E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI2141(ACE-inhibitory peptide)
DFBP ID DFBPACEI2141
Peptide sequence EVD
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity Antioxidative activity [D1], Multifunctional activity [D2]
Calculated physicochemical properties
Three-letter amino acid Glu-Val-Asp
Single-letter amino acid EVD
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
361.35 Da 361.35 Da c
Net charge 0.00 c
Isoelectric point (pI) 3.04 c
IC50 1.32 ± 0.05 mM (= 1320 ± 50 μM)
pIC50 -0.121
GRAVY -0.9333 c
Hydrophilic residue ratio 33.33% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal, Milk protein
Organism/Source Whey protein
Precursor protein β-Lactoglobulin (β-LG)
Residue position f(143-145)
Precursor protein(s) search
Source.1: DFBPPR0115 ---- Milk proteins ---- Beta-lactoglobulin
Source.2: DFBPPR0807 ---- Plant proteins ---- Protein EARLY HEADING DATE 2
Source.3: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2
Source.4: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.5: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.6: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.7: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A
Source.8: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1
Source.9: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.10: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.11: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.12: DFBPPR0891 ---- Plant proteins ---- Heat shock 70 kDa protein BIP1
Source.13: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.14: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.15: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.16: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.17: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.18: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.19: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.20: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.21: DFBPPR0962 ---- Plant proteins ---- Transcription factor MYBS3
Source.22: DFBPPR0969 ---- Plant proteins ---- Polyamine oxidase 1
Source.23: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic
Source.24: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic
Source.25: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50
Source.26: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21
Source.27: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.28: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1
Source.29: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.30: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.31: DFBPPR1016 ---- Plant proteins ---- Calcium-dependent protein kinase 12
Source.32: DFBPPR1034 ---- Plant proteins ---- bZIP transcription factor 50
Source.33: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.34: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56
Source.35: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.36: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A
Source.37: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4
Source.38: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.39: DFBPPR1116 ---- Plant proteins ---- Polycomb group protein EMF2B
Source.40: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.41: DFBPPR1124 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, cytoplasmic isoform
Source.42: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.43: DFBPPR1139 ---- Plant proteins ---- Kinesin-like protein KIN-13A
Source.44: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.45: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.46: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.47: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.48: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3
Source.49: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.50: DFBPPR1219 ---- Plant proteins ---- Guanylate kinase 2, chloroplastic/mitochondrial
Source.51: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.52: DFBPPR1247 ---- Plant proteins ---- Calcium-dependent protein kinase 15
Source.53: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15
Source.54: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.55: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.56: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.57: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.58: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.59: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.60: DFBPPR1303 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 6
Source.61: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.62: DFBPPR1313 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1
Source.63: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.64: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic
Source.65: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16
Source.66: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.67: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.68: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.69: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.70: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14
Source.71: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.72: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.73: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.74: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.75: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.76: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.77: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5
Source.78: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.79: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.80: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.81: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E
Source.82: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1
Source.83: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.84: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.85: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.86: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.87: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.88: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.89: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.90: DFBPPR1550 ---- Plant proteins ---- Transcription factor BHLH148
Source.91: DFBPPR1552 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 2
Source.92: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3
Source.93: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.94: DFBPPR1566 ---- Plant proteins ---- Transcription factor ILI5
Source.95: DFBPPR1572 ---- Plant proteins ---- Late embryogenesis abundant protein 17
Source.96: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.97: DFBPPR1587 ---- Plant proteins ---- CBL-interacting protein kinase 8
Source.98: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.99: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.100: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71
Source.101: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.102: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic
Source.103: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2
Source.104: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.105: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.106: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.107: DFBPPR1648 ---- Plant proteins ---- Transcription factor ILI4
Source.108: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.109: DFBPPR1651 ---- Plant proteins ---- Protein KTI12 homolog
Source.110: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.111: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.112: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3
Source.113: DFBPPR1687 ---- Plant proteins ---- Transcription factor ILI1
Source.114: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.115: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.116: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.117: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.118: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.119: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.120: DFBPPR1722 ---- Plant proteins ---- Protein TIFY 11a
Source.121: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.122: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.123: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2
Source.124: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.125: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.126: DFBPPR1748 ---- Plant proteins ---- 17.7 kDa class I heat shock protein
Source.127: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.128: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.129: DFBPPR1778 ---- Plant proteins ---- Mitogen-activated protein kinase 11
Source.130: DFBPPR1779 ---- Plant proteins ---- SPX domain-containing protein 3
Source.131: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic
Source.132: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.133: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.134: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.135: DFBPPR1805 ---- Plant proteins ---- Probable polyribonucleotide nucleotidyltransferase 1, chloroplastic
Source.136: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial
Source.137: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1
Source.138: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5
Source.139: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.140: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1
Source.141: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.142: DFBPPR1838 ---- Plant proteins ---- Aminopeptidase M1-C
Source.143: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.144: DFBPPR1850 ---- Plant proteins ---- Replication factor C subunit 1
Source.145: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.146: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.147: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.148: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.149: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.150: DFBPPR1901 ---- Plant proteins ---- Polyribonucleotide nucleotidyltransferase 2, mitochondrial
Source.151: DFBPPR1902 ---- Plant proteins ---- Transcription factor ILI6
Source.152: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.153: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.154: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.155: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2
Source.156: DFBPPR1923 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK2
Source.157: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.158: DFBPPR1929 ---- Plant proteins ---- Guanylate kinase 1
Source.159: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.160: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2
Source.161: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.162: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.163: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3
Source.164: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial
Source.165: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.166: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.167: DFBPPR2008 ---- Plant proteins ---- Putative MYST-like histone acetyltransferase 1
Source.168: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a
Source.169: DFBPPR2019 ---- Plant proteins ---- SPX domain-containing protein 5
Source.170: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.171: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic
Source.172: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial
Source.173: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11
Source.174: DFBPPR2054 ---- Plant proteins ---- NAC domain-containing protein 10
Source.175: DFBPPR2065 ---- Plant proteins ---- Protein TITANIA
Source.176: DFBPPR2070 ---- Plant proteins ---- Calmodulin-1
Source.177: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.178: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.179: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic
Source.180: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.181: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.182: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.183: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.184: DFBPPR2118 ---- Plant proteins ---- NAC domain-containing protein 45
Source.185: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.186: DFBPPR2138 ---- Plant proteins ---- 17.9 kDa class I heat shock protein
Source.187: DFBPPR2143 ---- Plant proteins ---- S-adenosylmethionine synthase 3
Source.188: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.189: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.190: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.191: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase
Source.192: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B
Source.193: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.194: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1
Source.195: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.196: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.197: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30
Source.198: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.199: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.200: DFBPPR2278 ---- Plant proteins ---- Zinc finger protein CO3
Source.201: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.202: DFBPPR2284 ---- Plant proteins ---- Probable glucan 1,3-alpha-glucosidase
Source.203: DFBPPR2288 ---- Plant proteins ---- DnaJ protein P58IPK homolog B
Source.204: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.205: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3
Source.206: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic
Source.207: DFBPPR2313 ---- Plant proteins ---- Kinesin-like protein KIN-UA
Source.208: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.209: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.210: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.211: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1
Source.212: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.213: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic
Source.214: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.215: DFBPPR2375 ---- Plant proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.216: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein
Source.217: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.218: DFBPPR2383 ---- Plant proteins ---- Probable ubiquitin receptor RAD23
Source.219: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.220: DFBPPR2394 ---- Plant proteins ---- Sucrose synthase 5
Source.221: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22
Source.222: DFBPPR2403 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.223: DFBPPR2410 ---- Plant proteins ---- Kinesin-like protein KIN-5B
Source.224: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.225: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1
Source.226: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1
Source.227: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic
Source.228: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.229: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.230: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2
Source.231: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.232: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.233: DFBPPR2534 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.234: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.235: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.236: DFBPPR2543 ---- Plant proteins ---- DNA topoisomerase 3-beta
Source.237: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.238: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic
Source.239: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.240: DFBPPR2562 ---- Plant proteins ---- WUSCHEL-related homeobox 9
Source.241: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.242: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.243: DFBPPR2587 ---- Plant proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 homolog
Source.244: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.245: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A
Source.246: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5
Source.247: DFBPPR2602 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX19
Source.248: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4
Source.249: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.250: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.251: DFBPPR2629 ---- Plant proteins ---- Calcineurin B-like protein 1
Source.252: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.253: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.254: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein
Source.255: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic
Source.256: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.257: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.258: DFBPPR2708 ---- Plant proteins ---- Ras-related protein RGP1
Source.259: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.260: DFBPPR2715 ---- Plant proteins ---- NAC domain-containing protein 77
Source.261: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5
Source.262: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.263: DFBPPR2745 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor EL2
Source.264: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7
Source.265: DFBPPR2757 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0157700
Source.266: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2
Source.267: DFBPPR2779 ---- Plant proteins ---- Auxin response factor 2
Source.268: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2
Source.269: DFBPPR2783 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.270: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A
Source.271: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B
Source.272: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.273: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.274: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.275: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.276: DFBPPR2858 ---- Plant proteins ---- Proton pump-interactor BIP103
Source.277: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.278: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.279: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.280: DFBPPR2893 ---- Plant proteins ---- Long chain base biosynthesis protein 1c
Source.281: DFBPPR2904 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 2
Source.282: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7
Source.283: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.284: DFBPPR2932 ---- Plant proteins ---- Auxin response factor 14
Source.285: DFBPPR2956 ---- Plant proteins ---- Tryptamine hydroxycinnamoyltransferase 1
Source.286: DFBPPR2967 ---- Plant proteins ---- Sucrose synthase 7
Source.287: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1
Source.288: DFBPPR2991 ---- Plant proteins ---- 26S proteasome regulatory subunit 6A homolog
Source.289: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13
Source.290: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.291: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.292: DFBPPR3031 ---- Plant proteins ---- Ent-kaurene oxidase-like protein 1
Source.293: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.294: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1
Source.295: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16
Source.296: DFBPPR3060 ---- Plant proteins ---- Polycomb group protein EMF2A
Source.297: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53
Source.298: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.299: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.300: DFBPPR3115 ---- Plant proteins ---- Nucleosome assembly protein 1;1
Source.301: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2
Source.302: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.303: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.304: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.305: DFBPPR3147 ---- Plant proteins ---- Elongation factor G, mitochondrial
Source.306: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.307: DFBPPR3161 ---- Plant proteins ---- Aquaporin PIP2-4
Source.308: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.309: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.310: DFBPPR3181 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX15
Source.311: DFBPPR3190 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX17
Source.312: DFBPPR3194 ---- Plant proteins ---- G patch domain-containing protein TGH homolog
Source.313: DFBPPR3196 ---- Plant proteins ---- Nicotianamine synthase 1
Source.314: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.315: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.316: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.317: DFBPPR3264 ---- Plant proteins ---- Copper chaperone for superoxide dismutase, chloroplastic
Source.318: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.319: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.320: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.321: DFBPPR3270 ---- Plant proteins ---- Calmodulin-like protein 1
Source.322: DFBPPR3272 ---- Plant proteins ---- NPL4-like protein
Source.323: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18
Source.324: DFBPPR3275 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 37
Source.325: DFBPPR3280 ---- Plant proteins ---- Long chain base biosynthesis protein 1b
Source.326: DFBPPR3287 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52B
Source.327: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5
Source.328: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.329: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8
Source.330: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.331: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.332: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.333: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1
Source.334: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28
Source.335: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.336: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.337: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.338: DFBPPR3433 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 3
Source.339: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F
Source.340: DFBPPR3437 ---- Plant proteins ---- Putative acetyl-coenzyme A carboxylase carboxyl transferase subunit beta-like protein
Source.341: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.342: DFBPPR3440 ---- Plant proteins ---- Agmatine hydroxycinnamoyltransferase 1
Source.343: DFBPPR3443 ---- Plant proteins ---- Calmodulin-2
Source.344: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.345: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68
Source.346: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14
Source.347: DFBPPR3477 ---- Plant proteins ---- Nicotianamine synthase 2
Source.348: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.349: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.350: DFBPPR3537 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 58, chloroplastic
Source.351: DFBPPR3545 ---- Plant proteins ---- Auxin response factor 3
Source.352: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8
Source.353: DFBPPR3556 ---- Plant proteins ---- Probable zinc metalloprotease EGY3, chloroplastic
Source.354: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.355: DFBPPR3574 ---- Plant proteins ---- Putative protein phosphatase 2C 76
Source.356: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3
Source.357: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.358: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19
Source.359: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.360: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2
Source.361: DFBPPR3600 ---- Plant proteins ---- Transcription factor NIGTH1
Source.362: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.363: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.364: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.365: DFBPPR3639 ---- Plant proteins ---- Calmodulin-3
Source.366: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9
Source.367: DFBPPR3669 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 41
Source.368: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.369: DFBPPR3674 ---- Plant proteins ---- Putative calmodulin-like protein 2
Source.370: DFBPPR3681 ---- Plant proteins ---- Transcription factor JAMYB
Source.371: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.372: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.373: DFBPPR3713 ---- Plant proteins ---- Probable NADH kinase
Source.374: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.375: DFBPPR3717 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM3
Source.376: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.377: DFBPPR3723 ---- Plant proteins ---- Inactive protein FON2 SPARE1
Source.378: DFBPPR3758 ---- Plant proteins ---- Target of rapamycin complex subunit LST8
Source.379: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog
Source.380: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.381: DFBPPR3801 ---- Plant proteins ---- Transcription termination factor MTERF4, chloroplastic
Source.382: DFBPPR3804 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 1, chloroplastic
Source.383: DFBPPR3818 ---- Plant proteins ---- 26S proteasome regulatory subunit 4 homolog
Source.384: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.385: DFBPPR3823 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 4
Source.386: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78
Source.387: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.388: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.389: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20
Source.390: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.391: DFBPPR3922 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-4 catalytic subunit
Source.392: DFBPPR3925 ---- Plant proteins ---- Squamosa promoter-binding-like protein 5
Source.393: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.394: DFBPPR3933 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-2 catalytic subunit
Source.395: DFBPPR3934 ---- Plant proteins ---- Probable calcium-binding protein CML8
Source.396: DFBPPR3938 ---- Plant proteins ---- Calmodulin-like protein 3
Source.397: DFBPPR3942 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 3
Source.398: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic
Source.399: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.400: DFBPPR3986 ---- Plant proteins ---- CRS2-associated factor 2, chloroplastic
Source.401: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.402: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.403: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.404: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.405: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.406: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta
Source.407: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.408: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.409: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.410: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.411: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.412: DFBPPR4125 ---- Plant proteins ---- Calmodulin-like protein 4
Source.413: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.414: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16
Source.415: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2
Source.416: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1
Source.417: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.418: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.419: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10
Source.420: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.421: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.422: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1
Source.423: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.424: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.425: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial
Source.426: DFBPPR4212 ---- Plant proteins ---- RNA pseudouridine synthase 1
Source.427: DFBPPR4217 ---- Plant proteins ---- Potassium transporter 26
Source.428: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4
Source.429: DFBPPR4228 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 2
Source.430: DFBPPR4233 ---- Plant proteins ---- Putative glutaredoxin-C2
Source.431: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2
Source.432: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4
Source.433: DFBPPR4262 ---- Plant proteins ---- Flavonoid O-methyltransferase-like protein Os11g0303600
Source.434: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.435: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.436: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.437: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11
Source.438: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform
Source.439: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10
Source.440: DFBPPR4343 ---- Plant proteins ---- Transcription factor ILI7
Source.441: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4
Source.442: DFBPPR4360 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47A
Source.443: DFBPPR4367 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 47B
Source.444: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.445: DFBPPR4374 ---- Plant proteins ---- WUSCHEL-related homeobox 10
Source.446: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.447: DFBPPR4380 ---- Plant proteins ---- Sucrose synthase 6
Source.448: DFBPPR4381 ---- Plant proteins ---- Transcription factor ILI3
Source.449: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15
Source.450: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.451: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.452: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.453: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.454: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.455: DFBPPR4465 ---- Plant proteins ---- Electron transfer flavoprotein subunit beta, mitochondrial
Source.456: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.457: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.458: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.459: DFBPPR4529 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 1
Source.460: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.461: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3
Source.462: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7
Source.463: DFBPPR4576 ---- Plant proteins ---- Probable calcium-binding protein CML7
Source.464: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.465: DFBPPR4622 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.466: DFBPPR4625 ---- Plant proteins ---- Actin-depolymerizing factor 2
Source.467: DFBPPR4637 ---- Plant proteins ---- Putative NAD kinase 3
Source.468: DFBPPR4657 ---- Plant proteins ---- Probable plastid-lipid-associated protein 3, chloroplastic
Source.469: DFBPPR4668 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 62
Source.470: DFBPPR4675 ---- Plant proteins ---- Cyclin-P4-1
Source.471: DFBPPR4694 ---- Plant proteins ---- Putative protein ABIL2
Source.472: DFBPPR4696 ---- Plant proteins ---- Uncharacterized protein ycf72
Source.473: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32
Source.474: DFBPPR4720 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 8
Source.475: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.476: DFBPPR4743 ---- Plant proteins ---- Protein Brevis radix-like 1
Source.477: DFBPPR4757 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 13
Source.478: DFBPPR4772 ---- Plant proteins ---- SEC1 family transport protein SLY1
Source.479: DFBPPR4778 ---- Plant proteins ---- B3 domain-containing protein Os03g0120900
Source.480: DFBPPR4784 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19
Source.481: DFBPPR4809 ---- Plant proteins ---- B3 domain-containing protein Os03g0164300
Source.482: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.483: DFBPPR4828 ---- Plant proteins ---- BURP domain-containing protein 6
Source.484: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200
Source.485: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080
Source.486: DFBPPR4895 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 7, chloroplastic
Source.487: DFBPPR4905 ---- Plant proteins ---- Light-regulated protein, chloroplastic
Source.488: DFBPPR4908 ---- Plant proteins ---- Calcium-dependent protein kinase 1
Source.489: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.490: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1
Source.491: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.492: DFBPPR4936 ---- Plant proteins ---- Kinesin-like protein KIN-1
Source.493: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A
Source.494: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.495: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase
Source.496: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic
Source.497: DFBPPR5041 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 2D
Source.498: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.499: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.500: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.501: DFBPPR5078 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.502: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.503: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.504: DFBPPR5106 ---- Plant proteins ---- Probable 2-isopropylmalate synthase
Source.505: DFBPPR5107 ---- Plant proteins ---- Cytochrome c oxidase subunit 2, mitochondrial
Source.506: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic
Source.507: DFBPPR5128 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.508: DFBPPR5139 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.509: DFBPPR5162 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.510: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.511: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2
Source.512: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.513: DFBPPR5206 ---- Plant proteins ---- Calmodulin-2
Source.514: DFBPPR5218 ---- Plant proteins ---- Arginine decarboxylase
Source.515: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.516: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.517: DFBPPR5240 ---- Plant proteins ---- Kunitz-type trypsin inhibitor KTI1
Source.518: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.519: DFBPPR5277 ---- Plant proteins ---- Cytochrome P450 97B2, chloroplastic
Source.520: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.521: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2
Source.522: DFBPPR5384 ---- Plant proteins ---- Acyclic sesquiterpene synthase
Source.523: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.524: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.525: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3
Source.526: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.527: DFBPPR5403 ---- Plant proteins ---- Homeotic protein knotted-1
Source.528: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.529: DFBPPR5465 ---- Plant proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.530: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1
Source.531: DFBPPR5471 ---- Plant proteins ---- Luminal-binding protein 2
Source.532: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.533: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase
Source.534: DFBPPR5544 ---- Plant proteins ---- Luminal-binding protein 3
Source.535: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.536: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.537: DFBPPR5588 ---- Plant proteins ---- 60S acidic ribosomal protein P2A
Source.538: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1
Source.539: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain
Source.540: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain
Source.541: DFBPPR5610 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.542: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.543: DFBPPR5620 ---- Plant proteins ---- Zeta-carotene desaturase, chloroplastic/chromoplastic
Source.544: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic
Source.545: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.546: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.547: DFBPPR5650 ---- Plant proteins ---- Enolase 1
Source.548: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.549: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.550: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.551: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.552: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase
Source.553: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.554: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.555: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.556: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.557: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5
Source.558: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.559: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.560: DFBPPR5761 ---- Plant proteins ---- Ferredoxin-6, chloroplastic
Source.561: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.562: DFBPPR5788 ---- Plant proteins ---- Globulin-1 S allele
Source.563: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase
Source.564: DFBPPR5812 ---- Plant proteins ---- tRNA (guanine-N(7)-)-methyltransferase
Source.565: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.566: DFBPPR5840 ---- Plant proteins ---- Probable histone deacetylase 19
Source.567: DFBPPR5842 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.568: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.569: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.570: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.571: DFBPPR5945 ---- Plant proteins ---- Calmodulin
Source.572: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1
Source.573: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.574: DFBPPR5971 ---- Plant proteins ---- Aquaporin PIP2-6
Source.575: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.576: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.577: DFBPPR5991 ---- Plant proteins ---- Myb-related protein Zm38
Source.578: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2
Source.579: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.580: DFBPPR6045 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog
Source.581: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.582: DFBPPR6126 ---- Plant proteins ---- Oil body-associated protein 1A
Source.583: DFBPPR6140 ---- Plant proteins ---- Uncharacterized protein ycf72
Source.584: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.585: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.586: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.587: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.588: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial
Source.589: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.590: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.591: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.592: DFBPPR6275 ---- Plant proteins ---- Ferredoxin-1, chloroplastic
Source.593: DFBPPR6295 ---- Plant proteins ---- Outer envelope pore protein 37, chloroplastic
Source.594: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.595: DFBPPR6313 ---- Plant proteins ---- Elongation factor Tu, chloroplastic
Source.596: DFBPPR6325 ---- Plant proteins ---- Monodehydroascorbate reductase
Source.597: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.598: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.599: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.600: DFBPPR6368 ---- Plant proteins ---- Provicilin
Source.601: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.602: DFBPPR6383 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.603: DFBPPR6386 ---- Plant proteins ---- ATP synthase subunit delta', mitochondrial
Source.604: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.605: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.606: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic
Source.607: DFBPPR6418 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.608: DFBPPR6424 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.609: DFBPPR6470 ---- Plant proteins ---- Vicilin
Source.610: DFBPPR6474 ---- Plant proteins ---- Stromal 70 kDa heat shock-related protein, chloroplastic
Source.611: DFBPPR6484 ---- Plant proteins ---- Cytochrome P450 97B1, chloroplastic
Source.612: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.613: DFBPPR6499 ---- Plant proteins ---- Provicilin
Source.614: DFBPPR6559 ---- Plant proteins ---- Truncated basic helix-loop-helix protein A
Source.615: DFBPPR6594 ---- Plant proteins ---- Unknown protein from spots 23/28/205 of 2D-PAGE of thylakoid
Source.616: DFBPPR6595 ---- Plant proteins ---- Unknown protein from spots 23/28/205 of 2D-PAGE of thylakoid
Source.617: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.618: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.619: DFBPPR6665 ---- Plant proteins ---- DELLA protein RHT-1
Source.620: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.621: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.622: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.623: DFBPPR6692 ---- Plant proteins ---- Cytochrome c oxidase subunit 2
Source.624: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.625: DFBPPR6705 ---- Plant proteins ---- Calmodulin
Source.626: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.627: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.628: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase
Source.629: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D
Source.630: DFBPPR6740 ---- Plant proteins ---- Phenylalanine ammonia-lyase
Source.631: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.632: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.633: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.634: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.635: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.636: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.637: DFBPPR6833 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.638: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.639: DFBPPR6854 ---- Plant proteins ---- Eukaryotic translation initiation factor 2 subunit beta
Source.640: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin
Source.641: DFBPPR6980 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.642: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.643: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2
Source.644: DFBPPR7028 ---- Plant proteins ---- Agmatine coumaroyltransferase-1
Source.645: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7
Source.646: DFBPPR7070 ---- Plant proteins ---- Red chlorophyll catabolite reductase
Source.647: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.648: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.649: DFBPPR7088 ---- Plant proteins ---- DELLA protein SLN1
Source.650: DFBPPR7113 ---- Plant proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase I, chloroplastic
Source.651: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.652: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2
Source.653: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.654: DFBPPR7159 ---- Plant proteins ---- Nicotianamine synthase 8
Source.655: DFBPPR7179 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.656: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.657: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog
Source.658: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.659: DFBPPR7202 ---- Plant proteins ---- UTP--glucose-1-phosphate uridylyltransferase
Source.660: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.661: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.662: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.663: DFBPPR7228 ---- Plant proteins ---- Calmodulin
Source.664: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.665: DFBPPR7240 ---- Plant proteins ---- Agmatine coumaroyltransferase-2
Source.666: DFBPPR7303 ---- Plant proteins ---- Probable nicotianamine synthase 4
Source.667: DFBPPR7304 ---- Plant proteins ---- Probable nicotianamine synthase 2
Source.668: DFBPPR7305 ---- Plant proteins ---- Probable nicotianamine synthase 6
Source.669: DFBPPR7306 ---- Plant proteins ---- Probable nicotianamine synthase 7
Source.670: DFBPPR7314 ---- Plant proteins ---- Translationally-controlled tumor protein homolog
Source.671: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic
Source.672: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.673: DFBPPR7415 ---- Plant proteins ---- Co-chaperone protein p23-1
Source.674: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.675: DFBPPR7453 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain F1, chloroplastic
Source.676: DFBPPR7468 ---- Plant proteins ---- Malate dehydrogenase 2, glyoxysomal
Source.677: DFBPPR7471 ---- Plant proteins ---- Malate dehydrogenase 1, glyoxysomal
Source.678: DFBPPR7478 ---- Plant proteins ---- Napin embryo-specific
Source.679: DFBPPR7482 ---- Plant proteins ---- Napin
Source.680: DFBPPR7492 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic
Source.681: DFBPPR7514 ---- Plant proteins ---- Floral homeotic protein AGAMOUS
Source.682: DFBPPR7518 ---- Plant proteins ---- Agamous-like MADS-box protein AGL15
Source.683: DFBPPR7528 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.684: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.685: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.686: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.687: DFBPPR7640 ---- Milk proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.688: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor
Source.689: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4
Source.690: DFBPPR7687 ---- Milk proteins ---- Beta-lactoglobulin
Source.691: DFBPPR7698 ---- Milk proteins ---- Beta-lactoglobulin-1/B
Source.692: DFBPPR7714 ---- Milk proteins ---- Beta-lactoglobulin
Source.693: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.694: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.695: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.696: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.697: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.698: DFBPPR8458 ---- Plant proteins ---- Catalase
Source.699: DFBPPR8491 ---- Milk proteins ---- Osteopontin
Source.700: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase
Source.701: DFBPPR8499 ---- Milk proteins ---- Beta-lactoglobulin
Source.702: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase
Source.703: DFBPPR8511 ---- Milk proteins ---- Transcobalamin-2
Source.704: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.705: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.706: DFBPPR15968 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain
Source.707: DFBPPR15978 ---- Animal proteins ---- 7,8-dihydro-8-oxoguanine triphosphatase
Source.708: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.709: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.710: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.711: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.712: DFBPPR16025 ---- Animal proteins ---- Transforming protein RhoA
Source.713: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.714: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.715: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.716: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.717: DFBPPR16062 ---- Animal proteins ---- Methylosome subunit pICln
Source.718: DFBPPR16064 ---- Animal proteins ---- Calnexin
Source.719: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2
Source.720: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.721: DFBPPR16082 ---- Animal proteins ---- Ras-related protein Rab-9A
Source.722: DFBPPR16083 ---- Animal proteins ---- Annexin A13
Source.723: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.724: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.725: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.726: DFBPPR16132 ---- Animal proteins ---- Signal peptidase complex catalytic subunit SEC11C
Source.727: DFBPPR16134 ---- Animal proteins ---- Growth hormone receptor
Source.728: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.729: DFBPPR16162 ---- Animal proteins ---- Minor allergen Can f 2
Source.730: DFBPPR16168 ---- Animal proteins ---- Annexin A2
Source.731: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.732: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.733: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.734: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2
Source.735: DFBPPR16182 ---- Animal proteins ---- Heat shock 70 kDa protein 1
Source.736: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.737: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.738: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.739: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.740: DFBPPR16226 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.741: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.742: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.743: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1
Source.744: DFBPPR16274 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.745: DFBPPR16277 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase
Source.746: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.747: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.748: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.749: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.750: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.751: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.752: DFBPPR16440 ---- Animal proteins ---- Inactive rhomboid protein 2
Source.753: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.754: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.755: DFBPPR16515 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.756: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.757: DFBPPR16537 ---- Animal proteins ---- Interleukin-2 receptor subunit alpha
Source.758: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.759: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.760: DFBPPR16568 ---- Animal proteins ---- Beta-lactoglobulin-1
Source.761: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.762: DFBPPR16614 ---- Animal proteins ---- Protein S100-A4
Source.763: DFBPPR16615 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1
Source.764: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.765: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8
Source.766: DFBPPR16674 ---- Animal proteins ---- Double-headed protease inhibitor, submandibular gland
Source.767: DFBPPR16713 ---- Animal proteins ---- Zinc finger protein 252
Source.768: DFBPPR16733 ---- Animal proteins ---- 40S ribosomal protein S17
Source.769: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46
Source.770: DFBPPR16739 ---- Animal proteins ---- Lengsin
Source.771: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10
Source.772: DFBPPR16765 ---- Animal proteins ---- Annexin A1 isoform p37
Source.773: DFBPPR16771 ---- Animal proteins ---- Argininosuccinate lyase
Source.774: DFBPPR16774 ---- Animal proteins ---- Annexin A1 isoform p35
Source.775: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.776: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase
Source.777: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.778: DFBPPR16840 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.779: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.780: DFBPPR16843 ---- Animal proteins ---- Calmodulin
Source.781: DFBPPR16844 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.782: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial
Source.783: DFBPPR16847 ---- Animal proteins ---- Fibrinogen alpha chain
Source.784: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.785: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor
Source.786: DFBPPR16876 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.787: DFBPPR16880 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 1
Source.788: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.789: DFBPPR16888 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.790: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial
Source.791: DFBPPR16899 ---- Animal proteins ---- Heat shock 70 kDa protein 1A
Source.792: DFBPPR16912 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.793: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.794: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.795: DFBPPR16932 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.796: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.797: DFBPPR16940 ---- Animal proteins ---- Ras-related protein Rap-1A
Source.798: DFBPPR16945 ---- Animal proteins ---- Transforming protein RhoA
Source.799: DFBPPR16952 ---- Animal proteins ---- Annexin A2
Source.800: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.801: DFBPPR16970 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.802: DFBPPR16981 ---- Animal proteins ---- Clusterin
Source.803: DFBPPR16982 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.804: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.805: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.806: DFBPPR17000 ---- Animal proteins ---- Vimentin
Source.807: DFBPPR17001 ---- Animal proteins ---- Serine/threonine-protein kinase 4
Source.808: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.809: DFBPPR17004 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.810: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1
Source.811: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.812: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.813: DFBPPR17050 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.814: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.815: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.816: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.817: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.818: DFBPPR17070 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF168
Source.819: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.820: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21
Source.821: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.822: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.823: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.824: DFBPPR17142 ---- Animal proteins ---- Medium-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.825: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.826: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.827: DFBPPR17167 ---- Animal proteins ---- Calcineurin subunit B type 1
Source.828: DFBPPR17202 ---- Animal proteins ---- Protein S100-A1
Source.829: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.830: DFBPPR17272 ---- Animal proteins ---- Dysbindin
Source.831: DFBPPR17296 ---- Animal proteins ---- Dynamin-2
Source.832: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.833: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.834: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3
Source.835: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.836: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.837: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.838: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.839: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.840: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.841: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.842: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.843: DFBPPR17396 ---- Animal proteins ---- Trans-acting T-cell-specific transcription factor GATA-3
Source.844: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.845: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.846: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5
Source.847: DFBPPR17425 ---- Animal proteins ---- Dynamin-1
Source.848: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.849: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.850: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase
Source.851: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform
Source.852: DFBPPR17504 ---- Animal proteins ---- Duodenase-1
Source.853: DFBPPR17515 ---- Animal proteins ---- 5'-nucleotidase
Source.854: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase
Source.855: DFBPPR17523 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.856: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial
Source.857: DFBPPR17563 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein A1
Source.858: DFBPPR17573 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.859: DFBPPR17576 ---- Animal proteins ---- Fibrillin-1
Source.860: DFBPPR17582 ---- Animal proteins ---- Ferroptosis suppressor protein 1
Source.861: DFBPPR17587 ---- Animal proteins ---- Lipoamide acyltransferase component of branched-chain alpha-keto acid dehydrogenase complex, mitochondrial
Source.862: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1
Source.863: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.864: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16
Source.865: DFBPPR17694 ---- Animal proteins ---- Pyridoxal kinase
Source.866: DFBPPR17754 ---- Animal proteins ---- Amelogenin, X isoform
Source.867: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.868: DFBPPR17782 ---- Animal proteins ---- Ras GTPase-activating protein-binding protein 1
Source.869: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3
Source.870: DFBPPR17801 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit rho-2
Source.871: DFBPPR17819 ---- Animal proteins ---- Ras-related protein Rap-1b
Source.872: DFBPPR17833 ---- Animal proteins ---- Histone-lysine N-methyltransferase SUV39H1
Source.873: DFBPPR17835 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.874: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.875: DFBPPR17843 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 33B
Source.876: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.877: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.878: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.879: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.880: DFBPPR17899 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.881: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.882: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.883: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.884: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.885: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A
Source.886: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3
Source.887: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.888: DFBPPR17940 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM38
Source.889: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.890: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.891: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.892: DFBPPR17952 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.893: DFBPPR17954 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member A
Source.894: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.895: DFBPPR17964 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 1
Source.896: DFBPPR17965 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.897: DFBPPR17974 ---- Animal proteins ---- Mimecan
Source.898: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.899: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase
Source.900: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1
Source.901: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.902: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.903: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5
Source.904: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.905: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.906: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.907: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8
Source.908: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.909: DFBPPR18089 ---- Animal proteins ---- Coatomer subunit delta
Source.910: DFBPPR18102 ---- Animal proteins ---- G1/S-specific cyclin-D1
Source.911: DFBPPR18104 ---- Animal proteins ---- Thioredoxin
Source.912: DFBPPR18150 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 1
Source.913: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.914: DFBPPR18162 ---- Animal proteins ---- Renin receptor
Source.915: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase
Source.916: DFBPPR18167 ---- Animal proteins ---- Ubiquitin thioesterase ZRANB1
Source.917: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.918: DFBPPR18247 ---- Animal proteins ---- Interferon regulatory factor 1
Source.919: DFBPPR18258 ---- Animal proteins ---- Prothymosin alpha
Source.920: DFBPPR18288 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.921: DFBPPR18291 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.922: DFBPPR18296 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.923: DFBPPR18300 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.924: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon
Source.925: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.926: DFBPPR18338 ---- Animal proteins ---- Kappa-type opioid receptor
Source.927: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.928: DFBPPR18366 ---- Animal proteins ---- Bone sialoprotein 2
Source.929: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain
Source.930: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.931: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1
Source.932: DFBPPR18398 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.933: DFBPPR18415 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-14
Source.934: DFBPPR18421 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.935: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.936: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.937: DFBPPR18443 ---- Animal proteins ---- Single-stranded DNA cytosine deaminase
Source.938: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.939: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.940: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.941: DFBPPR18455 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2B
Source.942: DFBPPR18461 ---- Animal proteins ---- Glutamine--tRNA ligase
Source.943: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.944: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3
Source.945: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor
Source.946: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8
Source.947: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.948: DFBPPR18518 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP1
Source.949: DFBPPR18563 ---- Animal proteins ---- Collectin-43
Source.950: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal
Source.951: DFBPPR18586 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoproteins A2/B1
Source.952: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.953: DFBPPR18603 ---- Animal proteins ---- Sodium channel subunit beta-4
Source.954: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.955: DFBPPR18609 ---- Animal proteins ---- ERO1-like protein alpha
Source.956: DFBPPR18614 ---- Animal proteins ---- Beta-enolase
Source.957: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta
Source.958: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.959: DFBPPR18635 ---- Animal proteins ---- Rho-related GTP-binding protein RhoB
Source.960: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.961: DFBPPR18637 ---- Animal proteins ---- Protein S100-A4
Source.962: DFBPPR18641 ---- Animal proteins ---- Cadherin-5
Source.963: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.964: DFBPPR18713 ---- Animal proteins ---- Arginase-1
Source.965: DFBPPR18736 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.966: DFBPPR18738 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.967: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.968: DFBPPR18777 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase-like 2
Source.969: DFBPPR18805 ---- Animal proteins ---- Nascent polypeptide-associated complex subunit alpha
Source.970: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.971: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.972: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.973: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.974: DFBPPR18839 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 12
Source.975: DFBPPR18848 ---- Animal proteins ---- Ras-related protein Rab-15
Source.976: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.977: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3
Source.978: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6
Source.979: DFBPPR18890 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase [NAD(+)], cytoplasmic
Source.980: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2
Source.981: DFBPPR18901 ---- Animal proteins ---- Nuclear factor of activated T-cells, cytoplasmic 1
Source.982: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.983: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.984: DFBPPR18975 ---- Animal proteins ---- Ribosome maturation protein SBDS
Source.985: DFBPPR18995 ---- Animal proteins ---- Tektin-3
Source.986: DFBPPR19007 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1
Source.987: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.988: DFBPPR19062 ---- Animal proteins ---- Protein farnesyltransferase subunit beta
Source.989: DFBPPR19064 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.990: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1
Source.991: DFBPPR19074 ---- Animal proteins ---- Lysophosphatidic acid phosphatase type 6
Source.992: DFBPPR19081 ---- Animal proteins ---- Fermitin family homolog 3
Source.993: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.994: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.995: DFBPPR19204 ---- Animal proteins ---- Regulator of G-protein signaling 7
Source.996: DFBPPR19214 ---- Animal proteins ---- N-acylneuraminate cytidylyltransferase
Source.997: DFBPPR19223 ---- Animal proteins ---- Caveolae-associated protein 4
Source.998: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog
Source.999: DFBPPR19231 ---- Animal proteins ---- S-phase kinase-associated protein 1
Source.1000: DFBPPR19235 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 1
Source.1001: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial
Source.1002: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128
Source.1003: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.1004: DFBPPR19256 ---- Animal proteins ---- BCL2/adenovirus E1B 19 kDa protein-interacting protein 3-like
Source.1005: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33
Source.1006: DFBPPR19290 ---- Animal proteins ---- Nuclear RNA export factor 1
Source.1007: DFBPPR19291 ---- Animal proteins ---- Multicilin
Source.1008: DFBPPR19310 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.1009: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47
Source.1010: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.1011: DFBPPR19323 ---- Animal proteins ---- WAP, Kazal, immunoglobulin, Kunitz and NTR domain-containing protein 2
Source.1012: DFBPPR19330 ---- Animal proteins ---- Nuclear pore complex protein Nup85
Source.1013: DFBPPR19346 ---- Animal proteins ---- Cylicin-1
Source.1014: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.1015: DFBPPR19362 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 5
Source.1016: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.1017: DFBPPR19381 ---- Animal proteins ---- BRCA2 and CDKN1A-interacting protein
Source.1018: DFBPPR19403 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 12
Source.1019: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein
Source.1020: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20
Source.1021: DFBPPR19473 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.1022: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.1023: DFBPPR19524 ---- Animal proteins ---- Interleukin-1 beta
Source.1024: DFBPPR19526 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase E
Source.1025: DFBPPR19530 ---- Animal proteins ---- Tuftelin
Source.1026: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.1027: DFBPPR19544 ---- Animal proteins ---- Marginal zone B- and B1-cell-specific protein
Source.1028: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.1029: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1030: DFBPPR19586 ---- Animal proteins ---- Uridine-cytidine kinase 1
Source.1031: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein
Source.1032: DFBPPR19592 ---- Animal proteins ---- Ras-related protein Rab-18
Source.1033: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin
Source.1034: DFBPPR19606 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.1035: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.1036: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.1037: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase
Source.1038: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.1039: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator
Source.1040: DFBPPR19663 ---- Animal proteins ---- Synembryn-A
Source.1041: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.1042: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.1043: DFBPPR19675 ---- Animal proteins ---- INO80 complex subunit E
Source.1044: DFBPPR19698 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 7
Source.1045: DFBPPR19701 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.1046: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.1047: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205
Source.1048: DFBPPR19722 ---- Animal proteins ---- Cdc42 effector protein 1
Source.1049: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3
Source.1050: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1
Source.1051: DFBPPR19757 ---- Animal proteins ---- Torsin-1A-interacting protein 1
Source.1052: DFBPPR19763 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.1053: DFBPPR19772 ---- Animal proteins ---- ADP-dependent glucokinase
Source.1054: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.1055: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4
Source.1056: DFBPPR19804 ---- Animal proteins ---- N(G),N(G)-dimethylarginine dimethylaminohydrolase 2
Source.1057: DFBPPR19807 ---- Animal proteins ---- Spermine synthase
Source.1058: DFBPPR19816 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 72 homolog
Source.1059: DFBPPR19829 ---- Animal proteins ---- Arginine--tRNA ligase, cytoplasmic
Source.1060: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.1061: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2
Source.1062: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.1063: DFBPPR19841 ---- Animal proteins ---- Catenin alpha-1
Source.1064: DFBPPR19853 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.1065: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.1066: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.1067: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.1068: DFBPPR19952 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1
Source.1069: DFBPPR19967 ---- Animal proteins ---- Cytohesin-2
Source.1070: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.1071: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2
Source.1072: DFBPPR19986 ---- Animal proteins ---- Regulator of G-protein signaling 20
Source.1073: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.1074: DFBPPR19994 ---- Animal proteins ---- STE20-related kinase adapter protein alpha
Source.1075: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit
Source.1076: DFBPPR20010 ---- Animal proteins ---- Craniofacial development protein 1
Source.1077: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.1078: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1
Source.1079: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B
Source.1080: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6
Source.1081: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1
Source.1082: DFBPPR20098 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B
Source.1083: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2
Source.1084: DFBPPR20169 ---- Animal proteins ---- Cytoplasmic dynein 2 light intermediate chain 1
Source.1085: DFBPPR20190 ---- Animal proteins ---- DNA polymerase epsilon subunit 3
Source.1086: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.1087: DFBPPR20198 ---- Animal proteins ---- Calcium-binding protein 2
Source.1088: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial
Source.1089: DFBPPR20213 ---- Animal proteins ---- Coiled-coil domain-containing protein 115
Source.1090: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase
Source.1091: DFBPPR20237 ---- Animal proteins ---- Fibronectin type 3 and ankyrin repeat domains protein 1
Source.1092: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.1093: DFBPPR20340 ---- Animal proteins ---- Peripherin
Source.1094: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.1095: DFBPPR20357 ---- Animal proteins ---- Snurportin-1
Source.1096: DFBPPR20367 ---- Animal proteins ---- Follistatin-related protein 1
Source.1097: DFBPPR20368 ---- Animal proteins ---- Galectin-3-binding protein
Source.1098: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.1099: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2
Source.1100: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.1101: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.1102: DFBPPR20399 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC4
Source.1103: DFBPPR20404 ---- Animal proteins ---- Protein tilB homolog
Source.1104: DFBPPR20412 ---- Animal proteins ---- Protein disulfide-isomerase A4
Source.1105: DFBPPR20415 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9
Source.1106: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein
Source.1107: DFBPPR20445 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.1108: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.1109: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8
Source.1110: DFBPPR20459 ---- Animal proteins ---- Transcription factor MafF
Source.1111: DFBPPR20468 ---- Animal proteins ---- 28S ribosomal protein S28, mitochondrial
Source.1112: DFBPPR20475 ---- Animal proteins ---- Replication factor C subunit 3
Source.1113: DFBPPR20481 ---- Animal proteins ---- Ropporin-1
Source.1114: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.1115: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.1116: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.1117: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.1118: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1
Source.1119: DFBPPR20584 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 5-like protein
Source.1120: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.1121: DFBPPR20603 ---- Animal proteins ---- Craniofacial development protein 2
Source.1122: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.1123: DFBPPR20607 ---- Animal proteins ---- Spliceosome-associated protein CWC27 homolog
Source.1124: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5
Source.1125: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial
Source.1126: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa
Source.1127: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.1128: DFBPPR20666 ---- Animal proteins ---- Tektin-2
Source.1129: DFBPPR20672 ---- Animal proteins ---- Tripartite motif-containing protein 45
Source.1130: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease
Source.1131: DFBPPR20682 ---- Animal proteins ---- 26S proteasome regulatory subunit 10B
Source.1132: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.1133: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.1134: DFBPPR20749 ---- Animal proteins ---- SUMO-activating enzyme subunit 1
Source.1135: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.1136: DFBPPR20756 ---- Animal proteins ---- Myosin regulatory light chain 12B
Source.1137: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.1138: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1
Source.1139: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.1140: DFBPPR20817 ---- Animal proteins ---- 60S ribosomal protein L3
Source.1141: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.1142: DFBPPR20834 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 12
Source.1143: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.1144: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.1145: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.1146: DFBPPR20857 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15
Source.1147: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1
Source.1148: DFBPPR20886 ---- Animal proteins ---- Dentin matrix acidic phosphoprotein 1
Source.1149: DFBPPR20896 ---- Animal proteins ---- Ribonuclease H2 subunit B
Source.1150: DFBPPR20898 ---- Animal proteins ---- Transaldolase
Source.1151: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.1152: DFBPPR20909 ---- Animal proteins ---- Macrophage immunometabolism regulator
Source.1153: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668
Source.1154: DFBPPR20929 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX11, mitochondrial
Source.1155: DFBPPR20954 ---- Animal proteins ---- Secretagogin
Source.1156: DFBPPR20956 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC10
Source.1157: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.1158: DFBPPR20997 ---- Animal proteins ---- Prefoldin subunit 2
Source.1159: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase
Source.1160: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A
Source.1161: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.1162: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.1163: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10
Source.1164: DFBPPR21063 ---- Animal proteins ---- Zinc finger protein 691
Source.1165: DFBPPR21131 ---- Animal proteins ---- Dynein regulatory complex subunit 7
Source.1166: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.1167: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel
Source.1168: DFBPPR21164 ---- Animal proteins ---- Probable cytosolic iron-sulfur protein assembly protein CIAO1
Source.1169: DFBPPR21169 ---- Animal proteins ---- GA-binding protein subunit beta-2
Source.1170: DFBPPR21179 ---- Animal proteins ---- Eukaryotic translation initiation factor 4H
Source.1171: DFBPPR21181 ---- Animal proteins ---- Calpastatin
Source.1172: DFBPPR21184 ---- Animal proteins ---- Kinetochore protein Spc24
Source.1173: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.1174: DFBPPR21197 ---- Animal proteins ---- Spindle and kinetochore-associated protein 2
Source.1175: DFBPPR21201 ---- Animal proteins ---- mRNA turnover protein 4 homolog
Source.1176: DFBPPR21209 ---- Animal proteins ---- 40S ribosomal protein S6
Source.1177: DFBPPR21237 ---- Animal proteins ---- MIF4G domain-containing protein
Source.1178: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal
Source.1179: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3
Source.1180: DFBPPR21253 ---- Animal proteins ---- Sorting nexin-8
Source.1181: DFBPPR21256 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.1182: DFBPPR21260 ---- Animal proteins ---- 40S ribosomal protein S21
Source.1183: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase
Source.1184: DFBPPR21280 ---- Animal proteins ---- Tubulointerstitial nephritis antigen
Source.1185: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1
Source.1186: DFBPPR21295 ---- Animal proteins ---- COP9 signalosome complex subunit 7b
Source.1187: DFBPPR21307 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.1188: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.1189: DFBPPR21382 ---- Animal proteins ---- DnaJ homolog subfamily B member 4
Source.1190: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.1191: DFBPPR21432 ---- Animal proteins ---- Amelogenin, Y isoform
Source.1192: DFBPPR21436 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1A
Source.1193: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.1194: DFBPPR21481 ---- Animal proteins ---- EF-hand domain-containing protein D2
Source.1195: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.1196: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.1197: DFBPPR21518 ---- Animal proteins ---- U6 snRNA phosphodiesterase
Source.1198: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.1199: DFBPPR21562 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.1200: DFBPPR21580 ---- Animal proteins ---- Density-regulated protein
Source.1201: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma
Source.1202: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3
Source.1203: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.1204: DFBPPR21632 ---- Animal proteins ---- Apoptosis facilitator Bcl-2-like protein 14
Source.1205: DFBPPR21633 ---- Animal proteins ---- DNA fragmentation factor subunit beta
Source.1206: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.1207: DFBPPR21700 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.1208: DFBPPR21713 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2
Source.1209: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2
Source.1210: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1
Source.1211: DFBPPR21755 ---- Animal proteins ---- ELMO domain-containing protein 2
Source.1212: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25
Source.1213: DFBPPR21772 ---- Animal proteins ---- RNA polymerase II-associated protein 1
Source.1214: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2
Source.1215: DFBPPR21822 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 7
Source.1216: DFBPPR21830 ---- Animal proteins ---- Guanine nucleotide exchange factor for Rab-3A
Source.1217: DFBPPR21841 ---- Animal proteins ---- LIM domain-containing protein 2
Source.1218: DFBPPR21843 ---- Animal proteins ---- Tektin-1
Source.1219: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2
Source.1220: DFBPPR21923 ---- Animal proteins ---- Endophilin-B2
Source.1221: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11
Source.1222: DFBPPR21962 ---- Animal proteins ---- Tetraspanin-3
Source.1223: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial
Source.1224: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101
Source.1225: DFBPPR21975 ---- Animal proteins ---- Protein AAR2 homolog
Source.1226: DFBPPR21982 ---- Animal proteins ---- Protein MAK16 homolog
Source.1227: DFBPPR22001 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.1228: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2
Source.1229: DFBPPR22036 ---- Animal proteins ---- Anaphase-promoting complex subunit 15
Source.1230: DFBPPR22095 ---- Animal proteins ---- Solute carrier family 25 member 41
Source.1231: DFBPPR22105 ---- Animal proteins ---- Centromere protein L
Source.1232: DFBPPR22135 ---- Animal proteins ---- TBC1 domain family member 31
Source.1233: DFBPPR22144 ---- Animal proteins ---- Activator of 90 kDa heat shock protein ATPase homolog 2
Source.1234: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.1235: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial
Source.1236: DFBPPR22197 ---- Animal proteins ---- Nuclear receptor 2C2-associated protein
Source.1237: DFBPPR22198 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2
Source.1238: DFBPPR22222 ---- Animal proteins ---- PGC-1 and ERR-induced regulator in muscle protein 1
Source.1239: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.1240: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.1241: DFBPPR22282 ---- Animal proteins ---- Optic atrophy 3 protein homolog
Source.1242: DFBPPR22298 ---- Animal proteins ---- 40S ribosomal protein S17
Source.1243: DFBPPR22313 ---- Animal proteins ---- Nucleolar protein 16
Source.1244: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.1245: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.1246: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1
Source.1247: DFBPPR22410 ---- Animal proteins ---- Small acidic protein
Source.1248: DFBPPR22435 ---- Animal proteins ---- CDAN1-interacting nuclease 1
Source.1249: DFBPPR22446 ---- Animal proteins ---- Tektin-5
Source.1250: DFBPPR22452 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 37
Source.1251: DFBPPR22457 ---- Animal proteins ---- Cilia- and flagella-associated protein 97
Source.1252: DFBPPR22496 ---- Animal proteins ---- Dysbindin domain-containing protein 1
Source.1253: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.1254: DFBPPR22541 ---- Animal proteins ---- Protein FAM177A1
Source.1255: DFBPPR22544 ---- Animal proteins ---- SH3 domain-binding glutamic acid-rich-like protein 2
Source.1256: DFBPPR22571 ---- Animal proteins ---- Gypsy retrotransposon integrase-like protein 1
Source.1257: DFBPPR22601 ---- Animal proteins ---- Leukocyte receptor cluster member 1 homolog
Source.1258: DFBPPR22608 ---- Animal proteins ---- Tetratricopeptide repeat protein 36
Source.1259: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4
Source.1260: DFBPPR22623 ---- Animal proteins ---- Lysine-rich coiled-coil protein 1
Source.1261: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65
Source.1262: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.1263: DFBPPR22701 ---- Animal proteins ---- Fibronectin type III domain-containing protein 8
Source.1264: DFBPPR22763 ---- Animal proteins ---- Uncharacterized protein C19orf71 homolog
Source.1265: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.1266: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.1267: DFBPPR8567 ---- Animal proteins ---- CMP-N-acetylneuraminate-beta-galactosamide-alpha-2,3-sialyltransferase 1
Source.1268: DFBPPR8579 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-1
Source.1269: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.1270: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.1271: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.1272: DFBPPR8634 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.1273: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.1274: DFBPPR8652 ---- Animal proteins ---- 5'-AMP-activated protein kinase catalytic subunit alpha-2
Source.1275: DFBPPR8653 ---- Animal proteins ---- Acrosin-binding protein
Source.1276: DFBPPR8657 ---- Animal proteins ---- Annexin A2
Source.1277: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.1278: DFBPPR8673 ---- Animal proteins ---- Calreticulin
Source.1279: DFBPPR8679 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 5-phosphatase 2
Source.1280: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.1281: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.1282: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.1283: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.1284: DFBPPR8702 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.1285: DFBPPR8712 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1286: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C
Source.1287: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.1288: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.1289: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.1290: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.1291: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.1292: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase
Source.1293: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.1294: DFBPPR8781 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 1
Source.1295: DFBPPR8786 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.1296: DFBPPR8804 ---- Animal proteins ---- 1,5-anhydro-D-fructose reductase
Source.1297: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3
Source.1298: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase
Source.1299: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase
Source.1300: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.1301: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha
Source.1302: DFBPPR8851 ---- Animal proteins ---- Vimentin
Source.1303: DFBPPR8852 ---- Animal proteins ---- Vimentin
Source.1304: DFBPPR8854 ---- Animal proteins ---- Vimentin
Source.1305: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.1306: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.1307: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.1308: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1
Source.1309: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.1310: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.1311: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.1312: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase
Source.1313: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80
Source.1314: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.1315: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor
Source.1316: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta
Source.1317: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1318: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.1319: DFBPPR9121 ---- Animal proteins ---- Endoplasmin
Source.1320: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.1321: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase
Source.1322: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.1323: DFBPPR9139 ---- Animal proteins ---- Heat shock 70 kDa protein 6
Source.1324: DFBPPR9155 ---- Animal proteins ---- Heat shock 70 kDa protein 1-like
Source.1325: DFBPPR9162 ---- Animal proteins ---- Thioredoxin
Source.1326: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.1327: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20
Source.1328: DFBPPR9187 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.1329: DFBPPR9194 ---- Animal proteins ---- Arginase-1
Source.1330: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.1331: DFBPPR9207 ---- Animal proteins ---- Beta-enolase
Source.1332: DFBPPR9232 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.1333: DFBPPR9241 ---- Animal proteins ---- Epithelial cell adhesion molecule
Source.1334: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.1335: DFBPPR9267 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1336: DFBPPR9278 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-11
Source.1337: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.1338: DFBPPR9312 ---- Animal proteins ---- 40S ribosomal protein S21
Source.1339: DFBPPR9327 ---- Animal proteins ---- Multicilin
Source.1340: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1
Source.1341: DFBPPR9374 ---- Animal proteins ---- Casein kinase II subunit beta
Source.1342: DFBPPR9377 ---- Animal proteins ---- Myosin regulatory light polypeptide 9
Source.1343: DFBPPR9386 ---- Animal proteins ---- Cysteine protease ATG4D
Source.1344: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.1345: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.1346: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit
Source.1347: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.1348: DFBPPR9438 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit RPB9
Source.1349: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.1350: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.1351: DFBPPR9487 ---- Animal proteins ---- Troponin C, slow skeletal and cardiac muscles
Source.1352: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24
Source.1353: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25
Source.1354: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.1355: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.1356: DFBPPR9574 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.1357: DFBPPR9580 ---- Animal proteins ---- Mediator of DNA damage checkpoint protein 1
Source.1358: DFBPPR9581 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain
Source.1359: DFBPPR9591 ---- Animal proteins ---- Bone sialoprotein 2
Source.1360: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.1361: DFBPPR9603 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.1362: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.1363: DFBPPR9644 ---- Animal proteins ---- Lambda-crystallin homolog
Source.1364: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.1365: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1366: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein
Source.1367: DFBPPR9718 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.1368: DFBPPR9720 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C beta chain
Source.1369: DFBPPR9721 ---- Animal proteins ---- WAP four-disulfide core domain protein 2
Source.1370: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.1371: DFBPPR9729 ---- Animal proteins ---- Secretagogin
Source.1372: DFBPPR9761 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.1373: DFBPPR9789 ---- Animal proteins ---- Calsequestrin-2
Source.1374: DFBPPR9821 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.1375: DFBPPR9864 ---- Animal proteins ---- Ribose-5-phosphate isomerase
Source.1376: DFBPPR9870 ---- Animal proteins ---- 40S ribosomal protein S17
Source.1377: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.1378: DFBPPR9966 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.1379: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.1380: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.1381: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.1382: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.1383: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1384: DFBPPR10004 ---- Animal proteins ---- Spastin
Source.1385: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.1386: DFBPPR10018 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx
Source.1387: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.1388: DFBPPR10041 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.1389: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.1390: DFBPPR10051 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.1391: DFBPPR10071 ---- Animal proteins ---- Endoplasmic reticulum membrane sensor NFE2L1
Source.1392: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase
Source.1393: DFBPPR10077 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.1394: DFBPPR10079 ---- Animal proteins ---- Heat shock 70 kDa protein
Source.1395: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2
Source.1396: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.1397: DFBPPR10107 ---- Animal proteins ---- Ovomucoid
Source.1398: DFBPPR10111 ---- Animal proteins ---- Hematopoietic prostaglandin D synthase
Source.1399: DFBPPR10118 ---- Animal proteins ---- GATA-binding factor 3
Source.1400: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.1401: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.1402: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.1403: DFBPPR10136 ---- Animal proteins ---- Annexin A2
Source.1404: DFBPPR10150 ---- Animal proteins ---- Tenascin
Source.1405: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial
Source.1406: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.1407: DFBPPR10160 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.1408: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.1409: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.1410: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.1411: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1
Source.1412: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.1413: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.1414: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1
Source.1415: DFBPPR10209 ---- Animal proteins ---- Coagulation factor X
Source.1416: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.1417: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.1418: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.1419: DFBPPR10254 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.1420: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.1421: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.1422: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.1423: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.1424: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.1425: DFBPPR10306 ---- Animal proteins ---- D-erythrulose reductase
Source.1426: DFBPPR10308 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 1
Source.1427: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.1428: DFBPPR10318 ---- Animal proteins ---- LIM domain kinase 1
Source.1429: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.1430: DFBPPR10336 ---- Animal proteins ---- Rho-related GTP-binding protein RhoC
Source.1431: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.1432: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.1433: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2
Source.1434: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.1435: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5
Source.1436: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1
Source.1437: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.1438: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.1439: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1440: DFBPPR10420 ---- Animal proteins ---- Delta-1 crystallin
Source.1441: DFBPPR10421 ---- Animal proteins ---- Prostaglandin E synthase 3
Source.1442: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.1443: DFBPPR10427 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle major isoform
Source.1444: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.1445: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.1446: DFBPPR10440 ---- Animal proteins ---- RNA N6-adenosine-methyltransferase METTL16
Source.1447: DFBPPR10451 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 1
Source.1448: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.1449: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.1450: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1
Source.1451: DFBPPR10506 ---- Animal proteins ---- Ribose-phosphate pyrophosphokinase 2
Source.1452: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.1453: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.1454: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.1455: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.1456: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.1457: DFBPPR10541 ---- Animal proteins ---- Glypican-1
Source.1458: DFBPPR10546 ---- Animal proteins ---- Calmodulin
Source.1459: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1
Source.1460: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.1461: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2
Source.1462: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.1463: DFBPPR10569 ---- Animal proteins ---- Argininosuccinate lyase
Source.1464: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.1465: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.1466: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.1467: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6
Source.1468: DFBPPR10615 ---- Animal proteins ---- Polyribonucleotide 5'-hydroxyl-kinase Clp1
Source.1469: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1
Source.1470: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.1471: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1472: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.1473: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.1474: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.1475: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3
Source.1476: DFBPPR10672 ---- Animal proteins ---- Nibrin
Source.1477: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.1478: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.1479: DFBPPR10723 ---- Animal proteins ---- Interferon regulatory factor 8
Source.1480: DFBPPR10727 ---- Animal proteins ---- Vimentin
Source.1481: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.1482: DFBPPR10744 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.1483: DFBPPR10745 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 3
Source.1484: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.1485: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.1486: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase
Source.1487: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.1488: DFBPPR10808 ---- Animal proteins ---- S-phase kinase-associated protein 1
Source.1489: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A
Source.1490: DFBPPR10811 ---- Animal proteins ---- Chromatin assembly factor 1 subunit A
Source.1491: DFBPPR10817 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1492: DFBPPR10821 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.1493: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.1494: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.1495: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.1496: DFBPPR10866 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.1497: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11
Source.1498: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.1499: DFBPPR10878 ---- Animal proteins ---- Zinc finger protein DPF3
Source.1500: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain
Source.1501: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.1502: DFBPPR10925 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.1503: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.1504: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.1505: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.1506: DFBPPR10948 ---- Animal proteins ---- Kinesin-like protein KIF2A
Source.1507: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2
Source.1508: DFBPPR10958 ---- Animal proteins ---- Heat shock cognate protein HSP 90-beta
Source.1509: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5
Source.1510: DFBPPR10976 ---- Animal proteins ---- Lamin-B2
Source.1511: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.1512: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji
Source.1513: DFBPPR11027 ---- Animal proteins ---- Ras-related protein Rab-18
Source.1514: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.1515: DFBPPR11042 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.1516: DFBPPR11047 ---- Animal proteins ---- Nucleolin
Source.1517: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.1518: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2
Source.1519: DFBPPR11093 ---- Animal proteins ---- DBIRD complex subunit ZNF326
Source.1520: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2
Source.1521: DFBPPR11110 ---- Animal proteins ---- Lamin-B1
Source.1522: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14
Source.1523: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1524: DFBPPR11128 ---- Animal proteins ---- Ras-related protein Rap-1b
Source.1525: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform
Source.1526: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.1527: DFBPPR11151 ---- Animal proteins ---- SPARC
Source.1528: DFBPPR11171 ---- Animal proteins ---- Coatomer subunit delta
Source.1529: DFBPPR11178 ---- Animal proteins ---- Gallinacin-3
Source.1530: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.1531: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.1532: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1533: DFBPPR11208 ---- Animal proteins ---- Transcription factor MafF
Source.1534: DFBPPR11213 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.1535: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2
Source.1536: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.1537: DFBPPR11233 ---- Animal proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.1538: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2
Source.1539: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.1540: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1541: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.1542: DFBPPR11299 ---- Animal proteins ---- Casein kinase II subunit beta
Source.1543: DFBPPR11332 ---- Animal proteins ---- Pre-mRNA-splicing factor CWC22 homolog
Source.1544: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2
Source.1545: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.1546: DFBPPR11364 ---- Animal proteins ---- Interleukin-18
Source.1547: DFBPPR11368 ---- Animal proteins ---- Hematopoietically-expressed homeobox protein HHEX
Source.1548: DFBPPR11369 ---- Animal proteins ---- SAGA-associated factor 29
Source.1549: DFBPPR11376 ---- Animal proteins ---- Lamin-A
Source.1550: DFBPPR11382 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 10
Source.1551: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37
Source.1552: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B
Source.1553: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.1554: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.1555: DFBPPR11422 ---- Animal proteins ---- Methionine aminopeptidase 1
Source.1556: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator
Source.1557: DFBPPR11467 ---- Animal proteins ---- Synembryn-A
Source.1558: DFBPPR11498 ---- Animal proteins ---- Troponin C, slow skeletal and cardiac muscles
Source.1559: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.1560: DFBPPR11532 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle minor isoform
Source.1561: DFBPPR11536 ---- Animal proteins ---- Putative Polycomb group protein ASXL2
Source.1562: DFBPPR11542 ---- Animal proteins ---- Alpha-fetoprotein
Source.1563: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.1564: DFBPPR11550 ---- Animal proteins ---- D-beta-hydroxybutyrate dehydrogenase, mitochondrial
Source.1565: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.1566: DFBPPR11575 ---- Animal proteins ---- Myosin light chain 1, cardiac muscle
Source.1567: DFBPPR11601 ---- Animal proteins ---- TBC domain-containing protein kinase-like protein
Source.1568: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.1569: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1
Source.1570: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2
Source.1571: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.1572: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.1573: DFBPPR11660 ---- Animal proteins ---- Cathepsin K
Source.1574: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2
Source.1575: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.1576: DFBPPR11670 ---- Animal proteins ---- Snurportin-1
Source.1577: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.1578: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog
Source.1579: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.1580: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.1581: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.1582: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.1583: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.1584: DFBPPR11763 ---- Animal proteins ---- Activated RNA polymerase II transcriptional coactivator p15
Source.1585: DFBPPR11807 ---- Animal proteins ---- Activating transcription factor 7-interacting protein 1
Source.1586: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.1587: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.1588: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.1589: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8
Source.1590: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.1591: DFBPPR11914 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.1592: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3
Source.1593: DFBPPR11917 ---- Animal proteins ---- Protein VAC14 homolog
Source.1594: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.1595: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.1596: DFBPPR11940 ---- Animal proteins ---- Calmodulin, striated muscle
Source.1597: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A
Source.1598: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.1599: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.1600: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.1601: DFBPPR11953 ---- Animal proteins ---- Protein NEL
Source.1602: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.1603: DFBPPR11970 ---- Animal proteins ---- Rap1 GTPase-activating protein 2
Source.1604: DFBPPR11985 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD7
Source.1605: DFBPPR11992 ---- Animal proteins ---- Craniofacial development protein 1
Source.1606: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.1607: DFBPPR12018 ---- Animal proteins ---- Density-regulated protein
Source.1608: DFBPPR12024 ---- Animal proteins ---- 40S ribosomal protein S6
Source.1609: DFBPPR12027 ---- Animal proteins ---- Centromere protein L
Source.1610: DFBPPR12034 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.1611: DFBPPR12041 ---- Animal proteins ---- Paladin
Source.1612: DFBPPR12043 ---- Animal proteins ---- Biogenesis of lysosome-related organelles complex 1 subunit 5
Source.1613: DFBPPR12072 ---- Animal proteins ---- 40S ribosomal protein S17
Source.1614: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.1615: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.1616: DFBPPR12082 ---- Animal proteins ---- Zona pellucida-binding protein 2
Source.1617: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.1618: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox
Source.1619: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.1620: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.1621: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.1622: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1
Source.1623: DFBPPR12153 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 11A
Source.1624: DFBPPR12164 ---- Animal proteins ---- Neo-calmodulin
Source.1625: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45
Source.1626: DFBPPR12176 ---- Animal proteins ---- Serine/threonine-protein kinase 11-interacting protein
Source.1627: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3
Source.1628: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2
Source.1629: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.1630: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.1631: DFBPPR12262 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.1632: DFBPPR12265 ---- Animal proteins ---- Myosin light chain kinase 2, skeletal/cardiac muscle
Source.1633: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.1634: DFBPPR12280 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 1
Source.1635: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.1636: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.1637: DFBPPR12314 ---- Animal proteins ---- Annexin A1
Source.1638: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1639: DFBPPR12351 ---- Animal proteins ---- 4F2 cell-surface antigen heavy chain
Source.1640: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform
Source.1641: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1642: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.1643: DFBPPR12386 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.1644: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.1645: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.1646: DFBPPR12407 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.1647: DFBPPR12425 ---- Animal proteins ---- Beta-enolase
Source.1648: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.1649: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1
Source.1650: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.1651: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.1652: DFBPPR12480 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.1653: DFBPPR12512 ---- Animal proteins ---- Carbonic anhydrase 4
Source.1654: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.1655: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.1656: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.1657: DFBPPR12585 ---- Animal proteins ---- Calmodulin
Source.1658: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5
Source.1659: DFBPPR12611 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 1A
Source.1660: DFBPPR12635 ---- Animal proteins ---- Prostaglandin E synthase 3
Source.1661: DFBPPR12637 ---- Animal proteins ---- Thioredoxin
Source.1662: DFBPPR12638 ---- Animal proteins ---- Thioredoxin
Source.1663: DFBPPR12642 ---- Animal proteins ---- Haptoglobin
Source.1664: DFBPPR12643 ---- Animal proteins ---- Haptoglobin
Source.1665: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.1666: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.1667: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.1668: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.1669: DFBPPR12754 ---- Animal proteins ---- Methylosome subunit pICln
Source.1670: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5
Source.1671: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.1672: DFBPPR12775 ---- Animal proteins ---- Troponin C, skeletal muscle
Source.1673: DFBPPR12776 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1674: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.1675: DFBPPR12782 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 2
Source.1676: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.1677: DFBPPR12807 ---- Animal proteins ---- Chloride intracellular channel protein 1
Source.1678: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.1679: DFBPPR12857 ---- Animal proteins ---- Arginase-1
Source.1680: DFBPPR12858 ---- Animal proteins ---- Catenin alpha-1
Source.1681: DFBPPR12863 ---- Animal proteins ---- Casein kinase II subunit beta
Source.1682: DFBPPR12869 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.1683: DFBPPR12876 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain
Source.1684: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase
Source.1685: DFBPPR12928 ---- Animal proteins ---- Regulatory solute carrier protein family 1 member 1
Source.1686: DFBPPR12961 ---- Animal proteins ---- Potassium voltage-gated channel subfamily S member 3
Source.1687: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain
Source.1688: DFBPPR12992 ---- Animal proteins ---- Mimecan
Source.1689: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.1690: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.1691: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.1692: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.1693: DFBPPR13110 ---- Animal proteins ---- Tumor necrosis factor alpha-induced protein 8-like protein 2
Source.1694: DFBPPR13117 ---- Animal proteins ---- Ig kappa-b4 chain C region
Source.1695: DFBPPR13123 ---- Animal proteins ---- Ig kappa-b5 chain C region
Source.1696: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.1697: DFBPPR13147 ---- Animal proteins ---- Heat shock protein HSP 90-beta
Source.1698: DFBPPR13154 ---- Animal proteins ---- Annexin A1
Source.1699: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.1700: DFBPPR13168 ---- Animal proteins ---- Heat shock cognate 71 kDa protein
Source.1701: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1702: DFBPPR13189 ---- Animal proteins ---- Heat shock protein HSP 90-alpha
Source.1703: DFBPPR13223 ---- Animal proteins ---- Caspase-1
Source.1704: DFBPPR13237 ---- Animal proteins ---- Thioredoxin
Source.1705: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.1706: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.1707: DFBPPR13264 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.1708: DFBPPR13265 ---- Animal proteins ---- Gasdermin-E
Source.1709: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme
Source.1710: DFBPPR13318 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1711: DFBPPR13327 ---- Animal proteins ---- Metalloproteinase inhibitor 2
Source.1712: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha
Source.1713: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.1714: DFBPPR13356 ---- Animal proteins ---- Hyaluronan and proteoglycan link protein 1
Source.1715: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.1716: DFBPPR13454 ---- Animal proteins ---- Vitamin K-dependent protein C
Source.1717: DFBPPR13463 ---- Animal proteins ---- Cathelicidin-2
Source.1718: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1719: DFBPPR13475 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.1720: DFBPPR13479 ---- Animal proteins ---- Interleukin-1 beta
Source.1721: DFBPPR13484 ---- Animal proteins ---- Heat shock-related 70 kDa protein 2
Source.1722: DFBPPR13508 ---- Animal proteins ---- Fibrinogen beta chain
Source.1723: DFBPPR13539 ---- Animal proteins ---- Sorbitol dehydrogenase
Source.1724: DFBPPR13542 ---- Animal proteins ---- Pyridoxal kinase
Source.1725: DFBPPR13564 ---- Animal proteins ---- Calmodulin
Source.1726: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.1727: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.1728: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.1729: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1730: DFBPPR13616 ---- Animal proteins ---- Ornithine carbamoyltransferase, mitochondrial
Source.1731: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1732: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.1733: DFBPPR13626 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1734: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.1735: DFBPPR13656 ---- Animal proteins ---- Thioredoxin
Source.1736: DFBPPR13672 ---- Animal proteins ---- Annexin A2
Source.1737: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.1738: DFBPPR13698 ---- Animal proteins ---- Progonadoliberin-1
Source.1739: DFBPPR13710 ---- Animal proteins ---- Interleukin-1 beta
Source.1740: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.1741: DFBPPR13788 ---- Animal proteins ---- Albumin
Source.1742: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1
Source.1743: DFBPPR13800 ---- Animal proteins ---- Keratin, type I cytoskeletal 25
Source.1744: DFBPPR13845 ---- Animal proteins ---- Target of rapamycin complex 2 subunit MAPKAP1
Source.1745: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa
Source.1746: DFBPPR13867 ---- Animal proteins ---- Acidic leucine-rich nuclear phosphoprotein 32 family member B
Source.1747: DFBPPR13874 ---- Animal proteins ---- Cathelicidin-2
Source.1748: DFBPPR13882 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1749: DFBPPR13885 ---- Animal proteins ---- Mast cell protease 3
Source.1750: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1751: DFBPPR13903 ---- Animal proteins ---- Fibrinogen beta chain
Source.1752: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.1753: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.1754: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.1755: DFBPPR13959 ---- Animal proteins ---- Calpastatin
Source.1756: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.1757: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.1758: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.1759: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.1760: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.1761: DFBPPR14017 ---- Animal proteins ---- Ependymin
Source.1762: DFBPPR14018 ---- Animal proteins ---- Ras-related protein Rap-1b
Source.1763: DFBPPR14019 ---- Animal proteins ---- Vimentin
Source.1764: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36
Source.1765: DFBPPR14081 ---- Marine protein ---- Beta-enolase
Source.1766: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III
Source.1767: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.1768: DFBPPR14099 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.1769: DFBPPR14107 ---- Marine protein ---- E3 ubiquitin-protein ligase rnf146
Source.1770: DFBPPR14110 ---- Marine protein ---- BRCA1-A complex subunit Abraxas 1
Source.1771: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.1772: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator
Source.1773: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.1774: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog
Source.1775: DFBPPR14201 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-B
Source.1776: DFBPPR14202 ---- Marine protein ---- Phosphotriesterase-related protein
Source.1777: DFBPPR14203 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-A
Source.1778: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.1779: DFBPPR14350 ---- Marine protein ---- 3-oxoacyl-[acyl-carrier-protein] synthase 3
Source.1780: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.1781: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.1782: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha
Source.1783: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA
Source.1784: DFBPPR14512 ---- Marine protein ---- UPF0051 protein ycf24
Source.1785: DFBPPR14516 ---- Marine protein ---- Uncharacterized protein ycf53
Source.1786: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.1787: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain
Source.1788: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.1789: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.1790: DFBPPR14591 ---- Marine protein ---- Vimentin
Source.1791: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b
Source.1792: DFBPPR14598 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx2
Source.1793: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1
Source.1794: DFBPPR14624 ---- Marine protein ---- Heat shock cognate 70 kDa protein
Source.1795: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a
Source.1796: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3
Source.1797: DFBPPR14647 ---- Marine protein ---- Retinol-binding protein 4-A
Source.1798: DFBPPR14648 ---- Marine protein ---- Retinol-binding protein 4-B
Source.1799: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.1800: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13
Source.1801: DFBPPR14725 ---- Marine protein ---- 40S ribosomal protein S6
Source.1802: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.1803: DFBPPR14749 ---- Marine protein ---- Alcohol dehydrogenase 1
Source.1804: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.1805: DFBPPR14765 ---- Marine protein ---- Intracellular coagulation inhibitor 3
Source.1806: DFBPPR14783 ---- Marine protein ---- Enolase
Source.1807: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.1808: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.1809: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1
Source.1810: DFBPPR14818 ---- Marine protein ---- Tropomyosin
Source.1811: DFBPPR14819 ---- Marine protein ---- Digestive cysteine proteinase 2
Source.1812: DFBPPR14820 ---- Marine protein ---- Troponin C, isoform 1
Source.1813: DFBPPR14828 ---- Marine protein ---- Tropomyosin
Source.1814: DFBPPR14832 ---- Marine protein ---- Troponin C, isoform 2B
Source.1815: DFBPPR14833 ---- Marine protein ---- Troponin C, isoform 2A
Source.1816: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1817: DFBPPR14862 ---- Marine protein ---- Insulin
Source.1818: DFBPPR14871 ---- Marine protein ---- Troponin C, skeletal muscle
Source.1819: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1
Source.1820: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.1821: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.1822: DFBPPR14897 ---- Microorganism protein ---- Calmodulin
Source.1823: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.1824: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit
Source.1825: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein
Source.1826: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1
Source.1827: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1
Source.1828: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1
Source.1829: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.1830: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.1831: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1
Source.1832: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.1833: DFBPPR15010 ---- Microorganism protein ---- N-acetyltransferase ECO1
Source.1834: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.1835: DFBPPR15024 ---- Microorganism protein ---- Leucine aminopeptidase 2
Source.1836: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.1837: DFBPPR15060 ---- Microorganism protein ---- Transaldolase
Source.1838: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1
Source.1839: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.1840: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.1841: DFBPPR15080 ---- Microorganism protein ---- Dimethyladenosine transferase
Source.1842: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.1843: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase
Source.1844: DFBPPR15103 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein END3
Source.1845: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1
Source.1846: DFBPPR15131 ---- Microorganism protein ---- tRNA (guanine(9)-N1)-methyltransferase
Source.1847: DFBPPR15136 ---- Microorganism protein ---- Maintenance of mitochondrial morphology protein 1
Source.1848: DFBPPR15156 ---- Microorganism protein ---- Vacuolar protein sorting/targeting protein 10
Source.1849: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.1850: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84
Source.1851: DFBPPR15180 ---- Microorganism protein ---- Protein ROT1
Source.1852: DFBPPR15192 ---- Microorganism protein ---- D-aminoacyl-tRNA deacylase
Source.1853: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9
Source.1854: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.1855: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.1856: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal
Source.1857: DFBPPR15214 ---- Microorganism protein ---- Endoribonuclease YSH1
Source.1858: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8
Source.1859: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2
Source.1860: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.1861: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.1862: DFBPPR15258 ---- Microorganism protein ---- Invertase
Source.1863: DFBPPR15261 ---- Microorganism protein ---- Nascent polypeptide-associated complex subunit alpha
Source.1864: DFBPPR15264 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX1
Source.1865: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.1866: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1
Source.1867: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.1868: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1
Source.1869: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.1870: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1
Source.1871: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.1872: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.1873: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.1874: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.1875: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme
Source.1876: DFBPPR15410 ---- Microorganism protein ---- Mitochondrial inner membrane protease ATP23
Source.1877: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2
Source.1878: DFBPPR15420 ---- Microorganism protein ---- EKC/KEOPS complex subunit GON7
Source.1879: DFBPPR15423 ---- Microorganism protein ---- ATP phosphoribosyltransferase
Source.1880: DFBPPR15432 ---- Microorganism protein ---- Pre-rRNA-processing protein ESF2
Source.1881: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1
Source.1882: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase
Source.1883: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase
Source.1884: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.1885: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1
Source.1886: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3
Source.1887: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2
Source.1888: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.1889: DFBPPR15486 ---- Microorganism protein ---- Transcription factor IWS1
Source.1890: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.1891: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.1892: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1
Source.1893: DFBPPR15508 ---- Microorganism protein ---- RNA polymerase II transcription factor B subunit 3
Source.1894: DFBPPR15553 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX4
Source.1895: DFBPPR15555 ---- Microorganism protein ---- Spindle pole body component 110
Source.1896: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.1897: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9
Source.1898: DFBPPR15595 ---- Microorganism protein ---- MICOS complex subunit MIC27
Source.1899: DFBPPR15607 ---- Microorganism protein ---- Histone H2A.Z-specific chaperone CHZ1
Source.1900: DFBPPR15610 ---- Microorganism protein ---- Inheritance of peroxisomes protein 2
Source.1901: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2
Source.1902: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.1903: DFBPPR15632 ---- Microorganism protein ---- Ribosome biogenesis protein NSA1
Source.1904: DFBPPR15641 ---- Microorganism protein ---- Ribosomal lysine N-methyltransferase 5
Source.1905: DFBPPR15667 ---- Microorganism protein ---- 60S ribosomal protein L25
Source.1906: DFBPPR15674 ---- Microorganism protein ---- DNA polymerase epsilon subunit C
Source.1907: DFBPPR15679 ---- Microorganism protein ---- 40S ribosomal protein S6
Source.1908: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4
Source.1909: DFBPPR15696 ---- Microorganism protein ---- pH-response regulator palI/RIM9 homolog 1
Source.1910: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1
Source.1911: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.1912: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase
Source.1913: DFBPPR15751 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 41, mitochondrial
Source.1914: DFBPPR15756 ---- Microorganism protein ---- Inheritance of peroxisomes protein 1
Source.1915: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1
Source.1916: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111
Source.1917: DFBPPR15780 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 8
Source.1918: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9
Source.1919: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component
Source.1920: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.1921: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.1922: DFBPPR15845 ---- Microorganism protein ---- Calmodulin
Source.1923: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.1924: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.1925: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.1926: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.1927: DFBPPR7817 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1928: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.1929: DFBPPR7917 ---- Plant protein ---- CASP-like protein 4D1
Source.1930: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.1931: DFBPPR7955 ---- Plant protein ---- FACT complex subunit SSRP1
Source.1932: DFBPPR7960 ---- Plant protein ---- Vicilin
Source.1933: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B
Source.1934: DFBPPR8030 ---- Plant protein ---- Arcelin-5A
Source.1935: DFBPPR8073 ---- Plant protein ---- Arcelin-5B
Source.1936: DFBPPR8090 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1937: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.1938: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.1939: DFBPPR8218 ---- Plant protein ---- Germacrene A acid 8-beta-hydroxylase
Source.1940: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.1941: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1942: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.1943: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.1944: DFBPPR8284 ---- Plant protein ---- Calmodulin
Source.1945: DFBPPR8285 ---- Plant protein ---- 26S proteasome regulatory subunit 6B homolog
Source.1946: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.1947: DFBPPR8331 ---- Plant protein ---- Auxin-responsive protein SAUR50
Source.1948: DFBPPR8352 ---- Plant protein ---- Putative uncharacterized protein ycf15
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide EVD exhibited very weak Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 1.32 ± 0.05 mM (= 1320 ± 50 μM).

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Non-bitter taste prediction
SMILES N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydrolysis

Enzyme(s)/starter culture

Lactobacillus helveticus LB 10 proteinases immobilized with sodium alginate were used to hydrolyze whey protein to produce ACE-inhibitory peptides. Using a response surface method, we determined that a proteinase concentration of 7.55 mg/mL, sodium alginate concentration of 2.03 g/100 mL, and glutaraldehyde concentration of 0.39% were found to be the optimal immobilization conditions.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information
  1. Compared with free proteinases, the immobilized proteinases had significantly higher pH, thermal, and storage stabilities.

  2. This study provides a research basis for the development of bioactive peptide ingredients applied to the functional food market.

Database cross-references
DFBP
[D1] DFBPANOX0940
[D2] DFBPMUFU0623
BIOPEP-UWM [D3] -
APD [D4] -
BioPepDB [D5] -
MBPDB [D6] -
Reference(s)
Primary literature Guo Y, Jiang X, Xiong B, Zhang T, Zeng X, Wu Z, Sun Y, Pan D. Production and transepithelial transportation of angiotensin-I-converting enzyme (ACE)-inhibitory peptides from whey protein hydrolyzed by immobilized Lactobacillus helveticus proteinase. J Dairy Sci. 2019 Feb;102(2):961-975.
PMID: 30594363
Other literature(s) N.D
PubDate 2019
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214