Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANHY0849(Antihypertensive peptide)

DFBP ID	DFBPANHY0849
Peptide sequence	AEL
Type	Native peptide
Peptide/Function name	Antihypertensive peptide

Function-activity relationship

Main bioactivity	Antihypertensive activity
Otheir bioactivity	ACE-inhibitory activity ^[D1], Multifunctional activity ^[D2]

Calculated physicochemical properties

Three-letter amino acid

Ala-Glu-Leu

Single-letter amino acid

AEL

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	331.36 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

3.34 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

0.7000^c

Hydrophilic residue ratio

66.67%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal
Organism/Source	Short-necked clam (Tapes philippinarum)
Precursor protein	Short-necked clam powder hydrolysates
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0810 ---- Plant proteins ---- APETALA2-like protein 1 Source.2: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1 Source.3: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25 Source.4: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3 Source.5: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4 Source.6: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9 Source.7: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5 Source.8: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6 Source.9: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71 Source.10: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1 Source.11: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.12: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7 Source.13: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13 Source.14: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2 Source.15: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46 Source.16: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2 Source.17: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9 Source.18: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1 Source.19: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1 Source.20: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11 Source.21: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1 Source.22: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1 Source.23: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53 Source.24: DFBPPR0900 ---- Plant proteins ---- GTPase activating protein 1 Source.25: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2 Source.26: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A Source.27: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase Source.28: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog Source.29: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5 Source.30: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6 Source.31: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1 Source.32: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.33: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.34: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1 Source.35: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1 Source.36: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1 Source.37: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC Source.38: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.39: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1 Source.40: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.41: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70 Source.42: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10 Source.43: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2 Source.44: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR Source.45: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1 Source.46: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23 Source.47: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic Source.48: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming] Source.49: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial Source.50: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75 Source.51: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic Source.52: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5 Source.53: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic Source.54: DFBPPR1022 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK3 Source.55: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform Source.56: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic Source.57: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.58: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8 Source.59: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56 Source.60: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12 Source.61: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial Source.62: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2 Source.63: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A Source.64: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6 Source.65: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c Source.66: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1 Source.67: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79 Source.68: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic Source.69: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9 Source.70: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7 Source.71: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51 Source.72: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.73: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1 Source.74: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24 Source.75: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1 Source.76: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic Source.77: DFBPPR1103 ---- Plant proteins ---- Villin-2 Source.78: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10 Source.79: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic Source.80: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2 Source.81: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E Source.82: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4 Source.83: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase Source.84: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic Source.85: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic Source.86: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3 Source.87: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2 Source.88: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2 Source.89: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14 Source.90: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.91: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM Source.92: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic Source.93: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b Source.94: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic Source.95: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4 Source.96: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28 Source.97: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.98: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15 Source.99: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.100: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a Source.101: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO Source.102: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.103: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog Source.104: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.105: DFBPPR1271 ---- Plant proteins ---- CBL-interacting protein kinase 23 Source.106: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3 Source.107: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C Source.108: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming] Source.109: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase Source.110: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D Source.111: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5 Source.112: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5 Source.113: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B Source.114: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic Source.115: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B Source.116: DFBPPR1300 ---- Plant proteins ---- Protein G1 Source.117: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A Source.118: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.119: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.120: DFBPPR1313 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1 Source.121: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.122: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22 Source.123: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic Source.124: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d Source.125: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain Source.126: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2 Source.127: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain Source.128: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1 Source.129: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1 Source.130: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.131: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14 Source.132: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1 Source.133: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3 Source.134: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic Source.135: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F Source.136: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1 Source.137: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4 Source.138: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming] Source.139: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic Source.140: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic Source.141: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5 Source.142: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog Source.143: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase Source.144: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic Source.145: DFBPPR1396 ---- Plant proteins ---- Peroxidase 2 Source.146: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.147: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B Source.148: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.149: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23 Source.150: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1 Source.151: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4 Source.152: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7 Source.153: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1 Source.154: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.155: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4 Source.156: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain Source.157: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic Source.158: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2 Source.159: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29 Source.160: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1 Source.161: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2 Source.162: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1 Source.163: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4 Source.164: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming] Source.165: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3 Source.166: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1 Source.167: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic Source.168: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5 Source.169: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1 Source.170: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A Source.171: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2 Source.172: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1 Source.173: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1 Source.174: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic Source.175: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.176: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase Source.177: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1 Source.178: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2 Source.179: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.180: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic Source.181: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50 Source.182: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.183: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d Source.184: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A Source.185: DFBPPR1513 ---- Plant proteins ---- 14-3-3-like protein GF14-F Source.186: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.187: DFBPPR1515 ---- Plant proteins ---- Serine/threonine-protein kinase Nek3 Source.188: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.189: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3 Source.190: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1 Source.191: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2 Source.192: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1 Source.193: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1 Source.194: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53 Source.195: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic Source.196: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1 Source.197: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase Source.198: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain Source.199: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15 Source.200: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.201: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2 Source.202: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic Source.203: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.204: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1 Source.205: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic Source.206: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1 Source.207: DFBPPR1600 ---- Plant proteins ---- Phytosulfokines 5 Source.208: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.209: DFBPPR1605 ---- Plant proteins ---- Phytochrome B Source.210: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.211: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2 Source.212: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.213: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase Source.214: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.215: DFBPPR1623 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 2, chloroplastic Source.216: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3 Source.217: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4 Source.218: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic Source.219: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.220: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3 Source.221: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1 Source.222: DFBPPR1641 ---- Plant proteins ---- Enolase Source.223: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic Source.224: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain Source.225: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain Source.226: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.227: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1 Source.228: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase Source.229: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10 Source.230: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.231: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.232: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2 Source.233: DFBPPR1687 ---- Plant proteins ---- Transcription factor ILI1 Source.234: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG Source.235: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2 Source.236: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.237: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic Source.238: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a Source.239: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.240: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.241: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase Source.242: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3 Source.243: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1 Source.244: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1 Source.245: DFBPPR1722 ---- Plant proteins ---- Protein TIFY 11a Source.246: DFBPPR1726 ---- Plant proteins ---- SPX domain-containing protein 1 Source.247: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54 Source.248: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.249: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2 Source.250: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1 Source.251: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial Source.252: DFBPPR1754 ---- Plant proteins ---- Transcription factor BHLH094 Source.253: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain Source.254: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4 Source.255: DFBPPR1769 ---- Plant proteins ---- Two-component response regulator ORR3 Source.256: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1 Source.257: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3 Source.258: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial Source.259: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.260: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic Source.261: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4 Source.262: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3 Source.263: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase Source.264: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial Source.265: DFBPPR1810 ---- Plant proteins ---- Shaggy-related protein kinase GSK4 Source.266: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1 Source.267: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7 Source.268: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a Source.269: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3 Source.270: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17 Source.271: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3 Source.272: DFBPPR1841 ---- Plant proteins ---- SPX domain-containing protein 2 Source.273: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17 Source.274: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1 Source.275: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic Source.276: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B Source.277: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D Source.278: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A Source.279: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial Source.280: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5 Source.281: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4 Source.282: DFBPPR1881 ---- Plant proteins ---- Protein TIFY 11d Source.283: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1 Source.284: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2 Source.285: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic Source.286: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic Source.287: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.288: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial Source.289: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A Source.290: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.291: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7 Source.292: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2 Source.293: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3 Source.294: DFBPPR1929 ---- Plant proteins ---- Guanylate kinase 1 Source.295: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.296: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic Source.297: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4 Source.298: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A Source.299: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1 Source.300: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.301: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3 Source.302: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15 Source.303: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A Source.304: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4 Source.305: DFBPPR1988 ---- Plant proteins ---- Protein FLORAL ORGAN NUMBER2 Source.306: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.307: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28 Source.308: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1 Source.309: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase Source.310: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic Source.311: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1 Source.312: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3 Source.313: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B Source.314: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2 Source.315: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1 Source.316: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.317: DFBPPR2052 ---- Plant proteins ---- Laccase-23 Source.318: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.319: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7 Source.320: DFBPPR2070 ---- Plant proteins ---- Calmodulin-1 Source.321: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.322: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic Source.323: DFBPPR2083 ---- Plant proteins ---- Lectin Source.324: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6 Source.325: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial Source.326: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1 Source.327: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.328: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain Source.329: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5 Source.330: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase Source.331: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.332: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6 Source.333: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1 Source.334: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14 Source.335: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2 Source.336: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2 Source.337: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.338: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic Source.339: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3 Source.340: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4 Source.341: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4 Source.342: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial Source.343: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2 Source.344: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11 Source.345: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.346: DFBPPR2173 ---- Plant proteins ---- Cullin-1 Source.347: DFBPPR2179 ---- Plant proteins ---- 14-3-3-like protein GF14-C Source.348: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.349: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2 Source.350: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4 Source.351: DFBPPR2216 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit gamma 1 Source.352: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12 Source.353: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB Source.354: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial Source.355: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1 Source.356: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5 Source.357: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.358: DFBPPR2237 ---- Plant proteins ---- Probable glutathione S-transferase GSTU1 Source.359: DFBPPR2239 ---- Plant proteins ---- Elongation factor 1-alpha Source.360: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1 Source.361: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9 Source.362: DFBPPR2247 ---- Plant proteins ---- Phytochrome C Source.363: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1 Source.364: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.365: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.366: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.367: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3 Source.368: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.369: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1 Source.370: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3 Source.371: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic Source.372: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial Source.373: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4 Source.374: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7 Source.375: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase Source.376: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.377: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain Source.378: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2 Source.379: DFBPPR2325 ---- Plant proteins ---- Peroxiredoxin-2E-2, chloroplastic Source.380: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4 Source.381: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2 Source.382: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5 Source.383: DFBPPR2364 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta Source.384: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5 Source.385: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.386: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase Source.387: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial Source.388: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1 Source.389: DFBPPR2387 ---- Plant proteins ---- Chitinase 8 Source.390: DFBPPR2389 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-1 Source.391: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic Source.392: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22 Source.393: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1 Source.394: DFBPPR2405 ---- Plant proteins ---- Transcription factor BHLH089 Source.395: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6 Source.396: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.397: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28 Source.398: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic Source.399: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1 Source.400: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1 Source.401: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.402: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1 Source.403: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4 Source.404: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9 Source.405: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial Source.406: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase Source.407: DFBPPR2504 ---- Plant proteins ---- 14-3-3-like protein GF14-B Source.408: DFBPPR2508 ---- Plant proteins ---- Transcription factor RF2b Source.409: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22 Source.410: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.411: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3 Source.412: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1 Source.413: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.414: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18 Source.415: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2 Source.416: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1 Source.417: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1 Source.418: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial Source.419: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1 Source.420: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.421: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic Source.422: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal Source.423: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.424: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27 Source.425: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal Source.426: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.427: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b Source.428: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial Source.429: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic Source.430: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic Source.431: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1 Source.432: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10 Source.433: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3 Source.434: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial Source.435: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2 Source.436: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4 Source.437: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.438: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24 Source.439: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.440: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26 Source.441: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b Source.442: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1 Source.443: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2 Source.444: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1 Source.445: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1 Source.446: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog Source.447: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1 Source.448: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18 Source.449: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H Source.450: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11 Source.451: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal Source.452: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.453: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5 Source.454: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.455: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15 Source.456: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25 Source.457: DFBPPR2753 ---- Plant proteins ---- Transportin-1 Source.458: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2 Source.459: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.460: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9 Source.461: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.462: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA Source.463: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22 Source.464: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.465: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA Source.466: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.467: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.468: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like Source.469: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2 Source.470: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.471: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.472: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.473: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.474: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.475: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.476: DFBPPR2847 ---- Plant proteins ---- Glutaredoxin-C4, chloroplastic Source.477: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.478: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9 Source.479: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.480: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase Source.481: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX Source.482: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2 Source.483: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11 Source.484: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27 Source.485: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2 Source.486: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial Source.487: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A Source.488: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic Source.489: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB Source.490: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.491: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.492: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4 Source.493: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1 Source.494: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7 Source.495: DFBPPR2947 ---- Plant proteins ---- Peroxisomal membrane protein 11-5 Source.496: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1 Source.497: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8 Source.498: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1 Source.499: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3 Source.500: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14 Source.501: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4 Source.502: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1 Source.503: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L Source.504: DFBPPR3006 ---- Plant proteins ---- 3'(2'),5'-bisphosphate nucleotidase Source.505: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1 Source.506: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2 Source.507: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1 Source.508: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic Source.509: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase Source.510: DFBPPR3054 ---- Plant proteins ---- Pectinesterase inhibitor 8 Source.511: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2 Source.512: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5 Source.513: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2 Source.514: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic Source.515: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1 Source.516: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.517: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2 Source.518: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1 Source.519: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.520: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic Source.521: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E Source.522: DFBPPR3106 ---- Plant proteins ---- Protein HIRA Source.523: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1 Source.524: DFBPPR3110 ---- Plant proteins ---- Thioredoxin H5 Source.525: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.526: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1 Source.527: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.528: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2 Source.529: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1 Source.530: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.531: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O Source.532: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2 Source.533: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3 Source.534: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.535: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2 Source.536: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5 Source.537: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48 Source.538: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3 Source.539: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3 Source.540: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic Source.541: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3 Source.542: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15 Source.543: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5 Source.544: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1 Source.545: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4 Source.546: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1 Source.547: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic Source.548: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3 Source.549: DFBPPR3225 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit M, chloroplastic Source.550: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1 Source.551: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37 Source.552: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic Source.553: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26 Source.554: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A Source.555: DFBPPR3242 ---- Plant proteins ---- Peroxisomal membrane protein 11-1 Source.556: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B Source.557: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial Source.558: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70 Source.559: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18 Source.560: DFBPPR3266 ---- Plant proteins ---- Protein MOR1 Source.561: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13 Source.562: DFBPPR3270 ---- Plant proteins ---- Calmodulin-like protein 1 Source.563: DFBPPR3276 ---- Plant proteins ---- MADS-box transcription factor 27 Source.564: DFBPPR3296 ---- Plant proteins ---- MADS-box transcription factor 32 Source.565: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4 Source.566: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4 Source.567: DFBPPR3301 ---- Plant proteins ---- 14-3-3-like protein GF14-E Source.568: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2 Source.569: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2 Source.570: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5 Source.571: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.572: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1 Source.573: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10 Source.574: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3 Source.575: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2 Source.576: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8 Source.577: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic Source.578: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2 Source.579: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22 Source.580: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C Source.581: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1 Source.582: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1 Source.583: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1 Source.584: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28 Source.585: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42 Source.586: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14 Source.587: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7 Source.588: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28 Source.589: DFBPPR3393 ---- Plant proteins ---- Auxin-responsive protein IAA20 Source.590: DFBPPR3443 ---- Plant proteins ---- Calmodulin-2 Source.591: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.592: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5 Source.593: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic Source.594: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12 Source.595: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic Source.596: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1 Source.597: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34 Source.598: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27 Source.599: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68 Source.600: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4 Source.601: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3 Source.602: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9 Source.603: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2 Source.604: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P Source.605: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2 Source.606: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N Source.607: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3 Source.608: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic Source.609: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18 Source.610: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4 Source.611: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4 Source.612: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2 Source.613: DFBPPR3543 ---- Plant proteins ---- 26.7 kDa heat shock protein, chloroplastic Source.614: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5 Source.615: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2 Source.616: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61 Source.617: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.618: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3 Source.619: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5 Source.620: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.621: DFBPPR3584 ---- Plant proteins ---- Signal recognition particle 19 kDa protein Source.622: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic Source.623: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2 Source.624: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2 Source.625: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.626: DFBPPR3617 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog Source.627: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3 Source.628: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.629: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5 Source.630: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6 Source.631: DFBPPR3639 ---- Plant proteins ---- Calmodulin-3 Source.632: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3 Source.633: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C Source.634: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3 Source.635: DFBPPR3674 ---- Plant proteins ---- Putative calmodulin-like protein 2 Source.636: DFBPPR3680 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.637: DFBPPR3681 ---- Plant proteins ---- Transcription factor JAMYB Source.638: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5 Source.639: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9 Source.640: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.641: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G Source.642: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5 Source.643: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36 Source.644: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9 Source.645: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1 Source.646: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9 Source.647: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71 Source.648: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1 Source.649: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.650: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2 Source.651: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C Source.652: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3 Source.653: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1 Source.654: DFBPPR3792 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 1 Source.655: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B Source.656: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2 Source.657: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G Source.658: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3 Source.659: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d Source.660: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14 Source.661: DFBPPR3844 ---- Plant proteins ---- Probable protein phosphatase 2C 41 Source.662: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78 Source.663: DFBPPR3860 ---- Plant proteins ---- Probable protein phosphatase 2C 62 Source.664: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1 Source.665: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein Source.666: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5 Source.667: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19 Source.668: DFBPPR3876 ---- Plant proteins ---- Bifunctional nuclease 2 Source.669: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.670: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.671: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8 Source.672: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2 Source.673: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11 Source.674: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1 Source.675: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5 Source.676: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4 Source.677: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.678: DFBPPR3920 ---- Plant proteins ---- Glutaredoxin-C9 Source.679: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1 Source.680: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7 Source.681: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2 Source.682: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2 Source.683: DFBPPR3933 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-2 catalytic subunit Source.684: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4 Source.685: DFBPPR3938 ---- Plant proteins ---- Calmodulin-like protein 3 Source.686: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2 Source.687: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10 Source.688: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog Source.689: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16 Source.690: DFBPPR3955 ---- Plant proteins ---- Cysteine proteinase inhibitor 3 Source.691: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1 Source.692: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7 Source.693: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5 Source.694: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7 Source.695: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3 Source.696: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic Source.697: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4 Source.698: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12 Source.699: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6 Source.700: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5 Source.701: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1 Source.702: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1 Source.703: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31 Source.704: DFBPPR4031 ---- Plant proteins ---- Probable protein phosphatase 2C 27 Source.705: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A Source.706: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase Source.707: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta Source.708: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2 Source.709: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B Source.710: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic Source.711: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F Source.712: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6 Source.713: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3 Source.714: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3 Source.715: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b Source.716: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic Source.717: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2 Source.718: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B Source.719: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4 Source.720: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8 Source.721: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5 Source.722: DFBPPR4098 ---- Plant proteins ---- ESCRT-related protein CHMP1 Source.723: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.724: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2 Source.725: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400 Source.726: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2 Source.727: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33 Source.728: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1 Source.729: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3 Source.730: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5 Source.731: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22 Source.732: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16 Source.733: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1 Source.734: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP Source.735: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6 Source.736: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3 Source.737: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67 Source.738: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3 Source.739: DFBPPR4174 ---- Plant proteins ---- Mitochondrial intermembrane space import and assembly protein 40 homolog Source.740: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1 Source.741: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5 Source.742: DFBPPR4189 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.743: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2 Source.744: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2 Source.745: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C Source.746: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4 Source.747: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial Source.748: DFBPPR4213 ---- Plant proteins ---- Mitochondrial import inner membrane translocase subunit Tim9 Source.749: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic Source.750: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8 Source.751: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22 Source.752: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial Source.753: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic Source.754: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1 Source.755: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14 Source.756: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.757: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE Source.758: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2 Source.759: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3 Source.760: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase Source.761: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1 Source.762: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1 Source.763: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8 Source.764: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2 Source.765: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10 Source.766: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3 Source.767: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3 Source.768: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like Source.769: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1 Source.770: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog Source.771: DFBPPR4318 ---- Plant proteins ---- Golgin-84 Source.772: DFBPPR4322 ---- Plant proteins ---- Microtubule-associated protein 70-3 Source.773: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2 Source.774: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog Source.775: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5 Source.776: DFBPPR4336 ---- Plant proteins ---- Putative cyclin-F3-2 Source.777: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5 Source.778: DFBPPR4343 ---- Plant proteins ---- Transcription factor ILI7 Source.779: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E Source.780: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2 Source.781: DFBPPR4348 ---- Plant proteins ---- Probable calcium-binding protein CML11 Source.782: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1 Source.783: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3 Source.784: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4 Source.785: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic Source.786: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1 Source.787: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2 Source.788: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1 Source.789: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.790: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog Source.791: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog Source.792: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7 Source.793: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4 Source.794: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31 Source.795: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8 Source.796: DFBPPR4409 ---- Plant proteins ---- 14-3-3-like protein GF14-D Source.797: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53 Source.798: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4 Source.799: DFBPPR4416 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 4 Source.800: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.801: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2 Source.802: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP Source.803: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7 Source.804: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B Source.805: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6 Source.806: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1 Source.807: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1 Source.808: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3 Source.809: DFBPPR4461 ---- Plant proteins ---- Probable calcium-binding protein CML18 Source.810: DFBPPR4463 ---- Plant proteins ---- Probable calcium-binding protein CML17 Source.811: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1 Source.812: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2 Source.813: DFBPPR4474 ---- Plant proteins ---- Probable calcium-binding protein CML16 Source.814: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.815: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6 Source.816: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12 Source.817: DFBPPR4482 ---- Plant proteins ---- Probable calcium-binding protein CML30 Source.818: DFBPPR4489 ---- Plant proteins ---- Protein NLP1 Source.819: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1 Source.820: DFBPPR4505 ---- Plant proteins ---- TPD1 protein homolog 1B Source.821: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like Source.822: DFBPPR4518 ---- Plant proteins ---- Probable calcium-binding protein CML14 Source.823: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5 Source.824: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2 Source.825: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3 Source.826: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6 Source.827: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.828: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2 Source.829: DFBPPR4539 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 3 Source.830: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A Source.831: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27 Source.832: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59 Source.833: DFBPPR4547 ---- Plant proteins ---- Probable calcium-binding protein CML31 Source.834: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23 Source.835: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.836: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H Source.837: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1 Source.838: DFBPPR4577 ---- Plant proteins ---- Probable calcium-binding protein CML10 Source.839: DFBPPR4582 ---- Plant proteins ---- Probable calcium-binding protein CML12 Source.840: DFBPPR4583 ---- Plant proteins ---- Probable calcium-binding protein CML15 Source.841: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21 Source.842: DFBPPR4596 ---- Plant proteins ---- Putative calcium-binding protein CML19 Source.843: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39 Source.844: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic Source.845: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1 Source.846: DFBPPR4640 ---- Plant proteins ---- Protein Brevis radix-like 4 Source.847: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5 Source.848: DFBPPR4660 ---- Plant proteins ---- Transcription factor ILI2 Source.849: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2 Source.850: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17 Source.851: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic Source.852: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.853: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19 Source.854: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.855: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8 Source.856: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9 Source.857: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400 Source.858: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18 Source.859: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21 Source.860: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1 Source.861: DFBPPR4764 ---- Plant proteins ---- 14-3-3-like protein GF14-A Source.862: DFBPPR4766 ---- Plant proteins ---- 14-3-3-like protein GF14-G Source.863: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700 Source.864: DFBPPR4789 ---- Plant proteins ---- B3 domain-containing protein Os11g0197600 Source.865: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200 Source.866: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2 Source.867: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000 Source.868: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56 Source.869: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400 Source.870: DFBPPR4860 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600 Source.871: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1 Source.872: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12 Source.873: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.874: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5 Source.875: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10 Source.876: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2 Source.877: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8 Source.878: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.879: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.880: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic Source.881: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23 Source.882: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A Source.883: DFBPPR4967 ---- Plant proteins ---- Beta-amylase Source.884: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.885: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1 Source.886: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A Source.887: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP] Source.888: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit Source.889: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase Source.890: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.891: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic Source.892: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.893: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A Source.894: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.895: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.896: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit Source.897: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.898: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1 Source.899: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic Source.900: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2 Source.901: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2 Source.902: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.903: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B Source.904: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2 Source.905: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1 Source.906: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase Source.907: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1 Source.908: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic Source.909: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.910: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.911: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain Source.912: DFBPPR5080 ---- Plant proteins ---- Phytochrome A Source.913: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain Source.914: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain Source.915: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2 Source.916: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1 Source.917: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase Source.918: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.919: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.920: DFBPPR5133 ---- Plant proteins ---- Elongation factor 1-alpha Source.921: DFBPPR5135 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-2 Source.922: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6 Source.923: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.924: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.925: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.926: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C Source.927: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta Source.928: DFBPPR5206 ---- Plant proteins ---- Calmodulin-2 Source.929: DFBPPR5212 ---- Plant proteins ---- Small ribosomal subunit protein S13, mitochondrial Source.930: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214 Source.931: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3 Source.932: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65 Source.933: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme Source.934: DFBPPR5242 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-1 Source.935: DFBPPR5255 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-B Source.936: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2 Source.937: DFBPPR5266 ---- Plant proteins ---- Cyanate hydratase Source.938: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4 Source.939: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2 Source.940: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8 Source.941: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2 Source.942: DFBPPR5296 ---- Plant proteins ---- 18 kDa seed maturation protein Source.943: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2 Source.944: DFBPPR5307 ---- Plant proteins ---- 4-coumarate--CoA ligase 1 Source.945: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10 Source.946: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6 Source.947: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3 Source.948: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1 Source.949: DFBPPR5353 ---- Plant proteins ---- Small heat shock protein, chloroplastic Source.950: DFBPPR5360 ---- Plant proteins ---- 14-3-3-like protein A Source.951: DFBPPR5361 ---- Plant proteins ---- 14-3-3-like protein B Source.952: DFBPPR5362 ---- Plant proteins ---- 14-3-3-like protein C Source.953: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1 Source.954: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase Source.955: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.956: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.957: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.958: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2 Source.959: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.960: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.961: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.962: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase Source.963: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase Source.964: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.965: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase Source.966: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1 Source.967: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2 Source.968: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic Source.969: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.970: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic Source.971: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2 Source.972: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1 Source.973: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH] Source.974: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic Source.975: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.976: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1 Source.977: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic Source.978: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic Source.979: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9 Source.980: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic Source.981: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase Source.982: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8 Source.983: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1 Source.984: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1 Source.985: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic Source.986: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1 Source.987: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic Source.988: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain Source.989: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.990: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.991: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial Source.992: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase Source.993: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic Source.994: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1 Source.995: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.996: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2 Source.997: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.998: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.999: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic Source.1000: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.1001: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase Source.1002: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic Source.1003: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW Source.1004: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9 Source.1005: DFBPPR5626 ---- Plant proteins ---- Single myb histone 6 Source.1006: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase Source.1007: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase Source.1008: DFBPPR5642 ---- Plant proteins ---- Zeamatin Source.1009: DFBPPR5661 ---- Plant proteins ---- Albumin b-32 Source.1010: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1 Source.1011: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain Source.1012: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2 Source.1013: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.1014: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1 Source.1015: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3 Source.1016: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.1017: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.1018: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic Source.1019: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain Source.1020: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase Source.1021: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3 Source.1022: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain Source.1023: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain Source.1024: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain Source.1025: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain Source.1026: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5 Source.1027: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain Source.1028: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2 Source.1029: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.1030: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.1031: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2 Source.1032: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2 Source.1033: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16 Source.1034: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1 Source.1035: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1036: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase Source.1037: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain Source.1038: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2 Source.1039: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3 Source.1040: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial Source.1041: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase Source.1042: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1 Source.1043: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1044: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1 Source.1045: DFBPPR5822 ---- Plant proteins ---- Elongation factor 1-alpha Source.1046: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2 Source.1047: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3 Source.1048: DFBPPR5845 ---- Plant proteins ---- 14-3-3-like protein GF14-12 Source.1049: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase Source.1050: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.1051: DFBPPR5855 ---- Plant proteins ---- 14-3-3-like protein GF14-6 Source.1052: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1053: DFBPPR5866 ---- Plant proteins ---- Outer plastidial membrane protein porin Source.1054: DFBPPR5878 ---- Plant proteins ---- Ocs element-binding factor 1 Source.1055: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1 Source.1056: DFBPPR5903 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta Source.1057: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2 Source.1058: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4 Source.1059: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4 Source.1060: DFBPPR5945 ---- Plant proteins ---- Calmodulin Source.1061: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2 Source.1062: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1 Source.1063: DFBPPR5975 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.1064: DFBPPR5976 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog Source.1065: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2 Source.1066: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1 Source.1067: DFBPPR5986 ---- Plant proteins ---- Beta-amylase Source.1068: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor Source.1069: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1 Source.1070: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2 Source.1071: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1 Source.1072: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1073: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP) Source.1074: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1 Source.1075: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2 Source.1076: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.1077: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.1078: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1 Source.1079: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2 Source.1080: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1 Source.1081: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein Source.1082: DFBPPR6174 ---- Plant proteins ---- Oil body-associated protein 2A Source.1083: DFBPPR6210 ---- Plant proteins ---- Cysteine synthase Source.1084: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic Source.1085: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic Source.1086: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase Source.1087: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic Source.1088: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial Source.1089: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic Source.1090: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic Source.1091: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic Source.1092: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic Source.1093: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic Source.1094: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic Source.1095: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.1096: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.1097: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial Source.1098: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96 Source.1099: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic Source.1100: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase Source.1101: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic Source.1102: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.1103: DFBPPR6265 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit Source.1104: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit Source.1105: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.1106: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic Source.1107: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic Source.1108: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1109: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic Source.1110: DFBPPR6339 ---- Plant proteins ---- Phytochrome A Source.1111: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic Source.1112: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain Source.1113: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain Source.1114: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain Source.1115: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1116: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.1117: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.1118: DFBPPR6386 ---- Plant proteins ---- ATP synthase subunit delta', mitochondrial Source.1119: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.1120: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.1121: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1122: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic Source.1123: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.1124: DFBPPR6424 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic Source.1125: DFBPPR6429 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic Source.1126: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha Source.1127: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA Source.1128: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.1129: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW Source.1130: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein Source.1131: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2 Source.1132: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1133: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1134: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial Source.1135: DFBPPR6571 ---- Plant proteins ---- Small heat shock protein, chloroplastic Source.1136: DFBPPR6611 ---- Plant proteins ---- 14-3-3-like protein Source.1137: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1138: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.1139: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D Source.1140: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase Source.1141: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic Source.1142: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.1143: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1 Source.1144: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.1145: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic Source.1146: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.1147: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic Source.1148: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B Source.1149: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A Source.1150: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic Source.1151: DFBPPR6705 ---- Plant proteins ---- Calmodulin Source.1152: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain Source.1153: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain Source.1154: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain Source.1155: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain Source.1156: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain Source.1157: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic Source.1158: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase Source.1159: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic Source.1160: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1161: DFBPPR6794 ---- Plant proteins ---- Elongation factor 1-alpha Source.1162: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.1163: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1164: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1165: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17 Source.1166: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1167: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1168: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme Source.1169: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1170: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.1171: DFBPPR6902 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.1172: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1173: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.1174: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin Source.1175: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.1176: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.1177: DFBPPR6953 ---- Plant proteins ---- Small heat shock protein, chloroplastic Source.1178: DFBPPR6982 ---- Plant proteins ---- 60S ribosomal protein L35 Source.1179: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1 Source.1180: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme Source.1181: DFBPPR7013 ---- Plant proteins ---- Protein MLO Source.1182: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.1183: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1 Source.1184: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic Source.1185: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.1186: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1 Source.1187: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic Source.1188: DFBPPR7043 ---- Plant proteins ---- Beta-amylase Source.1189: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd Source.1190: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase Source.1191: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1192: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1193: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.1194: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic Source.1195: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase Source.1196: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.1197: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1198: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1 Source.1199: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2 Source.1200: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3 Source.1201: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial Source.1202: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain Source.1203: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase Source.1204: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1205: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.1206: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1 Source.1207: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1208: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase Source.1209: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.1210: DFBPPR7228 ---- Plant proteins ---- Calmodulin Source.1211: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1 Source.1212: DFBPPR7258 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV90, chloroplastic Source.1213: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic Source.1214: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic Source.1215: DFBPPR7266 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic Source.1216: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1217: DFBPPR7300 ---- Plant proteins ---- 40S ribosomal protein S27 Source.1218: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4 Source.1219: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein Source.1220: DFBPPR7333 ---- Plant proteins ---- C-hordein Source.1221: DFBPPR7334 ---- Plant proteins ---- C-hordein Source.1222: DFBPPR7343 ---- Plant proteins ---- 14-3-3-like protein A Source.1223: DFBPPR7347 ---- Plant proteins ---- 14-3-3-like protein B Source.1224: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic Source.1225: DFBPPR7400 ---- Plant proteins ---- Myrosinase Source.1226: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a Source.1227: DFBPPR7426 ---- Plant proteins ---- Acyl carrier protein, chloroplastic Source.1228: DFBPPR7429 ---- Plant proteins ---- Acyl carrier protein, chloroplastic Source.1229: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412 Source.1230: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405 Source.1231: DFBPPR7435 ---- Plant proteins ---- Acyl carrier protein, chloroplastic Source.1232: DFBPPR7436 ---- Plant proteins ---- Acyl carrier protein, chloroplastic Source.1233: DFBPPR7454 ---- Plant proteins ---- Peptide methionine sulfoxide reductase Source.1234: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic Source.1235: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic Source.1236: DFBPPR7461 ---- Plant proteins ---- Shaggy-related protein kinase theta Source.1237: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.1238: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION Source.1239: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1240: DFBPPR7518 ---- Plant proteins ---- Agamous-like MADS-box protein AGL15 Source.1241: DFBPPR7528 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A catalytic subunit Source.1242: DFBPPR7530 ---- Plant proteins ---- Glycine-rich RNA-binding protein 10 Source.1243: DFBPPR7541 ---- Plant proteins ---- Polcalcin Bra n 1 Source.1244: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.1245: DFBPPR7614 ---- Milk proteins ---- Tenascin Source.1246: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1 Source.1247: DFBPPR7628 ---- Milk proteins ---- Complement C4-A Source.1248: DFBPPR7635 ---- Milk proteins ---- Prosaposin Source.1249: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1 Source.1250: DFBPPR7649 ---- Milk proteins ---- Cadherin-1 Source.1251: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2 Source.1252: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor Source.1253: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin Source.1254: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase Source.1255: DFBPPR7705 ---- Milk proteins ---- Late lactation protein A, LLP-A Source.1256: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase Source.1257: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3 Source.1258: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4 Source.1259: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5 Source.1260: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain Source.1261: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase Source.1262: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic Source.1263: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase Source.1264: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic Source.1265: DFBPPR8428 ---- Plant proteins ---- 11S globulin seed storage protein 2 Source.1266: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1267: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase Source.1268: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase Source.1269: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic Source.1270: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic Source.1271: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1 Source.1272: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase Source.1273: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.1274: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1 Source.1275: DFBPPR15936 ---- Animal proteins ---- Apolipoprotein E Source.1276: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2 Source.1277: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.1278: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id Source.1279: DFBPPR15953 ---- Animal proteins ---- Occludin Source.1280: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase Source.1281: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.1282: DFBPPR15958 ---- Animal proteins ---- Myosin-9 Source.1283: DFBPPR15960 ---- Animal proteins ---- Apolipoprotein A-IV Source.1284: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump Source.1285: DFBPPR15963 ---- Animal proteins ---- Cadherin-1 Source.1286: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1 Source.1287: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.1288: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.1289: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9 Source.1290: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1291: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14 Source.1292: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B Source.1293: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1294: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta Source.1295: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1296: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.1297: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.1298: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1299: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1 Source.1300: DFBPPR16073 ---- Animal proteins ---- Endothelin-1 Source.1301: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein Source.1302: DFBPPR16093 ---- Animal proteins ---- Menin Source.1303: DFBPPR16095 ---- Animal proteins ---- Myosin-7 Source.1304: DFBPPR16102 ---- Animal proteins ---- 40S ribosomal protein S3 Source.1305: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1 Source.1306: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1307: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1 Source.1308: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1309: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.1310: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.1311: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1 Source.1312: DFBPPR16166 ---- Animal proteins ---- Ras-related protein Rab-12 Source.1313: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1 Source.1314: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1315: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.1316: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.1317: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.1318: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.1319: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.1320: DFBPPR16214 ---- Animal proteins ---- Insulin-like growth factor I Source.1321: DFBPPR16216 ---- Animal proteins ---- Troponin I, cardiac muscle Source.1322: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2 Source.1323: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.1324: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2 Source.1325: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D Source.1326: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72 Source.1327: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2 Source.1328: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.1329: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta Source.1330: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type Source.1331: DFBPPR16264 ---- Animal proteins ---- Pancreatic prohormone Source.1332: DFBPPR16265 ---- Animal proteins ---- Caspase-1 Source.1333: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1 Source.1334: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor Source.1335: DFBPPR16282 ---- Animal proteins ---- COMM domain-containing protein 1 Source.1336: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.1337: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain Source.1338: DFBPPR16302 ---- Animal proteins ---- Myosin-2 Source.1339: DFBPPR16307 ---- Animal proteins ---- DNA-binding protein inhibitor ID-3 Source.1340: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein Source.1341: DFBPPR16380 ---- Animal proteins ---- Myosin-8 Source.1342: DFBPPR16418 ---- Animal proteins ---- Myosin-1 Source.1343: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.1344: DFBPPR16437 ---- Animal proteins ---- Myosin-4 Source.1345: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.1346: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2 Source.1347: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1 Source.1348: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.1349: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.1350: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin Source.1351: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B Source.1352: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog Source.1353: DFBPPR16516 ---- Animal proteins ---- Cytospin-A Source.1354: DFBPPR16534 ---- Animal proteins ---- Myoglobin Source.1355: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31 Source.1356: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.1357: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1358: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.1359: DFBPPR16593 ---- Animal proteins ---- Calcyphosin Source.1360: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.1361: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog Source.1362: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.1363: DFBPPR16636 ---- Animal proteins ---- Prefoldin subunit 6 Source.1364: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.1365: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.1366: DFBPPR16651 ---- Animal proteins ---- N-acylglucosamine 2-epimerase Source.1367: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.1368: DFBPPR16655 ---- Animal proteins ---- Somatostatin Source.1369: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5 Source.1370: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.1371: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.1372: DFBPPR16693 ---- Animal proteins ---- Cingulin Source.1373: DFBPPR16698 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-3 Source.1374: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4 Source.1375: DFBPPR16714 ---- Animal proteins ---- Protein fosB Source.1376: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2 Source.1377: DFBPPR16730 ---- Animal proteins ---- RING finger protein 141 Source.1378: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46 Source.1379: DFBPPR16776 ---- Animal proteins ---- Nucleoside diphosphate kinase Source.1380: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.1381: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A Source.1382: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin Source.1383: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.1384: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1 Source.1385: DFBPPR16834 ---- Animal proteins ---- Seminal plasma protein PDC-109 Source.1386: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.1387: DFBPPR16843 ---- Animal proteins ---- Calmodulin Source.1388: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1 Source.1389: DFBPPR16859 ---- Animal proteins ---- Ubiquitin-like protein ISG15 Source.1390: DFBPPR16862 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 Source.1391: DFBPPR16868 ---- Animal proteins ---- Insulin-like growth factor I Source.1392: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.1393: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.1394: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase Source.1395: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.1396: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.1397: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.1398: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53 Source.1399: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4 Source.1400: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase Source.1401: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein Source.1402: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2 Source.1403: DFBPPR17000 ---- Animal proteins ---- Vimentin Source.1404: DFBPPR17010 ---- Animal proteins ---- Sestrin-2 Source.1405: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1 Source.1406: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.1407: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor Source.1408: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1 Source.1409: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.1410: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.1411: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1 Source.1412: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase Source.1413: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin Source.1414: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5 Source.1415: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.1416: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21 Source.1417: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.1418: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36 Source.1419: DFBPPR17090 ---- Animal proteins ---- Phakinin Source.1420: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1 Source.1421: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta Source.1422: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.1423: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1424: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2 Source.1425: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain Source.1426: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1 Source.1427: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1 Source.1428: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.1429: DFBPPR17189 ---- Animal proteins ---- Troponin I, cardiac muscle Source.1430: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial Source.1431: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor Source.1432: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor Source.1433: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35 Source.1434: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D Source.1435: DFBPPR17272 ---- Animal proteins ---- Dysbindin Source.1436: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.1437: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1438: DFBPPR17286 ---- Animal proteins ---- Septin-2 Source.1439: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A Source.1440: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D Source.1441: DFBPPR17294 ---- Animal proteins ---- Ezrin Source.1442: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha Source.1443: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2 Source.1444: DFBPPR17314 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit beta Source.1445: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta Source.1446: DFBPPR17327 ---- Animal proteins ---- Myotubularin Source.1447: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.1448: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase Source.1449: DFBPPR17334 ---- Animal proteins ---- Prohibitin Source.1450: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.1451: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI Source.1452: DFBPPR17341 ---- Animal proteins ---- Radixin Source.1453: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B Source.1454: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.1455: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112 Source.1456: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2 Source.1457: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N Source.1458: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H Source.1459: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.1460: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1 Source.1461: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.1462: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1 Source.1463: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1 Source.1464: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10 Source.1465: DFBPPR17401 ---- Animal proteins ---- Moesin Source.1466: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme Source.1467: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2 Source.1468: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1 Source.1469: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1 Source.1470: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial Source.1471: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit Source.1472: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein Source.1473: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5 Source.1474: DFBPPR17439 ---- Animal proteins ---- Folliculin Source.1475: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1 Source.1476: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1 Source.1477: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.1478: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1 Source.1479: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.1480: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.1481: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N Source.1482: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id Source.1483: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.1484: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.1485: DFBPPR17522 ---- Animal proteins ---- Homer protein homolog 1 Source.1486: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6 Source.1487: DFBPPR17538 ---- Animal proteins ---- Septin-7 Source.1488: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog Source.1489: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA Source.1490: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1 Source.1491: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1 Source.1492: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.1493: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1494: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1 Source.1495: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1496: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta Source.1497: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2 Source.1498: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.1499: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B Source.1500: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.1501: DFBPPR17661 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3 Source.1502: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.1503: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.1504: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase Source.1505: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial Source.1506: DFBPPR17694 ---- Animal proteins ---- Pyridoxal kinase Source.1507: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B Source.1508: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B Source.1509: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1 Source.1510: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A Source.1511: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.1512: DFBPPR17753 ---- Animal proteins ---- Apoptosis-associated speck-like protein containing a CARD Source.1513: DFBPPR17764 ---- Animal proteins ---- L-selectin Source.1514: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5 Source.1515: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V Source.1516: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C Source.1517: DFBPPR17783 ---- Animal proteins ---- 40S ribosomal protein S3 Source.1518: DFBPPR17787 ---- Animal proteins ---- Septin-6 Source.1519: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.1520: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.1521: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.1522: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1 Source.1523: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor Source.1524: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B Source.1525: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.1526: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.1527: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3 Source.1528: DFBPPR17866 ---- Animal proteins ---- PIH1 domain-containing protein 1 Source.1529: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.1530: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.1531: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.1532: DFBPPR17879 ---- Animal proteins ---- Menin Source.1533: DFBPPR17880 ---- Animal proteins ---- Apolipoprotein A-IV Source.1534: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3 Source.1535: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1 Source.1536: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.1537: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.1538: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain Source.1539: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain Source.1540: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A Source.1541: DFBPPR17923 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.1542: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1 Source.1543: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.1544: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1 Source.1545: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2 Source.1546: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.1547: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1 Source.1548: DFBPPR17955 ---- Animal proteins ---- m7GpppX diphosphatase Source.1549: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein Source.1550: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12 Source.1551: DFBPPR17966 ---- Animal proteins ---- Clathrin light chain A Source.1552: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7 Source.1553: DFBPPR17977 ---- Animal proteins ---- Collagenase 3 Source.1554: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN Source.1555: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.1556: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase Source.1557: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.1558: DFBPPR18007 ---- Animal proteins ---- Complement C4 Source.1559: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein Source.1560: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1 Source.1561: DFBPPR18041 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 S Source.1562: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6 Source.1563: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5 Source.1564: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.1565: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.1566: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2 Source.1567: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.1568: DFBPPR18065 ---- Animal proteins ---- Isopentenyl-diphosphate Delta-isomerase 1 Source.1569: DFBPPR18069 ---- Animal proteins ---- Glypican-1 Source.1570: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8 Source.1571: DFBPPR18078 ---- Animal proteins ---- 14-3-3 protein eta Source.1572: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8 Source.1573: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3 Source.1574: DFBPPR18110 ---- Animal proteins ---- Protein inturned Source.1575: DFBPPR18111 ---- Animal proteins ---- Transcriptional adapter 3 Source.1576: DFBPPR18114 ---- Animal proteins ---- Charged multivesicular body protein 4a Source.1577: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15 Source.1578: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7 Source.1579: DFBPPR18150 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 1 Source.1580: DFBPPR18174 ---- Animal proteins ---- Interferon-inducible double-stranded RNA-dependent protein kinase activator A Source.1581: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2 Source.1582: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37 Source.1583: DFBPPR18220 ---- Animal proteins ---- Platelet-activating factor receptor Source.1584: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2 Source.1585: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2 Source.1586: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1 Source.1587: DFBPPR18242 ---- Animal proteins ---- Heparanase Source.1588: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3 Source.1589: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase Source.1590: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.1591: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.1592: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2 Source.1593: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase Source.1594: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56 Source.1595: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20 Source.1596: DFBPPR18290 ---- Animal proteins ---- Cyclin-dependent kinase 10 Source.1597: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C Source.1598: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein Source.1599: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK Source.1600: DFBPPR18325 ---- Animal proteins ---- Tropomyosin alpha-1 chain Source.1601: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon Source.1602: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.1603: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial Source.1604: DFBPPR18335 ---- Animal proteins ---- Septin-11 Source.1605: DFBPPR18337 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 alpha Source.1606: DFBPPR18346 ---- Animal proteins ---- DNA-binding protein inhibitor ID-3 Source.1607: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3 Source.1608: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12 Source.1609: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.1610: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1 Source.1611: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.1612: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3 Source.1613: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6 Source.1614: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa Source.1615: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.1616: DFBPPR18408 ---- Animal proteins ---- 14-3-3 protein beta/alpha Source.1617: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1 Source.1618: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1 Source.1619: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor Source.1620: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.1621: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.1622: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.1623: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin Source.1624: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1 Source.1625: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase Source.1626: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog Source.1627: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22 Source.1628: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3 Source.1629: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1 Source.1630: DFBPPR18459 ---- Animal proteins ---- Transcription factor AP-1 Source.1631: DFBPPR18466 ---- Animal proteins ---- Retinoic acid receptor responder protein 2 Source.1632: DFBPPR18470 ---- Animal proteins ---- Perilipin-5 Source.1633: DFBPPR18475 ---- Animal proteins ---- Myosin-2 Source.1634: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47 Source.1635: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein Source.1636: DFBPPR18497 ---- Animal proteins ---- Synaptobrevin homolog YKT6 Source.1637: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.1638: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.1639: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1 Source.1640: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3 Source.1641: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase Source.1642: DFBPPR18541 ---- Animal proteins ---- Chromatin modification-related protein MEAF6 Source.1643: DFBPPR18556 ---- Animal proteins ---- Transketolase Source.1644: DFBPPR18578 ---- Animal proteins ---- 5-demethoxyubiquinone hydroxylase, mitochondrial Source.1645: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3 Source.1646: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.1647: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit Source.1648: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2 Source.1649: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.1650: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein Source.1651: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1 Source.1652: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.1653: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta Source.1654: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.1655: DFBPPR18641 ---- Animal proteins ---- Cadherin-5 Source.1656: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type Source.1657: DFBPPR18649 ---- Animal proteins ---- 14-3-3 protein zeta/delta Source.1658: DFBPPR18698 ---- Animal proteins ---- ATPase GET3 Source.1659: DFBPPR18702 ---- Animal proteins ---- E3 ubiquitin-protein ligase E3D Source.1660: DFBPPR18720 ---- Animal proteins ---- Protein quaking Source.1661: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.1662: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.1663: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta' Source.1664: DFBPPR18745 ---- Animal proteins ---- Cocaine- and amphetamine-regulated transcript protein Source.1665: DFBPPR18754 ---- Animal proteins ---- Collectin-11 Source.1666: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial Source.1667: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase Source.1668: DFBPPR18766 ---- Animal proteins ---- Negative elongation factor E Source.1669: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.1670: DFBPPR18772 ---- Animal proteins ---- Myosin-7 Source.1671: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3 Source.1672: DFBPPR18799 ---- Animal proteins ---- Myosin-1 Source.1673: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5 Source.1674: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain Source.1675: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4 Source.1676: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.1677: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6 Source.1678: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.1679: DFBPPR18840 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F Source.1680: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.1681: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor Source.1682: DFBPPR18848 ---- Animal proteins ---- Ras-related protein Rab-15 Source.1683: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin Source.1684: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6 Source.1685: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1 Source.1686: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2 Source.1687: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase Source.1688: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.1689: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11 Source.1690: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.1691: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.1692: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8 Source.1693: DFBPPR18933 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.1694: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9 Source.1695: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein Source.1696: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6 Source.1697: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2 Source.1698: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1 Source.1699: DFBPPR18960 ---- Animal proteins ---- Spondin-1 Source.1700: DFBPPR18966 ---- Animal proteins ---- Lupus La protein homolog Source.1701: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1 Source.1702: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.1703: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform Source.1704: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta Source.1705: DFBPPR18993 ---- Animal proteins ---- Dynein regulatory complex protein 1 Source.1706: DFBPPR18997 ---- Animal proteins ---- Striatin-3 Source.1707: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2 Source.1708: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3 Source.1709: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D Source.1710: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11 Source.1711: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic Source.1712: DFBPPR19044 ---- Animal proteins ---- Adenylosuccinate lyase Source.1713: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2 Source.1714: DFBPPR19053 ---- Animal proteins ---- Transmembrane protein 100 Source.1715: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic Source.1716: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E Source.1717: DFBPPR19069 ---- Animal proteins ---- Small glutamine-rich tetratricopeptide repeat-containing protein alpha Source.1718: DFBPPR19076 ---- Animal proteins ---- Protein MGARP Source.1719: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1 Source.1720: DFBPPR19083 ---- Animal proteins ---- UBX domain-containing protein 1 Source.1721: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1 Source.1722: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A Source.1723: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial Source.1724: DFBPPR19105 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein Source.1725: DFBPPR19107 ---- Animal proteins ---- Lymphocyte transmembrane adapter 1 Source.1726: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.1727: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3 Source.1728: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8 Source.1729: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.1730: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like Source.1731: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2 Source.1732: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14 Source.1733: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2 Source.1734: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1 Source.1735: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone Source.1736: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3 Source.1737: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.1738: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4 Source.1739: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2 Source.1740: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5 Source.1741: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial Source.1742: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.1743: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B Source.1744: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6 Source.1745: DFBPPR19237 ---- Animal proteins ---- Cadherin-18 Source.1746: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42 Source.1747: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Source.1748: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog Source.1749: DFBPPR19246 ---- Animal proteins ---- Elongation factor 1-alpha 2 Source.1750: DFBPPR19253 ---- Animal proteins ---- Limbin Source.1751: DFBPPR19254 ---- Animal proteins ---- Periaxin Source.1752: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B Source.1753: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.1754: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1 Source.1755: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial Source.1756: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic Source.1757: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain Source.1758: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.1759: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal Source.1760: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1 Source.1761: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.1762: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.1763: DFBPPR19352 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit GRINL1A Source.1764: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2 Source.1765: DFBPPR19361 ---- Animal proteins ---- Retinol dehydrogenase 14 Source.1766: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog Source.1767: DFBPPR19371 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 1 Source.1768: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor Source.1769: DFBPPR19381 ---- Animal proteins ---- BRCA2 and CDKN1A-interacting protein Source.1770: DFBPPR19396 ---- Animal proteins ---- SAM and SH3 domain-containing protein 3 Source.1771: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein Source.1772: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein Source.1773: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1 Source.1774: DFBPPR19429 ---- Animal proteins ---- Protein Spindly Source.1775: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70 Source.1776: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor Source.1777: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59 Source.1778: DFBPPR19440 ---- Animal proteins ---- Phosphoglycerate mutase 2 Source.1779: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3 Source.1780: DFBPPR19449 ---- Animal proteins ---- SCO-spondin Source.1781: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1 Source.1782: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2 Source.1783: DFBPPR19463 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide VF Source.1784: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase Source.1785: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2 Source.1786: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.1787: DFBPPR19475 ---- Animal proteins ---- Coronin-7 Source.1788: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7 Source.1789: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.1790: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.1791: DFBPPR19482 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2 Source.1792: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13 Source.1793: DFBPPR19486 ---- Animal proteins ---- Probable dimethyladenosine transferase Source.1794: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.1795: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4 Source.1796: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73 Source.1797: DFBPPR19499 ---- Animal proteins ---- Transcription factor MafG Source.1798: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2 Source.1799: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic Source.1800: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Source.1801: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A Source.1802: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B Source.1803: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial Source.1804: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha Source.1805: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase Source.1806: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein Source.1807: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.1808: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial Source.1809: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2 Source.1810: DFBPPR19582 ---- Animal proteins ---- dCTP pyrophosphatase 1 Source.1811: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin Source.1812: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4 Source.1813: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein Source.1814: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4 Source.1815: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase Source.1816: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.1817: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.1818: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5 Source.1819: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2 Source.1820: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta Source.1821: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2 Source.1822: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase Source.1823: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein Source.1824: DFBPPR19648 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit Source.1825: DFBPPR19668 ---- Animal proteins ---- Calicin Source.1826: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein Source.1827: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2 Source.1828: DFBPPR19683 ---- Animal proteins ---- COMM domain-containing protein 1 Source.1829: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.1830: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A Source.1831: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase Source.1832: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule Source.1833: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3 Source.1834: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain Source.1835: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.1836: DFBPPR19709 ---- Animal proteins ---- Centromere protein X Source.1837: DFBPPR19713 ---- Animal proteins ---- Shadow of prion protein Source.1838: DFBPPR19718 ---- Animal proteins ---- Type 2 phosphatidylinositol 4,5-bisphosphate 4-phosphatase Source.1839: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3 Source.1840: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.1841: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon Source.1842: DFBPPR19740 ---- Animal proteins ---- Sin3 histone deacetylase corepressor complex component SDS3 Source.1843: DFBPPR19752 ---- Animal proteins ---- Chromatin target of PRMT1 protein Source.1844: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1 Source.1845: DFBPPR19776 ---- Animal proteins ---- Tropomyosin alpha-3 chain Source.1846: DFBPPR19785 ---- Animal proteins ---- Calcyclin-binding protein Source.1847: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4 Source.1848: DFBPPR19793 ---- Animal proteins ---- Cyclin-F Source.1849: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4 Source.1850: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.1851: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L Source.1852: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.1853: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1 Source.1854: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial Source.1855: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1 Source.1856: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.1857: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain Source.1858: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5 Source.1859: DFBPPR19874 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor B Source.1860: DFBPPR19876 ---- Animal proteins ---- Placenta-expressed transcript 1 protein Source.1861: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.1862: DFBPPR19884 ---- Animal proteins ---- Activator of basal transcription 1 Source.1863: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27 Source.1864: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6 Source.1865: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.1866: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial Source.1867: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18 Source.1868: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase Source.1869: DFBPPR19935 ---- Animal proteins ---- Reticulon-3 Source.1870: DFBPPR19940 ---- Animal proteins ---- Keratin, type II cytoskeletal 78 Source.1871: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40 Source.1872: DFBPPR19949 ---- Animal proteins ---- Syndecan-2 Source.1873: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial Source.1874: DFBPPR19970 ---- Animal proteins ---- 14-3-3 protein gamma Source.1875: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3 Source.1876: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7 Source.1877: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3 Source.1878: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3 Source.1879: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5 Source.1880: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer Source.1881: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2 Source.1882: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1 Source.1883: DFBPPR20058 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2 Source.1884: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5 Source.1885: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2 Source.1886: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1 Source.1887: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1 Source.1888: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.1889: DFBPPR20089 ---- Animal proteins ---- Fascin-2 Source.1890: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase Source.1891: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.1892: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1 Source.1893: DFBPPR20099 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit WDR4 Source.1894: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1 Source.1895: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase Source.1896: DFBPPR20149 ---- Animal proteins ---- Flotillin-2 Source.1897: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.1898: DFBPPR20155 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF181 Source.1899: DFBPPR20161 ---- Animal proteins ---- Calponin-2 Source.1900: DFBPPR20166 ---- Animal proteins ---- Programmed cell death protein 5 Source.1901: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1 Source.1902: DFBPPR20183 ---- Animal proteins ---- Mitochondrial intermembrane space import and assembly protein 40 Source.1903: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase Source.1904: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1 Source.1905: DFBPPR20195 ---- Animal proteins ---- GSK3B-interacting protein Source.1906: DFBPPR20197 ---- Animal proteins ---- Ribonuclease P protein subunit p20 Source.1907: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1 Source.1908: DFBPPR20224 ---- Animal proteins ---- Sclerostin Source.1909: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2 Source.1910: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase Source.1911: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26 Source.1912: DFBPPR20250 ---- Animal proteins ---- General transcription factor IIH subunit 5 Source.1913: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2 Source.1914: DFBPPR20258 ---- Animal proteins ---- Ribosome biogenesis regulatory protein homolog Source.1915: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79 Source.1916: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.1917: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3 Source.1918: DFBPPR20290 ---- Animal proteins ---- Dynein light chain 1, axonemal Source.1919: DFBPPR20305 ---- Animal proteins ---- Nostrin Source.1920: DFBPPR20317 ---- Animal proteins ---- Cadherin-13 Source.1921: DFBPPR20323 ---- Animal proteins ---- Myosin light chain 3 Source.1922: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14 Source.1923: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.1924: DFBPPR20344 ---- Animal proteins ---- Dynactin subunit 2 Source.1925: DFBPPR20354 ---- Animal proteins ---- Single-strand selective monofunctional uracil DNA glycosylase Source.1926: DFBPPR20359 ---- Animal proteins ---- Glutathione S-transferase theta-1 Source.1927: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta Source.1928: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6 Source.1929: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter Source.1930: DFBPPR20388 ---- Animal proteins ---- SOSS complex subunit C Source.1931: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2 Source.1932: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial Source.1933: DFBPPR20399 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC4 Source.1934: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2 Source.1935: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1 Source.1936: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein Source.1937: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3 Source.1938: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase Source.1939: DFBPPR20442 ---- Animal proteins ---- DNA replication complex GINS protein SLD5 Source.1940: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4 Source.1941: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C Source.1942: DFBPPR20468 ---- Animal proteins ---- 28S ribosomal protein S28, mitochondrial Source.1943: DFBPPR20481 ---- Animal proteins ---- Ropporin-1 Source.1944: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10 Source.1945: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein Source.1946: DFBPPR20495 ---- Animal proteins ---- Spliceosome-associated protein CWC15 homolog Source.1947: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein Source.1948: DFBPPR20531 ---- Animal proteins ---- Myozenin-2 Source.1949: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1 Source.1950: DFBPPR20544 ---- Animal proteins ---- 28S ribosomal protein S34, mitochondrial Source.1951: DFBPPR20557 ---- Animal proteins ---- Asporin Source.1952: DFBPPR20560 ---- Animal proteins ---- Draxin Source.1953: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4 Source.1954: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta Source.1955: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related Source.1956: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16 Source.1957: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor Source.1958: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog Source.1959: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase Source.1960: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2 Source.1961: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.1962: DFBPPR20627 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M Source.1963: DFBPPR20652 ---- Animal proteins ---- HAUS augmin-like complex subunit 1 Source.1964: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa Source.1965: DFBPPR20666 ---- Animal proteins ---- Tektin-2 Source.1966: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11 Source.1967: DFBPPR20695 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 28 homolog Source.1968: DFBPPR20702 ---- Animal proteins ---- 5-azacytidine-induced protein 2 Source.1969: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1 Source.1970: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21 Source.1971: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase Source.1972: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206 Source.1973: DFBPPR20743 ---- Animal proteins ---- Myozenin-1 Source.1974: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A Source.1975: DFBPPR20762 ---- Animal proteins ---- Mucosal pentraxin Source.1976: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1 Source.1977: DFBPPR20776 ---- Animal proteins ---- C4b-binding protein beta chain Source.1978: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27 Source.1979: DFBPPR20789 ---- Animal proteins ---- Prefoldin subunit 6 Source.1980: DFBPPR20791 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 13 Source.1981: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation Source.1982: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase Source.1983: DFBPPR20823 ---- Animal proteins ---- Ubiquitin-related modifier 1 Source.1984: DFBPPR20824 ---- Animal proteins ---- CD151 antigen Source.1985: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog Source.1986: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog Source.1987: DFBPPR20856 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim10 Source.1988: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial Source.1989: DFBPPR20860 ---- Animal proteins ---- Vesicle-associated membrane protein 5 Source.1990: DFBPPR20861 ---- Animal proteins ---- Zinc finger protein 135 Source.1991: DFBPPR20883 ---- Animal proteins ---- Pre-mRNA-splicing factor 38A Source.1992: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237 Source.1993: DFBPPR20894 ---- Animal proteins ---- THAP domain-containing protein 11 Source.1994: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16 Source.1995: DFBPPR20899 ---- Animal proteins ---- Centrosomal protein kizuna Source.1996: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein Source.1997: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668 Source.1998: DFBPPR20913 ---- Animal proteins ---- Somatostatin Source.1999: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.2000: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.2001: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4 Source.2002: DFBPPR20942 ---- Animal proteins ---- 45 kDa calcium-binding protein Source.2003: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A Source.2004: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1 Source.2005: DFBPPR20954 ---- Animal proteins ---- Secretagogin Source.2006: DFBPPR20959 ---- Animal proteins ---- Janus kinase and microtubule-interacting protein 1 Source.2007: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta Source.2008: DFBPPR20972 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP11 Source.2009: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.2010: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like Source.2011: DFBPPR20997 ---- Animal proteins ---- Prefoldin subunit 2 Source.2012: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2 Source.2013: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha Source.2014: DFBPPR21003 ---- Animal proteins ---- Protein BCAP Source.2015: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1 Source.2016: DFBPPR21033 ---- Animal proteins ---- 26S proteasome complex subunit SEM1 Source.2017: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21 Source.2018: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10 Source.2019: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28 Source.2020: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5 Source.2021: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C Source.2022: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2 Source.2023: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein Source.2024: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43 Source.2025: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1 Source.2026: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4 Source.2027: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7 Source.2028: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2 Source.2029: DFBPPR21107 ---- Animal proteins ---- Proteasome assembly chaperone 2 Source.2030: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.2031: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16 Source.2032: DFBPPR21121 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-3 Source.2033: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2 Source.2034: DFBPPR21155 ---- Animal proteins ---- Cyclin-H Source.2035: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22 Source.2036: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial Source.2037: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase Source.2038: DFBPPR21180 ---- Animal proteins ---- Golgin subfamily A member 7 Source.2039: DFBPPR21184 ---- Animal proteins ---- Kinetochore protein Spc24 Source.2040: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal Source.2041: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3 Source.2042: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1 Source.2043: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog Source.2044: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2 Source.2045: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2 Source.2046: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase Source.2047: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198 Source.2048: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3 Source.2049: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase Source.2050: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1 Source.2051: DFBPPR21293 ---- Animal proteins ---- IST1 homolog Source.2052: DFBPPR21296 ---- Animal proteins ---- Parathymosin Source.2053: DFBPPR21303 ---- Animal proteins ---- Palmdelphin Source.2054: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.2055: DFBPPR21312 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim8 B Source.2056: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein Source.2057: DFBPPR21315 ---- Animal proteins ---- PCNA-interacting partner Source.2058: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9 Source.2059: DFBPPR21342 ---- Animal proteins ---- G kinase-anchoring protein 1 Source.2060: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151 Source.2061: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3 Source.2062: DFBPPR21358 ---- Animal proteins ---- Myosin light chain 1/3, skeletal muscle isoform Source.2063: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18 Source.2064: DFBPPR21369 ---- Animal proteins ---- Protein MIS12 homolog Source.2065: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2 Source.2066: DFBPPR21377 ---- Animal proteins ---- Hemoglobin subunit mu Source.2067: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B Source.2068: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.2069: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15 Source.2070: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B Source.2071: DFBPPR21397 ---- Animal proteins ---- Leucine zipper transcription factor-like protein 1 Source.2072: DFBPPR21399 ---- Animal proteins ---- Trafficking protein particle complex subunit 6A Source.2073: DFBPPR21401 ---- Animal proteins ---- THAP domain-containing protein 5 Source.2074: DFBPPR21404 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 1 Source.2075: DFBPPR21407 ---- Animal proteins ---- Ribosome biogenesis protein BRX1 homolog Source.2076: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A Source.2077: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C Source.2078: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B Source.2079: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1 Source.2080: DFBPPR21451 ---- Animal proteins ---- Nurim Source.2081: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.2082: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.2083: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3 Source.2084: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4 Source.2085: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein Source.2086: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9 Source.2087: DFBPPR21479 ---- Animal proteins ---- Pentraxin-related protein PTX3 Source.2088: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8 Source.2089: DFBPPR21498 ---- Animal proteins ---- Alanyl-tRNA editing protein Aarsd1 Source.2090: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1 Source.2091: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2 Source.2092: DFBPPR21532 ---- Animal proteins ---- Transmembrane protein 225 Source.2093: DFBPPR21562 ---- Animal proteins ---- COP9 signalosome complex subunit 6 Source.2094: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.2095: DFBPPR21586 ---- Animal proteins ---- Cyclin-C Source.2096: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma Source.2097: DFBPPR21594 ---- Animal proteins ---- SH3 domain-binding protein 5-like Source.2098: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2 Source.2099: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3 Source.2100: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein Source.2101: DFBPPR21666 ---- Animal proteins ---- Importin-13 Source.2102: DFBPPR21689 ---- Animal proteins ---- ADP-ribosylation factor-like protein 11 Source.2103: DFBPPR21691 ---- Animal proteins ---- Protein LRATD1 Source.2104: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic Source.2105: DFBPPR21731 ---- Animal proteins ---- DnaJ homolog subfamily C member 17 Source.2106: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1 Source.2107: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1 Source.2108: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15 Source.2109: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8 Source.2110: DFBPPR21750 ---- Animal proteins ---- 14-3-3 protein theta Source.2111: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1 Source.2112: DFBPPR21763 ---- Animal proteins ---- Protein GOLM2 Source.2113: DFBPPR21768 ---- Animal proteins ---- Tektin-4 Source.2114: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4 Source.2115: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5 Source.2116: DFBPPR21779 ---- Animal proteins ---- Serpin B8 Source.2117: DFBPPR21783 ---- Animal proteins ---- Radial spoke head protein 9 homolog Source.2118: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3 Source.2119: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44 Source.2120: DFBPPR21799 ---- Animal proteins ---- Major vault protein Source.2121: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1 Source.2122: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog Source.2123: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial Source.2124: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein Source.2125: DFBPPR21825 ---- Animal proteins ---- Meiosis-specific nuclear structural protein 1 Source.2126: DFBPPR21826 ---- Animal proteins ---- RING finger protein 141 Source.2127: DFBPPR21828 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 11 Source.2128: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1 Source.2129: DFBPPR21856 ---- Animal proteins ---- Protein FAM32A Source.2130: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog Source.2131: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2 Source.2132: DFBPPR21897 ---- Animal proteins ---- ZW10 interactor Source.2133: DFBPPR21901 ---- Animal proteins ---- Calcyphosin Source.2134: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter Source.2135: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog Source.2136: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5 Source.2137: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein Source.2138: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog Source.2139: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial Source.2140: DFBPPR21968 ---- Animal proteins ---- F-box only protein 28 Source.2141: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1 Source.2142: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein Source.2143: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1 Source.2144: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.2145: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1 Source.2146: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14 Source.2147: DFBPPR22012 ---- Animal proteins ---- GRB2-related adapter protein Source.2148: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein Source.2149: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like Source.2150: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4 Source.2151: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12 Source.2152: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C Source.2153: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6 Source.2154: DFBPPR22066 ---- Animal proteins ---- Pyridoxal phosphate homeostasis protein Source.2155: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1 Source.2156: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5 Source.2157: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9 Source.2158: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512 Source.2159: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor Source.2160: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1 Source.2161: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2 Source.2162: DFBPPR22101 ---- Animal proteins ---- DNA polymerase epsilon subunit 4 Source.2163: DFBPPR22112 ---- Animal proteins ---- DPY30 domain-containing protein 1 Source.2164: DFBPPR22113 ---- Animal proteins ---- DPY30 domain-containing protein 1 Source.2165: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2 Source.2166: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2 Source.2167: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B Source.2168: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein Source.2169: DFBPPR22159 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 24 Source.2170: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245 Source.2171: DFBPPR22165 ---- Animal proteins ---- Coiled-coil domain-containing protein 106 Source.2172: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143 Source.2173: DFBPPR22171 ---- Animal proteins ---- Leucine-rich repeat flightless-interacting protein 2 Source.2174: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6 Source.2175: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial Source.2176: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8 Source.2177: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5 Source.2178: DFBPPR22201 ---- Animal proteins ---- Pleckstrin homology domain-containing family J member 1 Source.2179: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.2180: DFBPPR22209 ---- Animal proteins ---- Transmembrane protein 147 Source.2181: DFBPPR22213 ---- Animal proteins ---- Protein TEX261 Source.2182: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1 Source.2183: DFBPPR22223 ---- Animal proteins ---- Calretinin Source.2184: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36 Source.2185: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.2186: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5 Source.2187: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1 Source.2188: DFBPPR22240 ---- Animal proteins ---- Ataxin-10 Source.2189: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7 Source.2190: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1 Source.2191: DFBPPR22262 ---- Animal proteins ---- Tetraspanin-18 Source.2192: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog Source.2193: DFBPPR22275 ---- Animal proteins ---- 60S ribosomal protein L17 Source.2194: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B Source.2195: DFBPPR22282 ---- Animal proteins ---- Optic atrophy 3 protein homolog Source.2196: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B Source.2197: DFBPPR22291 ---- Animal proteins ---- Keratin-like protein KRT222 Source.2198: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2 Source.2199: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A Source.2200: DFBPPR22322 ---- Animal proteins ---- Testis-specific protein 10-interacting protein Source.2201: DFBPPR22324 ---- Animal proteins ---- Arginine and glutamate-rich protein 1 Source.2202: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2 Source.2203: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.2204: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1 Source.2205: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B Source.2206: DFBPPR22346 ---- Animal proteins ---- FUN14 domain-containing protein 2 Source.2207: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63 Source.2208: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1 Source.2209: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein Source.2210: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal Source.2211: DFBPPR22369 ---- Animal proteins ---- Transmembrane protein 247 Source.2212: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1 Source.2213: DFBPPR22380 ---- Animal proteins ---- G patch domain-containing protein 4 Source.2214: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A Source.2215: DFBPPR22395 ---- Animal proteins ---- UPF0524 protein C3orf70 homolog Source.2216: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9 Source.2217: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog Source.2218: DFBPPR22419 ---- Animal proteins ---- Prolyl-tRNA synthetase associated domain-containing protein 1 Source.2219: DFBPPR22422 ---- Animal proteins ---- UPF0428 protein CXorf56 homolog Source.2220: DFBPPR22431 ---- Animal proteins ---- BolA-like protein 3 Source.2221: DFBPPR22445 ---- Animal proteins ---- Tetratricopeptide repeat protein 1 Source.2222: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2 Source.2223: DFBPPR22448 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 5B Source.2224: DFBPPR22455 ---- Animal proteins ---- Phosducin-like protein 2 Source.2225: DFBPPR22460 ---- Animal proteins ---- Coiled-coil domain-containing protein 149 Source.2226: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein Source.2227: DFBPPR22469 ---- Animal proteins ---- Protein FAM136A Source.2228: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1 Source.2229: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19 Source.2230: DFBPPR22497 ---- Animal proteins ---- Enkurin domain-containing protein 1 Source.2231: DFBPPR22508 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 2 Source.2232: DFBPPR22520 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 2 Source.2233: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8 Source.2234: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2 Source.2235: DFBPPR22559 ---- Animal proteins ---- Vimentin-type intermediate filament-associated coiled-coil protein Source.2236: DFBPPR22560 ---- Animal proteins ---- Mesenteric estrogen-dependent adipogenesis protein Source.2237: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.2238: DFBPPR22575 ---- Animal proteins ---- UPF0687 protein C20orf27 homolog Source.2239: DFBPPR22584 ---- Animal proteins ---- Arginine vasopressin-induced protein 1 Source.2240: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog Source.2241: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19 Source.2242: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13 Source.2243: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.2244: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4 Source.2245: DFBPPR22614 ---- Animal proteins ---- Protein FAM81B Source.2246: DFBPPR22617 ---- Animal proteins ---- SNRPN upstream reading frame protein Source.2247: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72 Source.2248: DFBPPR22629 ---- Animal proteins ---- Coiled-coil domain-containing protein 153 Source.2249: DFBPPR22639 ---- Animal proteins ---- UPF0235 protein C15orf40 homolog Source.2250: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18 Source.2251: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65 Source.2252: DFBPPR22652 ---- Animal proteins ---- PX domain-containing protein 1 Source.2253: DFBPPR22667 ---- Animal proteins ---- Uncharacterized protein C17orf78 homolog Source.2254: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog Source.2255: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C Source.2256: DFBPPR22699 ---- Animal proteins ---- LYR motif-containing protein 9 Source.2257: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog Source.2258: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein Source.2259: DFBPPR22749 ---- Animal proteins ---- Uncharacterized protein C2orf73 homolog Source.2260: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog Source.2261: DFBPPR8531 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.2262: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1 Source.2263: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1 Source.2264: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.2265: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.2266: DFBPPR8565 ---- Animal proteins ---- Villin-1 Source.2267: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1 Source.2268: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.2269: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase Source.2270: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme Source.2271: DFBPPR8596 ---- Animal proteins ---- Gelsolin Source.2272: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.2273: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial Source.2274: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.2275: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.2276: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.2277: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha Source.2278: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5 Source.2279: DFBPPR8639 ---- Animal proteins ---- Mannose-binding protein A Source.2280: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2 Source.2281: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor Source.2282: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A Source.2283: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2284: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase Source.2285: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin Source.2286: DFBPPR8688 ---- Animal proteins ---- Vinculin Source.2287: DFBPPR8700 ---- Animal proteins ---- Endoglin Source.2288: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI Source.2289: DFBPPR8710 ---- Animal proteins ---- Leptin receptor Source.2290: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C Source.2291: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9 Source.2292: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.2293: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.2294: DFBPPR8738 ---- Animal proteins ---- Interleukin-8 Source.2295: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.2296: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.2297: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.2298: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.2299: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2 Source.2300: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.2301: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin Source.2302: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.2303: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial Source.2304: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.2305: DFBPPR8784 ---- Animal proteins ---- Transcription factor AP-1 Source.2306: DFBPPR8785 ---- Animal proteins ---- 40S ribosomal protein S3 Source.2307: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.2308: DFBPPR8806 ---- Animal proteins ---- Cadherin-5 Source.2309: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.2310: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.2311: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.2312: DFBPPR8823 ---- Animal proteins ---- Sodium/potassium ATPase inhibitor SPAI-2 Source.2313: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase Source.2314: DFBPPR8825 ---- Animal proteins ---- Optineurin Source.2315: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1 Source.2316: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial Source.2317: DFBPPR8849 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3 Source.2318: DFBPPR8850 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3 Source.2319: DFBPPR8851 ---- Animal proteins ---- Vimentin Source.2320: DFBPPR8852 ---- Animal proteins ---- Vimentin Source.2321: DFBPPR8854 ---- Animal proteins ---- Vimentin Source.2322: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog Source.2323: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide Source.2324: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.2325: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial Source.2326: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.2327: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor Source.2328: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.2329: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1 Source.2330: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.2331: DFBPPR8969 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha Source.2332: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein Source.2333: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.2334: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4 Source.2335: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein Source.2336: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3 Source.2337: DFBPPR9022 ---- Animal proteins ---- Prothrombin Source.2338: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5 Source.2339: DFBPPR9048 ---- Animal proteins ---- Neuroendocrine protein 7B2 Source.2340: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain Source.2341: DFBPPR9055 ---- Animal proteins ---- Ameloblastin Source.2342: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1 Source.2343: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.2344: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47 Source.2345: DFBPPR9085 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1 Source.2346: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase Source.2347: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2 Source.2348: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.2349: DFBPPR9108 ---- Animal proteins ---- Somatostatin Source.2350: DFBPPR9110 ---- Animal proteins ---- Insulin-like growth factor I Source.2351: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4 Source.2352: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.2353: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.2354: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase Source.2355: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.2356: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.2357: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase Source.2358: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase Source.2359: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein Source.2360: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.2361: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.2362: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6 Source.2363: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10 Source.2364: DFBPPR9236 ---- Animal proteins ---- Radixin Source.2365: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 Source.2366: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B Source.2367: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin Source.2368: DFBPPR9254 ---- Animal proteins ---- Complement factor D Source.2369: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent Source.2370: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial Source.2371: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3 Source.2372: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.2373: DFBPPR9305 ---- Animal proteins ---- Myosin-4 Source.2374: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2 Source.2375: DFBPPR9315 ---- Animal proteins ---- Protein S100-G Source.2376: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26 Source.2377: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase Source.2378: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1 Source.2379: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3 Source.2380: DFBPPR9346 ---- Animal proteins ---- Myozenin-1 Source.2381: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform Source.2382: DFBPPR9352 ---- Animal proteins ---- Tropomyosin alpha-1 chain Source.2383: DFBPPR9363 ---- Animal proteins ---- Moesin Source.2384: DFBPPR9369 ---- Animal proteins ---- Nuclear receptor subfamily 6 group A member 1 Source.2385: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.2386: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.2387: DFBPPR9373 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.2388: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.2389: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1 Source.2390: DFBPPR9395 ---- Animal proteins ---- Calponin-2 Source.2391: DFBPPR9398 ---- Animal proteins ---- Myosin-2 Source.2392: DFBPPR9403 ---- Animal proteins ---- Ras-related protein Rab-34 Source.2393: DFBPPR9405 ---- Animal proteins ---- Myosin-1 Source.2394: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type Source.2395: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type Source.2396: DFBPPR9408 ---- Animal proteins ---- CD70 antigen Source.2397: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1 Source.2398: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.2399: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2 Source.2400: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50 Source.2401: DFBPPR9427 ---- Animal proteins ---- Protein quaking Source.2402: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59 Source.2403: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59 Source.2404: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16 Source.2405: DFBPPR9447 ---- Animal proteins ---- Myosin light chain 4 Source.2406: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3 Source.2407: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain Source.2408: DFBPPR9497 ---- Animal proteins ---- Myoglobin Source.2409: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1 Source.2410: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta Source.2411: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.2412: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.2413: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1 Source.2414: DFBPPR9535 ---- Animal proteins ---- Ribonuclease inhibitor Source.2415: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha Source.2416: DFBPPR9552 ---- Animal proteins ---- Electron transfer flavoprotein subunit beta Source.2417: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2 Source.2418: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked Source.2419: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1 Source.2420: DFBPPR9595 ---- Animal proteins ---- Platelet-activating factor receptor Source.2421: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2 Source.2422: DFBPPR9606 ---- Animal proteins ---- Pancreatic prohormone precursor Source.2423: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.2424: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor Source.2425: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1 Source.2426: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4 Source.2427: DFBPPR9729 ---- Animal proteins ---- Secretagogin Source.2428: DFBPPR9734 ---- Animal proteins ---- Replication termination factor 2 Source.2429: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8 Source.2430: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain Source.2431: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial Source.2432: DFBPPR9751 ---- Animal proteins ---- Perilipin-3 Source.2433: DFBPPR9759 ---- Animal proteins ---- Palmdelphin Source.2434: DFBPPR9801 ---- Animal proteins ---- Tropomyosin alpha-3 chain Source.2435: DFBPPR9808 ---- Animal proteins ---- Epidermal growth factor-like protein 8 Source.2436: DFBPPR9816 ---- Animal proteins ---- Metaxin-2 Source.2437: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62 Source.2438: DFBPPR9821 ---- Animal proteins ---- COP9 signalosome complex subunit 6 Source.2439: DFBPPR9839 ---- Animal proteins ---- Nurim Source.2440: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase Source.2441: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1 Source.2442: DFBPPR9860 ---- Animal proteins ---- Transcription factor 19 Source.2443: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D Source.2444: DFBPPR9898 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial Source.2445: DFBPPR9904 ---- Animal proteins ---- EKC/KEOPS complex subunit GON7 Source.2446: DFBPPR9906 ---- Animal proteins ---- Tetraspanin-9 Source.2447: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.2448: DFBPPR9938 ---- Animal proteins ---- FUN14 domain-containing protein 2 Source.2449: DFBPPR9940 ---- Animal proteins ---- Neuronatin Source.2450: DFBPPR9963 ---- Animal proteins ---- Tropomyosin alpha-1 chain Source.2451: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2452: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2 Source.2453: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.2454: DFBPPR9988 ---- Animal proteins ---- Vinculin Source.2455: DFBPPR9991 ---- Animal proteins ---- Insulin-like growth factor I Source.2456: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.2457: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.2458: DFBPPR10011 ---- Animal proteins ---- Myosin-11 Source.2459: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor Source.2460: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2 Source.2461: DFBPPR10030 ---- Animal proteins ---- Calbindin Source.2462: DFBPPR10033 ---- Animal proteins ---- Apolipoprotein A-I Source.2463: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.2464: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.2465: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta Source.2466: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.2467: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15 Source.2468: DFBPPR10061 ---- Animal proteins ---- Ovocleidin-17 Source.2469: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11 Source.2470: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9 Source.2471: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2472: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor Source.2473: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2 Source.2474: DFBPPR10083 ---- Animal proteins ---- Myosin-9 Source.2475: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial Source.2476: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2 Source.2477: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.2478: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog Source.2479: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor Source.2480: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1 Source.2481: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1 Source.2482: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7 Source.2483: DFBPPR10114 ---- Animal proteins ---- Cadherin-5 Source.2484: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial Source.2485: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.2486: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.2487: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3 Source.2488: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1 Source.2489: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.2490: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein Source.2491: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.2492: DFBPPR10163 ---- Animal proteins ---- Annexin A6 Source.2493: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8 Source.2494: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.2495: DFBPPR10177 ---- Animal proteins ---- Talin-1 Source.2496: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.2497: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1 Source.2498: DFBPPR10183 ---- Animal proteins ---- Villin-1 Source.2499: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia Source.2500: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1 Source.2501: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1 Source.2502: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.2503: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1 Source.2504: DFBPPR10215 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1 Source.2505: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1 Source.2506: DFBPPR10240 ---- Animal proteins ---- Cerberus Source.2507: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein Source.2508: DFBPPR10259 ---- Animal proteins ---- Frizzled-4 Source.2509: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1 Source.2510: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6 Source.2511: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.2512: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.2513: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2514: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6 Source.2515: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.2516: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.2517: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon Source.2518: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.2519: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP Source.2520: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.2521: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1 Source.2522: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.2523: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase Source.2524: DFBPPR10311 ---- Animal proteins ---- Homeobox protein engrailed-2 Source.2525: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1 Source.2526: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3 Source.2527: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK Source.2528: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7 Source.2529: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1 Source.2530: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.2531: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2 Source.2532: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel Source.2533: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA Source.2534: DFBPPR10366 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein Source.2535: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.2536: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial Source.2537: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type Source.2538: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.2539: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65 Source.2540: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9 Source.2541: DFBPPR10401 ---- Animal proteins ---- Heparanase Source.2542: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult Source.2543: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.2544: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.2545: DFBPPR10412 ---- Animal proteins ---- Dysbindin Source.2546: DFBPPR10416 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.2547: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5 Source.2548: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.2549: DFBPPR10424 ---- Animal proteins ---- Charged multivesicular body protein 4b Source.2550: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10 Source.2551: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1 Source.2552: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.2553: DFBPPR10456 ---- Animal proteins ---- Neuroserpin Source.2554: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.2555: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1 Source.2556: DFBPPR10481 ---- Animal proteins ---- Syndecan-3 Source.2557: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1 Source.2558: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase Source.2559: DFBPPR10490 ---- Animal proteins ---- Tudor-interacting repair regulator protein Source.2560: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1 Source.2561: DFBPPR10496 ---- Animal proteins ---- Vascular endothelial growth factor A Source.2562: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4 Source.2563: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.2564: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3 Source.2565: DFBPPR10508 ---- Animal proteins ---- Septin-2 Source.2566: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase Source.2567: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1 Source.2568: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4 Source.2569: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein Source.2570: DFBPPR10540 ---- Animal proteins ---- Nucleoside diphosphate kinase Source.2571: DFBPPR10544 ---- Animal proteins ---- Thioredoxin Source.2572: DFBPPR10546 ---- Animal proteins ---- Calmodulin Source.2573: DFBPPR10552 ---- Animal proteins ---- Transcription factor AP-1 Source.2574: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.2575: DFBPPR10563 ---- Animal proteins ---- Optineurin Source.2576: DFBPPR10567 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial Source.2577: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase Source.2578: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B Source.2579: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial Source.2580: DFBPPR10584 ---- Animal proteins ---- Nuclear distribution protein nudE homolog 1 Source.2581: DFBPPR10588 ---- Animal proteins ---- Myosin-1B Source.2582: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.2583: DFBPPR10590 ---- Animal proteins ---- Centromere protein X Source.2584: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4 Source.2585: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6 Source.2586: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain Source.2587: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8 Source.2588: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain Source.2589: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5 Source.2590: DFBPPR10616 ---- Animal proteins ---- Cholecystokinin Source.2591: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2 Source.2592: DFBPPR10620 ---- Animal proteins ---- Centromere protein T Source.2593: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain Source.2594: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit Source.2595: DFBPPR10629 ---- Animal proteins ---- Hemoglobin subunit alpha-D Source.2596: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.2597: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2 Source.2598: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase Source.2599: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.2600: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.2601: DFBPPR10650 ---- Animal proteins ---- Gelsolin Source.2602: DFBPPR10653 ---- Animal proteins ---- Contactin-1 Source.2603: DFBPPR10654 ---- Animal proteins ---- Fibronectin Source.2604: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain Source.2605: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.2606: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain Source.2607: DFBPPR10670 ---- Animal proteins ---- Interferon lambda-3 Source.2608: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65 Source.2609: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1 Source.2610: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase Source.2611: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.2612: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3 Source.2613: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.2614: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3 Source.2615: DFBPPR10703 ---- Animal proteins ---- Tensin Source.2616: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2 Source.2617: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer Source.2618: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain Source.2619: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2 Source.2620: DFBPPR10709 ---- Animal proteins ---- Docking protein 3 Source.2621: DFBPPR10718 ---- Animal proteins ---- Myosin light chain 1, skeletal muscle isoform Source.2622: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.2623: DFBPPR10726 ---- Animal proteins ---- Ciliary neurotrophic factor Source.2624: DFBPPR10727 ---- Animal proteins ---- Vimentin Source.2625: DFBPPR10728 ---- Animal proteins ---- Myelomonocytic growth factor Source.2626: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.2627: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1 Source.2628: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1 Source.2629: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3 Source.2630: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2 Source.2631: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein Source.2632: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic Source.2633: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain Source.2634: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12 Source.2635: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain Source.2636: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B Source.2637: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V Source.2638: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.2639: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide Source.2640: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha Source.2641: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.2642: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa Source.2643: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog Source.2644: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26 Source.2645: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase Source.2646: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1 Source.2647: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1 Source.2648: DFBPPR10882 ---- Animal proteins ---- Noggin Source.2649: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.2650: DFBPPR10884 ---- Animal proteins ---- Tapasin Source.2651: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1 Source.2652: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain Source.2653: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2 Source.2654: DFBPPR10896 ---- Animal proteins ---- Contactin-5 Source.2655: DFBPPR10903 ---- Animal proteins ---- Myosin light chain 3, skeletal muscle isoform Source.2656: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149 Source.2657: DFBPPR10919 ---- Animal proteins ---- Ski oncogene Source.2658: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2 Source.2659: DFBPPR10927 ---- Animal proteins ---- Frizzled-7 Source.2660: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28 Source.2661: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2 Source.2662: DFBPPR10938 ---- Animal proteins ---- Serine/threonine-protein kinase mos Source.2663: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.2664: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1 Source.2665: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain Source.2666: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1 Source.2667: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2 Source.2668: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor Source.2669: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like Source.2670: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1 Source.2671: DFBPPR10970 ---- Animal proteins ---- Prohibitin Source.2672: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1 Source.2673: DFBPPR10976 ---- Animal proteins ---- Lamin-B2 Source.2674: DFBPPR10981 ---- Animal proteins ---- Kinectin Source.2675: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3 Source.2676: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein Source.2677: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain Source.2678: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D Source.2679: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein Source.2680: DFBPPR11009 ---- Animal proteins ---- Cathelicidin-B1 Source.2681: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein Source.2682: DFBPPR11014 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F Source.2683: DFBPPR11023 ---- Animal proteins ---- 43 kDa receptor-associated protein of the synapse Source.2684: DFBPPR11032 ---- Animal proteins ---- B-cadherin Source.2685: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial Source.2686: DFBPPR11035 ---- Animal proteins ---- Protein Dr1 Source.2687: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2 Source.2688: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.2689: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein Source.2690: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13 Source.2691: DFBPPR11064 ---- Animal proteins ---- General transcription factor IIH subunit 5 Source.2692: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.2693: DFBPPR11073 ---- Animal proteins ---- Axin-1 Source.2694: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1 Source.2695: DFBPPR11079 ---- Animal proteins ---- Frizzled-1 Source.2696: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog Source.2697: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.2698: DFBPPR11094 ---- Animal proteins ---- Transcription factor MafA Source.2699: DFBPPR11095 ---- Animal proteins ---- Ras-related protein Rab-33B Source.2700: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin Source.2701: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2 Source.2702: DFBPPR11112 ---- Animal proteins ---- Protein quaking Source.2703: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin Source.2704: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1 Source.2705: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform Source.2706: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit Source.2707: DFBPPR11133 ---- Animal proteins ---- Transcription factor MafG Source.2708: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1 Source.2709: DFBPPR11141 ---- Animal proteins ---- Serine/threonine-protein kinase ULK3 Source.2710: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1 Source.2711: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7 Source.2712: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B Source.2713: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2 Source.2714: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein Source.2715: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1 Source.2716: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1 Source.2717: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase Source.2718: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.2719: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2 Source.2720: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4 Source.2721: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type Source.2722: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1 Source.2723: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1 Source.2724: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein Source.2725: DFBPPR11219 ---- Animal proteins ---- Cytospin-A Source.2726: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4 Source.2727: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase Source.2728: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.2729: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A Source.2730: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.2731: DFBPPR11254 ---- Animal proteins ---- Intracellular hyaluronan-binding protein 4 Source.2732: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1 Source.2733: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B Source.2734: DFBPPR11264 ---- Animal proteins ---- Charged multivesicular body protein 7 Source.2735: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3 Source.2736: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.2737: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4 Source.2738: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2 Source.2739: DFBPPR11294 ---- Animal proteins ---- Frizzled-8 Source.2740: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2 Source.2741: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1 Source.2742: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14 Source.2743: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1 Source.2744: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog Source.2745: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2 Source.2746: DFBPPR11318 ---- Animal proteins ---- Chromatin modification-related protein MEAF6 Source.2747: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2 Source.2748: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2 Source.2749: DFBPPR11330 ---- Animal proteins ---- Proteasome activator complex subunit 3 Source.2750: DFBPPR11334 ---- Animal proteins ---- Heme oxygenase 1 Source.2751: DFBPPR11335 ---- Animal proteins ---- 14-3-3 protein beta/alpha Source.2752: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.2753: DFBPPR11347 ---- Animal proteins ---- Neogenin Source.2754: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47 Source.2755: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.2756: DFBPPR11369 ---- Animal proteins ---- SAGA-associated factor 29 Source.2757: DFBPPR11376 ---- Animal proteins ---- Lamin-A Source.2758: DFBPPR11377 ---- Animal proteins ---- UBX domain-containing protein 2B Source.2759: DFBPPR11379 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2 Source.2760: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1 Source.2761: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.2762: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2 Source.2763: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner Source.2764: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.2765: DFBPPR11415 ---- Animal proteins ---- Elongation factor Tu, mitochondrial Source.2766: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19 Source.2767: DFBPPR11429 ---- Animal proteins ---- Centrosomal protein 20 Source.2768: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5 Source.2769: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.2770: DFBPPR11455 ---- Animal proteins ---- Growth factor receptor-bound protein 2 Source.2771: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.2772: DFBPPR11472 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein Source.2773: DFBPPR11480 ---- Animal proteins ---- Cytochrome P450 1A2 Source.2774: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3 Source.2775: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase Source.2776: DFBPPR11490 ---- Animal proteins ---- Twinfilin-2 Source.2777: DFBPPR11493 ---- Animal proteins ---- Interferon regulatory factor 1 Source.2778: DFBPPR11495 ---- Animal proteins ---- Calretinin Source.2779: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7 Source.2780: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2 Source.2781: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog Source.2782: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2 Source.2783: DFBPPR11516 ---- Animal proteins ---- Gastrin/cholecystokinin-like peptide Source.2784: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD Source.2785: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1 Source.2786: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.2787: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2 Source.2788: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog Source.2789: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70 Source.2790: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic Source.2791: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein Source.2792: DFBPPR11569 ---- Animal proteins ---- Homeobox protein Hox-D8 Source.2793: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1 Source.2794: DFBPPR11575 ---- Animal proteins ---- Myosin light chain 1, cardiac muscle Source.2795: DFBPPR11577 ---- Animal proteins ---- Vasotocin-neurophysin VT Source.2796: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta Source.2797: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3 Source.2798: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622 Source.2799: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein Source.2800: DFBPPR11593 ---- Animal proteins ---- Syndetin Source.2801: DFBPPR11604 ---- Animal proteins ---- Centromere protein I Source.2802: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B Source.2803: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2 Source.2804: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5 Source.2805: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2 Source.2806: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog Source.2807: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1 Source.2808: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase Source.2809: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog Source.2810: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2 Source.2811: DFBPPR11673 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4 Source.2812: DFBPPR11677 ---- Animal proteins ---- SOSS complex subunit C Source.2813: DFBPPR11679 ---- Animal proteins ---- Spondin-1 Source.2814: DFBPPR11683 ---- Animal proteins ---- Somatostatin Source.2815: DFBPPR11684 ---- Animal proteins ---- 14-3-3 protein theta Source.2816: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog Source.2817: DFBPPR11698 ---- Animal proteins ---- NADH-cytochrome b5 reductase 2 Source.2818: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit Source.2819: DFBPPR11700 ---- Animal proteins ---- Ubiquitin-related modifier 1 Source.2820: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.2821: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7 Source.2822: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.2823: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1 Source.2824: DFBPPR11717 ---- Animal proteins ---- DNA polymerase delta subunit 3 Source.2825: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D Source.2826: DFBPPR11724 ---- Animal proteins ---- Protein TENP Source.2827: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1 Source.2828: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61 Source.2829: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.2830: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa Source.2831: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog Source.2832: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1 Source.2833: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1 Source.2834: DFBPPR11759 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M Source.2835: DFBPPR11762 ---- Animal proteins ---- Trafficking protein particle complex subunit 5 Source.2836: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.2837: DFBPPR11792 ---- Animal proteins ---- Selenoprotein W Source.2838: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog Source.2839: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3 Source.2840: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1 Source.2841: DFBPPR11814 ---- Animal proteins ---- Centromere protein R Source.2842: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1 Source.2843: DFBPPR11846 ---- Animal proteins ---- Golgin subfamily A member 7 Source.2844: DFBPPR11851 ---- Animal proteins ---- Borealin Source.2845: DFBPPR11864 ---- Animal proteins ---- Radixin Source.2846: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2 Source.2847: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog Source.2848: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1 Source.2849: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN Source.2850: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A Source.2851: DFBPPR11911 ---- Animal proteins ---- NmrA-like family domain-containing protein 1 Source.2852: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19 Source.2853: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2 Source.2854: DFBPPR11924 ---- Animal proteins ---- Centromere protein P Source.2855: DFBPPR11928 ---- Animal proteins ---- Cyclin-C Source.2856: DFBPPR11932 ---- Animal proteins ---- 14-3-3 protein zeta Source.2857: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7 Source.2858: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase Source.2859: DFBPPR11940 ---- Animal proteins ---- Calmodulin, striated muscle Source.2860: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A Source.2861: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8 Source.2862: DFBPPR11949 ---- Animal proteins ---- Spindle assembly abnormal protein 6 homolog Source.2863: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2 Source.2864: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2 Source.2865: DFBPPR11959 ---- Animal proteins ---- Deubiquitinase OTUD6B Source.2866: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.2867: DFBPPR11975 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein Source.2868: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1 Source.2869: DFBPPR11983 ---- Animal proteins ---- Tumor protein D53 homolog Source.2870: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3 Source.2871: DFBPPR11999 ---- Animal proteins ---- Dymeclin Source.2872: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal Source.2873: DFBPPR12014 ---- Animal proteins ---- Raftlin Source.2874: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5 Source.2875: DFBPPR12031 ---- Animal proteins ---- Exportin-7 Source.2876: DFBPPR12039 ---- Animal proteins ---- Protein GOLM2 Source.2877: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24 Source.2878: DFBPPR12055 ---- Animal proteins ---- Importin-13 Source.2879: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9 Source.2880: DFBPPR12068 ---- Animal proteins ---- Serine/arginine repetitive matrix protein 1 Source.2881: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7 Source.2882: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237 Source.2883: DFBPPR12071 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1 Source.2884: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein Source.2885: DFBPPR12081 ---- Animal proteins ---- 14-3-3 protein gamma Source.2886: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2 Source.2887: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like Source.2888: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1 Source.2889: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox Source.2890: DFBPPR12110 ---- Animal proteins ---- Myosin light chain, embryonic Source.2891: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21 Source.2892: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19 Source.2893: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93 Source.2894: DFBPPR12149 ---- Animal proteins ---- Major vault protein Source.2895: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.2896: DFBPPR12164 ---- Animal proteins ---- Neo-calmodulin Source.2897: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45 Source.2898: DFBPPR12189 ---- Animal proteins ---- Arginine and glutamate-rich protein 1 Source.2899: DFBPPR12198 ---- Animal proteins ---- RING finger protein 141 Source.2900: DFBPPR12201 ---- Animal proteins ---- Protein lin-52 homolog Source.2901: DFBPPR12207 ---- Animal proteins ---- WD repeat, SAM and U-box domain-containing protein 1 Source.2902: DFBPPR12216 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial Source.2903: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174 Source.2904: DFBPPR12226 ---- Animal proteins ---- Protein DGCR6 Source.2905: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2 Source.2906: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog Source.2907: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.2908: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.2909: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A Source.2910: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1 Source.2911: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1 Source.2912: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.2913: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15 Source.2914: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1 Source.2915: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1 Source.2916: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.2917: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.2918: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2919: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform Source.2920: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.2921: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase Source.2922: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.2923: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit Source.2924: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2 Source.2925: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4 Source.2926: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.2927: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase Source.2928: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1 Source.2929: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump Source.2930: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1 Source.2931: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4 Source.2932: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.2933: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.2934: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.2935: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial Source.2936: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.2937: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein Source.2938: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type Source.2939: DFBPPR12385 ---- Animal proteins ---- Myosin-11 Source.2940: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1 Source.2941: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.2942: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.2943: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.2944: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.2945: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.2946: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.2947: DFBPPR12429 ---- Animal proteins ---- Apolipoprotein A-I Source.2948: DFBPPR12433 ---- Animal proteins ---- Carbonic anhydrase 2 Source.2949: DFBPPR12437 ---- Animal proteins ---- Trehalase Source.2950: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.2951: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein Source.2952: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type Source.2953: DFBPPR12478 ---- Animal proteins ---- Protein phosphatase 1A Source.2954: DFBPPR12483 ---- Animal proteins ---- Elongation factor 1-alpha 2 Source.2955: DFBPPR12484 ---- Animal proteins ---- Myosin-4 Source.2956: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2 Source.2957: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle Source.2958: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.2959: DFBPPR12501 ---- Animal proteins ---- Ezrin Source.2960: DFBPPR12504 ---- Animal proteins ---- Collagenase 3 Source.2961: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3 Source.2962: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.2963: DFBPPR12517 ---- Animal proteins ---- 5-formyltetrahydrofolate cyclo-ligase Source.2964: DFBPPR12523 ---- Animal proteins ---- Tropomyosin alpha-1 chain Source.2965: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.2966: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein Source.2967: DFBPPR12539 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1 Source.2968: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.2969: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.2970: DFBPPR12551 ---- Animal proteins ---- C-reactive protein Source.2971: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor Source.2972: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.2973: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2 Source.2974: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1 Source.2975: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6 Source.2976: DFBPPR12578 ---- Animal proteins ---- Troponin I, cardiac muscle Source.2977: DFBPPR12580 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2 Source.2978: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2 Source.2979: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1 Source.2980: DFBPPR12585 ---- Animal proteins ---- Calmodulin Source.2981: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.2982: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1 Source.2983: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1 Source.2984: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.2985: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.2986: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12 Source.2987: DFBPPR12630 ---- Animal proteins ---- Insulin-like growth factor I Source.2988: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin Source.2989: DFBPPR12681 ---- Animal proteins ---- Myosin-7 Source.2990: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.2991: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform Source.2992: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform Source.2993: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta Source.2994: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.2995: DFBPPR12742 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2 Source.2996: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1 Source.2997: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain Source.2998: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform Source.2999: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3 Source.3000: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor Source.3001: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein Source.3002: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9 Source.3003: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5 Source.3004: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta Source.3005: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor Source.3006: DFBPPR12833 ---- Animal proteins ---- Cullin-5 Source.3007: DFBPPR12853 ---- Animal proteins ---- Insulin Source.3008: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.3009: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B Source.3010: DFBPPR12880 ---- Animal proteins ---- Corticostatin 1 Source.3011: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16 Source.3012: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14 Source.3013: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13 Source.3014: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2 Source.3015: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial Source.3016: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1 Source.3017: DFBPPR12918 ---- Animal proteins ---- Myosin heavy chain, embryonic smooth muscle isoform Source.3018: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11 Source.3019: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1 Source.3020: DFBPPR12950 ---- Animal proteins ---- Vitamin D-binding protein Source.3021: DFBPPR12954 ---- Animal proteins ---- Apolipoprotein B Source.3022: DFBPPR12959 ---- Animal proteins ---- Keratin, type I cytoskeletal 12 Source.3023: DFBPPR12964 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-5 Source.3024: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1 Source.3025: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform Source.3026: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1 Source.3027: DFBPPR12981 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-4 Source.3028: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.3029: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1 Source.3030: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.3031: DFBPPR13080 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.3032: DFBPPR13089 ---- Animal proteins ---- 14-3-3 protein theta Source.3033: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.3034: DFBPPR13094 ---- Animal proteins ---- Atherin Source.3035: DFBPPR13138 ---- Animal proteins ---- SNRPN upstream reading frame protein Source.3036: DFBPPR13139 ---- Animal proteins ---- Ig kappa chain b5 variant C region Source.3037: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.3038: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.3039: DFBPPR13170 ---- Animal proteins ---- Carbonic anhydrase 1 Source.3040: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.3041: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.3042: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A Source.3043: DFBPPR13195 ---- Animal proteins ---- Albumin Source.3044: DFBPPR13205 ---- Animal proteins ---- Collagenase 3 Source.3045: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase Source.3046: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3 Source.3047: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.3048: DFBPPR13229 ---- Animal proteins ---- Gelsolin Source.3049: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3 Source.3050: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2 Source.3051: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.3052: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.3053: DFBPPR13250 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3, truncated Source.3054: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.3055: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1 Source.3056: DFBPPR13276 ---- Animal proteins ---- Protein quaking Source.3057: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.3058: DFBPPR13284 ---- Animal proteins ---- Interleukin-8 Source.3059: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor Source.3060: DFBPPR13291 ---- Animal proteins ---- Myosin-7 Source.3061: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2 Source.3062: DFBPPR13301 ---- Animal proteins ---- Protein S100-A6 Source.3063: DFBPPR13313 ---- Animal proteins ---- Insulin-like growth factor I Source.3064: DFBPPR13314 ---- Animal proteins ---- Myosin-1 Source.3065: DFBPPR13315 ---- Animal proteins ---- Ski oncogene Source.3066: DFBPPR13317 ---- Animal proteins ---- Myosin-2 Source.3067: DFBPPR13323 ---- Animal proteins ---- Myoglobin Source.3068: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha Source.3069: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.3070: DFBPPR13436 ---- Animal proteins ---- Transmembrane protein 147 Source.3071: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.3072: DFBPPR13447 ---- Animal proteins ---- Insulin-like growth factor I Source.3073: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.3074: DFBPPR13453 ---- Animal proteins ---- Hemoglobin subunit beta-C Source.3075: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2 Source.3076: DFBPPR13502 ---- Animal proteins ---- 45 kDa calcium-binding protein Source.3077: DFBPPR13504 ---- Animal proteins ---- Platelet-activating factor receptor Source.3078: DFBPPR13505 ---- Animal proteins ---- Spectrin beta chain, non-erythrocytic 1 Source.3079: DFBPPR13506 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.3080: DFBPPR13513 ---- Animal proteins ---- Ubiquitin-related modifier 1 Source.3081: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin Source.3082: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.3083: DFBPPR13542 ---- Animal proteins ---- Pyridoxal kinase Source.3084: DFBPPR13546 ---- Animal proteins ---- Platelet-derived growth factor subunit B Source.3085: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.3086: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1 Source.3087: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.3088: DFBPPR13564 ---- Animal proteins ---- Calmodulin Source.3089: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.3090: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein Source.3091: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9 Source.3092: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53 Source.3093: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.3094: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.3095: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.3096: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2 Source.3097: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle Source.3098: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.3099: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta Source.3100: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1 Source.3101: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial Source.3102: DFBPPR13673 ---- Animal proteins ---- Insulin-like growth factor I Source.3103: DFBPPR13686 ---- Animal proteins ---- Vimentin Source.3104: DFBPPR13697 ---- Animal proteins ---- Carbonic anhydrase 1 Source.3105: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.3106: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.3107: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5 Source.3108: DFBPPR13734 ---- Animal proteins ---- Perilipin-5 Source.3109: DFBPPR13747 ---- Animal proteins ---- 14-3-3 protein beta/alpha Source.3110: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2 Source.3111: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial Source.3112: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon Source.3113: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3 Source.3114: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.3115: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1 Source.3116: DFBPPR13802 ---- Animal proteins ---- Pancreatic prohormone Source.3117: DFBPPR13803 ---- Animal proteins ---- 14-3-3 protein zeta/delta Source.3118: DFBPPR13811 ---- Animal proteins ---- 14-3-3 protein gamma Source.3119: DFBPPR13814 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide VF Source.3120: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1 Source.3121: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3 Source.3122: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa Source.3123: DFBPPR13861 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1 Source.3124: DFBPPR13863 ---- Animal proteins ---- Granulocyte colony-stimulating factor Source.3125: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1 Source.3126: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein Source.3127: DFBPPR13896 ---- Animal proteins ---- Somatostatin Source.3128: DFBPPR13907 ---- Animal proteins ---- Shadow of prion protein Source.3129: DFBPPR13908 ---- Animal proteins ---- Shadow of prion protein Source.3130: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein Source.3131: DFBPPR13939 ---- Animal proteins ---- T-cell surface glycoprotein CD4 Source.3132: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.3133: DFBPPR13953 ---- Animal proteins ---- Tetraspanin-9 Source.3134: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5 Source.3135: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein Source.3136: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B Source.3137: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A Source.3138: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1 Source.3139: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle Source.3140: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial Source.3141: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein Source.3142: DFBPPR14019 ---- Animal proteins ---- Vimentin Source.3143: DFBPPR14046 ---- Animal proteins ---- Myoglobin Source.3144: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos Source.3145: DFBPPR14052 ---- Animal proteins ---- Insulin-like growth factor I, adult form Source.3146: DFBPPR14055 ---- Animal proteins ---- Insulin-like growth factor I, juvenile form Source.3147: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.3148: DFBPPR14087 ---- Marine protein ---- Lissencephaly-1 homolog A Source.3149: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B Source.3150: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1 Source.3151: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183 Source.3152: DFBPPR14123 ---- Marine protein ---- Albumin 1 Source.3153: DFBPPR14124 ---- Marine protein ---- Albumin 2 Source.3154: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.3155: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8 Source.3156: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I Source.3157: DFBPPR14170 ---- Marine protein ---- SOSS complex subunit C Source.3158: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein Source.3159: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein Source.3160: DFBPPR14210 ---- Marine protein ---- Tetraspanin-9 Source.3161: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1 Source.3162: DFBPPR14257 ---- Marine protein ---- Somatolactin Source.3163: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.3164: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE Source.3165: DFBPPR14313 ---- Marine protein ---- Photosystem I reaction center subunit PsaK Source.3166: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B Source.3167: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.3168: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N Source.3169: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain Source.3170: DFBPPR14354 ---- Marine protein ---- Cytochrome c-550 Source.3171: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha Source.3172: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.3173: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain Source.3174: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.3175: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta Source.3176: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta Source.3177: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog Source.3178: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha Source.3179: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic Source.3180: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic Source.3181: DFBPPR14458 ---- Marine protein ---- 50S ribosomal protein L12, chloroplastic Source.3182: DFBPPR14460 ---- Marine protein ---- Probable 30S ribosomal protein 3, chloroplastic Source.3183: DFBPPR14487 ---- Marine protein ---- Chloroplast envelope membrane protein Source.3184: DFBPPR14495 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic Source.3185: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39 Source.3186: DFBPPR14525 ---- Marine protein ---- Uncharacterized protein ycf55 Source.3187: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator Source.3188: DFBPPR14545 ---- Marine protein ---- Ghrelin Source.3189: DFBPPR14547 ---- Marine protein ---- Interleukin-6 Source.3190: DFBPPR14555 ---- Marine protein ---- Vitellogenin Source.3191: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.3192: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1 Source.3193: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1 Source.3194: DFBPPR14583 ---- Marine protein ---- Insulin-like growth factor I Source.3195: DFBPPR14591 ---- Marine protein ---- Vimentin Source.3196: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b Source.3197: DFBPPR14600 ---- Marine protein ---- Transforming growth factor beta-1 proprotein Source.3198: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1 Source.3199: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1 Source.3200: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a Source.3201: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3 Source.3202: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain Source.3203: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein Source.3204: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2 Source.3205: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13 Source.3206: DFBPPR14706 ---- Marine protein ---- 14-3-3 protein beta/alpha-1 Source.3207: DFBPPR14707 ---- Marine protein ---- 14-3-3 protein beta/alpha-2 Source.3208: DFBPPR14709 ---- Marine protein ---- Protein lin-52 homolog Source.3209: DFBPPR14711 ---- Marine protein ---- UI Source.3210: DFBPPR14714 ---- Marine protein ---- 14-3-3 protein gamma-2 Source.3211: DFBPPR14715 ---- Marine protein ---- 14-3-3 protein gamma-1 Source.3212: DFBPPR14716 ---- Marine protein ---- Secreted phosphoprotein 24 Source.3213: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1 Source.3214: DFBPPR14783 ---- Marine protein ---- Enolase Source.3215: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.3216: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain Source.3217: DFBPPR14832 ---- Marine protein ---- Troponin C, isoform 2B Source.3218: DFBPPR14853 ---- Marine protein ---- Sarcoplasmic calcium-binding protein 1 Source.3219: DFBPPR14860 ---- Marine protein ---- Thyrotropin subunit beta Source.3220: DFBPPR14873 ---- Marine protein ---- Somatolactin Source.3221: DFBPPR14876 ---- Microorganism protein ---- Hexokinase Source.3222: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide Source.3223: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3 Source.3224: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.3225: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80 Source.3226: DFBPPR14897 ---- Microorganism protein ---- Calmodulin Source.3227: DFBPPR14898 ---- Microorganism protein ---- Transcription factor IIIB 70 kDa subunit Source.3228: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.3229: DFBPPR14904 ---- Microorganism protein ---- Myosin-1 Source.3230: DFBPPR14908 ---- Microorganism protein ---- Flap endonuclease 1 Source.3231: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific Source.3232: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific Source.3233: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1 Source.3234: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase Source.3235: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4 Source.3236: DFBPPR14942 ---- Microorganism protein ---- Transcription initiation factor IIB Source.3237: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4 Source.3238: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1 Source.3239: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1 Source.3240: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15 Source.3241: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase Source.3242: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial Source.3243: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial Source.3244: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2 Source.3245: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3 Source.3246: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.3247: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.3248: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1 Source.3249: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1 Source.3250: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2 Source.3251: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1 Source.3252: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate) Source.3253: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase Source.3254: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1 Source.3255: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7 Source.3256: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2 Source.3257: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1 Source.3258: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9 Source.3259: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B Source.3260: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1 Source.3261: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4 Source.3262: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11 Source.3263: DFBPPR15080 ---- Microorganism protein ---- Dimethyladenosine transferase Source.3264: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13 Source.3265: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A Source.3266: DFBPPR15103 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein END3 Source.3267: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.3268: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase Source.3269: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1 Source.3270: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2 Source.3271: DFBPPR15148 ---- Microorganism protein ---- Riboflavin kinase Source.3272: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2 Source.3273: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2 Source.3274: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3 Source.3275: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase Source.3276: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3 Source.3277: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3 Source.3278: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23 Source.3279: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase Source.3280: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60 Source.3281: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1 Source.3282: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8 Source.3283: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10 Source.3284: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20 Source.3285: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1 Source.3286: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1 Source.3287: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1 Source.3288: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2 Source.3289: DFBPPR15282 ---- Microorganism protein ---- Peroxisomal biogenesis factor 3 Source.3290: DFBPPR15309 ---- Microorganism protein ---- Respiratory supercomplex factor 1, mitochondrial Source.3291: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase Source.3292: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial Source.3293: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10 Source.3294: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10 Source.3295: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2 Source.3296: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18 Source.3297: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial Source.3298: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31 Source.3299: DFBPPR15353 ---- Microorganism protein ---- Pre-mRNA-splicing factor ISY1 Source.3300: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B Source.3301: DFBPPR15382 ---- Microorganism protein ---- Sensitive to high expression protein 9 homolog, mitochondrial Source.3302: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1 Source.3303: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase Source.3304: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1 Source.3305: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41 Source.3306: DFBPPR15404 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM10 Source.3307: DFBPPR15430 ---- Microorganism protein ---- Exportin-T Source.3308: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101 Source.3309: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase Source.3310: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6 Source.3311: DFBPPR15461 ---- Microorganism protein ---- EKC/KEOPS complex subunit CGI121 Source.3312: DFBPPR15462 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM21 Source.3313: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10 Source.3314: DFBPPR15478 ---- Microorganism protein ---- COP9 signalosome complex subunit 9 Source.3315: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP) Source.3316: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1 Source.3317: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1 Source.3318: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1 Source.3319: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54 Source.3320: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1 Source.3321: DFBPPR15521 ---- Microorganism protein ---- rRNA-processing protein EFG1 Source.3322: DFBPPR15531 ---- Microorganism protein ---- DNA replication complex GINS protein SLD5 Source.3323: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.3324: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1 Source.3325: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13 Source.3326: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32 Source.3327: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6 Source.3328: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9 Source.3329: DFBPPR15596 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit BLS1 Source.3330: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1 Source.3331: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase Source.3332: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1 Source.3333: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1 Source.3334: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4 Source.3335: DFBPPR15642 ---- Microorganism protein ---- Spindle pole component 29 Source.3336: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit Source.3337: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1 Source.3338: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2 Source.3339: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8 Source.3340: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5 Source.3341: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1 Source.3342: DFBPPR15720 ---- Microorganism protein ---- Protein BFR2 Source.3343: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2 Source.3344: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5 Source.3345: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21 Source.3346: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1 Source.3347: DFBPPR15744 ---- Microorganism protein ---- Peroxisomal membrane protein PEX21 Source.3348: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8 Source.3349: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1 Source.3350: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5 Source.3351: DFBPPR15771 ---- Microorganism protein ---- Required for respiratory growth protein 1, mitochondrial Source.3352: DFBPPR15773 ---- Microorganism protein ---- 37S ribosomal protein S25, mitochondrial Source.3353: DFBPPR15775 ---- Microorganism protein ---- Increased recombination centers protein 6 Source.3354: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3 Source.3355: DFBPPR15789 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 4 Source.3356: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.3357: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.3358: DFBPPR15809 ---- Microorganism protein ---- PTS system sorbose-specific EIIA component Source.3359: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase Source.3360: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase Source.3361: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain Source.3362: DFBPPR15840 ---- Microorganism protein ---- Protein RecA Source.3363: DFBPPR15845 ---- Microorganism protein ---- Calmodulin Source.3364: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1 Source.3365: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.3366: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase Source.3367: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase Source.3368: DFBPPR15869 ---- Microorganism protein ---- Phenylalanine ammonia-lyase Source.3369: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase Source.3370: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain Source.3371: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain Source.3372: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase Source.3373: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic Source.3374: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic Source.3375: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3 Source.3376: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain Source.3377: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase Source.3378: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.3379: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase Source.3380: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1 Source.3381: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic Source.3382: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase Source.3383: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial Source.3384: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.3385: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.3386: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic Source.3387: DFBPPR7802 ---- Plant protein ---- Phytochrome B Source.3388: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2 Source.3389: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.3390: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.3391: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3392: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.3393: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial Source.3394: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1 Source.3395: DFBPPR7864 ---- Plant protein ---- ATP synthase epsilon chain, chloroplastic Source.3396: DFBPPR7891 ---- Plant protein ---- CASP-like protein 1B1 Source.3397: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1 Source.3398: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4 Source.3399: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2 Source.3400: DFBPPR7909 ---- Plant protein ---- CASP-like protein 2D1 Source.3401: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase Source.3402: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic Source.3403: DFBPPR7936 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase, chloroplastic Source.3404: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha Source.3405: DFBPPR7983 ---- Plant protein ---- 14-3-3-like protein B Source.3406: DFBPPR7984 ---- Plant protein ---- 14-3-3-like protein A Source.3407: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase Source.3408: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1 Source.3409: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type Source.3410: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme Source.3411: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type Source.3412: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.3413: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.3414: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.3415: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.3416: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'' Source.3417: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic Source.3418: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.3419: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1 Source.3420: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme Source.3421: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase Source.3422: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial Source.3423: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase Source.3424: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase Source.3425: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1 Source.3426: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2 Source.3427: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial Source.3428: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.3429: DFBPPR8284 ---- Plant protein ---- Calmodulin Source.3430: DFBPPR8304 ---- Plant protein ---- Protein TIC 214 Source.3431: DFBPPR8335 ---- Plant protein ---- Photosystem I assembly protein Ycf4 Source.3432: DFBPPR8355 ---- Plant protein ---- 14-3-3-like protein
Link-research Inductive analysis	Link 1: DFBPANHY0446----Chlorella vulgaris and Spirulina platensis----Microalgae powder hydrolysates

Biological/Functional activity & target protein

Antihypertensive activity

The antihypertensive activity of each peptidic fraction obtained from the pearl oysters was evaluated by measuring the change in SBP at 1h, 2h, 3h, 4h, and 6h after oral administration. Systolic blood pressure did not change in the control rats during the experimental period (6 h). Captopril (10 mg/kg) lowered SBP significantly from 1 h to 4 h after administration of the drug. A single dose of the peptidic fraction from the short-necked clam reduced SBP significantly by 42.2 mmHg at 2 h, and this antihypertensive effect continued for 4 h after administration. The ACE-inhibitory peptide AEL was isolated from the highest active fraction, so the peptide was a potential antihypertensive peptide.

Specific target protein(s)

N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Non-bitter taste ^prediction

SMILES

N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	Hydrolysis with pepsin (Porcine tomach mucosa; Wako Pure Chemicals, Osaka, Japan).

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	No measured
Prediction:	ToxinPred

Additional information

The purified peptide AEL is a possible candidate for application as a dietary supplement or as a component of a functional food product.

Database cross-references

DFBP

[D1]	DFBPACEI1184, DFBPACEI1514
[D2]	DFBPMUFU0240

[D3]

[D4]

[D5]

[D6]

Reference(s)

Primary literature	Suetsuna, K. Identification of antihypertensive peptides from peptic digest of the short-necked clam Tapes philippinarum and the pearl oyster Pinctada fucata martensii. Fisheries Science. 2002, 68, 233-5. DOI: 10.1046/j.1444-2906.2002.00415.x
Other literature(s)	N.D
PubDate	2002