Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPALGL0022(α-Glucosidase inhibitory peptide)

DFBP ID	DFBPALGL0022
Peptide sequence	YPG
Type	Native peptide
Peptide/Function name	α-Glucosidase inhibitory peptide, Anti-diabetic peptide

Function-activity relationship

Main bioactivity	α-Glucosidase inhibitory activity
Otheir bioactivity	N.D

Calculated physicochemical properties

Three-letter amino acid

Tyr-Pro-Gly

Single-letter amino acid

YPG

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	335.36 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.92 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

-1.1000^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal, Fish, Marine
Organism/Source	Sardine
Precursor protein	Muscle protein hydrolyzates
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.2: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a Source.3: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog Source.4: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda Source.5: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR Source.6: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B Source.7: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic Source.8: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3 Source.9: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic Source.10: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.11: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.12: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.13: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.14: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.15: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.16: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7 Source.17: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.18: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.19: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic Source.20: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic Source.21: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.22: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2 Source.23: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b Source.24: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.25: DFBPPR1613 ---- Plant proteins ---- Villin-3 Source.26: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1 Source.27: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.28: DFBPPR1683 ---- Plant proteins ---- Probable acetolactate synthase 2, chloroplastic Source.29: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1 Source.30: DFBPPR1747 ---- Plant proteins ---- Probable apyrase 2 Source.31: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.32: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3 Source.33: DFBPPR1795 ---- Plant proteins ---- Tubulin gamma-2 chain Source.34: DFBPPR1843 ---- Plant proteins ---- Laccase-13 Source.35: DFBPPR1853 ---- Plant proteins ---- Laccase-4 Source.36: DFBPPR1882 ---- Plant proteins ---- Laccase-12 Source.37: DFBPPR1888 ---- Plant proteins ---- Cytokinin dehydrogenase 11 Source.38: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.39: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.40: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.41: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6 Source.42: DFBPPR2033 ---- Plant proteins ---- Laccase-2 Source.43: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.44: DFBPPR2126 ---- Plant proteins ---- Glutelin type-B 2 Source.45: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1 Source.46: DFBPPR2157 ---- Plant proteins ---- Expansin-B6 Source.47: DFBPPR2158 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase 1 Source.48: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase Source.49: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.50: DFBPPR2247 ---- Plant proteins ---- Phytochrome C Source.51: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7 Source.52: DFBPPR2362 ---- Plant proteins ---- Metal-nicotianamine transporter YSL2 Source.53: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1 Source.54: DFBPPR2461 ---- Plant proteins ---- Glutelin type-B 1 Source.55: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.56: DFBPPR2526 ---- Plant proteins ---- Chitinase 10 Source.57: DFBPPR2563 ---- Plant proteins ---- Thymidine kinase Source.58: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic Source.59: DFBPPR2578 ---- Plant proteins ---- Peptide methionine sulfoxide reductase B3, chloroplastic Source.60: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase Source.61: DFBPPR2595 ---- Plant proteins ---- Expansin-B7 Source.62: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.63: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25 Source.64: DFBPPR2664 ---- Plant proteins ---- Germin-like protein 3-8 Source.65: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30 Source.66: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase Source.67: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27 Source.68: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1 Source.69: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.70: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.71: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2 Source.72: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.73: DFBPPR2883 ---- Plant proteins ---- Expansin-B9 Source.74: DFBPPR2888 ---- Plant proteins ---- Expansin-B10 Source.75: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15 Source.76: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17 Source.77: DFBPPR3096 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.78: DFBPPR3115 ---- Plant proteins ---- Nucleosome assembly protein 1;1 Source.79: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29 Source.80: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic Source.81: DFBPPR3282 ---- Plant proteins ---- Putative beta-glucosidase 35 Source.82: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4 Source.83: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase Source.84: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.85: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.86: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15 Source.87: DFBPPR3482 ---- Plant proteins ---- Probable inactive heme oxygenase 2, chloroplastic Source.88: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2 Source.89: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.90: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3 Source.91: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65 Source.92: DFBPPR3567 ---- Plant proteins ---- U2 small nuclear ribonucleoprotein B'' Source.93: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog Source.94: DFBPPR3685 ---- Plant proteins ---- Sugar transport protein MST8 Source.95: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic Source.96: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2 Source.97: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic Source.98: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6 Source.99: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2 Source.100: DFBPPR3981 ---- Plant proteins ---- Sugar transport protein MST7 Source.101: DFBPPR3989 ---- Plant proteins ---- Probable carboxylesterase Os04g0669500 Source.102: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4 Source.103: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6 Source.104: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5 Source.105: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.106: DFBPPR4093 ---- Plant proteins ---- Villin-5 Source.107: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.108: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.109: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1 Source.110: DFBPPR4226 ---- Plant proteins ---- RNA pseudouridine synthase 5 Source.111: DFBPPR4227 ---- Plant proteins ---- U1 small nuclear ribonucleoprotein A Source.112: DFBPPR4327 ---- Plant proteins ---- Lysine--tRNA ligase Source.113: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5 Source.114: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18 Source.115: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9 Source.116: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1 Source.117: DFBPPR4480 ---- Plant proteins ---- Formin-like protein 7 Source.118: DFBPPR4517 ---- Plant proteins ---- Protein MEI2-like 3 Source.119: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63 Source.120: DFBPPR4551 ---- Plant proteins ---- Putative nitric oxide synthase Source.121: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5 Source.122: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3 Source.123: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2 Source.124: DFBPPR4796 ---- Plant proteins ---- Protein BUD31 homolog 1 Source.125: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66 Source.126: DFBPPR4877 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0333500 Source.127: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A Source.128: DFBPPR4965 ---- Plant proteins ---- Glycinin G1 Source.129: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A Source.130: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.131: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic Source.132: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.133: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.134: DFBPPR5067 ---- Plant proteins ---- Amidophosphoribosyltransferase, chloroplastic Source.135: DFBPPR5074 ---- Plant proteins ---- Phytochrome B Source.136: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic Source.137: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase Source.138: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1 Source.139: DFBPPR5115 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 2, chloroplastic Source.140: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.141: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.142: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.143: DFBPPR5332 ---- Plant proteins ---- Nodulin-20a Source.144: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1 Source.145: DFBPPR5393 ---- Plant proteins ---- Endochitinase A Source.146: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8 Source.147: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.148: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic Source.149: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.150: DFBPPR5522 ---- Plant proteins ---- ABC transporter C family MRP4 Source.151: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.152: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.153: DFBPPR5585 ---- Plant proteins ---- Tubulin gamma-2 chain Source.154: DFBPPR5592 ---- Plant proteins ---- Tubulin gamma-1 chain Source.155: DFBPPR5603 ---- Plant proteins ---- Tubulin gamma-3 chain Source.156: DFBPPR5622 ---- Plant proteins ---- Tryptophan synthase beta chain 2, chloroplastic Source.157: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4 Source.158: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1 Source.159: DFBPPR5670 ---- Plant proteins ---- Endochitinase B Source.160: DFBPPR5672 ---- Plant proteins ---- Tryptophan synthase beta chain 1 Source.161: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5 Source.162: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.163: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.164: DFBPPR5700 ---- Plant proteins ---- Glutamine synthetase root isozyme 5 Source.165: DFBPPR5704 ---- Plant proteins ---- Glutamine synthetase root isozyme 1 Source.166: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2 Source.167: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.168: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase Source.169: DFBPPR5946 ---- Plant proteins ---- Maturase K Source.170: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA Source.171: DFBPPR6179 ---- Plant proteins ---- Unknown protein from spot 75 of 2D-PAGE of etiolated coleoptile Source.172: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic Source.173: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic Source.174: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase Source.175: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic Source.176: DFBPPR6241 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 1 protein Source.177: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic Source.178: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.179: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96 Source.180: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic Source.181: DFBPPR6263 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic Source.182: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.183: DFBPPR6287 ---- Plant proteins ---- Kunitz-type trypsin inhibitor-like 2 protein Source.184: DFBPPR6327 ---- Plant proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.185: DFBPPR6330 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic Source.186: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic Source.187: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.188: DFBPPR6400 ---- Plant proteins ---- Glutamine synthetase root isozyme A Source.189: DFBPPR6414 ---- Plant proteins ---- Glutamine synthetase nodule isozyme Source.190: DFBPPR6416 ---- Plant proteins ---- Glutamine synthetase root isozyme B Source.191: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.192: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.193: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.194: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic Source.195: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19 Source.196: DFBPPR6683 ---- Plant proteins ---- Glutenin, high molecular weight subunit DX5 Source.197: DFBPPR6698 ---- Plant proteins ---- Adenosylhomocysteinase Source.198: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53 Source.199: DFBPPR6776 ---- Plant proteins ---- Alpha-amylase inhibitor WDAI-3 Source.200: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.201: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.202: DFBPPR6836 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CM2 Source.203: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.204: DFBPPR6852 ---- Plant proteins ---- Glutenin, high molecular weight subunit DY10 Source.205: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.206: DFBPPR6872 ---- Plant proteins ---- Glutenin, high molecular weight subunit 12 Source.207: DFBPPR6882 ---- Plant proteins ---- Maturase K Source.208: DFBPPR6886 ---- Plant proteins ---- Glutenin, high molecular weight subunit PW212 Source.209: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2 Source.210: DFBPPR7027 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-21, chloroplastic Source.211: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.212: DFBPPR7036 ---- Plant proteins ---- Chlorophyll a-b binding protein 1B-20, chloroplastic Source.213: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic Source.214: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd Source.215: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic Source.216: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic Source.217: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic Source.218: DFBPPR7170 ---- Plant proteins ---- Maturase K Source.219: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.220: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2 Source.221: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1 Source.222: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.223: DFBPPR7301 ---- Plant proteins ---- Glycine-rich cell wall structural protein Source.224: DFBPPR7338 ---- Plant proteins ---- 60S ribosomal protein L24 Source.225: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.226: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.227: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.228: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic Source.229: DFBPPR7538 ---- Plant proteins ---- Late embryogenesis abundant protein 76 Source.230: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1 Source.231: DFBPPR7631 ---- Milk proteins ---- Zinc-alpha-2-glycoprotein Source.232: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein Source.233: DFBPPR7645 ---- Milk proteins ---- Kallikrein-6 Source.234: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.235: DFBPPR7654 ---- Milk proteins ---- Kallikrein-12 Source.236: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.237: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.238: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase Source.239: DFBPPR8190 ---- Plant proteins ---- Acyl-coenzyme A oxidase, peroxisomal Source.240: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101 Source.241: DFBPPR8201 ---- Plant proteins ---- 16 kDa phloem protein 1 Source.242: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2 Source.243: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.244: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.245: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.246: DFBPPR15952 ---- Animal proteins ---- Galectin-3 Source.247: DFBPPR15955 ---- Animal proteins ---- Cellular tumor antigen p53 Source.248: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.249: DFBPPR15974 ---- Animal proteins ---- Androgen receptor Source.250: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.251: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.252: DFBPPR16038 ---- Animal proteins ---- Protein amnionless Source.253: DFBPPR16086 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.254: DFBPPR16100 ---- Animal proteins ---- Nucleoside diphosphate kinase B Source.255: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.256: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.257: DFBPPR16114 ---- Animal proteins ---- Collagen alpha-5(IV) chain Source.258: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer Source.259: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.260: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase Source.261: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1 Source.262: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.263: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1 Source.264: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.265: DFBPPR16200 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.266: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.267: DFBPPR16245 ---- Animal proteins ---- Tubulin gamma-1 chain Source.268: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.269: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase Source.270: DFBPPR16264 ---- Animal proteins ---- Pancreatic prohormone Source.271: DFBPPR16278 ---- Animal proteins ---- Major prion protein Source.272: DFBPPR16284 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.273: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1 Source.274: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.275: DFBPPR16446 ---- Animal proteins ---- Anionic trypsin Source.276: DFBPPR16447 ---- Animal proteins ---- Anionic trypsin Source.277: DFBPPR16463 ---- Animal proteins ---- Carbonic anhydrase 6 Source.278: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin Source.279: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII Source.280: DFBPPR16507 ---- Animal proteins ---- Cationic trypsin Source.281: DFBPPR16514 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 6 homolog Source.282: DFBPPR16586 ---- Animal proteins ---- Beta-crystallin B2 Source.283: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K Source.284: DFBPPR16603 ---- Animal proteins ---- Prostaglandin E2 receptor EP1 subtype Source.285: DFBPPR16609 ---- Animal proteins ---- DLA class II histocompatibility antigen, DR-1 beta chain Source.286: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19 Source.287: DFBPPR16707 ---- Animal proteins ---- Trefoil factor 2 Source.288: DFBPPR16761 ---- Animal proteins ---- NADP-dependent malic enzyme Source.289: DFBPPR16776 ---- Animal proteins ---- Nucleoside diphosphate kinase Source.290: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor Source.291: DFBPPR16796 ---- Animal proteins ---- Major prion protein Source.292: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A Source.293: DFBPPR16822 ---- Animal proteins ---- Kininogen-2 Source.294: DFBPPR16832 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.295: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.296: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1 Source.297: DFBPPR16873 ---- Animal proteins ---- Cationic trypsin Source.298: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2 Source.299: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle Source.300: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.301: DFBPPR16915 ---- Animal proteins ---- Vitamin K-dependent protein S Source.302: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53 Source.303: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2 Source.304: DFBPPR16992 ---- Animal proteins ---- Phospholipase B-like 1 Source.305: DFBPPR17008 ---- Animal proteins ---- Prolyl endopeptidase FAP Source.306: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.307: DFBPPR17057 ---- Animal proteins ---- Cation-independent mannose-6-phosphate receptor Source.308: DFBPPR17080 ---- Animal proteins ---- Presenilin-2 Source.309: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.310: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.311: DFBPPR17089 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.312: DFBPPR17096 ---- Animal proteins ---- Activated CDC42 kinase 1 Source.313: DFBPPR17100 ---- Animal proteins ---- Phosphatidylserine lipase ABHD16A Source.314: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.315: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.316: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.317: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain Source.318: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.319: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A Source.320: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.321: DFBPPR17312 ---- Animal proteins ---- Mitogen-activated protein kinase 7 Source.322: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta Source.323: DFBPPR17321 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.324: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.325: DFBPPR17405 ---- Animal proteins ---- Transcription factor HES-1 Source.326: DFBPPR17406 ---- Animal proteins ---- Exostosin-2 Source.327: DFBPPR17431 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.328: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Source.329: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase Source.330: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.331: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.332: DFBPPR17538 ---- Animal proteins ---- Septin-7 Source.333: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1 Source.334: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase Source.335: DFBPPR17586 ---- Animal proteins ---- Dermatopontin Source.336: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.337: DFBPPR17608 ---- Animal proteins ---- Early growth response protein 1 Source.338: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2 Source.339: DFBPPR17626 ---- Animal proteins ---- Elastin Source.340: DFBPPR17680 ---- Animal proteins ---- Beta-crystallin B2 Source.341: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.342: DFBPPR17777 ---- Animal proteins ---- Tubulin gamma-1 chain Source.343: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase Source.344: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.345: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase Source.346: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.347: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.348: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.349: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.350: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13 Source.351: DFBPPR17932 ---- Animal proteins ---- Protein IMPACT Source.352: DFBPPR17944 ---- Animal proteins ---- P-selectin Source.353: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1 Source.354: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1 Source.355: DFBPPR17958 ---- Animal proteins ---- Homeobox protein NANOG Source.356: DFBPPR17962 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L1 Source.357: DFBPPR17986 ---- Animal proteins ---- Atypical kinase COQ8A, mitochondrial Source.358: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.359: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5 Source.360: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12 Source.361: DFBPPR18068 ---- Animal proteins ---- Annexin A11 Source.362: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit Source.363: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23 Source.364: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15 Source.365: DFBPPR18130 ---- Animal proteins ---- CCAAT/enhancer-binding protein alpha Source.366: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase Source.367: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44 Source.368: DFBPPR18165 ---- Animal proteins ---- Retinaldehyde-binding protein 1 Source.369: DFBPPR18171 ---- Animal proteins ---- Anionic trypsin Source.370: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.371: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.372: DFBPPR18250 ---- Animal proteins ---- RNA binding protein fox-1 homolog 2 Source.373: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2 Source.374: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase Source.375: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56 Source.376: DFBPPR18334 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.377: DFBPPR18341 ---- Animal proteins ---- BRISC complex subunit Abraxas 2 Source.378: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.379: DFBPPR18370 ---- Animal proteins ---- Tubulin gamma-2 chain Source.380: DFBPPR18387 ---- Animal proteins ---- Vitamin K-dependent protein Z Source.381: DFBPPR18403 ---- Animal proteins ---- Complement C1q subcomponent subunit A Source.382: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor Source.383: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1 Source.384: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.385: DFBPPR18520 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11 Source.386: DFBPPR18525 ---- Animal proteins ---- Lipoyltransferase 1, mitochondrial Source.387: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.388: DFBPPR18536 ---- Animal proteins ---- Plastin-1 Source.389: DFBPPR18537 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.390: DFBPPR18554 ---- Animal proteins ---- Arylsulfatase A Source.391: DFBPPR18598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.392: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.393: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.394: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.395: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2 Source.396: DFBPPR18784 ---- Animal proteins ---- Thrombospondin-4 Source.397: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor Source.398: DFBPPR18846 ---- Animal proteins ---- Sex-determining region Y protein Source.399: DFBPPR18861 ---- Animal proteins ---- D-aspartate oxidase Source.400: DFBPPR18865 ---- Animal proteins ---- Collagen alpha-1(XI) chain Source.401: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.402: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase Source.403: DFBPPR18965 ---- Animal proteins ---- THO complex subunit 5 homolog Source.404: DFBPPR18973 ---- Animal proteins ---- Transcriptional activator Myb Source.405: DFBPPR18978 ---- Animal proteins ---- Membrane-bound transcription factor site-2 protease Source.406: DFBPPR19005 ---- Animal proteins ---- Zinc finger protein 746 Source.407: DFBPPR19018 ---- Animal proteins ---- Interferon regulatory factor 5 Source.408: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase Source.409: DFBPPR19033 ---- Animal proteins ---- Collagen alpha-2(XI) chain Source.410: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.411: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial Source.412: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.413: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain Source.414: DFBPPR19152 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF186 Source.415: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.416: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3 Source.417: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone Source.418: DFBPPR19193 ---- Animal proteins ---- Transmembrane 9 superfamily member 4 Source.419: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2 Source.420: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6 Source.421: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein Source.422: DFBPPR19274 ---- Animal proteins ---- Phosphatidylinositol 4-phosphate 5-kinase-like protein 1 Source.423: DFBPPR19299 ---- Animal proteins ---- Annexin A7 Source.424: DFBPPR19326 ---- Animal proteins ---- Glutamine--fructose-6-phosphate aminotransferase [isomerizing] 2 Source.425: DFBPPR19339 ---- Animal proteins ---- Peroxiredoxin-4 Source.426: DFBPPR19347 ---- Animal proteins ---- LRP chaperone MESD Source.427: DFBPPR19357 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.428: DFBPPR19358 ---- Animal proteins ---- Beta-crystallin A3 Source.429: DFBPPR19359 ---- Animal proteins ---- Spartin Source.430: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2 Source.431: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.432: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.433: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.434: DFBPPR19478 ---- Animal proteins ---- Carboxypeptidase N catalytic chain Source.435: DFBPPR19480 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.436: DFBPPR19500 ---- Animal proteins ---- Complement C2 Source.437: DFBPPR19502 ---- Animal proteins ---- Keratin, type II cytoskeletal 72 Source.438: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.439: DFBPPR19529 ---- Animal proteins ---- Cbp/p300-interacting transactivator 1 Source.440: DFBPPR19541 ---- Animal proteins ---- Serrate RNA effector molecule homolog Source.441: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog Source.442: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase Source.443: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein Source.444: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.445: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase Source.446: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase Source.447: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.448: DFBPPR19799 ---- Animal proteins ---- Migration and invasion enhancer 1 Source.449: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial Source.450: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor Source.451: DFBPPR19960 ---- Animal proteins ---- 60S ribosomal protein L24 Source.452: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein Source.453: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1 Source.454: DFBPPR19999 ---- Animal proteins ---- Cell death-inducing p53-target protein 1 Source.455: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7 Source.456: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase Source.457: DFBPPR20046 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin-2 Source.458: DFBPPR20060 ---- Animal proteins ---- Fibulin-5 Source.459: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.460: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6 Source.461: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.462: DFBPPR20216 ---- Animal proteins ---- Calcium-responsive transactivator Source.463: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2 Source.464: DFBPPR20302 ---- Animal proteins ---- General transcription factor IIH subunit 3 Source.465: DFBPPR20360 ---- Animal proteins ---- Tubulin-specific chaperone C Source.466: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase Source.467: DFBPPR20408 ---- Animal proteins ---- Phospholipid scramblase 2 Source.468: DFBPPR20437 ---- Animal proteins ---- Protein shisa-5 Source.469: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2 Source.470: DFBPPR20485 ---- Animal proteins ---- Beta-crystallin A2 Source.471: DFBPPR20548 ---- Animal proteins ---- Myogenic factor 6 Source.472: DFBPPR20579 ---- Animal proteins ---- Synaptogyrin-3 Source.473: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6 Source.474: DFBPPR20609 ---- Animal proteins ---- Ran-binding protein 10 Source.475: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2 Source.476: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.477: DFBPPR20667 ---- Animal proteins ---- 39S ribosomal protein L13, mitochondrial Source.478: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9 Source.479: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10 Source.480: DFBPPR20707 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 9 Source.481: DFBPPR20720 ---- Animal proteins ---- BoLa class II histocompatibility antigen, DQB*0101 beta chain Source.482: DFBPPR20723 ---- Animal proteins ---- Histamine N-methyltransferase Source.483: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1 Source.484: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K Source.485: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1 Source.486: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.487: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1 Source.488: DFBPPR20949 ---- Animal proteins ---- Synaptogyrin-2 Source.489: DFBPPR20968 ---- Animal proteins ---- Ras GTPase-activating protein 3 Source.490: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like Source.491: DFBPPR21009 ---- Animal proteins ---- Endoribonuclease LACTB2 Source.492: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6 Source.493: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1 Source.494: DFBPPR21094 ---- Animal proteins ---- RING finger protein 148 Source.495: DFBPPR21154 ---- Animal proteins ---- Proton-activated chloride channel Source.496: DFBPPR21255 ---- Animal proteins ---- Homeobox protein Hox-B7 Source.497: DFBPPR21346 ---- Animal proteins ---- Ameloblastin Source.498: DFBPPR21354 ---- Animal proteins ---- RNA polymerase II elongation factor ELL3 Source.499: DFBPPR21361 ---- Animal proteins ---- Seizure protein 6 homolog Source.500: DFBPPR21365 ---- Animal proteins ---- Probable ribosome biogenesis protein RLP24 Source.501: DFBPPR21384 ---- Animal proteins ---- Transcription factor Sp2 Source.502: DFBPPR21411 ---- Animal proteins ---- Adaptin ear-binding coat-associated protein 1 Source.503: DFBPPR21535 ---- Animal proteins ---- Gastrotropin Source.504: DFBPPR21561 ---- Animal proteins ---- Vesicle-trafficking protein SEC22c Source.505: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4 Source.506: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork Source.507: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B Source.508: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4 Source.509: DFBPPR21791 ---- Animal proteins ---- Fumarylacetoacetate hydrolase domain-containing protein 2 Source.510: DFBPPR21819 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 11 Source.511: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1 Source.512: DFBPPR21945 ---- Animal proteins ---- Dermokine Source.513: DFBPPR21961 ---- Animal proteins ---- P3 protein Source.514: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1 Source.515: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog Source.516: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like Source.517: DFBPPR22064 ---- Animal proteins ---- Uroplakin-3b-like protein 1 Source.518: DFBPPR22109 ---- Animal proteins ---- Host cell factor C1 regulator 1 Source.519: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein Source.520: DFBPPR22246 ---- Animal proteins ---- Pancreatic progenitor cell differentiation and proliferation factor Source.521: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like Source.522: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.523: DFBPPR22428 ---- Animal proteins ---- Cysteine-rich and transmembrane domain-containing protein 1 Source.524: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein Source.525: DFBPPR22458 ---- Animal proteins ---- DNA damage-inducible transcript 4-like protein Source.526: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2 Source.527: DFBPPR22613 ---- Animal proteins ---- Coiled-coil domain-containing protein 71 Source.528: DFBPPR22672 ---- Animal proteins ---- WD repeat-containing protein 89 Source.529: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog Source.530: DFBPPR22752 ---- Animal proteins ---- Uncharacterized protein C11orf71 homolog Source.531: DFBPPR8538 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.532: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.533: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2 Source.534: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.535: DFBPPR8574 ---- Animal proteins ---- Glutathione S-transferase omega-1 Source.536: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.537: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.538: DFBPPR8642 ---- Animal proteins ---- Major prion protein Source.539: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3 Source.540: DFBPPR8646 ---- Animal proteins ---- Chitinase-3-like protein 1 Source.541: DFBPPR8680 ---- Animal proteins ---- Wilms tumor protein homolog Source.542: DFBPPR8691 ---- Animal proteins ---- Presenilin-2 Source.543: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.544: DFBPPR8706 ---- Animal proteins ---- Cellular tumor antigen p53 Source.545: DFBPPR8724 ---- Animal proteins ---- Nitric oxide synthase, endothelial Source.546: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.547: DFBPPR8745 ---- Animal proteins ---- Hyaluronidase-1 Source.548: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.549: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2 Source.550: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.551: DFBPPR8753 ---- Animal proteins ---- Androgen receptor Source.552: DFBPPR8762 ---- Animal proteins ---- Aconitate hydratase, mitochondrial Source.553: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.554: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.555: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.556: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.557: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.558: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.559: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein Source.560: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.561: DFBPPR9014 ---- Animal proteins ---- ATP synthase subunit alpha, mitochondrial Source.562: DFBPPR9022 ---- Animal proteins ---- Prothrombin Source.563: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme Source.564: DFBPPR9048 ---- Animal proteins ---- Neuroendocrine protein 7B2 Source.565: DFBPPR9055 ---- Animal proteins ---- Ameloblastin Source.566: DFBPPR9069 ---- Animal proteins ---- E-selectin Source.567: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.568: DFBPPR9074 ---- Animal proteins ---- Trefoil factor 2 Source.569: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor Source.570: DFBPPR9098 ---- Animal proteins ---- Gastrotropin Source.571: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase Source.572: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.573: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.574: DFBPPR9191 ---- Animal proteins ---- Carbonyl reductase [NADPH] 2 Source.575: DFBPPR9195 ---- Animal proteins ---- Sex-determining region Y protein Source.576: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII Source.577: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase Source.578: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.579: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.580: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase Source.581: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.582: DFBPPR9557 ---- Animal proteins ---- Complement C1q subcomponent subunit A Source.583: DFBPPR9606 ---- Animal proteins ---- Pancreatic prohormone precursor Source.584: DFBPPR9636 ---- Animal proteins ---- D-aspartate oxidase Source.585: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor Source.586: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1 Source.587: DFBPPR9654 ---- Animal proteins ---- Myogenic factor 6 Source.588: DFBPPR9687 ---- Animal proteins ---- Beta-crystallin B1 Source.589: DFBPPR9754 ---- Animal proteins ---- Ig lambda chain C region Source.590: DFBPPR9807 ---- Animal proteins ---- Galectin-4 Source.591: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2 Source.592: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain Source.593: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.594: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src Source.595: DFBPPR10025 ---- Animal proteins ---- Major prion protein homolog Source.596: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes Source.597: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4 Source.598: DFBPPR10060 ---- Animal proteins ---- Alpha-N-acetylgalactosaminidase Source.599: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.600: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2 Source.601: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.602: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.603: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2 Source.604: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.605: DFBPPR10155 ---- Animal proteins ---- Cationic amino acid transporter 2 Source.606: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog Source.607: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.608: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha Source.609: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1 Source.610: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk Source.611: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.612: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1 Source.613: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2 Source.614: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3 Source.615: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn Source.616: DFBPPR10265 ---- Animal proteins ---- GATA-binding factor 2 Source.617: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.618: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.619: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1 Source.620: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.621: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK Source.622: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.623: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle Source.624: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.625: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.626: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.627: DFBPPR10459 ---- Animal proteins ---- Reelin Source.628: DFBPPR10467 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.629: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.630: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21 Source.631: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.632: DFBPPR10489 ---- Animal proteins ---- Myogenic factor 6 Source.633: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1 Source.634: DFBPPR10493 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.635: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta Source.636: DFBPPR10520 ---- Animal proteins ---- Collagen alpha-2(IX) chain Source.637: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.638: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9 Source.639: DFBPPR10540 ---- Animal proteins ---- Nucleoside diphosphate kinase Source.640: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.641: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain Source.642: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog Source.643: DFBPPR10646 ---- Animal proteins ---- Netrin-1 Source.644: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.645: DFBPPR10672 ---- Animal proteins ---- Nibrin Source.646: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb Source.647: DFBPPR10694 ---- Animal proteins ---- Dihydrofolate reductase Source.648: DFBPPR10703 ---- Animal proteins ---- Tensin Source.649: DFBPPR10720 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 11 Source.650: DFBPPR10723 ---- Animal proteins ---- Interferon regulatory factor 8 Source.651: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4 Source.652: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2 Source.653: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5 Source.654: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain Source.655: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.656: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.657: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein Source.658: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.659: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.660: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.661: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2 Source.662: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1 Source.663: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.664: DFBPPR11147 ---- Animal proteins ---- Fibulin-1 Source.665: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A Source.666: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B Source.667: DFBPPR11180 ---- Animal proteins ---- Trypsin I-P1 Source.668: DFBPPR11183 ---- Animal proteins ---- Trypsin II-P29 Source.669: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2 Source.670: DFBPPR11218 ---- Animal proteins ---- Pancreatic hormone Source.671: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.672: DFBPPR11223 ---- Animal proteins ---- Trypsin I-P38 Source.673: DFBPPR11238 ---- Animal proteins ---- Retinaldehyde-binding protein 1 Source.674: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.675: DFBPPR11255 ---- Animal proteins ---- Beta-crystallin A3 Source.676: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha Source.677: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2 Source.678: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2 Source.679: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4 Source.680: DFBPPR11362 ---- Animal proteins ---- Beta-crystallin B2 Source.681: DFBPPR11372 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase Source.682: DFBPPR11417 ---- Animal proteins ---- LRP chaperone MESD Source.683: DFBPPR11425 ---- Animal proteins ---- Secreted frizzled-related protein 1 Source.684: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1 Source.685: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.686: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5 Source.687: DFBPPR11489 ---- Animal proteins ---- Beta-crystallin B1 Source.688: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.689: DFBPPR11510 ---- Animal proteins ---- Gonadoliberin-2 Source.690: DFBPPR11522 ---- Animal proteins ---- S-adenosylmethionine sensor upstream of mTORC1 Source.691: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.692: DFBPPR11592 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.693: DFBPPR11593 ---- Animal proteins ---- Syndetin Source.694: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K Source.695: DFBPPR11614 ---- Animal proteins ---- Beta-crystallin B3 Source.696: DFBPPR11628 ---- Animal proteins ---- Beta-crystallin A2 Source.697: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog Source.698: DFBPPR11691 ---- Animal proteins ---- Beta-crystallin A4 Source.699: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit Source.700: DFBPPR11706 ---- Animal proteins ---- Sine oculis-binding protein homolog Source.701: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1 Source.702: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.703: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1 Source.704: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6 Source.705: DFBPPR11842 ---- Animal proteins ---- Homeobox protein ANF-1 Source.706: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8 Source.707: DFBPPR11904 ---- Animal proteins ---- Paired box protein Pax-1 Source.708: DFBPPR11915 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 3 Source.709: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8 Source.710: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.711: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.712: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1 Source.713: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.714: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog Source.715: DFBPPR12128 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like Source.716: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.717: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1 Source.718: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.719: DFBPPR12271 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.720: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.721: DFBPPR12278 ---- Animal proteins ---- Major prion protein Source.722: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.723: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.724: DFBPPR12298 ---- Animal proteins ---- Serine hydroxymethyltransferase, mitochondrial Source.725: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.726: DFBPPR12324 ---- Animal proteins ---- Androgen receptor Source.727: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14 Source.728: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein Source.729: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.730: DFBPPR12398 ---- Animal proteins ---- Acyloxyacyl hydrolase Source.731: DFBPPR12420 ---- Animal proteins ---- Serum paraoxonase/lactonase 3 Source.732: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase Source.733: DFBPPR12433 ---- Animal proteins ---- Carbonic anhydrase 2 Source.734: DFBPPR12441 ---- Animal proteins ---- Triadin Source.735: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.736: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1 Source.737: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2 Source.738: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.739: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase Source.740: DFBPPR12545 ---- Animal proteins ---- Galectin-3 Source.741: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle Source.742: DFBPPR12591 ---- Animal proteins ---- Annexin A11 Source.743: DFBPPR12600 ---- Animal proteins ---- Protein IMPACT Source.744: DFBPPR12601 ---- Animal proteins ---- Protein IMPACT Source.745: DFBPPR12602 ---- Animal proteins ---- Osteopontin Source.746: DFBPPR12603 ---- Animal proteins ---- Osteopontin Source.747: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S Source.748: DFBPPR12626 ---- Animal proteins ---- E-selectin Source.749: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain Source.750: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.751: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype Source.752: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor Source.753: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.754: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.755: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.756: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9 Source.757: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.758: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1 Source.759: DFBPPR12965 ---- Animal proteins ---- RLA class II histocompatibility antigen, DP beta chain Source.760: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.761: DFBPPR13015 ---- Animal proteins ---- Beta-crystallin B2 Source.762: DFBPPR13026 ---- Animal proteins ---- Homeobox expressed in ES cells 1 Source.763: DFBPPR13040 ---- Animal proteins ---- Pancreatic hormone Source.764: DFBPPR13062 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.765: DFBPPR13070 ---- Animal proteins ---- Beta-crystallin A2 Source.766: DFBPPR13148 ---- Animal proteins ---- Cellular tumor antigen p53 Source.767: DFBPPR13222 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.768: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.769: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.770: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.771: DFBPPR13364 ---- Animal proteins ---- Glycophorin-A Source.772: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.773: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein Source.774: DFBPPR13423 ---- Animal proteins ---- Chitinase-3-like protein 1 Source.775: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.776: DFBPPR13433 ---- Animal proteins ---- Major prion protein Source.777: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.778: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.779: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein Source.780: DFBPPR13530 ---- Animal proteins ---- Major prion protein Source.781: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.782: DFBPPR13534 ---- Animal proteins ---- Chitinase-3-like protein 1 Source.783: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.784: DFBPPR13549 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.785: DFBPPR13560 ---- Animal proteins ---- P-selectin Source.786: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53 Source.787: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2 Source.788: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase Source.789: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor Source.790: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.791: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor Source.792: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40 Source.793: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein Source.794: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.795: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.796: DFBPPR13802 ---- Animal proteins ---- Pancreatic prohormone Source.797: DFBPPR13842 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.798: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein Source.799: DFBPPR13983 ---- Animal proteins ---- Pro-opiomelanocortin-1 Source.800: DFBPPR13984 ---- Animal proteins ---- Pro-opiomelanocortin-2 Source.801: DFBPPR13987 ---- Animal proteins ---- Hemoglobin subunit alpha Source.802: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.803: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.804: DFBPPR14075 ---- Marine protein ---- Trypsin-1 Source.805: DFBPPR14090 ---- Marine protein ---- Trypsin-3 Source.806: DFBPPR14118 ---- Marine protein ---- Trypsin-2 Source.807: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase Source.808: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.809: DFBPPR14129 ---- Marine protein ---- Methylthioribulose-1-phosphate dehydratase Source.810: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1 Source.811: DFBPPR14179 ---- Marine protein ---- Alpha-endosulfine Source.812: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.813: DFBPPR14303 ---- Marine protein ---- Phycobilisome rod-core linker polypeptide cpcG Source.814: DFBPPR14330 ---- Marine protein ---- Acetolactate synthase large subunit Source.815: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.816: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic Source.817: DFBPPR14402 ---- Marine protein ---- 50S ribosomal protein L3, chloroplastic Source.818: DFBPPR14575 ---- Marine protein ---- Cellular tumor antigen p53 Source.819: DFBPPR14587 ---- Marine protein ---- Thyrotropin subunit beta Source.820: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.821: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha Source.822: DFBPPR14692 ---- Marine protein ---- Progonadoliberin-2 Source.823: DFBPPR14704 ---- Marine protein ---- Selenoprotein F Source.824: DFBPPR14753 ---- Marine protein ---- Clotting factor B Source.825: DFBPPR14781 ---- Marine protein ---- Hemocyanin Source.826: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase Source.827: DFBPPR14860 ---- Marine protein ---- Thyrotropin subunit beta Source.828: DFBPPR14876 ---- Microorganism protein ---- Hexokinase Source.829: DFBPPR14885 ---- Microorganism protein ---- Guanine nucleotide-binding protein alpha-1 subunit Source.830: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1 Source.831: DFBPPR14890 ---- Microorganism protein ---- Killer toxin subunits alpha/beta Source.832: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase Source.833: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1 Source.834: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase Source.835: DFBPPR14959 ---- Microorganism protein ---- Serine/threonine-protein kinase BUR1 Source.836: DFBPPR14960 ---- Microorganism protein ---- Protease KEX1 Source.837: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase Source.838: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.839: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial Source.840: DFBPPR14996 ---- Microorganism protein ---- Homocysteine/cysteine synthase Source.841: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1 Source.842: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1 Source.843: DFBPPR15048 ---- Microorganism protein ---- 3-ketodihydrosphingosine reductase TSC10 Source.844: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2 Source.845: DFBPPR15171 ---- Microorganism protein ---- Serine palmitoyltransferase 2 Source.846: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5 Source.847: DFBPPR15183 ---- Microorganism protein ---- Homoaconitase, mitochondrial Source.848: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.849: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1 Source.850: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease Source.851: DFBPPR15390 ---- Microorganism protein ---- Probable nucleolar complex protein 14 Source.852: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1 Source.853: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial Source.854: DFBPPR15429 ---- Microorganism protein ---- 54S ribosomal protein L2, mitochondrial Source.855: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1 Source.856: DFBPPR15457 ---- Microorganism protein ---- Ribosome biogenesis protein RLP24 Source.857: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44 Source.858: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12 Source.859: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.860: DFBPPR15750 ---- Microorganism protein ---- 60S ribosomal protein L24 Source.861: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain Source.862: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4 Source.863: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.864: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.865: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.866: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.867: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.868: DFBPPR7826 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-2 Source.869: DFBPPR7827 ---- Plant protein ---- U1 small nuclear ribonucleoprotein C-1 Source.870: DFBPPR7856 ---- Plant protein ---- Maturase K Source.871: DFBPPR7925 ---- Plant protein ---- Kafirin PGK1 Source.872: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.873: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.874: DFBPPR8056 ---- Plant protein ---- Glutamine synthetase leaf isozyme, chloroplastic Source.875: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.876: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2 Source.877: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.878: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.879: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.880: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.881: DFBPPR8265 ---- Plant protein ---- Oxygen-evolving enhancer protein 2, chloroplastic Source.882: DFBPPR8314 ---- Plant protein ---- Maturase K
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

α-Glucosidase inhibitory activity

Inhibitor of α-Glucosidase (AGH, EC 3.2.1.20). Tyr-Tyr-Pro-Leu which showed a potent inhibition against yeast AGH was selected as a skeleton peptide. As summarized five peptides were synthesized , and the AGH inhibition was determined. Substitution of Leu by Gly at the C-terminus of Tyr-Pro-Leu exhibited a similar AGH inhibition (IC₅₀ = 5.0 mM ), whereas a 6-fold reduction of in hibition activity was observed with Tyr-Pro-Tyr (IC₅₀ = 25.8 mM ). These results indicate that aliphatic amino acids, e.g. Leu or Gly at the C-terminus of the tri-peptide was more favorable than aromatic ones to inhibit AGH.

Table 1 AGH inhibitory activity of synthetic analogues of the peptide isolated from muscle hydrolyzate ^a
Sequence	IC50 (mM)
Tyr-Tyr-Pro-Leu	3.7 ± 0.02
Tyr-Pro-Leu	3.9 ± 0.02
Pro-Leu	No inhibition
Tyr-Pro	16.8 ± 0.08
Tyr-Pro-Gly	5.0 ± 0.01
Tyr-Pro-Tyr	25.8 ± 0.12

^a The analogue peptides were synthesized on the basis of the sequence of Tyr-Tyr-Pro-Leu isolated from the hydrolyzate.

Specific target protein(s)

Specific Target Protein(s):
Lysosomal alpha-glucosidase

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)O

Preparation method

Mode of preparation	Synthesis peptide
Enzyme(s)/starter culture	The peptide was synthesized using Fmoc solid phase synthesis on a Kokusan Peptide Synthesizer.

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

(1) AGH inhibitory studies of Try-Tyr-Pro-Leu and its derivatives demonstrated the importance of the tri-peptide chain length as well as the hydrophobic aromatic amino acid tyrosine at the N-terminus, aliphatic amino acids at the C-terminus, as well as an amide proton from the peptide chain at the middle position of the tri-peptide to develop AGH inhibition activity.
(2) Although the sequenc (Tyr-Pro-Gly) is only an synthetic analogue of the peptide and is not found in the sardine muscle hydrolyzate, it is likely to be present in the sardine muscle, or other foods, for later research and discovery, we add this peptde to the DFBP database.

Database cross-references

[D1]

[D2]

[D3]

[D4]

Reference(s)

Primary literature	Matsui T, Oki T, Osajima Y. Isolation and identification of peptidic alpha-glucosidase inhibitors derived from sardine muscle hydrolyzate. Z Naturforsch C J Biosci. 1999 Mar-Apr;54(3-4):259-63. PMID: 10408829 DOI: 10.1515/znc-1999-3-417
Other literature(s)	[1] Matsui T, Yoshimoto C, Osajima K, et al. In vitro survey of alpha-glucosidase inhibitory food components.[J]. Journal of the Agricultural Chemical Society of Japan, 1996, 60(12):2019-2022.
PubDate	1999