins ---- Probable aquaporin TIP2-1
Source.1038: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.1039: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A
Source.1040: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600
Source.1041: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14
Source.1042: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2
Source.1043: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1
Source.1044: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic
Source.1045: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.1046: DFBPPR3493 ---- Plant proteins ---- Endoglucanase 20
Source.1047: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600
Source.1048: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.1049: DFBPPR3504 ---- Plant proteins ---- Zinc transporter 9
Source.1050: DFBPPR3505 ---- Plant proteins ---- Ribosome biogenesis protein WDR12 homolog
Source.1051: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.1052: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3
Source.1053: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14
Source.1054: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic
Source.1055: DFBPPR3519 ---- Plant proteins ---- Growth-regulating factor 6
Source.1056: DFBPPR3522 ---- Plant proteins ---- Probable protein phosphatase 2C 56
Source.1057: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4
Source.1058: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36
Source.1059: DFBPPR3531 ---- Plant proteins ---- Zinc transporter 10
Source.1060: DFBPPR3534 ---- Plant proteins ---- Cardiolipin synthase (CMP-forming), mitochondrial
Source.1061: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.1062: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic
Source.1063: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2
Source.1064: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.1065: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.1066: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.1067: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36
Source.1068: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16
Source.1069: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.1070: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500
Source.1071: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5
Source.1072: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.1073: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.1074: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.1075: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.1076: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.1077: DFBPPR3588 ---- Plant proteins ---- ASC1-like protein 3
Source.1078: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2
Source.1079: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.1080: DFBPPR3593 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 1
Source.1081: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2
Source.1082: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.1083: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.1084: DFBPPR3603 ---- Plant proteins ---- Protein TIFY 11e
Source.1085: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3
Source.1086: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6
Source.1087: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A
Source.1088: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.1089: DFBPPR3619 ---- Plant proteins ---- Cyclin-D3-1
Source.1090: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B
Source.1091: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5
Source.1092: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.1093: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.1094: DFBPPR3644 ---- Plant proteins ---- Chaperone protein ClpC3, chloroplastic
Source.1095: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.1096: DFBPPR3647 ---- Plant proteins ---- Dof zinc finger protein 2
Source.1097: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.1098: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2
Source.1099: DFBPPR3654 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7a
Source.1100: DFBPPR3658 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1101: DFBPPR3659 ---- Plant proteins ---- Probable signal peptidase complex subunit 3
Source.1102: DFBPPR3660 ---- Plant proteins ---- Calcineurin B-like protein 5
Source.1103: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9
Source.1104: DFBPPR3664 ---- Plant proteins ---- Calcineurin B-like protein 6
Source.1105: DFBPPR3665 ---- Plant proteins ---- Calcineurin B-like protein 10
Source.1106: DFBPPR3668 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 29
Source.1107: DFBPPR3670 ---- Plant proteins ---- RNA pseudouridine synthase 2, chloroplastic
Source.1108: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3
Source.1109: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.1110: DFBPPR3676 ---- Plant proteins ---- Endoglucanase 6
Source.1111: DFBPPR3677 ---- Plant proteins ---- Auxin-responsive protein IAA25
Source.1112: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9
Source.1113: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.1114: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.1115: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.1116: DFBPPR3688 ---- Plant proteins ---- Probable protein phosphatase 2C 67
Source.1117: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.1118: DFBPPR3692 ---- Plant proteins ---- Protein disulfide isomerase-like 5-1
Source.1119: DFBPPR3695 ---- Plant proteins ---- Auxin-responsive protein IAA23
Source.1120: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39
Source.1121: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.1122: DFBPPR3699 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.1123: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.1124: DFBPPR3706 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 2
Source.1125: DFBPPR3711 ---- Plant proteins ---- 17kDa alpha-amylase/trypsin inhibitor 1
Source.1126: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.1127: DFBPPR3713 ---- Plant proteins ---- Probable NADH kinase
Source.1128: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5
Source.1129: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.1130: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.1131: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic
Source.1132: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.1133: DFBPPR3729 ---- Plant proteins ---- Cyclin-D4-1
Source.1134: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic
Source.1135: DFBPPR3731 ---- Plant proteins ---- Probable protein phosphatase 2C 8
Source.1136: DFBPPR3736 ---- Plant proteins ---- Probable aquaporin PIP2-3
Source.1137: DFBPPR3737 ---- Plant proteins ---- Probable protein phosphatase 2C 28
Source.1138: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1
Source.1139: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.1140: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71
Source.1141: DFBPPR3758 ---- Plant proteins ---- Target of rapamycin complex subunit LST8
Source.1142: DFBPPR3764 ---- Plant proteins ---- Cytochrome b6-f complex subunit 6
Source.1143: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.1144: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.1145: DFBPPR3774 ---- Plant proteins ---- Kinesin-like protein KIN-14A
Source.1146: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.1147: DFBPPR3782 ---- Plant proteins ---- Auxin-responsive protein IAA16
Source.1148: DFBPPR3785 ---- Plant proteins ---- 23.6 kDa heat shock protein, mitochondrial
Source.1149: DFBPPR3786 ---- Plant proteins ---- Kinesin-like protein KIN-14D
Source.1150: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1
Source.1151: DFBPPR3794 ---- Plant proteins ---- UDP-D-apiose/UDP-D-xylose synthase
Source.1152: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77
Source.1153: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1154: DFBPPR3802 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2E
Source.1155: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.1156: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.1157: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.1158: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.1159: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1
Source.1160: DFBPPR3820 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 3, chloroplastic
Source.1161: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.1162: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4
Source.1163: DFBPPR3824 ---- Plant proteins ---- Auxin-responsive protein IAA22
Source.1164: DFBPPR3828 ---- Plant proteins ---- Probable histone H2A variant 1
Source.1165: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.1166: DFBPPR3830 ---- Plant proteins ---- Probable histone H2A variant 3
Source.1167: DFBPPR3832 ---- Plant proteins ---- 26.2 kDa heat shock protein, mitochondrial
Source.1168: DFBPPR3834 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS35
Source.1169: DFBPPR3835 ---- Plant proteins ---- Probable histone H2A variant 2
Source.1170: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2
Source.1171: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.1172: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.1173: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57
Source.1174: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.1175: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.1176: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.1177: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.1178: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.1179: DFBPPR3874 ---- Plant proteins ---- Transcription factor PCF3
Source.1180: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1
Source.1181: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.1182: DFBPPR3880 ---- Plant proteins ---- Monothiol glutaredoxin-S2
Source.1183: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31
Source.1184: DFBPPR3883 ---- Plant proteins ---- Cyclin-D5-1
Source.1185: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.1186: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.1187: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.1188: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13
Source.1189: DFBPPR3902 ---- Plant proteins ---- Probable serine acetyltransferase 5
Source.1190: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial
Source.1191: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.1192: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.1193: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.1194: DFBPPR3916 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1b
Source.1195: DFBPPR3918 ---- Plant proteins ---- Protein TIFY 11g
Source.1196: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1
Source.1197: DFBPPR3920 ---- Plant proteins ---- Glutaredoxin-C9
Source.1198: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.1199: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.1200: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.1201: DFBPPR3927 ---- Plant proteins ---- Basic leucine zipper 2
Source.1202: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.1203: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1
Source.1204: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.1205: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.1206: DFBPPR3936 ---- Plant proteins ---- Endoglucanase 14
Source.1207: DFBPPR3939 ---- Plant proteins ---- Non-specific lipid-transfer protein 4
Source.1208: DFBPPR3940 ---- Plant proteins ---- Putative cyclin-D2-3
Source.1209: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.1210: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.1211: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10
Source.1212: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA
Source.1213: DFBPPR3955 ---- Plant proteins ---- Cysteine proteinase inhibitor 3
Source.1214: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1
Source.1215: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.1216: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.1217: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.1218: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9
Source.1219: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.1220: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.1221: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2
Source.1222: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.1223: DFBPPR3984 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 7
Source.1224: DFBPPR3985 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 2
Source.1225: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.1226: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500
Source.1227: DFBPPR3991 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.1228: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.1229: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.1230: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.1231: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.1232: DFBPPR4003 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 9
Source.1233: DFBPPR4005 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.1234: DFBPPR4006 ---- Plant proteins ---- Glutaredoxin-C7
Source.1235: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.1236: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.1237: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic
Source.1238: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.1239: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1
Source.1240: DFBPPR4021 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 2
Source.1241: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1
Source.1242: DFBPPR4025 ---- Plant proteins ---- CASP-like protein 1E1
Source.1243: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.1244: DFBPPR4033 ---- Plant proteins ---- Urease accessory protein G
Source.1245: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A
Source.1246: DFBPPR4036 ---- Plant proteins ---- Probable aquaporin PIP2-8
Source.1247: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.1248: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3
Source.1249: DFBPPR4041 ---- Plant proteins ---- CASP-like protein 4A2
Source.1250: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.1251: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6
Source.1252: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69
Source.1253: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.1254: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.1255: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.1256: DFBPPR4055 ---- Plant proteins ---- Serpin-ZXB
Source.1257: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.1258: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F
Source.1259: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C
Source.1260: DFBPPR4068 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 6
Source.1261: DFBPPR4069 ---- Plant proteins ---- Putative magnesium transporter MRS2-D
Source.1262: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.1263: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5
Source.1264: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.1265: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.1266: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.1267: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.1268: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B
Source.1269: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8
Source.1270: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.1271: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.1272: DFBPPR4096 ---- Plant proteins ---- Cytochrome c biogenesis protein CCS1, chloroplastic
Source.1273: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.1274: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.1275: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4
Source.1276: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.1277: DFBPPR4108 ---- Plant proteins ---- Caffeate O-methyltransferase-like protein 2
Source.1278: DFBPPR4111 ---- Plant proteins ---- Cyclin-D4-2
Source.1279: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43
Source.1280: DFBPPR4117 ---- Plant proteins ---- Cyclin-D5-2
Source.1281: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33
Source.1282: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3
Source.1283: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.1284: DFBPPR4122 ---- Plant proteins ---- Probable protein phosphatase 2C 2
Source.1285: DFBPPR4124 ---- Plant proteins ---- Ras-related protein RGP2
Source.1286: DFBPPR4125 ---- Plant proteins ---- Calmodulin-like protein 4
Source.1287: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5
Source.1288: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.1289: DFBPPR4134 ---- Plant proteins ---- Glutaredoxin-C1
Source.1290: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.1291: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1
Source.1292: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1
Source.1293: DFBPPR4155 ---- Plant proteins ---- Putative cyclin-F2-1
Source.1294: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.1295: DFBPPR4171 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 4
Source.1296: DFBPPR4174 ---- Plant proteins ---- Mitochondrial intermembrane space import and assembly protein 40 homolog
Source.1297: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.1298: DFBPPR4176 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 3
Source.1299: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.1300: DFBPPR4179 ---- Plant proteins ---- CASP-like protein 4B3
Source.1301: DFBPPR4183 ---- Plant proteins ---- Senescence-associated protein OSA15, chloroplastic
Source.1302: DFBPPR4188 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL7
Source.1303: DFBPPR4190 ---- Plant proteins ---- U3 snoRNP-associated protein-like YAOH
Source.1304: DFBPPR4192 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic
Source.1305: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.1306: DFBPPR4196 ---- Plant proteins ---- Cyclin-D5-3
Source.1307: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3
Source.1308: DFBPPR4201 ---- Plant proteins ---- Cyclin-D6-1
Source.1309: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.1310: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.1311: DFBPPR4204 ---- Plant proteins ---- CASP-like protein 2B1
Source.1312: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.1313: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.1314: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.1315: DFBPPR4214 ---- Plant proteins ---- Disease resistance protein Piks-1
Source.1316: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.1317: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.1318: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.1319: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22
Source.1320: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.1321: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5
Source.1322: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic
Source.1323: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1
Source.1324: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.1325: DFBPPR4234 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 3
Source.1326: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3
Source.1327: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.1328: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1
Source.1329: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.1330: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.1331: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2
Source.1332: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.1333: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.1334: DFBPPR4245 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 2
Source.1335: DFBPPR4249 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 2
Source.1336: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1
Source.1337: DFBPPR4254 ---- Plant proteins ---- Cysteine proteinase inhibitor 6
Source.1338: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4
Source.1339: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11
Source.1340: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2
Source.1341: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16
Source.1342: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.1343: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.1344: DFBPPR4265 ---- Plant proteins ---- WUSCHEL-related homeobox 13
Source.1345: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1
Source.1346: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6
Source.1347: DFBPPR4270 ---- Plant proteins ---- CASP-like protein Os03g0196400
Source.1348: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3
Source.1349: DFBPPR4272 ---- Plant proteins ---- CASP-like protein 3A1
Source.1350: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2
Source.1351: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6
Source.1352: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.1353: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.1354: DFBPPR4289 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 4
Source.1355: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1
Source.1356: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like
Source.1357: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.1358: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1
Source.1359: DFBPPR4306 ---- Plant proteins ---- Phosphopantothenate--cysteine ligase 1
Source.1360: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8
Source.1361: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.1362: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1
Source.1363: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C
Source.1364: DFBPPR4318 ---- Plant proteins ---- Golgin-84
Source.1365: DFBPPR4321 ---- Plant proteins ---- Bax inhibitor 1
Source.1366: DFBPPR4324 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.1367: DFBPPR4326 ---- Plant proteins ---- Protein BIG GRAIN 1-like
Source.1368: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5
Source.1369: DFBPPR4339 ---- Plant proteins ---- Protein LHCP TRANSLOCATION DEFECT
Source.1370: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10
Source.1371: DFBPPR4343 ---- Plant proteins ---- Transcription factor ILI7
Source.1372: DFBPPR4345 ---- Plant proteins ---- Putative cysteine proteinase inhibitor 11
Source.1373: DFBPPR4354 ---- Plant proteins ---- Probable calcium-binding protein CML9
Source.1374: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3
Source.1375: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4
Source.1376: DFBPPR4357 ---- Plant proteins ---- Cyclin-F2-2
Source.1377: DFBPPR4359 ---- Plant proteins ---- Protein STAY-GREEN LIKE, chloroplastic
Source.1378: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.1379: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.1380: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.1381: DFBPPR4369 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 2
Source.1382: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4
Source.1383: DFBPPR4378 ---- Plant proteins ---- Basic leucine zipper 6
Source.1384: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.1385: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2
Source.1386: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5
Source.1387: DFBPPR4389 ---- Plant proteins ---- CASP-like protein 5B2
Source.1388: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic
Source.1389: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.1390: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4
Source.1391: DFBPPR4404 ---- Plant proteins ---- Two-component response regulator ORR32
Source.1392: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5
Source.1393: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.1394: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6
Source.1395: DFBPPR4416 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 4
Source.1396: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15
Source.1397: DFBPPR4424 ---- Plant proteins ---- Phospholipase A1-II 5
Source.1398: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.1399: DFBPPR4430 ---- Plant proteins ---- Nucleolar complex protein 2 homolog
Source.1400: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.1401: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein
Source.1402: DFBPPR4439 ---- Plant proteins ---- Copper transporter 5.1
Source.1403: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.1404: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.1405: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.1406: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3
Source.1407: DFBPPR4453 ---- Plant proteins ---- Protein EXECUTER 1, chloroplastic
Source.1408: DFBPPR4458 ---- Plant proteins ---- CASP-like protein 2C2
Source.1409: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.1410: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.1411: DFBPPR4463 ---- Plant proteins ---- Probable calcium-binding protein CML17
Source.1412: DFBPPR4466 ---- Plant proteins ---- Putative copper transporter 5.2
Source.1413: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.1414: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.1415: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.1416: DFBPPR4474 ---- Plant proteins ---- Probable calcium-binding protein CML16
Source.1417: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.1418: DFBPPR4476 ---- Plant proteins ---- Probable calcium-binding protein CML24
Source.1419: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.1420: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6
Source.1421: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.1422: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.1423: DFBPPR4483 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 11
Source.1424: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.1425: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4
Source.1426: DFBPPR4488 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.1427: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1
Source.1428: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2
Source.1429: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L
Source.1430: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein
Source.1431: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.1432: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.1433: DFBPPR4518 ---- Plant proteins ---- Probable calcium-binding protein CML14
Source.1434: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.1435: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33
Source.1436: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.1437: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.1438: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6
Source.1439: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.1440: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.1441: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.1442: DFBPPR4536 ---- Plant proteins ---- Protein PEP-RELATED DEVELOPMENT ARRESTED 1 homolog, chloroplastic
Source.1443: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.1444: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.1445: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59
Source.1446: DFBPPR4545 ---- Plant proteins ---- Tubby-like F-box protein 12
Source.1447: DFBPPR4546 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.1448: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase
Source.1449: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.1450: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.1451: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9
Source.1452: DFBPPR4557 ---- Plant proteins ---- Urease accessory protein F
Source.1453: DFBPPR4563 ---- Plant proteins ---- CASP-like protein 4C1
Source.1454: DFBPPR4566 ---- Plant proteins ---- CASP-like protein 5C1
Source.1455: DFBPPR4567 ---- Plant proteins ---- UPF0496 protein 3
Source.1456: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1
Source.1457: DFBPPR4570 ---- Plant proteins ---- CASP-like protein 2C1
Source.1458: DFBPPR4571 ---- Plant proteins ---- CASP-like protein 1D1
Source.1459: DFBPPR4573 ---- Plant proteins ---- CASP-like protein UU-1
Source.1460: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.1461: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32
Source.1462: DFBPPR4582 ---- Plant proteins ---- Probable calcium-binding protein CML12
Source.1463: DFBPPR4583 ---- Plant proteins ---- Probable calcium-binding protein CML15
Source.1464: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.1465: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.1466: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.1467: DFBPPR4592 ---- Plant proteins ---- Ubiquitin-fold modifier 1
Source.1468: DFBPPR4595 ---- Plant proteins ---- Tubby-like F-box protein 9
Source.1469: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.1470: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2
Source.1471: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.1472: DFBPPR4613 ---- Plant proteins ---- Urease accessory protein D
Source.1473: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3
Source.1474: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.1475: DFBPPR4630 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 11
Source.1476: DFBPPR4631 ---- Plant proteins ---- B3 domain-containing protein Os03g0620500
Source.1477: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.1478: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3
Source.1479: DFBPPR4638 ---- Plant proteins ---- Probable NAD kinase 1
Source.1480: DFBPPR4639 ---- Plant proteins ---- CASP-like protein 4D1
Source.1481: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2
Source.1482: DFBPPR4652 ---- Plant proteins ---- Probable protein ABIL1
Source.1483: DFBPPR4653 ---- Plant proteins ---- Protein MEI2-like 7
Source.1484: DFBPPR4654 ---- Plant proteins ---- Cyclin-P3-1
Source.1485: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.1486: DFBPPR4660 ---- Plant proteins ---- Transcription factor ILI2
Source.1487: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.1488: DFBPPR4663 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 6
Source.1489: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.1490: DFBPPR4667 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 4
Source.1491: DFBPPR4669 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 8
Source.1492: DFBPPR4671 ---- Plant proteins ---- Tubby-like F-box protein 3
Source.1493: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.1494: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2
Source.1495: DFBPPR4685 ---- Plant proteins ---- 30S ribosomal protein S31, mitochondrial
Source.1496: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1
Source.1497: DFBPPR4698 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 2
Source.1498: DFBPPR4706 ---- Plant proteins ---- Tubby-like protein 4
Source.1499: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1
Source.1500: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.1501: DFBPPR4714 ---- Plant proteins ---- B3 domain-containing protein Os06g0107800
Source.1502: DFBPPR4717 ---- Plant proteins ---- Tubby-like F-box protein 11
Source.1503: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.1504: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.1505: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.1506: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.1507: DFBPPR4735 ---- Plant proteins ---- Uncharacterized protein Os08g0218700/LOC_Os08g12160
Source.1508: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400
Source.1509: DFBPPR4746 ---- Plant proteins ---- UPF0603 protein Os05g0401100, chloroplastic
Source.1510: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.1511: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.1512: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400
Source.1513: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.1514: DFBPPR4758 ---- Plant proteins ---- BURP domain-containing protein 7
Source.1515: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21
Source.1516: DFBPPR4764 ---- Plant proteins ---- 14-3-3-like protein GF14-A
Source.1517: DFBPPR4767 ---- Plant proteins ---- CRS2-like protein, chloroplastic
Source.1518: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700
Source.1519: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1
Source.1520: DFBPPR4775 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.1521: DFBPPR4780 ---- Plant proteins ---- Ripening-related protein 3
Source.1522: DFBPPR4784 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19
Source.1523: DFBPPR4794 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0346900
Source.1524: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.1525: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2
Source.1526: DFBPPR4814 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 47
Source.1527: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.1528: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500
Source.1529: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a
Source.1530: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1
Source.1531: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6
Source.1532: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000
Source.1533: DFBPPR4835 ---- Plant proteins ---- DDRGK domain-containing protein 1
Source.1534: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2
Source.1535: DFBPPR4846 ---- Plant proteins ---- Uncharacterized protein Os04g0629400
Source.1536: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200
Source.1537: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5
Source.1538: DFBPPR4861 ---- Plant proteins ---- B3 domain-containing protein Os06g0112300
Source.1539: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37
Source.1540: DFBPPR4865 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 homolog
Source.1541: DFBPPR4876 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 3
Source.1542: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500
Source.1543: DFBPPR4878 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 10
Source.1544: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940
Source.1545: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.1546: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.1547: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48
Source.1548: DFBPPR4892 ---- Plant proteins ---- Chitin elicitor-binding protein
Source.1549: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.1550: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic
Source.1551: DFBPPR4898 ---- Plant proteins ---- Serine racemase
Source.1552: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.1553: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.1554: DFBPPR4915 ---- Plant proteins ---- Chitinase 2
Source.1555: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic
Source.1556: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8
Source.1557: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.1558: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.1559: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2
Source.1560: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7
Source.1561: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70
Source.1562: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.1563: DFBPPR4938 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 2, mitochondrial
Source.1564: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1
Source.1565: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.1566: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1
Source.1567: DFBPPR4949 ---- Plant proteins ---- Probable histone H2AXb
Source.1568: DFBPPR4972 ---- Plant proteins ---- Isoflavone 7-O-glucosyltransferase 1
Source.1569: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.1570: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1
Source.1571: DFBPPR4984 ---- Plant proteins ---- Histone acetyltransferase TAP1
Source.1572: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1573: DFBPPR4993 ---- Plant proteins ---- Photosystem II protein D1
Source.1574: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.1575: DFBPPR5013 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1a
Source.1576: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1577: DFBPPR5030 ---- Plant proteins ---- Transcription initiation factor IIB
Source.1578: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.1579: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.1580: DFBPPR5045 ---- Plant proteins ---- Leghemoglobin A
Source.1581: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.1582: DFBPPR5054 ---- Plant proteins ---- Leghemoglobin C2
Source.1583: DFBPPR5055 ---- Plant proteins ---- TATA-box-binding protein
Source.1584: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.1585: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.1586: DFBPPR5066 ---- Plant proteins ---- Leghemoglobin C3
Source.1587: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.1588: DFBPPR5071 ---- Plant proteins ---- Leghemoglobin C1
Source.1589: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.1590: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.1591: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.1592: DFBPPR5083 ---- Plant proteins ---- Malate dehydrogenase, glyoxysomal
Source.1593: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog
Source.1594: DFBPPR5109 ---- Plant proteins ---- Chalcone--flavonone isomerase 1A
Source.1595: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic
Source.1596: DFBPPR5117 ---- Plant proteins ---- P24 oleosin isoform B
Source.1597: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.1598: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.1599: DFBPPR5126 ---- Plant proteins ---- P24 oleosin isoform A
Source.1600: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.1601: DFBPPR5130 ---- Plant proteins ---- Probable acetyltransferase TAP2
Source.1602: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.1603: DFBPPR5139 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1604: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.1605: DFBPPR5155 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.1606: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.1607: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1
Source.1608: DFBPPR5164 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 2
Source.1609: DFBPPR5168 ---- Plant proteins ---- Homeobox protein SBH1
Source.1610: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.1611: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1612: DFBPPR5177 ---- Plant proteins ---- Anamorsin homolog
Source.1613: DFBPPR5182 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 1
Source.1614: DFBPPR5190 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.1615: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.1616: DFBPPR5196 ---- Plant proteins ---- Arginase
Source.1617: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.1618: DFBPPR5214 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1619: DFBPPR5215 ---- Plant proteins ---- Probable phytol kinase 2, chloroplastic
Source.1620: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.1621: DFBPPR5220 ---- Plant proteins ---- Probable phytol kinase 3, chloroplastic
Source.1622: DFBPPR5226 ---- Plant proteins ---- Chalcone--flavonone isomerase 1
Source.1623: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.1624: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.1625: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1626: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.1627: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1
Source.1628: DFBPPR5241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI2
Source.1629: DFBPPR5242 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-1
Source.1630: DFBPPR5247 ---- Plant proteins ---- RuBisCO-associated protein
Source.1631: DFBPPR5248 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1632: DFBPPR5255 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-B
Source.1633: DFBPPR5256 ---- Plant proteins ---- Early nodulin-70
Source.1634: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.1635: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.1636: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9
Source.1637: DFBPPR5278 ---- Plant proteins ---- 40S ribosomal protein SA
Source.1638: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.1639: DFBPPR5308 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein
Source.1640: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1
Source.1641: DFBPPR5329 ---- Plant proteins ---- CASP-like protein 2A2
Source.1642: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1
Source.1643: DFBPPR5333 ---- Plant proteins ---- Repetitive proline-rich cell wall protein 3
Source.1644: DFBPPR5339 ---- Plant proteins ---- Putative 3,4-dihydroxy-2-butanone kinase
Source.1645: DFBPPR5376 ---- Plant proteins ---- Pyruvate, phosphate dikinase 1, chloroplastic
Source.1646: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic
Source.1647: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.1648: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.1649: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.1650: DFBPPR5391 ---- Plant proteins ---- Glutathione S-transferase 4
Source.1651: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.1652: DFBPPR5394 ---- Plant proteins ---- Photosystem II protein D1
Source.1653: DFBPPR5396 ---- Plant proteins ---- DELLA protein DWARF8
Source.1654: DFBPPR5397 ---- Plant proteins ---- Alpha-terpineol synthase, chloroplastic
Source.1655: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.1656: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.1657: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic
Source.1658: DFBPPR5407 ---- Plant proteins ---- Profilin-2
Source.1659: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.1660: DFBPPR5412 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1
Source.1661: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.1662: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein
Source.1663: DFBPPR5418 ---- Plant proteins ---- Aquaporin PIP1-1
Source.1664: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.1665: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.1666: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.1667: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.1668: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.1669: DFBPPR5429 ---- Plant proteins ---- HMG-Y-related protein A
Source.1670: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2
Source.1671: DFBPPR5432 ---- Plant proteins ---- Expansin-B1
Source.1672: DFBPPR5439 ---- Plant proteins ---- Aquaporin PIP1-2
Source.1673: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1
Source.1674: DFBPPR5442 ---- Plant proteins ---- GRF-interacting factor 1
Source.1675: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.1676: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.1677: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.1678: DFBPPR5448 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.1679: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic
Source.1680: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2
Source.1681: DFBPPR5460 ---- Plant proteins ---- Peroxidase 2
Source.1682: DFBPPR5461 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.1, mitochondrial
Source.1683: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial
Source.1684: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.1685: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1
Source.1686: DFBPPR5468 ---- Plant proteins ---- Aquaporin PIP2-5
Source.1687: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.1688: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1689: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.1690: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.1691: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.1692: DFBPPR5488 ---- Plant proteins ---- Sec-independent protein translocase protein TATA, chloroplastic
Source.1693: DFBPPR5494 ---- Plant proteins ---- Peroxidase 70
Source.1694: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.1695: DFBPPR5500 ---- Plant proteins ---- Trypsin/factor XIIA inhibitor
Source.1696: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.1697: DFBPPR5503 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.1698: DFBPPR5505 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme
Source.1699: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.1700: DFBPPR5508 ---- Plant proteins ---- Expansin-B9
Source.1701: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.1702: DFBPPR5512 ---- Plant proteins ---- Peroxidase 42
Source.1703: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.1704: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase
Source.1705: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.1706: DFBPPR5518 ---- Plant proteins ---- Ferredoxin-2, chloroplastic
Source.1707: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.1708: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.1709: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1710: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain
Source.1711: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain
Source.1712: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1
Source.1713: DFBPPR5550 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.1714: DFBPPR5552 ---- Plant proteins ---- Growth-regulating factor 1
Source.1715: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.1716: DFBPPR5554 ---- Plant proteins ---- TATA-box-binding protein 1
Source.1717: DFBPPR5560 ---- Plant proteins ---- TRIBOA-glucoside O-methyltransferase BX7
Source.1718: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.1719: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.1720: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.1721: DFBPPR5568 ---- Plant proteins ---- Microtubule-binding protein TANGLED1
Source.1722: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.1723: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.1724: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.1725: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.1726: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.1727: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.1728: DFBPPR5587 ---- Plant proteins ---- Protein PHOTOSYSTEM I ASSEMBLY 2, chloroplastic
Source.1729: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1
Source.1730: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.1731: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.1732: DFBPPR5598 ---- Plant proteins ---- Trehalose 6-phosphate phosphatase RA3
Source.1733: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.1734: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic
Source.1735: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3
Source.1736: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.1737: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.1738: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.1739: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase
Source.1740: DFBPPR5613 ---- Plant proteins ---- 60S acidic ribosomal protein P0
Source.1741: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.1742: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.1743: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.1744: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.1745: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic
Source.1746: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9
Source.1747: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1748: DFBPPR5629 ---- Plant proteins ---- TATA-box-binding protein 2
Source.1749: DFBPPR5632 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.1750: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.1751: DFBPPR5638 ---- Plant proteins ---- Histone H2B.5
Source.1752: DFBPPR5639 ---- Plant proteins ---- Histone H2B.1
Source.1753: DFBPPR5640 ---- Plant proteins ---- Histone H2B.4
Source.1754: DFBPPR5641 ---- Plant proteins ---- Histone H2B.2
Source.1755: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1756: DFBPPR5655 ---- Plant proteins ---- Aquaporin PIP1-5
Source.1757: DFBPPR5656 ---- Plant proteins ---- Histone H2B.3
Source.1758: DFBPPR5661 ---- Plant proteins ---- Albumin b-32
Source.1759: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.1760: DFBPPR5673 ---- Plant proteins ---- Aquaporin PIP1-6
Source.1761: DFBPPR5676 ---- Plant proteins ---- Aquaporin PIP1-3/PIP1-4
Source.1762: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein
Source.1763: DFBPPR5678 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic
Source.1764: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic
Source.1765: DFBPPR5683 ---- Plant proteins ---- Non-specific lipid-transfer protein
Source.1766: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.1767: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5
Source.1768: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.1769: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.1770: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.1771: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.1772: DFBPPR5706 ---- Plant proteins ---- Glutelin-2
Source.1773: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase
Source.1774: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.1775: DFBPPR5722 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.1776: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.1777: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.1778: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.1779: DFBPPR5730 ---- Plant proteins ---- Aquaporin TIP2-3
Source.1780: DFBPPR5732 ---- Plant proteins ---- Aquaporin PIP2-4
Source.1781: DFBPPR5734 ---- Plant proteins ---- Nucleobase-ascorbate transporter LPE1
Source.1782: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23
Source.1783: DFBPPR5739 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR1
Source.1784: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.1785: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1
Source.1786: DFBPPR5753 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.1787: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.1788: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1789: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1
Source.1790: DFBPPR5775 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 2
Source.1791: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.1792: DFBPPR5783 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit A
Source.1793: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.1794: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase
Source.1795: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1796: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1
Source.1797: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic
Source.1798: DFBPPR5802 ---- Plant proteins ---- Dof zinc finger protein PBF
Source.1799: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1800: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase
Source.1801: DFBPPR5807 ---- Plant proteins ---- Histone H2A
Source.1802: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1803: DFBPPR5817 ---- Plant proteins ---- Anamorsin homolog
Source.1804: DFBPPR5819 ---- Plant proteins ---- Photosystem I assembly factor PSA3, chloroplastic
Source.1805: DFBPPR5825 ---- Plant proteins ---- UDP-glycosyltransferase 708A6
Source.1806: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.1807: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.1808: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.1809: DFBPPR5833 ---- Plant proteins ---- O-methyltransferase ZRP4
Source.1810: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.1811: DFBPPR5847 ---- Plant proteins ---- Large ribosomal RNA subunit accumulation protein YCED homolog 1, chloroplastic
Source.1812: DFBPPR5849 ---- Plant proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.1813: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.1814: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase
Source.1815: DFBPPR5862 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.1816: DFBPPR5868 ---- Plant proteins ---- 22 kDa alpha-zein 16
Source.1817: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.1818: DFBPPR5872 ---- Plant proteins ---- 50S ribosomal protein L29, chloroplastic
Source.1819: DFBPPR5879 ---- Plant proteins ---- Protein POOR HOMOLOGOUS SYNAPSIS 1
Source.1820: DFBPPR5880 ---- Plant proteins ---- Protein LIGULELESS 1
Source.1821: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.1822: DFBPPR5885 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.1823: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1
Source.1824: DFBPPR5894 ---- Plant proteins ---- Isoflavone reductase homolog IRL
Source.1825: DFBPPR5895 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1826: DFBPPR5902 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.1827: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.1828: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4
Source.1829: DFBPPR5918 ---- Plant proteins ---- Aquaporin TIP2-1
Source.1830: DFBPPR5922 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.1831: DFBPPR5925 ---- Plant proteins ---- Photosystem I reaction center subunit VI, chloroplastic
Source.1832: DFBPPR5927 ---- Plant proteins ---- Aquaporin SIP2-1
Source.1833: DFBPPR5928 ---- Plant proteins ---- 16 kDa gamma-zein
Source.1834: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1835: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2
Source.1836: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1837: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.1838: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A
Source.1839: DFBPPR5939 ---- Plant proteins ---- 15-cis-zeta-carotene isomerase, chloroplastic
Source.1840: DFBPPR5943 ---- Plant proteins ---- Aquaporin PIP2-3
Source.1841: DFBPPR5947 ---- Plant proteins ---- Aquaporin TIP2-2
Source.1842: DFBPPR5957 ---- Plant proteins ---- Protein FLOURY 2
Source.1843: DFBPPR5963 ---- Plant proteins ---- Homeobox protein knotted-1-like 5
Source.1844: DFBPPR5967 ---- Plant proteins ---- Cytochrome b6-f complex subunit 6
Source.1845: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6
Source.1846: DFBPPR5978 ---- Plant proteins ---- CASP-like protein 1E1
Source.1847: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2
Source.1848: DFBPPR5982 ---- Plant proteins ---- Aquaporin TIP5-1
Source.1849: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1
Source.1850: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2
Source.1851: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1
Source.1852: DFBPPR5995 ---- Plant proteins ---- Aquaporin NIP2-2
Source.1853: DFBPPR5998 ---- Plant proteins ---- Homeobox protein knotted-1-like 11
Source.1854: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2
Source.1855: DFBPPR6001 ---- Plant proteins ---- Homeobox protein liguleless 3
Source.1856: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.1857: DFBPPR6015 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.1858: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.1859: DFBPPR6020 ---- Plant proteins ---- Aquaporin NIP2-3
Source.1860: DFBPPR6022 ---- Plant proteins ---- Stress-related protein 1
Source.1861: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1862: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.1863: DFBPPR6029 ---- Plant proteins ---- Zein-alpha PMS2
Source.1864: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b
Source.1865: DFBPPR6037 ---- Plant proteins ---- 19 kDa alpha-zein 19C2
Source.1866: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1
Source.1867: DFBPPR6050 ---- Plant proteins ---- CASP-like protein 4U1
Source.1868: DFBPPR6051 ---- Plant proteins ---- CASP-like protein 2C2
Source.1869: DFBPPR6052 ---- Plant proteins ---- Cystatin-1
Source.1870: DFBPPR6057 ---- Plant proteins ---- Zein-alpha PMS1
Source.1871: DFBPPR6058 ---- Plant proteins ---- Elongation factor Ts, mitochondrial
Source.1872: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.1873: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2
Source.1874: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.1875: DFBPPR6080 ---- Plant proteins ---- Zein-alpha 19A2
Source.1876: DFBPPR6081 ---- Plant proteins ---- Zein-alpha 19B1
Source.1877: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1
Source.1878: DFBPPR6085 ---- Plant proteins ---- Zein-alpha A30
Source.1879: DFBPPR6088 ---- Plant proteins ---- Zein-alpha ZG99
Source.1880: DFBPPR6090 ---- Plant proteins ---- 40S ribosomal protein S14
Source.1881: DFBPPR6093 ---- Plant proteins ---- Zein-alpha 19C1
Source.1882: DFBPPR6094 ---- Plant proteins ---- Zein-alpha PZ19.1
Source.1883: DFBPPR6095 ---- Plant proteins ---- Zein-alpha A20
Source.1884: DFBPPR6096 ---- Plant proteins ---- Zein-alpha GZ19AB11
Source.1885: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2
Source.1886: DFBPPR6100 ---- Plant proteins ---- CASP-like protein 5B2
Source.1887: DFBPPR6101 ---- Plant proteins ---- Zein-alpha M6
Source.1888: DFBPPR6102 ---- Plant proteins ---- CASP-like protein 2C3
Source.1889: DFBPPR6105 ---- Plant proteins ---- CASP-like protein 2U1
Source.1890: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.1891: DFBPPR6109 ---- Plant proteins ---- CASP-like protein 2C1
Source.1892: DFBPPR6110 ---- Plant proteins ---- Zein-alpha Z4
Source.1893: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1
Source.1894: DFBPPR6112 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.1895: DFBPPR6113 ---- Plant proteins ---- CASP-like protein 2C4
Source.1896: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.1897: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.1898: DFBPPR6138 ---- Plant proteins ---- Anther-specific protein MZm3-3
Source.1899: DFBPPR6147 ---- Plant proteins ---- 60S ribosomal protein L19
Source.1900: DFBPPR6159 ---- Plant proteins ---- MFS14 protein
Source.1901: DFBPPR6165 ---- Plant proteins ---- Uncharacterized 33.9 kDa protein in mitochondrial linear 2.3 KB plasmid
Source.1902: DFBPPR6172 ---- Plant proteins ---- Unknown protein from spot 207 of 2D-PAGE of etiolated coleoptile
Source.1903: DFBPPR6180 ---- Plant proteins ---- Unknown protein from spot 168 of 2D-PAGE of etiolated coleoptile
Source.1904: DFBPPR6186 ---- Plant proteins ---- Transposable element activator uncharacterized 23 kDa protein
Source.1905: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1906: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.1907: DFBPPR6220 ---- Plant proteins ---- Photosystem II protein D1
Source.1908: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial
Source.1909: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic
Source.1910: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.1911: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1912: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1913: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.1914: DFBPPR6249 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.1915: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1916: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic
Source.1917: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.1918: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1919: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.1920: DFBPPR6289 ---- Plant proteins ---- Protein farnesyltransferase subunit beta
Source.1921: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.1922: DFBPPR6297 ---- Plant proteins ---- Aminomethyltransferase, mitochondrial
Source.1923: DFBPPR6309 ---- Plant proteins ---- Cytochrome b
Source.1924: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH
Source.1925: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase
Source.1926: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.1927: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.1928: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.1929: DFBPPR6337 ---- Plant proteins ---- Histone H2A.1
Source.1930: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.1931: DFBPPR6355 ---- Plant proteins ---- Endochitinase
Source.1932: DFBPPR6359 ---- Plant proteins ---- ATP synthase delta chain, chloroplastic
Source.1933: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1
Source.1934: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.1935: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic
Source.1936: DFBPPR6372 ---- Plant proteins ---- Early nodulin-12A
Source.1937: DFBPPR6386 ---- Plant proteins ---- ATP synthase subunit delta', mitochondrial
Source.1938: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.1939: DFBPPR6395 ---- Plant proteins ---- Histone H2A.2
Source.1940: DFBPPR6403 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial
Source.1941: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic
Source.1942: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.1943: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.1944: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.1945: DFBPPR6423 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.1946: DFBPPR6445 ---- Plant proteins ---- Early nodulin-12B
Source.1947: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.1948: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.1949: DFBPPR6466 ---- Plant proteins ---- Arginine decarboxylase
Source.1950: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.1951: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic
Source.1952: DFBPPR6475 ---- Plant proteins ---- Probable aquaporin PIP-type 7a
Source.1953: DFBPPR6481 ---- Plant proteins ---- 30S ribosomal protein S7, chloroplastic
Source.1954: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2
Source.1955: DFBPPR6486 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 1
Source.1956: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.1957: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein
Source.1958: DFBPPR6492 ---- Plant proteins ---- Phospholipid hydroperoxide glutathione peroxidase, chloroplastic
Source.1959: DFBPPR6500 ---- Plant proteins ---- Defensin-like protein 39
Source.1960: DFBPPR6511 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.1961: DFBPPR6513 ---- Plant proteins ---- Plastoglobulin-1, chloroplastic
Source.1962: DFBPPR6518 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.1963: DFBPPR6524 ---- Plant proteins ---- Preprotein translocase subunit SECY, chloroplastic
Source.1964: DFBPPR6532 ---- Plant proteins ---- 22.7 kDa class IV heat shock protein
Source.1965: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A
Source.1966: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1967: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic
Source.1968: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic
Source.1969: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic
Source.1970: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic
Source.1971: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.1972: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.1973: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.1974: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.1975: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.1976: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.1977: DFBPPR6652 ---- Plant proteins ---- Histone H2A.1
Source.1978: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic
Source.1979: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.1980: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.1981: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1982: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic
Source.1983: DFBPPR6683 ---- Plant proteins ---- Glutenin, high molecular weight subunit DX5
Source.1984: DFBPPR6690 ---- Plant proteins ---- Histone H2A.2.2
Source.1985: DFBPPR6691 ---- Plant proteins ---- Histone H2A.2.1
Source.1986: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic
Source.1987: DFBPPR6694 ---- Plant proteins ---- TATA-box-binding protein 1
Source.1988: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.1989: DFBPPR6697 ---- Plant proteins ---- Non-specific lipid-transfer protein 2G
Source.1990: DFBPPR6699 ---- Plant proteins ---- TATA-box-binding protein 2
Source.1991: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.1992: DFBPPR6702 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-1
Source.1993: DFBPPR6709 ---- Plant proteins ---- Protein H2A.7
Source.1994: DFBPPR6712 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM16
Source.1995: DFBPPR6717 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM3
Source.1996: DFBPPR6728 ---- Plant proteins ---- Protein H2A.5
Source.1997: DFBPPR6729 ---- Plant proteins ---- Protein H2A.6
Source.1998: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.1999: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.2000: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic
Source.2001: DFBPPR6752 ---- Plant proteins ---- Probable non-specific lipid-transfer protein 3
Source.2002: DFBPPR6753 ---- Plant proteins ---- Ferredoxin, chloroplastic
Source.2003: DFBPPR6754 ---- Plant proteins ---- Histone H2A.4
Source.2004: DFBPPR6755 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.2005: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase
Source.2006: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.2007: DFBPPR6764 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-2
Source.2008: DFBPPR6765 ---- Plant proteins ---- Non-specific lipid-transfer protein
Source.2009: DFBPPR6767 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 2-3
Source.2010: DFBPPR6770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.2011: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2012: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A
Source.2013: DFBPPR6782 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.2014: DFBPPR6792 ---- Plant proteins ---- Cytochrome b6-f complex subunit 6
Source.2015: DFBPPR6793 ---- Plant proteins ---- Chymotrypsin inhibitor WCI
Source.2016: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B
Source.2017: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.2018: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B
Source.2019: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.2020: DFBPPR6815 ---- Plant proteins ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.2021: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C
Source.2022: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2023: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.2024: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.2025: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2
Source.2026: DFBPPR6842 ---- Plant proteins ---- Splicing factor U2af large subunit A
Source.2027: DFBPPR6847 ---- Plant proteins ---- Casparian strip membrane protein 1
Source.2028: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2029: DFBPPR6855 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2030: DFBPPR6860 ---- Plant proteins ---- Probable phytol kinase, chloroplastic
Source.2031: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.2032: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.2033: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.2034: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2035: DFBPPR6886 ---- Plant proteins ---- Glutenin, high molecular weight subunit PW212
Source.2036: DFBPPR6887 ---- Plant proteins ---- Glutenin, low molecular weight subunit
Source.2037: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1
Source.2038: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.2039: DFBPPR6924 ---- Plant proteins ---- Glutenin, high molecular weight subunit PC256
Source.2040: DFBPPR6925 ---- Plant proteins ---- Glutenin, high molecular weight subunit PC237
Source.2041: DFBPPR6928 ---- Plant proteins ---- Avenin-like a5
Source.2042: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin
Source.2043: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2
Source.2044: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6
Source.2045: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7
Source.2046: DFBPPR6983 ---- Plant proteins ---- Avenin-like a4
Source.2047: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1
Source.2048: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10
Source.2049: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9
Source.2050: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8
Source.2051: DFBPPR6991 ---- Plant proteins ---- Ninja-family protein 3
Source.2052: DFBPPR6998 ---- Plant proteins ---- Trypsin/alpha-amylase inhibitor CMX1/CMX3
Source.2053: DFBPPR7000 ---- Plant proteins ---- Trypsin/alpha-amylase inhibitor CMX2
Source.2054: DFBPPR7003 ---- Plant proteins ---- Protein RAFTIN 1C
Source.2055: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.2056: DFBPPR7015 ---- Plant proteins ---- Phytepsin
Source.2057: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.2058: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.2059: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.2060: DFBPPR7031 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMb
Source.2061: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2062: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.2063: DFBPPR7049 ---- Plant proteins ---- 1-Cys peroxiredoxin PER1
Source.2064: DFBPPR7050 ---- Plant proteins ---- Lichenase-2
Source.2065: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.2066: DFBPPR7053 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMa
Source.2067: DFBPPR7055 ---- Plant proteins ---- Homeobox protein KNOX3
Source.2068: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.2069: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.2070: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.2071: DFBPPR7076 ---- Plant proteins ---- Acyl carrier protein 1, chloroplastic
Source.2072: DFBPPR7087 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase
Source.2073: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.2074: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic
Source.2075: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.2076: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.2077: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.2078: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2079: DFBPPR7110 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIII
Source.2080: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.2081: DFBPPR7116 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.2082: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.2083: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2084: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1
Source.2085: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2
Source.2086: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3
Source.2087: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV
Source.2088: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.2089: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.2090: DFBPPR7142 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.2091: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A
Source.2092: DFBPPR7144 ---- Plant proteins ---- L-lactate dehydrogenase B
Source.2093: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX
Source.2094: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.2095: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.2096: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.2097: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3
Source.2098: DFBPPR7154 ---- Plant proteins ---- Nicotianamine synthase 9
Source.2099: DFBPPR7155 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.2100: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8
Source.2101: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.2102: DFBPPR7164 ---- Plant proteins ---- Probable non-specific lipid-transfer protein
Source.2103: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.2104: DFBPPR7186 ---- Plant proteins ---- Photosystem I reaction center subunit III, chloroplastic
Source.2105: DFBPPR7188 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2106: DFBPPR7192 ---- Plant proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.2107: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.2108: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.2109: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase
Source.2110: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.2111: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.2112: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.2113: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.2114: DFBPPR7242 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.2115: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.2116: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1
Source.2117: DFBPPR7256 ---- Plant proteins ---- Cytochrome b6-f complex subunit 6
Source.2118: DFBPPR7258 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV90, chloroplastic
Source.2119: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic
Source.2120: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic
Source.2121: DFBPPR7262 ---- Plant proteins ---- Photosystem I reaction center subunit IV, chloroplastic
Source.2122: DFBPPR7276 ---- Plant proteins ---- Photosystem I reaction center subunit N, chloroplastic
Source.2123: DFBPPR7289 ---- Plant proteins ---- Myb-related protein Hv33
Source.2124: DFBPPR7301 ---- Plant proteins ---- Glycine-rich cell wall structural protein
Source.2125: DFBPPR7302 ---- Plant proteins ---- Probable nicotianamine synthase 3
Source.2126: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4
Source.2127: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2
Source.2128: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6
Source.2129: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7
Source.2130: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein
Source.2131: DFBPPR7345 ---- Plant proteins ---- Cold-regulated protein BLT14
Source.2132: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic
Source.2133: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.2134: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.2135: DFBPPR7401 ---- Plant proteins ---- Photosystem II protein D1
Source.2136: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase
Source.2137: DFBPPR7407 ---- Plant proteins ---- Oleosin-B1
Source.2138: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic
Source.2139: DFBPPR7428 ---- Plant proteins ---- Isocitrate lyase
Source.2140: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.2141: DFBPPR7435 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.2142: DFBPPR7436 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.2143: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.2144: DFBPPR7438 ---- Plant proteins ---- Oleosin-B3
Source.2145: DFBPPR7439 ---- Plant proteins ---- Oleosin-B4
Source.2146: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.2147: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.2148: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.2149: DFBPPR7466 ---- Plant proteins ---- 3-phosphoshikimate 1-carboxyvinyltransferase, chloroplastic
Source.2150: DFBPPR7475 ---- Plant proteins ---- ATP synthase subunit beta, chloroplastic
Source.2151: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.2152: DFBPPR7488 ---- Plant proteins ---- Homeobox protein HD1
Source.2153: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.2154: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.2155: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.2156: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.2157: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.2158: DFBPPR7523 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.2159: DFBPPR7524 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.2160: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.2161: DFBPPR7529 ---- Plant proteins ---- Profilin
Source.2162: DFBPPR7536 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial
Source.2163: DFBPPR7540 ---- Plant proteins ---- Ribosomal protein S14, mitochondrial
Source.2164: DFBPPR7550 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein
Source.2165: DFBPPR7594 ---- Milk proteins ---- Lactadherin
Source.2166: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.2167: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein
Source.2168: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.2169: DFBPPR7604 ---- Milk proteins ---- Zinc transporter 2
Source.2170: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.2171: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.2172: DFBPPR7625 ---- Milk proteins ---- Leucine-rich alpha-2-glycoprotein
Source.2173: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.2174: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.2175: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.2176: DFBPPR7634 ---- Milk proteins ---- CD59 glycoprotein
Source.2177: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.2178: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.2179: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.2180: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.2181: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.2182: DFBPPR7657 ---- Milk proteins ---- Chymosin
Source.2183: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.2184: DFBPPR7659 ---- Milk proteins ---- Glycosylation-dependent cell adhesion molecule 1
Source.2185: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.2186: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.2187: DFBPPR7676 ---- Milk proteins ---- Kappa-casein
Source.2188: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.2189: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.2190: DFBPPR7684 ---- Milk proteins ---- Glycosylation-dependent cell adhesion molecule 1
Source.2191: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.2192: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.2193: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.2194: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.2195: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.2196: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.2197: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2198: DFBPPR7729 ---- Plant proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.2199: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase
Source.2200: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase
Source.2201: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.2202: DFBPPR8193 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMW33
Source.2203: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.2204: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.2205: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2206: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.2207: DFBPPR8381 ---- Plant proteins ---- Conglutin-7
Source.2208: DFBPPR8387 ---- Plant proteins ---- Cationic peroxidase 2
Source.2209: DFBPPR8390 ---- Plant proteins ---- Galactose-binding lectin
Source.2210: DFBPPR8391 ---- Plant proteins ---- Oleosin Ara h 15.0101
Source.2211: DFBPPR8400 ---- Plant proteins ---- Oleosin Ara h 11.0102
Source.2212: DFBPPR8420 ---- Plant proteins ---- Peroxygenase
Source.2213: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.2214: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2215: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.2216: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.2217: DFBPPR8438 ---- Plant proteins ---- Non-specific lipid-transfer protein 2
Source.2218: DFBPPR8440 ---- Plant proteins ---- Non-specific lipid-transfer protein 4
Source.2219: DFBPPR8441 ---- Plant proteins ---- Non-specific lipid-transfer protein 6
Source.2220: DFBPPR8442 ---- Plant proteins ---- Non-specific lipid-transfer protein 5
Source.2221: DFBPPR8444 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.2222: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.2223: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.2224: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.2225: DFBPPR8463 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.2226: DFBPPR8467 ---- Plant proteins ---- Photosystem II CP47 reaction center protein
Source.2227: DFBPPR8486 ---- Milk proteins ---- Lactadherin
Source.2228: DFBPPR8487 ---- Milk proteins ---- Glycosylation-dependent cell adhesion molecule 1
Source.2229: DFBPPR8496 ---- Milk proteins ---- Mucin-1
Source.2230: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.2231: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.2232: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.2233: DFBPPR8502 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.2234: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.2235: DFBPPR8508 ---- Milk proteins ---- Pancreatic lipase-related protein 2
Source.2236: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase
Source.2237: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3
Source.2238: DFBPPR15934 ---- Animal proteins ---- Apolipoprotein A-I
Source.2239: DFBPPR15935 ---- Animal proteins ---- Catalase
Source.2240: DFBPPR15939 ---- Animal proteins ---- Rhodopsin
Source.2241: DFBPPR15940 ---- Animal proteins ---- Thyroid transcription factor 1
Source.2242: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.2243: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.2244: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.2245: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.2246: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.2247: DFBPPR15956 ---- Animal proteins ---- Phospholipase A2
Source.2248: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.2249: DFBPPR15969 ---- Animal proteins ---- Natriuretic peptides A
Source.2250: DFBPPR15973 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 5
Source.2251: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.2252: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.2253: DFBPPR16010 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.2254: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.2255: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.2256: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.2257: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.2258: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.2259: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.2260: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35
Source.2261: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.2262: DFBPPR16034 ---- Animal proteins ---- Progesterone receptor
Source.2263: DFBPPR16038 ---- Animal proteins ---- Protein amnionless
Source.2264: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.2265: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.2266: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.2267: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.2268: DFBPPR16051 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.2269: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2270: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.2271: DFBPPR16057 ---- Animal proteins ---- Interleukin-8
Source.2272: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.2273: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2
Source.2274: DFBPPR16096 ---- Animal proteins ---- Protein CLN8
Source.2275: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.2276: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.2277: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.2278: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.2279: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain
Source.2280: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.2281: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.2282: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer
Source.2283: DFBPPR16135 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.2284: DFBPPR16138 ---- Animal proteins ---- Claudin-3
Source.2285: DFBPPR16144 ---- Animal proteins ---- Tight junction protein ZO-3
Source.2286: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.2287: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.2288: DFBPPR16155 ---- Animal proteins ---- NAD(P)H-hydrate epimerase
Source.2289: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.2290: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.2291: DFBPPR16172 ---- Animal proteins ---- Translocator protein 2
Source.2292: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.2293: DFBPPR16183 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase
Source.2294: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.2295: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.2296: DFBPPR16191 ---- Animal proteins ---- Somatotropin
Source.2297: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.2298: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2299: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.2300: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.2301: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.2302: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.2303: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.2304: DFBPPR16213 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.2305: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.2306: DFBPPR16228 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.2307: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.2308: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2309: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.2310: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.2311: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a
Source.2312: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1
Source.2313: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.2314: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4
Source.2315: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.2316: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin
Source.2317: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.2318: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3
Source.2319: DFBPPR16297 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.2320: DFBPPR16298 ---- Animal proteins ---- Erythropoietin receptor
Source.2321: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.2322: DFBPPR16305 ---- Animal proteins ---- Phosducin
Source.2323: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel
Source.2324: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.2325: DFBPPR16326 ---- Animal proteins ---- Desmin
Source.2326: DFBPPR16327 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.2327: DFBPPR16368 ---- Animal proteins ---- Tyrosinase
Source.2328: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.2329: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.2330: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.2331: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.2332: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.2333: DFBPPR16439 ---- Animal proteins ---- Lutropin subunit beta
Source.2334: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.2335: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.2336: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6
Source.2337: DFBPPR16467 ---- Animal proteins ---- Opticin
Source.2338: DFBPPR16472 ---- Animal proteins ---- Beta-1,3-galactosyltransferase 4
Source.2339: DFBPPR16473 ---- Animal proteins ---- Glycoprotein hormones alpha chain
Source.2340: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.2341: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.2342: DFBPPR16508 ---- Animal proteins ---- Protein crumbs homolog 3
Source.2343: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.2344: DFBPPR16512 ---- Animal proteins ---- Cytochrome c oxidase copper chaperone
Source.2345: DFBPPR16516 ---- Animal proteins ---- Cytospin-A
Source.2346: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8
Source.2347: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator
Source.2348: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.2349: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor
Source.2350: DFBPPR16541 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2351: DFBPPR16547 ---- Animal proteins ---- Alpha-fetoprotein
Source.2352: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.2353: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2354: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.2355: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.2356: DFBPPR16564 ---- Animal proteins ---- Bcl-2-like protein 2
Source.2357: DFBPPR16569 ---- Animal proteins ---- Beta-lactoglobulin-2
Source.2358: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.2359: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.2360: DFBPPR16578 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.2361: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2362: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.2363: DFBPPR16587 ---- Animal proteins ---- B-lymphocyte antigen CD20
Source.2364: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.2365: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4
Source.2366: DFBPPR16596 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.2367: DFBPPR16599 ---- Animal proteins ---- Receptor-binding cancer antigen expressed on SiSo cells
Source.2368: DFBPPR16600 ---- Animal proteins ---- Ras-related protein Rab-4B
Source.2369: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype
Source.2370: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1
Source.2371: DFBPPR16616 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.2372: DFBPPR16620 ---- Animal proteins ---- Angiopoietin-1
Source.2373: DFBPPR16621 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.2374: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.2375: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.2376: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.2377: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7
Source.2378: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.2379: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.2380: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.2381: DFBPPR16655 ---- Animal proteins ---- Somatostatin
Source.2382: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5
Source.2383: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b
Source.2384: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22
Source.2385: DFBPPR16669 ---- Animal proteins ---- C-C motif chemokine 28
Source.2386: DFBPPR16681 ---- Animal proteins ---- Olfactory receptor-like protein OLF3
Source.2387: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.2388: DFBPPR16693 ---- Animal proteins ---- Cingulin
Source.2389: DFBPPR16694 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.2390: DFBPPR16695 ---- Animal proteins ---- UDP-galactose translocator
Source.2391: DFBPPR16704 ---- Animal proteins ---- Retbindin
Source.2392: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.2393: DFBPPR16714 ---- Animal proteins ---- Protein fosB
Source.2394: DFBPPR16724 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2
Source.2395: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46
Source.2396: DFBPPR16739 ---- Animal proteins ---- Lengsin
Source.2397: DFBPPR16744 ---- Animal proteins ---- Apoptotic protease-activating factor 1
Source.2398: DFBPPR16746 ---- Animal proteins ---- Tektin-1
Source.2399: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.2400: DFBPPR16752 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.2401: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.2402: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase
Source.2403: DFBPPR16777 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.2404: DFBPPR16779 ---- Animal proteins ---- Hemoglobin subunit beta
Source.2405: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1
Source.2406: DFBPPR16799 ---- Animal proteins ---- Somatotropin
Source.2407: DFBPPR16804 ---- Animal proteins ---- Pancreatic trypsin inhibitor
Source.2408: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.2409: DFBPPR16809 ---- Animal proteins ---- Rhodopsin
Source.2410: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.2411: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2412: DFBPPR16818 ---- Animal proteins ---- ATPase inhibitor, mitochondrial
Source.2413: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.2414: DFBPPR16826 ---- Animal proteins ---- Phospholipase A2
Source.2415: DFBPPR16833 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.2416: DFBPPR16838 ---- Animal proteins ---- Leptin
Source.2417: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.2418: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.2419: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor
Source.2420: DFBPPR16861 ---- Animal proteins ---- Adenylate kinase 2, mitochondrial
Source.2421: DFBPPR16863 ---- Animal proteins ---- Biglycan
Source.2422: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2423: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.2424: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2425: DFBPPR16887 ---- Animal proteins ---- Pleiotrophin
Source.2426: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial
Source.2427: DFBPPR16902 ---- Animal proteins ---- Interleukin-8
Source.2428: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.2429: DFBPPR16907 ---- Animal proteins ---- Acyl carrier protein, mitochondrial
Source.2430: DFBPPR16909 ---- Animal proteins ---- Calreticulin
Source.2431: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.2432: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.2433: DFBPPR16930 ---- Animal proteins ---- Apolipoprotein A-I
Source.2434: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.2435: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.2436: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.2437: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin
Source.2438: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.2439: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6
Source.2440: DFBPPR16977 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.2441: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.2442: DFBPPR16985 ---- Animal proteins ---- Filensin
Source.2443: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.2444: DFBPPR16996 ---- Animal proteins ---- Retinol dehydrogenase 5
Source.2445: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.2446: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.2447: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1
Source.2448: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.2449: DFBPPR17006 ---- Animal proteins ---- Syntaxin-17
Source.2450: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1
Source.2451: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.2452: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.2453: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.2454: DFBPPR17029 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.2455: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.2456: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.2457: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.2458: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.2459: DFBPPR17044 ---- Animal proteins ---- N-acyl-phosphatidylethanolamine-hydrolyzing phospholipase D
Source.2460: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.2461: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.2462: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform
Source.2463: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.2464: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1
Source.2465: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.2466: DFBPPR17086 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.2467: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.2468: DFBPPR17090 ---- Animal proteins ---- Phakinin
Source.2469: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.2470: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.2471: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.2472: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1
Source.2473: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.2474: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.2475: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.2476: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.2477: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1
Source.2478: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2479: DFBPPR17137 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 1
Source.2480: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.2481: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.2482: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.2483: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.2484: DFBPPR17168 ---- Animal proteins ---- Angiopoietin-1
Source.2485: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.2486: DFBPPR17172 ---- Animal proteins ---- Cartilage oligomeric matrix protein
Source.2487: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.2488: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.2489: DFBPPR17205 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.2490: DFBPPR17207 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase 75 kDa subunit, mitochondrial
Source.2491: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.2492: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.2493: DFBPPR17237 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.2494: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35
Source.2495: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33
Source.2496: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.2497: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.2498: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D
Source.2499: DFBPPR17270 ---- Animal proteins ---- Nucleophosmin
Source.2500: DFBPPR17273 ---- Animal proteins ---- Integrin-linked protein kinase
Source.2501: DFBPPR17275 ---- Animal proteins ---- Fructose-2,6-bisphosphatase TIGAR
Source.2502: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2
Source.2503: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.2504: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1
Source.2505: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.2506: DFBPPR17292 ---- Animal proteins ---- COUP transcription factor 2
Source.2507: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.2508: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.2509: DFBPPR17296 ---- Animal proteins ---- Dynamin-2
Source.2510: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.2511: DFBPPR17301 ---- Animal proteins ---- N-fatty-acyl-amino acid synthase/hydrolase PM20D1
Source.2512: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial
Source.2513: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.2514: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3
Source.2515: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.2516: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.2517: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.2518: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase
Source.2519: DFBPPR17332 ---- Animal proteins ---- Protein odd-skipped-related 1
Source.2520: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.2521: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.2522: DFBPPR17340 ---- Animal proteins ---- Sterol-4-alpha-carboxylate 3-dehydrogenase, decarboxylating
Source.2523: DFBPPR17341 ---- Animal proteins ---- Radixin
Source.2524: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.2525: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.2526: DFBPPR17349 ---- Animal proteins ---- Sialidase-3
Source.2527: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.2528: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.2529: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.2530: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.2531: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.2532: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H
Source.2533: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.2534: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.2535: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.2536: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.2537: DFBPPR17376 ---- Animal proteins ---- Flotillin-1
Source.2538: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.2539: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.2540: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.2541: DFBPPR17384 ---- Animal proteins ---- Alpha-actinin-1
Source.2542: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.2543: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.2544: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.2545: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.2546: DFBPPR17415 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase 1
Source.2547: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.2548: DFBPPR17423 ---- Animal proteins ---- Furin
Source.2549: DFBPPR17425 ---- Animal proteins ---- Dynamin-1
Source.2550: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.2551: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.2552: DFBPPR17430 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.2553: DFBPPR17432 ---- Animal proteins ---- Ephrin-A1
Source.2554: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.2555: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.2556: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.2557: DFBPPR17447 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 5
Source.2558: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.2559: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.2560: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.2561: DFBPPR17481 ---- Animal proteins ---- Apolipoprotein C-III
Source.2562: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.2563: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.2564: DFBPPR17495 ---- Animal proteins ---- tRNA methyltransferase 10 homolog C
Source.2565: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.2566: DFBPPR17498 ---- Animal proteins ---- Guanine nucleotide-binding protein G(o) subunit alpha
Source.2567: DFBPPR17509 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.2568: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1
Source.2569: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.2570: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase
Source.2571: DFBPPR17522 ---- Animal proteins ---- Homer protein homolog 1
Source.2572: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.2573: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3
Source.2574: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.2575: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E
Source.2576: DFBPPR17534 ---- Animal proteins ---- RISC-loading complex subunit TARBP2
Source.2577: DFBPPR17538 ---- Animal proteins ---- Septin-7
Source.2578: DFBPPR17549 ---- Animal proteins ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.2579: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4
Source.2580: DFBPPR17554 ---- Animal proteins ---- Double-strand-break repair protein rad21 homolog
Source.2581: DFBPPR17555 ---- Animal proteins ---- ATP synthase subunit delta, mitochondrial
Source.2582: DFBPPR17556 ---- Animal proteins ---- Histone H2A type 1
Source.2583: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.2584: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1
Source.2585: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.2586: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.2587: DFBPPR17571 ---- Animal proteins ---- Proton-coupled folate transporter
Source.2588: DFBPPR17574 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.2589: DFBPPR17580 ---- Animal proteins ---- Insulin-like growth factor-binding protein 5
Source.2590: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.2591: DFBPPR17592 ---- Animal proteins ---- Claudin-3
Source.2592: DFBPPR17593 ---- Animal proteins ---- Claudin-3
Source.2593: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.2594: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.2595: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.2596: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.2597: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.2598: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.2599: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1
Source.2600: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2
Source.2601: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.2602: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.2603: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.2604: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.2605: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.2606: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.2607: DFBPPR17743 ---- Animal proteins ---- Myelin protein P0
Source.2608: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.2609: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2
Source.2610: DFBPPR17758 ---- Animal proteins ---- Matrix Gla protein
Source.2611: DFBPPR17760 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 1
Source.2612: DFBPPR17761 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.2613: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.2614: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.2615: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.2616: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.2617: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.2618: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.2619: DFBPPR17792 ---- Animal proteins ---- Glycine N-acyltransferase
Source.2620: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial
Source.2621: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6
Source.2622: DFBPPR17804 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.2623: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1
Source.2624: DFBPPR17807 ---- Animal proteins ---- Opticin
Source.2625: DFBPPR17808 ---- Animal proteins ---- N-alpha-acetyltransferase 60
Source.2626: DFBPPR17810 ---- Animal proteins ---- Histone H1.2
Source.2627: DFBPPR17815 ---- Animal proteins ---- 40S ribosomal protein SA
Source.2628: DFBPPR17821 ---- Animal proteins ---- 2',3'-cyclic-nucleotide 3'-phosphodiesterase
Source.2629: DFBPPR17832 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.2630: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.2631: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3
Source.2632: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.2633: DFBPPR17856 ---- Animal proteins ---- Selenoprotein S
Source.2634: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.2635: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.2636: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.2637: DFBPPR17867 ---- Animal proteins ---- Guanylate kinase
Source.2638: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.2639: DFBPPR17884 ---- Animal proteins ---- Mitochondrial cardiolipin hydrolase
Source.2640: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.2641: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.2642: DFBPPR17894 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 9
Source.2643: DFBPPR17895 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase DES1
Source.2644: DFBPPR17896 ---- Animal proteins ---- Lethal(2) giant larvae protein homolog 1
Source.2645: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial
Source.2646: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.2647: DFBPPR17902 ---- Animal proteins ---- PDZ and LIM domain protein 4
Source.2648: DFBPPR17909 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 8
Source.2649: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.2650: DFBPPR17913 ---- Animal proteins ---- ATP synthase subunit gamma, mitochondrial
Source.2651: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.2652: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1
Source.2653: DFBPPR17921 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.2654: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.2655: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.2656: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.2657: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.2658: DFBPPR17942 ---- Animal proteins ---- Proteasome subunit beta type-9
Source.2659: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.2660: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10
Source.2661: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3
Source.2662: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1
Source.2663: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.2664: DFBPPR17957 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.2665: DFBPPR17963 ---- Animal proteins ---- Acetyl-CoA acetyltransferase, mitochondrial
Source.2666: DFBPPR17971 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 7, mitochondrial
Source.2667: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.2668: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.2669: DFBPPR17978 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial
Source.2670: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin
Source.2671: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.2672: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.2673: DFBPPR17994 ---- Animal proteins ---- Lysophospholipid acyltransferase 7
Source.2674: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.2675: DFBPPR18001 ---- Animal proteins ---- Syntaxin-1B
Source.2676: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.2677: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.2678: DFBPPR18011 ---- Animal proteins ---- Afamin
Source.2679: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.2680: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase
Source.2681: DFBPPR18021 ---- Animal proteins ---- Lutropin subunit beta
Source.2682: DFBPPR18022 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial
Source.2683: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.2684: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.2685: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2686: DFBPPR18028 ---- Animal proteins ---- Atlastin-1
Source.2687: DFBPPR18032 ---- Animal proteins ---- Insulin-induced gene 1 protein
Source.2688: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.2689: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.2690: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3
Source.2691: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.2692: DFBPPR18041 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 S
Source.2693: DFBPPR18057 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 T
Source.2694: DFBPPR18058 ---- Animal proteins ---- Ras-related GTP-binding protein A
Source.2695: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.2696: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.2697: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.2698: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.2699: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.2700: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta
Source.2701: DFBPPR18093 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2702: DFBPPR18096 ---- Animal proteins ---- Serine palmitoyltransferase 1
Source.2703: DFBPPR18097 ---- Animal proteins ---- Deoxycytidine kinase
Source.2704: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.2705: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.2706: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.2707: DFBPPR18114 ---- Animal proteins ---- Charged multivesicular body protein 4a
Source.2708: DFBPPR18116 ---- Animal proteins ---- Carbonic anhydrase 4
Source.2709: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23
Source.2710: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.2711: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter
Source.2712: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.2713: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3
Source.2714: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.2715: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha
Source.2716: DFBPPR18134 ---- Animal proteins ---- Cyclin-T1
Source.2717: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.2718: DFBPPR18163 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.2719: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1
Source.2720: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.2721: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6
Source.2722: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.2723: DFBPPR18211 ---- Animal proteins ---- Phosducin
Source.2724: DFBPPR18216 ---- Animal proteins ---- Collectin-12
Source.2725: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4
Source.2726: DFBPPR18227 ---- Animal proteins ---- Desmin
Source.2727: DFBPPR18231 ---- Animal proteins ---- Transcription factor jun-B
Source.2728: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1
Source.2729: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.2730: DFBPPR18272 ---- Animal proteins ---- Folylpolyglutamate synthase, mitochondrial
Source.2731: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.2732: DFBPPR18286 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.2733: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.2734: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.2735: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase
Source.2736: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.2737: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.2738: DFBPPR18308 ---- Animal proteins ---- Chymotrypsinogen A
Source.2739: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.2740: DFBPPR18318 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.2741: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.2742: DFBPPR18322 ---- Animal proteins ---- Stomatin-like protein 2, mitochondrial
Source.2743: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.2744: DFBPPR18324 ---- Animal proteins ---- RuvB-like 2
Source.2745: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon
Source.2746: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.2747: DFBPPR18337 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 alpha
Source.2748: DFBPPR18339 ---- Animal proteins ---- SPARC
Source.2749: DFBPPR18344 ---- Animal proteins ---- Monofunctional C1-tetrahydrofolate synthase, mitochondrial
Source.2750: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.2751: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B
Source.2752: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.2753: DFBPPR18361 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.2754: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2
Source.2755: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.2756: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.2757: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3
Source.2758: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.2759: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.2760: DFBPPR18391 ---- Animal proteins ---- Exosome complex component RRP43
Source.2761: DFBPPR18394 ---- Animal proteins ---- Histone H1.1
Source.2762: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.2763: DFBPPR18406 ---- Animal proteins ---- Angiotensinogen
Source.2764: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1
Source.2765: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.2766: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.2767: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.2768: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin
Source.2769: DFBPPR18432 ---- Animal proteins ---- Vacuole membrane protein 1
Source.2770: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.2771: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.2772: DFBPPR18447 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease 2
Source.2773: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2
Source.2774: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.2775: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1
Source.2776: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.2777: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.2778: DFBPPR18478 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.2779: DFBPPR18485 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.2780: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein
Source.2781: DFBPPR18496 ---- Animal proteins ---- Beta-1,3-galactosyl-O-glycosyl-glycoprotein beta-1,6-N-acetylglucosaminyltransferase
Source.2782: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1
Source.2783: DFBPPR18501 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain
Source.2784: DFBPPR18502 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.2785: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8
Source.2786: DFBPPR18508 ---- Animal proteins ---- Regakine-1
Source.2787: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.2788: DFBPPR18520 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.2789: DFBPPR18521 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-3
Source.2790: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.2791: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.2792: DFBPPR18530 ---- Animal proteins ---- Zeta-crystallin
Source.2793: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.2794: DFBPPR18544 ---- Animal proteins ---- ATP synthase subunit e, mitochondrial
Source.2795: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu
Source.2796: DFBPPR18551 ---- Animal proteins ---- Coatomer subunit gamma-1
Source.2797: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.2798: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.2799: DFBPPR18559 ---- Animal proteins ---- Kinesin-like protein KIF22
Source.2800: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3
Source.2801: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5
Source.2802: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.2803: DFBPPR18577 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.2804: DFBPPR18578 ---- Animal proteins ---- 5-demethoxyubiquinone hydroxylase, mitochondrial
Source.2805: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.2806: DFBPPR18587 ---- Animal proteins ---- Proteasome subunit beta type-6
Source.2807: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.2808: DFBPPR18592 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.2809: DFBPPR18593 ---- Animal proteins ---- Pigment epithelium-derived factor
Source.2810: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.2811: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.2812: DFBPPR18599 ---- Animal proteins ---- Beta-1,4-glucuronyltransferase 1
Source.2813: DFBPPR18604 ---- Animal proteins ---- Protein disulfide-isomerase A3
Source.2814: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.2815: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2816: DFBPPR18623 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial
Source.2817: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A
Source.2818: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4
Source.2819: DFBPPR18629 ---- Animal proteins ---- Sphingolipid delta(4)-desaturase/C4-monooxygenase DES2
Source.2820: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.2821: DFBPPR18641 ---- Animal proteins ---- Cadherin-5
Source.2822: DFBPPR18642 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.2823: DFBPPR18653 ---- Animal proteins ---- Palmitoyltransferase ZDHHC21
Source.2824: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.2825: DFBPPR18686 ---- Animal proteins ---- Intraflagellar transport protein 27 homolog
Source.2826: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.2827: DFBPPR18712 ---- Animal proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.2828: DFBPPR18715 ---- Animal proteins ---- Choline transporter-like protein 4
Source.2829: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor
Source.2830: DFBPPR18718 ---- Animal proteins ---- Chondroadherin
Source.2831: DFBPPR18720 ---- Animal proteins ---- Protein quaking
Source.2832: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.2833: DFBPPR18726 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF2
Source.2834: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.2835: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.2836: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.2837: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7
Source.2838: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.2839: DFBPPR18743 ---- Animal proteins ---- Sperm-egg fusion protein TMEM95
Source.2840: DFBPPR18749 ---- Animal proteins ---- Short transient receptor potential channel 4
Source.2841: DFBPPR18754 ---- Animal proteins ---- Collectin-11
Source.2842: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase
Source.2843: DFBPPR18758 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 3
Source.2844: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.2845: DFBPPR18762 ---- Animal proteins ---- DDRGK domain-containing protein 1
Source.2846: DFBPPR18763 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.2847: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.2848: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.2849: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.2850: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4
Source.2851: DFBPPR18797 ---- Animal proteins ---- UV excision repair protein RAD23 homolog A
Source.2852: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.2853: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8
Source.2854: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.2855: DFBPPR18805 ---- Animal proteins ---- Nascent polypeptide-associated complex subunit alpha
Source.2856: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.2857: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.2858: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2
Source.2859: DFBPPR18820 ---- Animal proteins ---- LIM domain kinase 2
Source.2860: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.2861: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.2862: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.2863: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.2864: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.2865: DFBPPR18860 ---- Animal proteins ---- RAS guanyl-releasing protein 2
Source.2866: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1
Source.2867: DFBPPR18864 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.2868: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.2869: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6
Source.2870: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.2871: DFBPPR18902 ---- Animal proteins ---- Plasmanylethanolamine desaturase
Source.2872: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.2873: DFBPPR18910 ---- Animal proteins ---- Aspartyl aminopeptidase
Source.2874: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3
Source.2875: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11
Source.2876: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.2877: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b
Source.2878: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.2879: DFBPPR18926 ---- Animal proteins ---- Keratin, type I cytoskeletal 10
Source.2880: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.2881: DFBPPR18929 ---- Animal proteins ---- Dipeptidyl peptidase 1
Source.2882: DFBPPR18931 ---- Animal proteins ---- Ficolin-2
Source.2883: DFBPPR18933 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.2884: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.2885: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.2886: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.2887: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.2888: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1
Source.2889: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.2890: DFBPPR18968 ---- Animal proteins ---- L-serine dehydratase/L-threonine deaminase
Source.2891: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.2892: DFBPPR18981 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.2893: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.2894: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.2895: DFBPPR18994 ---- Animal proteins ---- Breast cancer anti-estrogen resistance protein 3 homolog
Source.2896: DFBPPR18995 ---- Animal proteins ---- Tektin-3
Source.2897: DFBPPR18996 ---- Animal proteins ---- Serine/threonine-protein kinase 40
Source.2898: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.2899: DFBPPR18999 ---- Animal proteins ---- Keratin, type II cytoskeletal 74
Source.2900: DFBPPR19000 ---- Animal proteins ---- Centrosomal protein of 57 kDa
Source.2901: DFBPPR19004 ---- Animal proteins ---- Histone H1.3
Source.2902: DFBPPR19008 ---- Animal proteins ---- GTP-binding protein 1
Source.2903: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2
Source.2904: DFBPPR19020 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.2905: DFBPPR19022 ---- Animal proteins ---- Spermatogenesis-defective protein 39 homolog
Source.2906: DFBPPR19034 ---- Animal proteins ---- Sialomucin core protein 24
Source.2907: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9
Source.2908: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.2909: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial
Source.2910: DFBPPR19053 ---- Animal proteins ---- Transmembrane protein 100
Source.2911: DFBPPR19056 ---- Animal proteins ---- Gastrin
Source.2912: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.2913: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.2914: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta
Source.2915: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.2916: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.2917: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1
Source.2918: DFBPPR19075 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 J2
Source.2919: DFBPPR19083 ---- Animal proteins ---- UBX domain-containing protein 1
Source.2920: DFBPPR19087 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.2921: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.2922: DFBPPR19092 ---- Animal proteins ---- Autophagy-related protein 13
Source.2923: DFBPPR19093 ---- Animal proteins ---- COUP transcription factor 1
Source.2924: DFBPPR19096 ---- Animal proteins ---- Phenylethanolamine N-methyltransferase
Source.2925: DFBPPR19097 ---- Animal proteins ---- Serine protease HTRA1
Source.2926: DFBPPR19098 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 9
Source.2927: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.2928: DFBPPR19105 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein
Source.2929: DFBPPR19110 ---- Animal proteins ---- Trimeric intracellular cation channel type B
Source.2930: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.2931: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.2932: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3
Source.2933: DFBPPR19131 ---- Animal proteins ---- Nectin-4
Source.2934: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.2935: DFBPPR19137 ---- Animal proteins ---- Serpin H1
Source.2936: DFBPPR19140 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 5
Source.2937: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.2938: DFBPPR19152 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF186
Source.2939: DFBPPR19155 ---- Animal proteins ---- 3-ketodihydrosphingosine reductase
Source.2940: DFBPPR19158 ---- Animal proteins ---- Tuberoinfundibular peptide of 39 residues
Source.2941: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14
Source.2942: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2
Source.2943: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase
Source.2944: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.2945: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.2946: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4
Source.2947: DFBPPR19194 ---- Animal proteins ---- Vesicular glutamate transporter 2
Source.2948: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7
Source.2949: DFBPPR19212 ---- Animal proteins ---- Nucleosome assembly protein 1-like 1
Source.2950: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.2951: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.2952: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.2953: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog
Source.2954: DFBPPR19231 ---- Animal proteins ---- S-phase kinase-associated protein 1
Source.2955: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A
Source.2956: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.2957: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.2958: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.2959: DFBPPR19249 ---- Animal proteins ---- Guanidinoacetate N-methyltransferase
Source.2960: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.2961: DFBPPR19252 ---- Animal proteins ---- Ras-related protein Rab-39B
Source.2962: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.2963: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.2964: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2
Source.2965: DFBPPR19260 ---- Animal proteins ---- rRNA N6-adenosine-methyltransferase ZCCHC4
Source.2966: DFBPPR19263 ---- Animal proteins ---- Proteasome subunit beta type-2
Source.2967: DFBPPR19264 ---- Animal proteins ---- Claudin-16
Source.2968: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.2969: DFBPPR19283 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.2970: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.2971: DFBPPR19286 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.2972: DFBPPR19287 ---- Animal proteins ---- Rab-like protein 3
Source.2973: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.2974: DFBPPR19295 ---- Animal proteins ---- 26S proteasome regulatory subunit 7
Source.2975: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.2976: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1
Source.2977: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.2978: DFBPPR19316 ---- Animal proteins ---- Histidine triad nucleotide-binding protein 2, mitochondrial
Source.2979: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial
Source.2980: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1
Source.2981: DFBPPR19329 ---- Animal proteins ---- CD302 antigen
Source.2982: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.2983: DFBPPR19337 ---- Animal proteins ---- CMRF35-like molecule 9
Source.2984: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.2985: DFBPPR19352 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit GRINL1A
Source.2986: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.2987: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.2988: DFBPPR19361 ---- Animal proteins ---- Retinol dehydrogenase 14
Source.2989: DFBPPR19362 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 5
Source.2990: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog
Source.2991: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.2992: DFBPPR19375 ---- Animal proteins ---- ATPase family AAA domain-containing protein 1
Source.2993: DFBPPR19377 ---- Animal proteins ---- ER lumen protein-retaining receptor 2
Source.2994: DFBPPR19378 ---- Animal proteins ---- DNA replication licensing factor MCM5
Source.2995: DFBPPR19382 ---- Animal proteins ---- Arrestin-C
Source.2996: DFBPPR19384 ---- Animal proteins ---- Complement component C9
Source.2997: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.2998: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18
Source.2999: DFBPPR19405 ---- Animal proteins ---- Endothelial differentiation-related factor 1
Source.3000: DFBPPR19407 ---- Animal proteins ---- Galanin peptides
Source.3001: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein
Source.3002: DFBPPR19415 ---- Animal proteins ---- Coatomer subunit gamma-2
Source.3003: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.3004: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF
Source.3005: DFBPPR19427 ---- Animal proteins ---- Probable tRNA(His) guanylyltransferase
Source.3006: DFBPPR19429 ---- Animal proteins ---- Protein Spindly
Source.3007: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor
Source.3008: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71
Source.3009: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.3010: DFBPPR19451 ---- Animal proteins ---- Proline/serine-rich coiled-coil protein 1
Source.3011: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.3012: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.3013: DFBPPR19458 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.3014: DFBPPR19459 ---- Animal proteins ---- UV excision repair protein RAD23 homolog B
Source.3015: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137
Source.3016: DFBPPR19471 ---- Animal proteins ---- Ribosome biogenesis protein WDR12
Source.3017: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.3018: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.3019: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.3020: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.3021: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1
Source.3022: DFBPPR19490 ---- Animal proteins ---- GTPase RhebL1
Source.3023: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.3024: DFBPPR19497 ---- Animal proteins ---- G1/S-specific cyclin-E2
Source.3025: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73
Source.3026: DFBPPR19499 ---- Animal proteins ---- Transcription factor MafG
Source.3027: DFBPPR19501 ---- Animal proteins ---- CD320 antigen
Source.3028: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase
Source.3029: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.3030: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.3031: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2
Source.3032: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.3033: DFBPPR19525 ---- Animal proteins ---- Tomoregulin-2
Source.3034: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.3035: DFBPPR19533 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3
Source.3036: DFBPPR19537 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.3037: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.3038: DFBPPR19547 ---- Animal proteins ---- Intercellular adhesion molecule 3
Source.3039: DFBPPR19548 ---- Animal proteins ---- Reticulophagy regulator 1
Source.3040: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.3041: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.3042: DFBPPR19559 ---- Animal proteins ---- CCN family member 2
Source.3043: DFBPPR19561 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.3044: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.3045: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.3046: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.3047: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.3048: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.3049: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.3050: DFBPPR19582 ---- Animal proteins ---- dCTP pyrophosphatase 1
Source.3051: DFBPPR19590 ---- Animal proteins ---- Norrin
Source.3052: DFBPPR19592 ---- Animal proteins ---- Ras-related protein Rab-18
Source.3053: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin
Source.3054: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4
Source.3055: DFBPPR19599 ---- Animal proteins ---- Thrombomodulin
Source.3056: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.3057: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.3058: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.3059: DFBPPR19614 ---- Animal proteins ---- Putative glycerol kinase 5
Source.3060: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.3061: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS
Source.3062: DFBPPR19619 ---- Animal proteins ---- PAXIP1-associated glutamate-rich protein 1
Source.3063: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.3064: DFBPPR19629 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide FF
Source.3065: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein
Source.3066: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like
Source.3067: DFBPPR19649 ---- Animal proteins ---- Proteasome subunit alpha type-4
Source.3068: DFBPPR19653 ---- Animal proteins ---- Chymotrypsinogen B
Source.3069: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase
Source.3070: DFBPPR19656 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.3071: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.3072: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.3073: DFBPPR19663 ---- Animal proteins ---- Synembryn-A
Source.3074: DFBPPR19668 ---- Animal proteins ---- Calicin
Source.3075: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.3076: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.3077: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.3078: DFBPPR19694 ---- Animal proteins ---- Palmitoyltransferase ZDHHC4
Source.3079: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.3080: DFBPPR19699 ---- Animal proteins ---- Endophilin-B1
Source.3081: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.3082: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205
Source.3083: DFBPPR19713 ---- Animal proteins ---- Shadow of prion protein
Source.3084: DFBPPR19714 ---- Animal proteins ---- Keratin, type I cytoskeletal 17
Source.3085: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.3086: DFBPPR19725 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 1
Source.3087: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.3088: DFBPPR19732 ---- Animal proteins ---- Proteasome subunit alpha type-2
Source.3089: DFBPPR19739 ---- Animal proteins ---- WD repeat-containing protein 5
Source.3090: DFBPPR19743 ---- Animal proteins ---- C-X-C motif chemokine 16
Source.3091: DFBPPR19747 ---- Animal proteins ---- Organic solute transporter subunit beta
Source.3092: DFBPPR19754 ---- Animal proteins ---- Deoxyhypusine synthase
Source.3093: DFBPPR19759 ---- Animal proteins ---- Histone H2A.J
Source.3094: DFBPPR19764 ---- Animal proteins ---- Bcl-2-like protein 2
Source.3095: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase
Source.3096: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.3097: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.3098: DFBPPR19776 ---- Animal proteins ---- Tropomyosin alpha-3 chain
Source.3099: DFBPPR19777 ---- Animal proteins ---- Translin
Source.3100: DFBPPR19782 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.3101: DFBPPR19784 ---- Animal proteins ---- Ammonium transporter Rh type A
Source.3102: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.3103: DFBPPR19796 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.3104: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.3105: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.3106: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L
Source.3107: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog
Source.3108: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.3109: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.3110: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.3111: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.3112: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2
Source.3113: DFBPPR19828 ---- Animal proteins ---- Transmembrane protein 14C
Source.3114: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.3115: DFBPPR19830 ---- Animal proteins ---- Sesquipedalian-2
Source.3116: DFBPPR19831 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 3
Source.3117: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.3118: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2
Source.3119: DFBPPR19840 ---- Animal proteins ---- 3-hydroxyisobutyrate dehydrogenase, mitochondrial
Source.3120: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.3121: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial
Source.3122: DFBPPR19849 ---- Animal proteins ---- 4-hydroxybenzoate polyprenyltransferase, mitochondrial
Source.3123: DFBPPR19858 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A
Source.3124: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2
Source.3125: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.3126: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.3127: DFBPPR19870 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta
Source.3128: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.3129: DFBPPR19882 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 1
Source.3130: DFBPPR19884 ---- Animal proteins ---- Activator of basal transcription 1
Source.3131: DFBPPR19904 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 30
Source.3132: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.3133: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.3134: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2
Source.3135: DFBPPR19935 ---- Animal proteins ---- Reticulon-3
Source.3136: DFBPPR19943 ---- Animal proteins ---- Keratin, type II cytoskeletal 80
Source.3137: DFBPPR19946 ---- Animal proteins ---- Actin-like protein 6B
Source.3138: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40
Source.3139: DFBPPR19949 ---- Animal proteins ---- Syndecan-2
Source.3140: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial
Source.3141: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2
Source.3142: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.3143: DFBPPR19978 ---- Animal proteins ---- 2-amino-3-carboxymuconate-6-semialdehyde decarboxylase
Source.3144: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.3145: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.3146: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1
Source.3147: DFBPPR20001 ---- Animal proteins ---- Glycine N-phenylacetyltransferase
Source.3148: DFBPPR20003 ---- Animal proteins ---- TATA-box-binding protein
Source.3149: DFBPPR20012 ---- Animal proteins ---- Zinc transporter ZIP12
Source.3150: DFBPPR20015 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.3151: DFBPPR20019 ---- Animal proteins ---- 28S ribosomal protein S16, mitochondrial
Source.3152: DFBPPR20032 ---- Animal proteins ---- Annexin A9
Source.3153: DFBPPR20037 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit beta
Source.3154: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase
Source.3155: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1
Source.3156: DFBPPR20046 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin-2
Source.3157: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase
Source.3158: DFBPPR20055 ---- Animal proteins ---- Myelin protein zero-like protein 1
Source.3159: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.3160: DFBPPR20062 ---- Animal proteins ---- 39S ribosomal protein L20, mitochondrial
Source.3161: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein
Source.3162: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4
Source.3163: DFBPPR20073 ---- Animal proteins ---- Histidine decarboxylase
Source.3164: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.3165: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1
Source.3166: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.3167: DFBPPR20092 ---- Animal proteins ---- Peptidyl-tRNA hydrolase 2, mitochondrial
Source.3168: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.3169: DFBPPR20102 ---- Animal proteins ---- Cylicin-2
Source.3170: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.3171: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase
Source.3172: DFBPPR20140 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.3173: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6
Source.3174: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.3175: DFBPPR20150 ---- Animal proteins ---- Acid sphingomyelinase-like phosphodiesterase 3a
Source.3176: DFBPPR20160 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.3177: DFBPPR20163 ---- Animal proteins ---- Lymphocyte antigen 6 complex locus protein G6f
Source.3178: DFBPPR20168 ---- Animal proteins ---- Alpha-actinin-2
Source.3179: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta
Source.3180: DFBPPR20176 ---- Animal proteins ---- Wiskott-Aldrich syndrome protein family member 2
Source.3181: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase
Source.3182: DFBPPR20180 ---- Animal proteins ---- Peroxisome assembly protein 12
Source.3183: DFBPPR20185 ---- Animal proteins ---- Zinc transporter 7
Source.3184: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.3185: DFBPPR20196 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 4
Source.3186: DFBPPR20199 ---- Animal proteins ---- Claudin-7
Source.3187: DFBPPR20204 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.3188: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B
Source.3189: DFBPPR20213 ---- Animal proteins ---- Coiled-coil domain-containing protein 115
Source.3190: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1
Source.3191: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12
Source.3192: DFBPPR20239 ---- Animal proteins ---- Speckle-type POZ protein
Source.3193: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.3194: DFBPPR20247 ---- Animal proteins ---- Claudin-15
Source.3195: DFBPPR20254 ---- Animal proteins ---- Leukemia inhibitory factor
Source.3196: DFBPPR20261 ---- Animal proteins ---- Protein SCO1 homolog, mitochondrial
Source.3197: DFBPPR20263 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 54
Source.3198: DFBPPR20271 ---- Animal proteins ---- EEF1A lysine methyltransferase 3
Source.3199: DFBPPR20273 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT14
Source.3200: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.3201: DFBPPR20288 ---- Animal proteins ---- Golgi phosphoprotein 3-like
Source.3202: DFBPPR20293 ---- Animal proteins ---- Cytosolic arginine sensor for mTORC1 subunit 1
Source.3203: DFBPPR20297 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4
Source.3204: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.3205: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2
Source.3206: DFBPPR20312 ---- Animal proteins ---- 39S ribosomal protein L52, mitochondrial
Source.3207: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial
Source.3208: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2
Source.3209: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.3210: DFBPPR20332 ---- Animal proteins ---- Mitochondrial uncoupling protein 3
Source.3211: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14
Source.3212: DFBPPR20340 ---- Animal proteins ---- Peripherin
Source.3213: DFBPPR20342 ---- Animal proteins ---- Nucleosome assembly protein 1-like 4
Source.3214: DFBPPR20344 ---- Animal proteins ---- Dynactin subunit 2
Source.3215: DFBPPR20359 ---- Animal proteins ---- Glutathione S-transferase theta-1
Source.3216: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C
Source.3217: DFBPPR20362 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase
Source.3218: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56
Source.3219: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4
Source.3220: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6
Source.3221: DFBPPR20386 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59
Source.3222: DFBPPR20387 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.3223: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.3224: DFBPPR20393 ---- Animal proteins ---- Putative nuclease HARBI1
Source.3225: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.3226: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.3227: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein
Source.3228: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein
Source.3229: DFBPPR20429 ---- Animal proteins ---- Sepiapterin reductase
Source.3230: DFBPPR20433 ---- Animal proteins ---- Interleukin-22 receptor subunit alpha-1
Source.3231: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.3232: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.3233: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1
Source.3234: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1
Source.3235: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.3236: DFBPPR20484 ---- Animal proteins ---- MEF2-activating motif and SAP domain-containing transcriptional regulator
Source.3237: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.3238: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102
Source.3239: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1
Source.3240: DFBPPR20502 ---- Animal proteins ---- COP9 signalosome complex subunit 9
Source.3241: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6
Source.3242: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.3243: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial
Source.3244: DFBPPR20515 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 2
Source.3245: DFBPPR20529 ---- Animal proteins ---- Transgelin
Source.3246: DFBPPR20530 ---- Animal proteins ---- Protein HEXIM2
Source.3247: DFBPPR20532 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.3248: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.3249: DFBPPR20539 ---- Animal proteins ---- Regulator of G-protein signaling 16
Source.3250: DFBPPR20541 ---- Animal proteins ---- Lambda-crystallin homolog
Source.3251: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.3252: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.3253: DFBPPR20558 ---- Animal proteins ---- N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase
Source.3254: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.3255: DFBPPR20574 ---- Animal proteins ---- Transmembrane protein 201
Source.3256: DFBPPR20577 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor-interacting protein
Source.3257: DFBPPR20583 ---- Animal proteins ---- Mesoderm-specific transcript homolog protein
Source.3258: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.3259: DFBPPR20588 ---- Animal proteins ---- CXXC-type zinc finger protein 5
Source.3260: DFBPPR20595 ---- Animal proteins ---- LHFPL tetraspan subfamily member 4 protein
Source.3261: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.3262: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.3263: DFBPPR20607 ---- Animal proteins ---- Spliceosome-associated protein CWC27 homolog
Source.3264: DFBPPR20608 ---- Animal proteins ---- Nucleolar protein 56
Source.3265: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13
Source.3266: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2
Source.3267: DFBPPR20635 ---- Animal proteins ---- Transcription elongation factor A protein 1
Source.3268: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91
Source.3269: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.3270: DFBPPR20667 ---- Animal proteins ---- 39S ribosomal protein L13, mitochondrial
Source.3271: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4
Source.3272: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease
Source.3273: DFBPPR20677 ---- Animal proteins ---- EEF1A lysine methyltransferase 1
Source.3274: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14
Source.3275: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5
Source.3276: DFBPPR20684 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor A2
Source.3277: DFBPPR20692 ---- Animal proteins ---- ELMO domain-containing protein 3
Source.3278: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog
Source.3279: DFBPPR20697 ---- Animal proteins ---- Zinc transporter ZIP11
Source.3280: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.3281: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2
Source.3282: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1
Source.3283: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial
Source.3284: DFBPPR20728 ---- Animal proteins ---- Serine protease 45
Source.3285: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.3286: DFBPPR20738 ---- Animal proteins ---- Ferritin, mitochondrial
Source.3287: DFBPPR20740 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 6
Source.3288: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1
Source.3289: DFBPPR20747 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 7B
Source.3290: DFBPPR20748 ---- Animal proteins ---- Protein ABHD14B
Source.3291: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33
Source.3292: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.3293: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.3294: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha
Source.3295: DFBPPR20774 ---- Animal proteins ---- Ankyrin repeat family A protein 2
Source.3296: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.3297: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial
Source.3298: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1
Source.3299: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.3300: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.3301: DFBPPR20805 ---- Animal proteins ---- Regulator of G-protein signaling 2
Source.3302: DFBPPR20806 ---- Animal proteins ---- Transcriptional adapter 1
Source.3303: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2
Source.3304: DFBPPR20810 ---- Animal proteins ---- Zinc finger protein 148
Source.3305: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14
Source.3306: DFBPPR20818 ---- Animal proteins ---- Protein-lysine N-methyltransferase EEF2KMT
Source.3307: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.3308: DFBPPR20825 ---- Animal proteins ---- Hydroxyacid-oxoacid transhydrogenase, mitochondrial
Source.3309: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.3310: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.3311: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.3312: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.3313: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.3314: DFBPPR20856 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim10
Source.3315: DFBPPR20863 ---- Animal proteins ---- LIM and senescent cell antigen-like-containing domain protein 2
Source.3316: DFBPPR20871 ---- Animal proteins ---- Iron-sulfur cluster assembly 2 homolog, mitochondrial
Source.3317: DFBPPR20887 ---- Animal proteins ---- UAP56-interacting factor
Source.3318: DFBPPR20888 ---- Animal proteins ---- Translocon-associated protein subunit delta
Source.3319: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein
Source.3320: DFBPPR20898 ---- Animal proteins ---- Transaldolase
Source.3321: DFBPPR20904 ---- Animal proteins ---- Zinc finger protein 143
Source.3322: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.3323: DFBPPR20913 ---- Animal proteins ---- Somatostatin
Source.3324: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.3325: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.3326: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.3327: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial
Source.3328: DFBPPR20937 ---- Animal proteins ---- Leucine-rich repeat-containing protein 25
Source.3329: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A
Source.3330: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1
Source.3331: DFBPPR20952 ---- Animal proteins ---- Phosphatidate cytidylyltransferase, mitochondrial
Source.3332: DFBPPR20957 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial
Source.3333: DFBPPR20958 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial
Source.3334: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.3335: DFBPPR20967 ---- Animal proteins ---- Phosducin-like protein
Source.3336: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1
Source.3337: DFBPPR20980 ---- Animal proteins ---- Interferon-inducible GTPase 5
Source.3338: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1
Source.3339: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7
Source.3340: DFBPPR20998 ---- Animal proteins ---- Zinc finger protein 821
Source.3341: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1
Source.3342: DFBPPR21018 ---- Animal proteins ---- Solute carrier family 22 member 17
Source.3343: DFBPPR21034 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 25
Source.3344: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.3345: DFBPPR21044 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 7
Source.3346: DFBPPR21046 ---- Animal proteins ---- Opalin
Source.3347: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28
Source.3348: DFBPPR21054 ---- Animal proteins ---- Synaptic vesicle 2-related protein
Source.3349: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.3350: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C
Source.3351: DFBPPR21072 ---- Animal proteins ---- 39S ribosomal protein L42, mitochondrial
Source.3352: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.3353: DFBPPR21089 ---- Animal proteins ---- 39S ribosomal protein L11, mitochondrial
Source.3354: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.3355: DFBPPR21098 ---- Animal proteins ---- Pre T-cell antigen receptor alpha
Source.3356: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.3357: DFBPPR21108 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.3358: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.3359: DFBPPR21111 ---- Animal proteins ---- Zinc finger protein-like 1
Source.3360: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.3361: DFBPPR21132 ---- Animal proteins ---- Regulator of G-protein signaling 7-binding protein
Source.3362: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.3363: DFBPPR21142 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta
Source.3364: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.3365: DFBPPR21169 ---- Animal proteins ---- GA-binding protein subunit beta-2
Source.3366: DFBPPR21185 ---- Animal proteins ---- Lymphocyte antigen 6H
Source.3367: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal
Source.3368: DFBPPR21190 ---- Animal proteins ---- Coiled-coil domain-containing protein 22
Source.3369: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.3370: DFBPPR21208 ---- Animal proteins ---- Short transient receptor potential channel 2 homolog
Source.3371: DFBPPR21211 ---- Animal proteins ---- TLR adapter interacting with SLC15A4 on the lysosome
Source.3372: DFBPPR21215 ---- Animal proteins ---- Origin recognition complex subunit 6
Source.3373: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1
Source.3374: DFBPPR21225 ---- Animal proteins ---- 28S ribosomal protein S31, mitochondrial
Source.3375: DFBPPR21227 ---- Animal proteins ---- FUN14 domain-containing protein 1
Source.3376: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.3377: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase
Source.3378: DFBPPR21234 ---- Animal proteins ---- 60S ribosomal protein L4
Source.3379: DFBPPR21241 ---- Animal proteins ---- Cytochrome b-245 chaperone 1
Source.3380: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.3381: DFBPPR21244 ---- Animal proteins ---- RELT-like protein 1
Source.3382: DFBPPR21245 ---- Animal proteins ---- Cilia- and flagella-associated protein 36
Source.3383: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3
Source.3384: DFBPPR21253 ---- Animal proteins ---- Sorting nexin-8
Source.3385: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7
Source.3386: DFBPPR21258 ---- Animal proteins ---- Insulin-like growth factor-binding protein 6
Source.3387: DFBPPR21264 ---- Animal proteins ---- Inositol-3-phosphate synthase 1
Source.3388: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.3389: DFBPPR21268 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM40 homolog
Source.3390: DFBPPR21269 ---- Animal proteins ---- TOX high mobility group box family member 4
Source.3391: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase
Source.3392: DFBPPR21273 ---- Animal proteins ---- Poly(rC)-binding protein 4
Source.3393: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.3394: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.3395: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.3396: DFBPPR21290 ---- Animal proteins ---- Metaxin-1
Source.3397: DFBPPR21293 ---- Animal proteins ---- IST1 homolog
Source.3398: DFBPPR21301 ---- Animal proteins ---- Lymphocyte antigen 6D
Source.3399: DFBPPR21305 ---- Animal proteins ---- Methyltransferase-like protein 17, mitochondrial
Source.3400: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4
Source.3401: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1
Source.3402: DFBPPR21311 ---- Animal proteins ---- WD repeat-containing protein 18
Source.3403: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.3404: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.3405: DFBPPR21337 ---- Animal proteins ---- Transmembrane protein 65
Source.3406: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein
Source.3407: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial
Source.3408: DFBPPR21344 ---- Animal proteins ---- Gap junction gamma-3 protein
Source.3409: DFBPPR21348 ---- Animal proteins ---- Transmembrane protein 204
Source.3410: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.3411: DFBPPR21350 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.3412: DFBPPR21352 ---- Animal proteins ---- Glutathione peroxidase 7
Source.3413: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3
Source.3414: DFBPPR21359 ---- Animal proteins ---- Protein tyrosine phosphatase domain-containing protein 1
Source.3415: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.3416: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.3417: DFBPPR21362 ---- Animal proteins ---- 40S ribosomal protein S4
Source.3418: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.3419: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18
Source.3420: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.3421: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.3422: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.3423: DFBPPR21375 ---- Animal proteins ---- Transcription factor jun-D
Source.3424: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3
Source.3425: DFBPPR21379 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.3426: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2
Source.3427: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2
Source.3428: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4
Source.3429: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.3430: DFBPPR21389 ---- Animal proteins ---- N-terminal EF-hand calcium-binding protein 3
Source.3431: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.3432: DFBPPR21400 ---- Animal proteins ---- Replication initiator 1
Source.3433: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog
Source.3434: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A
Source.3435: DFBPPR21412 ---- Animal proteins ---- Pyridoxal-dependent decarboxylase domain-containing protein 1
Source.3436: DFBPPR21414 ---- Animal proteins ---- Neuromedin-B
Source.3437: DFBPPR21423 ---- Animal proteins ---- G-protein coupled receptor 84
Source.3438: DFBPPR21429 ---- Animal proteins ---- Histone PARylation factor 1
Source.3439: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.3440: DFBPPR21436 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1A
Source.3441: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1
Source.3442: DFBPPR21445 ---- Animal proteins ---- Secretory carrier-associated membrane protein 4
Source.3443: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.3444: DFBPPR21451 ---- Animal proteins ---- Nurim
Source.3445: DFBPPR21456 ---- Animal proteins ---- Fatty acid-binding protein, intestinal
Source.3446: DFBPPR21460 ---- Animal proteins ---- SREBP regulating gene protein
Source.3447: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.3448: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.3449: DFBPPR21474 ---- Animal proteins ---- m-AAA protease-interacting protein 1, mitochondrial
Source.3450: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein
Source.3451: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8
Source.3452: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8
Source.3453: DFBPPR21486 ---- Animal proteins ---- Caspase recruitment domain-containing protein 19
Source.3454: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial
Source.3455: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.3456: DFBPPR21492 ---- Animal proteins ---- Homeobox protein DBX1
Source.3457: DFBPPR21493 ---- Animal proteins ---- Cytoskeleton-associated protein 2-like
Source.3458: DFBPPR21494 ---- Animal proteins ---- Spleen trypsin inhibitor I
Source.3459: DFBPPR21496 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim9
Source.3460: DFBPPR21497 ---- Animal proteins ---- NEDD8 ultimate buster 1
Source.3461: DFBPPR21500 ---- Animal proteins ---- Docking protein 2
Source.3462: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1
Source.3463: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1
Source.3464: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.3465: DFBPPR21513 ---- Animal proteins ---- Profilin-3
Source.3466: DFBPPR21516 ---- Animal proteins ---- Cysteine and histidine-rich protein 1
Source.3467: DFBPPR21517 ---- Animal proteins ---- Transmembrane 4 L6 family member 20
Source.3468: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1
Source.3469: DFBPPR21526 ---- Animal proteins ---- Interferon alpha-inducible protein 27-like protein 2
Source.3470: DFBPPR21528 ---- Animal proteins ---- Vasculin
Source.3471: DFBPPR21534 ---- Animal proteins ---- 39S ribosomal protein L46, mitochondrial
Source.3472: DFBPPR21536 ---- Animal proteins ---- Alpha-1-acid glycoprotein
Source.3473: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22
Source.3474: DFBPPR21557 ---- Animal proteins ---- WD repeat-containing protein 55
Source.3475: DFBPPR21559 ---- Animal proteins ---- C-type lectin domain family 3 member A
Source.3476: DFBPPR21563 ---- Animal proteins ---- RWD domain-containing protein 3
Source.3477: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.3478: DFBPPR21569 ---- Animal proteins ---- Engulfment and cell motility protein 3
Source.3479: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.3480: DFBPPR21574 ---- Animal proteins ---- Parvalbumin alpha
Source.3481: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.3482: DFBPPR21589 ---- Animal proteins ---- Dynein regulatory complex protein 10
Source.3483: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase
Source.3484: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3
Source.3485: DFBPPR21600 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit H
Source.3486: DFBPPR21605 ---- Animal proteins ---- Transmembrane protein 138
Source.3487: DFBPPR21606 ---- Animal proteins ---- Surfeit locus protein 6
Source.3488: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.3489: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.3490: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.3491: DFBPPR21619 ---- Animal proteins ---- CBY1-interacting BAR domain-containing protein 2
Source.3492: DFBPPR21624 ---- Animal proteins ---- Docking protein 1
Source.3493: DFBPPR21627 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 gamma
Source.3494: DFBPPR21633 ---- Animal proteins ---- DNA fragmentation factor subunit beta
Source.3495: DFBPPR21637 ---- Animal proteins ---- 60S acidic ribosomal protein P2
Source.3496: DFBPPR21638 ---- Animal proteins ---- 28S ribosomal protein S10, mitochondrial
Source.3497: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44
Source.3498: DFBPPR21655 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 7
Source.3499: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.3500: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10
Source.3501: DFBPPR21677 ---- Animal proteins ---- Dolichol phosphate-mannose biosynthesis regulatory protein
Source.3502: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like
Source.3503: DFBPPR21690 ---- Animal proteins ---- Synapse differentiation-inducing gene protein 1-like
Source.3504: DFBPPR21697 ---- Animal proteins ---- UDP-galactose translocator
Source.3505: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2
Source.3506: DFBPPR21720 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.3507: DFBPPR21723 ---- Animal proteins ---- OCIA domain-containing protein 1
Source.3508: DFBPPR21732 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1
Source.3509: DFBPPR21737 ---- Animal proteins ---- C-type lectin domain family 1 member A
Source.3510: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15
Source.3511: DFBPPR21740 ---- Animal proteins ---- 60S ribosomal protein L36
Source.3512: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.3513: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1
Source.3514: DFBPPR21768 ---- Animal proteins ---- Tektin-4
Source.3515: DFBPPR21769 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 21
Source.3516: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.3517: DFBPPR21775 ---- Animal proteins ---- Protein FAM193B
Source.3518: DFBPPR21776 ---- Animal proteins ---- Coiled-coil domain-containing protein 130
Source.3519: DFBPPR21787 ---- Animal proteins ---- PRA1 family protein 2
Source.3520: DFBPPR21790 ---- Animal proteins ---- DnaJ homolog subfamily C member 18
Source.3521: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.3522: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.3523: DFBPPR21810 ---- Animal proteins ---- Regulator of G-protein signaling 4
Source.3524: DFBPPR21814 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.3525: DFBPPR21837 ---- Animal proteins ---- Zinc finger protein 750
Source.3526: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B
Source.3527: DFBPPR21846 ---- Animal proteins ---- Izumo sperm-egg fusion protein 3
Source.3528: DFBPPR21857 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 2
Source.3529: DFBPPR21863 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 3
Source.3530: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.3531: DFBPPR21872 ---- Animal proteins ---- 40S ribosomal protein S19
Source.3532: DFBPPR21877 ---- Animal proteins ---- Ras-GEF domain-containing family member 1B
Source.3533: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor
Source.3534: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.3535: DFBPPR21909 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 11
Source.3536: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog
Source.3537: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.3538: DFBPPR21926 ---- Animal proteins ---- N-acetyltransferase 14
Source.3539: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.3540: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2
Source.3541: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.3542: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.3543: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414
Source.3544: DFBPPR21958 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.3545: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15
Source.3546: DFBPPR21968 ---- Animal proteins ---- F-box only protein 28
Source.3547: DFBPPR21971 ---- Animal proteins ---- Chemokine-like protein TAFA-5
Source.3548: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.3549: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1
Source.3550: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14
Source.3551: DFBPPR21987 ---- Animal proteins ---- Ribonuclease H2 subunit C
Source.3552: DFBPPR21989 ---- Animal proteins ---- Morphine-modulating neuropeptide A
Source.3553: DFBPPR21999 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 3
Source.3554: DFBPPR22001 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.3555: DFBPPR22010 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21E
Source.3556: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5
Source.3557: DFBPPR22018 ---- Animal proteins ---- Armadillo repeat-containing protein 1
Source.3558: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.3559: DFBPPR22035 ---- Animal proteins ---- Protein CCSMST1
Source.3560: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C
Source.3561: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.3562: DFBPPR22052 ---- Animal proteins ---- Caspase activity and apoptosis inhibitor 1
Source.3563: DFBPPR22060 ---- Animal proteins ---- Transmembrane protein 126A
Source.3564: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1
Source.3565: DFBPPR22071 ---- Animal proteins ---- Neuromedin-S
Source.3566: DFBPPR22073 ---- Animal proteins ---- C2 calcium-dependent domain-containing protein 4A
Source.3567: DFBPPR22084 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 49
Source.3568: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1
Source.3569: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.3570: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like
Source.3571: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2
Source.3572: DFBPPR22106 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.3573: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.3574: DFBPPR22122 ---- Animal proteins ---- Transmembrane protein FAM155A
Source.3575: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog
Source.3576: DFBPPR22134 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8
Source.3577: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.3578: DFBPPR22137 ---- Animal proteins ---- Epimerase family protein SDR39U1
Source.3579: DFBPPR22141 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 1
Source.3580: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2
Source.3581: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B
Source.3582: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein
Source.3583: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.3584: DFBPPR22163 ---- Animal proteins ---- Calcium homeostasis modulator protein 2
Source.3585: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.3586: DFBPPR22171 ---- Animal proteins ---- Leucine-rich repeat flightless-interacting protein 2
Source.3587: DFBPPR22174 ---- Animal proteins ---- Ribonuclease kappa
Source.3588: DFBPPR22175 ---- Animal proteins ---- Small integral membrane protein 11A
Source.3589: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5
Source.3590: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.3591: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial
Source.3592: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.3593: DFBPPR22196 ---- Animal proteins ---- Bladder cancer-associated protein
Source.3594: DFBPPR22217 ---- Animal proteins ---- Lebercilin-like protein
Source.3595: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1
Source.3596: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.3597: DFBPPR22227 ---- Animal proteins ---- Tetraspanin-8
Source.3598: DFBPPR22232 ---- Animal proteins ---- Transmembrane protein 176A
Source.3599: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.3600: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3
Source.3601: DFBPPR22258 ---- Animal proteins ---- Solute carrier family 25 member 34
Source.3602: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.3603: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.3604: DFBPPR22282 ---- Animal proteins ---- Optic atrophy 3 protein homolog
Source.3605: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.3606: DFBPPR22291 ---- Animal proteins ---- Keratin-like protein KRT222
Source.3607: DFBPPR22293 ---- Animal proteins ---- Nutritionally-regulated adipose and cardiac-enriched protein homolog
Source.3608: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2
Source.3609: DFBPPR22308 ---- Animal proteins ---- Mitochondrial pyruvate carrier-like protein
Source.3610: DFBPPR22319 ---- Animal proteins ---- Regulator of G-protein signaling 5
Source.3611: DFBPPR22321 ---- Animal proteins ---- Solute carrier family 25 member 35
Source.3612: DFBPPR22322 ---- Animal proteins ---- Testis-specific protein 10-interacting protein
Source.3613: DFBPPR22324 ---- Animal proteins ---- Arginine and glutamate-rich protein 1
Source.3614: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.3615: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.3616: DFBPPR22340 ---- Animal proteins ---- Lysoplasmalogenase-like protein TMEM86A
Source.3617: DFBPPR22341 ---- Animal proteins ---- Zinc finger HIT domain-containing protein 2
Source.3618: DFBPPR22346 ---- Animal proteins ---- FUN14 domain-containing protein 2
Source.3619: DFBPPR22350 ---- Animal proteins ---- Transmembrane protein 80
Source.3620: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.3621: DFBPPR22363 ---- Animal proteins ---- Tetratricopeptide repeat protein 23
Source.3622: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1
Source.3623: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.3624: DFBPPR22391 ---- Animal proteins ---- Transmembrane protein 88B
Source.3625: DFBPPR22418 ---- Animal proteins ---- Transmembrane protein 160
Source.3626: DFBPPR22419 ---- Animal proteins ---- Prolyl-tRNA synthetase associated domain-containing protein 1
Source.3627: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B
Source.3628: DFBPPR22425 ---- Animal proteins ---- Protein THEM6
Source.3629: DFBPPR22450 ---- Animal proteins ---- Leucine-rich single-pass membrane protein 1
Source.3630: DFBPPR22452 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 37
Source.3631: DFBPPR22456 ---- Animal proteins ---- Myeloid-associated differentiation marker-like protein 2
Source.3632: DFBPPR22465 ---- Animal proteins ---- OCIA domain-containing protein 2
Source.3633: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.3634: DFBPPR22488 ---- Animal proteins ---- Zinc finger BED domain-containing protein 5
Source.3635: DFBPPR22501 ---- Animal proteins ---- Multiple myeloma tumor-associated protein 2 homolog
Source.3636: DFBPPR22502 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 46
Source.3637: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.3638: DFBPPR22506 ---- Animal proteins ---- Transport and Golgi organization protein 2 homolog
Source.3639: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101
Source.3640: DFBPPR22511 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 2
Source.3641: DFBPPR22524 ---- Animal proteins ---- Transmembrane protein 54
Source.3642: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9
Source.3643: DFBPPR22534 ---- Animal proteins ---- Protein FAM162B
Source.3644: DFBPPR22559 ---- Animal proteins ---- Vimentin-type intermediate filament-associated coiled-coil protein
Source.3645: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.3646: DFBPPR22578 ---- Animal proteins ---- Protein FAM71F1
Source.3647: DFBPPR22591 ---- Animal proteins ---- Leucine-rich repeat-containing protein 51
Source.3648: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19
Source.3649: DFBPPR22595 ---- Animal proteins ---- Transmembrane protein 268
Source.3650: DFBPPR22599 ---- Animal proteins ---- Tetratricopeptide repeat protein 9C
Source.3651: DFBPPR22602 ---- Animal proteins ---- Transmembrane protein 125
Source.3652: DFBPPR22604 ---- Animal proteins ---- Protein FAM181B
Source.3653: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4
Source.3654: DFBPPR22619 ---- Animal proteins ---- Transmembrane protein 42
Source.3655: DFBPPR22627 ---- Animal proteins ---- Leucine-rich repeat-containing protein 61
Source.3656: DFBPPR22633 ---- Animal proteins ---- Transmembrane protein 270
Source.3657: DFBPPR22637 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 61
Source.3658: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.3659: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65
Source.3660: DFBPPR22651 ---- Animal proteins ---- Spermatogenesis-associated protein 2-like protein
Source.3661: DFBPPR22662 ---- Animal proteins ---- Uncharacterized protein C11orf94 homolog
Source.3662: DFBPPR22664 ---- Animal proteins ---- UPF0696 protein C11orf68 homolog
Source.3663: DFBPPR22670 ---- Animal proteins ---- Neuroblastoma breakpoint family member 6-like protein
Source.3664: DFBPPR22671 ---- Animal proteins ---- Uncharacterized protein C1orf185 homolog
Source.3665: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.3666: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1
Source.3667: DFBPPR22698 ---- Animal proteins ---- Protein FAM228A
Source.3668: DFBPPR22707 ---- Animal proteins ---- Protein FAM160B1
Source.3669: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16
Source.3670: DFBPPR22727 ---- Animal proteins ---- Uncharacterized protein C6orf163 homolog
Source.3671: DFBPPR22728 ---- Animal proteins ---- UPF0598 protein C8orf82 homolog
Source.3672: DFBPPR22732 ---- Animal proteins ---- Uncharacterized protein C3orf22 homolog
Source.3673: DFBPPR22733 ---- Animal proteins ---- Armadillo-like helical domain containing protein 1
Source.3674: DFBPPR22736 ---- Animal proteins ---- Uncharacterized protein C16orf71 homolog
Source.3675: DFBPPR22742 ---- Animal proteins ---- Uncharacterized protein C12orf71 homolog
Source.3676: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.3677: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.3678: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.3679: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.3680: DFBPPR8545 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial
Source.3681: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.3682: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2
Source.3683: DFBPPR8555 ---- Animal proteins ---- Membrane cofactor protein
Source.3684: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.3685: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6
Source.3686: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.3687: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.3688: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.3689: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.3690: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.3691: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.3692: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.3693: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.3694: DFBPPR8598 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 5
Source.3695: DFBPPR8599 ---- Animal proteins ---- Interleukin-6 receptor subunit alpha
Source.3696: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.3697: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1
Source.3698: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.3699: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.3700: DFBPPR8615 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.3701: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.3702: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.3703: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.3704: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.3705: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.3706: DFBPPR8646 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.3707: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2
Source.3708: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.3709: DFBPPR8658 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.3710: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.3711: DFBPPR8673 ---- Animal proteins ---- Calreticulin
Source.3712: DFBPPR8674 ---- Animal proteins ---- Calpain-3
Source.3713: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.3714: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.3715: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.3716: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.3717: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1
Source.3718: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3719: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.3720: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53
Source.3721: DFBPPR8707 ---- Animal proteins ---- Flotillin-1
Source.3722: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.3723: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.3724: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.3725: DFBPPR8717 ---- Animal proteins ---- Rhodopsin
Source.3726: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C
Source.3727: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.3728: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.3729: DFBPPR8727 ---- Animal proteins ---- Cyclic GMP-AMP synthase
Source.3730: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5
Source.3731: DFBPPR8731 ---- Animal proteins ---- Natriuretic peptides A
Source.3732: DFBPPR8733 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial
Source.3733: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H
Source.3734: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3735: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.3736: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.3737: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.3738: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.3739: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.3740: DFBPPR8764 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.3741: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase
Source.3742: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.3743: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.3744: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.3745: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.3746: DFBPPR8780 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.3747: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.3748: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.3749: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.3750: DFBPPR8807 ---- Animal proteins ---- Selenoprotein S
Source.3751: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1
Source.3752: DFBPPR8809 ---- Animal proteins ---- Lysosomal acid glucosylceramidase
Source.3753: DFBPPR8811 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial
Source.3754: DFBPPR8812 ---- Animal proteins ---- NPC intracellular cholesterol transporter 2
Source.3755: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.3756: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3
Source.3757: DFBPPR8816 ---- Animal proteins ---- 40S ribosomal protein SA
Source.3758: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.3759: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.3760: DFBPPR8826 ---- Animal proteins ---- Phospholemman
Source.3761: DFBPPR8827 ---- Animal proteins ---- Guanylate kinase
Source.3762: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.3763: DFBPPR8833 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.3764: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5
Source.3765: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1
Source.3766: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.3767: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide
Source.3768: DFBPPR8867 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.3769: DFBPPR8869 ---- Animal proteins ---- Muscarinic acetylcholine receptor M1
Source.3770: DFBPPR8880 ---- Animal proteins ---- Apolipoprotein A-I
Source.3771: DFBPPR8883 ---- Animal proteins ---- Apolipoprotein A-I
Source.3772: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.3773: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.3774: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2
Source.3775: DFBPPR8897 ---- Animal proteins ---- Cytochrome b
Source.3776: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.3777: DFBPPR8932 ---- Animal proteins ---- ATPase inhibitor, mitochondrial
Source.3778: DFBPPR8933 ---- Animal proteins ---- ATPase inhibitor, mitochondrial
Source.3779: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B
Source.3780: DFBPPR8972 ---- Animal proteins ---- Lutropin subunit beta
Source.3781: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.3782: DFBPPR8986 ---- Animal proteins ---- LIM domain and actin-binding protein 1
Source.3783: DFBPPR8991 ---- Animal proteins ---- Cholecystokinin
Source.3784: DFBPPR9001 ---- Animal proteins ---- Inhibin beta B chain
Source.3785: DFBPPR9002 ---- Animal proteins ---- Inhibin beta B chain
Source.3786: DFBPPR9005 ---- Animal proteins ---- Protein amnionless
Source.3787: DFBPPR9007 ---- Animal proteins ---- Inhibin alpha chain
Source.3788: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.3789: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.3790: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.3791: DFBPPR9012 ---- Animal proteins ---- Orexin
Source.3792: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2
Source.3793: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.3794: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.3795: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.3796: DFBPPR9034 ---- Animal proteins ---- Carbohydrate-binding protein AWN
Source.3797: DFBPPR9039 ---- Animal proteins ---- Desmin
Source.3798: DFBPPR9051 ---- Animal proteins ---- Retinol-binding protein 4
Source.3799: DFBPPR9056 ---- Animal proteins ---- Protein S100-A11
Source.3800: DFBPPR9061 ---- Animal proteins ---- Caspase-1
Source.3801: DFBPPR9069 ---- Animal proteins ---- E-selectin
Source.3802: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.3803: DFBPPR9076 ---- Animal proteins ---- Histone H1t
Source.3804: DFBPPR9082 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.3805: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta
Source.3806: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.3807: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.3808: DFBPPR9108 ---- Animal proteins ---- Somatostatin
Source.3809: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.3810: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.3811: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.3812: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.3813: DFBPPR9135 ---- Animal proteins ---- mRNA-decapping enzyme 1A
Source.3814: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1
Source.3815: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.3816: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.3817: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.3818: DFBPPR9168 ---- Animal proteins ---- Inhibitor of carbonic anhydrase
Source.3819: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.3820: DFBPPR9174 ---- Animal proteins ---- Ficolin-1
Source.3821: DFBPPR9175 ---- Animal proteins ---- Regulator of G-protein signaling 2
Source.3822: DFBPPR9176 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.3823: DFBPPR9178 ---- Animal proteins ---- Cyclin-dependent kinase inhibitor 3
Source.3824: DFBPPR9179 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.3825: DFBPPR9182 ---- Animal proteins ---- Short-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3826: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10
Source.3827: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.3828: DFBPPR9188 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain
Source.3829: DFBPPR9191 ---- Animal proteins ---- Carbonyl reductase [NADPH] 2
Source.3830: DFBPPR9209 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.3831: DFBPPR9214 ---- Animal proteins ---- Choline transporter-like protein 4
Source.3832: DFBPPR9216 ---- Animal proteins ---- Netrin-1
Source.3833: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.3834: DFBPPR9221 ---- Animal proteins ---- Catalase
Source.3835: DFBPPR9222 ---- Animal proteins ---- Glutathione peroxidase 1
Source.3836: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.3837: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.3838: DFBPPR9236 ---- Animal proteins ---- Radixin
Source.3839: DFBPPR9241 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.3840: DFBPPR9254 ---- Animal proteins ---- Complement factor D
Source.3841: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.3842: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3
Source.3843: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.3844: DFBPPR9265 ---- Animal proteins ---- Pantetheinase
Source.3845: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase
Source.3846: DFBPPR9271 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-1
Source.3847: DFBPPR9280 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.3848: DFBPPR9290 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.3849: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase
Source.3850: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2
Source.3851: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.3852: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.3853: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.3854: DFBPPR9314 ---- Animal proteins ---- Regucalcin
Source.3855: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.3856: DFBPPR9325 ---- Animal proteins ---- Ephrin-A1
Source.3857: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.3858: DFBPPR9332 ---- Animal proteins ---- B2 bradykinin receptor
Source.3859: DFBPPR9338 ---- Animal proteins ---- SPARC
Source.3860: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1
Source.3861: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial
Source.3862: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.3863: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.3864: DFBPPR9362 ---- Animal proteins ---- Alpha-fetoprotein
Source.3865: DFBPPR9368 ---- Animal proteins ---- Myosin-11
Source.3866: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.3867: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.3868: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.3869: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4
Source.3870: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.3871: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.3872: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.3873: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.3874: DFBPPR9416 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.3875: DFBPPR9419 ---- Animal proteins ---- Deoxyribonuclease-2-alpha
Source.3876: DFBPPR9420 ---- Animal proteins ---- B1 bradykinin receptor
Source.3877: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.3878: DFBPPR9425 ---- Animal proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.3879: DFBPPR9426 ---- Animal proteins ---- Opalin
Source.3880: DFBPPR9427 ---- Animal proteins ---- Protein quaking
Source.3881: DFBPPR9428 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.3882: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.3883: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.3884: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.3885: DFBPPR9446 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.3886: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.3887: DFBPPR9454 ---- Animal proteins ---- Proteasome subunit beta type-7
Source.3888: DFBPPR9461 ---- Animal proteins ---- CCN family member 2
Source.3889: DFBPPR9462 ---- Animal proteins ---- Cytochrome c oxidase copper chaperone
Source.3890: DFBPPR9501 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.3891: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2
Source.3892: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.3893: DFBPPR9508 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4
Source.3894: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa
Source.3895: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.3896: DFBPPR9521 ---- Animal proteins ---- Endothelin-3
Source.3897: DFBPPR9529 ---- Animal proteins ---- Quinone oxidoreductase
Source.3898: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6
Source.3899: DFBPPR9538 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.3900: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.3901: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic
Source.3902: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha
Source.3903: DFBPPR9559 ---- Animal proteins ---- CD302 antigen
Source.3904: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1
Source.3905: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.3906: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase
Source.3907: DFBPPR9579 ---- Animal proteins ---- ATP synthase subunit f, mitochondrial
Source.3908: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.3909: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.3910: DFBPPR9587 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.3911: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2
Source.3912: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.3913: DFBPPR9605 ---- Animal proteins ---- Polypyrimidine tract-binding protein 1
Source.3914: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.3915: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.3916: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.3917: DFBPPR9634 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.3918: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial
Source.3919: DFBPPR9656 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 3
Source.3920: DFBPPR9660 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2
Source.3921: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.3922: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.3923: DFBPPR9684 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3924: DFBPPR9685 ---- Animal proteins ---- Interleukin-27 subunit alpha
Source.3925: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1
Source.3926: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein
Source.3927: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta
Source.3928: DFBPPR9697 ---- Animal proteins ---- Cytochrome c oxidase subunit 5B, mitochondrial
Source.3929: DFBPPR9699 ---- Animal proteins ---- Angiopoietin-1
Source.3930: DFBPPR9700 ---- Animal proteins ---- Galectin-1
Source.3931: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.3932: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter
Source.3933: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.3934: DFBPPR9722 ---- Animal proteins ---- Fetal and adult testis-expressed transcript protein homolog
Source.3935: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.3936: DFBPPR9736 ---- Animal proteins ---- Metaxin-1
Source.3937: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2
Source.3938: DFBPPR9744 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 14B
Source.3939: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.3940: DFBPPR9750 ---- Animal proteins ---- 60S ribosome subunit biogenesis protein NIP7 homolog
Source.3941: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.3942: DFBPPR9772 ---- Animal proteins ---- 60S ribosomal protein L13a
Source.3943: DFBPPR9784 ---- Animal proteins ---- Translocator protein
Source.3944: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.3945: DFBPPR9791 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.3946: DFBPPR9794 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 3
Source.3947: DFBPPR9795 ---- Animal proteins ---- Insulin-like growth factor-binding protein 5
Source.3948: DFBPPR9796 ---- Animal proteins ---- Arrestin-C
Source.3949: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2
Source.3950: DFBPPR9801 ---- Animal proteins ---- Tropomyosin alpha-3 chain
Source.3951: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4
Source.3952: DFBPPR9805 ---- Animal proteins ---- Fatty acid-binding protein, intestinal
Source.3953: DFBPPR9806 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.3954: DFBPPR9825 ---- Animal proteins ---- Cysteinyl leukotriene receptor 1
Source.3955: DFBPPR9826 ---- Animal proteins ---- Keratin, type I cytoskeletal 20
Source.3956: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.3957: DFBPPR9839 ---- Animal proteins ---- Nurim
Source.3958: DFBPPR9843 ---- Animal proteins ---- P protein
Source.3959: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1
Source.3960: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.3961: DFBPPR9874 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1
Source.3962: DFBPPR9877 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4
Source.3963: DFBPPR9890 ---- Animal proteins ---- 60S acidic ribosomal protein P2
Source.3964: DFBPPR9901 ---- Animal proteins ---- 40S ribosomal protein S14
Source.3965: DFBPPR9902 ---- Animal proteins ---- 40S ribosomal protein S19
Source.3966: DFBPPR9908 ---- Animal proteins ---- Gastrokine-3
Source.3967: DFBPPR9932 ---- Animal proteins ---- Regulator of G-protein signaling 5
Source.3968: DFBPPR9938 ---- Animal proteins ---- FUN14 domain-containing protein 2
Source.3969: DFBPPR9939 ---- Animal proteins ---- Tctex1 domain-containing protein 4
Source.3970: DFBPPR9949 ---- Animal proteins ---- Coiled-coil domain-containing protein 127
Source.3971: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3
Source.3972: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.3973: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.3974: DFBPPR9961 ---- Animal proteins ---- Somatotropin
Source.3975: DFBPPR9965 ---- Animal proteins ---- Lysozyme C
Source.3976: DFBPPR9975 ---- Animal proteins ---- Interleukin-10
Source.3977: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.3978: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.3979: DFBPPR9994 ---- Animal proteins ---- Nuclear factor NF-kappa-B p105 subunit
Source.3980: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.3981: DFBPPR9997 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 1
Source.3982: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.3983: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1
Source.3984: DFBPPR10008 ---- Animal proteins ---- Protein Wnt-2b
Source.3985: DFBPPR10010 ---- Animal proteins ---- Transforming growth factor beta-2 proprotein
Source.3986: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.3987: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16
Source.3988: DFBPPR10015 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.3989: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.3990: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2
Source.3991: DFBPPR10023 ---- Animal proteins ---- Glucagon family neuropeptides
Source.3992: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog
Source.3993: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.3994: DFBPPR10028 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.3995: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.3996: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.3997: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.3998: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.3999: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.4000: DFBPPR10052 ---- Animal proteins ---- Protein Wnt-11
Source.4001: DFBPPR10057 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.4002: DFBPPR10061 ---- Animal proteins ---- Ovocleidin-17
Source.4003: DFBPPR10064 ---- Animal proteins ---- Pleiotrophin
Source.4004: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.4005: DFBPPR10070 ---- Animal proteins ---- Vesicle-associated membrane protein 7
Source.4006: DFBPPR10072 ---- Animal proteins ---- Cell division control protein 42 homolog
Source.4007: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.4008: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.4009: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor
Source.4010: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.4011: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.4012: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.4013: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.4014: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.4015: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.4016: DFBPPR10107 ---- Animal proteins ---- Ovomucoid
Source.4017: DFBPPR10110 ---- Animal proteins ---- ER lumen protein-retaining receptor 2
Source.4018: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2
Source.4019: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.4020: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.4021: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.4022: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.4023: DFBPPR10131 ---- Animal proteins ---- Alpha-actinin-1
Source.4024: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.4025: DFBPPR10139 ---- Animal proteins ---- Cytochrome b
Source.4026: DFBPPR10142 ---- Animal proteins ---- Calpain-3
Source.4027: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.4028: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.4029: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.4030: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.4031: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.4032: DFBPPR10159 ---- Animal proteins ---- Choline/ethanolaminephosphotransferase 1
Source.4033: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.4034: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog
Source.4035: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.4036: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.4037: DFBPPR10170 ---- Animal proteins ---- Drebrin
Source.4038: DFBPPR10171 ---- Animal proteins ---- Heterochromatin-associated protein MENT
Source.4039: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.4040: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.4041: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.4042: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1
Source.4043: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.4044: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein
Source.4045: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.4046: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3
Source.4047: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.4048: DFBPPR10198 ---- Animal proteins ---- Insulin-like growth factor 2 mRNA-binding protein 1
Source.4049: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.4050: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.4051: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.4052: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.4053: DFBPPR10208 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 12A
Source.4054: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.4055: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.4056: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5
Source.4057: DFBPPR10231 ---- Animal proteins ---- Basigin
Source.4058: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3
Source.4059: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.4060: DFBPPR10238 ---- Animal proteins ---- COUP transcription factor 2
Source.4061: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.4062: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.4063: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1
Source.4064: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6
Source.4065: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.4066: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.4067: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.4068: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1
Source.4069: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.4070: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.4071: DFBPPR10268 ---- Animal proteins ---- CD166 antigen
Source.4072: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.4073: DFBPPR10272 ---- Animal proteins ---- CUGBP Elav-like family member 2
Source.4074: DFBPPR10274 ---- Animal proteins ---- CCN family member 1
Source.4075: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.4076: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.4077: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.4078: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.4079: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.4080: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2
Source.4081: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.4082: DFBPPR10304 ---- Animal proteins ---- Rhodopsin
Source.4083: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1
Source.4084: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.4085: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.4086: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4
Source.4087: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.4088: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.4089: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.4090: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.4091: DFBPPR10339 ---- Animal proteins ---- Osteocalcin
Source.4092: DFBPPR10344 ---- Animal proteins ---- Centromere protein W
Source.4093: DFBPPR10352 ---- Animal proteins ---- Hemoglobin subunit beta
Source.4094: DFBPPR10354 ---- Animal proteins ---- DNA topoisomerase 2-beta
Source.4095: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.4096: DFBPPR10357 ---- Animal proteins ---- Histone H5
Source.4097: DFBPPR10363 ---- Animal proteins ---- E3 ubiquitin-protein ligase HACE1
Source.4098: DFBPPR10368 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.4099: DFBPPR10369 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.4100: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.4101: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.4102: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.4103: DFBPPR10394 ---- Animal proteins ---- Transcription factor Maf
Source.4104: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.4105: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.4106: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.4107: DFBPPR10405 ---- Animal proteins ---- Ras-related protein Rab-8A
Source.4108: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.4109: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.4110: DFBPPR10412 ---- Animal proteins ---- Dysbindin
Source.4111: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin
Source.4112: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.4113: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.4114: DFBPPR10424 ---- Animal proteins ---- Charged multivesicular body protein 4b
Source.4115: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10
Source.4116: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.4117: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.4118: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.4119: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.4120: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.4121: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.4122: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4123: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.4124: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.4125: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.4126: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.4127: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.4128: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.4129: DFBPPR10490 ---- Animal proteins ---- Tudor-interacting repair regulator protein
Source.4130: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.4131: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.4132: DFBPPR10496 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.4133: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.4134: DFBPPR10511 ---- Animal proteins ---- Vitellogenin-3
Source.4135: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.4136: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.4137: DFBPPR10517 ---- Animal proteins ---- Histone H2A-IV
Source.4138: DFBPPR10519 ---- Animal proteins ---- Prolyl 3-hydroxylase 2
Source.4139: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.4140: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase
Source.4141: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2
Source.4142: DFBPPR10528 ---- Animal proteins ---- Far upstream element-binding protein 2
Source.4143: DFBPPR10531 ---- Animal proteins ---- Serpin H1
Source.4144: DFBPPR10532 ---- Animal proteins ---- Carnosine N-methyltransferase
Source.4145: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.4146: DFBPPR10536 ---- Animal proteins ---- Inhibin beta B chain
Source.4147: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.4148: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.4149: DFBPPR10548 ---- Animal proteins ---- Syndecan-4
Source.4150: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.4151: DFBPPR10561 ---- Animal proteins ---- Lens fiber major intrinsic protein
Source.4152: DFBPPR10563 ---- Animal proteins ---- Optineurin
Source.4153: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.4154: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase
Source.4155: DFBPPR10570 ---- Animal proteins ---- Protein atonal homolog 7
Source.4156: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.4157: DFBPPR10574 ---- Animal proteins ---- Stathmin-2
Source.4158: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.4159: DFBPPR10577 ---- Animal proteins ---- Frizzled-10
Source.4160: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.4161: DFBPPR10585 ---- Animal proteins ---- Cystatin
Source.4162: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.4163: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.4164: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.4165: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.4166: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.4167: DFBPPR10616 ---- Animal proteins ---- Cholecystokinin
Source.4168: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.4169: DFBPPR10624 ---- Animal proteins ---- 40S ribosomal protein SA
Source.4170: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.4171: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.4172: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.4173: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.4174: DFBPPR10638 ---- Animal proteins ---- Cellular tumor antigen p53
Source.4175: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3
Source.4176: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.4177: DFBPPR10644 ---- Animal proteins ---- UDP-glucose 6-dehydrogenase
Source.4178: DFBPPR10646 ---- Animal proteins ---- Netrin-1
Source.4179: DFBPPR10649 ---- Animal proteins ---- Ciliary neurotrophic factor receptor subunit alpha
Source.4180: DFBPPR10651 ---- Animal proteins ---- Neuronal growth regulator 1
Source.4181: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.4182: DFBPPR10664 ---- Animal proteins ---- Unconventional myosin-Ig
Source.4183: DFBPPR10668 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.4184: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.4185: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.4186: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.4187: DFBPPR10697 ---- Animal proteins ---- Alpha-actinin-2
Source.4188: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.4189: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2
Source.4190: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.4191: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.4192: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.4193: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.4194: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.4195: DFBPPR10724 ---- Animal proteins ---- Insulin-induced gene 1 protein
Source.4196: DFBPPR10726 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.4197: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1
Source.4198: DFBPPR10738 ---- Animal proteins ---- Histone H1.10
Source.4199: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.4200: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.4201: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2
Source.4202: DFBPPR10751 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.4203: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4
Source.4204: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein
Source.4205: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.4206: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.4207: DFBPPR10769 ---- Animal proteins ---- Ubiquitin thioesterase OTU1
Source.4208: DFBPPR10776 ---- Animal proteins ---- GTP cyclohydrolase 1
Source.4209: DFBPPR10782 ---- Animal proteins ---- Vesicle-trafficking protein SEC22b
Source.4210: DFBPPR10783 ---- Animal proteins ---- Fructose-bisphosphate aldolase C
Source.4211: DFBPPR10788 ---- Animal proteins ---- D-aminoacyl-tRNA deacylase 2
Source.4212: DFBPPR10790 ---- Animal proteins ---- Histone H1
Source.4213: DFBPPR10793 ---- Animal proteins ---- Histone H2A-III
Source.4214: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12
Source.4215: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.4216: DFBPPR10808 ---- Animal proteins ---- S-phase kinase-associated protein 1
Source.4217: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.4218: DFBPPR10814 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.4219: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.4220: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5
Source.4221: DFBPPR10820 ---- Animal proteins ---- Collagen alpha-1(IX) chain
Source.4222: DFBPPR10825 ---- Animal proteins ---- Collagen alpha-3(IX) chain
Source.4223: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.4224: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa
Source.4225: DFBPPR10839 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2
Source.4226: DFBPPR10845 ---- Animal proteins ---- Cytochrome P450 26A1
Source.4227: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.4228: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.4229: DFBPPR10851 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.4230: DFBPPR10852 ---- Animal proteins ---- Wee1-like protein kinase 2
Source.4231: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.4232: DFBPPR10859 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase BAP1
Source.4233: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.4234: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.4235: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.4236: DFBPPR10877 ---- Animal proteins ---- Histone H1.01
Source.4237: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.4238: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.4239: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.4240: DFBPPR10900 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.4241: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.4242: DFBPPR10908 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.4243: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.4244: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.4245: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1
Source.4246: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.4247: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1
Source.4248: DFBPPR10932 ---- Animal proteins ---- Histone H1.11L
Source.4249: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.4250: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2
Source.4251: DFBPPR10938 ---- Animal proteins ---- Serine/threonine-protein kinase mos
Source.4252: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.4253: DFBPPR10945 ---- Animal proteins ---- Prosaposin
Source.4254: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.4255: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.4256: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor
Source.4257: DFBPPR10957 ---- Animal proteins ---- Hemoglobin subunit rho
Source.4258: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.4259: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2
Source.4260: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.4261: DFBPPR10979 ---- Animal proteins ---- Myc proto-oncogene protein
Source.4262: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.4263: DFBPPR10982 ---- Animal proteins ---- Melatonin receptor type 1C
Source.4264: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.4265: DFBPPR10988 ---- Animal proteins ---- Midkine
Source.4266: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4267: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.4268: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.4269: DFBPPR11008 ---- Animal proteins ---- Homeobox protein NANOG
Source.4270: DFBPPR11009 ---- Animal proteins ---- Cathelicidin-B1
Source.4271: DFBPPR11010 ---- Animal proteins ---- Alpha-actinin-4
Source.4272: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.4273: DFBPPR11017 ---- Animal proteins ---- Collectin-12
Source.4274: DFBPPR11018 ---- Animal proteins ---- Transcriptional coactivator YAP1
Source.4275: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.4276: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu
Source.4277: DFBPPR11027 ---- Animal proteins ---- Ras-related protein Rab-18
Source.4278: DFBPPR11028 ---- Animal proteins ---- Interleukin-6
Source.4279: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.4280: DFBPPR11035 ---- Animal proteins ---- Protein Dr1
Source.4281: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.4282: DFBPPR11040 ---- Animal proteins ---- Fatty acyl-CoA reductase 1
Source.4283: DFBPPR11042 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.4284: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.4285: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.4286: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13
Source.4287: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2
Source.4288: DFBPPR11067 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.4289: DFBPPR11069 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.4290: DFBPPR11072 ---- Animal proteins ---- TATA-box-binding protein
Source.4291: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.4292: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.4293: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.4294: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1
Source.4295: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.4296: DFBPPR11089 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.4297: DFBPPR11094 ---- Animal proteins ---- Transcription factor MafA
Source.4298: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.4299: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A
Source.4300: DFBPPR11110 ---- Animal proteins ---- Lamin-B1
Source.4301: DFBPPR11112 ---- Animal proteins ---- Protein quaking
Source.4302: DFBPPR11120 ---- Animal proteins ---- Ephrin-B1
Source.4303: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14
Source.4304: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.4305: DFBPPR11126 ---- Animal proteins ---- Parvalbumin, thymic
Source.4306: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.4307: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1
Source.4308: DFBPPR11141 ---- Animal proteins ---- Serine/threonine-protein kinase ULK3
Source.4309: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain
Source.4310: DFBPPR11151 ---- Animal proteins ---- SPARC
Source.4311: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain
Source.4312: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.4313: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1
Source.4314: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein
Source.4315: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta
Source.4316: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.4317: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein
Source.4318: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1
Source.4319: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1
Source.4320: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.4321: DFBPPR11199 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.4322: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1
Source.4323: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1
Source.4324: DFBPPR11213 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.4325: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2
Source.4326: DFBPPR11219 ---- Animal proteins ---- Cytospin-A
Source.4327: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.4328: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38
Source.4329: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2
Source.4330: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.4331: DFBPPR11233 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.4332: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase
Source.4333: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.4334: DFBPPR11241 ---- Animal proteins ---- Lymphocyte antigen 6E
Source.4335: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.4336: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.4337: DFBPPR11256 ---- Animal proteins ---- Neuroblastoma suppressor of tumorigenicity 1
Source.4338: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1
Source.4339: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.4340: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3
Source.4341: DFBPPR11280 ---- Animal proteins ---- KICSTOR complex protein kaptin
Source.4342: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.4343: DFBPPR11294 ---- Animal proteins ---- Frizzled-8
Source.4344: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.4345: DFBPPR11302 ---- Animal proteins ---- Histone H1.11R
Source.4346: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.4347: DFBPPR11308 ---- Animal proteins ---- Histone H1.03
Source.4348: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.4349: DFBPPR11317 ---- Animal proteins ---- Dickkopf-related protein 3
Source.4350: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15
Source.4351: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2
Source.4352: DFBPPR11336 ---- Animal proteins ---- Monocarboxylate transporter 3
Source.4353: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2
Source.4354: DFBPPR11341 ---- Animal proteins ---- CDP-diacylglycerol--glycerol-3-phosphate 3-phosphatidyltransferase, mitochondrial
Source.4355: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.4356: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.4357: DFBPPR11344 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.4358: DFBPPR11345 ---- Animal proteins ---- LIM/homeobox protein LMX-1.2
Source.4359: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase
Source.4360: DFBPPR11352 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.4361: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.4362: DFBPPR11363 ---- Animal proteins ---- Forkhead box protein D3
Source.4363: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.4364: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX
Source.4365: DFBPPR11375 ---- Animal proteins ---- Transcription factor E2F1
Source.4366: DFBPPR11376 ---- Animal proteins ---- Lamin-A
Source.4367: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6
Source.4368: DFBPPR11381 ---- Animal proteins ---- GPI mannosyltransferase 1
Source.4369: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1
Source.4370: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.4371: DFBPPR11387 ---- Animal proteins ---- Amphiphysin
Source.4372: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.4373: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.4374: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A
Source.4375: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1
Source.4376: DFBPPR11408 ---- Animal proteins ---- Cadherin-10
Source.4377: DFBPPR11411 ---- Animal proteins ---- Zinc finger protein ubi-d4
Source.4378: DFBPPR11415 ---- Animal proteins ---- Elongation factor Tu, mitochondrial
Source.4379: DFBPPR11419 ---- Animal proteins ---- Glutathione S-transferase
Source.4380: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.4381: DFBPPR11430 ---- Animal proteins ---- AarF domain-containing protein kinase 1
Source.4382: DFBPPR11436 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.4383: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4384: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7
Source.4385: DFBPPR11453 ---- Animal proteins ---- Charged multivesicular body protein 2a
Source.4386: DFBPPR11466 ---- Animal proteins ---- GDNF family receptor alpha-2
Source.4387: DFBPPR11467 ---- Animal proteins ---- Synembryn-A
Source.4388: DFBPPR11473 ---- Animal proteins ---- G2/M phase-specific E3 ubiquitin-protein ligase
Source.4389: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4
Source.4390: DFBPPR11479 ---- Animal proteins ---- Rab-like protein 3
Source.4391: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3
Source.4392: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9
Source.4393: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein
Source.4394: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog
Source.4395: DFBPPR11492 ---- Animal proteins ---- Carbohydrate sulfotransferase 10
Source.4396: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.4397: DFBPPR11506 ---- Animal proteins ---- Homeobox protein BarH-like 1b
Source.4398: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.4399: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.4400: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A
Source.4401: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.4402: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.4403: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD
Source.4404: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.4405: DFBPPR11552 ---- Animal proteins ---- RecQ-mediated genome instability protein 2
Source.4406: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1
Source.4407: DFBPPR11574 ---- Animal proteins ---- LHFPL tetraspan subfamily member 5 protein
Source.4408: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.4409: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.4410: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.4411: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.4412: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.4413: DFBPPR11599 ---- Animal proteins ---- Homeobox protein Hox-A9
Source.4414: DFBPPR11605 ---- Animal proteins ---- DNA repair protein complementing XP-A cells homolog
Source.4415: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.4416: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.4417: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.4418: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59
Source.4419: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.4420: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.4421: DFBPPR11637 ---- Animal proteins ---- 2-oxoglutarate and iron-dependent oxygenase JMJD4
Source.4422: DFBPPR11641 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.4423: DFBPPR11646 ---- Animal proteins ---- Frizzled-9
Source.4424: DFBPPR11652 ---- Animal proteins ---- Stathmin-3
Source.4425: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.4426: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4427: DFBPPR11663 ---- Animal proteins ---- Limbic system-associated membrane protein
Source.4428: DFBPPR11665 ---- Animal proteins ---- Shadow of prion protein
Source.4429: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.4430: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.4431: DFBPPR11670 ---- Animal proteins ---- Snurportin-1
Source.4432: DFBPPR11675 ---- Animal proteins ---- Endophilin-B1
Source.4433: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.4434: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.4435: DFBPPR11683 ---- Animal proteins ---- Somatostatin
Source.4436: DFBPPR11692 ---- Animal proteins ---- Non-histone chromosomal protein HMG-14B
Source.4437: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog
Source.4438: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.4439: DFBPPR11724 ---- Animal proteins ---- Protein TENP
Source.4440: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor
Source.4441: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.4442: DFBPPR11735 ---- Animal proteins ---- Protein YIPF3
Source.4443: DFBPPR11738 ---- Animal proteins ---- Ensconsin
Source.4444: DFBPPR11741 ---- Animal proteins ---- Parvalbumin, thymic CPV3
Source.4445: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.4446: DFBPPR11746 ---- Animal proteins ---- EEF1A lysine methyltransferase 1
Source.4447: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.4448: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1
Source.4449: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.4450: DFBPPR11758 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17B
Source.4451: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein
Source.4452: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.4453: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B
Source.4454: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.4455: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.4456: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.4457: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.4458: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.4459: DFBPPR11781 ---- Animal proteins ---- Embryonic pepsinogen
Source.4460: DFBPPR11784 ---- Animal proteins ---- Homeobox protein Hox-B8
Source.4461: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1
Source.4462: DFBPPR11795 ---- Animal proteins ---- Class E basic helix-loop-helix protein 22
Source.4463: DFBPPR11796 ---- Animal proteins ---- Surfeit locus protein 4
Source.4464: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91
Source.4465: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.4466: DFBPPR11810 ---- Animal proteins ---- Homeobox protein BarH-like 1
Source.4467: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.4468: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.4469: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.4470: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.4471: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.4472: DFBPPR11833 ---- Animal proteins ---- Kelch-like protein 7
Source.4473: DFBPPR11845 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 17
Source.4474: DFBPPR11847 ---- Animal proteins ---- Borealin-2
Source.4475: DFBPPR11848 ---- Animal proteins ---- Parvalbumin, muscle
Source.4476: DFBPPR11849 ---- Animal proteins ---- Monocarboxylate transporter 9
Source.4477: DFBPPR11852 ---- Animal proteins ---- Endothelial differentiation-related factor 1 homolog
Source.4478: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.4479: DFBPPR11859 ---- Animal proteins ---- Leucine-rich repeat-containing protein 59
Source.4480: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.4481: DFBPPR11861 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 10
Source.4482: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3
Source.4483: DFBPPR11864 ---- Animal proteins ---- Radixin
Source.4484: DFBPPR11868 ---- Animal proteins ---- Apoptosis inhibitor 5
Source.4485: DFBPPR11882 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A
Source.4486: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.4487: DFBPPR11890 ---- Animal proteins ---- Sodium/hydrogen exchanger 8
Source.4488: DFBPPR11894 ---- Animal proteins ---- Centromere protein K
Source.4489: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9
Source.4490: DFBPPR11908 ---- Animal proteins ---- Centrosomal protein kizuna
Source.4491: DFBPPR11912 ---- Animal proteins ---- Homeobox protein Hox-A13
Source.4492: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3
Source.4493: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.4494: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19
Source.4495: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.4496: DFBPPR11930 ---- Animal proteins ---- UAP56-interacting factor
Source.4497: DFBPPR11938 ---- Animal proteins ---- Nuclear apoptosis-inducing factor 1
Source.4498: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3
Source.4499: DFBPPR11948 ---- Animal proteins ---- Nucleolar complex protein 4 homolog
Source.4500: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.4501: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.4502: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2
Source.4503: DFBPPR11959 ---- Animal proteins ---- Deubiquitinase OTUD6B
Source.4504: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.4505: DFBPPR11961 ---- Animal proteins ---- KIF-binding protein
Source.4506: DFBPPR11966 ---- Animal proteins ---- Protein CREG1
Source.4507: DFBPPR11967 ---- Animal proteins ---- Monocarboxylate transporter 4
Source.4508: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.4509: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.4510: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1
Source.4511: DFBPPR11974 ---- Animal proteins ---- Adipocyte plasma membrane-associated protein
Source.4512: DFBPPR11975 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.4513: DFBPPR11976 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim9
Source.4514: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.4515: DFBPPR11983 ---- Animal proteins ---- Tumor protein D53 homolog
Source.4516: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4
Source.4517: DFBPPR11985 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.4518: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.4519: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.4520: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.4521: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.4522: DFBPPR12014 ---- Animal proteins ---- Raftlin
Source.4523: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.4524: DFBPPR12022 ---- Animal proteins ---- Regulator of G-protein signaling 4
Source.4525: DFBPPR12025 ---- Animal proteins ---- Transmembrane protein 18
Source.4526: DFBPPR12026 ---- Animal proteins ---- Bridging integrator 2
Source.4527: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.4528: DFBPPR12034 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.4529: DFBPPR12039 ---- Animal proteins ---- Protein GOLM2
Source.4530: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.4531: DFBPPR12049 ---- Animal proteins ---- 60S ribosomal protein L36
Source.4532: DFBPPR12050 ---- Animal proteins ---- Pleckstrin homology domain-containing family O member 1
Source.4533: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.4534: DFBPPR12067 ---- Animal proteins ---- Transcription factor EC
Source.4535: DFBPPR12073 ---- Animal proteins ---- 40S ribosomal protein S4
Source.4536: DFBPPR12075 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.4537: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.4538: DFBPPR12078 ---- Animal proteins ---- Transmembrane protein 129
Source.4539: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.4540: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2
Source.4541: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.4542: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.4543: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.4544: DFBPPR12103 ---- Animal proteins ---- FUN14 domain-containing protein 1
Source.4545: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.4546: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.4547: DFBPPR12116 ---- Animal proteins ---- Armadillo repeat-containing protein 1
Source.4548: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.4549: DFBPPR12125 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8
Source.4550: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.4551: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.4552: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.4553: DFBPPR12132 ---- Animal proteins ---- Transmembrane protein 11, mitochondrial
Source.4554: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93
Source.4555: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.4556: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.4557: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.4558: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.4559: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A
Source.4560: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.4561: DFBPPR12165 ---- Animal proteins ---- Vacuolar fusion protein MON1 homolog A
Source.4562: DFBPPR12171 ---- Animal proteins ---- Arylamine N-acetyltransferase, pineal gland isozyme NAT-3
Source.4563: DFBPPR12173 ---- Animal proteins ---- Protein CIP2A homolog
Source.4564: DFBPPR12189 ---- Animal proteins ---- Arginine and glutamate-rich protein 1
Source.4565: DFBPPR12191 ---- Animal proteins ---- DEP domain-containing protein 1B
Source.4566: DFBPPR12199 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit B
Source.4567: DFBPPR12200 ---- Animal proteins ---- Basic leucine zipper and W2 domain-containing protein 1
Source.4568: DFBPPR12214 ---- Animal proteins ---- Nucleolar protein 11
Source.4569: DFBPPR12216 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial
Source.4570: DFBPPR12222 ---- Animal proteins ---- Coiled-coil domain-containing protein 43
Source.4571: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2
Source.4572: DFBPPR12230 ---- Animal proteins ---- Orofacial cleft 1 candidate gene 1 protein homolog
Source.4573: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10
Source.4574: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.4575: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.4576: DFBPPR12248 ---- Animal proteins ---- Fructose-bisphosphate aldolase A
Source.4577: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.4578: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.4579: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.4580: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.4581: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1
Source.4582: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.4583: DFBPPR12259 ---- Animal proteins ---- Lambda-crystallin
Source.4584: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.4585: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.4586: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.4587: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.4588: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.4589: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.4590: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.4591: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.4592: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3
Source.4593: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.4594: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.4595: DFBPPR12304 ---- Animal proteins ---- Cellular tumor antigen p53
Source.4596: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.4597: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.4598: DFBPPR12319 ---- Animal proteins ---- Calreticulin
Source.4599: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.4600: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E
Source.4601: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.4602: DFBPPR12342 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.4603: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.4604: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.4605: DFBPPR12352 ---- Animal proteins ---- Podocalyxin
Source.4606: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.4607: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.4608: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.4609: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.4610: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.4611: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.4612: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.4613: DFBPPR12393 ---- Animal proteins ---- Growth hormone receptor
Source.4614: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.4615: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.4616: DFBPPR12399 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.4617: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.4618: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.4619: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.4620: DFBPPR12417 ---- Animal proteins ---- Rhodopsin
Source.4621: DFBPPR12419 ---- Animal proteins ---- Phospholipase A2
Source.4622: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase
Source.4623: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.4624: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4625: DFBPPR12424 ---- Animal proteins ---- Protein phosphatase inhibitor 2
Source.4626: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.4627: DFBPPR12429 ---- Animal proteins ---- Apolipoprotein A-I
Source.4628: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.4629: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.4630: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.4631: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.4632: DFBPPR12445 ---- Animal proteins ---- Hemoglobin subunit beta-1/2
Source.4633: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.4634: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.4635: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.4636: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.4637: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.4638: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.4639: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.4640: DFBPPR12482 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.4641: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.4642: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.4643: DFBPPR12493 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.4644: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.4645: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.4646: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.4647: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.4648: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.4649: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.4650: DFBPPR12516 ---- Animal proteins ---- Indolethylamine N-methyltransferase
Source.4651: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.4652: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII
Source.4653: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.4654: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.4655: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.4656: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.4657: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.4658: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4659: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.4660: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K
Source.4661: DFBPPR12573 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.4662: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.4663: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.4664: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.4665: DFBPPR12590 ---- Animal proteins ---- Epoxide hydrolase 1
Source.4666: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20
Source.4667: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.4668: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.4669: DFBPPR12607 ---- Animal proteins ---- Basigin
Source.4670: DFBPPR12615 ---- Animal proteins ---- Metalloproteinase inhibitor 1
Source.4671: DFBPPR12624 ---- Animal proteins ---- Heparin cofactor 2
Source.4672: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.4673: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.4674: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.4675: DFBPPR12641 ---- Animal proteins ---- Cytochrome b-245 light chain
Source.4676: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1
Source.4677: DFBPPR12652 ---- Animal proteins ---- Corticostatin-3
Source.4678: DFBPPR12654 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4679: DFBPPR12657 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.4680: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.4681: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.4682: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.4683: DFBPPR12709 ---- Animal proteins ---- Somatotropin
Source.4684: DFBPPR12723 ---- Animal proteins ---- Glutathione S-transferase alpha I
Source.4685: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.4686: DFBPPR12734 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.4687: DFBPPR12738 ---- Animal proteins ---- Histone H1.4
Source.4688: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.4689: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1
Source.4690: DFBPPR12748 ---- Animal proteins ---- Pepsin II-1
Source.4691: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.4692: DFBPPR12755 ---- Animal proteins ---- Pepsin II-2/3
Source.4693: DFBPPR12757 ---- Animal proteins ---- Pepsin II-4
Source.4694: DFBPPR12762 ---- Animal proteins ---- SPARC
Source.4695: DFBPPR12768 ---- Animal proteins ---- Pepsin-3
Source.4696: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.4697: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.4698: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.4699: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.4700: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.4701: DFBPPR12789 ---- Animal proteins ---- CD59 glycoprotein
Source.4702: DFBPPR12793 ---- Animal proteins ---- Corticostatin-4
Source.4703: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.4704: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.4705: DFBPPR12800 ---- Animal proteins ---- B2 bradykinin receptor
Source.4706: DFBPPR12801 ---- Animal proteins ---- Cytochrome P450 3A6
Source.4707: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.4708: DFBPPR12807 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.4709: DFBPPR12811 ---- Animal proteins ---- Heme oxygenase 2
Source.4710: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.4711: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4
Source.4712: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.4713: DFBPPR12817 ---- Animal proteins ---- Cathepsin E
Source.4714: DFBPPR12819 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.4715: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.4716: DFBPPR12827 ---- Animal proteins ---- Matrix Gla protein
Source.4717: DFBPPR12828 ---- Animal proteins ---- Retinol-binding protein 4
Source.4718: DFBPPR12831 ---- Animal proteins ---- Serine--pyruvate aminotransferase
Source.4719: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor
Source.4720: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.4721: DFBPPR12839 ---- Animal proteins ---- Ammonium transporter Rh type B
Source.4722: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.4723: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.4724: DFBPPR12853 ---- Animal proteins ---- Insulin
Source.4725: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1
Source.4726: DFBPPR12877 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.4727: DFBPPR12880 ---- Animal proteins ---- Corticostatin 1
Source.4728: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.4729: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.4730: DFBPPR12884 ---- Animal proteins ---- Extracellular superoxide dismutase [Cu-Zn]
Source.4731: DFBPPR12886 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.4732: DFBPPR12901 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I
Source.4733: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.4734: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.4735: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.4736: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.4737: DFBPPR12918 ---- Animal proteins ---- Myosin heavy chain, embryonic smooth muscle isoform
Source.4738: DFBPPR12930 ---- Animal proteins ---- Kappa-casein
Source.4739: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C
Source.4740: DFBPPR12935 ---- Animal proteins ---- Histone H1.3
Source.4741: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.4742: DFBPPR12942 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.4743: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.4744: DFBPPR12955 ---- Animal proteins ---- Urea transporter 2
Source.4745: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor
Source.4746: DFBPPR12959 ---- Animal proteins ---- Keratin, type I cytoskeletal 12
Source.4747: DFBPPR12964 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-5
Source.4748: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.4749: DFBPPR12975 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.4750: DFBPPR12979 ---- Animal proteins ---- Lutropin subunit beta
Source.4751: DFBPPR12981 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-4
Source.4752: DFBPPR12986 ---- Animal proteins ---- Elongation factor 1-gamma
Source.4753: DFBPPR12993 ---- Animal proteins ---- Tumor protein D52
Source.4754: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.4755: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.4756: DFBPPR13000 ---- Animal proteins ---- Cystatin-C
Source.4757: DFBPPR13002 ---- Animal proteins ---- Complement component C8 gamma chain
Source.4758: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4759: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.4760: DFBPPR13053 ---- Animal proteins ---- G-protein coupled bile acid receptor 1
Source.4761: DFBPPR13063 ---- Animal proteins ---- 60S acidic ribosomal protein P2
Source.4762: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.4763: DFBPPR13079 ---- Animal proteins ---- NXPE family member 1
Source.4764: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4765: DFBPPR13094 ---- Animal proteins ---- Atherin
Source.4766: DFBPPR13095 ---- Animal proteins ---- Regulator of G-protein signaling 4
Source.4767: DFBPPR13098 ---- Animal proteins ---- Epithelial membrane protein 1
Source.4768: DFBPPR13100 ---- Animal proteins ---- Lengsin
Source.4769: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.4770: DFBPPR13167 ---- Animal proteins ---- Natriuretic peptides A
Source.4771: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4772: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2
Source.4773: DFBPPR13175 ---- Animal proteins ---- Catechol O-methyltransferase
Source.4774: DFBPPR13183 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, muscle type
Source.4775: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.4776: DFBPPR13193 ---- Animal proteins ---- Aquaporin-11
Source.4777: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.4778: DFBPPR13195 ---- Animal proteins ---- Albumin
Source.4779: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.4780: DFBPPR13214 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.4781: DFBPPR13226 ---- Animal proteins ---- Lutropin/choriogonadotropin subunit beta
Source.4782: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4783: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.4784: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.4785: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.4786: DFBPPR13245 ---- Animal proteins ---- Somatotropin
Source.4787: DFBPPR13250 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3, truncated
Source.4788: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4789: DFBPPR13262 ---- Animal proteins ---- Gastrin
Source.4790: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.4791: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.4792: DFBPPR13276 ---- Animal proteins ---- Protein quaking
Source.4793: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a
Source.4794: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.4795: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.4796: DFBPPR13292 ---- Animal proteins ---- Inhibin alpha chain
Source.4797: DFBPPR13297 ---- Animal proteins ---- Plasminogen
Source.4798: DFBPPR13298 ---- Animal proteins ---- Cyclin-T1
Source.4799: DFBPPR13312 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.4800: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.4801: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.4802: DFBPPR13316 ---- Animal proteins ---- Myelin protein P0
Source.4803: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.4804: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.4805: DFBPPR13337 ---- Animal proteins ---- Calcitonin gene-related peptide 1
Source.4806: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.4807: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.4808: DFBPPR13348 ---- Animal proteins ---- Calcitonin
Source.4809: DFBPPR13349 ---- Animal proteins ---- Cysteine-rich secretory protein 3
Source.4810: DFBPPR13354 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4811: DFBPPR13359 ---- Animal proteins ---- Protein S100-A7
Source.4812: DFBPPR13366 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.4813: DFBPPR13371 ---- Animal proteins ---- Calcitonin gene-related peptide 2
Source.4814: DFBPPR13374 ---- Animal proteins ---- Retinol-binding protein 4
Source.4815: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.4816: DFBPPR13389 ---- Animal proteins ---- Phosducin
Source.4817: DFBPPR13397 ---- Animal proteins ---- Hemoglobin subunit theta-1
Source.4818: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.4819: DFBPPR13405 ---- Animal proteins ---- 60S acidic ribosomal protein P2
Source.4820: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4821: DFBPPR13424 ---- Animal proteins ---- Leptin
Source.4822: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.4823: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.4824: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4825: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4826: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.4827: DFBPPR13456 ---- Animal proteins ---- Galectin-1
Source.4828: DFBPPR13481 ---- Animal proteins ---- Somatotropin
Source.4829: DFBPPR13505 ---- Animal proteins ---- Spectrin beta chain, non-erythrocytic 1
Source.4830: DFBPPR13506 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.4831: DFBPPR13507 ---- Animal proteins ---- Growth/differentiation factor 9
Source.4832: DFBPPR13521 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.4833: DFBPPR13522 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2
Source.4834: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.4835: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.4836: DFBPPR13540 ---- Animal proteins ---- Somatotropin
Source.4837: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.4838: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.4839: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36
Source.4840: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.4841: DFBPPR13584 ---- Animal proteins ---- Calpain-3
Source.4842: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4843: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha
Source.4844: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4845: DFBPPR13597 ---- Animal proteins ---- Leptin
Source.4846: DFBPPR13598 ---- Animal proteins ---- Interleukin-8
Source.4847: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.4848: DFBPPR13605 ---- Animal proteins ---- Rhodopsin
Source.4849: DFBPPR13609 ---- Animal proteins ---- Lutropin subunit beta
Source.4850: DFBPPR13610 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide
Source.4851: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.4852: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.4853: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.4854: DFBPPR13630 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.4855: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.4856: DFBPPR13638 ---- Animal proteins ---- Lysophosphatidic acid receptor 1
Source.4857: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6
Source.4858: DFBPPR13652 ---- Animal proteins ---- Interleukin-3
Source.4859: DFBPPR13660 ---- Animal proteins ---- 40S ribosomal protein SA
Source.4860: DFBPPR13663 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] cytochrome b small subunit, mitochondrial
Source.4861: DFBPPR13670 ---- Animal proteins ---- Vasopressin-neurophysin 2-copeptin
Source.4862: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic
Source.4863: DFBPPR13678 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.4864: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.4865: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.4866: DFBPPR13690 ---- Animal proteins ---- Angiotensinogen
Source.4867: DFBPPR13706 ---- Animal proteins ---- Alpha-1-antiproteinase
Source.4868: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.4869: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.4870: DFBPPR13732 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 1
Source.4871: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.4872: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.4873: DFBPPR13739 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain
Source.4874: DFBPPR13746 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.4875: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.4876: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21
Source.4877: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.4878: DFBPPR13771 ---- Animal proteins ---- Growth/differentiation factor 9
Source.4879: DFBPPR13772 ---- Animal proteins ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.4880: DFBPPR13778 ---- Animal proteins ---- Insulin-like growth factor-binding protein 4
Source.4881: DFBPPR13779 ---- Animal proteins ---- Syntaxin-1B
Source.4882: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.4883: DFBPPR13783 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.4884: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.4885: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1
Source.4886: DFBPPR13821 ---- Animal proteins ---- Calcitonin
Source.4887: DFBPPR13822 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.4888: DFBPPR13829 ---- Animal proteins ---- Melatonin receptor type 1A
Source.4889: DFBPPR13834 ---- Animal proteins ---- Biglycan
Source.4890: DFBPPR13836 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.4891: DFBPPR13840 ---- Animal proteins ---- Cytochrome b561
Source.4892: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein
Source.4893: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor
Source.4894: DFBPPR13875 ---- Animal proteins ---- Gastrin
Source.4895: DFBPPR13877 ---- Animal proteins ---- Sialin
Source.4896: DFBPPR13880 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4897: DFBPPR13883 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.4898: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.4899: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.4900: DFBPPR13896 ---- Animal proteins ---- Somatostatin
Source.4901: DFBPPR13900 ---- Animal proteins ---- Keratin, type I cytoskeletal 15
Source.4902: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.4903: DFBPPR13907 ---- Animal proteins ---- Shadow of prion protein
Source.4904: DFBPPR13908 ---- Animal proteins ---- Shadow of prion protein
Source.4905: DFBPPR13910 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.4906: DFBPPR13923 ---- Animal proteins ---- CCAAT/enhancer-binding protein epsilon
Source.4907: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.4908: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.4909: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4910: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.4911: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.4912: DFBPPR13957 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 1
Source.4913: DFBPPR13987 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.4914: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4915: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.4916: DFBPPR13992 ---- Animal proteins ---- Rhodopsin
Source.4917: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.4918: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.4919: DFBPPR14014 ---- Animal proteins ---- Somatotropin
Source.4920: DFBPPR14036 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.4921: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.4922: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4923: DFBPPR14044 ---- Animal proteins ---- Transcription factor jun-B
Source.4924: DFBPPR14047 ---- Animal proteins ---- Cytochrome c oxidase subunit 6A, mitochondrial
Source.4925: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.4926: DFBPPR14073 ---- Marine protein ---- Elastase-1
Source.4927: DFBPPR14077 ---- Marine protein ---- Serotransferrin-1
Source.4928: DFBPPR14078 ---- Marine protein ---- Histone H1
Source.4929: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.4930: DFBPPR14080 ---- Marine protein ---- Serotransferrin-2
Source.4931: DFBPPR14086 ---- Marine protein ---- Hemoglobin subunit alpha
Source.4932: DFBPPR14091 ---- Marine protein ---- 40S ribosomal protein SA
Source.4933: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1
Source.4934: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran
Source.4935: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A
Source.4936: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183
Source.4937: DFBPPR14115 ---- Marine protein ---- Adenylate kinase 2, mitochondrial
Source.4938: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin
Source.4939: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.4940: DFBPPR14131 ---- Marine protein ---- Kynurenine formamidase
Source.4941: DFBPPR14140 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.4942: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I
Source.4943: DFBPPR14147 ---- Marine protein ---- Parvalbumin beta 2
Source.4944: DFBPPR14150 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.4945: DFBPPR14154 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.4946: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.4947: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.4948: DFBPPR14186 ---- Marine protein ---- 60S ribosomal protein L18
Source.4949: DFBPPR14194 ---- Marine protein ---- UAP56-interacting factor
Source.4950: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein
Source.4951: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.4952: DFBPPR14205 ---- Marine protein ---- Intraflagellar transport protein 43 homolog A
Source.4953: DFBPPR14212 ---- Marine protein ---- Proline-rich nuclear receptor coactivator 2
Source.4954: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial
Source.4955: DFBPPR14230 ---- Marine protein ---- Pro-opiomelanocortin
Source.4956: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.4957: DFBPPR14262 ---- Marine protein ---- Pro-opiomelanocortin
Source.4958: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.4959: DFBPPR14294 ---- Marine protein ---- ATP synthase subunit c, chloroplastic
Source.4960: DFBPPR14301 ---- Marine protein ---- ATP synthase subunit b', chloroplastic
Source.4961: DFBPPR14304 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.4962: DFBPPR14321 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.4963: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.4964: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.4965: DFBPPR14344 ---- Marine protein ---- Probable molybdopterin-synthase adenylyltransferase
Source.4966: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.4967: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N
Source.4968: DFBPPR14350 ---- Marine protein ---- 3-oxoacyl-[acyl-carrier-protein] synthase 3
Source.4969: DFBPPR14354 ---- Marine protein ---- Cytochrome c-550
Source.4970: DFBPPR14355 ---- Marine protein ---- ATP synthase subunit c, chloroplastic
Source.4971: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha
Source.4972: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.4973: DFBPPR14376 ---- Marine protein ---- ATP synthase subunit b', chloroplastic
Source.4974: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.4975: DFBPPR14385 ---- Marine protein ---- ATP synthase subunit b, chloroplastic
Source.4976: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic
Source.4977: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.4978: DFBPPR14401 ---- Marine protein ---- 50S ribosomal protein L4, chloroplastic
Source.4979: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.4980: DFBPPR14408 ---- Marine protein ---- Cytochrome b6-f complex subunit 6
Source.4981: DFBPPR14427 ---- Marine protein ---- Photosystem I reaction center subunit III
Source.4982: DFBPPR14429 ---- Marine protein ---- Photosystem II protein Y
Source.4983: DFBPPR14537 ---- Marine protein ---- Histone H2A
Source.4984: DFBPPR14549 ---- Marine protein ---- Pro-opiomelanocortin B
Source.4985: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.4986: DFBPPR14557 ---- Marine protein ---- Interferon a3
Source.4987: DFBPPR14559 ---- Marine protein ---- Histone H1
Source.4988: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.4989: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta
Source.4990: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.4991: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific
Source.4992: DFBPPR14579 ---- Marine protein ---- Hemoglobin subunit alpha-1
Source.4993: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.4994: DFBPPR14596 ---- Marine protein ---- Parvalbumin beta 2
Source.4995: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing]
Source.4996: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.4997: DFBPPR14620 ---- Marine protein ---- GTP cyclohydrolase 1
Source.4998: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein
Source.4999: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1
Source.5000: DFBPPR14633 ---- Marine protein ---- Keratin, type I cytoskeletal 18
Source.5001: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain
Source.5002: DFBPPR14649 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 2
Source.5003: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.5004: DFBPPR14657 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 4
Source.5005: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.5006: DFBPPR14664 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 5
Source.5007: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.5008: DFBPPR14674 ---- Marine protein ---- Glucagon-1
Source.5009: DFBPPR14675 ---- Marine protein ---- Glucagon-2
Source.5010: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor
Source.5011: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6
Source.5012: DFBPPR14679 ---- Marine protein ---- Otolith matrix protein 1
Source.5013: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.5014: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2
Source.5015: DFBPPR14699 ---- Marine protein ---- Otolith matrix protein OMM-64
Source.5016: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13
Source.5017: DFBPPR14729 ---- Marine protein ---- Protein LEG1 homolog
Source.5018: DFBPPR14746 ---- Marine protein ---- Parvalbumin beta 1
Source.5019: DFBPPR14749 ---- Marine protein ---- Alcohol dehydrogenase 1
Source.5020: DFBPPR14762 ---- Marine protein ---- Coagulogen
Source.5021: DFBPPR14775 ---- Marine protein ---- Troponin C
Source.5022: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain
Source.5023: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.5024: DFBPPR14793 ---- Marine protein ---- Panulirin
Source.5025: DFBPPR14799 ---- Marine protein ---- Arginine kinase
Source.5026: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.5027: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit
Source.5028: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1
Source.5029: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2
Source.5030: DFBPPR14820 ---- Marine protein ---- Troponin C, isoform 1
Source.5031: DFBPPR14832 ---- Marine protein ---- Troponin C, isoform 2B
Source.5032: DFBPPR14833 ---- Marine protein ---- Troponin C, isoform 2A
Source.5033: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form
Source.5034: DFBPPR14856 ---- Marine protein ---- Rhodopsin, deep-sea form
Source.5035: DFBPPR14858 ---- Marine protein ---- Hemoglobin cathodic subunit alpha
Source.5036: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.5037: DFBPPR14863 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit beta-233
Source.5038: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.5039: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.5040: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.5041: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.5042: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1
Source.5043: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.5044: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.5045: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.5046: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.5047: DFBPPR14918 ---- Microorganism protein ---- Isocitrate lyase
Source.5048: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.5049: DFBPPR14929 ---- Microorganism protein ---- Histone H2A
Source.5050: DFBPPR14931 ---- Microorganism protein ---- E3 ubiquitin-protein ligase BRE1
Source.5051: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial
Source.5052: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.5053: DFBPPR14944 ---- Microorganism protein ---- Histone H3
Source.5054: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.5055: DFBPPR14952 ---- Microorganism protein ---- Histone H2B.1
Source.5056: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.5057: DFBPPR14967 ---- Microorganism protein ---- Histone H2B.2
Source.5058: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.5059: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.5060: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.5061: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial
Source.5062: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.5063: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.5064: DFBPPR14995 ---- Microorganism protein ---- ATP-dependent RNA helicase MSS116, mitochondrial
Source.5065: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase
Source.5066: DFBPPR15001 ---- Microorganism protein ---- ARS-binding factor 1
Source.5067: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8
Source.5068: DFBPPR15018 ---- Microorganism protein ---- Sorting nexin-4
Source.5069: DFBPPR15019 ---- Microorganism protein ---- Cytochrome c peroxidase, mitochondrial
Source.5070: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein
Source.5071: DFBPPR15026 ---- Microorganism protein ---- ATP synthase subunit 9, mitochondrial
Source.5072: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.5073: DFBPPR15036 ---- Microorganism protein ---- ATP synthase subunit gamma, mitochondrial
Source.5074: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase
Source.5075: DFBPPR15045 ---- Microorganism protein ---- Enolase
Source.5076: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.5077: DFBPPR15053 ---- Microorganism protein ---- 60S ribosomal subunit assembly/export protein LOC1
Source.5078: DFBPPR15057 ---- Microorganism protein ---- Protein transport protein SEC13
Source.5079: DFBPPR15060 ---- Microorganism protein ---- Transaldolase
Source.5080: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.5081: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1
Source.5082: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.5083: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase
Source.5084: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.5085: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.5086: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear
Source.5087: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40
Source.5088: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.5089: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3
Source.5090: DFBPPR15164 ---- Microorganism protein ---- Methionine aminopeptidase 2
Source.5091: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.5092: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C
Source.5093: DFBPPR15187 ---- Microorganism protein ---- Delta 8-(E)-sphingolipid desaturase
Source.5094: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3
Source.5095: DFBPPR15194 ---- Microorganism protein ---- FACT complex subunit POB3
Source.5096: DFBPPR15207 ---- Microorganism protein ---- Triosephosphate isomerase
Source.5097: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60
Source.5098: DFBPPR15221 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.5099: DFBPPR15228 ---- Microorganism protein ---- Elongation factor G, mitochondrial
Source.5100: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2
Source.5101: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3
Source.5102: DFBPPR15244 ---- Microorganism protein ---- DASH complex subunit SPC19
Source.5103: DFBPPR15271 ---- Microorganism protein ---- Actin-related protein 4
Source.5104: DFBPPR15272 ---- Microorganism protein ---- Pre-mRNA-splicing factor CEF1
Source.5105: DFBPPR15277 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 20
Source.5106: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.5107: DFBPPR15295 ---- Microorganism protein ---- Galactose/lactose metabolism regulatory protein GAL80
Source.5108: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1
Source.5109: DFBPPR15315 ---- Microorganism protein ---- Porphobilinogen deaminase
Source.5110: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10
Source.5111: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10
Source.5112: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3
Source.5113: DFBPPR15343 ---- Microorganism protein ---- Protein BIG1
Source.5114: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.5115: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.5116: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.5117: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.5118: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1
Source.5119: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.5120: DFBPPR15393 ---- Microorganism protein ---- Inner membrane assembly complex subunit 17
Source.5121: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase
Source.5122: DFBPPR15441 ---- Microorganism protein ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.5123: DFBPPR15443 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 10
Source.5124: DFBPPR15444 ---- Microorganism protein ---- Monopolar spindle protein 2
Source.5125: DFBPPR15448 ---- Microorganism protein ---- 40S ribosomal protein S0
Source.5126: DFBPPR15450 ---- Microorganism protein ---- Ceramide synthase subunit LIP1
Source.5127: DFBPPR15453 ---- Microorganism protein ---- ATP synthase subunit 5, mitochondrial
Source.5128: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.5129: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.5130: DFBPPR15481 ---- Microorganism protein ---- Probable cytosolic iron-sulfur protein assembly protein 1
Source.5131: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.5132: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46
Source.5133: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62
Source.5134: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.5135: DFBPPR15500 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 5
Source.5136: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1
Source.5137: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.5138: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.5139: DFBPPR15514 ---- Microorganism protein ---- Nucleotide exchange factor SIL1
Source.5140: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14
Source.5141: DFBPPR15518 ---- Microorganism protein ---- Chromatin modification-related protein EAF6
Source.5142: DFBPPR15536 ---- Microorganism protein ---- Protein SDS23
Source.5143: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.5144: DFBPPR15549 ---- Microorganism protein ---- Probable kinetochore protein SPC25
Source.5145: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.5146: DFBPPR15574 ---- Microorganism protein ---- Protein PXR1
Source.5147: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1
Source.5148: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1
Source.5149: DFBPPR15597 ---- Microorganism protein ---- DNA damage-binding protein CMR1
Source.5150: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1
Source.5151: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1
Source.5152: DFBPPR15609 ---- Microorganism protein ---- Shugoshin
Source.5153: DFBPPR15622 ---- Microorganism protein ---- Mitochondrial zinc maintenance protein 1, mitochondrial
Source.5154: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.5155: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.5156: DFBPPR15632 ---- Microorganism protein ---- Ribosome biogenesis protein NSA1
Source.5157: DFBPPR15642 ---- Microorganism protein ---- Spindle pole component 29
Source.5158: DFBPPR15644 ---- Microorganism protein ---- Cytoplasmic dynein intermediate light chain DYN3
Source.5159: DFBPPR15677 ---- Microorganism protein ---- Ribosome-recycling factor, mitochondrial
Source.5160: DFBPPR15687 ---- Microorganism protein ---- 40S ribosomal protein S14
Source.5161: DFBPPR15695 ---- Microorganism protein ---- Genetic interactor of prohibitin 5, mitochondrial
Source.5162: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.5163: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5
Source.5164: DFBPPR15707 ---- Microorganism protein ---- Golgi apparatus membrane protein TVP23
Source.5165: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4
Source.5166: DFBPPR15710 ---- Microorganism protein ---- rRNA-processing protein CGR1
Source.5167: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial
Source.5168: DFBPPR15730 ---- Microorganism protein ---- Suppressor of hydroxyurea sensitivity protein 2
Source.5169: DFBPPR15732 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 6, mitochondrial
Source.5170: DFBPPR15738 ---- Microorganism protein ---- Regulator of rDNA transcription 14
Source.5171: DFBPPR15750 ---- Microorganism protein ---- 60S ribosomal protein L24
Source.5172: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog
Source.5173: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1
Source.5174: DFBPPR15786 ---- Microorganism protein ---- Stationary phase protein 4
Source.5175: DFBPPR15796 ---- Microorganism protein ---- Folylpolyglutamate synthase
Source.5176: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.5177: DFBPPR15813 ---- Microorganism protein ---- Anthranilate phosphoribosyltransferase
Source.5178: DFBPPR15818 ---- Microorganism protein ---- PTS system sorbose-specific EIID component
Source.5179: DFBPPR15827 ---- Microorganism protein ---- HTH-type transcriptional regulator GalR
Source.5180: DFBPPR15830 ---- Microorganism protein ---- Indole-3-glycerol phosphate synthase
Source.5181: DFBPPR15832 ---- Microorganism protein ---- Uncharacterized protein in fgs 3'region
Source.5182: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.5183: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.5184: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2
Source.5185: DFBPPR15839 ---- Microorganism protein ---- Citrate synthase
Source.5186: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase
Source.5187: DFBPPR15850 ---- Microorganism protein ---- Histone H2A
Source.5188: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.5189: DFBPPR15864 ---- Microorganism protein ---- Hydrophobin-3
Source.5190: DFBPPR15869 ---- Microorganism protein ---- Phenylalanine ammonia-lyase
Source.5191: DFBPPR15871 ---- Microorganism protein ---- Aldehyde dehydrogenase
Source.5192: DFBPPR15887 ---- Microorganism protein ---- Uncharacterized protein ORF1
Source.5193: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5194: DFBPPR7750 ---- Plant protein ---- Cationic peroxidase SPC4
Source.5195: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase
Source.5196: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.5197: DFBPPR7757 ---- Plant protein ---- Photosystem II protein D1
Source.5198: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.5199: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.5200: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5201: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.5202: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial
Source.5203: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.5204: DFBPPR7799 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 4L, chloroplastic
Source.5205: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.5206: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.5207: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.5208: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.5209: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.5210: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.5211: DFBPPR7831 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.5212: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a
Source.5213: DFBPPR7846 ---- Plant protein ---- Casparian strip membrane protein 2
Source.5214: DFBPPR7847 ---- Plant protein ---- Non-specific lipid-transfer protein 1
Source.5215: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.5216: DFBPPR7852 ---- Plant protein ---- Bidirectional sugar transporter SWEET2a
Source.5217: DFBPPR7854 ---- Plant protein ---- Cytochrome b6-f complex subunit 6
Source.5218: DFBPPR7860 ---- Plant protein ---- CASP-like protein 1C1
Source.5219: DFBPPR7867 ---- Plant protein ---- CASP-like protein 3A1
Source.5220: DFBPPR7868 ---- Plant protein ---- Alpha-amylase inhibitor 4
Source.5221: DFBPPR7883 ---- Plant protein ---- Non-specific lipid-transfer protein 2
Source.5222: DFBPPR7884 ---- Plant protein ---- CASP-like protein 4A1
Source.5223: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1
Source.5224: DFBPPR7890 ---- Plant protein ---- CASP-like protein 1E1
Source.5225: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1
Source.5226: DFBPPR7893 ---- Plant protein ---- Casparian strip membrane protein 1
Source.5227: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1
Source.5228: DFBPPR7903 ---- Plant protein ---- CASP-like protein 4U1
Source.5229: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2
Source.5230: DFBPPR7907 ---- Plant protein ---- CASP-like protein 2C1
Source.5231: DFBPPR7908 ---- Plant protein ---- CASP-like protein 2U1
Source.5232: DFBPPR7913 ---- Plant protein ---- CASP-like protein 1U4
Source.5233: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2
Source.5234: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.5235: DFBPPR7917 ---- Plant protein ---- CASP-like protein 4D1
Source.5236: DFBPPR7918 ---- Plant protein ---- CASP-like protein 1U1
Source.5237: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.5238: DFBPPR7929 ---- Plant protein ---- Photosystem II protein D1
Source.5239: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.5240: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.5241: DFBPPR7935 ---- Plant protein ---- Cytochrome b
Source.5242: DFBPPR7946 ---- Plant protein ---- Aquaporin PIP1.1
Source.5243: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.5244: DFBPPR7977 ---- Plant protein ---- Ribosomal protein S14, mitochondrial
Source.5245: DFBPPR7987 ---- Plant protein ---- Antifungal protein ginkbilobin-2
Source.5246: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5247: DFBPPR8009 ---- Plant protein ---- CASP-like protein 5B1
Source.5248: DFBPPR8031 ---- Plant protein ---- Photosystem II protein D1
Source.5249: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5250: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.5251: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.5252: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha
Source.5253: DFBPPR8063 ---- Plant protein ---- Leghemoglobin A
Source.5254: DFBPPR8099 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.5255: DFBPPR8100 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.5256: DFBPPR8105 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.5257: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.5258: DFBPPR8125 ---- Plant protein ---- Eukaryotic translation initiation factor 5
Source.5259: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase
Source.5260: DFBPPR8216 ---- Plant protein ---- Photosystem II protein D1
Source.5261: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5262: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.5263: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.5264: DFBPPR8268 ---- Plant protein ---- ATP synthase subunit beta, chloroplastic
Source.5265: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.5266: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.5267: DFBPPR8281 ---- Plant protein ---- 30S ribosomal protein S7, chloroplastic
Source.5268: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.5269: DFBPPR8286 ---- Plant protein ---- Oleosin
Source.5270: DFBPPR8289 ---- Plant protein ---- ATP synthase subunit b, chloroplastic
Source.5271: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.5272: DFBPPR8317 ---- Plant protein ---- Casparian strip membrane protein 1
Source.5273: DFBPPR8344 ---- Plant protein ---- Cytochrome c oxidase subunit 5C-1
Source.5274: DFBPPR8345 ---- Plant protein ---- Cytochrome c oxidase subunit 5C-2
Source.5275: DFBPPR8355 ---- Plant protein ---- 14-3-3-like protein
Link-research
Link 1: DFBPACEI0584----Maize crops----α-Zein
Biological/Functional activity & target protein
ACE-inhibitory activity

Amaranth trypsin-digested glutelins induce endothelial NO production and consequent vasodilation through their ACE-inhibitory activity. The peptide LAA was isolated from the highest active fraction, so the peptide was a potential Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory peptide (No valid IC50 value was determined in this study).

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Non-bitter taste prediction
SMILES N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydrolysis

Enzyme(s)/starter culture

Native amaranth glutelins were digested with trypsin (Sigma-Aldrich, St. Louis, MO, USA) at an enzyme/substrate ratio of 1:10 (w/w) for 10 h at 37 ℃.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

Amaranth trypsin-digested glutelins have a high potential as a nutraceutical food in prevention of cardiovascular diseases.

Database cross-references
BIOPEP-UWM [D1] 3539
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature de la Rosa AP, Montoya AB, Martínez-Cuevas P, Hernández-Ledesma B, León-Galván MF, De León-Rodríguez A, González C. Tryptic amaranth glutelin digests induce endothelial nitric oxide production through inhibition of ACE: antihypertensive role of amaranth peptides. Nitric Oxide. 2010 Sep 15;23(2):106-11.
PMID: 20435155
Other literature(s)

[1] Miyoshi S, Ishikawa H, Kaneko T, et al. Structures and activity of angiotensin-converting enzyme inhibitors in an alpha-zein hydrolysate.[J]. Journal of the Agricultural Chemical Society of Japan, 1991, 55(5):1313.

PubDate 2010
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214