E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPALGL0022(α-Glucosidase inhibitory peptide)
DFBP ID DFBPALGL0022
Peptide sequence YPG
Type Native peptide
Peptide/Function name α-Glucosidase inhibitory peptide, Anti-diabetic peptide
Function-activity relationship
Main bioactivity α-Glucosidase inhibitory activity
Otheir bioactivity N.D
Calculated physicochemical properties
Three-letter amino acid Tyr-Pro-Gly
Single-letter amino acid YPG
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 335.36 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.92 c
IC50 N.D
pIC50 N.D
GRAVY -1.1000 c
Hydrophilic residue ratio 66.67% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal, Fish, Marine
Organism/Source Sardine
Precursor protein Muscle protein hydrolyzates
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.2: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a
Source.3: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.4: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda
Source.5: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.6: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B
Source.7: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic
Source.8: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.9: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic
Source.10: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.11: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.12: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.13: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.14: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.15: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.16: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7
Source.17: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3
Source.18: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.19: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.20: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.21: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.22: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2
Source.23: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b
Source.24: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.25: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.26: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1
Source.27: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.28: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic
Source.29: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.30: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2
Source.31: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.32: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.33: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.34: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.35: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.36: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.37: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11
Source.38: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.39: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.40: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.41: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.42: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.43: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.44: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2
Source.45: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.46: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.47: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1
Source.48: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.49: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.50: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.51: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7
Source.52: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2
Source.53: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.54: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1
Source.55: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.56: DFBPPR2526 ---- Plant proteins ---- Chitinase 10
Source.57: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase
Source.58: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.59: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic
Source.60: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase
Source.61: DFBPPR2595 ---- Plant proteins ---- Expansin-B7
Source.62: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.63: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.64: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8
Source.65: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.66: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.67: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27
Source.68: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.69: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.70: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.71: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2
Source.72: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.73: DFBPPR2883 ---- Plant proteins ---- Expansin-B9
Source.74: DFBPPR2888 ---- Plant proteins ---- Expansin-B10
Source.75: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.76: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.77: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.78: DFBPPR3115 ---- Plant proteins ---- Nucleosome assembly protein 1;1
Source.79: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29
Source.80: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic
Source.81: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35
Source.82: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4
Source.83: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.84: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.85: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.86: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15
Source.87: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic
Source.88: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2
Source.89: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.90: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3
Source.91: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.92: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B''
Source.93: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.94: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8
Source.95: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic
Source.96: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2
Source.97: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.98: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6
Source.99: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.100: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7
Source.101: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500
Source.102: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4
Source.103: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.104: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.105: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48
Source.106: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.107: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.108: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.109: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.110: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5
Source.111: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A
Source.112: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase
Source.113: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5
Source.114: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.115: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.116: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.117: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7
Source.118: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3
Source.119: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63
Source.120: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase
Source.121: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5
Source.122: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3
Source.123: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.124: DFBPPR4796 ---- Plant proteins ---- Protein BUD31 homolog 1
Source.125: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66
Source.126: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500
Source.127: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A
Source.128: DFBPPR4965 ---- Plant proteins ---- Glycinin G1
Source.129: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.130: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.131: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.132: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.133: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.134: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic
Source.135: DFBPPR5074 ---- Plant proteins ---- Phytochrome B
Source.136: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.137: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.138: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.139: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic
Source.140: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.141: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.142: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.143: DFBPPR5332 ---- Plant proteins ---- Nodulin-20a
Source.144: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.145: DFBPPR5393 ---- Plant proteins ---- Endochitinase A
Source.146: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.147: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.148: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic
Source.149: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.150: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4
Source.151: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.152: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.153: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain
Source.154: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain
Source.155: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain
Source.156: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic
Source.157: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.158: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.159: DFBPPR5670 ---- Plant proteins ---- Endochitinase B
Source.160: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1
Source.161: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5
Source.162: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.163: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.164: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5
Source.165: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1
Source.166: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.167: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.168: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.169: DFBPPR5946 ---- Plant proteins ---- Maturase K
Source.170: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA
Source.171: DFBPPR6179 ---- Plant proteins ---- Unknown protein from spot 75 of 2D-PAGE of etiolated coleoptile
Source.172: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic
Source.173: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic
Source.174: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.175: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.176: DFBPPR6241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 1 protein
Source.177: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic
Source.178: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.179: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96
Source.180: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic
Source.181: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.182: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.183: DFBPPR6287 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 2 protein
Source.184: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.185: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.186: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic
Source.187: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.188: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A
Source.189: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme
Source.190: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B
Source.191: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase
Source.192: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic
Source.193: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.194: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic
Source.195: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19
Source.196: DFBPPR6683 ---- Plant proteins ---- Glutenin, high molecular weight subunit DX5
Source.197: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase
Source.198: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53
Source.199: DFBPPR6776 ---- Plant proteins ---- Alpha-amylase inhibitor WDAI-3
Source.200: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.201: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.202: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2
Source.203: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.204: DFBPPR6852 ---- Plant proteins ---- Glutenin, high molecular weight subunit DY10
Source.205: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.206: DFBPPR6872 ---- Plant proteins ---- Glutenin, high molecular weight subunit 12
Source.207: DFBPPR6882 ---- Plant proteins ---- Maturase K
Source.208: DFBPPR6886 ---- Plant proteins ---- Glutenin, high molecular weight subunit PW212
Source.209: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2
Source.210: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic
Source.211: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.212: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic
Source.213: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic
Source.214: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd
Source.215: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.216: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.217: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.218: DFBPPR7170 ---- Plant proteins ---- Maturase K
Source.219: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.220: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2
Source.221: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1
Source.222: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.223: DFBPPR7301 ---- Plant proteins ---- Glycine-rich cell wall structural protein
Source.224: DFBPPR7338 ---- Plant proteins ---- 60S ribosomal protein L24
Source.225: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.226: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.227: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.228: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.229: DFBPPR7538 ---- Plant proteins ---- Late embryogenesis abundant protein 76
Source.230: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.231: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein
Source.232: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.233: DFBPPR7645 ---- Milk proteins ---- Kallikrein-6
Source.234: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.235: DFBPPR7654 ---- Milk proteins ---- Kallikrein-12
Source.236: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.237: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.238: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase
Source.239: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal
Source.240: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101
Source.241: DFBPPR8201 ---- Plant proteins ---- 16 kDa phloem protein 1
Source.242: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2
Source.243: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.244: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B
Source.245: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase
Source.246: DFBPPR15952 ---- Animal proteins ---- Galectin-3
Source.247: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53
Source.248: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.249: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.250: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.251: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.252: DFBPPR16038 ---- Animal proteins ---- Protein amnionless
Source.253: DFBPPR16086 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.254: DFBPPR16100 ---- Animal proteins ---- Nucleoside diphosphate kinase B
Source.255: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.256: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.257: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain
Source.258: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer
Source.259: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.260: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.261: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.262: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.263: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.264: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.265: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.266: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.267: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.268: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.269: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.270: DFBPPR16264 ---- Animal proteins ---- Pancreatic prohormone
Source.271: DFBPPR16278 ---- Animal proteins ---- Major prion protein
Source.272: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.273: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.274: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.275: DFBPPR16446 ---- Animal proteins ---- Anionic trypsin
Source.276: DFBPPR16447 ---- Animal proteins ---- Anionic trypsin
Source.277: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6
Source.278: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.279: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.280: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin
Source.281: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog
Source.282: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2
Source.283: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K
Source.284: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype
Source.285: DFBPPR16609 ---- Animal proteins ---- DLA class II histocompatibility antigen, DR-1 beta chain
Source.286: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.287: DFBPPR16707 ---- Animal proteins ---- Trefoil factor 2
Source.288: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.289: DFBPPR16776 ---- Animal proteins ---- Nucleoside diphosphate kinase
Source.290: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.291: DFBPPR16796 ---- Animal proteins ---- Major prion protein
Source.292: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.293: DFBPPR16822 ---- Animal proteins ---- Kininogen-2
Source.294: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.295: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.296: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.297: DFBPPR16873 ---- Animal proteins ---- Cationic trypsin
Source.298: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2
Source.299: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.300: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.301: DFBPPR16915 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.302: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53
Source.303: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2
Source.304: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1
Source.305: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP
Source.306: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.307: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor
Source.308: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.309: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.310: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.311: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.312: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1
Source.313: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A
Source.314: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.315: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.316: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.317: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.318: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.319: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.320: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.321: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7
Source.322: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta
Source.323: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.324: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.325: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1
Source.326: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.327: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.328: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2
Source.329: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.330: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.331: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.332: DFBPPR17538 ---- Animal proteins ---- Septin-7
Source.333: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.334: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.335: DFBPPR17586 ---- Animal proteins ---- Dermatopontin
Source.336: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.337: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1
Source.338: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.339: DFBPPR17626 ---- Animal proteins ---- Elastin
Source.340: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2
Source.341: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.342: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain
Source.343: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.344: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.345: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.346: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.347: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.348: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.349: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.350: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.351: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT
Source.352: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.353: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1
Source.354: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1
Source.355: DFBPPR17958 ---- Animal proteins ---- Homeobox protein NANOG
Source.356: DFBPPR17962 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1
Source.357: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial
Source.358: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.359: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.360: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12
Source.361: DFBPPR18068 ---- Animal proteins ---- Annexin A11
Source.362: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit
Source.363: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23
Source.364: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.365: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha
Source.366: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase
Source.367: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.368: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.369: DFBPPR18171 ---- Animal proteins ---- Anionic trypsin
Source.370: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.371: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.372: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2
Source.373: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2
Source.374: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.375: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56
Source.376: DFBPPR18334 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.377: DFBPPR18341 ---- Animal proteins ---- BRISC complex subunit Abraxas 2
Source.378: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.379: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain
Source.380: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z
Source.381: DFBPPR18403 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.382: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor
Source.383: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1
Source.384: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.385: DFBPPR18520 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.386: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial
Source.387: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.388: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.389: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.390: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A
Source.391: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.392: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.393: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.394: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.395: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.396: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4
Source.397: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.398: DFBPPR18846 ---- Animal proteins ---- Sex-determining region Y protein
Source.399: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase
Source.400: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain
Source.401: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.402: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase
Source.403: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.404: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb
Source.405: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease
Source.406: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746
Source.407: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5
Source.408: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase
Source.409: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain
Source.410: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.411: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.412: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.413: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.414: DFBPPR19152 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF186
Source.415: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.416: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.417: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone
Source.418: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4
Source.419: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.420: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.421: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.422: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1
Source.423: DFBPPR19299 ---- Animal proteins ---- Annexin A7
Source.424: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2
Source.425: DFBPPR19339 ---- Animal proteins ---- Peroxiredoxin-4
Source.426: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD
Source.427: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.428: DFBPPR19358 ---- Animal proteins ---- Beta-crystallin A3
Source.429: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.430: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2
Source.431: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.432: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.433: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.434: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain
Source.435: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.436: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.437: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72
Source.438: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.439: DFBPPR19529 ---- Animal proteins ---- Cbp/p300-interacting transactivator 1
Source.440: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog
Source.441: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.442: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.443: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.444: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.445: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.446: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase
Source.447: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.448: DFBPPR19799 ---- Animal proteins ---- Migration and invasion enhancer 1
Source.449: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial
Source.450: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor
Source.451: DFBPPR19960 ---- Animal proteins ---- 60S ribosomal protein L24
Source.452: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein
Source.453: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1
Source.454: DFBPPR19999 ---- Animal proteins ---- Cell death-inducing p53-target protein 1
Source.455: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7
Source.456: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase
Source.457: DFBPPR20046 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin-2
Source.458: DFBPPR20060 ---- Animal proteins ---- Fibulin-5
Source.459: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.460: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6
Source.461: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.462: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator
Source.463: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2
Source.464: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3
Source.465: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C
Source.466: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.467: DFBPPR20408 ---- Animal proteins ---- Phospholipid scramblase 2
Source.468: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5
Source.469: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2
Source.470: DFBPPR20485 ---- Animal proteins ---- Beta-crystallin A2
Source.471: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6
Source.472: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3
Source.473: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6
Source.474: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10
Source.475: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.476: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.477: DFBPPR20667 ---- Animal proteins ---- 39S ribosomal protein L13, mitochondrial
Source.478: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.479: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10
Source.480: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9
Source.481: DFBPPR20720 ---- Animal proteins ---- BoLa class II histocompatibility antigen, DQB*0101 beta chain
Source.482: DFBPPR20723 ---- Animal proteins ---- Histamine N-methyltransferase
Source.483: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.484: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K
Source.485: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1
Source.486: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.487: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1
Source.488: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2
Source.489: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3
Source.490: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.491: DFBPPR21009 ---- Animal proteins ---- Endoribonuclease LACTB2
Source.492: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6
Source.493: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.494: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148
Source.495: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel
Source.496: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7
Source.497: DFBPPR21346 ---- Animal proteins ---- Ameloblastin
Source.498: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3
Source.499: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog
Source.500: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24
Source.501: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2
Source.502: DFBPPR21411 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 1
Source.503: DFBPPR21535 ---- Animal proteins ---- Gastrotropin
Source.504: DFBPPR21561 ---- Animal proteins ---- Vesicle-trafficking protein SEC22c
Source.505: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4
Source.506: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork
Source.507: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.508: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4
Source.509: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2
Source.510: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11
Source.511: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1
Source.512: DFBPPR21945 ---- Animal proteins ---- Dermokine
Source.513: DFBPPR21961 ---- Animal proteins ---- P3 protein
Source.514: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1
Source.515: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.516: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.517: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1
Source.518: DFBPPR22109 ---- Animal proteins ---- Host cell factor C1 regulator 1
Source.519: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein
Source.520: DFBPPR22246 ---- Animal proteins ---- Pancreatic progenitor cell differentiation and proliferation factor
Source.521: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like
Source.522: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.523: DFBPPR22428 ---- Animal proteins ---- Cysteine-rich and transmembrane domain-containing protein 1
Source.524: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein
Source.525: DFBPPR22458 ---- Animal proteins ---- DNA damage-inducible transcript 4-like protein
Source.526: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2
Source.527: DFBPPR22613 ---- Animal proteins ---- Coiled-coil domain-containing protein 71
Source.528: DFBPPR22672 ---- Animal proteins ---- WD repeat-containing protein 89
Source.529: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.530: DFBPPR22752 ---- Animal proteins ---- Uncharacterized protein C11orf71 homolog
Source.531: DFBPPR8538 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.532: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.533: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.534: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.535: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1
Source.536: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.537: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.538: DFBPPR8642 ---- Animal proteins ---- Major prion protein
Source.539: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.540: DFBPPR8646 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.541: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog
Source.542: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.543: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.544: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53
Source.545: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial
Source.546: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.547: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1
Source.548: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.549: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.550: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.551: DFBPPR8753 ---- Animal proteins ---- Androgen receptor
Source.552: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial
Source.553: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.554: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.555: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.556: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.557: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.558: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.559: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.560: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.561: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial
Source.562: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.563: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme
Source.564: DFBPPR9048 ---- Animal proteins ---- Neuroendocrine protein 7B2
Source.565: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.566: DFBPPR9069 ---- Animal proteins ---- E-selectin
Source.567: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.568: DFBPPR9074 ---- Animal proteins ---- Trefoil factor 2
Source.569: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor
Source.570: DFBPPR9098 ---- Animal proteins ---- Gastrotropin
Source.571: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.572: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.573: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.574: DFBPPR9191 ---- Animal proteins ---- Carbonyl reductase [NADPH] 2
Source.575: DFBPPR9195 ---- Animal proteins ---- Sex-determining region Y protein
Source.576: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.577: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase
Source.578: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.579: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.580: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase
Source.581: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.582: DFBPPR9557 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.583: DFBPPR9606 ---- Animal proteins ---- Pancreatic prohormone precursor
Source.584: DFBPPR9636 ---- Animal proteins ---- D-aspartate oxidase
Source.585: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.586: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1
Source.587: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6
Source.588: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1
Source.589: DFBPPR9754 ---- Animal proteins ---- Ig lambda chain C region
Source.590: DFBPPR9807 ---- Animal proteins ---- Galectin-4
Source.591: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2
Source.592: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.593: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.594: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src
Source.595: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog
Source.596: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.597: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4
Source.598: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase
Source.599: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.600: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2
Source.601: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.602: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.603: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.604: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.605: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2
Source.606: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog
Source.607: DFBPPR10173 ---- Animal proteins ---- Teneurin-1
Source.608: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.609: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.610: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk
Source.611: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7
Source.612: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.613: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.614: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.615: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.616: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2
Source.617: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.618: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.619: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1
Source.620: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.621: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.622: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.623: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.624: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.625: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.626: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.627: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.628: DFBPPR10467 ---- Animal proteins ---- Brain-derived neurotrophic factor
Source.629: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.630: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.631: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.632: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6
Source.633: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.634: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.635: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta
Source.636: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain
Source.637: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.638: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.639: DFBPPR10540 ---- Animal proteins ---- Nucleoside diphosphate kinase
Source.640: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.641: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.642: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.643: DFBPPR10646 ---- Animal proteins ---- Netrin-1
Source.644: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.645: DFBPPR10672 ---- Animal proteins ---- Nibrin
Source.646: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb
Source.647: DFBPPR10694 ---- Animal proteins ---- Dihydrofolate reductase
Source.648: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.649: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11
Source.650: DFBPPR10723 ---- Animal proteins ---- Interferon regulatory factor 8
Source.651: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4
Source.652: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2
Source.653: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5
Source.654: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.655: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.656: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.657: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.658: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.659: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.660: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.661: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2
Source.662: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1
Source.663: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.664: DFBPPR11147 ---- Animal proteins ---- Fibulin-1
Source.665: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.666: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.667: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1
Source.668: DFBPPR11183 ---- Animal proteins ---- Trypsin II-P29
Source.669: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2
Source.670: DFBPPR11218 ---- Animal proteins ---- Pancreatic hormone
Source.671: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.672: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38
Source.673: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1
Source.674: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.675: DFBPPR11255 ---- Animal proteins ---- Beta-crystallin A3
Source.676: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.677: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2
Source.678: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2
Source.679: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4
Source.680: DFBPPR11362 ---- Animal proteins ---- Beta-crystallin B2
Source.681: DFBPPR11372 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.682: DFBPPR11417 ---- Animal proteins ---- LRP chaperone MESD
Source.683: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1
Source.684: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.685: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.686: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5
Source.687: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1
Source.688: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.689: DFBPPR11510 ---- Animal proteins ---- Gonadoliberin-2
Source.690: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1
Source.691: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.692: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.693: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.694: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K
Source.695: DFBPPR11614 ---- Animal proteins ---- Beta-crystallin B3
Source.696: DFBPPR11628 ---- Animal proteins ---- Beta-crystallin A2
Source.697: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.698: DFBPPR11691 ---- Animal proteins ---- Beta-crystallin A4
Source.699: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit
Source.700: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog
Source.701: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.702: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5
Source.703: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.704: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.705: DFBPPR11842 ---- Animal proteins ---- Homeobox protein ANF-1
Source.706: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8
Source.707: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1
Source.708: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3
Source.709: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.710: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.711: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.712: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.713: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.714: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.715: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.716: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.717: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1
Source.718: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.719: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.720: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.721: DFBPPR12278 ---- Animal proteins ---- Major prion protein
Source.722: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.723: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.724: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial
Source.725: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.726: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.727: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.728: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.729: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.730: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase
Source.731: DFBPPR12420 ---- Animal proteins ---- Serum paraoxonase/lactonase 3
Source.732: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase
Source.733: DFBPPR12433 ---- Animal proteins ---- Carbonic anhydrase 2
Source.734: DFBPPR12441 ---- Animal proteins ---- Triadin
Source.735: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.736: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.737: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.738: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.739: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.740: DFBPPR12545 ---- Animal proteins ---- Galectin-3
Source.741: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.742: DFBPPR12591 ---- Animal proteins ---- Annexin A11
Source.743: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT
Source.744: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT
Source.745: DFBPPR12602 ---- Animal proteins ---- Osteopontin
Source.746: DFBPPR12603 ---- Animal proteins ---- Osteopontin
Source.747: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.748: DFBPPR12626 ---- Animal proteins ---- E-selectin
Source.749: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.750: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.751: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.752: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.753: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.754: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.755: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.756: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.757: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.758: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1
Source.759: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain
Source.760: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.761: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2
Source.762: DFBPPR13026 ---- Animal proteins ---- Homeobox expressed in ES cells 1
Source.763: DFBPPR13040 ---- Animal proteins ---- Pancreatic hormone
Source.764: DFBPPR13062 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.765: DFBPPR13070 ---- Animal proteins ---- Beta-crystallin A2
Source.766: DFBPPR13148 ---- Animal proteins ---- Cellular tumor antigen p53
Source.767: DFBPPR13222 ---- Animal proteins ---- Metalloproteinase inhibitor 3
Source.768: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.769: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.770: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.771: DFBPPR13364 ---- Animal proteins ---- Glycophorin-A
Source.772: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.773: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.774: DFBPPR13423 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.775: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.776: DFBPPR13433 ---- Animal proteins ---- Major prion protein
Source.777: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.778: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.779: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein
Source.780: DFBPPR13530 ---- Animal proteins ---- Major prion protein
Source.781: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.782: DFBPPR13534 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.783: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.784: DFBPPR13549 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.785: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.786: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53
Source.787: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2
Source.788: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.789: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.790: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.791: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.792: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40
Source.793: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.794: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.795: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.796: DFBPPR13802 ---- Animal proteins ---- Pancreatic prohormone
Source.797: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A
Source.798: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein
Source.799: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1
Source.800: DFBPPR13984 ---- Animal proteins ---- Pro-opiomelanocortin-2
Source.801: DFBPPR13987 ---- Animal proteins ---- Hemoglobin subunit alpha
Source.802: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.803: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.804: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.805: DFBPPR14090 ---- Marine protein ---- Trypsin-3
Source.806: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.807: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.808: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.809: DFBPPR14129 ---- Marine protein ---- Methylthioribulose-1-phosphate dehydratase
Source.810: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1
Source.811: DFBPPR14179 ---- Marine protein ---- Alpha-endosulfine
Source.812: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.813: DFBPPR14303 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG
Source.814: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit
Source.815: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.816: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic
Source.817: DFBPPR14402 ---- Marine protein ---- 50S ribosomal protein L3, chloroplastic
Source.818: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53
Source.819: DFBPPR14587 ---- Marine protein ---- Thyrotropin subunit beta
Source.820: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.821: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.822: DFBPPR14692 ---- Marine protein ---- Progonadoliberin-2
Source.823: DFBPPR14704 ---- Marine protein ---- Selenoprotein F
Source.824: DFBPPR14753 ---- Marine protein ---- Clotting factor B
Source.825: DFBPPR14781 ---- Marine protein ---- Hemocyanin
Source.826: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase
Source.827: DFBPPR14860 ---- Marine protein ---- Thyrotropin subunit beta
Source.828: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.829: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.830: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1
Source.831: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta
Source.832: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.833: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.834: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.835: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1
Source.836: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1
Source.837: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase
Source.838: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.839: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial
Source.840: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase
Source.841: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.842: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.843: DFBPPR15048 ---- Microorganism protein ---- 3-ketodihydrosphingosine reductase TSC10
Source.844: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.845: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2
Source.846: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.847: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial
Source.848: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24
Source.849: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1
Source.850: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.851: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14
Source.852: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.853: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.854: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial
Source.855: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.856: DFBPPR15457 ---- Microorganism protein ---- Ribosome biogenesis protein RLP24
Source.857: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44
Source.858: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.859: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.860: DFBPPR15750 ---- Microorganism protein ---- 60S ribosomal protein L24
Source.861: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.862: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4
Source.863: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.864: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.865: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.866: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.867: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.868: DFBPPR7826 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-2
Source.869: DFBPPR7827 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-1
Source.870: DFBPPR7856 ---- Plant protein ---- Maturase K
Source.871: DFBPPR7925 ---- Plant protein ---- Kafirin PGK1
Source.872: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.873: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.874: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.875: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.876: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.877: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.878: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.879: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.880: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.881: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic
Source.882: DFBPPR8314 ---- Plant protein ---- Maturase K
Link-research
There are no literature reports on the discovery of this sequence in other food-source proteins.
Biological/Functional activity & target protein
α-Glucosidase inhibitory activity

Inhibitor of α-Glucosidase (AGH, EC 3.2.1.20). Tyr-Tyr-Pro-Leu which showed a potent inhibition against yeast AGH was selected as a skeleton peptide. As summarized five peptides were synthesized , and the AGH inhibition was determined. Sub­stitution of Leu by Gly at the C-terminus of Tyr-Pro-Leu exhibited a similar AGH inhibition (IC50 = 5.0 mM ), whereas a 6-fold reduction of in­ hibition activity was observed with Tyr-Pro-Tyr (IC50 = 25.8 mM ). These results indicate that ali­phatic amino acids, e.g. Leu or Gly at the C-terminus of the tri-peptide was more favorable than aromatic ones to inhibit AGH.

Table 1 AGH inhibitory activity of synthetic analogues of the peptide isolated from muscle hydrolyzate a
Sequence
IC50 (mM)
Tyr-Tyr-Pro-Leu3.7 ± 0.02
Tyr-Pro-Leu3.9 ± 0.02
Pro-Leu
No inhibition
Tyr-Pro
16.8 ± 0.08
Tyr-Pro-Gly
5.0 ± 0.01
Tyr-Pro-Tyr
25.8 ± 0.12

a The analogue peptides were synthesized on the basis of the sequence of Tyr-Tyr-Pro-Leu isolated from the hydrolyzate.

Specific target protein(s) Specific Target Protein(s):
Lysosomal alpha-glucosidase
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)O
Preparation method
Mode of preparation

Synthesis peptide

Enzyme(s)/starter culture

The peptide was synthesized using Fmoc solid phase synthesis on a Kokusan Peptide Synthesizer.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

(1) AGH inhibitory studies of Try-Tyr-Pro-Leu and its derivatives demonstrated the importance of the tri­-peptide chain length as well as the hydrophobic aromatic amino acid tyrosine at the N-terminus, aliphatic amino acids at the C-terminus, as well as an amide proton from the peptide chain at the middle position of the tri-peptide to develop AGH inhibition activity.
(2) Although the  sequenc (Tyr-Pro-Gly) is only an synthetic analogue of the peptide and is not found in the sardine muscle hydrolyzate,  it is likely to be present in the sardine muscle, or other foods, for later research and discovery, we add this peptde to the DFBP database.

Database cross-references
BIOPEP-UWM [D1] 9066, 9549
APD [D2] -
BioPepDB [D3] -
MBPDB [D4] -
Reference(s)
Primary literature Matsui T, Oki T, Osajima Y. Isolation and identification of peptidic alpha-glucosidase inhibitors derived from sardine muscle hydrolyzate. Z Naturforsch C J Biosci. 1999 Mar-Apr;54(3-4):259-63.
PMID: 10408829
Other literature(s)

[1] Matsui T, Yoshimoto C, Osajima K, et al. In vitro survey of alpha-glucosidase inhibitory food components.[J]. Journal of the Agricultural Chemical Society of Japan, 1996, 60(12):2019-2022.

PubDate 1999
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214