E-mail: gzliang@cqu.edu.cn    Tel: (86)2365102507

DFBP ID - DFBPMUFU0238(Multifunctional peptide)
DFBP ID DFBPMUFU0238
Peptide sequence VEV
Type Native peptide
Term Multifunctional peptide
Multifunctional activities
Function Counts 2
ACE-inhibitory peptides
DFBPID Organism Precursor protein Residue position
DFBPACEI1181 Pearl oyster (Pinctada fucata martensii) Pearl oyster powder hydrolysates

N.D

DFBPACEI1766 Wheat Wheat germ

N.D

Antihypertensive peptides
DFBPID Organism Precursor protein Residue position
DFBPANHY0846 Pearl oyster (Pinctada fucata martensii) Pearl oyster powder hydrolysates

N.D

Physical & computational properties
Three-letter amino acid Val-Glu-Val
Single-letter amino acid VEV
Peptide length 3
Theoretical mass 345.40 Da c
Net charge 0.00 c
Isoelectric point (pI) 3.34 c
GRAVY 1.6333
Hydrophilic residue ratio 66.67%
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-source protein(s) search
Precursor protein(s) search
Source.1: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.2: DFBPPR0819 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC1
Source.3: DFBPPR0824 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC2
Source.4: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1
Source.5: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.6: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.7: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11
Source.8: DFBPPR0859 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic/amyloplastic/cytosolic
Source.9: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.10: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.11: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.12: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.13: DFBPPR0877 ---- Plant proteins ---- Probable glutathione S-transferase DHAR1, cytosolic
Source.14: DFBPPR0900 ---- Plant proteins ---- GTPase activating protein 1
Source.15: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.16: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.17: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.18: DFBPPR0923 ---- Plant proteins ---- Lysine-specific demethylase JMJ703
Source.19: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.20: DFBPPR0930 ---- Plant proteins ---- Abscisic acid receptor PYL3
Source.21: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.22: DFBPPR0943 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit A
Source.23: DFBPPR0948 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog B, chloroplastic
Source.24: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.25: DFBPPR0968 ---- Plant proteins ---- Polyamine oxidase 3
Source.26: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.27: DFBPPR0971 ---- Plant proteins ---- Protein STAR1
Source.28: DFBPPR0975 ---- Plant proteins ---- L-ascorbate peroxidase 2, cytosolic
Source.29: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.30: DFBPPR0991 ---- Plant proteins ---- Receptor-like cytoplasmic kinase 185
Source.31: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.32: DFBPPR1000 ---- Plant proteins ---- Flowering time control protein FCA
Source.33: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.34: DFBPPR1014 ---- Plant proteins ---- Flap endonuclease GEN-like 1
Source.35: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.36: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.37: DFBPPR1032 ---- Plant proteins ---- Disease resistance protein RGA4
Source.38: DFBPPR1049 ---- Plant proteins ---- Polyamine oxidase 5
Source.39: DFBPPR1061 ---- Plant proteins ---- Cinnamyl alcohol dehydrogenase 2
Source.40: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.41: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.42: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.43: DFBPPR1111 ---- Plant proteins ---- 12-oxophytodienoate reductase 1
Source.44: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic
Source.45: DFBPPR1128 ---- Plant proteins ---- Polyamine oxidase 4
Source.46: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.47: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B
Source.48: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.49: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A
Source.50: DFBPPR1167 ---- Plant proteins ---- Phototropin-2
Source.51: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A
Source.52: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.53: DFBPPR1182 ---- Plant proteins ---- Calcium-dependent protein kinase 3
Source.54: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1
Source.55: DFBPPR1210 ---- Plant proteins ---- Pachytene checkpoint protein 2 homolog
Source.56: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.57: DFBPPR1218 ---- Plant proteins ---- Cytochrome P450 90D2
Source.58: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.59: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.60: DFBPPR1260 ---- Plant proteins ---- Peptide deformylase 1A, chloroplastic
Source.61: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.62: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.63: DFBPPR1269 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.64: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.65: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic
Source.66: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.67: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic
Source.68: DFBPPR1321 ---- Plant proteins ---- Calcium-dependent protein kinase 16
Source.69: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.70: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.71: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.72: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1
Source.73: DFBPPR1337 ---- Plant proteins ---- CBL-interacting protein kinase 12
Source.74: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.75: DFBPPR1353 ---- Plant proteins ---- Transcription factor UDT1
Source.76: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.77: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B
Source.78: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic
Source.79: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic
Source.80: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.81: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.82: DFBPPR1390 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic/amyloplastic
Source.83: DFBPPR1402 ---- Plant proteins ---- Heat shock 70 kDa protein BIP5
Source.84: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.85: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.86: DFBPPR1409 ---- Plant proteins ---- Flavanone 3-dioxygenase 3
Source.87: DFBPPR1420 ---- Plant proteins ---- Protein HEADING DATE 3B
Source.88: DFBPPR1422 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit C
Source.89: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.90: DFBPPR1427 ---- Plant proteins ---- Probable esterase D14L
Source.91: DFBPPR1428 ---- Plant proteins ---- Inositol 3-kinase
Source.92: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.93: DFBPPR1446 ---- Plant proteins ---- Nucleoside diphosphate kinase 1
Source.94: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.95: DFBPPR1459 ---- Plant proteins ---- Protein TIFY 10c
Source.96: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.97: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.98: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A
Source.99: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7
Source.100: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.101: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.102: DFBPPR1487 ---- Plant proteins ---- Beta-1,2-xylosyltransferease XAX1
Source.103: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.104: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein
Source.105: DFBPPR1506 ---- Plant proteins ---- Succinate-semialdehyde dehydrogenase, mitochondrial
Source.106: DFBPPR1512 ---- Plant proteins ---- Cytochrome P450 714D1
Source.107: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.108: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1
Source.109: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.110: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.111: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.112: DFBPPR1539 ---- Plant proteins ---- Probable L-ascorbate peroxidase 4, peroxisomal
Source.113: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.114: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.115: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.116: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19
Source.117: DFBPPR1565 ---- Plant proteins ---- Nuclear cap-binding protein subunit 1
Source.118: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.119: DFBPPR1575 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.120: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.121: DFBPPR1597 ---- Plant proteins ---- MADS-box transcription factor 51
Source.122: DFBPPR1606 ---- Plant proteins ---- 17.4 kDa class I heat shock protein
Source.123: DFBPPR1609 ---- Plant proteins ---- Expansin-B1
Source.124: DFBPPR1610 ---- Plant proteins ---- 18.1 kDa class I heat shock protein
Source.125: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.126: DFBPPR1629 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 4, chloroplastic/amyloplastic
Source.127: DFBPPR1630 ---- Plant proteins ---- Exportin-T
Source.128: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.129: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.130: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.131: DFBPPR1649 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 2, chloroplastic
Source.132: DFBPPR1653 ---- Plant proteins ---- Protein CHLOROPLAST ENHANCING STRESS TOLERANCE, chloroplastic
Source.133: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.134: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10
Source.135: DFBPPR1667 ---- Plant proteins ---- Probable L-ascorbate peroxidase 3, peroxisomal
Source.136: DFBPPR1674 ---- Plant proteins ---- Heat shock 70 kDa protein BIP4
Source.137: DFBPPR1679 ---- Plant proteins ---- Heat shock 70 kDa protein BIP3
Source.138: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.139: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.140: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.141: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.142: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.143: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.144: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1
Source.145: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.146: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.147: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1
Source.148: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.149: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.150: DFBPPR1748 ---- Plant proteins ---- 17.7 kDa class I heat shock protein
Source.151: DFBPPR1781 ---- Plant proteins ---- Stemar-13-ene synthase
Source.152: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.153: DFBPPR1791 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 11
Source.154: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1
Source.155: DFBPPR1832 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 7, chloroplastic
Source.156: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3
Source.157: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.158: DFBPPR1844 ---- Plant proteins ---- Heat shock 70 kDa protein BIP2
Source.159: DFBPPR1851 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1
Source.160: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.161: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.162: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.163: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.164: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.165: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.166: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.167: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1
Source.168: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.169: DFBPPR1891 ---- Plant proteins ---- Transcription factor MYBS2
Source.170: DFBPPR1896 ---- Plant proteins ---- Laccase-8
Source.171: DFBPPR1900 ---- Plant proteins ---- Fanconi-associated nuclease 1 homolog
Source.172: DFBPPR1904 ---- Plant proteins ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.173: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.174: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.175: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.176: DFBPPR1927 ---- Plant proteins ---- Cyclin-dependent kinase G-1
Source.177: DFBPPR1936 ---- Plant proteins ---- tRNA wybutosine-synthesizing protein 2/3/4
Source.178: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.179: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2
Source.180: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.181: DFBPPR1974 ---- Plant proteins ---- U-box domain-containing protein 12
Source.182: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.183: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase
Source.184: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.185: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33
Source.186: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a
Source.187: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic
Source.188: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.189: DFBPPR2028 ---- Plant proteins ---- Laccase-7
Source.190: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.191: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16
Source.192: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.193: DFBPPR2041 ---- Plant proteins ---- Peroxiredoxin-2F, mitochondrial
Source.194: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.195: DFBPPR2047 ---- Plant proteins ---- 17.8 kDa heat shock protein
Source.196: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.197: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C
Source.198: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9
Source.199: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.200: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.201: DFBPPR2138 ---- Plant proteins ---- 17.9 kDa class I heat shock protein
Source.202: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.203: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.204: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.205: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7
Source.206: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.207: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.208: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.209: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1
Source.210: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32
Source.211: DFBPPR2223 ---- Plant proteins ---- Urease
Source.212: DFBPPR2227 ---- Plant proteins ---- Cyclin-SDS-like
Source.213: DFBPPR2228 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED4, chloroplastic
Source.214: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.215: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1
Source.216: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.217: DFBPPR2249 ---- Plant proteins ---- Proteasome subunit alpha type-3
Source.218: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30
Source.219: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29
Source.220: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.221: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.222: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.223: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8
Source.224: DFBPPR2299 ---- Plant proteins ---- Metal tolerance protein 3
Source.225: DFBPPR2301 ---- Plant proteins ---- Red chlorophyll catabolite reductase 1, chloroplastic
Source.226: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2
Source.227: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.228: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.229: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.230: DFBPPR2354 ---- Plant proteins ---- Thioredoxin-like protein CDSP32, chloroplastic
Source.231: DFBPPR2369 ---- Plant proteins ---- Kinesin-like protein KIN-UB
Source.232: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.233: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.234: DFBPPR2374 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2
Source.235: DFBPPR2377 ---- Plant proteins ---- 21.9 kDa heat shock protein
Source.236: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1
Source.237: DFBPPR2392 ---- Plant proteins ---- Metal tolerance protein 6
Source.238: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5
Source.239: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.240: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8
Source.241: DFBPPR2417 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK4
Source.242: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.243: DFBPPR2436 ---- Plant proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3
Source.244: DFBPPR2451 ---- Plant proteins ---- Fructose-bisphosphate aldolase 3, cytoplasmic
Source.245: DFBPPR2465 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.246: DFBPPR2475 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.247: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase
Source.248: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.249: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2
Source.250: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.251: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20
Source.252: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic
Source.253: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13
Source.254: DFBPPR2514 ---- Plant proteins ---- Metal tolerance protein 5
Source.255: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.256: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.257: DFBPPR2540 ---- Plant proteins ---- 23.2 kDa heat shock protein
Source.258: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.259: DFBPPR2572 ---- Plant proteins ---- Potassium channel AKT2
Source.260: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B
Source.261: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.262: DFBPPR2596 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 9
Source.263: DFBPPR2597 ---- Plant proteins ---- Leucine aminopeptidase
Source.264: DFBPPR2602 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX19
Source.265: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1
Source.266: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1
Source.267: DFBPPR2623 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 3
Source.268: DFBPPR2641 ---- Plant proteins ---- 18.8 kDa class V heat shock protein
Source.269: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5
Source.270: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10
Source.271: DFBPPR2673 ---- Plant proteins ---- Expansin-B13
Source.272: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.273: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.274: DFBPPR2707 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK9
Source.275: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.276: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10
Source.277: DFBPPR2747 ---- Plant proteins ---- Metal tolerance protein 7
Source.278: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.279: DFBPPR2754 ---- Plant proteins ---- Adenylate kinase 3
Source.280: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9
Source.281: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.282: DFBPPR2774 ---- Plant proteins ---- 17.9 kDa heat shock protein 2
Source.283: DFBPPR2786 ---- Plant proteins ---- 16.6 kDa heat shock protein
Source.284: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A
Source.285: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.286: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49
Source.287: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D
Source.288: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.289: DFBPPR2831 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 4
Source.290: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.291: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.292: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.293: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.294: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.295: DFBPPR2864 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 53
Source.296: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX
Source.297: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.298: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.299: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2
Source.300: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.301: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.302: DFBPPR2928 ---- Plant proteins ---- 18.9 kDa heat shock protein
Source.303: DFBPPR2933 ---- Plant proteins ---- Probable aldehyde oxidase 4
Source.304: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.305: DFBPPR2938 ---- Plant proteins ---- Kinesin-like protein KIN-10A
Source.306: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.307: DFBPPR2977 ---- Plant proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating], chloroplastic
Source.308: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.309: DFBPPR2986 ---- Plant proteins ---- 4-diphosphocytidyl-2-C-methyl-D-erythritol kinase, chloroplastic
Source.310: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.311: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3
Source.312: DFBPPR3032 ---- Plant proteins ---- 19.0 kDa class II heat shock protein
Source.313: DFBPPR3066 ---- Plant proteins ---- Glycine cleavage system H protein, mitochondrial
Source.314: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.315: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.316: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1
Source.317: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.318: DFBPPR3088 ---- Plant proteins ---- Beta-glucosidase 34
Source.319: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.320: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.321: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.322: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.323: DFBPPR3115 ---- Plant proteins ---- Nucleosome assembly protein 1;1
Source.324: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2
Source.325: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.326: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.327: DFBPPR3139 ---- Plant proteins ---- Chaperone protein ClpC1, chloroplastic
Source.328: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.329: DFBPPR3144 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 6
Source.330: DFBPPR3149 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.331: DFBPPR3151 ---- Plant proteins ---- Protein HAPLESS 2-B
Source.332: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.333: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2
Source.334: DFBPPR3164 ---- Plant proteins ---- Cysteine proteinase inhibitor 2
Source.335: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.336: DFBPPR3181 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX15
Source.337: DFBPPR3190 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX17
Source.338: DFBPPR3195 ---- Plant proteins ---- Nicotianamine synthase 3
Source.339: DFBPPR3213 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 5
Source.340: DFBPPR3214 ---- Plant proteins ---- Probable adenylate kinase 5, chloroplastic
Source.341: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1
Source.342: DFBPPR3231 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 45
Source.343: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.344: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26
Source.345: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.346: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.347: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.348: DFBPPR3253 ---- Plant proteins ---- Malate synthase
Source.349: DFBPPR3262 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic
Source.350: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.351: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18
Source.352: DFBPPR3291 ---- Plant proteins ---- Metal tolerance protein 1
Source.353: DFBPPR3329 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 12
Source.354: DFBPPR3335 ---- Plant proteins ---- Molybdopterin synthase sulfur carrier subunit
Source.355: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.356: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8
Source.357: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.358: DFBPPR3368 ---- Plant proteins ---- Probable zinc metalloprotease EGY1, chloroplastic
Source.359: DFBPPR3369 ---- Plant proteins ---- Probable adenylate kinase 2, chloroplastic
Source.360: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28
Source.361: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.362: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.363: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.364: DFBPPR3401 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 2
Source.365: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6
Source.366: DFBPPR3428 ---- Plant proteins ---- Carotenoid cleavage dioxygenase 8 homolog A, chloroplastic
Source.367: DFBPPR3430 ---- Plant proteins ---- Dehydrin DHN1
Source.368: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F
Source.369: DFBPPR3438 ---- Plant proteins ---- Protein ROLLING AND ERECT LEAF 2
Source.370: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.371: DFBPPR3461 ---- Plant proteins ---- 50S ribosomal protein L18, chloroplastic
Source.372: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A
Source.373: DFBPPR3470 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 7
Source.374: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.375: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.376: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B
Source.377: DFBPPR3495 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 13
Source.378: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.379: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.380: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2
Source.381: DFBPPR3554 ---- Plant proteins ---- GTP-binding nuclear protein Ran-3
Source.382: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.383: DFBPPR3573 ---- Plant proteins ---- Protein TIFY 5
Source.384: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.385: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.386: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.387: DFBPPR3616 ---- Plant proteins ---- Probable esterase PIR7A
Source.388: DFBPPR3622 ---- Plant proteins ---- Zinc transporter 6
Source.389: DFBPPR3635 ---- Plant proteins ---- Probable zinc metalloprotease EGY2, chloroplastic
Source.390: DFBPPR3645 ---- Plant proteins ---- Chaperone protein ClpC2, chloroplastic
Source.391: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3
Source.392: DFBPPR3659 ---- Plant proteins ---- Probable signal peptidase complex subunit 3
Source.393: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9
Source.394: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.395: DFBPPR3675 ---- Plant proteins ---- Neutral/alkaline invertase 3, chloroplastic
Source.396: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.397: DFBPPR3697 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 39
Source.398: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.399: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.400: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.401: DFBPPR3730 ---- Plant proteins ---- 50S ribosomal protein L27, chloroplastic
Source.402: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8
Source.403: DFBPPR3735 ---- Plant proteins ---- Beta-galactosidase 8
Source.404: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.405: DFBPPR3759 ---- Plant proteins ---- Probable protein arginine N-methyltransferase 6.1
Source.406: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog
Source.407: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.408: DFBPPR3769 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.409: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.410: DFBPPR3792 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 1
Source.411: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A
Source.412: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.413: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1
Source.414: DFBPPR3836 ---- Plant proteins ---- Probable protein phosphatase 2C 52
Source.415: DFBPPR3838 ---- Plant proteins ---- Probable protein phosphatase 2C 47
Source.416: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.417: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13
Source.418: DFBPPR3857 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 57
Source.419: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5
Source.420: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.421: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.422: DFBPPR3876 ---- Plant proteins ---- Bifunctional nuclease 2
Source.423: DFBPPR3890 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 5
Source.424: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1
Source.425: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5
Source.426: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4
Source.427: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.428: DFBPPR3915 ---- Plant proteins ---- Transcription factor TGAL6
Source.429: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2
Source.430: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.431: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA
Source.432: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.433: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3
Source.434: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.435: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.436: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.437: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3
Source.438: DFBPPR4023 ---- Plant proteins ---- Ankyrin repeat-containing protein NPR4
Source.439: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.440: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.441: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.442: DFBPPR4032 ---- Plant proteins ---- Cell division control protein 6 homolog
Source.443: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A
Source.444: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9
Source.445: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.446: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.447: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog
Source.448: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.449: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.450: DFBPPR4086 ---- Plant proteins ---- Endoglucanase 5
Source.451: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.452: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.453: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.454: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2
Source.455: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1
Source.456: DFBPPR4121 ---- Plant proteins ---- Protein argonaute 1C
Source.457: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.458: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.459: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.460: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.461: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.462: DFBPPR4220 ---- Plant proteins ---- Aquaporin NIP1-4
Source.463: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1
Source.464: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3
Source.465: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.466: DFBPPR4245 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 2
Source.467: DFBPPR4257 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL4
Source.468: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2
Source.469: DFBPPR4267 ---- Plant proteins ---- Putative cyclin-D7-1
Source.470: DFBPPR4276 ---- Plant proteins ---- CRS2-associated factor 2, mitochondrial
Source.471: DFBPPR4283 ---- Plant proteins ---- SCAR-like protein 1
Source.472: DFBPPR4295 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 5
Source.473: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6
Source.474: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B
Source.475: DFBPPR4308 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 28
Source.476: DFBPPR4309 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 5
Source.477: DFBPPR4315 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.478: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C
Source.479: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.480: DFBPPR4318 ---- Plant proteins ---- Golgin-84
Source.481: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11
Source.482: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24
Source.483: DFBPPR4340 ---- Plant proteins ---- Putative non-inhibitory serpin-10
Source.484: DFBPPR4378 ---- Plant proteins ---- Basic leucine zipper 6
Source.485: DFBPPR4383 ---- Plant proteins ---- ELF3-like protein 2
Source.486: DFBPPR4396 ---- Plant proteins ---- Nucleolin 2
Source.487: DFBPPR4413 ---- Plant proteins ---- Membrane-anchored ubiquitin-fold protein 4
Source.488: DFBPPR4423 ---- Plant proteins ---- SCAR-like protein 2
Source.489: DFBPPR4426 ---- Plant proteins ---- Protein argonaute 18
Source.490: DFBPPR4433 ---- Plant proteins ---- 22.3 kDa class VI heat shock protein
Source.491: DFBPPR4465 ---- Plant proteins ---- Electron transfer flavoprotein subunit beta, mitochondrial
Source.492: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.493: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4
Source.494: DFBPPR4493 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 1
Source.495: DFBPPR4506 ---- Plant proteins ---- Putative L-cysteine desulfhydrase 2
Source.496: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.497: DFBPPR4529 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 1
Source.498: DFBPPR4534 ---- Plant proteins ---- Protein argonaute 4A
Source.499: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.500: DFBPPR4548 ---- Plant proteins ---- Ribosome production factor 2 homolog
Source.501: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H
Source.502: DFBPPR4558 ---- Plant proteins ---- 40S ribosomal protein S20
Source.503: DFBPPR4559 ---- Plant proteins ---- 40S ribosomal protein S15
Source.504: DFBPPR4561 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 5
Source.505: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65
Source.506: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.507: DFBPPR4602 ---- Plant proteins ---- Protein argonaute 15
Source.508: DFBPPR4603 ---- Plant proteins ---- Tubby-like F-box protein 2
Source.509: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43
Source.510: DFBPPR4647 ---- Plant proteins ---- BURP domain-containing protein 12
Source.511: DFBPPR4655 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 7
Source.512: DFBPPR4661 ---- Plant proteins ---- Protein argonaute 4B
Source.513: DFBPPR4662 ---- Plant proteins ---- Cyclin-dependent protein kinase inhibitor SMR1
Source.514: DFBPPR4669 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 8
Source.515: DFBPPR4676 ---- Plant proteins ---- PP2A regulatory subunit TAP46
Source.516: DFBPPR4685 ---- Plant proteins ---- 30S ribosomal protein S31, mitochondrial
Source.517: DFBPPR4688 ---- Plant proteins ---- UPF0496 protein 1
Source.518: DFBPPR4693 ---- Plant proteins ---- Uncharacterized protein ycf68
Source.519: DFBPPR4696 ---- Plant proteins ---- Uncharacterized protein ycf72
Source.520: DFBPPR4700 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 6
Source.521: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.522: DFBPPR4736 ---- Plant proteins ---- B3 domain-containing protein Os04g0581400
Source.523: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400
Source.524: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein
Source.525: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21
Source.526: DFBPPR4801 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0619850
Source.527: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500
Source.528: DFBPPR4837 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 5
Source.529: DFBPPR4851 ---- Plant proteins ---- B3 domain-containing protein Os03g0619800
Source.530: DFBPPR4857 ---- Plant proteins ---- B3 domain-containing protein Os03g0619600
Source.531: DFBPPR4882 ---- Plant proteins ---- Salt stress root protein RS1
Source.532: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.533: DFBPPR4899 ---- Plant proteins ---- Casein kinase 1
Source.534: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.535: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.536: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.537: DFBPPR4913 ---- Plant proteins ---- LRR receptor kinase SERL2
Source.538: DFBPPR4921 ---- Plant proteins ---- Probable ethylene response sensor 2
Source.539: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.540: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.541: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A
Source.542: DFBPPR4968 ---- Plant proteins ---- Seed linoleate 13S-lipoxygenase-1
Source.543: DFBPPR4974 ---- Plant proteins ---- Hsp70-Hsp90 organizing protein 1
Source.544: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.545: DFBPPR4979 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.546: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1
Source.547: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.548: DFBPPR5005 ---- Plant proteins ---- Linoleate 9S-lipoxygenase-4
Source.549: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.550: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.551: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.552: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.553: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.554: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.555: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.556: DFBPPR5072 ---- Plant proteins ---- Cell division cycle protein 48 homolog
Source.557: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2
Source.558: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.559: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.560: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6
Source.561: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.562: DFBPPR5145 ---- Plant proteins ---- 22.0 kDa class IV heat shock protein
Source.563: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30
Source.564: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1
Source.565: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.566: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.567: DFBPPR5180 ---- Plant proteins ---- Biotin carboxyl carrier protein of acetyl-CoA carboxylase, chloroplastic
Source.568: DFBPPR5183 ---- Plant proteins ---- Histone deacetylase HDT1
Source.569: DFBPPR5197 ---- Plant proteins ---- Nodulin-21
Source.570: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.571: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.572: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.573: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.574: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.575: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.576: DFBPPR5230 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.577: DFBPPR5250 ---- Plant proteins ---- Translation initiation factor IF-1, chloroplastic
Source.578: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.579: DFBPPR5304 ---- Plant proteins ---- Maturase K
Source.580: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.581: DFBPPR5353 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.582: DFBPPR5360 ---- Plant proteins ---- 14-3-3-like protein A
Source.583: DFBPPR5364 ---- Plant proteins ---- Auxin-induced protein X10A
Source.584: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.585: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.586: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.587: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.588: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.589: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.590: DFBPPR5414 ---- Plant proteins ---- Transketolase, chloroplastic
Source.591: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.592: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic
Source.593: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.594: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.595: DFBPPR5493 ---- Plant proteins ---- GTPase ERA1, chloroplastic
Source.596: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.597: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.598: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.599: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.600: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain
Source.601: DFBPPR5510 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase
Source.602: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.603: DFBPPR5525 ---- Plant proteins ---- Lon protease homolog, mitochondrial
Source.604: DFBPPR5561 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase catalytic chain, chloroplastic
Source.605: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.606: DFBPPR5577 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.607: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase
Source.608: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.609: DFBPPR5583 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.610: DFBPPR5589 ---- Plant proteins ---- Flap endonuclease 1
Source.611: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.612: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic
Source.613: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.614: DFBPPR5623 ---- Plant proteins ---- ATP synthase subunit gamma, chloroplastic
Source.615: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.616: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.617: DFBPPR5650 ---- Plant proteins ---- Enolase 1
Source.618: DFBPPR5654 ---- Plant proteins ---- Molybdopterin synthase sulfur carrier subunit
Source.619: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.620: DFBPPR5675 ---- Plant proteins ---- Enolase 2
Source.621: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.622: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5
Source.623: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.624: DFBPPR5688 ---- Plant proteins ---- Organelle RRM domain-containing protein 1, chloroplastic
Source.625: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.626: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.627: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.628: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.629: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.630: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.631: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.632: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.633: DFBPPR5782 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic
Source.634: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.635: DFBPPR5800 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRD, chloroplastic
Source.636: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.637: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.638: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2
Source.639: DFBPPR5836 ---- Plant proteins ---- Eukaryotic translation initiation factor 5A
Source.640: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.641: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.642: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase
Source.643: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.644: DFBPPR5901 ---- Plant proteins ---- GTP-binding protein YPTM1
Source.645: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.646: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2
Source.647: DFBPPR5930 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.648: DFBPPR5935 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.649: DFBPPR5976 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog
Source.650: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.651: DFBPPR6062 ---- Plant proteins ---- HSP-interacting protein
Source.652: DFBPPR6089 ---- Plant proteins ---- Cell number regulator 6
Source.653: DFBPPR6115 ---- Plant proteins ---- Cell number regulator 8
Source.654: DFBPPR6140 ---- Plant proteins ---- Uncharacterized protein ycf72
Source.655: DFBPPR6156 ---- Plant proteins ---- Ninja-family protein 1
Source.656: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.657: DFBPPR6164 ---- Plant proteins ---- Oil body-associated protein 2B
Source.658: DFBPPR6169 ---- Plant proteins ---- Uncharacterized 2.5 kDa protein in tRNA-Arg-tRNA-Asn intergenic region
Source.659: DFBPPR6186 ---- Plant proteins ---- Transposable element activator uncharacterized 23 kDa protein
Source.660: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.661: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic
Source.662: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.663: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.664: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.665: DFBPPR6248 ---- Plant proteins ---- Protein TIC110, chloroplastic
Source.666: DFBPPR6250 ---- Plant proteins ---- Nodulation receptor kinase
Source.667: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.668: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.669: DFBPPR6288 ---- Plant proteins ---- Glutathione reductase, cytosolic
Source.670: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.671: DFBPPR6314 ---- Plant proteins ---- Protein TIC 40, chloroplastic
Source.672: DFBPPR6343 ---- Plant proteins ---- Aspartate carbamoyltransferase 3, chloroplastic
Source.673: DFBPPR6344 ---- Plant proteins ---- Aspartate carbamoyltransferase 2, chloroplastic
Source.674: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic
Source.675: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic
Source.676: DFBPPR6365 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.677: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic
Source.678: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.679: DFBPPR6370 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-3
Source.680: DFBPPR6371 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase-2
Source.681: DFBPPR6374 ---- Plant proteins ---- 18.1 kDa class I heat shock protein
Source.682: DFBPPR6394 ---- Plant proteins ---- Chaperone protein ClpC, chloroplastic
Source.683: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.684: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.685: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic
Source.686: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial
Source.687: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial
Source.688: DFBPPR6431 ---- Plant proteins ---- DNA-directed RNA polymerase subunit alpha
Source.689: DFBPPR6441 ---- Plant proteins ---- 30S ribosomal protein S17, chloroplastic
Source.690: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.691: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.692: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.693: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.694: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.695: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.696: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.697: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.698: DFBPPR6463 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.699: DFBPPR6465 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.700: DFBPPR6467 ---- Plant proteins ---- Spermidine synthase 2
Source.701: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.702: DFBPPR6525 ---- Plant proteins ---- Plastocyanin, chloroplastic
Source.703: DFBPPR6571 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.704: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.705: DFBPPR6641 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.706: DFBPPR6648 ---- Plant proteins ---- Photosystem II protein D1
Source.707: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.708: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A
Source.709: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.710: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain
Source.711: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B
Source.712: DFBPPR6726 ---- Plant proteins ---- 70 kDa peptidyl-prolyl isomerase
Source.713: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase
Source.714: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D
Source.715: DFBPPR6769 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 1
Source.716: DFBPPR6773 ---- Plant proteins ---- 16.9 kDa class I heat shock protein 2
Source.717: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.718: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A
Source.719: DFBPPR6788 ---- Plant proteins ---- Histone H1
Source.720: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B
Source.721: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B
Source.722: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.723: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A
Source.724: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C
Source.725: DFBPPR6835 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 1, chloroplastic
Source.726: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.727: DFBPPR6856 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 3, chloroplastic
Source.728: DFBPPR6857 ---- Plant proteins ---- Imidazoleglycerol-phosphate dehydratase 2, chloroplastic
Source.729: DFBPPR6873 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.730: DFBPPR6874 ---- Plant proteins ---- Dehydrin COR410
Source.731: DFBPPR6881 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.732: DFBPPR7016 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic/amyloplastic
Source.733: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.734: DFBPPR7023 ---- Plant proteins ---- Photosystem II protein D1
Source.735: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7
Source.736: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.737: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.738: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.739: DFBPPR7052 ---- Plant proteins ---- Protein synthesis inhibitor II
Source.740: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.741: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain
Source.742: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.743: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain
Source.744: DFBPPR7071 ---- Plant proteins ---- Serpin-Z4
Source.745: DFBPPR7072 ---- Plant proteins ---- Protein synthesis inhibitor I
Source.746: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.747: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.748: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX
Source.749: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.750: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1
Source.751: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3
Source.752: DFBPPR7190 ---- Plant proteins ---- Elongation factor 1-alpha
Source.753: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog
Source.754: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2
Source.755: DFBPPR7196 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.756: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.757: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.758: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1
Source.759: DFBPPR7243 ---- Plant proteins ---- ATP synthase subunit a, chloroplastic
Source.760: DFBPPR7273 ---- Plant proteins ---- Subtilisin-chymotrypsin inhibitor CI-1A
Source.761: DFBPPR7280 ---- Plant proteins ---- 30S ribosomal protein 3, chloroplastic
Source.762: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic
Source.763: DFBPPR7399 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase small subunit, chloroplastic
Source.764: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.765: DFBPPR7412 ---- Plant proteins ---- Acetolactate synthase 2, chloroplastic
Source.766: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.767: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.768: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.769: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.770: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic
Source.771: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.772: DFBPPR7462 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.773: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.774: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2
Source.775: DFBPPR7476 ---- Plant proteins ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog, chloroplastic
Source.776: DFBPPR7478 ---- Plant proteins ---- Napin embryo-specific
Source.777: DFBPPR7482 ---- Plant proteins ---- Napin
Source.778: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.779: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.780: DFBPPR7608 ---- Milk proteins ---- Kappa-casein
Source.781: DFBPPR7611 ---- Milk proteins ---- Clusterin
Source.782: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.783: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.784: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.785: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.786: DFBPPR7647 ---- Milk proteins ---- Plasma serine protease inhibitor
Source.787: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.788: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.789: DFBPPR7677 ---- Milk proteins ---- Alpha-S2-casein-like A
Source.790: DFBPPR7679 ---- Milk proteins ---- Alpha-S2-casein
Source.791: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.792: DFBPPR8192 ---- Plant proteins ---- 2S albumin
Source.793: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal
Source.794: DFBPPR8363 ---- Plant proteins ---- 13S globulin seed storage protein 1
Source.795: DFBPPR8365 ---- Plant proteins ---- 13S globulin seed storage protein 3
Source.796: DFBPPR8367 ---- Plant proteins ---- 13S globulin seed storage protein 2
Source.797: DFBPPR8376 ---- Plant proteins ---- Mannitol dehydrogenase
Source.798: DFBPPR8394 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A
Source.799: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.800: DFBPPR8452 ---- Plant proteins ---- Photosystem II protein D1
Source.801: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.802: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2
Source.803: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1
Source.804: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.805: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.806: DFBPPR15943 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.807: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.808: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.809: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.810: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.811: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.812: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.813: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.814: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.815: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.816: DFBPPR16081 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.817: DFBPPR16094 ---- Animal proteins ---- Mastin
Source.818: DFBPPR16102 ---- Animal proteins ---- 40S ribosomal protein S3
Source.819: DFBPPR16113 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.820: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.821: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.822: DFBPPR16148 ---- Animal proteins ---- Haptoglobin
Source.823: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.824: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.825: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.826: DFBPPR16189 ---- Animal proteins ---- Albumin
Source.827: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator
Source.828: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.829: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.830: DFBPPR16220 ---- Animal proteins ---- Deoxyribonuclease-1
Source.831: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.832: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.833: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.834: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta
Source.835: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.836: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.837: DFBPPR16265 ---- Animal proteins ---- Caspase-1
Source.838: DFBPPR16286 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.839: DFBPPR16296 ---- Animal proteins ---- Type-1 angiotensin II receptor
Source.840: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.841: DFBPPR16326 ---- Animal proteins ---- Desmin
Source.842: DFBPPR16330 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.843: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.844: DFBPPR16382 ---- Animal proteins ---- Platelet glycoprotein Ib alpha chain
Source.845: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.846: DFBPPR16457 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.847: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.848: DFBPPR16482 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.849: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.850: DFBPPR16527 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.851: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.852: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.853: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.854: DFBPPR16557 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.855: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.856: DFBPPR16572 ---- Animal proteins ---- Gamma-sarcoglycan
Source.857: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.858: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19
Source.859: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.860: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.861: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.862: DFBPPR16670 ---- Animal proteins ---- Heat shock protein beta-8
Source.863: DFBPPR16693 ---- Animal proteins ---- Cingulin
Source.864: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.865: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.866: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.867: DFBPPR16763 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.868: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.869: DFBPPR16782 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.870: DFBPPR16797 ---- Animal proteins ---- Albumin
Source.871: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.872: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase
Source.873: DFBPPR16810 ---- Animal proteins ---- Cathepsin B
Source.874: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.875: DFBPPR16814 ---- Animal proteins ---- Prothrombin
Source.876: DFBPPR16815 ---- Animal proteins ---- Deoxyribonuclease-1
Source.877: DFBPPR16821 ---- Animal proteins ---- Cytochrome b-c1 complex subunit Rieske, mitochondrial
Source.878: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.879: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.880: DFBPPR16851 ---- Animal proteins ---- Cytochrome c1, heme protein, mitochondrial
Source.881: DFBPPR16857 ---- Animal proteins ---- Plasma serine protease inhibitor
Source.882: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.883: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.884: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.885: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.886: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.887: DFBPPR16920 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2
Source.888: DFBPPR16924 ---- Animal proteins ---- 3-ketoacyl-CoA thiolase, mitochondrial
Source.889: DFBPPR16940 ---- Animal proteins ---- Ras-related protein Rap-1A
Source.890: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2
Source.891: DFBPPR16961 ---- Animal proteins ---- C-X-C motif chemokine 6
Source.892: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.893: DFBPPR16969 ---- Animal proteins ---- Adenosine deaminase
Source.894: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.895: DFBPPR16985 ---- Animal proteins ---- Filensin
Source.896: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.897: DFBPPR17000 ---- Animal proteins ---- Vimentin
Source.898: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.899: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.900: DFBPPR17007 ---- Animal proteins ---- Microtubule-associated protein tau
Source.901: DFBPPR17009 ---- Animal proteins ---- Thioredoxin reductase 2, mitochondrial
Source.902: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2
Source.903: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.904: DFBPPR17036 ---- Animal proteins ---- Parkinson disease protein 7 homolog
Source.905: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.906: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.907: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase
Source.908: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.909: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.910: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.911: DFBPPR17093 ---- Animal proteins ---- Guanine nucleotide-binding protein G(t) subunit alpha-2
Source.912: DFBPPR17102 ---- Animal proteins ---- Dystroglycan
Source.913: DFBPPR17103 ---- Animal proteins ---- Dystroglycan
Source.914: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2
Source.915: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.916: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit
Source.917: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2
Source.918: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.919: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1
Source.920: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial
Source.921: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.922: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.923: DFBPPR17260 ---- Animal proteins ---- Rap guanine nucleotide exchange factor 2
Source.924: DFBPPR17265 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.925: DFBPPR17268 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.926: DFBPPR17272 ---- Animal proteins ---- Dysbindin
Source.927: DFBPPR17277 ---- Animal proteins ---- Serpin A3-1
Source.928: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.929: DFBPPR17286 ---- Animal proteins ---- Septin-2
Source.930: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.931: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D
Source.932: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.933: DFBPPR17299 ---- Animal proteins ---- Dynamin-1-like protein
Source.934: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.935: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1
Source.936: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.937: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.938: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1
Source.939: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.940: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.941: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.942: DFBPPR17385 ---- Animal proteins ---- Complement component 1 Q subcomponent-binding protein, mitochondrial
Source.943: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.944: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.945: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.946: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.947: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.948: DFBPPR17442 ---- Animal proteins ---- AP-3 complex subunit beta-1
Source.949: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.950: DFBPPR17445 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.951: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.952: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.953: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.954: DFBPPR17463 ---- Animal proteins ---- Desmocollin-1
Source.955: DFBPPR17465 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.956: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase
Source.957: DFBPPR17484 ---- Animal proteins ---- Histone H1.8
Source.958: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.959: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.960: DFBPPR17503 ---- Animal proteins ---- Syntaxin-1A
Source.961: DFBPPR17513 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.962: DFBPPR17519 ---- Animal proteins ---- Alpha-enolase
Source.963: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.964: DFBPPR17531 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.965: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase
Source.966: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.967: DFBPPR17544 ---- Animal proteins ---- Stromal interaction molecule 1
Source.968: DFBPPR17562 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.969: DFBPPR17564 ---- Animal proteins ---- Acetylcholine receptor subunit alpha
Source.970: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.971: DFBPPR17590 ---- Animal proteins ---- Serine/threonine-protein kinase H1
Source.972: DFBPPR17623 ---- Animal proteins ---- Ectodysplasin-A
Source.973: DFBPPR17624 ---- Animal proteins ---- Ectodysplasin-A
Source.974: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.975: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.976: DFBPPR17679 ---- Animal proteins ---- Platelet-derived growth factor subunit A
Source.977: DFBPPR17717 ---- Animal proteins ---- Unconventional myosin-Ia
Source.978: DFBPPR17739 ---- Animal proteins ---- Molybdenum cofactor biosynthesis protein 1
Source.979: DFBPPR17748 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.980: DFBPPR17764 ---- Animal proteins ---- L-selectin
Source.981: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5
Source.982: DFBPPR17783 ---- Animal proteins ---- 40S ribosomal protein S3
Source.983: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.984: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1
Source.985: DFBPPR17797 ---- Animal proteins ---- Caspase-13
Source.986: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial
Source.987: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.988: DFBPPR17803 ---- Animal proteins ---- Carbonic anhydrase 6
Source.989: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.990: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.991: DFBPPR17819 ---- Animal proteins ---- Ras-related protein Rap-1b
Source.992: DFBPPR17824 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 9
Source.993: DFBPPR17834 ---- Animal proteins ---- Apolipoprotein D
Source.994: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial
Source.995: DFBPPR17844 ---- Animal proteins ---- Protein tyrosine phosphatase type IVA 3
Source.996: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.997: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.998: DFBPPR17872 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.999: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.1000: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.1001: DFBPPR17894 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 9
Source.1002: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1003: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.1004: DFBPPR17925 ---- Animal proteins ---- Caspase-4
Source.1005: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1006: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.1007: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate
Source.1008: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.1009: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.1010: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.1011: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.1012: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha'
Source.1013: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.1014: DFBPPR18001 ---- Animal proteins ---- Syntaxin-1B
Source.1015: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.1016: DFBPPR18009 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.1017: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon
Source.1018: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.1019: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.1020: DFBPPR18051 ---- Animal proteins ---- MAP kinase-interacting serine/threonine-protein kinase 1
Source.1021: DFBPPR18058 ---- Animal proteins ---- Ras-related GTP-binding protein A
Source.1022: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.1023: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4
Source.1024: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.1025: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.1026: DFBPPR18121 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.1027: DFBPPR18126 ---- Animal proteins ---- RNA polymerase II-associated factor 1 homolog
Source.1028: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.1029: DFBPPR18150 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 1
Source.1030: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.1031: DFBPPR18160 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 1
Source.1032: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.1033: DFBPPR18227 ---- Animal proteins ---- Desmin
Source.1034: DFBPPR18255 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.1035: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.1036: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2
Source.1037: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3
Source.1038: DFBPPR18281 ---- Animal proteins ---- CD63 antigen
Source.1039: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56
Source.1040: DFBPPR18294 ---- Animal proteins ---- PC4 and SFRS1-interacting protein
Source.1041: DFBPPR18295 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2
Source.1042: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.1043: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.1044: DFBPPR18327 ---- Animal proteins ---- Eukaryotic translation initiation factor 6
Source.1045: DFBPPR18339 ---- Animal proteins ---- SPARC
Source.1046: DFBPPR18361 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.1047: DFBPPR18371 ---- Animal proteins ---- F-actin-capping protein subunit beta
Source.1048: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.1049: DFBPPR18399 ---- Animal proteins ---- Integrin beta-6
Source.1050: DFBPPR18404 ---- Animal proteins ---- Regulator of microtubule dynamics protein 3
Source.1051: DFBPPR18415 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-14
Source.1052: DFBPPR18448 ---- Animal proteins ---- Septin-1
Source.1053: DFBPPR18468 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.1054: DFBPPR18469 ---- Animal proteins ---- Calsyntenin-3
Source.1055: DFBPPR18476 ---- Animal proteins ---- Protein O-linked-mannose beta-1,2-N-acetylglucosaminyltransferase 1
Source.1056: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1
Source.1057: DFBPPR18513 ---- Animal proteins ---- Placenta growth factor
Source.1058: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit
Source.1059: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.1060: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.1061: DFBPPR18540 ---- Animal proteins ---- Fibroblast growth factor-binding protein 1
Source.1062: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.1063: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2
Source.1064: DFBPPR18595 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.1065: DFBPPR18601 ---- Animal proteins ---- AP-1 complex subunit mu-2
Source.1066: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1067: DFBPPR18613 ---- Animal proteins ---- 2-amino-3-ketobutyrate coenzyme A ligase, mitochondrial
Source.1068: DFBPPR18614 ---- Animal proteins ---- Beta-enolase
Source.1069: DFBPPR18631 ---- Animal proteins ---- Guanylate cyclase soluble subunit alpha-1
Source.1070: DFBPPR18654 ---- Animal proteins ---- SMC5-SMC6 complex localization factor protein 1
Source.1071: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.1072: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.1073: DFBPPR18737 ---- Animal proteins ---- Centrosomal protein of 120 kDa
Source.1074: DFBPPR18740 ---- Animal proteins ---- Growth factor receptor-bound protein 7
Source.1075: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor
Source.1076: DFBPPR18746 ---- Animal proteins ---- Anamorsin
Source.1077: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.1078: DFBPPR18790 ---- Animal proteins ---- Proto-oncogene vav
Source.1079: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1
Source.1080: DFBPPR18805 ---- Animal proteins ---- Nascent polypeptide-associated complex subunit alpha
Source.1081: DFBPPR18810 ---- Animal proteins ---- SHC-transforming protein 1
Source.1082: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.1083: DFBPPR18823 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.1084: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1085: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.1086: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1
Source.1087: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A
Source.1088: DFBPPR18868 ---- Animal proteins ---- Haptoglobin
Source.1089: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.1090: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.1091: DFBPPR18887 ---- Animal proteins ---- Zinc finger X-chromosomal protein
Source.1092: DFBPPR18892 ---- Animal proteins ---- T-cell surface glycoprotein CD5
Source.1093: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.1094: DFBPPR18919 ---- Animal proteins ---- Dual specificity protein phosphatase 18
Source.1095: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11
Source.1096: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.1097: DFBPPR18957 ---- Animal proteins ---- Glycerol-3-phosphate dehydrogenase, mitochondrial
Source.1098: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.1099: DFBPPR18971 ---- Animal proteins ---- Inorganic pyrophosphatase
Source.1100: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.1101: DFBPPR19006 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.1102: DFBPPR19012 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit D
Source.1103: DFBPPR19016 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.1104: DFBPPR19031 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-3
Source.1105: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.1106: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11
Source.1107: DFBPPR19049 ---- Animal proteins ---- Caprin-1
Source.1108: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.1109: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5
Source.1110: DFBPPR19071 ---- Animal proteins ---- Collectrin
Source.1111: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.1112: DFBPPR19100 ---- Animal proteins ---- Interleukin-34
Source.1113: DFBPPR19104 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1114: DFBPPR19113 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.1115: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1
Source.1116: DFBPPR19137 ---- Animal proteins ---- Serpin H1
Source.1117: DFBPPR19153 ---- Animal proteins ---- Copine-6
Source.1118: DFBPPR19166 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.1119: DFBPPR19168 ---- Animal proteins ---- Endoplasmic reticulum-Golgi intermediate compartment protein 3
Source.1120: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16
Source.1121: DFBPPR19198 ---- Animal proteins ---- Cadherin-3
Source.1122: DFBPPR19210 ---- Animal proteins ---- Endophilin-A2
Source.1123: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.1124: DFBPPR19236 ---- Animal proteins ---- Alanine--glyoxylate aminotransferase 2, mitochondrial
Source.1125: DFBPPR19243 ---- Animal proteins ---- Probable tRNA N6-adenosine threonylcarbamoyltransferase
Source.1126: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.1127: DFBPPR19257 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 3
Source.1128: DFBPPR19260 ---- Animal proteins ---- rRNA N6-adenosine-methyltransferase ZCCHC4
Source.1129: DFBPPR19268 ---- Animal proteins ---- BAG family molecular chaperone regulator 2
Source.1130: DFBPPR19272 ---- Animal proteins ---- Ribosomal oxygenase 2
Source.1131: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8
Source.1132: DFBPPR19315 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX47
Source.1133: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.1134: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.1135: DFBPPR19360 ---- Animal proteins ---- KN motif and ankyrin repeat domain-containing protein 2
Source.1136: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.1137: DFBPPR19384 ---- Animal proteins ---- Complement component C9
Source.1138: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.1139: DFBPPR19390 ---- Animal proteins ---- E3 ubiquitin-protein ligase TM129
Source.1140: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6
Source.1141: DFBPPR19444 ---- Animal proteins ---- Tyrosine--tRNA ligase, cytoplasmic
Source.1142: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3
Source.1143: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.1144: DFBPPR19462 ---- Animal proteins ---- Intercellular adhesion molecule 1
Source.1145: DFBPPR19464 ---- Animal proteins ---- Keratin, type I cytoskeletal 20
Source.1146: DFBPPR19468 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 2
Source.1147: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.1148: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.1149: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1
Source.1150: DFBPPR19493 ---- Animal proteins ---- DnaJ homolog subfamily B member 11
Source.1151: DFBPPR19517 ---- Animal proteins ---- Nucleoredoxin
Source.1152: DFBPPR19531 ---- Animal proteins ---- Interferon omega-1
Source.1153: DFBPPR19536 ---- Animal proteins ---- Serpin A3-3
Source.1154: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial
Source.1155: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.1156: DFBPPR19580 ---- Animal proteins ---- Endosomal/lysosomal potassium channel TMEM175
Source.1157: DFBPPR19586 ---- Animal proteins ---- Uridine-cytidine kinase 1
Source.1158: DFBPPR19616 ---- Animal proteins ---- Protein THEMIS
Source.1159: DFBPPR19622 ---- Animal proteins ---- Thrombospondin type-1 domain-containing protein 1
Source.1160: DFBPPR19632 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF25
Source.1161: DFBPPR19634 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, mitochondrial
Source.1162: DFBPPR19650 ---- Animal proteins ---- Small G protein signaling modulator 3
Source.1163: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase
Source.1164: DFBPPR19670 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily D member 2
Source.1165: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase
Source.1166: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.1167: DFBPPR19712 ---- Animal proteins ---- Zinc finger protein 205
Source.1168: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.1169: DFBPPR19729 ---- Animal proteins ---- Transmembrane protein 106B
Source.1170: DFBPPR19733 ---- Animal proteins ---- Nucleolar and spindle-associated protein 1
Source.1171: DFBPPR19735 ---- Animal proteins ---- Complement component C7
Source.1172: DFBPPR19768 ---- Animal proteins ---- Peroxynitrite isomerase THAP4
Source.1173: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.1174: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.1175: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4
Source.1176: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.1177: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.1178: DFBPPR19808 ---- Animal proteins ---- Glycylpeptide N-tetradecanoyltransferase 2
Source.1179: DFBPPR19819 ---- Animal proteins ---- Heat shock protein 75 kDa, mitochondrial
Source.1180: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1181: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.1182: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.1183: DFBPPR19834 ---- Animal proteins ---- Harmonin
Source.1184: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2
Source.1185: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase
Source.1186: DFBPPR19858 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A
Source.1187: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.1188: DFBPPR19878 ---- Animal proteins ---- Ankyrin repeat and zinc finger domain-containing protein 1
Source.1189: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.1190: DFBPPR19934 ---- Animal proteins ---- Cyclin-A2
Source.1191: DFBPPR19950 ---- Animal proteins ---- Protein arginine methyltransferase NDUFAF7, mitochondrial
Source.1192: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.1193: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.1194: DFBPPR19955 ---- Animal proteins ---- Hemoglobin subunit epsilon-2
Source.1195: DFBPPR19968 ---- Animal proteins ---- Hemoglobin subunit epsilon-4
Source.1196: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.1197: DFBPPR19987 ---- Animal proteins ---- SH3 and cysteine-rich domain-containing protein
Source.1198: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.1199: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.1200: DFBPPR20050 ---- Animal proteins ---- Dihydroxyacetone phosphate acyltransferase
Source.1201: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.1202: DFBPPR20064 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical]
Source.1203: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.1204: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.1205: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.1206: DFBPPR20101 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1207: DFBPPR20142 ---- Animal proteins ---- Kinesin-like protein KIF3C
Source.1208: DFBPPR20151 ---- Animal proteins ---- AP-2 complex subunit sigma
Source.1209: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.1210: DFBPPR20182 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.1211: DFBPPR20196 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 4
Source.1212: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial
Source.1213: DFBPPR20205 ---- Animal proteins ---- Methionyl-tRNA formyltransferase, mitochondrial
Source.1214: DFBPPR20214 ---- Animal proteins ---- Lipopolysaccharide-binding protein
Source.1215: DFBPPR20218 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL9
Source.1216: DFBPPR20229 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.1217: DFBPPR20230 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase
Source.1218: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.1219: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2
Source.1220: DFBPPR20257 ---- Animal proteins ---- Targeting protein for Xklp2
Source.1221: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.1222: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.1223: DFBPPR20281 ---- Animal proteins ---- Splicing factor 3A subunit 2
Source.1224: DFBPPR20306 ---- Animal proteins ---- Gamma-sarcoglycan
Source.1225: DFBPPR20319 ---- Animal proteins ---- Protein pelota homolog
Source.1226: DFBPPR20335 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.1227: DFBPPR20340 ---- Animal proteins ---- Peripherin
Source.1228: DFBPPR20346 ---- Animal proteins ---- Serpin B6
Source.1229: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.1230: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1
Source.1231: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6
Source.1232: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.1233: DFBPPR20392 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1
Source.1234: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2
Source.1235: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.1236: DFBPPR20403 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 2
Source.1237: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein
Source.1238: DFBPPR20423 ---- Animal proteins ---- 39S ribosomal protein L16, mitochondrial
Source.1239: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.1240: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.1241: DFBPPR20455 ---- Animal proteins ---- Heat shock protein beta-8
Source.1242: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.1243: DFBPPR20487 ---- Animal proteins ---- Multifunctional methyltransferase subunit TRM112-like protein
Source.1244: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.1245: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.1246: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.1247: DFBPPR20520 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein H2
Source.1248: DFBPPR20525 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC6
Source.1249: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.1250: DFBPPR20533 ---- Animal proteins ---- Inactive serine protease PAMR1
Source.1251: DFBPPR20551 ---- Animal proteins ---- Pyrroline-5-carboxylate reductase 3
Source.1252: DFBPPR20552 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.1253: DFBPPR20555 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.1254: DFBPPR20587 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.1255: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.1256: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1
Source.1257: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.1258: DFBPPR20626 ---- Animal proteins ---- Melanocortin receptor 5
Source.1259: DFBPPR20628 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase C
Source.1260: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.1261: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.1262: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.1263: DFBPPR20666 ---- Animal proteins ---- Tektin-2
Source.1264: DFBPPR20669 ---- Animal proteins ---- D site-binding protein
Source.1265: DFBPPR20670 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 4
Source.1266: DFBPPR20673 ---- Animal proteins ---- Trafficking protein particle complex subunit 9
Source.1267: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1
Source.1268: DFBPPR20708 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 beta
Source.1269: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog
Source.1270: DFBPPR20716 ---- Animal proteins ---- EP300-interacting inhibitor of differentiation 3
Source.1271: DFBPPR20744 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.1272: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog
Source.1273: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.1274: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45
Source.1275: DFBPPR20764 ---- Animal proteins ---- Phosphatidylinositol-glycan biosynthesis class W protein
Source.1276: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein
Source.1277: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6
Source.1278: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.1279: DFBPPR20811 ---- Animal proteins ---- Transmembrane protein 216
Source.1280: DFBPPR20812 ---- Animal proteins ---- SEC14-like protein 2
Source.1281: DFBPPR20813 ---- Animal proteins ---- 60S ribosomal protein L14
Source.1282: DFBPPR20823 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.1283: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13
Source.1284: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.1285: DFBPPR20849 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.1286: DFBPPR20890 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1287: DFBPPR20893 ---- Animal proteins ---- TRMT1-like protein
Source.1288: DFBPPR20901 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase-like protein 1
Source.1289: DFBPPR20911 ---- Animal proteins ---- 40S ribosomal protein S20
Source.1290: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.1291: DFBPPR20922 ---- Animal proteins ---- Calcipressin-2
Source.1292: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1
Source.1293: DFBPPR20957 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial
Source.1294: DFBPPR20958 ---- Animal proteins ---- GrpE protein homolog 2, mitochondrial
Source.1295: DFBPPR20963 ---- Animal proteins ---- Protein kintoun
Source.1296: DFBPPR20971 ---- Animal proteins ---- BPI fold-containing family B member 1
Source.1297: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2
Source.1298: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog
Source.1299: DFBPPR21037 ---- Animal proteins ---- Zinc finger protein 574
Source.1300: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2
Source.1301: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier
Source.1302: DFBPPR21184 ---- Animal proteins ---- Kinetochore protein Spc24
Source.1303: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase
Source.1304: DFBPPR21207 ---- Animal proteins ---- Ragulator complex protein LAMTOR3
Source.1305: DFBPPR21217 ---- Animal proteins ---- GA-binding protein subunit beta-1
Source.1306: DFBPPR21235 ---- Animal proteins ---- Transmembrane protein 231
Source.1307: DFBPPR21241 ---- Animal proteins ---- Cytochrome b-245 chaperone 1
Source.1308: DFBPPR21246 ---- Animal proteins ---- Dynein intermediate chain CFAP94, axonemal
Source.1309: DFBPPR21247 ---- Animal proteins ---- Serpin A3-5
Source.1310: DFBPPR21283 ---- Animal proteins ---- Serpin A3-6
Source.1311: DFBPPR21287 ---- Animal proteins ---- Serpin A3-2
Source.1312: DFBPPR21290 ---- Animal proteins ---- Metaxin-1
Source.1313: DFBPPR21303 ---- Animal proteins ---- Palmdelphin
Source.1314: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.1315: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1
Source.1316: DFBPPR21326 ---- Animal proteins ---- Serpin A3-4
Source.1317: DFBPPR21339 ---- Animal proteins ---- Zinc finger protein 692
Source.1318: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.1319: DFBPPR21373 ---- Animal proteins ---- Zinc finger protein 2
Source.1320: DFBPPR21380 ---- Animal proteins ---- AP-4 complex subunit sigma-1
Source.1321: DFBPPR21383 ---- Animal proteins ---- Cytosolic iron-sulfur assembly component 2A
Source.1322: DFBPPR21389 ---- Animal proteins ---- N-terminal EF-hand calcium-binding protein 3
Source.1323: DFBPPR21395 ---- Animal proteins ---- Elongation factor Ts, mitochondrial
Source.1324: DFBPPR21461 ---- Animal proteins ---- Glycerate kinase
Source.1325: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1
Source.1326: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.1327: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial
Source.1328: DFBPPR21508 ---- Animal proteins ---- GPI transamidase component PIG-S
Source.1329: DFBPPR21535 ---- Animal proteins ---- Gastrotropin
Source.1330: DFBPPR21537 ---- Animal proteins ---- Serpin A3-8
Source.1331: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9
Source.1332: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.1333: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.1334: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2
Source.1335: DFBPPR21606 ---- Animal proteins ---- Surfeit locus protein 6
Source.1336: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.1337: DFBPPR21619 ---- Animal proteins ---- CBY1-interacting BAR domain-containing protein 2
Source.1338: DFBPPR21650 ---- Animal proteins ---- Synaptonemal complex central element protein 1
Source.1339: DFBPPR21670 ---- Animal proteins ---- V-type proton ATPase subunit E 2
Source.1340: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like
Source.1341: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.1342: DFBPPR21747 ---- Animal proteins ---- Zinc finger Y-chromosomal protein
Source.1343: DFBPPR21751 ---- Animal proteins ---- Oocyte-expressed protein homolog
Source.1344: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.1345: DFBPPR21769 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 21
Source.1346: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.1347: DFBPPR21779 ---- Animal proteins ---- Serpin B8
Source.1348: DFBPPR21785 ---- Animal proteins ---- Spermatogenesis-associated protein 19, mitochondrial
Source.1349: DFBPPR21794 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 8
Source.1350: DFBPPR21799 ---- Animal proteins ---- Major vault protein
Source.1351: DFBPPR21801 ---- Animal proteins ---- Cell cycle checkpoint control protein RAD9B
Source.1352: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.1353: DFBPPR21836 ---- Animal proteins ---- Potassium channel regulatory protein
Source.1354: DFBPPR21851 ---- Animal proteins ---- TSC22 domain family protein 1
Source.1355: DFBPPR21868 ---- Animal proteins ---- RAB6-interacting golgin
Source.1356: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein
Source.1357: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.1358: DFBPPR21886 ---- Animal proteins ---- Interferon-stimulated 20 kDa exonuclease-like 2
Source.1359: DFBPPR21888 ---- Animal proteins ---- Serum response factor-binding protein 1
Source.1360: DFBPPR21897 ---- Animal proteins ---- ZW10 interactor
Source.1361: DFBPPR21913 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 2
Source.1362: DFBPPR21921 ---- Animal proteins ---- AP-5 complex subunit beta-1
Source.1363: DFBPPR21928 ---- Animal proteins ---- Protein canopy homolog 4
Source.1364: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.1365: DFBPPR21940 ---- Animal proteins ---- G patch domain-containing protein 1
Source.1366: DFBPPR21949 ---- Animal proteins ---- ER membrane protein complex subunit 7
Source.1367: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11
Source.1368: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.1369: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101
Source.1370: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1371: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14
Source.1372: DFBPPR21988 ---- Animal proteins ---- Transmembrane protein 59-like
Source.1373: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.1374: DFBPPR22018 ---- Animal proteins ---- Armadillo repeat-containing protein 1
Source.1375: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein
Source.1376: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2
Source.1377: DFBPPR22043 ---- Animal proteins ---- Leukocyte antigen CD37
Source.1378: DFBPPR22046 ---- Animal proteins ---- Glucose-fructose oxidoreductase domain-containing protein 2
Source.1379: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6
Source.1380: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.1381: DFBPPR22075 ---- Animal proteins ---- GTP-binding protein 8
Source.1382: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9
Source.1383: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor
Source.1384: DFBPPR22105 ---- Animal proteins ---- Centromere protein L
Source.1385: DFBPPR22116 ---- Animal proteins ---- CB1 cannabinoid receptor-interacting protein 1
Source.1386: DFBPPR22119 ---- Animal proteins ---- Transmembrane protein with metallophosphoesterase domain
Source.1387: DFBPPR22124 ---- Animal proteins ---- Platelet-derived growth factor receptor-like protein
Source.1388: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11
Source.1389: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.1390: DFBPPR22191 ---- Animal proteins ---- Heat shock protein beta-3
Source.1391: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2
Source.1392: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.1393: DFBPPR22244 ---- Animal proteins ---- THAP domain-containing protein 3
Source.1394: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3
Source.1395: DFBPPR22289 ---- Animal proteins ---- Heme-binding protein 1
Source.1396: DFBPPR22306 ---- Animal proteins ---- p53 and DNA damage-regulated protein 1
Source.1397: DFBPPR22307 ---- Animal proteins ---- MORF4 family-associated protein 1
Source.1398: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.1399: DFBPPR22332 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 3
Source.1400: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9
Source.1401: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B
Source.1402: DFBPPR22429 ---- Animal proteins ---- Coiled-coil domain-containing protein 107
Source.1403: DFBPPR22448 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 5B
Source.1404: DFBPPR22451 ---- Animal proteins ---- RING finger protein 151
Source.1405: DFBPPR22463 ---- Animal proteins ---- T-complex protein 11-like protein 2
Source.1406: DFBPPR22501 ---- Animal proteins ---- Multiple myeloma tumor-associated protein 2 homolog
Source.1407: DFBPPR22531 ---- Animal proteins ---- BTB/POZ domain-containing protein 9
Source.1408: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B
Source.1409: DFBPPR22580 ---- Animal proteins ---- Paraneoplastic antigen-like protein 8A
Source.1410: DFBPPR22617 ---- Animal proteins ---- SNRPN upstream reading frame protein
Source.1411: DFBPPR22625 ---- Animal proteins ---- Transmembrane protein 164
Source.1412: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1
Source.1413: DFBPPR22654 ---- Animal proteins ---- Proline-rich protein 9
Source.1414: DFBPPR22657 ---- Animal proteins ---- Protein FAM110D
Source.1415: DFBPPR22661 ---- Animal proteins ---- Uncharacterized protein C2orf42 homolog
Source.1416: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1
Source.1417: DFBPPR22736 ---- Animal proteins ---- Uncharacterized protein C16orf71 homolog
Source.1418: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial
Source.1419: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1420: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.1421: DFBPPR8535 ---- Animal proteins ---- Succinate--CoA ligase [GDP-forming] subunit beta, mitochondrial
Source.1422: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.1423: DFBPPR8559 ---- Animal proteins ---- Hydroxyacyl-coenzyme A dehydrogenase, mitochondrial
Source.1424: DFBPPR8563 ---- Animal proteins ---- Transitional endoplasmic reticulum ATPase
Source.1425: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.1426: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.1427: DFBPPR8577 ---- Animal proteins ---- Nectin-1
Source.1428: DFBPPR8578 ---- Animal proteins ---- Large proline-rich protein BAG6
Source.1429: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.1430: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.1431: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.1432: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1
Source.1433: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.1434: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.1435: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.1436: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.1437: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.1438: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A
Source.1439: DFBPPR8676 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.1440: DFBPPR8678 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1441: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.1442: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.1443: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.1444: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.1445: DFBPPR8737 ---- Animal proteins ---- Growth hormone receptor
Source.1446: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.1447: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.1448: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.1449: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.1450: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase
Source.1451: DFBPPR8772 ---- Animal proteins ---- Dystroglycan
Source.1452: DFBPPR8774 ---- Animal proteins ---- Tenascin
Source.1453: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1
Source.1454: DFBPPR8785 ---- Animal proteins ---- 40S ribosomal protein S3
Source.1455: DFBPPR8815 ---- Animal proteins ---- Adenylyltransferase and sulfurtransferase MOCS3
Source.1456: DFBPPR8818 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX4
Source.1457: DFBPPR8844 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.1458: DFBPPR8851 ---- Animal proteins ---- Vimentin
Source.1459: DFBPPR8852 ---- Animal proteins ---- Vimentin
Source.1460: DFBPPR8854 ---- Animal proteins ---- Vimentin
Source.1461: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.1462: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.1463: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.1464: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.1465: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.1466: DFBPPR8942 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.1467: DFBPPR8976 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1468: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.1469: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.1470: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.1471: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.1472: DFBPPR9020 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.1473: DFBPPR9028 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.1474: DFBPPR9039 ---- Animal proteins ---- Desmin
Source.1475: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase
Source.1476: DFBPPR9044 ---- Animal proteins ---- Albumin
Source.1477: DFBPPR9060 ---- Animal proteins ---- Serine/threonine-protein kinase A-Raf
Source.1478: DFBPPR9066 ---- Animal proteins ---- Aminoacylase-1
Source.1479: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.1480: DFBPPR9084 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.1481: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.1482: DFBPPR9098 ---- Animal proteins ---- Gastrotropin
Source.1483: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1484: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1485: DFBPPR9116 ---- Animal proteins ---- Cathepsin B
Source.1486: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.1487: DFBPPR9142 ---- Animal proteins ---- Epoxide hydrolase 1
Source.1488: DFBPPR9144 ---- Animal proteins ---- Major seminal plasma glycoprotein PSP-II
Source.1489: DFBPPR9169 ---- Animal proteins ---- Aggrecan core protein
Source.1490: DFBPPR9180 ---- Animal proteins ---- Integrin beta-6
Source.1491: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1
Source.1492: DFBPPR9206 ---- Animal proteins ---- Serine/threonine-protein phosphatase 1 regulatory subunit 10
Source.1493: DFBPPR9207 ---- Animal proteins ---- Beta-enolase
Source.1494: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.1495: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.1496: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.1497: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.1498: DFBPPR9306 ---- Animal proteins ---- Complement component C7
Source.1499: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.1500: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.1501: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.1502: DFBPPR9330 ---- Animal proteins ---- Receptor activity-modifying protein 3
Source.1503: DFBPPR9338 ---- Animal proteins ---- SPARC
Source.1504: DFBPPR9353 ---- Animal proteins ---- Nicotinate-nucleotide pyrophosphorylase [carboxylating]
Source.1505: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.1506: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.1507: DFBPPR9394 ---- Animal proteins ---- 5-beta-cholestane-3-alpha,7-alpha-diol 12-alpha-hydroxylase
Source.1508: DFBPPR9399 ---- Animal proteins ---- High affinity copper uptake protein 1
Source.1509: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.1510: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.1511: DFBPPR9449 ---- Animal proteins ---- Bis(5'-nucleosyl)-tetraphosphatase [asymmetrical]
Source.1512: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase
Source.1513: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.1514: DFBPPR9488 ---- Animal proteins ---- 60S ribosomal protein L14
Source.1515: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase
Source.1516: DFBPPR9549 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.1517: DFBPPR9552 ---- Animal proteins ---- Electron transfer flavoprotein subunit beta
Source.1518: DFBPPR9554 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.1519: DFBPPR9581 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain
Source.1520: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.1521: DFBPPR9607 ---- Animal proteins ---- F-actin-capping protein subunit beta
Source.1522: DFBPPR9612 ---- Animal proteins ---- 40S ribosomal protein S20
Source.1523: DFBPPR9615 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit
Source.1524: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.1525: DFBPPR9653 ---- Animal proteins ---- Carbohydrate-binding protein AQN-1
Source.1526: DFBPPR9658 ---- Animal proteins ---- Melanocortin receptor 5
Source.1527: DFBPPR9700 ---- Animal proteins ---- Galectin-1
Source.1528: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.1529: DFBPPR9721 ---- Animal proteins ---- WAP four-disulfide core domain protein 2
Source.1530: DFBPPR9736 ---- Animal proteins ---- Metaxin-1
Source.1531: DFBPPR9748 ---- Animal proteins ---- Involucrin
Source.1532: DFBPPR9759 ---- Animal proteins ---- Palmdelphin
Source.1533: DFBPPR9771 ---- Animal proteins ---- 60S ribosomal protein L5
Source.1534: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15
Source.1535: DFBPPR9790 ---- Animal proteins ---- Deoxyribonuclease-1-like 1
Source.1536: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2
Source.1537: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.1538: DFBPPR9843 ---- Animal proteins ---- P protein
Source.1539: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1
Source.1540: DFBPPR9927 ---- Animal proteins ---- Protein BTG3
Source.1541: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1542: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.1543: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1544: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.1545: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.1546: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.1547: DFBPPR10019 ---- Animal proteins ---- Extracellular fatty acid-binding protein
Source.1548: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.1549: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.1550: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.1551: DFBPPR10057 ---- Animal proteins ---- Stimulator of interferon genes protein
Source.1552: DFBPPR10059 ---- Animal proteins ---- Protein Wnt-4
Source.1553: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.1554: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.1555: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.1556: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3
Source.1557: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.1558: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.1559: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.1560: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.1561: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial
Source.1562: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.1563: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.1564: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1
Source.1565: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.1566: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.1567: DFBPPR10216 ---- Animal proteins ---- Pro-neuregulin-1, membrane-bound isoform
Source.1568: DFBPPR10225 ---- Animal proteins ---- Neuropilin-1
Source.1569: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.1570: DFBPPR10239 ---- Animal proteins ---- Catenin alpha-2
Source.1571: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.1572: DFBPPR10256 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-6
Source.1573: DFBPPR10260 ---- Animal proteins ---- F-actin-capping protein subunit beta isoforms 1 and 2
Source.1574: DFBPPR10261 ---- Animal proteins ---- Cadherin-13
Source.1575: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.1576: DFBPPR10267 ---- Animal proteins ---- Gephyrin
Source.1577: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.1578: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.1579: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.1580: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.1581: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.1582: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.1583: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP
Source.1584: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.1585: DFBPPR10312 ---- Animal proteins ---- Protein kinase C and casein kinase substrate in neurons protein 2
Source.1586: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.1587: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.1588: DFBPPR10342 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.1589: DFBPPR10349 ---- Animal proteins ---- Leiomodin-2
Source.1590: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2
Source.1591: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.1592: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.1593: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.1594: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1
Source.1595: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.1596: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.1597: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.1598: DFBPPR10407 ---- Animal proteins ---- Beta-enolase
Source.1599: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.1600: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.1601: DFBPPR10447 ---- Animal proteins ---- Plastin-1
Source.1602: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit
Source.1603: DFBPPR10452 ---- Animal proteins ---- Desmin
Source.1604: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.1605: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.1606: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.1607: DFBPPR10464 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.1608: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.1609: DFBPPR10479 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.1610: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.1611: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.1612: DFBPPR10508 ---- Animal proteins ---- Septin-2
Source.1613: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.1614: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.1615: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2
Source.1616: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.1617: DFBPPR10541 ---- Animal proteins ---- Glypican-1
Source.1618: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.1619: DFBPPR10556 ---- Animal proteins ---- Tenascin-R
Source.1620: DFBPPR10558 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 2
Source.1621: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.1622: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1
Source.1623: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3
Source.1624: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b
Source.1625: DFBPPR10573 ---- Animal proteins ---- Neuronal-glial cell adhesion molecule
Source.1626: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial
Source.1627: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.1628: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z
Source.1629: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.1630: DFBPPR10621 ---- Animal proteins ---- Heparan-sulfate 6-O-sulfotransferase 1
Source.1631: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.1632: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1633: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.1634: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.1635: DFBPPR10652 ---- Animal proteins ---- Formimidoyltransferase-cyclodeaminase
Source.1636: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.1637: DFBPPR10656 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1
Source.1638: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.1639: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.1640: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.1641: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.1642: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.1643: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.1644: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.1645: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2
Source.1646: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.1647: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.1648: DFBPPR10712 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1649: DFBPPR10713 ---- Animal proteins ---- Adenosine deaminase
Source.1650: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.1651: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.1652: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2
Source.1653: DFBPPR10727 ---- Animal proteins ---- Vimentin
Source.1654: DFBPPR10747 ---- Animal proteins ---- Cathepsin B
Source.1655: DFBPPR10749 ---- Animal proteins ---- DnaJ homolog subfamily B member 6
Source.1656: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.1657: DFBPPR10761 ---- Animal proteins ---- Cell surface glycoprotein CD200 receptor 1-A
Source.1658: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1659: DFBPPR10781 ---- Animal proteins ---- Inhibin alpha chain
Source.1660: DFBPPR10789 ---- Animal proteins ---- Alpha-enolase
Source.1661: DFBPPR10792 ---- Animal proteins ---- H/ACA ribonucleoprotein complex subunit DKC1
Source.1662: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.1663: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.1664: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.1665: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.1666: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.1667: DFBPPR10824 ---- Animal proteins ---- Gamma-enolase
Source.1668: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5
Source.1669: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.1670: DFBPPR10854 ---- Animal proteins ---- Cytoplasmic aconitate hydratase
Source.1671: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.1672: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.1673: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.1674: DFBPPR10907 ---- Animal proteins ---- Endophilin-A2
Source.1675: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.1676: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2
Source.1677: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.1678: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.1679: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2
Source.1680: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.1681: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog
Source.1682: DFBPPR10976 ---- Animal proteins ---- Lamin-B2
Source.1683: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.1684: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.1685: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase
Source.1686: DFBPPR11004 ---- Animal proteins ---- Pachytene checkpoint protein 2 homolog
Source.1687: DFBPPR11007 ---- Animal proteins ---- Anamorsin
Source.1688: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.1689: DFBPPR11017 ---- Animal proteins ---- Collectin-12
Source.1690: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.1691: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.1692: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.1693: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.1694: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.1695: DFBPPR11055 ---- Animal proteins ---- Thymidine kinase, cytosolic
Source.1696: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2
Source.1697: DFBPPR11063 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.1698: DFBPPR11069 ---- Animal proteins ---- Casein kinase I isoform gamma-1
Source.1699: DFBPPR11078 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1
Source.1700: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.1701: DFBPPR11087 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3
Source.1702: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2
Source.1703: DFBPPR11110 ---- Animal proteins ---- Lamin-B1
Source.1704: DFBPPR11118 ---- Animal proteins ---- Filensin
Source.1705: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.1706: DFBPPR11128 ---- Animal proteins ---- Ras-related protein Rap-1b
Source.1707: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit
Source.1708: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial
Source.1709: DFBPPR11138 ---- Animal proteins ---- Neuropeptide Y receptor type 2
Source.1710: DFBPPR11151 ---- Animal proteins ---- SPARC
Source.1711: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1
Source.1712: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1
Source.1713: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.1714: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.1715: DFBPPR11199 ---- Animal proteins ---- Secreted frizzled-related protein 3
Source.1716: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1717: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.1718: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1
Source.1719: DFBPPR11206 ---- Animal proteins ---- Voltage-gated hydrogen channel 1
Source.1720: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component
Source.1721: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.1722: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.1723: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C
Source.1724: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha
Source.1725: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.1726: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1
Source.1727: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5
Source.1728: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.1729: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2
Source.1730: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2
Source.1731: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1732: DFBPPR11365 ---- Animal proteins ---- Heat shock 70 kDa protein 14
Source.1733: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2
Source.1734: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1
Source.1735: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3
Source.1736: DFBPPR11387 ---- Animal proteins ---- Amphiphysin
Source.1737: DFBPPR11394 ---- Animal proteins ---- Myb-related protein B
Source.1738: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.1739: DFBPPR11407 ---- Animal proteins ---- RAD52 motif-containing protein 1
Source.1740: DFBPPR11409 ---- Animal proteins ---- Transcriptional repressor CTCF
Source.1741: DFBPPR11418 ---- Animal proteins ---- Transmembrane protein 231
Source.1742: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.1743: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.1744: DFBPPR11454 ---- Animal proteins ---- Calcium release-activated calcium channel protein 1
Source.1745: DFBPPR11470 ---- Animal proteins ---- Acetylcholine receptor subunit beta
Source.1746: DFBPPR11483 ---- Animal proteins ---- Hsc70-interacting protein
Source.1747: DFBPPR11493 ---- Animal proteins ---- Interferon regulatory factor 1
Source.1748: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2
Source.1749: DFBPPR11521 ---- Animal proteins ---- Putative nucleotidyltransferase MAB21L1
Source.1750: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog
Source.1751: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase
Source.1752: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B
Source.1753: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.1754: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59
Source.1755: DFBPPR11632 ---- Animal proteins ---- Ubiquitin-like domain-containing CTD phosphatase 1
Source.1756: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.1757: DFBPPR11639 ---- Animal proteins ---- Agmatinase, mitochondrial
Source.1758: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus
Source.1759: DFBPPR11666 ---- Animal proteins ---- Interferon regulatory factor 2
Source.1760: DFBPPR11668 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.1761: DFBPPR11680 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.1762: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.1763: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.1764: DFBPPR11727 ---- Animal proteins ---- Peroxisomal targeting signal 1 receptor
Source.1765: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.1766: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein
Source.1767: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.1768: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.1769: DFBPPR11822 ---- Animal proteins ---- Inversin
Source.1770: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.1771: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13
Source.1772: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.1773: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2
Source.1774: DFBPPR11870 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.1775: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.1776: DFBPPR11877 ---- Animal proteins ---- Ig mu chain C region
Source.1777: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.1778: DFBPPR11901 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 8
Source.1779: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.1780: DFBPPR11931 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 20
Source.1781: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2
Source.1782: DFBPPR11943 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 3
Source.1783: DFBPPR11946 ---- Animal proteins ---- RecQ-mediated genome instability protein 1
Source.1784: DFBPPR11950 ---- Animal proteins ---- Spermatid perinuclear RNA-binding protein
Source.1785: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.1786: DFBPPR11995 ---- Animal proteins ---- Protein orai-2
Source.1787: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.1788: DFBPPR12014 ---- Animal proteins ---- Raftlin
Source.1789: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.1790: DFBPPR12035 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.1791: DFBPPR12040 ---- Animal proteins ---- Neurochondrin
Source.1792: DFBPPR12047 ---- Animal proteins ---- Ragulator complex protein LAMTOR3
Source.1793: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.1794: DFBPPR12060 ---- Animal proteins ---- Neurobeachin
Source.1795: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9
Source.1796: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.1797: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.1798: DFBPPR12113 ---- Animal proteins ---- Protein DENND6A
Source.1799: DFBPPR12116 ---- Animal proteins ---- Armadillo repeat-containing protein 1
Source.1800: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.1801: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.1802: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.1803: DFBPPR12135 ---- Animal proteins ---- Vigilin
Source.1804: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.1805: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.1806: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1
Source.1807: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.1808: DFBPPR12169 ---- Animal proteins ---- THAP domain-containing protein 5
Source.1809: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174
Source.1810: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2
Source.1811: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.1812: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.1813: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1
Source.1814: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.1815: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.1816: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.1817: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.1818: DFBPPR12300 ---- Animal proteins ---- Platelet-derived growth factor subunit A
Source.1819: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.1820: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.1821: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.1822: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.1823: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.1824: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.1825: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E
Source.1826: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.1827: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14
Source.1828: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1829: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1
Source.1830: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.1831: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.1832: DFBPPR12372 ---- Animal proteins ---- Rho-associated protein kinase 1
Source.1833: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.1834: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.1835: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.1836: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1
Source.1837: DFBPPR12401 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF1
Source.1838: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.1839: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.1840: DFBPPR12425 ---- Animal proteins ---- Beta-enolase
Source.1841: DFBPPR12426 ---- Animal proteins ---- Dual specificity tyrosine-phosphorylation-regulated kinase 1A
Source.1842: DFBPPR12430 ---- Animal proteins ---- Junctophilin-2
Source.1843: DFBPPR12442 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1844: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1
Source.1845: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.1846: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1
Source.1847: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1848: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X
Source.1849: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.1850: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.1851: DFBPPR12528 ---- Animal proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1852: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.1853: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.1854: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.1855: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA
Source.1856: DFBPPR12557 ---- Animal proteins ---- Acrosin
Source.1857: DFBPPR12569 ---- Animal proteins ---- Alveolar macrophage chemotactic factor
Source.1858: DFBPPR12575 ---- Animal proteins ---- CD63 antigen
Source.1859: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.1860: DFBPPR12579 ---- Animal proteins ---- Troponin I, slow skeletal muscle
Source.1861: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.1862: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.1863: DFBPPR12667 ---- Animal proteins ---- Trans-1,2-dihydrobenzene-1,2-diol dehydrogenase
Source.1864: DFBPPR12707 ---- Animal proteins ---- Pro-opiomelanocortin
Source.1865: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.1866: DFBPPR12749 ---- Animal proteins ---- Alcohol dehydrogenase 1
Source.1867: DFBPPR12762 ---- Animal proteins ---- SPARC
Source.1868: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.1869: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.1870: DFBPPR12781 ---- Animal proteins ---- Melanotransferrin
Source.1871: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.1872: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.1873: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.1874: DFBPPR12792 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28
Source.1875: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.1876: DFBPPR12822 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.1877: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.1878: DFBPPR12864 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.1879: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.1880: DFBPPR12875 ---- Animal proteins ---- Fatty acid synthase
Source.1881: DFBPPR12893 ---- Animal proteins ---- Platelet-derived growth factor D
Source.1882: DFBPPR12896 ---- Animal proteins ---- T-lymphocyte activation antigen CD80
Source.1883: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.1884: DFBPPR12926 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 2
Source.1885: DFBPPR12927 ---- Animal proteins ---- Alcohol dehydrogenase class-2 isozyme 1
Source.1886: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.1887: DFBPPR12939 ---- Animal proteins ---- Gastrotropin
Source.1888: DFBPPR12968 ---- Animal proteins ---- Phosphatidylinositol transfer protein alpha isoform
Source.1889: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.1890: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1
Source.1891: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.1892: DFBPPR13019 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B gamma isoform
Source.1893: DFBPPR13024 ---- Animal proteins ---- Erythropoietin
Source.1894: DFBPPR13026 ---- Animal proteins ---- Homeobox expressed in ES cells 1
Source.1895: DFBPPR13032 ---- Animal proteins ---- Alpha-S2-casein-like A
Source.1896: DFBPPR13045 ---- Animal proteins ---- Alpha-S2-casein
Source.1897: DFBPPR13077 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.1898: DFBPPR13096 ---- Animal proteins ---- Ig kappa chain V region 12F2
Source.1899: DFBPPR13104 ---- Animal proteins ---- Ig kappa chain V region 2717
Source.1900: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1901: DFBPPR13118 ---- Animal proteins ---- Ig kappa-B5 chain V region 2699
Source.1902: DFBPPR13138 ---- Animal proteins ---- SNRPN upstream reading frame protein
Source.1903: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1904: DFBPPR13181 ---- Animal proteins ---- Alcohol dehydrogenase E chain
Source.1905: DFBPPR13182 ---- Animal proteins ---- Insulin-like growth factor II
Source.1906: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A
Source.1907: DFBPPR13187 ---- Animal proteins ---- Toll-like receptor 4
Source.1908: DFBPPR13191 ---- Animal proteins ---- Alcohol dehydrogenase class-3
Source.1909: DFBPPR13192 ---- Animal proteins ---- Alcohol dehydrogenase S chain
Source.1910: DFBPPR13202 ---- Animal proteins ---- Aspartate aminotransferase, cytoplasmic
Source.1911: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.1912: DFBPPR13223 ---- Animal proteins ---- Caspase-1
Source.1913: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1
Source.1914: DFBPPR13235 ---- Animal proteins ---- Aldo-keto reductase family 1 member C23-like protein
Source.1915: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.1916: DFBPPR13246 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.1917: DFBPPR13250 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3, truncated
Source.1918: DFBPPR13253 ---- Animal proteins ---- Ribonuclease pancreatic
Source.1919: DFBPPR13266 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1920: DFBPPR13267 ---- Animal proteins ---- Interferon beta
Source.1921: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1
Source.1922: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.1923: DFBPPR13346 ---- Animal proteins ---- Steroidogenic acute regulatory protein, mitochondrial
Source.1924: DFBPPR13347 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.1925: DFBPPR13358 ---- Animal proteins ---- Erythropoietin
Source.1926: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2
Source.1927: DFBPPR13390 ---- Animal proteins ---- C-X-C motif chemokine 6
Source.1928: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1929: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.1930: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1
Source.1931: DFBPPR13442 ---- Animal proteins ---- Microtubule-associated protein tau
Source.1932: DFBPPR13456 ---- Animal proteins ---- Galectin-1
Source.1933: DFBPPR13470 ---- Animal proteins ---- Hemoglobin subunit epsilon-2
Source.1934: DFBPPR13482 ---- Animal proteins ---- N-acetylglucosamine-6-sulfatase
Source.1935: DFBPPR13490 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.1936: DFBPPR13513 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.1937: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.1938: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2
Source.1939: DFBPPR13537 ---- Animal proteins ---- Serine hydroxymethyltransferase, cytosolic
Source.1940: DFBPPR13546 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.1941: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.1942: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.1943: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1944: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.1945: DFBPPR13601 ---- Animal proteins ---- Cathepsin B
Source.1946: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1947: DFBPPR13636 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.1948: DFBPPR13639 ---- Animal proteins ---- Carbonic anhydrase 6
Source.1949: DFBPPR13642 ---- Animal proteins ---- Integrin beta-6
Source.1950: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha
Source.1951: DFBPPR13667 ---- Animal proteins ---- Granulocyte-macrophage colony-stimulating factor
Source.1952: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.1953: DFBPPR13691 ---- Animal proteins ---- Deoxyribonuclease-1
Source.1954: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.1955: DFBPPR13767 ---- Animal proteins ---- Vasopressin V1a receptor
Source.1956: DFBPPR13779 ---- Animal proteins ---- Syntaxin-1B
Source.1957: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1
Source.1958: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor
Source.1959: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa
Source.1960: DFBPPR13892 ---- Animal proteins ---- Melanocortin receptor 5
Source.1961: DFBPPR13925 ---- Animal proteins ---- Homeobox protein BarH-like 2
Source.1962: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.1963: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.1964: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.1965: DFBPPR13979 ---- Animal proteins ---- Putative uncharacterized protein Z
Source.1966: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.1967: DFBPPR14018 ---- Animal proteins ---- Ras-related protein Rap-1b
Source.1968: DFBPPR14019 ---- Animal proteins ---- Vimentin
Source.1969: DFBPPR14075 ---- Marine protein ---- Trypsin-1
Source.1970: DFBPPR14081 ---- Marine protein ---- Beta-enolase
Source.1971: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B
Source.1972: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C
Source.1973: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A
Source.1974: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran
Source.1975: DFBPPR14118 ---- Marine protein ---- Trypsin-2
Source.1976: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.1977: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.1978: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.1979: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.1980: DFBPPR14216 ---- Marine protein ---- Elongation factor Ts, mitochondrial
Source.1981: DFBPPR14245 ---- Marine protein ---- Pro-MCH 1
Source.1982: DFBPPR14318 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.1983: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'
Source.1984: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.1985: DFBPPR14365 ---- Marine protein ---- Phycobiliprotein ApcE
Source.1986: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.1987: DFBPPR14372 ---- Marine protein ---- ATP synthase subunit beta, chloroplastic
Source.1988: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.1989: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.1990: DFBPPR14398 ---- Marine protein ---- 30S ribosomal protein S7, chloroplastic
Source.1991: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic
Source.1992: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.1993: DFBPPR14489 ---- Marine protein ---- Elongation factor Ts, chloroplastic
Source.1994: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621
Source.1995: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.1996: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.1997: DFBPPR14591 ---- Marine protein ---- Vimentin
Source.1998: DFBPPR14593 ---- Marine protein ---- Insulin-like growth factor II
Source.1999: DFBPPR14599 ---- Marine protein ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.2000: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing]
Source.2001: DFBPPR14612 ---- Marine protein ---- Complement component C9
Source.2002: DFBPPR14623 ---- Marine protein ---- DNA nucleotidylexotransferase
Source.2003: DFBPPR14685 ---- Marine protein ---- Pro-MCH 1
Source.2004: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.2005: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13
Source.2006: DFBPPR14727 ---- Marine protein ---- Cytochrome c oxidase polypeptide 4, mitochondrial
Source.2007: DFBPPR14748 ---- Marine protein ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.2008: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.2009: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.2010: DFBPPR14783 ---- Marine protein ---- Enolase
Source.2011: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.2012: DFBPPR14816 ---- Marine protein ---- Digestive cysteine proteinase 3
Source.2013: DFBPPR14854 ---- Marine protein ---- Fucolectin
Source.2014: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1
Source.2015: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1
Source.2016: DFBPPR14882 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit beta
Source.2017: DFBPPR14888 ---- Microorganism protein ---- Serine/threonine-protein kinase STE20
Source.2018: DFBPPR14889 ---- Microorganism protein ---- Glucokinase-1
Source.2019: DFBPPR14893 ---- Microorganism protein ---- ATP-dependent 6-phosphofructokinase subunit alpha
Source.2020: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1
Source.2021: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.2022: DFBPPR14899 ---- Microorganism protein ---- Transcription elongation factor SPT5
Source.2023: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.2024: DFBPPR14917 ---- Microorganism protein ---- Endoplasmic reticulum chaperone BiP
Source.2025: DFBPPR14920 ---- Microorganism protein ---- Ribosome-associated molecular chaperone SSB1
Source.2026: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10
Source.2027: DFBPPR14928 ---- Microorganism protein ---- Adenylosuccinate synthetase
Source.2028: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.2029: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.2030: DFBPPR14971 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP2
Source.2031: DFBPPR14984 ---- Microorganism protein ---- Alpha-1,3/1,6-mannosyltransferase ALG2
Source.2032: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.2033: DFBPPR14998 ---- Microorganism protein ---- Galactokinase
Source.2034: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.2035: DFBPPR15007 ---- Microorganism protein ---- Vacuolar protein 8
Source.2036: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1
Source.2037: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase
Source.2038: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.2039: DFBPPR15045 ---- Microorganism protein ---- Enolase
Source.2040: DFBPPR15056 ---- Microorganism protein ---- RuvB-like helicase 2
Source.2041: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.2042: DFBPPR15062 ---- Microorganism protein ---- Transcription and mRNA export factor SUS1
Source.2043: DFBPPR15066 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.2044: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.2045: DFBPPR15084 ---- Microorganism protein ---- Mannose-1-phosphate guanyltransferase
Source.2046: DFBPPR15090 ---- Microorganism protein ---- Transketolase
Source.2047: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1
Source.2048: DFBPPR15106 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.2049: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase
Source.2050: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.2051: DFBPPR15134 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit A
Source.2052: DFBPPR15145 ---- Microorganism protein ---- Mitochondrial intermembrane space import and assembly protein 40
Source.2053: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.2054: DFBPPR15151 ---- Microorganism protein ---- 2,5-diamino-6-ribosylamino-4(3H)-pyrimidinone 5'-phosphate reductase
Source.2055: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase
Source.2056: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.2057: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.2058: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111
Source.2059: DFBPPR15177 ---- Microorganism protein ---- Exocyst complex component EXO84
Source.2060: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.2061: DFBPPR15190 ---- Microorganism protein ---- Pescadillo homolog
Source.2062: DFBPPR15193 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP9
Source.2063: DFBPPR15195 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP3
Source.2064: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.2065: DFBPPR15207 ---- Microorganism protein ---- Triosephosphate isomerase
Source.2066: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1
Source.2067: DFBPPR15236 ---- Microorganism protein ---- Protein PBN1
Source.2068: DFBPPR15250 ---- Microorganism protein ---- DNA replication regulator SLD2
Source.2069: DFBPPR15254 ---- Microorganism protein ---- D-arabinono-1,4-lactone oxidase
Source.2070: DFBPPR15259 ---- Microorganism protein ---- Guanidinobutyrase
Source.2071: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.2072: DFBPPR15269 ---- Microorganism protein ---- Endoplasmic reticulum vesicle protein 25
Source.2073: DFBPPR15283 ---- Microorganism protein ---- Diphthine methyl ester synthase
Source.2074: DFBPPR15285 ---- Microorganism protein ---- Superoxide dismutase 1 copper chaperone
Source.2075: DFBPPR15319 ---- Microorganism protein ---- Glucose transport transcription regulator RGT1
Source.2076: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.2077: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3
Source.2078: DFBPPR15334 ---- Microorganism protein ---- Probable kinetochore protein NUF2
Source.2079: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.2080: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog
Source.2081: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.2082: DFBPPR15414 ---- Microorganism protein ---- SWI5-dependent HO expression protein 2
Source.2083: DFBPPR15428 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC24
Source.2084: DFBPPR15436 ---- Microorganism protein ---- GTP-binding protein Rho1
Source.2085: DFBPPR15446 ---- Microorganism protein ---- Pre-rRNA-processing protein RIX1
Source.2086: DFBPPR15453 ---- Microorganism protein ---- ATP synthase subunit 5, mitochondrial
Source.2087: DFBPPR15463 ---- Microorganism protein ---- Protein LST4
Source.2088: DFBPPR15466 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor NAR1
Source.2089: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.2090: DFBPPR15473 ---- Microorganism protein ---- Rhomboid protein 2
Source.2091: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.2092: DFBPPR15482 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 44
Source.2093: DFBPPR15483 ---- Microorganism protein ---- Elongation factor 2
Source.2094: DFBPPR15485 ---- Microorganism protein ---- Pre-mRNA-splicing factor PRP46
Source.2095: DFBPPR15555 ---- Microorganism protein ---- Spindle pole body component 110
Source.2096: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.2097: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta
Source.2098: DFBPPR15584 ---- Microorganism protein ---- 40S ribosomal protein S1
Source.2099: DFBPPR15593 ---- Microorganism protein ---- SWR1-complex protein 3
Source.2100: DFBPPR15613 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF2
Source.2101: DFBPPR15652 ---- Microorganism protein ---- Translation machinery-associated protein 22
Source.2102: DFBPPR15704 ---- Microorganism protein ---- Oxidation resistance protein 1
Source.2103: DFBPPR15712 ---- Microorganism protein ---- Survival factor 1
Source.2104: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.2105: DFBPPR15729 ---- Microorganism protein ---- Probable acid phosphatase
Source.2106: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.2107: DFBPPR15738 ---- Microorganism protein ---- Regulator of rDNA transcription 14
Source.2108: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8
Source.2109: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5
Source.2110: DFBPPR15783 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 9
Source.2111: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase
Source.2112: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase
Source.2113: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.2114: DFBPPR15838 ---- Microorganism protein ---- Ubiquinol oxidase subunit 2
Source.2115: DFBPPR15844 ---- Microorganism protein ---- NADP-dependent mannitol dehydrogenase
Source.2116: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2
Source.2117: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.2118: DFBPPR15857 ---- Microorganism protein ---- Laccase-1
Source.2119: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase
Source.2120: DFBPPR15860 ---- Microorganism protein ---- ATP synthase subunit delta, mitochondrial
Source.2121: DFBPPR15881 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase
Source.2122: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.2123: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial
Source.2124: DFBPPR7785 ---- Plant protein ---- Alanine--tRNA ligase, chloroplastic/mitochondrial
Source.2125: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.2126: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.2127: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6
Source.2128: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7
Source.2129: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1
Source.2130: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4
Source.2131: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3
Source.2132: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5
Source.2133: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2
Source.2134: DFBPPR7851 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.2135: DFBPPR7930 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 1, chloroplastic
Source.2136: DFBPPR7931 ---- Plant protein ---- Glucose-1-phosphate adenylyltransferase small subunit 2, chloroplastic
Source.2137: DFBPPR7937 ---- Plant protein ---- Alpha-glucan phosphorylase, H isozyme
Source.2138: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic
Source.2139: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic
Source.2140: DFBPPR7966 ---- Plant protein ---- GTP-binding nuclear protein Ran/TC4
Source.2141: DFBPPR7967 ---- Plant protein ---- Plastocyanin
Source.2142: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B
Source.2143: DFBPPR8002 ---- Plant protein ---- Plastocyanin
Source.2144: DFBPPR8039 ---- Plant protein ---- Linoleate 9S-lipoxygenase
Source.2145: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.2146: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.2147: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.2148: DFBPPR8070 ---- Plant protein ---- Glucan endo-1,3-beta-glucosidase, basic isoform
Source.2149: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.2150: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.2151: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.2152: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.2153: DFBPPR8116 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.2154: DFBPPR8122 ---- Plant protein ---- Arcelin-4
Source.2155: DFBPPR8212 ---- Plant protein ---- Trypsin inhibitor 1
Source.2156: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase
Source.2157: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.2158: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.2159: DFBPPR8263 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.2160: DFBPPR8293 ---- Plant protein ---- ATP synthase subunit a, chloroplastic
Source.2161: DFBPPR8318 ---- Plant protein ---- 17.6 kDa class I heat shock protein
Source.2162: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Taste proterties & Structure
Bitterness
No prediction can be made about the peptide bitterness. prediction
SMILES N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)O
Peptide stability
Peptide stability
Databases Predict tools
DFBP Enzymatic Hydrolysis Prediction Tool (EHR-Tools)
ExPASy PeptideCutter
Cross-references
BIOPEP -
APD -
BioPepDB -
MBPDB -
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214