Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANHY0846(Antihypertensive peptide)

DFBP ID	DFBPANHY0846
Peptide sequence	VEV
Type	Native peptide
Peptide/Function name	Antihypertensive peptide

Function-activity relationship

Main bioactivity	Antihypertensive activity
Otheir bioactivity	ACE-inhibitory activity ^[D1], Multifunctional activity ^[D2]

Calculated physicochemical properties

Three-letter amino acid

Val-Glu-Val

Single-letter amino acid

VEV

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	345.40 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

3.34 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

1.6333^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Pearl oyster (Pinctada fucata martensii)
Precursor protein	Pearl oyster powder hydrolysates
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3 Source.2: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1 Source.3: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2 Source.4: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1 Source.5: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5 Source.6: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1 Source.7: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11 Source.8: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic Source.9: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.10: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.11: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.12: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.13: DFBPPR0877 ---- Plant proteins ---- Probable glutathione S-transferase DHAR1, cytosolic Source.14: DFBPPR0900 ---- Plant proteins ---- GTPase activating protein 1 Source.15: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.16: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase Source.17: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2 Source.18: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703 Source.19: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.20: DFBPPR0930 ---- Plant proteins ---- Abscisic acid receptor PYL3 Source.21: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1 Source.22: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A Source.23: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic Source.24: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.25: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3 Source.26: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1 Source.27: DFBPPR0971 ---- Plant proteins ---- Protein STAR1 Source.28: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic Source.29: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2 Source.30: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185 Source.31: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2 Source.32: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA Source.33: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B Source.34: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1 Source.35: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic Source.36: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2 Source.37: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4 Source.38: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5 Source.39: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2 Source.40: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.41: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1 Source.42: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.43: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1 Source.44: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic Source.45: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4 Source.46: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic Source.47: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B Source.48: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.49: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A Source.50: DFBPPR1167 ---- Plant proteins ---- Phototropin-2 Source.51: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A Source.52: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20 Source.53: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3 Source.54: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1 Source.55: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog Source.56: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM Source.57: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2 Source.58: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic Source.59: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3 Source.60: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic Source.61: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.62: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog Source.63: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.64: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.65: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic Source.66: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8 Source.67: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic Source.68: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16 Source.69: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7 Source.70: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog Source.71: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1 Source.72: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1 Source.73: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12 Source.74: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.75: DFBPPR1353 ---- Plant proteins ---- Transcription factor UDT1 Source.76: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.77: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B Source.78: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic Source.79: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic Source.80: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1 Source.81: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type Source.82: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic Source.83: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5 Source.84: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.85: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3 Source.86: DFBPPR1409 ---- Plant proteins ---- Flavanone 3-dioxygenase 3 Source.87: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B Source.88: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C Source.89: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.90: DFBPPR1427 ---- Plant proteins ---- Probable esterase D14L Source.91: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase Source.92: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4 Source.93: DFBPPR1446 ---- Plant proteins ---- Nucleoside diphosphate kinase 1 Source.94: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2 Source.95: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c Source.96: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1 Source.97: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4 Source.98: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A Source.99: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.100: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.101: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1 Source.102: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1 Source.103: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.104: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein Source.105: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial Source.106: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1 Source.107: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3 Source.108: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1 Source.109: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1 Source.110: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1 Source.111: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5 Source.112: DFBPPR1539 ---- Plant proteins ---- Probable L-ascorbate peroxidase 4, peroxisomal Source.113: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.114: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1 Source.115: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.116: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19 Source.117: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1 Source.118: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.119: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.120: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.121: DFBPPR1597 ---- Plant proteins ---- MADS-box transcription factor 51 Source.122: DFBPPR1606 ---- Plant proteins ---- 17.4 kDa class I heat shock protein Source.123: DFBPPR1609 ---- Plant proteins ---- Expansin-B1 Source.124: DFBPPR1610 ---- Plant proteins ---- 18.1 kDa class I heat shock protein Source.125: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.126: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic Source.127: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.128: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1 Source.129: DFBPPR1641 ---- Plant proteins ---- Enolase Source.130: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic Source.131: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic Source.132: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic Source.133: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase Source.134: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10 Source.135: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal Source.136: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4 Source.137: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3 Source.138: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.139: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.140: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4 Source.141: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2 Source.142: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.143: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.144: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1 Source.145: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.146: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54 Source.147: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1 Source.148: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1 Source.149: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic Source.150: DFBPPR1748 ---- Plant proteins ---- 17.7 kDa class I heat shock protein Source.151: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase Source.152: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12 Source.153: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11 Source.154: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1 Source.155: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic Source.156: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3 Source.157: DFBPPR1843 ---- Plant proteins ---- Laccase-13 Source.158: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2 Source.159: DFBPPR1851 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1 Source.160: DFBPPR1853 ---- Plant proteins ---- Laccase-4 Source.161: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a Source.162: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A Source.163: DFBPPR1865 ---- Plant proteins ---- Laccase-22 Source.164: DFBPPR1867 ---- Plant proteins ---- Laccase-21 Source.165: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11 Source.166: DFBPPR1882 ---- Plant proteins ---- Laccase-12 Source.167: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1 Source.168: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.169: DFBPPR1891 ---- Plant proteins ---- Transcription factor MYBS2 Source.170: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.171: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog Source.172: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.173: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.174: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7 Source.175: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3 Source.176: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1 Source.177: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4 Source.178: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.179: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2 Source.180: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.181: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12 Source.182: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.183: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase Source.184: DFBPPR2009 ---- Plant proteins ---- Laccase-14 Source.185: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33 Source.186: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a Source.187: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic Source.188: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.189: DFBPPR2028 ---- Plant proteins ---- Laccase-7 Source.190: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B Source.191: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16 Source.192: DFBPPR2037 ---- Plant proteins ---- Laccase-10 Source.193: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial Source.194: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.195: DFBPPR2047 ---- Plant proteins ---- 17.8 kDa heat shock protein Source.196: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7 Source.197: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C Source.198: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9 Source.199: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic Source.200: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 Source.201: DFBPPR2138 ---- Plant proteins ---- 17.9 kDa class I heat shock protein Source.202: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2 Source.203: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4 Source.204: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2 Source.205: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7 Source.206: DFBPPR2173 ---- Plant proteins ---- Cullin-1 Source.207: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase Source.208: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.209: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1 Source.210: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32 Source.211: DFBPPR2223 ---- Plant proteins ---- Urease Source.212: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like Source.213: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic Source.214: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain Source.215: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1 Source.216: DFBPPR2247 ---- Plant proteins ---- Phytochrome C Source.217: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3 Source.218: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30 Source.219: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29 Source.220: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.221: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3 Source.222: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.223: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8 Source.224: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3 Source.225: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic Source.226: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2 Source.227: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4 Source.228: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5 Source.229: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4 Source.230: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic Source.231: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB Source.232: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.233: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3 Source.234: DFBPPR2374 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2 Source.235: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein Source.236: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1 Source.237: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6 Source.238: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5 Source.239: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C Source.240: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8 Source.241: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4 Source.242: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13 Source.243: DFBPPR2436 ---- Plant proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3 Source.244: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic Source.245: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.246: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.247: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase Source.248: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase Source.249: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2 Source.250: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.251: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20 Source.252: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic Source.253: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13 Source.254: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5 Source.255: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22 Source.256: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.257: DFBPPR2540 ---- Plant proteins ---- 23.2 kDa heat shock protein Source.258: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1 Source.259: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2 Source.260: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B Source.261: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2 Source.262: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9 Source.263: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase Source.264: DFBPPR2602 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX19 Source.265: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1 Source.266: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1 Source.267: DFBPPR2623 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 3 Source.268: DFBPPR2641 ---- Plant proteins ---- 18.8 kDa class V heat shock protein Source.269: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5 Source.270: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10 Source.271: DFBPPR2673 ---- Plant proteins ---- Expansin-B13 Source.272: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog Source.273: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18 Source.274: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9 Source.275: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.276: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10 Source.277: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7 Source.278: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15 Source.279: DFBPPR2754 ---- Plant proteins ---- Adenylate kinase 3 Source.280: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9 Source.281: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2 Source.282: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2 Source.283: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein Source.284: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A Source.285: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.286: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.287: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D Source.288: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2 Source.289: DFBPPR2831 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 4 Source.290: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.291: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.292: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.293: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.294: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.295: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53 Source.296: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX Source.297: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11 Source.298: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27 Source.299: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2 Source.300: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1 Source.301: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.302: DFBPPR2928 ---- Plant proteins ---- 18.9 kDa heat shock protein Source.303: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4 Source.304: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.305: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A Source.306: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 Source.307: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic Source.308: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.309: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic Source.310: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2 Source.311: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3 Source.312: DFBPPR3032 ---- Plant proteins ---- 19.0 kDa class II heat shock protein Source.313: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial Source.314: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2 Source.315: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.316: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1 Source.317: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.318: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34 Source.319: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1 Source.320: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.321: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.322: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic Source.323: DFBPPR3115 ---- Plant proteins ---- Nucleosome assembly protein 1;1 Source.324: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2 Source.325: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1 Source.326: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.327: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic Source.328: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51 Source.329: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6 Source.330: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.331: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B Source.332: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O Source.333: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2 Source.334: DFBPPR3164 ---- Plant proteins ---- Cysteine proteinase inhibitor 2 Source.335: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.336: DFBPPR3181 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX15 Source.337: DFBPPR3190 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX17 Source.338: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3 Source.339: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5 Source.340: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic Source.341: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1 Source.342: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45 Source.343: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic Source.344: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26 Source.345: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B Source.346: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.347: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6 Source.348: DFBPPR3253 ---- Plant proteins ---- Malate synthase Source.349: DFBPPR3262 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic Source.350: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13 Source.351: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18 Source.352: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1 Source.353: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12 Source.354: DFBPPR3335 ---- Plant proteins ---- Molybdopterin synthase sulfur carrier subunit Source.355: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.356: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8 Source.357: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase Source.358: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic Source.359: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic Source.360: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28 Source.361: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.362: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.363: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28 Source.364: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2 Source.365: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6 Source.366: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic Source.367: DFBPPR3430 ---- Plant proteins ---- Dehydrin DHN1 Source.368: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F Source.369: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2 Source.370: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.371: DFBPPR3461 ---- Plant proteins ---- 50S ribosomal protein L18, chloroplastic Source.372: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A Source.373: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7 Source.374: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4 Source.375: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3 Source.376: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B Source.377: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13 Source.378: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2 Source.379: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.380: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2 Source.381: DFBPPR3554 ---- Plant proteins ---- GTP-binding nuclear protein Ran-3 Source.382: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600 Source.383: DFBPPR3573 ---- Plant proteins ---- Protein TIFY 5 Source.384: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2 Source.385: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.386: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.387: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A Source.388: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6 Source.389: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic Source.390: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic Source.391: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3 Source.392: DFBPPR3659 ---- Plant proteins ---- Probable signal peptidase complex subunit 3 Source.393: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9 Source.394: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.395: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic Source.396: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.397: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39 Source.398: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.399: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9 Source.400: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7 Source.401: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic Source.402: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.403: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8 Source.404: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24 Source.405: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1 Source.406: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog Source.407: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.408: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.409: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6 Source.410: DFBPPR3792 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 1 Source.411: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.412: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2 Source.413: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1 Source.414: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52 Source.415: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47 Source.416: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14 Source.417: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13 Source.418: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57 Source.419: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5 Source.420: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2 Source.421: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic Source.422: DFBPPR3876 ---- Plant proteins ---- Bifunctional nuclease 2 Source.423: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5 Source.424: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1 Source.425: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5 Source.426: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4 Source.427: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3 Source.428: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6 Source.429: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2 Source.430: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.431: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA Source.432: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9 Source.433: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3 Source.434: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7 Source.435: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J Source.436: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1 Source.437: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3 Source.438: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4 Source.439: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19 Source.440: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20 Source.441: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31 Source.442: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog Source.443: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A Source.444: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9 Source.445: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.446: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic Source.447: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog Source.448: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.449: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3 Source.450: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5 Source.451: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8 Source.452: DFBPPR4093 ---- Plant proteins ---- Villin-5 Source.453: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.454: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2 Source.455: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1 Source.456: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C Source.457: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.458: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13 Source.459: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6 Source.460: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1 Source.461: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C Source.462: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4 Source.463: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1 Source.464: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3 Source.465: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1 Source.466: DFBPPR4245 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 2 Source.467: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4 Source.468: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2 Source.469: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1 Source.470: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial Source.471: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1 Source.472: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5 Source.473: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.474: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B Source.475: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28 Source.476: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5 Source.477: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic Source.478: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C Source.479: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A Source.480: DFBPPR4318 ---- Plant proteins ---- Golgin-84 Source.481: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11 Source.482: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24 Source.483: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10 Source.484: DFBPPR4378 ---- Plant proteins ---- Basic leucine zipper 6 Source.485: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2 Source.486: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2 Source.487: DFBPPR4413 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 4 Source.488: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2 Source.489: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18 Source.490: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein Source.491: DFBPPR4465 ---- Plant proteins ---- Electron transfer flavoprotein subunit beta, mitochondrial Source.492: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.493: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4 Source.494: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1 Source.495: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2 Source.496: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.497: DFBPPR4529 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 1 Source.498: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A Source.499: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.500: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog Source.501: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H Source.502: DFBPPR4558 ---- Plant proteins ---- 40S ribosomal protein S20 Source.503: DFBPPR4559 ---- Plant proteins ---- 40S ribosomal protein S15 Source.504: DFBPPR4561 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 5 Source.505: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65 Source.506: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease Source.507: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15 Source.508: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2 Source.509: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43 Source.510: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12 Source.511: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7 Source.512: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B Source.513: DFBPPR4662 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor SMR1 Source.514: DFBPPR4669 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 8 Source.515: DFBPPR4676 ---- Plant proteins ---- PP2A regulatory subunit TAP46 Source.516: DFBPPR4685 ---- Plant proteins ---- 30S ribosomal protein S31, mitochondrial Source.517: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1 Source.518: DFBPPR4693 ---- Plant proteins ---- Uncharacterized protein ycf68 Source.519: DFBPPR4696 ---- Plant proteins ---- Uncharacterized protein ycf72 Source.520: DFBPPR4700 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 6 Source.521: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5 Source.522: DFBPPR4736 ---- Plant proteins ---- B3 domain-containing protein Os04g0581400 Source.523: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400 Source.524: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.525: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21 Source.526: DFBPPR4801 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0619850 Source.527: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500 Source.528: DFBPPR4837 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 5 Source.529: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800 Source.530: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600 Source.531: DFBPPR4882 ---- Plant proteins ---- Salt stress root protein RS1 Source.532: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic Source.533: DFBPPR4899 ---- Plant proteins ---- Casein kinase 1 Source.534: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.535: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10 Source.536: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.537: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2 Source.538: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2 Source.539: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.540: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.541: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A Source.542: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1 Source.543: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1 Source.544: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A Source.545: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.546: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1 Source.547: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase Source.548: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4 Source.549: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5 Source.550: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.551: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.552: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1 Source.553: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.554: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.555: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic Source.556: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog Source.557: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2 Source.558: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.559: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1 Source.560: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6 Source.561: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.562: DFBPPR5145 ---- Plant proteins ---- 22.0 kDa class IV heat shock protein Source.563: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.564: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1 Source.565: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.566: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic Source.567: DFBPPR5180 ---- Plant proteins ---- Biotin carboxyl carrier protein of acetyl-CoA carboxylase, chloroplastic Source.568: DFBPPR5183 ---- Plant proteins ---- Histone deacetylase HDT1 Source.569: DFBPPR5197 ---- Plant proteins ---- Nodulin-21 Source.570: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6 Source.571: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7 Source.572: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1 Source.573: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic Source.574: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3 Source.575: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase Source.576: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.577: DFBPPR5250 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic Source.578: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3 Source.579: DFBPPR5304 ---- Plant proteins ---- Maturase K Source.580: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3 Source.581: DFBPPR5353 ---- Plant proteins ---- Small heat shock protein, chloroplastic Source.582: DFBPPR5360 ---- Plant proteins ---- 14-3-3-like protein A Source.583: DFBPPR5364 ---- Plant proteins ---- Auxin-induced protein X10A Source.584: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.585: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.586: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.587: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1 Source.588: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.589: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.590: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic Source.591: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic Source.592: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.593: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH] Source.594: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic Source.595: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic Source.596: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8 Source.597: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.598: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain Source.599: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1 Source.600: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain Source.601: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase Source.602: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain Source.603: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial Source.604: DFBPPR5561 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase catalytic chain, chloroplastic Source.605: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.606: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.607: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.608: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.609: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.610: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1 Source.611: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic Source.612: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic Source.613: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.614: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic Source.615: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4 Source.616: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1 Source.617: DFBPPR5650 ---- Plant proteins ---- Enolase 1 Source.618: DFBPPR5654 ---- Plant proteins ---- Molybdopterin synthase sulfur carrier subunit Source.619: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.620: DFBPPR5675 ---- Plant proteins ---- Enolase 2 Source.621: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.622: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5 Source.623: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1 Source.624: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic Source.625: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3 Source.626: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.627: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.628: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.629: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.630: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2 Source.631: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.632: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.633: DFBPPR5782 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic Source.634: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.635: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic Source.636: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.637: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.638: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.639: DFBPPR5836 ---- Plant proteins ---- Eukaryotic translation initiation factor 5A Source.640: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.641: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.642: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase Source.643: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme Source.644: DFBPPR5901 ---- Plant proteins ---- GTP-binding protein YPTM1 Source.645: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase Source.646: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2 Source.647: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.648: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.649: DFBPPR5976 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog Source.650: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase Source.651: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein Source.652: DFBPPR6089 ---- Plant proteins ---- Cell number regulator 6 Source.653: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8 Source.654: DFBPPR6140 ---- Plant proteins ---- Uncharacterized protein ycf72 Source.655: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1 Source.656: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase Source.657: DFBPPR6164 ---- Plant proteins ---- Oil body-associated protein 2B Source.658: DFBPPR6169 ---- Plant proteins ---- Uncharacterized 2.5 kDa protein in tRNA-Arg-tRNA-Asn intergenic region Source.659: DFBPPR6186 ---- Plant proteins ---- Transposable element activator uncharacterized 23 kDa protein Source.660: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.661: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic Source.662: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.663: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3 Source.664: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase Source.665: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic Source.666: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase Source.667: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.668: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.669: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic Source.670: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.671: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic Source.672: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic Source.673: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic Source.674: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic Source.675: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic Source.676: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.677: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic Source.678: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.679: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3 Source.680: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2 Source.681: DFBPPR6374 ---- Plant proteins ---- 18.1 kDa class I heat shock protein Source.682: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic Source.683: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.684: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.685: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic Source.686: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial Source.687: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial Source.688: DFBPPR6431 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha Source.689: DFBPPR6441 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic Source.690: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6 Source.691: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B Source.692: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2 Source.693: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A Source.694: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3 Source.695: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4 Source.696: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5 Source.697: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1 Source.698: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.699: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.700: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2 Source.701: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.702: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic Source.703: DFBPPR6571 ---- Plant proteins ---- Small heat shock protein, chloroplastic Source.704: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.705: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.706: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1 Source.707: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.708: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A Source.709: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1 Source.710: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain Source.711: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B Source.712: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase Source.713: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase Source.714: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D Source.715: DFBPPR6769 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1 Source.716: DFBPPR6773 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2 Source.717: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.718: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A Source.719: DFBPPR6788 ---- Plant proteins ---- Histone H1 Source.720: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B Source.721: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B Source.722: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.723: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A Source.724: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C Source.725: DFBPPR6835 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 1, chloroplastic Source.726: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.727: DFBPPR6856 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 3, chloroplastic Source.728: DFBPPR6857 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 2, chloroplastic Source.729: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.730: DFBPPR6874 ---- Plant proteins ---- Dehydrin COR410 Source.731: DFBPPR6881 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic Source.732: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic Source.733: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.734: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1 Source.735: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7 Source.736: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.737: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1 Source.738: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.739: DFBPPR7052 ---- Plant proteins ---- Protein synthesis inhibitor II Source.740: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.741: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain Source.742: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.743: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain Source.744: DFBPPR7071 ---- Plant proteins ---- Serpin-Z4 Source.745: DFBPPR7072 ---- Plant proteins ---- Protein synthesis inhibitor I Source.746: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.747: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase Source.748: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX Source.749: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic Source.750: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.751: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3 Source.752: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha Source.753: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog Source.754: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.755: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.756: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.757: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.758: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1 Source.759: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic Source.760: DFBPPR7273 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1A Source.761: DFBPPR7280 ---- Plant proteins ---- 30S ribosomal protein 3, chloroplastic Source.762: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic Source.763: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic Source.764: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic Source.765: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic Source.766: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic Source.767: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a Source.768: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412 Source.769: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405 Source.770: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.771: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.772: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.773: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.774: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2 Source.775: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic Source.776: DFBPPR7478 ---- Plant proteins ---- Napin embryo-specific Source.777: DFBPPR7482 ---- Plant proteins ---- Napin Source.778: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog Source.779: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.780: DFBPPR7608 ---- Milk proteins ---- Kappa-casein Source.781: DFBPPR7611 ---- Milk proteins ---- Clusterin Source.782: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.783: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.784: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1 Source.785: DFBPPR7635 ---- Milk proteins ---- Prosaposin Source.786: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor Source.787: DFBPPR7649 ---- Milk proteins ---- Cadherin-1 Source.788: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.789: DFBPPR7677 ---- Milk proteins ---- Alpha-S2-casein-like A Source.790: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein Source.791: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH] Source.792: DFBPPR8192 ---- Plant proteins ---- 2S albumin Source.793: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal Source.794: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1 Source.795: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3 Source.796: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2 Source.797: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase Source.798: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.799: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.800: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1 Source.801: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic Source.802: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2 Source.803: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1 Source.804: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.805: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.806: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.807: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase Source.808: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N Source.809: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.810: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B Source.811: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.812: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.813: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.814: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.815: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.816: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1 Source.817: DFBPPR16094 ---- Animal proteins ---- Mastin Source.818: DFBPPR16102 ---- Animal proteins ---- 40S ribosomal protein S3 Source.819: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.820: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.821: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase Source.822: DFBPPR16148 ---- Animal proteins ---- Haptoglobin Source.823: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1 Source.824: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.825: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.826: DFBPPR16189 ---- Animal proteins ---- Albumin Source.827: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator Source.828: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3 Source.829: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.830: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1 Source.831: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.832: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.833: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.834: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta Source.835: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.836: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase Source.837: DFBPPR16265 ---- Animal proteins ---- Caspase-1 Source.838: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11 Source.839: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor Source.840: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.841: DFBPPR16326 ---- Animal proteins ---- Desmin Source.842: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.843: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.844: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain Source.845: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.846: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.847: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.848: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.849: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog Source.850: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.851: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3 Source.852: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.853: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.854: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.855: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.856: DFBPPR16572 ---- Animal proteins ---- Gamma-sarcoglycan Source.857: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.858: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19 Source.859: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.860: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.861: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.862: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8 Source.863: DFBPPR16693 ---- Animal proteins ---- Cingulin Source.864: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.865: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.866: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.867: DFBPPR16763 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.868: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor Source.869: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.870: DFBPPR16797 ---- Animal proteins ---- Albumin Source.871: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A Source.872: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase Source.873: DFBPPR16810 ---- Animal proteins ---- Cathepsin B Source.874: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1 Source.875: DFBPPR16814 ---- Animal proteins ---- Prothrombin Source.876: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1 Source.877: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial Source.878: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.879: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial Source.880: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial Source.881: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor Source.882: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.883: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2 Source.884: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1 Source.885: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.886: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.887: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.888: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial Source.889: DFBPPR16940 ---- Animal proteins ---- Ras-related protein Rap-1A Source.890: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2 Source.891: DFBPPR16961 ---- Animal proteins ---- C-X-C motif chemokine 6 Source.892: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase Source.893: DFBPPR16969 ---- Animal proteins ---- Adenosine deaminase Source.894: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase Source.895: DFBPPR16985 ---- Animal proteins ---- Filensin Source.896: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.897: DFBPPR17000 ---- Animal proteins ---- Vimentin Source.898: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase Source.899: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9 Source.900: DFBPPR17007 ---- Animal proteins ---- Microtubule-associated protein tau Source.901: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial Source.902: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2 Source.903: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.904: DFBPPR17036 ---- Animal proteins ---- Parkinson disease protein 7 homolog Source.905: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type Source.906: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.907: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.908: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.909: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.910: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.911: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2 Source.912: DFBPPR17102 ---- Animal proteins ---- Dystroglycan Source.913: DFBPPR17103 ---- Animal proteins ---- Dystroglycan Source.914: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2 Source.915: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta Source.916: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit Source.917: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2 Source.918: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.919: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.920: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial Source.921: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor Source.922: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor Source.923: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2 Source.924: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.925: DFBPPR17268 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.926: DFBPPR17272 ---- Animal proteins ---- Dysbindin Source.927: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1 Source.928: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.929: DFBPPR17286 ---- Animal proteins ---- Septin-2 Source.930: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.931: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D Source.932: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.933: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein Source.934: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.935: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1 Source.936: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.937: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.938: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.939: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2 Source.940: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog Source.941: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.942: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial Source.943: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.944: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1 Source.945: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha Source.946: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4 Source.947: DFBPPR17439 ---- Animal proteins ---- Folliculin Source.948: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1 Source.949: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.950: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.951: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.952: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.953: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.954: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1 Source.955: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.956: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase Source.957: DFBPPR17484 ---- Animal proteins ---- Histone H1.8 Source.958: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta Source.959: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2 Source.960: DFBPPR17503 ---- Animal proteins ---- Syntaxin-1A Source.961: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.962: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase Source.963: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5 Source.964: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1 Source.965: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase Source.966: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.967: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1 Source.968: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit Source.969: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha Source.970: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.971: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1 Source.972: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A Source.973: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A Source.974: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.975: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B Source.976: DFBPPR17679 ---- Animal proteins ---- Platelet-derived growth factor subunit A Source.977: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia Source.978: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1 Source.979: DFBPPR17748 ---- Animal proteins ---- Interleukin-12 subunit beta Source.980: DFBPPR17764 ---- Animal proteins ---- L-selectin Source.981: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5 Source.982: DFBPPR17783 ---- Animal proteins ---- 40S ribosomal protein S3 Source.983: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.984: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1 Source.985: DFBPPR17797 ---- Animal proteins ---- Caspase-13 Source.986: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.987: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.988: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6 Source.989: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.990: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer Source.991: DFBPPR17819 ---- Animal proteins ---- Ras-related protein Rap-1b Source.992: DFBPPR17824 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 9 Source.993: DFBPPR17834 ---- Animal proteins ---- Apolipoprotein D Source.994: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial Source.995: DFBPPR17844 ---- Animal proteins ---- Protein tyrosine phosphatase type IVA 3 Source.996: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.997: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.998: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.999: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3 Source.1000: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.1001: DFBPPR17894 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 9 Source.1002: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.1003: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13 Source.1004: DFBPPR17925 ---- Animal proteins ---- Caspase-4 Source.1005: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1006: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.1007: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate Source.1008: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.1009: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein Source.1010: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase Source.1011: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.1012: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.1013: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.1014: DFBPPR18001 ---- Animal proteins ---- Syntaxin-1B Source.1015: DFBPPR18007 ---- Animal proteins ---- Complement C4 Source.1016: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial Source.1017: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon Source.1018: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.1019: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F Source.1020: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1 Source.1021: DFBPPR18058 ---- Animal proteins ---- Ras-related GTP-binding protein A Source.1022: DFBPPR18069 ---- Animal proteins ---- Glypican-1 Source.1023: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Source.1024: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1 Source.1025: DFBPPR18110 ---- Animal proteins ---- Protein inturned Source.1026: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.1027: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog Source.1028: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15 Source.1029: DFBPPR18150 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 1 Source.1030: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44 Source.1031: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1 Source.1032: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37 Source.1033: DFBPPR18227 ---- Animal proteins ---- Desmin Source.1034: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.1035: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme Source.1036: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2 Source.1037: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3 Source.1038: DFBPPR18281 ---- Animal proteins ---- CD63 antigen Source.1039: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56 Source.1040: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein Source.1041: DFBPPR18295 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2 Source.1042: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10 Source.1043: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1 Source.1044: DFBPPR18327 ---- Animal proteins ---- Eukaryotic translation initiation factor 6 Source.1045: DFBPPR18339 ---- Animal proteins ---- SPARC Source.1046: DFBPPR18361 ---- Animal proteins ---- Casein kinase I isoform gamma-1 Source.1047: DFBPPR18371 ---- Animal proteins ---- F-actin-capping protein subunit beta Source.1048: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa Source.1049: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6 Source.1050: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3 Source.1051: DFBPPR18415 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-14 Source.1052: DFBPPR18448 ---- Animal proteins ---- Septin-1 Source.1053: DFBPPR18468 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1 Source.1054: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3 Source.1055: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1 Source.1056: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1 Source.1057: DFBPPR18513 ---- Animal proteins ---- Placenta growth factor Source.1058: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit Source.1059: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130 Source.1060: DFBPPR18536 ---- Animal proteins ---- Plastin-1 Source.1061: DFBPPR18540 ---- Animal proteins ---- Fibroblast growth factor-binding protein 1 Source.1062: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.1063: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2 Source.1064: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19 Source.1065: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2 Source.1066: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.1067: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial Source.1068: DFBPPR18614 ---- Animal proteins ---- Beta-enolase Source.1069: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1 Source.1070: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1 Source.1071: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4 Source.1072: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.1073: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa Source.1074: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7 Source.1075: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor Source.1076: DFBPPR18746 ---- Animal proteins ---- Anamorsin Source.1077: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.1078: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav Source.1079: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1 Source.1080: DFBPPR18805 ---- Animal proteins ---- Nascent polypeptide-associated complex subunit alpha Source.1081: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1 Source.1082: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3 Source.1083: DFBPPR18823 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 Source.1084: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.1085: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A Source.1086: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1 Source.1087: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A Source.1088: DFBPPR18868 ---- Animal proteins ---- Haptoglobin Source.1089: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.1090: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.1091: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein Source.1092: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5 Source.1093: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial Source.1094: DFBPPR18919 ---- Animal proteins ---- Dual specificity protein phosphatase 18 Source.1095: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11 Source.1096: DFBPPR18925 ---- Animal proteins ---- Neurochondrin Source.1097: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial Source.1098: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.1099: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase Source.1100: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.1101: DFBPPR19006 ---- Animal proteins ---- Thymidine kinase, cytosolic Source.1102: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D Source.1103: DFBPPR19016 ---- Animal proteins ---- Arginase-2, mitochondrial Source.1104: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3 Source.1105: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.1106: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11 Source.1107: DFBPPR19049 ---- Animal proteins ---- Caprin-1 Source.1108: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E Source.1109: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5 Source.1110: DFBPPR19071 ---- Animal proteins ---- Collectrin Source.1111: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A Source.1112: DFBPPR19100 ---- Animal proteins ---- Interleukin-34 Source.1113: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.1114: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.1115: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1 Source.1116: DFBPPR19137 ---- Animal proteins ---- Serpin H1 Source.1117: DFBPPR19153 ---- Animal proteins ---- Copine-6 Source.1118: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.1119: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3 Source.1120: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16 Source.1121: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.1122: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2 Source.1123: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.1124: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial Source.1125: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase Source.1126: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.1127: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3 Source.1128: DFBPPR19260 ---- Animal proteins ---- rRNA N6-adenosine-methyltransferase ZCCHC4 Source.1129: DFBPPR19268 ---- Animal proteins ---- BAG family molecular chaperone regulator 2 Source.1130: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2 Source.1131: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8 Source.1132: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47 Source.1133: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.1134: DFBPPR19359 ---- Animal proteins ---- Spartin Source.1135: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2 Source.1136: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.1137: DFBPPR19384 ---- Animal proteins ---- Complement component C9 Source.1138: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.1139: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129 Source.1140: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6 Source.1141: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic Source.1142: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3 Source.1143: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.1144: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1 Source.1145: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20 Source.1146: DFBPPR19468 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 2 Source.1147: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.1148: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.1149: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1 Source.1150: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11 Source.1151: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin Source.1152: DFBPPR19531 ---- Animal proteins ---- Interferon omega-1 Source.1153: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3 Source.1154: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial Source.1155: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.1156: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175 Source.1157: DFBPPR19586 ---- Animal proteins ---- Uridine-cytidine kinase 1 Source.1158: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS Source.1159: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1 Source.1160: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25 Source.1161: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial Source.1162: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3 Source.1163: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase Source.1164: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2 Source.1165: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase Source.1166: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule Source.1167: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205 Source.1168: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3 Source.1169: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B Source.1170: DFBPPR19733 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1 Source.1171: DFBPPR19735 ---- Animal proteins ---- Complement component C7 Source.1172: DFBPPR19768 ---- Animal proteins ---- Peroxynitrite isomerase THAP4 Source.1173: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25 Source.1174: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.1175: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4 Source.1176: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.1177: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.1178: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2 Source.1179: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial Source.1180: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.1181: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1 Source.1182: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.1183: DFBPPR19834 ---- Animal proteins ---- Harmonin Source.1184: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2 Source.1185: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase Source.1186: DFBPPR19858 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A Source.1187: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3 Source.1188: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1 Source.1189: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18 Source.1190: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2 Source.1191: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial Source.1192: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial Source.1193: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1 Source.1194: DFBPPR19955 ---- Animal proteins ---- Hemoglobin subunit epsilon-2 Source.1195: DFBPPR19968 ---- Animal proteins ---- Hemoglobin subunit epsilon-4 Source.1196: DFBPPR19973 ---- Animal proteins ---- Plastin-3 Source.1197: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein Source.1198: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2 Source.1199: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase Source.1200: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase Source.1201: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5 Source.1202: DFBPPR20064 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical] Source.1203: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2 Source.1204: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93 Source.1205: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.1206: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.1207: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C Source.1208: DFBPPR20151 ---- Animal proteins ---- AP-2 complex subunit sigma Source.1209: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2 Source.1210: DFBPPR20182 ---- Animal proteins ---- DnaJ homolog subfamily B member 6 Source.1211: DFBPPR20196 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 4 Source.1212: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial Source.1213: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial Source.1214: DFBPPR20214 ---- Animal proteins ---- Lipopolysaccharide-binding protein Source.1215: DFBPPR20218 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL9 Source.1216: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.1217: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase Source.1218: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.1219: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2 Source.1220: DFBPPR20257 ---- Animal proteins ---- Targeting protein for Xklp2 Source.1221: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial Source.1222: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2 Source.1223: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2 Source.1224: DFBPPR20306 ---- Animal proteins ---- Gamma-sarcoglycan Source.1225: DFBPPR20319 ---- Animal proteins ---- Protein pelota homolog Source.1226: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1 Source.1227: DFBPPR20340 ---- Animal proteins ---- Peripherin Source.1228: DFBPPR20346 ---- Animal proteins ---- Serpin B6 Source.1229: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.1230: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1 Source.1231: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6 Source.1232: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7 Source.1233: DFBPPR20392 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1 Source.1234: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2 Source.1235: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase Source.1236: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2 Source.1237: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein Source.1238: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial Source.1239: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase Source.1240: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog Source.1241: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8 Source.1242: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus Source.1243: DFBPPR20487 ---- Animal proteins ---- Multifunctional methyltransferase subunit TRM112-like protein Source.1244: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10 Source.1245: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein Source.1246: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161 Source.1247: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2 Source.1248: DFBPPR20525 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC6 Source.1249: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein Source.1250: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1 Source.1251: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3 Source.1252: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5 Source.1253: DFBPPR20555 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C Source.1254: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating] Source.1255: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog Source.1256: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.1257: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1 Source.1258: DFBPPR20626 ---- Animal proteins ---- Melanocortin receptor 5 Source.1259: DFBPPR20628 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase C Source.1260: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1 Source.1261: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C Source.1262: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.1263: DFBPPR20666 ---- Animal proteins ---- Tektin-2 Source.1264: DFBPPR20669 ---- Animal proteins ---- D site-binding protein Source.1265: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4 Source.1266: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9 Source.1267: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1 Source.1268: DFBPPR20708 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 beta Source.1269: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.1270: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3 Source.1271: DFBPPR20744 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform Source.1272: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog Source.1273: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.1274: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45 Source.1275: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein Source.1276: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein Source.1277: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6 Source.1278: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7 Source.1279: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216 Source.1280: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2 Source.1281: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14 Source.1282: DFBPPR20823 ---- Animal proteins ---- Ubiquitin-related modifier 1 Source.1283: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13 Source.1284: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog Source.1285: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.1286: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.1287: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein Source.1288: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1 Source.1289: DFBPPR20911 ---- Animal proteins ---- 40S ribosomal protein S20 Source.1290: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase Source.1291: DFBPPR20922 ---- Animal proteins ---- Calcipressin-2 Source.1292: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1 Source.1293: DFBPPR20957 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial Source.1294: DFBPPR20958 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial Source.1295: DFBPPR20963 ---- Animal proteins ---- Protein kintoun Source.1296: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1 Source.1297: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2 Source.1298: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog Source.1299: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574 Source.1300: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2 Source.1301: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier Source.1302: DFBPPR21184 ---- Animal proteins ---- Kinetochore protein Spc24 Source.1303: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase Source.1304: DFBPPR21207 ---- Animal proteins ---- Ragulator complex protein LAMTOR3 Source.1305: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1 Source.1306: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231 Source.1307: DFBPPR21241 ---- Animal proteins ---- Cytochrome b-245 chaperone 1 Source.1308: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal Source.1309: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5 Source.1310: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6 Source.1311: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2 Source.1312: DFBPPR21290 ---- Animal proteins ---- Metaxin-1 Source.1313: DFBPPR21303 ---- Animal proteins ---- Palmdelphin Source.1314: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.1315: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1 Source.1316: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4 Source.1317: DFBPPR21339 ---- Animal proteins ---- Zinc finger protein 692 Source.1318: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein Source.1319: DFBPPR21373 ---- Animal proteins ---- Zinc finger protein 2 Source.1320: DFBPPR21380 ---- Animal proteins ---- AP-4 complex subunit sigma-1 Source.1321: DFBPPR21383 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 2A Source.1322: DFBPPR21389 ---- Animal proteins ---- N-terminal EF-hand calcium-binding protein 3 Source.1323: DFBPPR21395 ---- Animal proteins ---- Elongation factor Ts, mitochondrial Source.1324: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase Source.1325: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1 Source.1326: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1 Source.1327: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial Source.1328: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S Source.1329: DFBPPR21535 ---- Animal proteins ---- Gastrotropin Source.1330: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8 Source.1331: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9 Source.1332: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A Source.1333: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A Source.1334: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2 Source.1335: DFBPPR21606 ---- Animal proteins ---- Surfeit locus protein 6 Source.1336: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.1337: DFBPPR21619 ---- Animal proteins ---- CBY1-interacting BAR domain-containing protein 2 Source.1338: DFBPPR21650 ---- Animal proteins ---- Synaptonemal complex central element protein 1 Source.1339: DFBPPR21670 ---- Animal proteins ---- V-type proton ATPase subunit E 2 Source.1340: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like Source.1341: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8 Source.1342: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein Source.1343: DFBPPR21751 ---- Animal proteins ---- Oocyte-expressed protein homolog Source.1344: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.1345: DFBPPR21769 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 21 Source.1346: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5 Source.1347: DFBPPR21779 ---- Animal proteins ---- Serpin B8 Source.1348: DFBPPR21785 ---- Animal proteins ---- Spermatogenesis-associated protein 19, mitochondrial Source.1349: DFBPPR21794 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 8 Source.1350: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.1351: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B Source.1352: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.1353: DFBPPR21836 ---- Animal proteins ---- Potassium channel regulatory protein Source.1354: DFBPPR21851 ---- Animal proteins ---- TSC22 domain family protein 1 Source.1355: DFBPPR21868 ---- Animal proteins ---- RAB6-interacting golgin Source.1356: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein Source.1357: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2 Source.1358: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2 Source.1359: DFBPPR21888 ---- Animal proteins ---- Serum response factor-binding protein 1 Source.1360: DFBPPR21897 ---- Animal proteins ---- ZW10 interactor Source.1361: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2 Source.1362: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1 Source.1363: DFBPPR21928 ---- Animal proteins ---- Protein canopy homolog 4 Source.1364: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5 Source.1365: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1 Source.1366: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7 Source.1367: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11 Source.1368: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor Source.1369: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101 Source.1370: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.1371: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14 Source.1372: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like Source.1373: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog Source.1374: DFBPPR22018 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.1375: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein Source.1376: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2 Source.1377: DFBPPR22043 ---- Animal proteins ---- Leukocyte antigen CD37 Source.1378: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2 Source.1379: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6 Source.1380: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1 Source.1381: DFBPPR22075 ---- Animal proteins ---- GTP-binding protein 8 Source.1382: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9 Source.1383: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor Source.1384: DFBPPR22105 ---- Animal proteins ---- Centromere protein L Source.1385: DFBPPR22116 ---- Animal proteins ---- CB1 cannabinoid receptor-interacting protein 1 Source.1386: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain Source.1387: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein Source.1388: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11 Source.1389: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.1390: DFBPPR22191 ---- Animal proteins ---- Heat shock protein beta-3 Source.1391: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2 Source.1392: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.1393: DFBPPR22244 ---- Animal proteins ---- THAP domain-containing protein 3 Source.1394: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3 Source.1395: DFBPPR22289 ---- Animal proteins ---- Heme-binding protein 1 Source.1396: DFBPPR22306 ---- Animal proteins ---- p53 and DNA damage-regulated protein 1 Source.1397: DFBPPR22307 ---- Animal proteins ---- MORF4 family-associated protein 1 Source.1398: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.1399: DFBPPR22332 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 3 Source.1400: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9 Source.1401: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B Source.1402: DFBPPR22429 ---- Animal proteins ---- Coiled-coil domain-containing protein 107 Source.1403: DFBPPR22448 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 5B Source.1404: DFBPPR22451 ---- Animal proteins ---- RING finger protein 151 Source.1405: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2 Source.1406: DFBPPR22501 ---- Animal proteins ---- Multiple myeloma tumor-associated protein 2 homolog Source.1407: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9 Source.1408: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.1409: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A Source.1410: DFBPPR22617 ---- Animal proteins ---- SNRPN upstream reading frame protein Source.1411: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164 Source.1412: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1 Source.1413: DFBPPR22654 ---- Animal proteins ---- Proline-rich protein 9 Source.1414: DFBPPR22657 ---- Animal proteins ---- Protein FAM110D Source.1415: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog Source.1416: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1 Source.1417: DFBPPR22736 ---- Animal proteins ---- Uncharacterized protein C16orf71 homolog Source.1418: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial Source.1419: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1420: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4 Source.1421: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial Source.1422: DFBPPR8550 ---- Animal proteins ---- Complement C3 Source.1423: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial Source.1424: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase Source.1425: DFBPPR8565 ---- Animal proteins ---- Villin-1 Source.1426: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.1427: DFBPPR8577 ---- Animal proteins ---- Nectin-1 Source.1428: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6 Source.1429: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial Source.1430: DFBPPR8596 ---- Animal proteins ---- Gelsolin Source.1431: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha Source.1432: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1 Source.1433: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial Source.1434: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein Source.1435: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.1436: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.1437: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3 Source.1438: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A Source.1439: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule Source.1440: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1441: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.1442: DFBPPR8700 ---- Animal proteins ---- Endoglin Source.1443: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial Source.1444: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.1445: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor Source.1446: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.1447: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.1448: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.1449: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.1450: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase Source.1451: DFBPPR8772 ---- Animal proteins ---- Dystroglycan Source.1452: DFBPPR8774 ---- Animal proteins ---- Tenascin Source.1453: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.1454: DFBPPR8785 ---- Animal proteins ---- 40S ribosomal protein S3 Source.1455: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3 Source.1456: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4 Source.1457: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8 Source.1458: DFBPPR8851 ---- Animal proteins ---- Vimentin Source.1459: DFBPPR8852 ---- Animal proteins ---- Vimentin Source.1460: DFBPPR8854 ---- Animal proteins ---- Vimentin Source.1461: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial Source.1462: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.1463: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.1464: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial Source.1465: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB Source.1466: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.1467: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.1468: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4 Source.1469: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein Source.1470: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.1471: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.1472: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.1473: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.1474: DFBPPR9039 ---- Animal proteins ---- Desmin Source.1475: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase Source.1476: DFBPPR9044 ---- Animal proteins ---- Albumin Source.1477: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf Source.1478: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1 Source.1479: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase Source.1480: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase Source.1481: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1 Source.1482: DFBPPR9098 ---- Animal proteins ---- Gastrotropin Source.1483: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.1484: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.1485: DFBPPR9116 ---- Animal proteins ---- Cathepsin B Source.1486: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.1487: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1 Source.1488: DFBPPR9144 ---- Animal proteins ---- Major seminal plasma glycoprotein PSP-II Source.1489: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein Source.1490: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6 Source.1491: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.1492: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10 Source.1493: DFBPPR9207 ---- Animal proteins ---- Beta-enolase Source.1494: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.1495: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme Source.1496: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase Source.1497: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial Source.1498: DFBPPR9306 ---- Animal proteins ---- Complement component C7 Source.1499: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3 Source.1500: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4 Source.1501: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26 Source.1502: DFBPPR9330 ---- Animal proteins ---- Receptor activity-modifying protein 3 Source.1503: DFBPPR9338 ---- Animal proteins ---- SPARC Source.1504: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating] Source.1505: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.1506: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor Source.1507: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase Source.1508: DFBPPR9399 ---- Animal proteins ---- High affinity copper uptake protein 1 Source.1509: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2 Source.1510: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.1511: DFBPPR9449 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical] Source.1512: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase Source.1513: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.1514: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14 Source.1515: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase Source.1516: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.1517: DFBPPR9552 ---- Animal proteins ---- Electron transfer flavoprotein subunit beta Source.1518: DFBPPR9554 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit Source.1519: DFBPPR9581 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.1520: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.1521: DFBPPR9607 ---- Animal proteins ---- F-actin-capping protein subunit beta Source.1522: DFBPPR9612 ---- Animal proteins ---- 40S ribosomal protein S20 Source.1523: DFBPPR9615 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit Source.1524: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1 Source.1525: DFBPPR9653 ---- Animal proteins ---- Carbohydrate-binding protein AQN-1 Source.1526: DFBPPR9658 ---- Animal proteins ---- Melanocortin receptor 5 Source.1527: DFBPPR9700 ---- Animal proteins ---- Galectin-1 Source.1528: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein Source.1529: DFBPPR9721 ---- Animal proteins ---- WAP four-disulfide core domain protein 2 Source.1530: DFBPPR9736 ---- Animal proteins ---- Metaxin-1 Source.1531: DFBPPR9748 ---- Animal proteins ---- Involucrin Source.1532: DFBPPR9759 ---- Animal proteins ---- Palmdelphin Source.1533: DFBPPR9771 ---- Animal proteins ---- 60S ribosomal protein L5 Source.1534: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15 Source.1535: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.1536: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2 Source.1537: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.1538: DFBPPR9843 ---- Animal proteins ---- P protein Source.1539: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1 Source.1540: DFBPPR9927 ---- Animal proteins ---- Protein BTG3 Source.1541: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.1542: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase Source.1543: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.1544: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain Source.1545: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.1546: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.1547: DFBPPR10019 ---- Animal proteins ---- Extracellular fatty acid-binding protein Source.1548: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.1549: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.1550: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.1551: DFBPPR10057 ---- Animal proteins ---- Stimulator of interferon genes protein Source.1552: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4 Source.1553: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.1554: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.1555: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.1556: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3 Source.1557: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.1558: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf Source.1559: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.1560: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.1561: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial Source.1562: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.1563: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase Source.1564: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1 Source.1565: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.1566: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1 Source.1567: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform Source.1568: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1 Source.1569: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3 Source.1570: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2 Source.1571: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7 Source.1572: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6 Source.1573: DFBPPR10260 ---- Animal proteins ---- F-actin-capping protein subunit beta isoforms 1 and 2 Source.1574: DFBPPR10261 ---- Animal proteins ---- Cadherin-13 Source.1575: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3 Source.1576: DFBPPR10267 ---- Animal proteins ---- Gephyrin Source.1577: DFBPPR10270 ---- Animal proteins ---- Agrin Source.1578: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C Source.1579: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran Source.1580: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs Source.1581: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2 Source.1582: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.1583: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP Source.1584: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.1585: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2 Source.1586: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1 Source.1587: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin Source.1588: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.1589: DFBPPR10349 ---- Animal proteins ---- Leiomodin-2 Source.1590: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2 Source.1591: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha Source.1592: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.1593: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial Source.1594: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1 Source.1595: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type Source.1596: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.1597: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.1598: DFBPPR10407 ---- Animal proteins ---- Beta-enolase Source.1599: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.1600: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.1601: DFBPPR10447 ---- Animal proteins ---- Plastin-1 Source.1602: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.1603: DFBPPR10452 ---- Animal proteins ---- Desmin Source.1604: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1 Source.1605: DFBPPR10456 ---- Animal proteins ---- Neuroserpin Source.1606: DFBPPR10459 ---- Animal proteins ---- Reelin Source.1607: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.1608: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9 Source.1609: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.1610: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1 Source.1611: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor Source.1612: DFBPPR10508 ---- Animal proteins ---- Septin-2 Source.1613: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.1614: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.1615: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.1616: DFBPPR10529 ---- Animal proteins ---- Cadherin-20 Source.1617: DFBPPR10541 ---- Animal proteins ---- Glypican-1 Source.1618: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.1619: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.1620: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2 Source.1621: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3 Source.1622: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1 Source.1623: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3 Source.1624: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b Source.1625: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule Source.1626: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial Source.1627: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.1628: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z Source.1629: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2 Source.1630: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1 Source.1631: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2 Source.1632: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1633: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B Source.1634: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.1635: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase Source.1636: DFBPPR10653 ---- Animal proteins ---- Contactin-1 Source.1637: DFBPPR10656 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1 Source.1638: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8 Source.1639: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.1640: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1 Source.1641: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1 Source.1642: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.1643: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3 Source.1644: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Source.1645: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.1646: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase Source.1647: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.1648: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1649: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase Source.1650: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2 Source.1651: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.1652: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2 Source.1653: DFBPPR10727 ---- Animal proteins ---- Vimentin Source.1654: DFBPPR10747 ---- Animal proteins ---- Cathepsin B Source.1655: DFBPPR10749 ---- Animal proteins ---- DnaJ homolog subfamily B member 6 Source.1656: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic Source.1657: DFBPPR10761 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-A Source.1658: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1659: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain Source.1660: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase Source.1661: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1 Source.1662: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase Source.1663: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain Source.1664: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.1665: DFBPPR10812 ---- Animal proteins ---- Cadherin-11 Source.1666: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide Source.1667: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase Source.1668: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5 Source.1669: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.1670: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase Source.1671: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7 Source.1672: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2 Source.1673: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7 Source.1674: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2 Source.1675: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.1676: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2 Source.1677: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.1678: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1 Source.1679: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2 Source.1680: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.1681: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog Source.1682: DFBPPR10976 ---- Animal proteins ---- Lamin-B2 Source.1683: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.1684: DFBPPR10981 ---- Animal proteins ---- Kinectin Source.1685: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase Source.1686: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog Source.1687: DFBPPR11007 ---- Animal proteins ---- Anamorsin Source.1688: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.1689: DFBPPR11017 ---- Animal proteins ---- Collectin-12 Source.1690: DFBPPR11019 ---- Animal proteins ---- Cadherin-4 Source.1691: DFBPPR11032 ---- Animal proteins ---- B-cadherin Source.1692: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.1693: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein Source.1694: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6 Source.1695: DFBPPR11055 ---- Animal proteins ---- Thymidine kinase, cytosolic Source.1696: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2 Source.1697: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1 Source.1698: DFBPPR11069 ---- Animal proteins ---- Casein kinase I isoform gamma-1 Source.1699: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1 Source.1700: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.1701: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.1702: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2 Source.1703: DFBPPR11110 ---- Animal proteins ---- Lamin-B1 Source.1704: DFBPPR11118 ---- Animal proteins ---- Filensin Source.1705: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4 Source.1706: DFBPPR11128 ---- Animal proteins ---- Ras-related protein Rap-1b Source.1707: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit Source.1708: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.1709: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2 Source.1710: DFBPPR11151 ---- Animal proteins ---- SPARC Source.1711: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1 Source.1712: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1 Source.1713: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3 Source.1714: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.1715: DFBPPR11199 ---- Animal proteins ---- Secreted frizzled-related protein 3 Source.1716: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.1717: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type Source.1718: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1 Source.1719: DFBPPR11206 ---- Animal proteins ---- Voltage-gated hydrogen channel 1 Source.1720: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.1721: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.1722: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog Source.1723: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C Source.1724: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha Source.1725: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.1726: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1 Source.1727: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5 Source.1728: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1 Source.1729: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2 Source.1730: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2 Source.1731: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.1732: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14 Source.1733: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2 Source.1734: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1 Source.1735: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Source.1736: DFBPPR11387 ---- Animal proteins ---- Amphiphysin Source.1737: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B Source.1738: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5 Source.1739: DFBPPR11407 ---- Animal proteins ---- RAD52 motif-containing protein 1 Source.1740: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF Source.1741: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231 Source.1742: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19 Source.1743: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48 Source.1744: DFBPPR11454 ---- Animal proteins ---- Calcium release-activated calcium channel protein 1 Source.1745: DFBPPR11470 ---- Animal proteins ---- Acetylcholine receptor subunit beta Source.1746: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein Source.1747: DFBPPR11493 ---- Animal proteins ---- Interferon regulatory factor 1 Source.1748: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2 Source.1749: DFBPPR11521 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1 Source.1750: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog Source.1751: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.1752: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.1753: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B Source.1754: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59 Source.1755: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1 Source.1756: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2 Source.1757: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial Source.1758: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus Source.1759: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2 Source.1760: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.1761: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial Source.1762: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.1763: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.1764: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor Source.1765: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61 Source.1766: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein Source.1767: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid Source.1768: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1 Source.1769: DFBPPR11822 ---- Animal proteins ---- Inversin Source.1770: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.1771: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13 Source.1772: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2 Source.1773: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2 Source.1774: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.1775: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.1776: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region Source.1777: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN Source.1778: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8 Source.1779: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.1780: DFBPPR11931 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 20 Source.1781: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2 Source.1782: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3 Source.1783: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1 Source.1784: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein Source.1785: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase Source.1786: DFBPPR11995 ---- Animal proteins ---- Protein orai-2 Source.1787: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7 Source.1788: DFBPPR12014 ---- Animal proteins ---- Raftlin Source.1789: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7 Source.1790: DFBPPR12035 ---- Animal proteins ---- Secreted phosphoprotein 24 Source.1791: DFBPPR12040 ---- Animal proteins ---- Neurochondrin Source.1792: DFBPPR12047 ---- Animal proteins ---- Ragulator complex protein LAMTOR3 Source.1793: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.1794: DFBPPR12060 ---- Animal proteins ---- Neurobeachin Source.1795: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9 Source.1796: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14 Source.1797: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16 Source.1798: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A Source.1799: DFBPPR12116 ---- Animal proteins ---- Armadillo repeat-containing protein 1 Source.1800: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A Source.1801: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B Source.1802: DFBPPR12131 ---- Animal proteins ---- Exportin-4 Source.1803: DFBPPR12135 ---- Animal proteins ---- Vigilin Source.1804: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C Source.1805: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.1806: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1 Source.1807: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.1808: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5 Source.1809: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174 Source.1810: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2 Source.1811: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.1812: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.1813: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1 Source.1814: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.1815: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform Source.1816: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.1817: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type Source.1818: DFBPPR12300 ---- Animal proteins ---- Platelet-derived growth factor subunit A Source.1819: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.1820: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2 Source.1821: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.1822: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.1823: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.1824: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.1825: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E Source.1826: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.1827: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14 Source.1828: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.1829: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.1830: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.1831: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.1832: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1 Source.1833: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated Source.1834: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.1835: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.1836: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1 Source.1837: DFBPPR12401 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1 Source.1838: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha Source.1839: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.1840: DFBPPR12425 ---- Animal proteins ---- Beta-enolase Source.1841: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A Source.1842: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2 Source.1843: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1844: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1 Source.1845: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.1846: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1 Source.1847: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1848: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X Source.1849: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain Source.1850: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.1851: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.1852: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.1853: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor Source.1854: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.1855: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.1856: DFBPPR12557 ---- Animal proteins ---- Acrosin Source.1857: DFBPPR12569 ---- Animal proteins ---- Alveolar macrophage chemotactic factor Source.1858: DFBPPR12575 ---- Animal proteins ---- CD63 antigen Source.1859: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6 Source.1860: DFBPPR12579 ---- Animal proteins ---- Troponin I, slow skeletal muscle Source.1861: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein Source.1862: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72 Source.1863: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase Source.1864: DFBPPR12707 ---- Animal proteins ---- Pro-opiomelanocortin Source.1865: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform Source.1866: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1 Source.1867: DFBPPR12762 ---- Animal proteins ---- SPARC Source.1868: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.1869: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial Source.1870: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin Source.1871: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.1872: DFBPPR12784 ---- Animal proteins ---- Cadherin-16 Source.1873: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9 Source.1874: DFBPPR12792 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 Source.1875: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.1876: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin Source.1877: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.1878: DFBPPR12864 ---- Animal proteins ---- Type I iodothyronine deiodinase Source.1879: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B Source.1880: DFBPPR12875 ---- Animal proteins ---- Fatty acid synthase Source.1881: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D Source.1882: DFBPPR12896 ---- Animal proteins ---- T-lymphocyte activation antigen CD80 Source.1883: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial Source.1884: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2 Source.1885: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1 Source.1886: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.1887: DFBPPR12939 ---- Animal proteins ---- Gastrotropin Source.1888: DFBPPR12968 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform Source.1889: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1 Source.1890: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1 Source.1891: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.1892: DFBPPR13019 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B gamma isoform Source.1893: DFBPPR13024 ---- Animal proteins ---- Erythropoietin Source.1894: DFBPPR13026 ---- Animal proteins ---- Homeobox expressed in ES cells 1 Source.1895: DFBPPR13032 ---- Animal proteins ---- Alpha-S2-casein-like A Source.1896: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein Source.1897: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.1898: DFBPPR13096 ---- Animal proteins ---- Ig kappa chain V region 12F2 Source.1899: DFBPPR13104 ---- Animal proteins ---- Ig kappa chain V region 2717 Source.1900: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.1901: DFBPPR13118 ---- Animal proteins ---- Ig kappa-B5 chain V region 2699 Source.1902: DFBPPR13138 ---- Animal proteins ---- SNRPN upstream reading frame protein Source.1903: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1904: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain Source.1905: DFBPPR13182 ---- Animal proteins ---- Insulin-like growth factor II Source.1906: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A Source.1907: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4 Source.1908: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3 Source.1909: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain Source.1910: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic Source.1911: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha Source.1912: DFBPPR13223 ---- Animal proteins ---- Caspase-1 Source.1913: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1 Source.1914: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein Source.1915: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3 Source.1916: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase Source.1917: DFBPPR13250 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3, truncated Source.1918: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic Source.1919: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1920: DFBPPR13267 ---- Animal proteins ---- Interferon beta Source.1921: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1 Source.1922: DFBPPR13315 ---- Animal proteins ---- Ski oncogene Source.1923: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial Source.1924: DFBPPR13347 ---- Animal proteins ---- Interleukin-12 subunit beta Source.1925: DFBPPR13358 ---- Animal proteins ---- Erythropoietin Source.1926: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2 Source.1927: DFBPPR13390 ---- Animal proteins ---- C-X-C motif chemokine 6 Source.1928: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.1929: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2 Source.1930: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1 Source.1931: DFBPPR13442 ---- Animal proteins ---- Microtubule-associated protein tau Source.1932: DFBPPR13456 ---- Animal proteins ---- Galectin-1 Source.1933: DFBPPR13470 ---- Animal proteins ---- Hemoglobin subunit epsilon-2 Source.1934: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase Source.1935: DFBPPR13490 ---- Animal proteins ---- Interleukin-12 subunit beta Source.1936: DFBPPR13513 ---- Animal proteins ---- Ubiquitin-related modifier 1 Source.1937: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1938: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2 Source.1939: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic Source.1940: DFBPPR13546 ---- Animal proteins ---- Platelet-derived growth factor subunit B Source.1941: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9 Source.1942: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha Source.1943: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator Source.1944: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2 Source.1945: DFBPPR13601 ---- Animal proteins ---- Cathepsin B Source.1946: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.1947: DFBPPR13636 ---- Animal proteins ---- Interleukin-12 subunit beta Source.1948: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6 Source.1949: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6 Source.1950: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha Source.1951: DFBPPR13667 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor Source.1952: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.1953: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1 Source.1954: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin Source.1955: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor Source.1956: DFBPPR13779 ---- Animal proteins ---- Syntaxin-1B Source.1957: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1 Source.1958: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor Source.1959: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa Source.1960: DFBPPR13892 ---- Animal proteins ---- Melanocortin receptor 5 Source.1961: DFBPPR13925 ---- Animal proteins ---- Homeobox protein BarH-like 2 Source.1962: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.1963: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5 Source.1964: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.1965: DFBPPR13979 ---- Animal proteins ---- Putative uncharacterized protein Z Source.1966: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C Source.1967: DFBPPR14018 ---- Animal proteins ---- Ras-related protein Rap-1b Source.1968: DFBPPR14019 ---- Animal proteins ---- Vimentin Source.1969: DFBPPR14075 ---- Marine protein ---- Trypsin-1 Source.1970: DFBPPR14081 ---- Marine protein ---- Beta-enolase Source.1971: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B Source.1972: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C Source.1973: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A Source.1974: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran Source.1975: DFBPPR14118 ---- Marine protein ---- Trypsin-2 Source.1976: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.1977: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8 Source.1978: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8 Source.1979: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2 Source.1980: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial Source.1981: DFBPPR14245 ---- Marine protein ---- Pro-MCH 1 Source.1982: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic Source.1983: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta' Source.1984: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.1985: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE Source.1986: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.1987: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic Source.1988: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta Source.1989: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog Source.1990: DFBPPR14398 ---- Marine protein ---- 30S ribosomal protein S7, chloroplastic Source.1991: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic Source.1992: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic Source.1993: DFBPPR14489 ---- Marine protein ---- Elongation factor Ts, chloroplastic Source.1994: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621 Source.1995: DFBPPR14550 ---- Marine protein ---- Complement C3 Source.1996: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase Source.1997: DFBPPR14591 ---- Marine protein ---- Vimentin Source.1998: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II Source.1999: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.2000: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing] Source.2001: DFBPPR14612 ---- Marine protein ---- Complement component C9 Source.2002: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase Source.2003: DFBPPR14685 ---- Marine protein ---- Pro-MCH 1 Source.2004: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein Source.2005: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13 Source.2006: DFBPPR14727 ---- Marine protein ---- Cytochrome c oxidase polypeptide 4, mitochondrial Source.2007: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.2008: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit Source.2009: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase Source.2010: DFBPPR14783 ---- Marine protein ---- Enolase Source.2011: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic Source.2012: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3 Source.2013: DFBPPR14854 ---- Marine protein ---- Fucolectin Source.2014: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2015: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1 Source.2016: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta Source.2017: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20 Source.2018: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1 Source.2019: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha Source.2020: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1 Source.2021: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80 Source.2022: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5 Source.2023: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.2024: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP Source.2025: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1 Source.2026: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10 Source.2027: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase Source.2028: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27 Source.2029: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.2030: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2 Source.2031: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2 Source.2032: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.2033: DFBPPR14998 ---- Microorganism protein ---- Galactokinase Source.2034: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1 Source.2035: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8 Source.2036: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.2037: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase Source.2038: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1 Source.2039: DFBPPR15045 ---- Microorganism protein ---- Enolase Source.2040: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2 Source.2041: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3 Source.2042: DFBPPR15062 ---- Microorganism protein ---- Transcription and mRNA export factor SUS1 Source.2043: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2 Source.2044: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11 Source.2045: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase Source.2046: DFBPPR15090 ---- Microorganism protein ---- Transketolase Source.2047: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1 Source.2048: DFBPPR15106 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial Source.2049: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase Source.2050: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.2051: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A Source.2052: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40 Source.2053: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.2054: DFBPPR15151 ---- Microorganism protein ---- 2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-phosphate reductase Source.2055: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase Source.2056: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing] Source.2057: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.2058: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111 Source.2059: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84 Source.2060: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3 Source.2061: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog Source.2062: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9 Source.2063: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3 Source.2064: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase Source.2065: DFBPPR15207 ---- Microorganism protein ---- Triosephosphate isomerase Source.2066: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1 Source.2067: DFBPPR15236 ---- Microorganism protein ---- Protein PBN1 Source.2068: DFBPPR15250 ---- Microorganism protein ---- DNA replication regulator SLD2 Source.2069: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase Source.2070: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase Source.2071: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase Source.2072: DFBPPR15269 ---- Microorganism protein ---- Endoplasmic reticulum vesicle protein 25 Source.2073: DFBPPR15283 ---- Microorganism protein ---- Diphthine methyl ester synthase Source.2074: DFBPPR15285 ---- Microorganism protein ---- Superoxide dismutase 1 copper chaperone Source.2075: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1 Source.2076: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.2077: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3 Source.2078: DFBPPR15334 ---- Microorganism protein ---- Probable kinetochore protein NUF2 Source.2079: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1 Source.2080: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.2081: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1 Source.2082: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2 Source.2083: DFBPPR15428 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC24 Source.2084: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1 Source.2085: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1 Source.2086: DFBPPR15453 ---- Microorganism protein ---- ATP synthase subunit 5, mitochondrial Source.2087: DFBPPR15463 ---- Microorganism protein ---- Protein LST4 Source.2088: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1 Source.2089: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3 Source.2090: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2 Source.2091: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10 Source.2092: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44 Source.2093: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2 Source.2094: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46 Source.2095: DFBPPR15555 ---- Microorganism protein ---- Spindle pole body component 110 Source.2096: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32 Source.2097: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta Source.2098: DFBPPR15584 ---- Microorganism protein ---- 40S ribosomal protein S1 Source.2099: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3 Source.2100: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2 Source.2101: DFBPPR15652 ---- Microorganism protein ---- Translation machinery-associated protein 22 Source.2102: DFBPPR15704 ---- Microorganism protein ---- Oxidation resistance protein 1 Source.2103: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1 Source.2104: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1 Source.2105: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase Source.2106: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5 Source.2107: DFBPPR15738 ---- Microorganism protein ---- Regulator of rDNA transcription 14 Source.2108: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8 Source.2109: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5 Source.2110: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9 Source.2111: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase Source.2112: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase Source.2113: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit Source.2114: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2 Source.2115: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase Source.2116: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2 Source.2117: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.2118: DFBPPR15857 ---- Microorganism protein ---- Laccase-1 Source.2119: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase Source.2120: DFBPPR15860 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial Source.2121: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase Source.2122: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1 Source.2123: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial Source.2124: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial Source.2125: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic Source.2126: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.2127: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6 Source.2128: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7 Source.2129: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1 Source.2130: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4 Source.2131: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3 Source.2132: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5 Source.2133: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2 Source.2134: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic Source.2135: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic Source.2136: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic Source.2137: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme Source.2138: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic Source.2139: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic Source.2140: DFBPPR7966 ---- Plant protein ---- GTP-binding nuclear protein Ran/TC4 Source.2141: DFBPPR7967 ---- Plant protein ---- Plastocyanin Source.2142: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B Source.2143: DFBPPR8002 ---- Plant protein ---- Plastocyanin Source.2144: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase Source.2145: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1 Source.2146: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2 Source.2147: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme Source.2148: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform Source.2149: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.2150: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.2151: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic Source.2152: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17 Source.2153: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic Source.2154: DFBPPR8122 ---- Plant protein ---- Arcelin-4 Source.2155: DFBPPR8212 ---- Plant protein ---- Trypsin inhibitor 1 Source.2156: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase Source.2157: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2 Source.2158: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.2159: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.2160: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic Source.2161: DFBPPR8318 ---- Plant protein ---- 17.6 kDa class I heat shock protein Source.2162: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antihypertensive activity

The antihypertensive activity of each peptidic fraction obtained from the pearl oysters was evaluated by measuring the change in SBP at 1h, 2h, 3h, 4h, and 6h after oral administration. Systolic blood pressure did not change in the control rats during the experimental period (6 h). Captopril (10 mg/kg) lowered SBP significantly from 1 h to 4 h after administration of the drug. When the peptidic fraction from the pearl oyster was orally administered to the SHR, the fraction reduced SBP significantly by 45.9 mmHg at 3 h, and the antihypertensive effect continued for 4 h. The ACE-inhibitory peptide VEV was isolated from the highest active fraction, so the peptide was a potential antihypertensive peptide.

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	No prediction can be made about the peptide bitterness. ^prediction

SMILES

N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	Hydrolysis with pepsin (Porcine tomach mucosa; Wako Pure Chemicals, Osaka, Japan).

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	No measured
Prediction:	ToxinPred

Additional information

The purified peptide VEV is a possible candidate for application as a dietary supplement or as a component of a functional food product.

Database cross-references

DFBP

[D1]	DFBPACEI1181, DFBPACEI1766
[D2]	DFBPMUFU0238

[D3]

[D4]

[D5]

[D6]

Reference(s)

Primary literature	Suetsuna, K. Identification of antihypertensive peptides from peptic digest of the short-necked clam Tapes philippinarum and the pearl oyster Pinctada fucata martensii. Fisheries Science. 2002, 68, 233-5. DOI: 10.1046/j.1444-2906.2002.00415.x
Other literature(s)	N.D
PubDate	2002