E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI2050(ACE-inhibitory peptide)
DFBP ID DFBPACEI2050
Peptide sequence NVA
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Asn-Val-Ala
Single-letter amino acid NVA
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
302.33 Da 302.33 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50 12.69 ± 1.50 μM
pIC50 -1.103
GRAVY 0.8333 c
Hydrophilic residue ratio 66.67% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Marine
Organism/Source Sea cucumber (Acaudina molpadioidea)
Precursor protein Sea cucumber protein
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0810 ---- Plant proteins ---- APETALA2-like protein 1
Source.2: DFBPPR0828 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC7
Source.3: DFBPPR0840 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 2
Source.4: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7
Source.5: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.6: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.7: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.8: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1
Source.9: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.10: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.11: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1
Source.12: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A
Source.13: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.14: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.15: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1
Source.16: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.17: DFBPPR0949 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK7
Source.18: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.19: DFBPPR0985 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK6
Source.20: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31
Source.21: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.22: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.23: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.24: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.25: DFBPPR1020 ---- Plant proteins ---- Calcium-transporting ATPase 5, plasma membrane-type
Source.26: DFBPPR1025 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog A
Source.27: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.28: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.29: DFBPPR1107 ---- Plant proteins ---- Phosphatidylinositol 4-kinase gamma 4
Source.30: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.31: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic
Source.32: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B
Source.33: DFBPPR1135 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 13
Source.34: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.35: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A
Source.36: DFBPPR1185 ---- Plant proteins ---- PHD finger protein EHD3
Source.37: DFBPPR1208 ---- Plant proteins ---- RNA polymerase sigma factor sigA
Source.38: DFBPPR1216 ---- Plant proteins ---- Pre-mRNA-processing factor 19
Source.39: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.40: DFBPPR1262 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 1
Source.41: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.42: DFBPPR1271 ---- Plant proteins ---- CBL-interacting protein kinase 23
Source.43: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.44: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6
Source.45: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22
Source.46: DFBPPR1309 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog B
Source.47: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.48: DFBPPR1316 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 2
Source.49: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.50: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.51: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1
Source.52: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.53: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1
Source.54: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.55: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING
Source.56: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.57: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.58: DFBPPR1413 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.59: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.60: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.61: DFBPPR1430 ---- Plant proteins ---- Eukaryotic initiation factor 4A-3
Source.62: DFBPPR1437 ---- Plant proteins ---- Topoisomerase 6 subunit A3
Source.63: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.64: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.65: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.66: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.67: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.68: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.69: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.70: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.71: DFBPPR1490 ---- Plant proteins ---- Transcription factor TGA2.1
Source.72: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1
Source.73: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.74: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.75: DFBPPR1523 ---- Plant proteins ---- Zinc transporter 5
Source.76: DFBPPR1532 ---- Plant proteins ---- Senescence-specific cysteine protease SAG39
Source.77: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.78: DFBPPR1557 ---- Plant proteins ---- WRKY transcription factor WRKY51
Source.79: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80
Source.80: DFBPPR1573 ---- Plant proteins ---- Heat stress transcription factor A-9
Source.81: DFBPPR1576 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.82: DFBPPR1580 ---- Plant proteins ---- Expansin-A4
Source.83: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.84: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2
Source.85: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7
Source.86: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.87: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.88: DFBPPR1665 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 1
Source.89: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial
Source.90: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.91: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.92: DFBPPR1702 ---- Plant proteins ---- Glutelin type-A 2
Source.93: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.94: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.95: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.96: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.97: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2
Source.98: DFBPPR1812 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9
Source.99: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2
Source.100: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.101: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.102: DFBPPR1835 ---- Plant proteins ---- Laccase-15
Source.103: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.104: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.105: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.106: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.107: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.108: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.109: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.110: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.111: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.112: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic
Source.113: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.114: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.115: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial
Source.116: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.117: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.118: DFBPPR1962 ---- Plant proteins ---- Expansin-A2
Source.119: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b
Source.120: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33
Source.121: DFBPPR2013 ---- Plant proteins ---- Laccase-6
Source.122: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.123: DFBPPR2021 ---- Plant proteins ---- Transcription factor TGAL1
Source.124: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.125: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.126: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15
Source.127: DFBPPR2059 ---- Plant proteins ---- Protein disulfide isomerase-like 1-5
Source.128: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.129: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1
Source.130: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.131: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23
Source.132: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.133: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.134: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.135: DFBPPR2175 ---- Plant proteins ---- Expansin-A16
Source.136: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.137: DFBPPR2197 ---- Plant proteins ---- Signal peptide peptidase-like 5
Source.138: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32
Source.139: DFBPPR2220 ---- Plant proteins ---- Expansin-A7
Source.140: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type
Source.141: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1
Source.142: DFBPPR2239 ---- Plant proteins ---- Elongation factor 1-alpha
Source.143: DFBPPR2242 ---- Plant proteins ---- Expansin-A3
Source.144: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial
Source.145: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.146: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.147: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4
Source.148: DFBPPR2316 ---- Plant proteins ---- 3-methyl-2-oxobutanoate hydroxymethyltransferase 2, mitochondrial
Source.149: DFBPPR2320 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 2
Source.150: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic
Source.151: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26
Source.152: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.153: DFBPPR2361 ---- Plant proteins ---- Iron-phytosiderophore transporter YSL15
Source.154: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.155: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.156: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.157: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.158: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1
Source.159: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3
Source.160: DFBPPR2445 ---- Plant proteins ---- Protein IRON-RELATED TRANSCRIPTION FACTOR 3
Source.161: DFBPPR2448 ---- Plant proteins ---- Expansin-A9
Source.162: DFBPPR2458 ---- Plant proteins ---- Monothiol glutaredoxin-S12, chloroplastic
Source.163: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.164: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.165: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14
Source.166: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.167: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13
Source.168: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase
Source.169: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.170: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.171: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase
Source.172: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.173: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5
Source.174: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.175: DFBPPR2609 ---- Plant proteins ---- Auxin response factor 15
Source.176: DFBPPR2611 ---- Plant proteins ---- Probable protein phosphatase 2C 57
Source.177: DFBPPR2618 ---- Plant proteins ---- Putative eukaryotic initiation factor 4A-2
Source.178: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.179: DFBPPR2656 ---- Plant proteins ---- Expansin-A15
Source.180: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33
Source.181: DFBPPR2670 ---- Plant proteins ---- Putative germin-like protein 2-2
Source.182: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.183: DFBPPR2676 ---- Plant proteins ---- Expansin-A11
Source.184: DFBPPR2679 ---- Plant proteins ---- Expansin-A22
Source.185: DFBPPR2683 ---- Plant proteins ---- Exonuclease 1
Source.186: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.187: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.188: DFBPPR2709 ---- Plant proteins ---- Long chain base biosynthesis protein 2b
Source.189: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.190: DFBPPR2735 ---- Plant proteins ---- Expansin-A24
Source.191: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.192: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700
Source.193: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.194: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.195: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.196: DFBPPR2793 ---- Plant proteins ---- MADS-box transcription factor 33
Source.197: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6
Source.198: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.199: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3
Source.200: DFBPPR2811 ---- Plant proteins ---- Protein TIFY 6a
Source.201: DFBPPR2812 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 1
Source.202: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.203: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.204: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2
Source.205: DFBPPR2851 ---- Plant proteins ---- Non-specific lipid-transfer protein 2B
Source.206: DFBPPR2878 ---- Plant proteins ---- 26S proteasome non-ATPase regulatory subunit 4 homolog
Source.207: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.208: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.209: DFBPPR2900 ---- Plant proteins ---- Expansin-A23
Source.210: DFBPPR2906 ---- Plant proteins ---- Transcription factor TGA2.2
Source.211: DFBPPR2910 ---- Plant proteins ---- Expansin-B5
Source.212: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.213: DFBPPR2920 ---- Plant proteins ---- Putative germin-like protein 2-3
Source.214: DFBPPR2936 ---- Plant proteins ---- Putative germin-like protein 2-1
Source.215: DFBPPR2944 ---- Plant proteins ---- Putative expansin-A27
Source.216: DFBPPR2948 ---- Plant proteins ---- Expansin-A25
Source.217: DFBPPR2964 ---- Plant proteins ---- Expansin-A14
Source.218: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic
Source.219: DFBPPR2982 ---- Plant proteins ---- SKP1-like protein 5
Source.220: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic
Source.221: DFBPPR2990 ---- Plant proteins ---- Eukaryotic initiation factor 4A-1
Source.222: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.223: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.224: DFBPPR3001 ---- Plant proteins ---- Probable high-affinity nitrate transporter 2.4
Source.225: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800
Source.226: DFBPPR3016 ---- Plant proteins ---- Expansin-A29
Source.227: DFBPPR3027 ---- Plant proteins ---- Expansin-A31
Source.228: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.229: DFBPPR3037 ---- Plant proteins ---- Transcription factor TGA2.3
Source.230: DFBPPR3053 ---- Plant proteins ---- Beta-glucosidase 18
Source.231: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.232: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.233: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.234: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.235: DFBPPR3094 ---- Plant proteins ---- UDP-glucose 4-epimerase 4
Source.236: DFBPPR3104 ---- Plant proteins ---- Beta-glucosidase 3
Source.237: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial
Source.238: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.239: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.240: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.241: DFBPPR3132 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 1
Source.242: DFBPPR3148 ---- Plant proteins ---- Growth-regulating factor 8
Source.243: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.244: DFBPPR3232 ---- Plant proteins ---- Expansin-A28
Source.245: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic
Source.246: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.247: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.248: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.249: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.250: DFBPPR3293 ---- Plant proteins ---- Protein-ribulosamine 3-kinase, chloroplastic
Source.251: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.252: DFBPPR3302 ---- Plant proteins ---- Expansin-A21
Source.253: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18
Source.254: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.255: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.256: DFBPPR3328 ---- Plant proteins ---- Putative expansin-A30
Source.257: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial
Source.258: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2
Source.259: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.260: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.261: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7
Source.262: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.263: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.264: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.265: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27
Source.266: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.267: DFBPPR3486 ---- Plant proteins ---- Probable nucleoredoxin 3
Source.268: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.269: DFBPPR3510 ---- Plant proteins ---- Thioredoxin-like protein Clot
Source.270: DFBPPR3513 ---- Plant proteins ---- Squamosa promoter-binding-like protein 14
Source.271: DFBPPR3515 ---- Plant proteins ---- Coatomer subunit delta-4
Source.272: DFBPPR3527 ---- Plant proteins ---- Elongation factor 1-delta 1
Source.273: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.274: DFBPPR3533 ---- Plant proteins ---- Peroxisomal membrane protein 11-4
Source.275: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.276: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.277: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.278: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76
Source.279: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.280: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.281: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.282: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4
Source.283: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3
Source.284: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9
Source.285: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.286: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.287: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1
Source.288: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.289: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2
Source.290: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1
Source.291: DFBPPR3770 ---- Plant proteins ---- Putative DEAD-box ATP-dependent RNA helicase 51
Source.292: DFBPPR3803 ---- Plant proteins ---- Probable trehalase
Source.293: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.294: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog
Source.295: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C
Source.296: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78
Source.297: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29
Source.298: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1
Source.299: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic
Source.300: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.301: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.302: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.303: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.304: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.305: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2
Source.306: DFBPPR3934 ---- Plant proteins ---- Probable calcium-binding protein CML8
Source.307: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA
Source.308: DFBPPR3959 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.309: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic
Source.310: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.311: DFBPPR3979 ---- Plant proteins ---- Probable uridine nucleosidase 1
Source.312: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.313: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.314: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.315: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A
Source.316: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.317: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.318: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.319: DFBPPR4055 ---- Plant proteins ---- Serpin-ZXB
Source.320: DFBPPR4057 ---- Plant proteins ---- Non-specific lipid-transfer protein 2A
Source.321: DFBPPR4067 ---- Plant proteins ---- Kinesin-like protein KIN-10C
Source.322: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.323: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.324: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75
Source.325: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600
Source.326: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.327: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.328: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.329: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1
Source.330: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4
Source.331: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial
Source.332: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21
Source.333: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.334: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.335: DFBPPR4376 ---- Plant proteins ---- Probable calcium-binding protein CML13
Source.336: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.337: DFBPPR4408 ---- Plant proteins ---- Tubby-like F-box protein 5
Source.338: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.339: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.340: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1
Source.341: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.342: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.343: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein
Source.344: DFBPPR4505 ---- Plant proteins ---- TPD1 protein homolog 1B
Source.345: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.346: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.347: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.348: DFBPPR4587 ---- Plant proteins ---- Protein argonaute 13
Source.349: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.350: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5
Source.351: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.352: DFBPPR4639 ---- Plant proteins ---- CASP-like protein 4D1
Source.353: DFBPPR4699 ---- Plant proteins ---- Probable GTP-binding protein OBGC2
Source.354: DFBPPR4705 ---- Plant proteins ---- 40S ribosomal protein S26
Source.355: DFBPPR4744 ---- Plant proteins ---- BURP domain-containing protein 3
Source.356: DFBPPR4765 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 57
Source.357: DFBPPR4774 ---- Plant proteins ---- B3 domain-containing protein Os01g0234100
Source.358: DFBPPR4817 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 20
Source.359: DFBPPR4819 ---- Plant proteins ---- B3 domain-containing protein Os08g0324300
Source.360: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic
Source.361: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase
Source.362: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.363: DFBPPR4933 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 7
Source.364: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.365: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.366: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650
Source.367: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase
Source.368: DFBPPR4978 ---- Plant proteins ---- 2-hydroxyisoflavanone dehydratase
Source.369: DFBPPR4981 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.370: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.371: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.372: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.373: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.374: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.375: DFBPPR5060 ---- Plant proteins ---- Ferritin-4, chloroplastic
Source.376: DFBPPR5068 ---- Plant proteins ---- Ferritin-3, chloroplastic
Source.377: DFBPPR5085 ---- Plant proteins ---- Pyruvate kinase, cytosolic isozyme
Source.378: DFBPPR5093 ---- Plant proteins ---- Meiotic recombination protein DMC1 homolog
Source.379: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic
Source.380: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.381: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6
Source.382: DFBPPR5133 ---- Plant proteins ---- Elongation factor 1-alpha
Source.383: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.384: DFBPPR5171 ---- Plant proteins ---- Sucrose-binding protein
Source.385: DFBPPR5264 ---- Plant proteins ---- Casparian strip membrane protein 4
Source.386: DFBPPR5267 ---- Plant proteins ---- Casparian strip membrane protein 3
Source.387: DFBPPR5268 ---- Plant proteins ---- Casparian strip membrane protein 2
Source.388: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.389: DFBPPR5290 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.390: DFBPPR5306 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase
Source.391: DFBPPR5311 ---- Plant proteins ---- Nodulin-20
Source.392: DFBPPR5325 ---- Plant proteins ---- Nodulin-C51
Source.393: DFBPPR5332 ---- Plant proteins ---- Nodulin-20a
Source.394: DFBPPR5336 ---- Plant proteins ---- Nodulin-26B
Source.395: DFBPPR5342 ---- Plant proteins ---- Nodulin-44
Source.396: DFBPPR5356 ---- Plant proteins ---- Nodulin-23
Source.397: DFBPPR5358 ---- Plant proteins ---- 14-3-3-like protein D
Source.398: DFBPPR5362 ---- Plant proteins ---- 14-3-3-like protein C
Source.399: DFBPPR5393 ---- Plant proteins ---- Endochitinase A
Source.400: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.401: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.402: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.403: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.404: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.405: DFBPPR5453 ---- Plant proteins ---- Adenine nucleotide transporter BT1, chloroplastic/amyloplastic/mitochondrial
Source.406: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.407: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2
Source.408: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial
Source.409: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2
Source.410: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.411: DFBPPR5504 ---- Plant proteins ---- Malate dehydrogenase, cytoplasmic
Source.412: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.413: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3
Source.414: DFBPPR5545 ---- Plant proteins ---- Fructokinase-1
Source.415: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B
Source.416: DFBPPR5551 ---- Plant proteins ---- DNA repair protein RAD51 homolog A
Source.417: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.418: DFBPPR5557 ---- Plant proteins ---- Protein OPAQUE10
Source.419: DFBPPR5570 ---- Plant proteins ---- ATP synthase subunit beta, mitochondrial
Source.420: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.421: DFBPPR5578 ---- Plant proteins ---- Anthranilate O-methyltransferase 3
Source.422: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.423: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.424: DFBPPR5609 ---- Plant proteins ---- Anthranilate O-methyltransferase 1
Source.425: DFBPPR5670 ---- Plant proteins ---- Endochitinase B
Source.426: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.427: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.428: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2
Source.429: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.430: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.431: DFBPPR5790 ---- Plant proteins ---- Benzoate O-methyltransferase
Source.432: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic
Source.433: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase
Source.434: DFBPPR5822 ---- Plant proteins ---- Elongation factor 1-alpha
Source.435: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.436: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19
Source.437: DFBPPR5846 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.438: DFBPPR5853 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.439: DFBPPR5868 ---- Plant proteins ---- 22 kDa alpha-zein 16
Source.440: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.441: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.442: DFBPPR5937 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.443: DFBPPR5957 ---- Plant proteins ---- Protein FLOURY 2
Source.444: DFBPPR6032 ---- Plant proteins ---- 22 kDa alpha-zein 8b
Source.445: DFBPPR6057 ---- Plant proteins ---- Zein-alpha PMS1
Source.446: DFBPPR6063 ---- Plant proteins ---- Inactive anthranilate O-methyltransferase 1
Source.447: DFBPPR6067 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.448: DFBPPR6082 ---- Plant proteins ---- Zein-alpha 19D1
Source.449: DFBPPR6107 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.450: DFBPPR6123 ---- Plant proteins ---- 22 kDa alpha-zein 8
Source.451: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.452: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.453: DFBPPR6257 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.454: DFBPPR6272 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32, chloroplastic
Source.455: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.456: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.457: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic
Source.458: DFBPPR6307 ---- Plant proteins ---- Phytochrome-associated serine/threonine-protein phosphatase
Source.459: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase
Source.460: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic
Source.461: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.462: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.463: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.464: DFBPPR6377 ---- Plant proteins ---- Lectin
Source.465: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.466: DFBPPR6409 ---- Plant proteins ---- Pyruvate decarboxylase 2
Source.467: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.468: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.469: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.470: DFBPPR6433 ---- Plant proteins ---- Histone H1
Source.471: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha
Source.472: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase
Source.473: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.474: DFBPPR6464 ---- Plant proteins ---- 50S ribosomal protein 5, chloroplastic
Source.475: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.476: DFBPPR6492 ---- Plant proteins ---- Phospholipid hydroperoxide glutathione peroxidase, chloroplastic
Source.477: DFBPPR6493 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.478: DFBPPR6512 ---- Plant proteins ---- Photosystem I reaction center subunit V
Source.479: DFBPPR6540 ---- Plant proteins ---- Non-seed lectin
Source.480: DFBPPR6557 ---- Plant proteins ---- Protein phosphatase PP2A regulatory subunit A
Source.481: DFBPPR6674 ---- Plant proteins ---- Oxalate oxidase GF-3.8
Source.482: DFBPPR6719 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.483: DFBPPR6725 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.484: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.485: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1
Source.486: DFBPPR6779 ---- Plant proteins ---- Eukaryotic initiation factor 4A
Source.487: DFBPPR6794 ---- Plant proteins ---- Elongation factor 1-alpha
Source.488: DFBPPR6798 ---- Plant proteins ---- Transcription factor HBP-1b(c1)
Source.489: DFBPPR6800 ---- Plant proteins ---- Transcription factor HBP-1b(c38)
Source.490: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A
Source.491: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2
Source.492: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1
Source.493: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.494: DFBPPR6915 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.495: DFBPPR6939 ---- Plant proteins ---- Alpha/beta-gliadin A-V
Source.496: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5
Source.497: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6
Source.498: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7
Source.499: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4
Source.500: DFBPPR6986 ---- Plant proteins ---- Avenin-like b11
Source.501: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10
Source.502: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9
Source.503: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8
Source.504: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2
Source.505: DFBPPR6993 ---- Plant proteins ---- Avenin-like b3
Source.506: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.507: DFBPPR7009 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.508: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.509: DFBPPR7033 ---- Plant proteins ---- Lipoxygenase 2.3, chloroplastic
Source.510: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7
Source.511: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.512: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.513: DFBPPR7052 ---- Plant proteins ---- Protein synthesis inhibitor II
Source.514: DFBPPR7071 ---- Plant proteins ---- Serpin-Z4
Source.515: DFBPPR7072 ---- Plant proteins ---- Protein synthesis inhibitor I
Source.516: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.517: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.518: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial
Source.519: DFBPPR7143 ---- Plant proteins ---- L-lactate dehydrogenase A
Source.520: DFBPPR7144 ---- Plant proteins ---- L-lactate dehydrogenase B
Source.521: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.522: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.523: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3
Source.524: DFBPPR7156 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.525: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase
Source.526: DFBPPR7178 ---- Plant proteins ---- Elongation factor 1-alpha
Source.527: DFBPPR7182 ---- Plant proteins ---- Serine carboxypeptidase II-1
Source.528: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha
Source.529: DFBPPR7206 ---- Plant proteins ---- Photosystem I reaction center subunit V, chloroplastic
Source.530: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2
Source.531: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1
Source.532: DFBPPR7290 ---- Plant proteins ---- 50S ribosomal protein L14, chloroplastic
Source.533: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C
Source.534: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.535: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.536: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.537: DFBPPR7490 ---- Plant proteins ---- Cysteine proteinase COT44
Source.538: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.539: DFBPPR7513 ---- Plant proteins ---- Thioredoxin H-type 2
Source.540: DFBPPR7524 ---- Plant proteins ---- Non-specific lipid-transfer protein 3
Source.541: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.542: DFBPPR7618 ---- Milk proteins ---- Plasminogen
Source.543: DFBPPR7620 ---- Milk proteins ---- Polymeric immunoglobulin receptor
Source.544: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta
Source.545: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.546: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.547: DFBPPR8390 ---- Plant proteins ---- Galactose-binding lectin
Source.548: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.549: DFBPPR8420 ---- Plant proteins ---- Peroxygenase
Source.550: DFBPPR8434 ---- Plant proteins ---- Lectin
Source.551: DFBPPR8443 ---- Plant proteins ---- Non-specific lipid-transfer protein 1
Source.552: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.553: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.554: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.555: DFBPPR16014 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.556: DFBPPR16028 ---- Animal proteins ---- Presenilin-1
Source.557: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.558: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.559: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.560: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.561: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.562: DFBPPR16082 ---- Animal proteins ---- Ras-related protein Rab-9A
Source.563: DFBPPR16096 ---- Animal proteins ---- Protein CLN8
Source.564: DFBPPR16124 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall
Source.565: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.566: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.567: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.568: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.569: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.570: DFBPPR16229 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.571: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.572: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4
Source.573: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.574: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.575: DFBPPR16317 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.576: DFBPPR16318 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.577: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.578: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.579: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.580: DFBPPR16503 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.581: DFBPPR16505 ---- Animal proteins ---- Agouti-signaling protein
Source.582: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.583: DFBPPR16524 ---- Animal proteins ---- Suppressor of cytokine signaling 3
Source.584: DFBPPR16542 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.585: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.586: DFBPPR16556 ---- Animal proteins ---- C-C chemokine receptor type 3
Source.587: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.588: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.589: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.590: DFBPPR16599 ---- Animal proteins ---- Receptor-binding cancer antigen expressed on SiSo cells
Source.591: DFBPPR16624 ---- Animal proteins ---- Vascular cell adhesion protein 1
Source.592: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.593: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.594: DFBPPR16662 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.595: DFBPPR16779 ---- Animal proteins ---- Hemoglobin subunit beta
Source.596: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.597: DFBPPR16783 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.598: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.599: DFBPPR16812 ---- Animal proteins ---- Ribonuclease pancreatic
Source.600: DFBPPR16828 ---- Animal proteins ---- Coagulation factor X
Source.601: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.602: DFBPPR16864 ---- Animal proteins ---- Protein AMBP
Source.603: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.604: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.605: DFBPPR16936 ---- Animal proteins ---- DNA-(apurinic or apyrimidinic site) endonuclease
Source.606: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.607: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.608: DFBPPR16981 ---- Animal proteins ---- Clusterin
Source.609: DFBPPR17013 ---- Animal proteins ---- Presenilin-1
Source.610: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.611: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type
Source.612: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.613: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1
Source.614: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.615: DFBPPR17191 ---- Animal proteins ---- Toll-like receptor 4
Source.616: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.617: DFBPPR17279 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.618: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.619: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein
Source.620: DFBPPR17326 ---- Animal proteins ---- Prostaglandin reductase 1
Source.621: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.622: DFBPPR17339 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.623: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.624: DFBPPR17351 ---- Animal proteins ---- Patatin-like phospholipase domain-containing protein 2
Source.625: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.626: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.627: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.628: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.629: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.630: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.631: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.632: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.633: DFBPPR17455 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase
Source.634: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.635: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.636: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase
Source.637: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.638: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.639: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.640: DFBPPR17551 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.641: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.642: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1
Source.643: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor
Source.644: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.645: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16
Source.646: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.647: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase
Source.648: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.649: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.650: DFBPPR17813 ---- Animal proteins ---- Rab GDP dissociation inhibitor alpha
Source.651: DFBPPR17826 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.652: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.653: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.654: DFBPPR17839 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM13
Source.655: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.656: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.657: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial
Source.658: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.659: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.660: DFBPPR17898 ---- Animal proteins ---- Endonuclease G, mitochondrial
Source.661: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.662: DFBPPR17917 ---- Animal proteins ---- Poly(ADP-ribose) glycohydrolase
Source.663: DFBPPR17970 ---- Animal proteins ---- Profilin-2
Source.664: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.665: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.666: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta
Source.667: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5
Source.668: DFBPPR18068 ---- Animal proteins ---- Annexin A11
Source.669: DFBPPR18075 ---- Animal proteins ---- ATP synthase subunit d, mitochondrial
Source.670: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.671: DFBPPR18098 ---- Animal proteins ---- Transforming growth factor beta activator LRRC33
Source.672: DFBPPR18122 ---- Animal proteins ---- Microtubule-associated protein 4
Source.673: DFBPPR18127 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.674: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.675: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.676: DFBPPR18218 ---- Animal proteins ---- Dual specificity protein phosphatase 6
Source.677: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial
Source.678: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.679: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.680: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.681: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.682: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.683: DFBPPR18315 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.684: DFBPPR18322 ---- Animal proteins ---- Stomatin-like protein 2, mitochondrial
Source.685: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.686: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5
Source.687: DFBPPR18386 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.688: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos
Source.689: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.690: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.691: DFBPPR18451 ---- Animal proteins ---- Suppressor of cytokine signaling 3
Source.692: DFBPPR18465 ---- Animal proteins ---- Photoreceptor-specific nuclear receptor
Source.693: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.694: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.695: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.696: DFBPPR18590 ---- Animal proteins ---- Retinol-binding protein 1
Source.697: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.698: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1
Source.699: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial
Source.700: DFBPPR18644 ---- Animal proteins ---- Histone deacetylase 1
Source.701: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial
Source.702: DFBPPR18724 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.703: DFBPPR18731 ---- Animal proteins ---- 39S ribosomal protein L10, mitochondrial
Source.704: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.705: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.706: DFBPPR18774 ---- Animal proteins ---- Testis-specific serine/threonine-protein kinase 1
Source.707: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8
Source.708: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1
Source.709: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.710: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.711: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.712: DFBPPR18858 ---- Animal proteins ---- tRNA (guanine(37)-N1)-methyltransferase
Source.713: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.714: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.715: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.716: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.717: DFBPPR18948 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL1
Source.718: DFBPPR18975 ---- Animal proteins ---- Ribosome maturation protein SBDS
Source.719: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.720: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase
Source.721: DFBPPR19009 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 1
Source.722: DFBPPR19013 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3
Source.723: DFBPPR19046 ---- Animal proteins ---- Stress-associated endoplasmic reticulum protein 1
Source.724: DFBPPR19048 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit B
Source.725: DFBPPR19052 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.726: DFBPPR19066 ---- Animal proteins ---- Agouti-signaling protein
Source.727: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3
Source.728: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.729: DFBPPR19091 ---- Animal proteins ---- Ribonuclease H2 subunit A
Source.730: DFBPPR19136 ---- Animal proteins ---- Proteasome subunit beta type-5
Source.731: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8
Source.732: DFBPPR19153 ---- Animal proteins ---- Copine-6
Source.733: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase
Source.734: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.735: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog
Source.736: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.737: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.738: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.739: DFBPPR19308 ---- Animal proteins ---- Nuclear receptor subfamily 2 group C member 1
Source.740: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.741: DFBPPR19345 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.742: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.743: DFBPPR19384 ---- Animal proteins ---- Complement component C9
Source.744: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.745: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2
Source.746: DFBPPR19441 ---- Animal proteins ---- Keratin, type II cytoskeletal 71
Source.747: DFBPPR19442 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit G
Source.748: DFBPPR19461 ---- Animal proteins ---- 28S ribosomal protein S9, mitochondrial
Source.749: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.750: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.751: DFBPPR19516 ---- Animal proteins ---- Protein phosphatase 1L
Source.752: DFBPPR19552 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.753: DFBPPR19553 ---- Animal proteins ---- DnaJ homolog subfamily A member 2
Source.754: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.755: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.756: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.757: DFBPPR19588 ---- Animal proteins ---- Prostaglandin reductase 2
Source.758: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin
Source.759: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.760: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein
Source.761: DFBPPR19676 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.762: DFBPPR19677 ---- Animal proteins ---- Pantothenate kinase 3
Source.763: DFBPPR19750 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.764: DFBPPR19788 ---- Animal proteins ---- Sulfotransferase family cytosolic 1B member 1
Source.765: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.766: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase
Source.767: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.768: DFBPPR19837 ---- Animal proteins ---- Ribonuclease P protein subunit p30
Source.769: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.770: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.771: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.772: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain
Source.773: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2
Source.774: DFBPPR19955 ---- Animal proteins ---- Hemoglobin subunit epsilon-2
Source.775: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.776: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.777: DFBPPR20053 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.778: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1
Source.779: DFBPPR20103 ---- Animal proteins ---- Protein MAL2
Source.780: DFBPPR20218 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL9
Source.781: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.782: DFBPPR20286 ---- Animal proteins ---- Nuclear transcription factor Y subunit beta
Source.783: DFBPPR20296 ---- Animal proteins ---- Claudin-18
Source.784: DFBPPR20305 ---- Animal proteins ---- Nostrin
Source.785: DFBPPR20315 ---- Animal proteins ---- Probable arginine--tRNA ligase, mitochondrial
Source.786: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha
Source.787: DFBPPR20422 ---- Animal proteins ---- WD repeat-containing protein 61
Source.788: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.789: DFBPPR20461 ---- Animal proteins ---- U6 snRNA-associated Sm-like protein LSm8
Source.790: DFBPPR20466 ---- Animal proteins ---- Ribonuclease P protein subunit p38
Source.791: DFBPPR20477 ---- Animal proteins ---- PAX-interacting protein 1
Source.792: DFBPPR20483 ---- Animal proteins ---- Thioredoxin-related transmembrane protein 1
Source.793: DFBPPR20486 ---- Animal proteins ---- Ethanolamine-phosphate phospho-lyase
Source.794: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.795: DFBPPR20534 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.796: DFBPPR20537 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 3
Source.797: DFBPPR20556 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.798: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta
Source.799: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related
Source.800: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3
Source.801: DFBPPR20601 ---- Animal proteins ---- Glucocorticoid modulatory element-binding protein 1
Source.802: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.803: DFBPPR20620 ---- Animal proteins ---- GDP-D-glucose phosphorylase 1
Source.804: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial
Source.805: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.806: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein
Source.807: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.808: DFBPPR20820 ---- Animal proteins ---- D-2-hydroxyglutarate dehydrogenase, mitochondrial
Source.809: DFBPPR20853 ---- Animal proteins ---- Hemopexin
Source.810: DFBPPR20882 ---- Animal proteins ---- Histone chaperone ASF1B
Source.811: DFBPPR20902 ---- Animal proteins ---- tRNA wybutosine-synthesizing protein 2 homolog
Source.812: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.813: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1
Source.814: DFBPPR20993 ---- Animal proteins ---- 39S ribosomal protein L12, mitochondrial
Source.815: DFBPPR21013 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit D
Source.816: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B
Source.817: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48
Source.818: DFBPPR21050 ---- Animal proteins ---- Tudor domain-containing protein 3
Source.819: DFBPPR21053 ---- Animal proteins ---- V-type proton ATPase subunit D
Source.820: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148
Source.821: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4
Source.822: DFBPPR21116 ---- Animal proteins ---- Suppressor of cytokine signaling 5
Source.823: DFBPPR21194 ---- Animal proteins ---- Thyroxine-binding globulin
Source.824: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog
Source.825: DFBPPR21210 ---- Animal proteins ---- T-cell receptor-associated transmembrane adapter 1
Source.826: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.827: DFBPPR21236 ---- Animal proteins ---- Hydroxysteroid 11-beta-dehydrogenase 1-like protein
Source.828: DFBPPR21260 ---- Animal proteins ---- 40S ribosomal protein S21
Source.829: DFBPPR21278 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 2
Source.830: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.831: DFBPPR21352 ---- Animal proteins ---- Glutathione peroxidase 7
Source.832: DFBPPR21378 ---- Animal proteins ---- Kinesin light chain 3
Source.833: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C
Source.834: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.835: DFBPPR21469 ---- Animal proteins ---- Probable glutathione peroxidase 8
Source.836: DFBPPR21490 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.837: DFBPPR21506 ---- Animal proteins ---- Origin recognition complex subunit 3
Source.838: DFBPPR21519 ---- Animal proteins ---- Stress-associated endoplasmic reticulum protein 2
Source.839: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.840: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.841: DFBPPR21602 ---- Animal proteins ---- Aspartate beta-hydroxylase domain-containing protein 1
Source.842: DFBPPR21621 ---- Animal proteins ---- Death-associated protein-like 1
Source.843: DFBPPR21661 ---- Animal proteins ---- Arginine/serine-rich coiled-coil protein 2
Source.844: DFBPPR21683 ---- Animal proteins ---- Serine protease 23
Source.845: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like
Source.846: DFBPPR21692 ---- Animal proteins ---- Mitotic-spindle organizing protein 2
Source.847: DFBPPR21704 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 5
Source.848: DFBPPR21712 ---- Animal proteins ---- Serpin E3
Source.849: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2
Source.850: DFBPPR21733 ---- Animal proteins ---- RUN domain-containing protein 3A
Source.851: DFBPPR21745 ---- Animal proteins ---- Mastermind-like protein 2
Source.852: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.853: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.854: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.855: DFBPPR21843 ---- Animal proteins ---- Tektin-1
Source.856: DFBPPR21852 ---- Animal proteins ---- Zinc finger MYM-type protein 5
Source.857: DFBPPR21873 ---- Animal proteins ---- Vitrin
Source.858: DFBPPR21903 ---- Animal proteins ---- Inactive serine protease 35
Source.859: DFBPPR21937 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 2
Source.860: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.861: DFBPPR22093 ---- Animal proteins ---- F-box only protein 3
Source.862: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.863: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.864: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein
Source.865: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1
Source.866: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.867: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.868: DFBPPR22266 ---- Animal proteins ---- Vexin
Source.869: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.870: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial
Source.871: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.872: DFBPPR22303 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 4
Source.873: DFBPPR22326 ---- Animal proteins ---- WD repeat-containing protein 70
Source.874: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.875: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.876: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63
Source.877: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.878: DFBPPR22365 ---- Animal proteins ---- Melanoma-associated antigen D4
Source.879: DFBPPR22496 ---- Animal proteins ---- Dysbindin domain-containing protein 1
Source.880: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101
Source.881: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9
Source.882: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13
Source.883: DFBPPR22601 ---- Animal proteins ---- Leukocyte receptor cluster member 1 homolog
Source.884: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128
Source.885: DFBPPR22616 ---- Animal proteins ---- Jhy protein homolog
Source.886: DFBPPR22627 ---- Animal proteins ---- Leucine-rich repeat-containing protein 61
Source.887: DFBPPR22658 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 32
Source.888: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog
Source.889: DFBPPR22698 ---- Animal proteins ---- Protein FAM228A
Source.890: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.891: DFBPPR8577 ---- Animal proteins ---- Nectin-1
Source.892: DFBPPR8590 ---- Animal proteins ---- Phospholipid hydroperoxide glutathione peroxidase
Source.893: DFBPPR8606 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.894: DFBPPR8614 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.895: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.896: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.897: DFBPPR8669 ---- Animal proteins ---- Heme oxygenase 1
Source.898: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.899: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.900: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.901: DFBPPR8840 ---- Animal proteins ---- Toll-like receptor 4
Source.902: DFBPPR8841 ---- Animal proteins ---- Glutamyl aminopeptidase
Source.903: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2
Source.904: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.905: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.906: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.907: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.908: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor
Source.909: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.910: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.911: DFBPPR9121 ---- Animal proteins ---- Endoplasmin
Source.912: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1
Source.913: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor
Source.914: DFBPPR9146 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.915: DFBPPR9185 ---- Animal proteins ---- Epididymal secretory glutathione peroxidase
Source.916: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.917: DFBPPR9222 ---- Animal proteins ---- Glutathione peroxidase 1
Source.918: DFBPPR9238 ---- Animal proteins ---- RNA-splicing ligase RtcB homolog
Source.919: DFBPPR9245 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.920: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.921: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.922: DFBPPR9312 ---- Animal proteins ---- 40S ribosomal protein S21
Source.923: DFBPPR9324 ---- Animal proteins ---- Carbohydrate-binding protein AQN-3
Source.924: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.925: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.926: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.927: DFBPPR9463 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.928: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.929: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.930: DFBPPR9516 ---- Animal proteins ---- L-lactate dehydrogenase C chain
Source.931: DFBPPR9570 ---- Animal proteins ---- Gastrokine-1
Source.932: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.933: DFBPPR9695 ---- Animal proteins ---- Seminal plasma sperm motility inhibitor
Source.934: DFBPPR9763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A beta isoform
Source.935: DFBPPR9764 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.936: DFBPPR9773 ---- Animal proteins ---- Rab GDP dissociation inhibitor beta
Source.937: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8
Source.938: DFBPPR9827 ---- Animal proteins ---- Guanylate cyclase activator 2B
Source.939: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.940: DFBPPR9933 ---- Animal proteins ---- Polymeric immunoglobulin receptor
Source.941: DFBPPR9955 ---- Animal proteins ---- Progesterone receptor
Source.942: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.943: DFBPPR10007 ---- Animal proteins ---- Protein Wnt-1
Source.944: DFBPPR10009 ---- Animal proteins ---- Transthyretin
Source.945: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.946: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.947: DFBPPR10057 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.948: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP]
Source.949: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.950: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.951: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.952: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.953: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.954: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3
Source.955: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.956: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.957: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.958: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.959: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.960: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8
Source.961: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.962: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.963: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.964: DFBPPR10189 ---- Animal proteins ---- Sonic hedgehog protein
Source.965: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.966: DFBPPR10214 ---- Animal proteins ---- Histone deacetylase 1
Source.967: DFBPPR10218 ---- Animal proteins ---- Occludin
Source.968: DFBPPR10219 ---- Animal proteins ---- Presenilin-1
Source.969: DFBPPR10228 ---- Animal proteins ---- Presenilin-2
Source.970: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.971: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1
Source.972: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.973: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.974: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP
Source.975: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.976: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.977: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.978: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.979: DFBPPR10349 ---- Animal proteins ---- Leiomodin-2
Source.980: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.981: DFBPPR10352 ---- Animal proteins ---- Hemoglobin subunit beta
Source.982: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog
Source.983: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.984: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.985: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.986: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.987: DFBPPR10414 ---- Animal proteins ---- Pre-mRNA-processing factor 19
Source.988: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.989: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.990: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.991: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.992: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1
Source.993: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.994: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7
Source.995: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.996: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon
Source.997: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.998: DFBPPR10505 ---- Animal proteins ---- DNA-binding protein Ikaros
Source.999: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.1000: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.1001: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3
Source.1002: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.1003: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.1004: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.1005: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.1006: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.1007: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.1008: DFBPPR10623 ---- Animal proteins ---- Pyruvate kinase PKM
Source.1009: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2
Source.1010: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.1011: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.1012: DFBPPR10672 ---- Animal proteins ---- Nibrin
Source.1013: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.1014: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.1015: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.1016: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.1017: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.1018: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.1019: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.1020: DFBPPR10836 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.1021: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5
Source.1022: DFBPPR10863 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.1023: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.1024: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.1025: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.1026: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.1027: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.1028: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48
Source.1029: DFBPPR10938 ---- Animal proteins ---- Serine/threonine-protein kinase mos
Source.1030: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2
Source.1031: DFBPPR10950 ---- Animal proteins ---- Ovalbumin-related protein Y
Source.1032: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1
Source.1033: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain
Source.1034: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.1035: DFBPPR10990 ---- Animal proteins ---- Period circadian protein homolog 2
Source.1036: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.1037: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.1038: DFBPPR11039 ---- Animal proteins ---- Neurexin-3
Source.1039: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.1040: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.1041: DFBPPR11103 ---- Animal proteins ---- Ribosome maturation protein SBDS
Source.1042: DFBPPR11104 ---- Animal proteins ---- Importin subunit alpha-5
Source.1043: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.1044: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain
Source.1045: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.1046: DFBPPR11164 ---- Animal proteins ---- Nuclear transcription factor Y subunit beta
Source.1047: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.1048: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.1049: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase
Source.1050: DFBPPR11245 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.1051: DFBPPR11267 ---- Animal proteins ---- Apolipoprotein B
Source.1052: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.1053: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.1054: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog
Source.1055: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog
Source.1056: DFBPPR11355 ---- Animal proteins ---- Collectin-10
Source.1057: DFBPPR11364 ---- Animal proteins ---- Interleukin-18
Source.1058: DFBPPR11369 ---- Animal proteins ---- SAGA-associated factor 29
Source.1059: DFBPPR11388 ---- Animal proteins ---- Matrilin-3
Source.1060: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.1061: DFBPPR11395 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 7A
Source.1062: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF
Source.1063: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.1064: DFBPPR11420 ---- Animal proteins ---- 60S acidic ribosomal protein P0
Source.1065: DFBPPR11439 ---- Animal proteins ---- Eukaryotic initiation factor 4A-II
Source.1066: DFBPPR11500 ---- Animal proteins ---- Ovalbumin-related protein X
Source.1067: DFBPPR11501 ---- Animal proteins ---- TIMELESS-interacting protein
Source.1068: DFBPPR11505 ---- Animal proteins ---- PRELI domain-containing protein 1, mitochondrial
Source.1069: DFBPPR11523 ---- Animal proteins ---- Myb-related protein A
Source.1070: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.1071: DFBPPR11545 ---- Animal proteins ---- Ubiquitin-associated domain-containing protein 2
Source.1072: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.1073: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622
Source.1074: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein
Source.1075: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.1076: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.1077: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4
Source.1078: DFBPPR11635 ---- Animal proteins ---- Cochlin
Source.1079: DFBPPR11637 ---- Animal proteins ---- 2-oxoglutarate and iron-dependent oxygenase JMJD4
Source.1080: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H
Source.1081: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.1082: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.1083: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1
Source.1084: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.1085: DFBPPR11875 ---- Animal proteins ---- WD repeat-containing protein 61
Source.1086: DFBPPR11879 ---- Animal proteins ---- Nicalin
Source.1087: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.1088: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2
Source.1089: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a
Source.1090: DFBPPR12005 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 2
Source.1091: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.1092: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.1093: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.1094: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.1095: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.1096: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.1097: DFBPPR12152 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.1098: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104
Source.1099: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.1100: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.1101: DFBPPR12249 ---- Animal proteins ---- Pyruvate kinase PKM
Source.1102: DFBPPR12255 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.1103: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1104: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.1105: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.1106: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.1107: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type
Source.1108: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.1109: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.1110: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.1111: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.1112: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1113: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.1114: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.1115: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.1116: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1
Source.1117: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.1118: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.1119: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon
Source.1120: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1
Source.1121: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.1122: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.1123: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1
Source.1124: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.1125: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.1126: DFBPPR12591 ---- Animal proteins ---- Annexin A11
Source.1127: DFBPPR12594 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.1128: DFBPPR12613 ---- Animal proteins ---- Glutathione peroxidase 1
Source.1129: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.1130: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.1131: DFBPPR12636 ---- Animal proteins ---- Complement component C9
Source.1132: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.1133: DFBPPR12710 ---- Animal proteins ---- Endoplasmin
Source.1134: DFBPPR12730 ---- Animal proteins ---- Eukaryotic peptide chain release factor subunit 1
Source.1135: DFBPPR12739 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP3
Source.1136: DFBPPR12758 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.1137: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.1138: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.1139: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.1140: DFBPPR12826 ---- Animal proteins ---- Eukaryotic initiation factor 4A-I
Source.1141: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11
Source.1142: DFBPPR12866 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.1143: DFBPPR12903 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.1144: DFBPPR12906 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3
Source.1145: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.1146: DFBPPR12975 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.1147: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.1148: DFBPPR13016 ---- Animal proteins ---- Bactericidal permeability-increasing protein
Source.1149: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.1150: DFBPPR13056 ---- Animal proteins ---- V-type proton ATPase subunit D
Source.1151: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.1152: DFBPPR13116 ---- Animal proteins ---- Ig gamma chain C region
Source.1153: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1154: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.1155: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha
Source.1156: DFBPPR13225 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1A
Source.1157: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.1158: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.1159: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.1160: DFBPPR13288 ---- Animal proteins ---- Eotaxin
Source.1161: DFBPPR13307 ---- Animal proteins ---- Hemoglobin subunit zeta
Source.1162: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.1163: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.1164: DFBPPR13355 ---- Animal proteins ---- Nuclear transcription factor Y subunit beta
Source.1165: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.1166: DFBPPR13430 ---- Animal proteins ---- Ribonuclease pancreatic
Source.1167: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.1168: DFBPPR13550 ---- Animal proteins ---- Corticotropin-releasing factor-binding protein
Source.1169: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1170: DFBPPR13607 ---- Animal proteins ---- Ribonuclease pancreatic
Source.1171: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.1172: DFBPPR13737 ---- Animal proteins ---- Glycogen phosphorylase, muscle form
Source.1173: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2
Source.1174: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.1175: DFBPPR13780 ---- Animal proteins ---- Glycogen phosphorylase, brain form
Source.1176: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.1177: DFBPPR13845 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.1178: DFBPPR13854 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1
Source.1179: DFBPPR13860 ---- Animal proteins ---- Thyroxine-binding globulin
Source.1180: DFBPPR13868 ---- Animal proteins ---- Carbonic anhydrase-related protein 11
Source.1181: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1182: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.1183: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B
Source.1184: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A
Source.1185: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.1186: DFBPPR14027 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.1187: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III
Source.1188: DFBPPR14095 ---- Marine protein ---- Enolase-phosphatase E1
Source.1189: DFBPPR14108 ---- Marine protein ---- 6-pyruvoyl tetrahydrobiopterin synthase
Source.1190: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.1191: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.1192: DFBPPR14205 ---- Marine protein ---- Intraflagellar transport protein 43 homolog A
Source.1193: DFBPPR14206 ---- Marine protein ---- Intraflagellar transport protein 43 homolog B
Source.1194: DFBPPR14289 ---- Marine protein ---- Allophycocyanin alpha chain
Source.1195: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.1196: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.1197: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.1198: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.1199: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.1200: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha
Source.1201: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic
Source.1202: DFBPPR14433 ---- Marine protein ---- 50S ribosomal protein L14, chloroplastic
Source.1203: DFBPPR14446 ---- Marine protein ---- 50S ribosomal protein L20, chloroplastic
Source.1204: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24
Source.1205: DFBPPR14520 ---- Marine protein ---- Uncharacterized protein ycf23
Source.1206: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.1207: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros
Source.1208: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible
Source.1209: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.1210: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4
Source.1211: DFBPPR14740 ---- Marine protein ---- DNA damage-inducible transcript 4-like protein
Source.1212: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.1213: DFBPPR14841 ---- Marine protein ---- Hemocyanin subunit 3
Source.1214: DFBPPR14854 ---- Marine protein ---- Fucolectin
Source.1215: DFBPPR14865 ---- Marine protein ---- Hemoglobin cathodic subunit beta
Source.1216: DFBPPR14881 ---- Microorganism protein ---- Decapping and exoribonuclease protein 1
Source.1217: DFBPPR14887 ---- Microorganism protein ---- Histone acetyltransferase ESA1
Source.1218: DFBPPR14896 ---- Microorganism protein ---- Farnesyl pyrophosphate synthase
Source.1219: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.1220: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.1221: DFBPPR14916 ---- Microorganism protein ---- Putative lipase ATG15
Source.1222: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.1223: DFBPPR14942 ---- Microorganism protein ---- Transcription initiation factor IIB
Source.1224: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.1225: DFBPPR14965 ---- Microorganism protein ---- NADPH-dependent diflavin oxidoreductase 1
Source.1226: DFBPPR14975 ---- Microorganism protein ---- Inner kinetochore subunit CTF19
Source.1227: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like
Source.1228: DFBPPR14988 ---- Microorganism protein ---- Isocitrate dehydrogenase [NAD] subunit 1, mitochondrial
Source.1229: DFBPPR15016 ---- Microorganism protein ---- Very-long-chain 3-oxoacyl-CoA reductase
Source.1230: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.1231: DFBPPR15037 ---- Microorganism protein ---- Regulatory protein SWI6
Source.1232: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase
Source.1233: DFBPPR15087 ---- Microorganism protein ---- Transcriptional activator HAP3
Source.1234: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1
Source.1235: DFBPPR15118 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC2
Source.1236: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.1237: DFBPPR15165 ---- Microorganism protein ---- Carbamoyl-phosphate synthase arginine-specific small chain
Source.1238: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.1239: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3
Source.1240: DFBPPR15189 ---- Microorganism protein ---- Inner kinetochore subunit NKP2
Source.1241: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9
Source.1242: DFBPPR15196 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP8
Source.1243: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.1244: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1
Source.1245: DFBPPR15221 ---- Microorganism protein ---- Cytochrome b-c1 complex subunit 2, mitochondrial
Source.1246: DFBPPR15269 ---- Microorganism protein ---- Endoplasmic reticulum vesicle protein 25
Source.1247: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.1248: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.1249: DFBPPR15320 ---- Microorganism protein ---- Chromatin modification-related protein EAF1
Source.1250: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial
Source.1251: DFBPPR15342 ---- Microorganism protein ---- Histone transcription regulator 3 homolog
Source.1252: DFBPPR15355 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.1253: DFBPPR15356 ---- Microorganism protein ---- ATP-dependent RNA helicase DED1
Source.1254: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.1255: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.1256: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.1257: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1
Source.1258: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.1259: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.1260: DFBPPR15502 ---- Microorganism protein ---- Mitochondrial distribution and morphology protein 32
Source.1261: DFBPPR15539 ---- Microorganism protein ---- Acyl-coenzyme A oxidase
Source.1262: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.1263: DFBPPR15562 ---- Microorganism protein ---- Mitotic spindle-associated protein SHE1
Source.1264: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1
Source.1265: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1
Source.1266: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9
Source.1267: DFBPPR15607 ---- Microorganism protein ---- Histone H2A.Z-specific chaperone CHZ1
Source.1268: DFBPPR15624 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit VAB2
Source.1269: DFBPPR15651 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 34, mitochondrial
Source.1270: DFBPPR15664 ---- Microorganism protein ---- Spindle pole body component SPC42
Source.1271: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial
Source.1272: DFBPPR15695 ---- Microorganism protein ---- Genetic interactor of prohibitin 5, mitochondrial
Source.1273: DFBPPR15723 ---- Microorganism protein ---- Regulator of free ubiquitin chains 1
Source.1274: DFBPPR15753 ---- Microorganism protein ---- KNR4/SMI1 homolog
Source.1275: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5
Source.1276: DFBPPR15777 ---- Microorganism protein ---- FAS1 domain-containing protein KLLA0E16841g
Source.1277: DFBPPR15791 ---- Microorganism protein ---- UPF0508 protein KLLA0A06237g
Source.1278: DFBPPR15810 ---- Microorganism protein ---- UDP-glucose 4-epimerase
Source.1279: DFBPPR15812 ---- Microorganism protein ---- ATP synthase subunit beta
Source.1280: DFBPPR15815 ---- Microorganism protein ---- Inositol 2-dehydrogenase/D-chiro-inositol 3-dehydrogenase
Source.1281: DFBPPR15823 ---- Microorganism protein ---- Tryptophan synthase alpha chain
Source.1282: DFBPPR15828 ---- Microorganism protein ---- Transcription antiterminator LacT
Source.1283: DFBPPR15834 ---- Microorganism protein ---- Succinyl-CoA:acetate CoA-transferase
Source.1284: DFBPPR15841 ---- Microorganism protein ---- Agaricus bisporus lectin
Source.1285: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase
Source.1286: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3
Source.1287: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.1288: DFBPPR0004 ---- Plant protein ---- Farnesyl pyrophosphate synthase 1
Source.1289: DFBPPR0005 ---- Plant protein ---- Farnesyl pyrophosphate synthase 2
Source.1290: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.1291: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.1292: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.1293: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial
Source.1294: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1295: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.1296: DFBPPR7836 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic
Source.1297: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha
Source.1298: DFBPPR7954 ---- Plant protein ---- Favin
Source.1299: DFBPPR7983 ---- Plant protein ---- 14-3-3-like protein B
Source.1300: DFBPPR8030 ---- Plant protein ---- Arcelin-5A
Source.1301: DFBPPR8032 ---- Plant protein ---- Alpha-amylase inhibitor 1
Source.1302: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.1303: DFBPPR8053 ---- Plant protein ---- Ferritin, chloroplastic
Source.1304: DFBPPR8073 ---- Plant protein ---- Arcelin-5B
Source.1305: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.1306: DFBPPR8092 ---- Plant protein ---- Alpha-amylase inhibitor 2
Source.1307: DFBPPR8128 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic
Source.1308: DFBPPR8167 ---- Plant protein ---- Leucoagglutinating phytohemagglutinin
Source.1309: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.1310: DFBPPR8230 ---- Plant protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic
Source.1311: DFBPPR8239 ---- Plant protein ---- Serine--tRNA ligase
Source.1312: DFBPPR8295 ---- Plant protein ---- Probable phospholipid hydroperoxide glutathione peroxidase
Source.1313: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.1314: DFBPPR8306 ---- Plant protein ---- 50S ribosomal protein L14, chloroplastic
Source.1315: DFBPPR8325 ---- Plant protein ---- 11 kDa late embryogenesis abundant protein
Source.1316: DFBPPR8332 ---- Plant protein ---- Glutathione peroxidase 1
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
ACE-inhibitory activity
  1. The peptide NVA showed potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 12.69 ± 1.50 μM.

  2. Molecular docking showed that PNVA formed a larger number of hydrogen bonds with ACE than NVA, while the proline at the N-terminal of peptide can affect the orientation of the binding site of ACE.

  3. The crystal structures of ACE (PDB ID: 2XYD)  bound with peptides were obtained from the Protein Data Bank (http://www.rcsb.org) for the docking studies.

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Non-bitter taste prediction
SMILES N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydrolysis

Enzyme(s)/starter culture

Trypsin (2.5 kU/g protein) and papain (2.5 kU/g protein) were added to Acaudina molpadioidea body wall protein solution and digested in a 50 ℃ water bath for 4 h.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

In this study, the researchers demonstrated that the addition of exogenous proline to Acaudina molpadioidea protein hydrolysates through the plastein reaction is a promising method to enhance the activity of natural ACE-inhibitory peptides.

Database cross-references
BIOPEP-UWM [D1] -
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Li J, Liu Z, Zhao Y, Zhu X, Yu R, Dong S, Wu H. Novel Natural Angiotensin Converting Enzyme (ACE)-Inhibitory Peptides Derived from Sea Cucumber-Modified Hydrolysates by Adding Exogenous Proline and a Study of Their Structure⁻Activity Relationship. Mar Drugs. 2018 Aug 4;16(8):271.
PMID: 30081563
Other literature(s) N.D
PubDate 2018
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214