E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI1932(ACE-inhibitory peptide)
DFBP ID DFBPACEI1932
Peptide sequence VLP
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity PEP-inhibitory activity [D1], Multifunctional activity [D2]
Calculated physicochemical properties
Three-letter amino acid Val-Leu-Pro
Single-letter amino acid VLP
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 327.42 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 N.D
pIC50 N.D
GRAVY 2.1333 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Amaranth seed proteins
Precursor protein Amaranth glutelins
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0388 ---- Plant protein ---- Low molecular weight glutenin subunit
Source.3: DFBPPR0808 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA8
Source.4: DFBPPR0814 ---- Plant proteins ---- Protein PAIR1
Source.5: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1
Source.6: DFBPPR0840 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 2
Source.7: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.8: DFBPPR0847 ---- Plant proteins ---- Strigolactone esterase D14
Source.9: DFBPPR0852 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO1
Source.10: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.11: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.12: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18
Source.13: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46
Source.14: DFBPPR0864 ---- Plant proteins ---- Growth-regulating factor 4
Source.15: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.16: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.17: DFBPPR0914 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.18: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.19: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1
Source.20: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.21: DFBPPR0935 ---- Plant proteins ---- Cytochrome P450 724B1
Source.22: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.23: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.24: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.25: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.26: DFBPPR0967 ---- Plant proteins ---- Receptor kinase-like protein Xa21
Source.27: DFBPPR0971 ---- Plant proteins ---- Protein STAR1
Source.28: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.29: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1
Source.30: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.31: DFBPPR0997 ---- Plant proteins ---- Tricin synthase 1
Source.32: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.33: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.34: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.35: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic
Source.36: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4
Source.37: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.38: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.39: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24
Source.40: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.41: DFBPPR1084 ---- Plant proteins ---- Protein AUXIN-REGULATED GENE INVOLVED IN ORGAN SIZE
Source.42: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.43: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB
Source.44: DFBPPR1102 ---- Plant proteins ---- APETALA2-like protein 3
Source.45: DFBPPR1113 ---- Plant proteins ---- Elongator complex protein 3
Source.46: DFBPPR1115 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.3
Source.47: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B
Source.48: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13
Source.49: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.50: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.51: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A
Source.52: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.53: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.54: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.55: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.56: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.57: DFBPPR1212 ---- Plant proteins ---- 9-beta-pimara-7,15-diene oxidase
Source.58: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10
Source.59: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.60: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1
Source.61: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.62: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.63: DFBPPR1279 ---- Plant proteins ---- Homeobox protein HAZ1
Source.64: DFBPPR1285 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.65: DFBPPR1308 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 4
Source.66: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.67: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d
Source.68: DFBPPR1330 ---- Plant proteins ---- Probable bifunctional riboflavin biosynthesis protein RIBA 2, chloroplastic
Source.69: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.70: DFBPPR1338 ---- Plant proteins ---- Fe(2+) transport protein 1
Source.71: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1
Source.72: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.73: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.74: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.75: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.76: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.77: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.78: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.79: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.80: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.81: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.82: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.83: DFBPPR1391 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT3
Source.84: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.85: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic
Source.86: DFBPPR1398 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC1
Source.87: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.88: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.89: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.90: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.91: DFBPPR1448 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO5
Source.92: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.93: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8
Source.94: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.95: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.96: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic
Source.97: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.98: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.99: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein
Source.100: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.101: DFBPPR1519 ---- Plant proteins ---- Histone H2B.1
Source.102: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1
Source.103: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.104: DFBPPR1530 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.105: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5
Source.106: DFBPPR1555 ---- Plant proteins ---- Cytochrome P450 734A6
Source.107: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80
Source.108: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.109: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.110: DFBPPR1570 ---- Plant proteins ---- MEIOTIC F-BOX protein MOF
Source.111: DFBPPR1579 ---- Plant proteins ---- O-methyltransferase 1, chloroplastic
Source.112: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.113: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic
Source.114: DFBPPR1599 ---- Plant proteins ---- Adenylosuccinate synthetase 2, chloroplastic
Source.115: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.116: DFBPPR1618 ---- Plant proteins ---- Heat stress transcription factor C-1a
Source.117: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.118: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.119: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.120: DFBPPR1652 ---- Plant proteins ---- Photosystem II D2 protein
Source.121: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.122: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.123: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.124: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7
Source.125: DFBPPR1681 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.126: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.127: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.128: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.129: DFBPPR1714 ---- Plant proteins ---- Protein MAO HUZI 4, chloroplastic
Source.130: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.131: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.132: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.133: DFBPPR1731 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA4
Source.134: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1
Source.135: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.136: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.137: DFBPPR1742 ---- Plant proteins ---- Fe(2+) transport protein 2
Source.138: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.139: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2
Source.140: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial
Source.141: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic
Source.142: DFBPPR1763 ---- Plant proteins ---- E3 ubiquitin-protein ligase SRFP1
Source.143: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.144: DFBPPR1765 ---- Plant proteins ---- Transcription factor MYC2
Source.145: DFBPPR1768 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase RZFP34
Source.146: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1
Source.147: DFBPPR1776 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.148: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A
Source.149: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.150: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.151: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.152: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic
Source.153: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.154: DFBPPR1828 ---- Plant proteins ---- Sphingosine-1-phosphate lyase
Source.155: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.156: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.157: DFBPPR1847 ---- Plant proteins ---- Amidase 1
Source.158: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.159: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.160: DFBPPR1854 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.161: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.162: DFBPPR1861 ---- Plant proteins ---- Laccase-25
Source.163: DFBPPR1864 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.164: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.165: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.166: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4
Source.167: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.168: DFBPPR1883 ---- Plant proteins ---- Histone H2B.7
Source.169: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.170: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.171: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.172: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.173: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.174: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.175: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10
Source.176: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.177: DFBPPR1934 ---- Plant proteins ---- Histone H2B.4
Source.178: DFBPPR1935 ---- Plant proteins ---- Zinc transporter 3
Source.179: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.180: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.181: DFBPPR1945 ---- Plant proteins ---- Histone H2B.2
Source.182: DFBPPR1952 ---- Plant proteins ---- CBL-interacting protein kinase 1
Source.183: DFBPPR1953 ---- Plant proteins ---- CBL-interacting protein kinase 17
Source.184: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.185: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.186: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.187: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2
Source.188: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.189: DFBPPR1966 ---- Plant proteins ---- Histone H2B.3
Source.190: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3
Source.191: DFBPPR1977 ---- Plant proteins ---- Histone H2B.8
Source.192: DFBPPR1982 ---- Plant proteins ---- Histone H2B.6
Source.193: DFBPPR1983 ---- Plant proteins ---- Histone H2B.11
Source.194: DFBPPR1984 ---- Plant proteins ---- Histone H2B.10
Source.195: DFBPPR1986 ---- Plant proteins ---- Histone H2B.5
Source.196: DFBPPR1993 ---- Plant proteins ---- Histone H2B.9
Source.197: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.198: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B
Source.199: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60
Source.200: DFBPPR2003 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic
Source.201: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.202: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.203: DFBPPR2027 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.204: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.205: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.206: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.207: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.208: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2
Source.209: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.210: DFBPPR2075 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.211: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9
Source.212: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic
Source.213: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1
Source.214: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5
Source.215: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.216: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.217: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.218: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic
Source.219: DFBPPR2134 ---- Plant proteins ---- Alpha-amylase/subtilisin inhibitor
Source.220: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.221: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.222: DFBPPR2144 ---- Plant proteins ---- 1-deoxy-D-xylulose 5-phosphate reductoisomerase, chloroplastic
Source.223: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.224: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.225: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.226: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.227: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.228: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.229: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4
Source.230: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1
Source.231: DFBPPR2199 ---- Plant proteins ---- 18.0 kDa class II heat shock protein
Source.232: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.233: DFBPPR2209 ---- Plant proteins ---- Succinate dehydrogenase subunit 4, mitochondrial
Source.234: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.235: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.236: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.237: DFBPPR2223 ---- Plant proteins ---- Urease
Source.238: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.239: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.240: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.241: DFBPPR2272 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 2
Source.242: DFBPPR2287 ---- Plant proteins ---- Dof zinc finger protein 3
Source.243: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.244: DFBPPR2310 ---- Plant proteins ---- Heat stress transcription factor A-3
Source.245: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.246: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2
Source.247: DFBPPR2321 ---- Plant proteins ---- Aspartate carbamoyltransferase, chloroplastic
Source.248: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.249: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.250: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic
Source.251: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.252: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic
Source.253: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.254: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1
Source.255: DFBPPR2389 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-1
Source.256: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.257: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.258: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.259: DFBPPR2398 ---- Plant proteins ---- Cytochrome b6
Source.260: DFBPPR2408 ---- Plant proteins ---- Cytochrome f
Source.261: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2
Source.262: DFBPPR2412 ---- Plant proteins ---- Cytochrome P450 99A2
Source.263: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.264: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1
Source.265: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic
Source.266: DFBPPR2423 ---- Plant proteins ---- Auxin response factor 16
Source.267: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.268: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.269: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic
Source.270: DFBPPR2453 ---- Plant proteins ---- Dihydroorotase, mitochondrial
Source.271: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.272: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.273: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase
Source.274: DFBPPR2481 ---- Plant proteins ---- Tryptophan decarboxylase 1
Source.275: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.276: DFBPPR2484 ---- Plant proteins ---- Translation factor GUF1 homolog, mitochondrial
Source.277: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2
Source.278: DFBPPR2489 ---- Plant proteins ---- Nicotianamine aminotransferase 1
Source.279: DFBPPR2503 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1A
Source.280: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic
Source.281: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.282: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.283: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.284: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta
Source.285: DFBPPR2547 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 3, chloroplastic
Source.286: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.287: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.288: DFBPPR2566 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 4
Source.289: DFBPPR2573 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os03g0188200
Source.290: DFBPPR2583 ---- Plant proteins ---- Thioredoxin-like 2, chloroplastic
Source.291: DFBPPR2584 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1
Source.292: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.293: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.294: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase
Source.295: DFBPPR2605 ---- Plant proteins ---- Clathrin light chain 2
Source.296: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.297: DFBPPR2617 ---- Plant proteins ---- Clathrin light chain 3
Source.298: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.299: DFBPPR2621 ---- Plant proteins ---- Germin-like protein 4-1
Source.300: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.301: DFBPPR2678 ---- Plant proteins ---- Thioredoxin-like 1-2, chloroplastic
Source.302: DFBPPR2681 ---- Plant proteins ---- Probable histone H2A.6
Source.303: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.304: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.305: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.306: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.307: DFBPPR2723 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 1B
Source.308: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit
Source.309: DFBPPR2730 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL5
Source.310: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.311: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.312: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7
Source.313: DFBPPR2761 ---- Plant proteins ---- Ent-kaurene synthase-like 3
Source.314: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.315: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.316: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.317: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.318: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.319: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1
Source.320: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2
Source.321: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.322: DFBPPR2801 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 21
Source.323: DFBPPR2803 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 5
Source.324: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.325: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.326: DFBPPR2813 ---- Plant proteins ---- Ferrochelatase-1, chloroplastic
Source.327: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35
Source.328: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36
Source.329: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.330: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.331: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.332: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.333: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.334: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2
Source.335: DFBPPR2872 ---- Plant proteins ---- Tryptophan decarboxylase 2
Source.336: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.337: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c
Source.338: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.339: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.340: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5
Source.341: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.342: DFBPPR2966 ---- Plant proteins ---- Probable histone H2A.5
Source.343: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.344: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.345: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic
Source.346: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog
Source.347: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B
Source.348: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.349: DFBPPR3042 ---- Plant proteins ---- Deoxyuridine 5'-triphosphate nucleotidohydrolase
Source.350: DFBPPR3046 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35B
Source.351: DFBPPR3051 ---- Plant proteins ---- Protein YABBY 3
Source.352: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.353: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.354: DFBPPR3072 ---- Plant proteins ---- Probable histone H2A.4
Source.355: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.356: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.357: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.358: DFBPPR3082 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE2
Source.359: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.360: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.361: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2
Source.362: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.363: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.364: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.365: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial
Source.366: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.367: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.368: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.369: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.370: DFBPPR3137 ---- Plant proteins ---- Transcription factor PCF5
Source.371: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.372: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.373: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.374: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.375: DFBPPR3185 ---- Plant proteins ---- Acyl transferase 10
Source.376: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.377: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1
Source.378: DFBPPR3197 ---- Plant proteins ---- Germin-like protein 11-1
Source.379: DFBPPR3200 ---- Plant proteins ---- Two-component response regulator ORR11
Source.380: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.381: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic
Source.382: DFBPPR3217 ---- Plant proteins ---- Probable glucuronosyltransferase Os02g0520750
Source.383: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.384: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7
Source.385: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.386: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26
Source.387: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.388: DFBPPR3255 ---- Plant proteins ---- COBRA-like protein 6
Source.389: DFBPPR3258 ---- Plant proteins ---- Squamosa promoter-binding-like protein 3
Source.390: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b
Source.391: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.392: DFBPPR3286 ---- Plant proteins ---- Expansin-A32
Source.393: DFBPPR3289 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3b
Source.394: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.395: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1
Source.396: DFBPPR3316 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 7
Source.397: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2
Source.398: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8
Source.399: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6
Source.400: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.401: DFBPPR3381 ---- Plant proteins ---- GATA transcription factor 18
Source.402: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.403: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.404: DFBPPR3413 ---- Plant proteins ---- Probable histone H2AXa
Source.405: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.406: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.407: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.408: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic
Source.409: DFBPPR3435 ---- Plant proteins ---- Probable protein phosphatase 2C 49
Source.410: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F
Source.411: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.412: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1
Source.413: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.414: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.415: DFBPPR3452 ---- Plant proteins ---- Eukaryotic translation initiation factor 3 subunit K
Source.416: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.417: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1
Source.418: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.419: DFBPPR3473 ---- Plant proteins ---- Probable glucuronosyltransferase Os04g0398600
Source.420: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1
Source.421: DFBPPR3488 ---- Plant proteins ---- GATA transcription factor 19
Source.422: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.423: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600
Source.424: DFBPPR3506 ---- Plant proteins ---- Growth-regulating factor 12
Source.425: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.426: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8
Source.427: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic
Source.428: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.429: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2
Source.430: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3
Source.431: DFBPPR3609 ---- Plant proteins ---- Thioredoxin-like 1-1, chloroplastic
Source.432: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.433: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6
Source.434: DFBPPR3632 ---- Plant proteins ---- Probable linoleate 9S-lipoxygenase 4
Source.435: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3
Source.436: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.437: DFBPPR3649 ---- Plant proteins ---- Cyclin-dependent kinases regulatory subunit 1
Source.438: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.439: DFBPPR3680 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.440: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.441: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.442: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.443: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3
Source.444: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.445: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog
Source.446: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.447: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.448: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3
Source.449: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77
Source.450: DFBPPR3800 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 1
Source.451: DFBPPR3807 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.452: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.453: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4
Source.454: DFBPPR3850 ---- Plant proteins ---- Probable protein phosphatase 2C 73
Source.455: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8
Source.456: DFBPPR3858 ---- Plant proteins ---- Putative protein phosphatase 2C 46
Source.457: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23
Source.458: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.459: DFBPPR3878 ---- Plant proteins ---- Growth-regulating factor 10
Source.460: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.461: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.462: DFBPPR3903 ---- Plant proteins ---- 60S ribosomal protein L2, mitochondrial
Source.463: DFBPPR3909 ---- Plant proteins ---- LIM domain-containing protein PLIM2b
Source.464: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4
Source.465: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1
Source.466: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.467: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.468: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.469: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.470: DFBPPR3962 ---- Plant proteins ---- Myb-related protein MYBAS2
Source.471: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.472: DFBPPR3964 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 1
Source.473: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.474: DFBPPR3971 ---- Plant proteins ---- WUSCHEL-related homeobox 12
Source.475: DFBPPR3974 ---- Plant proteins ---- Ent-kaurene synthase-like 2
Source.476: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.477: DFBPPR3978 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 2
Source.478: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5
Source.479: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.480: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7
Source.481: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.482: DFBPPR4024 ---- Plant proteins ---- Cytochrome c-type biogenesis ccda-like chloroplastic protein 1
Source.483: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.484: DFBPPR4044 ---- Plant proteins ---- SPX domain-containing protein 6
Source.485: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69
Source.486: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.487: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.488: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.489: DFBPPR4066 ---- Plant proteins ---- Pescadillo homolog
Source.490: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C
Source.491: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.492: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic
Source.493: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.494: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8
Source.495: DFBPPR4085 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 8
Source.496: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.497: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.498: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.499: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.500: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4
Source.501: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.502: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5
Source.503: DFBPPR4141 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 6
Source.504: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6
Source.505: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.506: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.507: DFBPPR4171 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 4
Source.508: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.509: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.510: DFBPPR4189 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.511: DFBPPR4205 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 24
Source.512: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.513: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.514: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.515: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5
Source.516: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H
Source.517: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.518: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4
Source.519: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.520: DFBPPR4259 ---- Plant proteins ---- Probable inactive methyltransferase Os04g0175900
Source.521: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.522: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP
Source.523: DFBPPR4279 ---- Plant proteins ---- Protein BZR1 homolog 4
Source.524: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3
Source.525: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.526: DFBPPR4284 ---- Plant proteins ---- Protein IN2-1 homolog B
Source.527: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.528: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D
Source.529: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5
Source.530: DFBPPR4300 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 10
Source.531: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16
Source.532: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1
Source.533: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.534: DFBPPR4365 ---- Plant proteins ---- Formin-like protein 10
Source.535: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10
Source.536: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.537: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.538: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2
Source.539: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2
Source.540: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5
Source.541: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic
Source.542: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.543: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9
Source.544: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5
Source.545: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.546: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.547: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.548: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.549: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1
Source.550: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic
Source.551: DFBPPR4469 ---- Plant proteins ---- Protein argonaute 11
Source.552: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2
Source.553: DFBPPR4475 ---- Plant proteins ---- Protein argonaute 14
Source.554: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.555: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.556: DFBPPR4484 ---- Plant proteins ---- Protein argonaute 12
Source.557: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2
Source.558: DFBPPR4508 ---- Plant proteins ---- Photosystem II stability/assembly factor HCF136, chloroplastic
Source.559: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.560: DFBPPR4526 ---- Plant proteins ---- BURP domain-containing protein 14
Source.561: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6
Source.562: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.563: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.564: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.565: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D
Source.566: DFBPPR4585 ---- Plant proteins ---- Protein MEI2-like 4
Source.567: DFBPPR4586 ---- Plant proteins ---- Protein MEI2-like 2
Source.568: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.569: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39
Source.570: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.571: DFBPPR4609 ---- Plant proteins ---- BURP domain-containing protein 16
Source.572: DFBPPR4611 ---- Plant proteins ---- SPX domain-containing membrane protein Os02g45520
Source.573: DFBPPR4616 ---- Plant proteins ---- BURP domain-containing protein 4
Source.574: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700
Source.575: DFBPPR4640 ---- Plant proteins ---- Protein Brevis radix-like 4
Source.576: DFBPPR4648 ---- Plant proteins ---- SPX domain-containing membrane protein Os04g0573000
Source.577: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800
Source.578: DFBPPR4660 ---- Plant proteins ---- Transcription factor ILI2
Source.579: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24
Source.580: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.581: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.582: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.583: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic
Source.584: DFBPPR4695 ---- Plant proteins ---- SNW/SKI-interacting protein B
Source.585: DFBPPR4705 ---- Plant proteins ---- 40S ribosomal protein S26
Source.586: DFBPPR4709 ---- Plant proteins ---- Protein argonaute 17
Source.587: DFBPPR4715 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 2
Source.588: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5
Source.589: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700
Source.590: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.591: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700
Source.592: DFBPPR4735 ---- Plant proteins ---- Uncharacterized protein Os08g0218700/LOC_Os08g12160
Source.593: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9
Source.594: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.595: DFBPPR4757 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 13
Source.596: DFBPPR4761 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 13
Source.597: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35
Source.598: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.599: DFBPPR4785 ---- Plant proteins ---- B3 domain-containing protein Os04g0386900
Source.600: DFBPPR4832 ---- Plant proteins ---- Protein GOS9
Source.601: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56
Source.602: DFBPPR4848 ---- Plant proteins ---- B3 domain-containing protein Os02g0455800
Source.603: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.604: DFBPPR4858 ---- Plant proteins ---- B3 domain-containing protein Os12g0591400
Source.605: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37
Source.606: DFBPPR4866 ---- Plant proteins ---- Putative B3 domain-containing protein Os02g0455900
Source.607: DFBPPR4885 ---- Plant proteins ---- REF/SRPP-like protein Os05g0151300/LOC_Os05g05940
Source.608: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic
Source.609: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.610: DFBPPR4905 ---- Plant proteins ---- Light-regulated protein, chloroplastic
Source.611: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.612: DFBPPR4922 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, cytoplasmic
Source.613: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11
Source.614: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.615: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1
Source.616: DFBPPR4949 ---- Plant proteins ---- Probable histone H2AXb
Source.617: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.618: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.619: DFBPPR4977 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein CLV1B
Source.620: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.621: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.622: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.623: DFBPPR5003 ---- Plant proteins ---- Probable glutathione S-transferase
Source.624: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.625: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.626: DFBPPR5014 ---- Plant proteins ---- Glycinol 4-dimethylallyltransferase
Source.627: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin
Source.628: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase
Source.629: DFBPPR5034 ---- Plant proteins ---- 15-cis-phytoene desaturase, chloroplastic/chromoplastic
Source.630: DFBPPR5037 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.631: DFBPPR5039 ---- Plant proteins ---- Catalase-1/2
Source.632: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D
Source.633: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.634: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.635: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.636: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.637: DFBPPR5063 ---- Plant proteins ---- Photosystem II D2 protein
Source.638: DFBPPR5086 ---- Plant proteins ---- Catalase-3
Source.639: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.640: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7
Source.641: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.642: DFBPPR5137 ---- Plant proteins ---- Cytochrome f
Source.643: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2
Source.644: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.645: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.646: DFBPPR5176 ---- Plant proteins ---- Cytochrome b6
Source.647: DFBPPR5177 ---- Plant proteins ---- Anamorsin homolog
Source.648: DFBPPR5225 ---- Plant proteins ---- Soyasapogenol B glucuronide galactosyltransferase
Source.649: DFBPPR5234 ---- Plant proteins ---- 17.9 kDa class II heat shock protein
Source.650: DFBPPR5252 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.651: DFBPPR5276 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.652: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.653: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.654: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2
Source.655: DFBPPR5319 ---- Plant proteins ---- Nodulin-22
Source.656: DFBPPR5336 ---- Plant proteins ---- Nodulin-26B
Source.657: DFBPPR5352 ---- Plant proteins ---- Nodulin-27
Source.658: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.659: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.660: DFBPPR5390 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase 1, chloroplastic
Source.661: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.662: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.663: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.664: DFBPPR5421 ---- Plant proteins ---- Pyruvate, phosphate dikinase regulatory protein, chloroplastic
Source.665: DFBPPR5423 ---- Plant proteins ---- Ribonuclease III domain-containing protein RNC1, chloroplastic
Source.666: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit
Source.667: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2
Source.668: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.669: DFBPPR5440 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-1
Source.670: DFBPPR5459 ---- Plant proteins ---- Adenylyltransferase and sulfurtransferase MOCS3-2
Source.671: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.672: DFBPPR5472 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 3, cytosolic
Source.673: DFBPPR5474 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.674: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1
Source.675: DFBPPR5476 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.676: DFBPPR5477 ---- Plant proteins ---- Photosystem II D2 protein
Source.677: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.678: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.679: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.680: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase
Source.681: DFBPPR5505 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme
Source.682: DFBPPR5516 ---- Plant proteins ---- Inositol 3-kinase
Source.683: DFBPPR5523 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.684: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.685: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.686: DFBPPR5558 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic
Source.687: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.688: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.689: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.690: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.691: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.692: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.693: DFBPPR5597 ---- Plant proteins ---- Cytochrome b6
Source.694: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3
Source.695: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.696: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.697: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.698: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9
Source.699: DFBPPR5631 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.700: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.701: DFBPPR5638 ---- Plant proteins ---- Histone H2B.5
Source.702: DFBPPR5639 ---- Plant proteins ---- Histone H2B.1
Source.703: DFBPPR5640 ---- Plant proteins ---- Histone H2B.4
Source.704: DFBPPR5641 ---- Plant proteins ---- Histone H2B.2
Source.705: DFBPPR5646 ---- Plant proteins ---- Ferredoxin--nitrite reductase, chloroplastic
Source.706: DFBPPR5650 ---- Plant proteins ---- Enolase 1
Source.707: DFBPPR5653 ---- Plant proteins ---- Inosine triphosphate pyrophosphatase
Source.708: DFBPPR5656 ---- Plant proteins ---- Histone H2B.3
Source.709: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.710: DFBPPR5661 ---- Plant proteins ---- Albumin b-32
Source.711: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.712: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.713: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein
Source.714: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.715: DFBPPR5718 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.716: DFBPPR5762 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.717: DFBPPR5764 ---- Plant proteins ---- Cysteine proteinase 1
Source.718: DFBPPR5765 ---- Plant proteins ---- Homeobox protein HOX1A
Source.719: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.720: DFBPPR5770 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 1
Source.721: DFBPPR5775 ---- Plant proteins ---- Caffeoyl-CoA O-methyltransferase 2
Source.722: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1
Source.723: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic
Source.724: DFBPPR5802 ---- Plant proteins ---- Dof zinc finger protein PBF
Source.725: DFBPPR5807 ---- Plant proteins ---- Histone H2A
Source.726: DFBPPR5813 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 2
Source.727: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.728: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic
Source.729: DFBPPR5828 ---- Plant proteins ---- Cytochrome f
Source.730: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.731: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.732: DFBPPR5832 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 3
Source.733: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.734: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3
Source.735: DFBPPR5853 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.736: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.737: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.738: DFBPPR5888 ---- Plant proteins ---- 17.0 kDa class II heat shock protein
Source.739: DFBPPR5893 ---- Plant proteins ---- Oxygen-evolving enhancer protein 3-1, chloroplastic
Source.740: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2
Source.741: DFBPPR5932 ---- Plant proteins ---- Probable glutathione S-transferase BZ2
Source.742: DFBPPR5936 ---- Plant proteins ---- Indole-3-acetate beta-glucosyltransferase
Source.743: DFBPPR5950 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.744: DFBPPR5962 ---- Plant proteins ---- Protein RIK
Source.745: DFBPPR5975 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.746: DFBPPR5981 ---- Plant proteins ---- 17.8 kDa class II heat shock protein
Source.747: DFBPPR5994 ---- Plant proteins ---- 17.5 kDa class II heat shock protein
Source.748: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic
Source.749: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.750: DFBPPR6037 ---- Plant proteins ---- 19 kDa alpha-zein 19C2
Source.751: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.752: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.753: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.754: DFBPPR6089 ---- Plant proteins ---- Cell number regulator 6
Source.755: DFBPPR6093 ---- Plant proteins ---- Zein-alpha 19C1
Source.756: DFBPPR6095 ---- Plant proteins ---- Zein-alpha A20
Source.757: DFBPPR6101 ---- Plant proteins ---- Zein-alpha M6
Source.758: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA
Source.759: DFBPPR6218 ---- Plant proteins ---- Translocase of chloroplast 34
Source.760: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.761: DFBPPR6226 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.762: DFBPPR6232 ---- Plant proteins ---- Photosystem II D2 protein
Source.763: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.764: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.765: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.766: DFBPPR6262 ---- Plant proteins ---- Nodule lectin
Source.767: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.768: DFBPPR6292 ---- Plant proteins ---- Probable ion channel SYM8
Source.769: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic
Source.770: DFBPPR6294 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase A, chloroplastic
Source.771: DFBPPR6300 ---- Plant proteins ---- Strigolactone esterase RMS3
Source.772: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.773: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.774: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic
Source.775: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic
Source.776: DFBPPR6318 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.777: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.778: DFBPPR6329 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic
Source.779: DFBPPR6337 ---- Plant proteins ---- Histone H2A.1
Source.780: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.781: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.782: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.783: DFBPPR6386 ---- Plant proteins ---- ATP synthase subunit delta', mitochondrial
Source.784: DFBPPR6391 ---- Plant proteins ---- Cytochrome b6
Source.785: DFBPPR6392 ---- Plant proteins ---- Cytochrome f
Source.786: DFBPPR6395 ---- Plant proteins ---- Histone H2A.2
Source.787: DFBPPR6477 ---- Plant proteins ---- 50S ribosomal protein L15, chloroplastic
Source.788: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.789: DFBPPR6485 ---- Plant proteins ---- Fructose-bisphosphate aldolase, cytoplasmic isozyme 2
Source.790: DFBPPR6491 ---- Plant proteins ---- Early nodulin-5
Source.791: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.792: DFBPPR6515 ---- Plant proteins ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.793: DFBPPR6518 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.794: DFBPPR6521 ---- Plant proteins ---- Pyrroline-5-carboxylate reductase
Source.795: DFBPPR6540 ---- Plant proteins ---- Non-seed lectin
Source.796: DFBPPR6578 ---- Plant proteins ---- 17.1 kDa class II heat shock protein
Source.797: DFBPPR6579 ---- Plant proteins ---- 17.1 kDa class II heat shock protein
Source.798: DFBPPR6580 ---- Plant proteins ---- 17.1 kDa class II heat shock protein
Source.799: DFBPPR6626 ---- Plant proteins ---- Alpha-amylase inhibitor 0.28
Source.800: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.801: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.802: DFBPPR6660 ---- Plant proteins ---- Histone H2B.2
Source.803: DFBPPR6662 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 2, chloroplastic
Source.804: DFBPPR6663 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase 1, chloroplastic
Source.805: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.806: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic
Source.807: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.808: DFBPPR6681 ---- Plant proteins ---- Histone H2B.4
Source.809: DFBPPR6684 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor WSCI
Source.810: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.811: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase
Source.812: DFBPPR6704 ---- Plant proteins ---- Histone H2B.1
Source.813: DFBPPR6707 ---- Plant proteins ---- Glutathione gamma-glutamylcysteinyltransferase 1
Source.814: DFBPPR6710 ---- Plant proteins ---- Photosystem II D2 protein
Source.815: DFBPPR6711 ---- Plant proteins ---- Histone H2B.5
Source.816: DFBPPR6714 ---- Plant proteins ---- Histone H2B.3
Source.817: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.818: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.819: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.820: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.821: DFBPPR6777 ---- Plant proteins ---- Cytochrome b6
Source.822: DFBPPR6805 ---- Plant proteins ---- Cytochrome f
Source.823: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.824: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.825: DFBPPR6823 ---- Plant proteins ---- Splicing factor U2af large subunit B
Source.826: DFBPPR6824 ---- Plant proteins ---- Protein RAFTIN 1B
Source.827: DFBPPR6845 ---- Plant proteins ---- Protein RAFTIN 1A
Source.828: DFBPPR6858 ---- Plant proteins ---- Glutenin, low molecular weight subunit 1D1
Source.829: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.830: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.831: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.832: DFBPPR6884 ---- Plant proteins ---- Endogenous alpha-amylase/subtilisin inhibitor
Source.833: DFBPPR6890 ---- Plant proteins ---- Glutenin, low molecular weight subunit PTDUCD1
Source.834: DFBPPR6902 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.835: DFBPPR6972 ---- Plant proteins ---- Gamma-gliadin B-I
Source.836: DFBPPR7003 ---- Plant proteins ---- Protein RAFTIN 1C
Source.837: DFBPPR7015 ---- Plant proteins ---- Phytepsin
Source.838: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic
Source.839: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.840: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.841: DFBPPR7052 ---- Plant proteins ---- Protein synthesis inhibitor II
Source.842: DFBPPR7054 ---- Plant proteins ---- Photosystem II D2 protein
Source.843: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.844: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.845: DFBPPR7072 ---- Plant proteins ---- Protein synthesis inhibitor I
Source.846: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.847: DFBPPR7103 ---- Plant proteins ---- Delta-aminolevulinic acid dehydratase, chloroplastic
Source.848: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.849: DFBPPR7109 ---- Plant proteins ---- Cytochrome b6
Source.850: DFBPPR7120 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic
Source.851: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.852: DFBPPR7123 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 1, cytosolic
Source.853: DFBPPR7130 ---- Plant proteins ---- Nicotianamine aminotransferase A
Source.854: DFBPPR7141 ---- Plant proteins ---- Nicotianamine aminotransferase B
Source.855: DFBPPR7145 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.856: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.857: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.858: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3
Source.859: DFBPPR7155 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.860: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.861: DFBPPR7175 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor-2A
Source.862: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.863: DFBPPR7181 ---- Plant proteins ---- Putative glucan endo-1,3-beta-glucosidase GVI
Source.864: DFBPPR7194 ---- Plant proteins ---- Cytochrome f
Source.865: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.866: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.867: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic
Source.868: DFBPPR7265 ---- Plant proteins ---- Gamma-hordein-3
Source.869: DFBPPR7266 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.870: DFBPPR7277 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor-2B
Source.871: DFBPPR7395 ---- Plant proteins ---- Enoyl-[acyl-carrier-protein] reductase [NADH], chloroplastic
Source.872: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic
Source.873: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.874: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.875: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.876: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4
Source.877: DFBPPR7417 ---- Plant proteins ---- Cruciferin
Source.878: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.879: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.880: DFBPPR7444 ---- Plant proteins ---- Cruciferin BnC2
Source.881: DFBPPR7445 ---- Plant proteins ---- Cruciferin CRU1
Source.882: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1
Source.883: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.884: DFBPPR7533 ---- Plant proteins ---- Tapetum-specific protein A9
Source.885: DFBPPR7605 ---- Milk proteins ---- Beta-casein
Source.886: DFBPPR7610 ---- Milk proteins ---- Immunoglobulin heavy constant alpha 2
Source.887: DFBPPR7623 ---- Milk proteins ---- Platelet glycoprotein 4
Source.888: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.889: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.890: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor
Source.891: DFBPPR7665 ---- Milk proteins ---- Beta-casein
Source.892: DFBPPR7673 ---- Milk proteins ---- Kappa-casein
Source.893: DFBPPR7686 ---- Milk proteins ---- Kappa-casein
Source.894: DFBPPR7692 ---- Milk proteins ---- Beta-casein
Source.895: DFBPPR7695 ---- Milk proteins ---- Kappa-casein
Source.896: DFBPPR7700 ---- Milk proteins ---- Beta-casein
Source.897: DFBPPR7706 ---- Milk proteins ---- Beta-casein
Source.898: DFBPPR7715 ---- Milk proteins ---- Kappa-casein
Source.899: DFBPPR7718 ---- Milk proteins ---- Beta-casein
Source.900: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.901: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.902: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.903: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.904: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.905: DFBPPR8379 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 1
Source.906: DFBPPR8380 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 2
Source.907: DFBPPR8402 ---- Plant proteins ---- Allergen Ara h 1, clone P41B
Source.908: DFBPPR8409 ---- Plant proteins ---- Allergen Ara h 1, clone P17
Source.909: DFBPPR8453 ---- Plant proteins ---- Photosystem II D2 protein
Source.910: DFBPPR8489 ---- Milk proteins ---- Beta-casein
Source.911: DFBPPR8517 ---- Milk proteins ---- Cathepsin D
Source.912: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2
Source.913: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.914: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.915: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.916: DFBPPR15965 ---- Animal proteins ---- Dystroglycan
Source.917: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.918: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.919: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.920: DFBPPR15994 ---- Animal proteins ---- Inactive pancreatic lipase-related protein 1
Source.921: DFBPPR16007 ---- Animal proteins ---- Myocilin
Source.922: DFBPPR16016 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.923: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.924: DFBPPR16042 ---- Animal proteins ---- Caveolin-2
Source.925: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.926: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.927: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.928: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.929: DFBPPR16085 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-2
Source.930: DFBPPR16086 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.931: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.932: DFBPPR16116 ---- Animal proteins ---- Kit ligand
Source.933: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.934: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4
Source.935: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.936: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.937: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.938: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.939: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.940: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.941: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.942: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.943: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.944: DFBPPR16190 ---- Animal proteins ---- Aprataxin
Source.945: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.946: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.947: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.948: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.949: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.950: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.951: DFBPPR16227 ---- Animal proteins ---- Myelin proteolipid protein
Source.952: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.953: DFBPPR16231 ---- Animal proteins ---- Induced myeloid leukemia cell differentiation protein Mcl-1 homolog
Source.954: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.955: DFBPPR16279 ---- Animal proteins ---- Galactokinase
Source.956: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.957: DFBPPR16293 ---- Animal proteins ---- Baculoviral IAP repeat-containing protein 3
Source.958: DFBPPR16305 ---- Animal proteins ---- Phosducin
Source.959: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.960: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.961: DFBPPR16344 ---- Animal proteins ---- Prostaglandin E2 receptor EP2 subtype
Source.962: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.963: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.964: DFBPPR16439 ---- Animal proteins ---- Lutropin subunit beta
Source.965: DFBPPR16443 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 11
Source.966: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.967: DFBPPR16462 ---- Animal proteins ---- Pantetheinase
Source.968: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.969: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.970: DFBPPR16503 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.971: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor
Source.972: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.973: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.974: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.975: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.976: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.977: DFBPPR16581 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.978: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.979: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.980: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.981: DFBPPR16634 ---- Animal proteins ---- Zinc transporter SLC39A7
Source.982: DFBPPR16663 ---- Animal proteins ---- Involucrin
Source.983: DFBPPR16665 ---- Animal proteins ---- Adenosine receptor A2b
Source.984: DFBPPR16687 ---- Animal proteins ---- Hepcidin
Source.985: DFBPPR16694 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.986: DFBPPR16696 ---- Animal proteins ---- von Hippel-Lindau disease tumor suppressor
Source.987: DFBPPR16704 ---- Animal proteins ---- Retbindin
Source.988: DFBPPR16739 ---- Animal proteins ---- Lengsin
Source.989: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.990: DFBPPR16749 ---- Animal proteins ---- Keratinocyte differentiation-associated protein
Source.991: DFBPPR16759 ---- Animal proteins ---- Ig mu chain C region
Source.992: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase
Source.993: DFBPPR16769 ---- Animal proteins ---- Growth hormone receptor
Source.994: DFBPPR16807 ---- Animal proteins ---- Seminal ribonuclease
Source.995: DFBPPR16810 ---- Animal proteins ---- Cathepsin B
Source.996: DFBPPR16824 ---- Animal proteins ---- Insulin-like growth factor II
Source.997: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.998: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein
Source.999: DFBPPR16841 ---- Animal proteins ---- Peroxiredoxin-6
Source.1000: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.1001: DFBPPR16852 ---- Animal proteins ---- Cytochrome b
Source.1002: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor
Source.1003: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.1004: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.1005: DFBPPR16898 ---- Animal proteins ---- Integrin beta-1
Source.1006: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1007: DFBPPR16915 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.1008: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.1009: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.1010: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.1011: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.1012: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.1013: DFBPPR16984 ---- Animal proteins ---- Caveolin-2
Source.1014: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.1015: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.1016: DFBPPR16996 ---- Animal proteins ---- Retinol dehydrogenase 5
Source.1017: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.1018: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.1019: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.1020: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1
Source.1021: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase
Source.1022: DFBPPR17033 ---- Animal proteins ---- Monoacylglycerol lipase ABHD2
Source.1023: DFBPPR17036 ---- Animal proteins ---- Parkinson disease protein 7 homolog
Source.1024: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1025: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.1026: DFBPPR17040 ---- Animal proteins ---- Myocilin
Source.1027: DFBPPR17048 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1028: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.1029: DFBPPR17060 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 1
Source.1030: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.1031: DFBPPR17082 ---- Animal proteins ---- Calbindin
Source.1032: DFBPPR17083 ---- Animal proteins ---- Cyclin-dependent kinase 5 activator 1
Source.1033: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.1034: DFBPPR17095 ---- Animal proteins ---- Hyaluronidase-1
Source.1035: DFBPPR17108 ---- Animal proteins ---- Coronin-1A
Source.1036: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1037: DFBPPR17135 ---- Animal proteins ---- Histidine-rich glycoprotein
Source.1038: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.1039: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2
Source.1040: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.1041: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.1042: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.1043: DFBPPR17192 ---- Animal proteins ---- Kit ligand
Source.1044: DFBPPR17193 ---- Animal proteins ---- Oxysterols receptor LXR-alpha
Source.1045: DFBPPR17194 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.1046: DFBPPR17231 ---- Animal proteins ---- Protein sprouty homolog 2
Source.1047: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.1048: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.1049: DFBPPR17256 ---- Animal proteins ---- X-box-binding protein 1
Source.1050: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.1051: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.1052: DFBPPR17273 ---- Animal proteins ---- Integrin-linked protein kinase
Source.1053: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2
Source.1054: DFBPPR17285 ---- Animal proteins ---- Serine/threonine-protein kinase N1
Source.1055: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1
Source.1056: DFBPPR17293 ---- Animal proteins ---- Aurora kinase B
Source.1057: DFBPPR17305 ---- Animal proteins ---- Metalloendopeptidase OMA1, mitochondrial
Source.1058: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2
Source.1059: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.1060: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.1061: DFBPPR17316 ---- Animal proteins ---- Forkhead box protein O1
Source.1062: DFBPPR17334 ---- Animal proteins ---- Prohibitin
Source.1063: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.1064: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal
Source.1065: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.1066: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.1067: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.1068: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1
Source.1069: DFBPPR17359 ---- Animal proteins ---- Beta-secretase 1
Source.1070: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H
Source.1071: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.1072: DFBPPR17376 ---- Animal proteins ---- Flotillin-1
Source.1073: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.1074: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.1075: DFBPPR17383 ---- Animal proteins ---- Cbp/p300-interacting transactivator 2
Source.1076: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.1077: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.1078: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD
Source.1079: DFBPPR17400 ---- Animal proteins ---- 2-acylglycerol O-acyltransferase 1
Source.1080: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.1081: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.1082: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.1083: DFBPPR17437 ---- Animal proteins ---- DNA excision repair protein ERCC-1
Source.1084: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1085: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.1086: DFBPPR17473 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.1087: DFBPPR17481 ---- Animal proteins ---- Apolipoprotein C-III
Source.1088: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase
Source.1089: DFBPPR17501 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.1090: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform
Source.1091: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.1092: DFBPPR17508 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPD
Source.1093: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.1094: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase
Source.1095: DFBPPR17521 ---- Animal proteins ---- Transforming growth factor beta-1-induced transcript 1 protein
Source.1096: DFBPPR17535 ---- Animal proteins ---- Atrial natriuretic peptide receptor 2
Source.1097: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6
Source.1098: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.1099: DFBPPR17556 ---- Animal proteins ---- Histone H2A type 1
Source.1100: DFBPPR17557 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 1A
Source.1101: DFBPPR17558 ---- Animal proteins ---- Aldehyde dehydrogenase family 3 member B1
Source.1102: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.1103: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.1104: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1
Source.1105: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.1106: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1107: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.1108: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.1109: DFBPPR17668 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 2
Source.1110: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.1111: DFBPPR17716 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.1112: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.1113: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.1114: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.1115: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.1116: DFBPPR17797 ---- Animal proteins ---- Caspase-13
Source.1117: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.1118: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.1119: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1120: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.1121: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13
Source.1122: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.1123: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.1124: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.1125: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial
Source.1126: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1127: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.1128: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.1129: DFBPPR17920 ---- Animal proteins ---- Rod outer segment membrane protein 1
Source.1130: DFBPPR17925 ---- Animal proteins ---- Caspase-4
Source.1131: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1132: DFBPPR17948 ---- Animal proteins ---- V-type proton ATPase subunit S1
Source.1133: DFBPPR17968 ---- Animal proteins ---- Cathelicidin-2
Source.1134: DFBPPR17972 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.1135: DFBPPR17974 ---- Animal proteins ---- Mimecan
Source.1136: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.1137: DFBPPR17985 ---- Animal proteins ---- Unconventional prefoldin RPB5 interactor
Source.1138: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.1139: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.1140: DFBPPR18006 ---- Animal proteins ---- Sorting nexin-17
Source.1141: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.1142: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.1143: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase
Source.1144: DFBPPR18021 ---- Animal proteins ---- Lutropin subunit beta
Source.1145: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.1146: DFBPPR18033 ---- Animal proteins ---- Cathelicidin-3
Source.1147: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.1148: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.1149: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6
Source.1150: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.1151: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.1152: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1
Source.1153: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.1154: DFBPPR18088 ---- Animal proteins ---- Aprataxin
Source.1155: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.1156: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.1157: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.1158: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C
Source.1159: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.1160: DFBPPR18181 ---- Animal proteins ---- Neutral amino acid transporter A
Source.1161: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.1162: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform
Source.1163: DFBPPR18200 ---- Animal proteins ---- RNA demethylase ALKBH5
Source.1164: DFBPPR18204 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein
Source.1165: DFBPPR18205 ---- Animal proteins ---- Myelin-oligodendrocyte glycoprotein
Source.1166: DFBPPR18211 ---- Animal proteins ---- Phosducin
Source.1167: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.1168: DFBPPR18223 ---- Animal proteins ---- Exosome complex component RRP40
Source.1169: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4
Source.1170: DFBPPR18238 ---- Animal proteins ---- Protein odd-skipped-related 2
Source.1171: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.1172: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.1173: DFBPPR18323 ---- Animal proteins ---- Transcription factor E2F7
Source.1174: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog
Source.1175: DFBPPR18351 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 1
Source.1176: DFBPPR18365 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.1177: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.1178: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.1179: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.1180: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.1181: DFBPPR18416 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6
Source.1182: DFBPPR18418 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.1183: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.1184: DFBPPR18425 ---- Animal proteins ---- Histone H2A type 2-C
Source.1185: DFBPPR18428 ---- Animal proteins ---- Palmitoyltransferase ZDHHC16
Source.1186: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.1187: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.1188: DFBPPR18485 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.1189: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein
Source.1190: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8
Source.1191: DFBPPR18513 ---- Animal proteins ---- Placenta growth factor
Source.1192: DFBPPR18516 ---- Animal proteins ---- Galactokinase
Source.1193: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.1194: DFBPPR18561 ---- Animal proteins ---- Cyclic AMP-responsive element-binding protein 3-like protein 3
Source.1195: DFBPPR18571 ---- Animal proteins ---- CREB-regulated transcription coactivator 2
Source.1196: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.1197: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.1198: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.1199: DFBPPR18597 ---- Animal proteins ---- Telethonin
Source.1200: DFBPPR18628 ---- Animal proteins ---- Cytochrome b5 reductase 4
Source.1201: DFBPPR18702 ---- Animal proteins ---- E3 ubiquitin-protein ligase E3D
Source.1202: DFBPPR18720 ---- Animal proteins ---- Protein quaking
Source.1203: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.1204: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor
Source.1205: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1
Source.1206: DFBPPR18750 ---- Animal proteins ---- Alpha-N-acetylneuraminide alpha-2,8-sialyltransferase
Source.1207: DFBPPR18759 ---- Animal proteins ---- Neuronal-specific septin-3
Source.1208: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1
Source.1209: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.1210: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav
Source.1211: DFBPPR18792 ---- Animal proteins ---- Integral membrane protein 2C
Source.1212: DFBPPR18793 ---- Animal proteins ---- BPI fold-containing family A member 1
Source.1213: DFBPPR18800 ---- Animal proteins ---- Transcription factor E2F8
Source.1214: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8
Source.1215: DFBPPR18815 ---- Animal proteins ---- Pantetheinase
Source.1216: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.1217: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.1218: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.1219: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2
Source.1220: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.1221: DFBPPR18843 ---- Animal proteins ---- Carboxypeptidase B
Source.1222: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1223: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.1224: DFBPPR18849 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF3
Source.1225: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.1226: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.1227: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase
Source.1228: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain
Source.1229: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.1230: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.1231: DFBPPR18906 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 9, mitochondrial
Source.1232: DFBPPR18911 ---- Animal proteins ---- Mesencephalic astrocyte-derived neurotrophic factor
Source.1233: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.1234: DFBPPR18915 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.1235: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5
Source.1236: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11
Source.1237: DFBPPR18923 ---- Animal proteins ---- Adenosine receptor A2b
Source.1238: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.1239: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.1240: DFBPPR18938 ---- Animal proteins ---- C-X-C chemokine receptor type 2
Source.1241: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.1242: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2
Source.1243: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.1244: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.1245: DFBPPR19006 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.1246: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5
Source.1247: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2
Source.1248: DFBPPR19061 ---- Animal proteins ---- RNA-binding protein 5
Source.1249: DFBPPR19087 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.1250: DFBPPR19090 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.1251: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1252: DFBPPR19117 ---- Animal proteins ---- Sigma intracellular receptor 2
Source.1253: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.1254: DFBPPR19175 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.1255: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3
Source.1256: DFBPPR19182 ---- Animal proteins ---- Protoporphyrinogen oxidase
Source.1257: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.1258: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1259: DFBPPR19203 ---- Animal proteins ---- Mitochondrial inner membrane protease subunit 2
Source.1260: DFBPPR19205 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF169
Source.1261: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.1262: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.1263: DFBPPR19224 ---- Animal proteins ---- Fetuin-B
Source.1264: DFBPPR19234 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase catalytic subunit TRMT61A
Source.1265: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial
Source.1266: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.1267: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.1268: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.1269: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.1270: DFBPPR19291 ---- Animal proteins ---- Multicilin
Source.1271: DFBPPR19319 ---- Animal proteins ---- Exopolyphosphatase PRUNE1
Source.1272: DFBPPR19337 ---- Animal proteins ---- CMRF35-like molecule 9
Source.1273: DFBPPR19348 ---- Animal proteins ---- Twinfilin-1
Source.1274: DFBPPR19352 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit GRINL1A
Source.1275: DFBPPR19368 ---- Animal proteins ---- Prion-like protein doppel
Source.1276: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog
Source.1277: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.1278: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor
Source.1279: DFBPPR19396 ---- Animal proteins ---- SAM and SH3 domain-containing protein 3
Source.1280: DFBPPR19404 ---- Animal proteins ---- Microfibril-associated glycoprotein 4
Source.1281: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.1282: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.1283: DFBPPR19429 ---- Animal proteins ---- Protein Spindly
Source.1284: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.1285: DFBPPR19452 ---- Animal proteins ---- Mitochondrial amidoxime reducing component 2
Source.1286: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.1287: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.1288: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain
Source.1289: DFBPPR19482 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.1290: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.1291: DFBPPR19494 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 1
Source.1292: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2
Source.1293: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.1294: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.1295: DFBPPR19534 ---- Animal proteins ---- D-ribitol-5-phosphate cytidylyltransferase
Source.1296: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.1297: DFBPPR19549 ---- Animal proteins ---- Mitochondrial RNA pseudouridine synthase RPUSD4
Source.1298: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.1299: DFBPPR19564 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 2
Source.1300: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1301: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.1302: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.1303: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.1304: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2
Source.1305: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.1306: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1
Source.1307: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C
Source.1308: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.1309: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.1310: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1
Source.1311: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2
Source.1312: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase
Source.1313: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25
Source.1314: DFBPPR19651 ---- Animal proteins ---- FAS-associated factor 2
Source.1315: DFBPPR19657 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.1316: DFBPPR19663 ---- Animal proteins ---- Synembryn-A
Source.1317: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1
Source.1318: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.1319: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.1320: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1
Source.1321: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.1322: DFBPPR19706 ---- Animal proteins ---- PHD finger protein 10
Source.1323: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.1324: DFBPPR19709 ---- Animal proteins ---- Centromere protein X
Source.1325: DFBPPR19723 ---- Animal proteins ---- Spindle and kinetochore-associated protein 3
Source.1326: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.1327: DFBPPR19746 ---- Animal proteins ---- tRNA pseudouridine(38/39) synthase
Source.1328: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1
Source.1329: DFBPPR19759 ---- Animal proteins ---- Histone H2A.J
Source.1330: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.1331: DFBPPR19791 ---- Animal proteins ---- Hairy/enhancer-of-split related with YRPW motif protein 1
Source.1332: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4
Source.1333: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2
Source.1334: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L
Source.1335: DFBPPR19814 ---- Animal proteins ---- Protein delta homolog 2
Source.1336: DFBPPR19857 ---- Animal proteins ---- DnaJ homolog subfamily B member 1
Source.1337: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.1338: DFBPPR19890 ---- Animal proteins ---- Protein N-terminal glutamine amidohydrolase
Source.1339: DFBPPR19891 ---- Animal proteins ---- Geranylgeranyl transferase type-1 subunit beta
Source.1340: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.1341: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.1342: DFBPPR19939 ---- Animal proteins ---- Phosphatidylinositol transfer protein beta isoform
Source.1343: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7
Source.1344: DFBPPR19948 ---- Animal proteins ---- Tensin-4
Source.1345: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial
Source.1346: DFBPPR19965 ---- Animal proteins ---- Homeobox protein PKNOX1
Source.1347: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.1348: DFBPPR19994 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.1349: DFBPPR19996 ---- Animal proteins ---- Interleukin-3
Source.1350: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer
Source.1351: DFBPPR20006 ---- Animal proteins ---- Protein Abitram
Source.1352: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.1353: DFBPPR20035 ---- Animal proteins ---- Aldehyde dehydrogenase, dimeric NADP-preferring
Source.1354: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.1355: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1
Source.1356: DFBPPR20044 ---- Animal proteins ---- Secernin-1
Source.1357: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A
Source.1358: DFBPPR20049 ---- Animal proteins ---- PDZ and LIM domain protein 2
Source.1359: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B
Source.1360: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.1361: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.1362: DFBPPR20091 ---- Animal proteins ---- Carboxypeptidase O
Source.1363: DFBPPR20122 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 25
Source.1364: DFBPPR20128 ---- Animal proteins ---- PHD finger protein 23
Source.1365: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.1366: DFBPPR20160 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.1367: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.1368: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial
Source.1369: DFBPPR20210 ---- Animal proteins ---- Exonuclease V
Source.1370: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.1371: DFBPPR20223 ---- Animal proteins ---- Protein cereblon
Source.1372: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase
Source.1373: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase
Source.1374: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3
Source.1375: DFBPPR20262 ---- Animal proteins ---- DNA-directed RNA polymerase I subunit RPA12
Source.1376: DFBPPR20269 ---- Animal proteins ---- Ras-related and estrogen-regulated growth inhibitor
Source.1377: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.1378: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.1379: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.1380: DFBPPR20298 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.1381: DFBPPR20303 ---- Animal proteins ---- Aspartate--tRNA ligase, mitochondrial
Source.1382: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2
Source.1383: DFBPPR20324 ---- Animal proteins ---- Mitochondrial potassium channel
Source.1384: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27
Source.1385: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.1386: DFBPPR20346 ---- Animal proteins ---- Serpin B6
Source.1387: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.1388: DFBPPR20352 ---- Animal proteins ---- Probable dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.1389: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C
Source.1390: DFBPPR20362 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase
Source.1391: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1
Source.1392: DFBPPR20369 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 1
Source.1393: DFBPPR20375 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX56
Source.1394: DFBPPR20377 ---- Animal proteins ---- RAS guanyl-releasing protein 4
Source.1395: DFBPPR20388 ---- Animal proteins ---- SOSS complex subunit C
Source.1396: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.1397: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.1398: DFBPPR20395 ---- Animal proteins ---- GDP-fucose transporter 1
Source.1399: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.1400: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.1401: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.1402: DFBPPR20409 ---- Animal proteins ---- DNA damage-regulated autophagy modulator protein 2
Source.1403: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.1404: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.1405: DFBPPR20419 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 3
Source.1406: DFBPPR20457 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.1407: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.1408: DFBPPR20498 ---- Animal proteins ---- Protein sprouty homolog 4
Source.1409: DFBPPR20501 ---- Animal proteins ---- 28S ribosomal protein S2, mitochondrial
Source.1410: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.1411: DFBPPR20509 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase II inhibitor 1
Source.1412: DFBPPR20511 ---- Animal proteins ---- Mitoguardin 2
Source.1413: DFBPPR20516 ---- Animal proteins ---- RNA-binding protein NOB1
Source.1414: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.1415: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.1416: DFBPPR20545 ---- Animal proteins ---- GPI mannosyltransferase 3
Source.1417: DFBPPR20561 ---- Animal proteins ---- Protein cornichon homolog 1
Source.1418: DFBPPR20590 ---- Animal proteins ---- POU domain class 2-associating factor 1
Source.1419: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16
Source.1420: DFBPPR20594 ---- Animal proteins ---- Vitamin D-binding protein
Source.1421: DFBPPR20595 ---- Animal proteins ---- LHFPL tetraspan subfamily member 4 protein
Source.1422: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.1423: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.1424: DFBPPR20616 ---- Animal proteins ---- Zinc transporter ZIP13
Source.1425: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.1426: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2
Source.1427: DFBPPR20624 ---- Animal proteins ---- SUN domain-containing protein 3
Source.1428: DFBPPR20637 ---- Animal proteins ---- Mitochondrial mRNA pseudouridine synthase RPUSD3
Source.1429: DFBPPR20648 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM22 homolog
Source.1430: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91
Source.1431: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.1432: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14
Source.1433: DFBPPR20701 ---- Animal proteins ---- Cysteine--tRNA ligase, mitochondrial
Source.1434: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial
Source.1435: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2
Source.1436: DFBPPR20732 ---- Animal proteins ---- Immunoglobulin superfamily member 11
Source.1437: DFBPPR20781 ---- Animal proteins ---- Proline dehydrogenase 1, mitochondrial
Source.1438: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1
Source.1439: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.1440: DFBPPR20808 ---- Animal proteins ---- Monocarboxylate transporter 13
Source.1441: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2
Source.1442: DFBPPR20815 ---- Animal proteins ---- Translation initiation factor IF-3, mitochondrial
Source.1443: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.1444: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.1445: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.1446: DFBPPR20854 ---- Animal proteins ---- PDZ and LIM domain protein 3
Source.1447: DFBPPR20900 ---- Animal proteins ---- F-box/LRR-repeat protein 12
Source.1448: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.1449: DFBPPR20908 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27
Source.1450: DFBPPR20910 ---- Animal proteins ---- Dynein regulatory complex subunit 2
Source.1451: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.1452: DFBPPR20926 ---- Animal proteins ---- 60S ribosomal protein L8
Source.1453: DFBPPR20928 ---- Animal proteins ---- Nuclear envelope integral membrane protein 1
Source.1454: DFBPPR20933 ---- Animal proteins ---- FAST kinase domain-containing protein 3, mitochondrial
Source.1455: DFBPPR20941 ---- Animal proteins ---- DNA-directed RNA polymerases I and III subunit RPAC1
Source.1456: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.1457: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1
Source.1458: DFBPPR20974 ---- Animal proteins ---- Short-chain dehydrogenase/reductase 3
Source.1459: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1460: DFBPPR20997 ---- Animal proteins ---- Prefoldin subunit 2
Source.1461: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.1462: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.1463: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.1464: DFBPPR21016 ---- Animal proteins ---- Little elongation complex subunit 2
Source.1465: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein
Source.1466: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.1467: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.1468: DFBPPR21087 ---- Animal proteins ---- Claudin-11
Source.1469: DFBPPR21091 ---- Animal proteins ---- Graves disease carrier protein
Source.1470: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148
Source.1471: DFBPPR21142 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta
Source.1472: DFBPPR21155 ---- Animal proteins ---- Cyclin-H
Source.1473: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal
Source.1474: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.1475: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin
Source.1476: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2
Source.1477: DFBPPR21225 ---- Animal proteins ---- 28S ribosomal protein S31, mitochondrial
Source.1478: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.1479: DFBPPR21238 ---- Animal proteins ---- Pleckstrin homology domain-containing family A member 2
Source.1480: DFBPPR21245 ---- Animal proteins ---- Cilia- and flagella-associated protein 36
Source.1481: DFBPPR21288 ---- Animal proteins ---- Polycomb group RING finger protein 1
Source.1482: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.1483: DFBPPR21293 ---- Animal proteins ---- IST1 homolog
Source.1484: DFBPPR21322 ---- Animal proteins ---- Zinc finger protein 227
Source.1485: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.1486: DFBPPR21336 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.1487: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.1488: DFBPPR21403 ---- Animal proteins ---- Zinc-alpha-2-glycoprotein
Source.1489: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.1490: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A
Source.1491: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.1492: DFBPPR21421 ---- Animal proteins ---- Protein SMG8
Source.1493: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform
Source.1494: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.1495: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.1496: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.1497: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.1498: DFBPPR21478 ---- Animal proteins ---- FTS and Hook-interacting protein
Source.1499: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8
Source.1500: DFBPPR21485 ---- Animal proteins ---- Proline-rich protein 14
Source.1501: DFBPPR21486 ---- Animal proteins ---- Caspase recruitment domain-containing protein 19
Source.1502: DFBPPR21500 ---- Animal proteins ---- Docking protein 2
Source.1503: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1
Source.1504: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1
Source.1505: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1
Source.1506: DFBPPR21523 ---- Animal proteins ---- tRNA 2'-phosphotransferase 1
Source.1507: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.1508: DFBPPR21583 ---- Animal proteins ---- Protein chibby homolog 2
Source.1509: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.1510: DFBPPR21643 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2-like protein 6
Source.1511: DFBPPR21645 ---- Animal proteins ---- Proteasome activator complex subunit 1
Source.1512: DFBPPR21656 ---- Animal proteins ---- Thioredoxin domain-containing protein 11
Source.1513: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.1514: DFBPPR21679 ---- Animal proteins ---- Protein spinster homolog 1
Source.1515: DFBPPR21680 ---- Animal proteins ---- 40S ribosomal protein S26
Source.1516: DFBPPR21681 ---- Animal proteins ---- Protein FAM110A
Source.1517: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.1518: DFBPPR21712 ---- Animal proteins ---- Serpin E3
Source.1519: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.1520: DFBPPR21728 ---- Animal proteins ---- Galectin-9
Source.1521: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.1522: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.1523: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.1524: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2
Source.1525: DFBPPR21799 ---- Animal proteins ---- Major vault protein
Source.1526: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.1527: DFBPPR21816 ---- Animal proteins ---- Sorting nexin-24
Source.1528: DFBPPR21832 ---- Animal proteins ---- Probable hydrolase PNKD
Source.1529: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.1530: DFBPPR21855 ---- Animal proteins ---- Proline-rich nuclear receptor coactivator 2
Source.1531: DFBPPR21861 ---- Animal proteins ---- Succinate dehydrogenase assembly factor 3, mitochondrial
Source.1532: DFBPPR21868 ---- Animal proteins ---- RAB6-interacting golgin
Source.1533: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.1534: DFBPPR21899 ---- Animal proteins ---- Gametocyte-specific factor 1
Source.1535: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog
Source.1536: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.1537: DFBPPR21928 ---- Animal proteins ---- Protein canopy homolog 4
Source.1538: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.1539: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7
Source.1540: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.1541: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial
Source.1542: DFBPPR21966 ---- Animal proteins ---- DNA replication complex GINS protein PSF1
Source.1543: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog
Source.1544: DFBPPR21999 ---- Animal proteins ---- Rho GDP-dissociation inhibitor 3
Source.1545: DFBPPR22003 ---- Animal proteins ---- 40S ribosomal protein S13
Source.1546: DFBPPR22005 ---- Animal proteins ---- Transmembrane protein 81
Source.1547: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3
Source.1548: DFBPPR22025 ---- Animal proteins ---- Putative deoxyribonuclease TATDN3
Source.1549: DFBPPR22035 ---- Animal proteins ---- Protein CCSMST1
Source.1550: DFBPPR22037 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2
Source.1551: DFBPPR22038 ---- Animal proteins ---- Kelch domain-containing protein 3
Source.1552: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12
Source.1553: DFBPPR22077 ---- Animal proteins ---- 39S ribosomal protein L21, mitochondrial
Source.1554: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.1555: DFBPPR22176 ---- Animal proteins ---- ER membrane protein complex subunit 3
Source.1556: DFBPPR22195 ---- Animal proteins ---- Homeobox protein DBX2
Source.1557: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.1558: DFBPPR22206 ---- Animal proteins ---- Promotilin
Source.1559: DFBPPR22213 ---- Animal proteins ---- Protein TEX261
Source.1560: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.1561: DFBPPR22244 ---- Animal proteins ---- THAP domain-containing protein 3
Source.1562: DFBPPR22253 ---- Animal proteins ---- Inhibitory synaptic factor 1
Source.1563: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.1564: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.1565: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B
Source.1566: DFBPPR22291 ---- Animal proteins ---- Keratin-like protein KRT222
Source.1567: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.1568: DFBPPR22339 ---- Animal proteins ---- R3H domain-containing protein 2
Source.1569: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B
Source.1570: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog
Source.1571: DFBPPR22351 ---- Animal proteins ---- Transmembrane protein 168
Source.1572: DFBPPR22354 ---- Animal proteins ---- ADP-ribosylation factor-like protein 6-interacting protein 6
Source.1573: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.1574: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1
Source.1575: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1
Source.1576: DFBPPR22396 ---- Animal proteins ---- Actin-related protein 10
Source.1577: DFBPPR22414 ---- Animal proteins ---- Protein C10
Source.1578: DFBPPR22415 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.1579: DFBPPR22417 ---- Animal proteins ---- Spermatogenesis-associated protein 46
Source.1580: DFBPPR22425 ---- Animal proteins ---- Protein THEM6
Source.1581: DFBPPR22426 ---- Animal proteins ---- Single-pass membrane and coiled-coil domain-containing protein 4
Source.1582: DFBPPR22437 ---- Animal proteins ---- Glutathione S-transferase C-terminal domain-containing protein
Source.1583: DFBPPR22441 ---- Animal proteins ---- Isochorismatase domain-containing protein 2
Source.1584: DFBPPR22446 ---- Animal proteins ---- Tektin-5
Source.1585: DFBPPR22448 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 5B
Source.1586: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9
Source.1587: DFBPPR22478 ---- Animal proteins ---- Trichohyalin-like protein 1
Source.1588: DFBPPR22485 ---- Animal proteins ---- Transmembrane protein 144
Source.1589: DFBPPR22502 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 46
Source.1590: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1
Source.1591: DFBPPR22541 ---- Animal proteins ---- Protein FAM177A1
Source.1592: DFBPPR22549 ---- Animal proteins ---- Isochorismatase domain-containing protein 1
Source.1593: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2
Source.1594: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.1595: DFBPPR22585 ---- Animal proteins ---- UPF0449 protein C19orf25 homolog
Source.1596: DFBPPR22588 ---- Animal proteins ---- Uncharacterized protein C1orf198 homolog
Source.1597: DFBPPR22633 ---- Animal proteins ---- Transmembrane protein 270
Source.1598: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1
Source.1599: DFBPPR22651 ---- Animal proteins ---- Spermatogenesis-associated protein 2-like protein
Source.1600: DFBPPR22678 ---- Animal proteins ---- TraB domain-containing protein
Source.1601: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C
Source.1602: DFBPPR22703 ---- Animal proteins ---- Arrestin domain-containing protein 5
Source.1603: DFBPPR22718 ---- Animal proteins ---- Fibronectin type III domain-containing protein 11
Source.1604: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog
Source.1605: DFBPPR22742 ---- Animal proteins ---- Uncharacterized protein C12orf71 homolog
Source.1606: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.1607: DFBPPR22758 ---- Animal proteins ---- Uncharacterized protein C14orf28 homolog
Source.1608: DFBPPR22762 ---- Animal proteins ---- Uncharacterized protein C6orf136 homolog
Source.1609: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.1610: DFBPPR8529 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.1611: DFBPPR8538 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.1612: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.1613: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.1614: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.1615: DFBPPR8553 ---- Animal proteins ---- Protein AMBP
Source.1616: DFBPPR8562 ---- Animal proteins ---- Steroid 17-alpha-hydroxylase/17,20 lyase
Source.1617: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.1618: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.1619: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1620: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.1621: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.1622: DFBPPR8581 ---- Animal proteins ---- Chymotrypsin-like elastase family member 1
Source.1623: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.1624: DFBPPR8586 ---- Animal proteins ---- Aurora kinase B
Source.1625: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.1626: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.1627: DFBPPR8609 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.1628: DFBPPR8612 ---- Animal proteins ---- Peroxiredoxin-6
Source.1629: DFBPPR8624 ---- Animal proteins ---- Integrin beta-1
Source.1630: DFBPPR8629 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 1
Source.1631: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.1632: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.1633: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.1634: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.1635: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.1636: DFBPPR8707 ---- Animal proteins ---- Flotillin-1
Source.1637: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor
Source.1638: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.1639: DFBPPR8714 ---- Animal proteins ---- Integrin beta-2
Source.1640: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.1641: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.1642: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1643: DFBPPR8741 ---- Animal proteins ---- Forkhead box protein O1
Source.1644: DFBPPR8744 ---- Animal proteins ---- Fibroblast growth factor 9
Source.1645: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.1646: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.1647: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1648: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.1649: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.1650: DFBPPR8758 ---- Animal proteins ---- Caveolin-2
Source.1651: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.1652: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.1653: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.1654: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.1655: DFBPPR8802 ---- Animal proteins ---- Insulin-like growth factor II
Source.1656: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3
Source.1657: DFBPPR8825 ---- Animal proteins ---- Optineurin
Source.1658: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.1659: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance
Source.1660: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.1661: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.1662: DFBPPR8855 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.1663: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.1664: DFBPPR8897 ---- Animal proteins ---- Cytochrome b
Source.1665: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.1666: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.1667: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.1668: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.1669: DFBPPR8939 ---- Animal proteins ---- Kit ligand
Source.1670: DFBPPR8967 ---- Animal proteins ---- Proenkephalin-B
Source.1671: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.1672: DFBPPR8972 ---- Animal proteins ---- Lutropin subunit beta
Source.1673: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1674: DFBPPR8980 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.1675: DFBPPR8982 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta
Source.1676: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.1677: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.1678: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.1679: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80
Source.1680: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.1681: DFBPPR9102 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.1682: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.1683: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.1684: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.1685: DFBPPR9161 ---- Animal proteins ---- Potassium voltage-gated channel subfamily E member 1
Source.1686: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.1687: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.1688: DFBPPR9186 ---- Animal proteins ---- Growth factor receptor-bound protein 10
Source.1689: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10
Source.1690: DFBPPR9207 ---- Animal proteins ---- Beta-enolase
Source.1691: DFBPPR9208 ---- Animal proteins ---- Uteroferrin-associated protein
Source.1692: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.1693: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.1694: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.1695: DFBPPR9228 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.1696: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta
Source.1697: DFBPPR9233 ---- Animal proteins ---- Integral membrane protein 2C
Source.1698: DFBPPR9235 ---- Animal proteins ---- Apomucin
Source.1699: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B
Source.1700: DFBPPR9252 ---- Animal proteins ---- Selenide, water dikinase 2
Source.1701: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.1702: DFBPPR9265 ---- Animal proteins ---- Pantetheinase
Source.1703: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1704: DFBPPR9286 ---- Animal proteins ---- BPI fold-containing family A member 1
Source.1705: DFBPPR9298 ---- Animal proteins ---- Melanocortin receptor 4
Source.1706: DFBPPR9303 ---- Animal proteins ---- Solute carrier family 52, riboflavin transporter, member 2
Source.1707: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.1708: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1709: DFBPPR9316 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.1710: DFBPPR9327 ---- Animal proteins ---- Multicilin
Source.1711: DFBPPR9337 ---- Animal proteins ---- Adrenocorticotropic hormone receptor
Source.1712: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1
Source.1713: DFBPPR9350 ---- Animal proteins ---- RNA-binding protein 4B
Source.1714: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.1715: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.1716: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.1717: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.1718: DFBPPR9420 ---- Animal proteins ---- B1 bradykinin receptor
Source.1719: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.1720: DFBPPR9427 ---- Animal proteins ---- Protein quaking
Source.1721: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.1722: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1
Source.1723: DFBPPR9501 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.1724: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.1725: DFBPPR9535 ---- Animal proteins ---- Ribonuclease inhibitor
Source.1726: DFBPPR9569 ---- Animal proteins ---- Myelin proteolipid protein
Source.1727: DFBPPR9571 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.1728: DFBPPR9573 ---- Animal proteins ---- 40S ribosomal protein S26
Source.1729: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.1730: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.1731: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.1732: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.1733: DFBPPR9596 ---- Animal proteins ---- Thyroxine-binding globulin
Source.1734: DFBPPR9619 ---- Animal proteins ---- Teashirt homolog 2
Source.1735: DFBPPR9620 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 5
Source.1736: DFBPPR9624 ---- Animal proteins ---- Cadherin-3
Source.1737: DFBPPR9627 ---- Animal proteins ---- Odontogenic ameloblast-associated protein
Source.1738: DFBPPR9645 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.1739: DFBPPR9655 ---- Animal proteins ---- A-kinase anchor protein 10, mitochondrial
Source.1740: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.1741: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1742: DFBPPR9683 ---- Animal proteins ---- Calpastatin
Source.1743: DFBPPR9713 ---- Animal proteins ---- Hepcidin
Source.1744: DFBPPR9715 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 27
Source.1745: DFBPPR9738 ---- Animal proteins ---- Protein delta homolog 2
Source.1746: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.1747: DFBPPR9742 ---- Animal proteins ---- Putative inhibitor of apoptosis
Source.1748: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.1749: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.1750: DFBPPR9774 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase alpha
Source.1751: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8
Source.1752: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.1753: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2
Source.1754: DFBPPR9807 ---- Animal proteins ---- Galectin-4
Source.1755: DFBPPR9808 ---- Animal proteins ---- Epidermal growth factor-like protein 8
Source.1756: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.1757: DFBPPR9861 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 6
Source.1758: DFBPPR9882 ---- Animal proteins ---- Krueppel-like factor 17
Source.1759: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.1760: DFBPPR9908 ---- Animal proteins ---- Gastrokine-3
Source.1761: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2
Source.1762: DFBPPR9923 ---- Animal proteins ---- Small muscular protein
Source.1763: DFBPPR9949 ---- Animal proteins ---- Coiled-coil domain-containing protein 127
Source.1764: DFBPPR9962 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.1765: DFBPPR9970 ---- Animal proteins ---- Growth hormone receptor
Source.1766: DFBPPR9975 ---- Animal proteins ---- Interleukin-10
Source.1767: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.1768: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.1769: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.1770: DFBPPR10019 ---- Animal proteins ---- Extracellular fatty acid-binding protein
Source.1771: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2
Source.1772: DFBPPR10028 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.1773: DFBPPR10030 ---- Animal proteins ---- Calbindin
Source.1774: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.1775: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.1776: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.1777: DFBPPR10056 ---- Animal proteins ---- Mothers against decapentaplegic homolog 3
Source.1778: DFBPPR10057 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.1779: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor
Source.1780: DFBPPR10082 ---- Animal proteins ---- Pinopsin
Source.1781: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1782: DFBPPR10104 ---- Animal proteins ---- Bloom syndrome protein homolog
Source.1783: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.1784: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.1785: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1
Source.1786: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.1787: DFBPPR10139 ---- Animal proteins ---- Cytochrome b
Source.1788: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.1789: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.1790: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5
Source.1791: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.1792: DFBPPR10170 ---- Animal proteins ---- Drebrin
Source.1793: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.1794: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.1795: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.1796: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.1797: DFBPPR10196 ---- Animal proteins ---- Transcription factor Sp3
Source.1798: DFBPPR10203 ---- Animal proteins ---- Protein/nucleic acid deglycase DJ-1
Source.1799: DFBPPR10205 ---- Animal proteins ---- Noelin
Source.1800: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.1801: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein
Source.1802: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.1803: DFBPPR10240 ---- Animal proteins ---- Cerberus
Source.1804: DFBPPR10243 ---- Animal proteins ---- Core histone macro-H2A.1
Source.1805: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1
Source.1806: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.1807: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.1808: DFBPPR10267 ---- Animal proteins ---- Gephyrin
Source.1809: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.1810: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.1811: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.1812: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.1813: DFBPPR10320 ---- Animal proteins ---- Insulin
Source.1814: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta
Source.1815: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.1816: DFBPPR10368 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1817: DFBPPR10369 ---- Animal proteins ---- Fructose-bisphosphate aldolase B
Source.1818: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.1819: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.1820: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.1821: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.1822: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.1823: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1824: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin
Source.1825: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.1826: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.1827: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.1828: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.1829: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.1830: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.1831: DFBPPR10477 ---- Animal proteins ---- Aprataxin
Source.1832: DFBPPR10481 ---- Animal proteins ---- Syndecan-3
Source.1833: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.1834: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.1835: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.1836: DFBPPR10517 ---- Animal proteins ---- Histone H2A-IV
Source.1837: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.1838: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.1839: DFBPPR10536 ---- Animal proteins ---- Inhibin beta B chain
Source.1840: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.1841: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C
Source.1842: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2
Source.1843: DFBPPR10560 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM71
Source.1844: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase
Source.1845: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.1846: DFBPPR10590 ---- Animal proteins ---- Centromere protein X
Source.1847: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.1848: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.1849: DFBPPR10605 ---- Animal proteins ---- Elastin
Source.1850: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.1851: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.1852: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1853: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.1854: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.1855: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.1856: DFBPPR10660 ---- Animal proteins ---- Tsukushin
Source.1857: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.1858: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase
Source.1859: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.1860: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.1861: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.1862: DFBPPR10675 ---- Animal proteins ---- Inhibitor of apoptosis protein
Source.1863: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.1864: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.1865: DFBPPR10731 ---- Animal proteins ---- Protein cereblon
Source.1866: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.1867: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1
Source.1868: DFBPPR10755 ---- Animal proteins ---- Draxin
Source.1869: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain
Source.1870: DFBPPR10793 ---- Animal proteins ---- Histone H2A-III
Source.1871: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.1872: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.1873: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.1874: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa
Source.1875: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.1876: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.1877: DFBPPR10848 ---- Animal proteins ---- Melatonin receptor type 1A
Source.1878: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.1879: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.1880: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.1881: DFBPPR10870 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 2
Source.1882: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.1883: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.1884: DFBPPR10886 ---- Animal proteins ---- Histone H2A.J
Source.1885: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1
Source.1886: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.1887: DFBPPR10909 ---- Animal proteins ---- Transcription factor 12
Source.1888: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.1889: DFBPPR10933 ---- Animal proteins ---- DNA cross-link repair 1A protein
Source.1890: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.1891: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.1892: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y
Source.1893: DFBPPR10955 ---- Animal proteins ---- DNA damage-binding protein 2
Source.1894: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta
Source.1895: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C
Source.1896: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.1897: DFBPPR10970 ---- Animal proteins ---- Prohibitin
Source.1898: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.1899: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase
Source.1900: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.1901: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.1902: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.1903: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1
Source.1904: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.1905: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.1906: DFBPPR11012 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 6
Source.1907: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.1908: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.1909: DFBPPR11029 ---- Animal proteins ---- Myelin proteolipid protein
Source.1910: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.1911: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.1912: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.1913: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1
Source.1914: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial
Source.1915: DFBPPR11101 ---- Animal proteins ---- Repulsive guidance molecule A
Source.1916: DFBPPR11112 ---- Animal proteins ---- Protein quaking
Source.1917: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.1918: DFBPPR11124 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase type-1 beta
Source.1919: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.1920: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.1921: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.1922: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1
Source.1923: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.1924: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta
Source.1925: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.1926: DFBPPR11194 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.1927: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.1928: DFBPPR11200 ---- Animal proteins ---- Homeobox protein HMX1
Source.1929: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1930: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.1931: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase
Source.1932: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2
Source.1933: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.1934: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.1935: DFBPPR11269 ---- Animal proteins ---- Anosmin-1
Source.1936: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3
Source.1937: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.1938: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1939: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2
Source.1940: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.1941: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15
Source.1942: DFBPPR11343 ---- Animal proteins ---- Transcription factor Sp8
Source.1943: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4
Source.1944: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.1945: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner
Source.1946: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231
Source.1947: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1
Source.1948: DFBPPR11427 ---- Animal proteins ---- Protein Abitram
Source.1949: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.1950: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46
Source.1951: DFBPPR11467 ---- Animal proteins ---- Synembryn-A
Source.1952: DFBPPR11468 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.1953: DFBPPR11482 ---- Animal proteins ---- Histone deacetylase 9
Source.1954: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1
Source.1955: DFBPPR11490 ---- Animal proteins ---- Twinfilin-2
Source.1956: DFBPPR11491 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 53 homolog
Source.1957: DFBPPR11494 ---- Animal proteins ---- T-box-containing protein TBX6L
Source.1958: DFBPPR11531 ---- Animal proteins ---- Protein AATF
Source.1959: DFBPPR11533 ---- Animal proteins ---- Mimecan
Source.1960: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.1961: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein
Source.1962: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic
Source.1963: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.1964: DFBPPR11579 ---- Animal proteins ---- Actin-related protein 6
Source.1965: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.1966: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.1967: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.1968: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.1969: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8
Source.1970: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59
Source.1971: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.1972: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.1973: DFBPPR11659 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.1974: DFBPPR11677 ---- Animal proteins ---- SOSS complex subunit C
Source.1975: DFBPPR11685 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 22
Source.1976: DFBPPR11694 ---- Animal proteins ---- Muscleblind-like protein 1
Source.1977: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit
Source.1978: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.1979: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.1980: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.1981: DFBPPR11714 ---- Animal proteins ---- Hydroxysteroid dehydrogenase-like protein 1
Source.1982: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1
Source.1983: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.1984: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.1985: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein
Source.1986: DFBPPR11770 ---- Animal proteins ---- Protein fem-1 homolog B
Source.1987: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.1988: DFBPPR11780 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog B
Source.1989: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B
Source.1990: DFBPPR11788 ---- Animal proteins ---- Homeobox protein GBX-2
Source.1991: DFBPPR11802 ---- Animal proteins ---- Transmembrane protein 17
Source.1992: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91
Source.1993: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.1994: DFBPPR11816 ---- Animal proteins ---- Sister chromatid cohesion protein PDS5 homolog A
Source.1995: DFBPPR11828 ---- Animal proteins ---- Spindlin-Z
Source.1996: DFBPPR11856 ---- Animal proteins ---- Spindlin-W
Source.1997: DFBPPR11868 ---- Animal proteins ---- Apoptosis inhibitor 5
Source.1998: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.1999: DFBPPR11880 ---- Animal proteins ---- Deleted in azoospermia-like
Source.2000: DFBPPR11907 ---- Animal proteins ---- Zinc transporter ZIP9
Source.2001: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.2002: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3
Source.2003: DFBPPR11953 ---- Animal proteins ---- Protein NEL
Source.2004: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.2005: DFBPPR11964 ---- Animal proteins ---- Protein LLP homolog
Source.2006: DFBPPR11975 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.2007: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.2008: DFBPPR11980 ---- Animal proteins ---- 40S ribosomal protein S13
Source.2009: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.2010: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.2011: DFBPPR12014 ---- Animal proteins ---- Raftlin
Source.2012: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5
Source.2013: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.2014: DFBPPR12059 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.2015: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.2016: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121
Source.2017: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.2018: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox
Source.2019: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.2020: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1
Source.2021: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.2022: DFBPPR12122 ---- Animal proteins ---- Fibroblast growth factor-binding protein 2
Source.2023: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.2024: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.2025: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93
Source.2026: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.2027: DFBPPR12157 ---- Animal proteins ---- Proline-rich nuclear receptor coactivator 2
Source.2028: DFBPPR12162 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 2
Source.2029: DFBPPR12167 ---- Animal proteins ---- Protein odr-4 homolog
Source.2030: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.2031: DFBPPR12188 ---- Animal proteins ---- Protein limb expression 1
Source.2032: DFBPPR12212 ---- Animal proteins ---- GTPase-activating Rap/Ran-GAP domain-like protein 3
Source.2033: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.2034: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein
Source.2035: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog
Source.2036: DFBPPR12234 ---- Animal proteins ---- Rab9 effector protein with kelch motifs
Source.2037: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.2038: DFBPPR12251 ---- Animal proteins ---- Serotransferrin
Source.2039: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.2040: DFBPPR12258 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 2
Source.2041: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.2042: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.2043: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.2044: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.2045: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.2046: DFBPPR12299 ---- Animal proteins ---- Myocilin
Source.2047: DFBPPR12303 ---- Animal proteins ---- Histidine-rich glycoprotein
Source.2048: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.2049: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2050: DFBPPR12320 ---- Animal proteins ---- Dystroglycan
Source.2051: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.2052: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.2053: DFBPPR12347 ---- Animal proteins ---- Progesterone receptor
Source.2054: DFBPPR12354 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.2055: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.2056: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.2057: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.2058: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1
Source.2059: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.2060: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1
Source.2061: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.2062: DFBPPR12390 ---- Animal proteins ---- Excitatory amino acid transporter 3
Source.2063: DFBPPR12400 ---- Animal proteins ---- RNA-binding protein 4
Source.2064: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.2065: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2066: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1
Source.2067: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2068: DFBPPR12425 ---- Animal proteins ---- Beta-enolase
Source.2069: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.2070: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.2071: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.2072: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.2073: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.2074: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.2075: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.2076: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor
Source.2077: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.2078: DFBPPR12516 ---- Animal proteins ---- Indolethylamine N-methyltransferase
Source.2079: DFBPPR12524 ---- Animal proteins ---- V(D)J recombination-activating protein 2
Source.2080: DFBPPR12527 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.2081: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.2082: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.2083: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.2084: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.2085: DFBPPR12559 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 2
Source.2086: DFBPPR12562 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.2087: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.2088: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.2089: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.2090: DFBPPR12596 ---- Animal proteins ---- Alpha-sarcoglycan
Source.2091: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.2092: DFBPPR12632 ---- Animal proteins ---- Caveolin-2
Source.2093: DFBPPR12633 ---- Animal proteins ---- Neutral amino acid transporter B(0)
Source.2094: DFBPPR12649 ---- Animal proteins ---- C-C chemokine receptor type 5
Source.2095: DFBPPR12708 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.2096: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.2097: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.2098: DFBPPR12722 ---- Animal proteins ---- Myelin proteolipid protein
Source.2099: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.2100: DFBPPR12728 ---- Animal proteins ---- Cytochrome b
Source.2101: DFBPPR12742 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.2102: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1
Source.2103: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.2104: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.2105: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2106: DFBPPR12803 ---- Animal proteins ---- Sulfotransferase 1C2
Source.2107: DFBPPR12804 ---- Animal proteins ---- Fibrinogen beta chain
Source.2108: DFBPPR12813 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit beta
Source.2109: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.2110: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.2111: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.2112: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.2113: DFBPPR12900 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.2114: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.2115: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.2116: DFBPPR12950 ---- Animal proteins ---- Vitamin D-binding protein
Source.2117: DFBPPR12962 ---- Animal proteins ---- Coronin-1B
Source.2118: DFBPPR12969 ---- Animal proteins ---- Prolactin
Source.2119: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.2120: DFBPPR12979 ---- Animal proteins ---- Lutropin subunit beta
Source.2121: DFBPPR12992 ---- Animal proteins ---- Mimecan
Source.2122: DFBPPR12994 ---- Animal proteins ---- Ig mu chain C region membrane-bound form
Source.2123: DFBPPR13006 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5
Source.2124: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein
Source.2125: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.2126: DFBPPR13058 ---- Animal proteins ---- Anion exchange transporter
Source.2127: DFBPPR13085 ---- Animal proteins ---- Protein AAR2 homolog
Source.2128: DFBPPR13093 ---- Animal proteins ---- Transmembrane protein 236
Source.2129: DFBPPR13099 ---- Animal proteins ---- Ig mu chain C region secreted form
Source.2130: DFBPPR13100 ---- Animal proteins ---- Lengsin
Source.2131: DFBPPR13119 ---- Animal proteins ---- Ig alpha chain C region
Source.2132: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2133: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2134: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2135: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain
Source.2136: DFBPPR13182 ---- Animal proteins ---- Insulin-like growth factor II
Source.2137: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain
Source.2138: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.2139: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.2140: DFBPPR13219 ---- Animal proteins ---- Kit ligand
Source.2141: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.2142: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.2143: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.2144: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.2145: DFBPPR13265 ---- Animal proteins ---- Gasdermin-E
Source.2146: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.2147: DFBPPR13276 ---- Animal proteins ---- Protein quaking
Source.2148: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.2149: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.2150: DFBPPR13305 ---- Animal proteins ---- Cytochrome b
Source.2151: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.2152: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2153: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.2154: DFBPPR13337 ---- Animal proteins ---- Calcitonin gene-related peptide 1
Source.2155: DFBPPR13348 ---- Animal proteins ---- Calcitonin
Source.2156: DFBPPR13389 ---- Animal proteins ---- Phosducin
Source.2157: DFBPPR13432 ---- Animal proteins ---- Integrin beta-2
Source.2158: DFBPPR13443 ---- Animal proteins ---- Kit ligand
Source.2159: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.2160: DFBPPR13469 ---- Animal proteins ---- Cytochrome b
Source.2161: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2162: DFBPPR13549 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.2163: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1
Source.2164: DFBPPR13575 ---- Animal proteins ---- Integrin beta-2
Source.2165: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.2166: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.2167: DFBPPR13583 ---- Animal proteins ---- Caveolin-2
Source.2168: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2169: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2170: DFBPPR13601 ---- Animal proteins ---- Cathepsin B
Source.2171: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.2172: DFBPPR13609 ---- Animal proteins ---- Lutropin subunit beta
Source.2173: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.2174: DFBPPR13614 ---- Animal proteins ---- Insulin-like growth factor II
Source.2175: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.2176: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.2177: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.2178: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.2179: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.2180: DFBPPR13652 ---- Animal proteins ---- Interleukin-3
Source.2181: DFBPPR13665 ---- Animal proteins ---- Kit ligand
Source.2182: DFBPPR13696 ---- Animal proteins ---- Cathepsin D
Source.2183: DFBPPR13712 ---- Animal proteins ---- Cytochrome b
Source.2184: DFBPPR13726 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.2185: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.2186: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.2187: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21
Source.2188: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.2189: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor
Source.2190: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.2191: DFBPPR13777 ---- Animal proteins ---- Centromere protein C
Source.2192: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.2193: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.2194: DFBPPR13796 ---- Animal proteins ---- Prion-like protein doppel
Source.2195: DFBPPR13836 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.2196: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor
Source.2197: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin
Source.2198: DFBPPR13873 ---- Animal proteins ---- Mineralocorticoid receptor
Source.2199: DFBPPR13874 ---- Animal proteins ---- Cathelicidin-2
Source.2200: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2201: DFBPPR13902 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.2202: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor
Source.2203: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.2204: DFBPPR13951 ---- Animal proteins ---- 40S ribosomal protein S26
Source.2205: DFBPPR13995 ---- Animal proteins ---- Radial spoke head 1 homolog
Source.2206: DFBPPR14002 ---- Animal proteins ---- Cytochrome b
Source.2207: DFBPPR14044 ---- Animal proteins ---- Transcription factor jun-B
Source.2208: DFBPPR14061 ---- Animal proteins ---- Neurotrophin-7
Source.2209: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1
Source.2210: DFBPPR14099 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.2211: DFBPPR14100 ---- Marine protein ---- Cytochrome b
Source.2212: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.2213: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183
Source.2214: DFBPPR14123 ---- Marine protein ---- Albumin 1
Source.2215: DFBPPR14124 ---- Marine protein ---- Albumin 2
Source.2216: DFBPPR14161 ---- Marine protein ---- GTPase Era, mitochondrial
Source.2217: DFBPPR14170 ---- Marine protein ---- SOSS complex subunit C
Source.2218: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.2219: DFBPPR14187 ---- Marine protein ---- Secreted phosphoprotein 24
Source.2220: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.2221: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein
Source.2222: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.2223: DFBPPR14212 ---- Marine protein ---- Proline-rich nuclear receptor coactivator 2
Source.2224: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1
Source.2225: DFBPPR14242 ---- Marine protein ---- Cytochrome b
Source.2226: DFBPPR14291 ---- Marine protein ---- Photosystem II D2 protein
Source.2227: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2228: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein
Source.2229: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein
Source.2230: DFBPPR14344 ---- Marine protein ---- Probable molybdopterin-synthase adenylyltransferase
Source.2231: DFBPPR14367 ---- Marine protein ---- Cytochrome f
Source.2232: DFBPPR14373 ---- Marine protein ---- Cytochrome b6
Source.2233: DFBPPR14382 ---- Marine protein ---- Photosystem II CP47 reaction center protein
Source.2234: DFBPPR14393 ---- Marine protein ---- Ribonuclease E/G-like protein
Source.2235: DFBPPR14468 ---- Marine protein ---- 50S ribosomal protein L9, chloroplastic
Source.2236: DFBPPR14510 ---- Marine protein ---- Tic20 family protein Ycf60
Source.2237: DFBPPR14537 ---- Marine protein ---- Histone H2A
Source.2238: DFBPPR14548 ---- Marine protein ---- Mineralocorticoid receptor
Source.2239: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.2240: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.2241: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1
Source.2242: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.2243: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros
Source.2244: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible
Source.2245: DFBPPR14590 ---- Marine protein ---- Cytochrome b
Source.2246: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II
Source.2247: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.2248: DFBPPR14617 ---- Marine protein ---- Na(+)/H(+) exchanger beta
Source.2249: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2
Source.2250: DFBPPR14680 ---- Marine protein ---- Steroidogenic acute regulatory protein, mitochondrial
Source.2251: DFBPPR14697 ---- Marine protein ---- Progonadoliberin-3
Source.2252: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.2253: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.2254: DFBPPR14716 ---- Marine protein ---- Secreted phosphoprotein 24
Source.2255: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.2256: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.2257: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.2258: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.2259: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain
Source.2260: DFBPPR14786 ---- Marine protein ---- Hemocyanin A chain
Source.2261: DFBPPR14794 ---- Marine protein ---- Hemocyanin C chain
Source.2262: DFBPPR14808 ---- Marine protein ---- Pseudohemocyanin-1
Source.2263: DFBPPR14809 ---- Marine protein ---- Pseudohemocyanin-2
Source.2264: DFBPPR14861 ---- Marine protein ---- Cytochrome b
Source.2265: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.2266: DFBPPR14908 ---- Microorganism protein ---- Flap endonuclease 1
Source.2267: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.2268: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific
Source.2269: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.2270: DFBPPR14925 ---- Microorganism protein ---- 3-isopropylmalate dehydrogenase
Source.2271: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial
Source.2272: DFBPPR14929 ---- Microorganism protein ---- Histone H2A
Source.2273: DFBPPR14934 ---- Microorganism protein ---- ATP synthase subunit beta, mitochondrial
Source.2274: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.2275: DFBPPR14947 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 1
Source.2276: DFBPPR14950 ---- Microorganism protein ---- 5'-AMP-activated protein kinase subunit gamma
Source.2277: DFBPPR14953 ---- Microorganism protein ---- DNA ligase 4
Source.2278: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.2279: DFBPPR14975 ---- Microorganism protein ---- Inner kinetochore subunit CTF19
Source.2280: DFBPPR14978 ---- Microorganism protein ---- Histone H2A.Z
Source.2281: DFBPPR14979 ---- Microorganism protein ---- tRNA N6-adenosine threonylcarbamoyltransferase
Source.2282: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.2283: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1
Source.2284: DFBPPR14998 ---- Microorganism protein ---- Galactokinase
Source.2285: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.2286: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b
Source.2287: DFBPPR15013 ---- Microorganism protein ---- Inorganic pyrophosphatase
Source.2288: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase
Source.2289: DFBPPR15021 ---- Microorganism protein ---- Mitochondrial Rho GTPase 1
Source.2290: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.2291: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.2292: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.2293: DFBPPR15045 ---- Microorganism protein ---- Enolase
Source.2294: DFBPPR15051 ---- Microorganism protein ---- Autophagy-related protein 21
Source.2295: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.2296: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.2297: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.2298: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial
Source.2299: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase
Source.2300: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase
Source.2301: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.2302: DFBPPR15103 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein END3
Source.2303: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.2304: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10
Source.2305: DFBPPR15118 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC2
Source.2306: DFBPPR15131 ---- Microorganism protein ---- tRNA (guanine(9)-N1)-methyltransferase
Source.2307: DFBPPR15132 ---- Microorganism protein ---- Amino-acid acetyltransferase, mitochondrial
Source.2308: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.2309: DFBPPR15140 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP6
Source.2310: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter
Source.2311: DFBPPR15147 ---- Microorganism protein ---- Enoyl-[acyl-carrier-protein] reductase, mitochondrial
Source.2312: DFBPPR15148 ---- Microorganism protein ---- Riboflavin kinase
Source.2313: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase
Source.2314: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.2315: DFBPPR15158 ---- Microorganism protein ---- DASH complex subunit DAM1
Source.2316: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.2317: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.2318: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.2319: DFBPPR15182 ---- Microorganism protein ---- Mitochondrial transcription factor 1
Source.2320: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3
Source.2321: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.2322: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1
Source.2323: DFBPPR15221 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.2324: DFBPPR15226 ---- Microorganism protein ---- GPI mannosyltransferase 4
Source.2325: DFBPPR15229 ---- Microorganism protein ---- Glycylpeptide N-tetradecanoyltransferase
Source.2326: DFBPPR15245 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX18, mitochondrial
Source.2327: DFBPPR15257 ---- Microorganism protein ---- Ribosome biogenesis protein YTM1
Source.2328: DFBPPR15261 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit alpha
Source.2329: DFBPPR15275 ---- Microorganism protein ---- Exocyst complex protein EXO70
Source.2330: DFBPPR15290 ---- Microorganism protein ---- Peptidyl-prolyl cis-trans isomerase D
Source.2331: DFBPPR15297 ---- Microorganism protein ---- Transcriptional activator HAP2
Source.2332: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.2333: DFBPPR15317 ---- Microorganism protein ---- Phosphatidylinositol transfer protein SFH5
Source.2334: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial
Source.2335: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.2336: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.2337: DFBPPR15379 ---- Microorganism protein ---- General transcription and DNA repair factor IIH subunit TFB2
Source.2338: DFBPPR15380 ---- Microorganism protein ---- Probable kinetochore protein NDC80
Source.2339: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.2340: DFBPPR15389 ---- Microorganism protein ---- Topoisomerase 1-associated factor 1
Source.2341: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16
Source.2342: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.2343: DFBPPR15408 ---- Microorganism protein ---- Pre-rRNA-processing protein IPI3
Source.2344: DFBPPR15419 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 34
Source.2345: DFBPPR15428 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC24
Source.2346: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101
Source.2347: DFBPPR15440 ---- Microorganism protein ---- Mitochondrial homologous recombination protein 1
Source.2348: DFBPPR15441 ---- Microorganism protein ---- Vacuolar ATPase assembly integral membrane protein VMA21
Source.2349: DFBPPR15444 ---- Microorganism protein ---- Monopolar spindle protein 2
Source.2350: DFBPPR15449 ---- Microorganism protein ---- Increased recombination centers protein 22
Source.2351: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.2352: DFBPPR15474 ---- Microorganism protein ---- GPN-loop GTPase 3
Source.2353: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.2354: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46
Source.2355: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6
Source.2356: DFBPPR15496 ---- Microorganism protein ---- Cell division cycle protein 123
Source.2357: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.2358: DFBPPR15516 ---- Microorganism protein ---- mRNA 3'-end-processing protein RNA14
Source.2359: DFBPPR15521 ---- Microorganism protein ---- rRNA-processing protein EFG1
Source.2360: DFBPPR15537 ---- Microorganism protein ---- mRNA 3'-end-processing protein YTH1
Source.2361: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase
Source.2362: DFBPPR15548 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 25
Source.2363: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.2364: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1
Source.2365: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.2366: DFBPPR15586 ---- Microorganism protein ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.2367: DFBPPR15587 ---- Microorganism protein ---- Chromosome segregation in meiosis protein 3
Source.2368: DFBPPR15595 ---- Microorganism protein ---- MICOS complex subunit MIC27
Source.2369: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1
Source.2370: DFBPPR15609 ---- Microorganism protein ---- Shugoshin
Source.2371: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.2372: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.2373: DFBPPR15643 ---- Microorganism protein ---- Peroxisome assembly protein 22
Source.2374: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6
Source.2375: DFBPPR15658 ---- Microorganism protein ---- Protein DSE1
Source.2376: DFBPPR15671 ---- Microorganism protein ---- Outer spore wall protein 5
Source.2377: DFBPPR15676 ---- Microorganism protein ---- Antagonist of mitotic exit network protein 1
Source.2378: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2
Source.2379: DFBPPR15693 ---- Microorganism protein ---- Restriction of telomere capping protein 4
Source.2380: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3
Source.2381: DFBPPR15713 ---- Microorganism protein ---- ATPase expression protein 1, mitochondrial
Source.2382: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial
Source.2383: DFBPPR15725 ---- Microorganism protein ---- Protein DML1
Source.2384: DFBPPR15732 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 6, mitochondrial
Source.2385: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1
Source.2386: DFBPPR15738 ---- Microorganism protein ---- Regulator of rDNA transcription 14
Source.2387: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1
Source.2388: DFBPPR15759 ---- Microorganism protein ---- Transcriptional regulatory protein LGE1
Source.2389: DFBPPR15787 ---- Microorganism protein ---- Required for respiratory growth protein 7, mitochondrial
Source.2390: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase
Source.2391: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.2392: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.2393: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.2394: DFBPPR15832 ---- Microorganism protein ---- Uncharacterized protein in fgs 3'region
Source.2395: DFBPPR15856 ---- Microorganism protein ---- Laccase-2
Source.2396: DFBPPR15857 ---- Microorganism protein ---- Laccase-1
Source.2397: DFBPPR15867 ---- Microorganism protein ---- Superoxide dismutase [Mn], mitochondrial
Source.2398: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.2399: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1
Source.2400: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.2401: DFBPPR0008 ---- Plant protein ---- Gamma conglutin 2
Source.2402: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.2403: DFBPPR7767 ---- Plant protein ---- Adenylosuccinate synthetase 2, chloroplastic
Source.2404: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic
Source.2405: DFBPPR7771 ---- Plant protein ---- Inosine triphosphate pyrophosphatase
Source.2406: DFBPPR7775 ---- Plant protein ---- Photosystem II D2 protein
Source.2407: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2408: DFBPPR7791 ---- Plant protein ---- Translation factor GUF1 homolog, mitochondrial
Source.2409: DFBPPR7794 ---- Plant protein ---- Cytochrome b6
Source.2410: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.2411: DFBPPR7810 ---- Plant protein ---- Cytochrome f
Source.2412: DFBPPR7813 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1
Source.2413: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2414: DFBPPR7834 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase homolog 2
Source.2415: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.2416: DFBPPR7864 ---- Plant protein ---- ATP synthase epsilon chain, chloroplastic
Source.2417: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1
Source.2418: DFBPPR7924 ---- Plant protein ---- Kafirin PSKR2
Source.2419: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.2420: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.2421: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.2422: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.2423: DFBPPR7994 ---- Plant protein ---- Glyceraldehyde-3-phosphate dehydrogenase, cytosolic
Source.2424: DFBPPR8034 ---- Plant protein ---- Linoleate 9S-lipoxygenase 1
Source.2425: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.2426: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.2427: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.2428: DFBPPR8050 ---- Plant protein ---- Photosystem II D2 protein
Source.2429: DFBPPR8054 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin
Source.2430: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2431: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform
Source.2432: DFBPPR8074 ---- Plant protein ---- Carotenoid 9,10(9',10')-cleavage dioxygenase 1
Source.2433: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.2434: DFBPPR8091 ---- Plant protein ---- Cytochrome f
Source.2435: DFBPPR8096 ---- Plant protein ---- Erythroagglutinating phytohemagglutinin
Source.2436: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.2437: DFBPPR8107 ---- Plant protein ---- Stress-related protein
Source.2438: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.2439: DFBPPR8167 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin
Source.2440: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.2441: DFBPPR8226 ---- Plant protein ---- Photosystem II D2 protein
Source.2442: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.2443: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.2444: DFBPPR8259 ---- Plant protein ---- Cytochrome f
Source.2445: DFBPPR8271 ---- Plant protein ---- Cytochrome b6
Source.2446: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.2447: DFBPPR8285 ---- Plant protein ---- 26S proteasome regulatory subunit 6B homolog
Source.2448: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.2449: DFBPPR8307 ---- Plant protein ---- ATP synthase epsilon chain, chloroplastic
Source.2450: DFBPPR8323 ---- Plant protein ---- Cytochrome P450
Link-research
Link 1: DFBPACEI0404----Human milk protein----β-Casein
Biological/Functional activity & target protein
ACE-inhibitory activity

Amaranth trypsin-digested glutelins induce endothelial NO production and consequent vasodilation through their ACE-inhibitory activity. The peptide VLP was isolated from the highest active fraction, so the peptide was a potential Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory peptide (No valid IC50 value was determined in this study).

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydrolysis

Enzyme(s)/starter culture

Native amaranth glutelins were digested with trypsin (Sigma-Aldrich, St. Louis, MO, USA) at an enzyme/substrate ratio of 1:10 (w/w) for 10 h at 37 ℃.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

Amaranth trypsin-digested glutelins have a high potential as a nutraceutical food in prevention of cardiovascular diseases.

Database cross-references
DFBP
[D1] DFBPPEPI0084
[D2] DFBPMUFU0411
BIOPEP-UWM [D3] 2653
APD [D4] -
BioPepDB [D5] -
MBPDB [D6] -
Reference(s)
Primary literature de la Rosa AP, Montoya AB, Martínez-Cuevas P, Hernández-Ledesma B, León-Galván MF, De León-Rodríguez A, González C. Tryptic amaranth glutelin digests induce endothelial nitric oxide production through inhibition of ACE: antihypertensive role of amaranth peptides. Nitric Oxide. 2010 Sep 15;23(2):106-11.
PMID: 20435155
Other literature(s)

[1] Kohmura M, Nio N, Kubo K, et al. Inhibition of angiotensin-converting enzyme by synthetic peptides of human. BETA.-casein[J]. Journal of the Agricultural Chemical Society of Japan, 1989, 53(8):2107-2114.

PubDate 2010
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214