Peptide properties

1Top 2Function-activity relationship 3Calculated physicochemical properties 4Peptide source & Food-borne protein(s) search 5Biological/Functional activity & target protein 6Taste properties & Structure 7Preparation method 8Stability & Cytotoxicity 9Additional information 10Database cross-references 11Reference(s)

List of peptide properties

DFBP ID - DFBPANOX0305(Antioxidative peptide)

DFBP ID	DFBPANOX0305
Peptide sequence	MY
Type	Native peptide
Peptide/Function name	Antioxidative peptide

Function-activity relationship

Main bioactivity	Antioxidative activity
Otheir bioactivity	ACE-inhibitory activity ^[D1], Multifunctional activity ^[D2]

Calculated physicochemical properties

Three-letter amino acid

Met-Tyr

Single-letter amino acid

Peptide length

Peptide mass

Experimental mass	Theoretical mass
N.D	312.38 Da ^c

Net charge

0.00 ^c

Isoelectric point (pI)

5.92 ^c

IC₅₀

N.D

pIC₅₀

N.D

GRAVY

0.3000^c

Hydrophilic residue ratio

50%^c

Peptide calculator

Peptide source & Food-borne protein(s) search

Classification	Animal, Fish, Marine
Organism/Source	Sardine
Precursor protein	Sardine muscle protein
Residue position	N.D
Precursor protein(s) search	Source.1: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein Source.2: DFBPPR0776 ---- Plant proteins ---- 11S globulin Source.3: DFBPPR0811 ---- Plant proteins ---- Meiosis-specific protein PAIR2 Source.4: DFBPPR0826 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC8 Source.5: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9 Source.6: DFBPPR0839 ---- Plant proteins ---- Flavone 3'-O-methyltransferase 1 Source.7: DFBPPR0843 ---- Plant proteins ---- MADS-box transcription factor 1 Source.8: DFBPPR0848 ---- Plant proteins ---- Beta-glucosidase 7 Source.9: DFBPPR0853 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1a Source.10: DFBPPR0858 ---- Plant proteins ---- Bidirectional sugar transporter SWEET11 Source.11: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic Source.12: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1 Source.13: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase Source.14: DFBPPR0866 ---- Plant proteins ---- Kinesin-like protein KIN-14Q Source.15: DFBPPR0867 ---- Plant proteins ---- Ras-related protein Rab5A Source.16: DFBPPR0875 ---- Plant proteins ---- ABC transporter G family member 5 Source.17: DFBPPR0879 ---- Plant proteins ---- UDP-arabinopyranose mutase 1 Source.18: DFBPPR0890 ---- Plant proteins ---- Beta-glucosidase 8 Source.19: DFBPPR0892 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 1 Source.20: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1 Source.21: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2 Source.22: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase Source.23: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4 Source.24: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A Source.25: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase Source.26: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2 Source.27: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog Source.28: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5 Source.29: DFBPPR0924 ---- Plant proteins ---- Two pore potassium channel a Source.30: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6 Source.31: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR Source.32: DFBPPR0929 ---- Plant proteins ---- Protein ROS1A Source.33: DFBPPR0932 ---- Plant proteins ---- Probable chlorophyll(ide) b reductase NYC1, chloroplastic Source.34: DFBPPR0934 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase FLS2 Source.35: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic Source.36: DFBPPR0940 ---- Plant proteins ---- Serine/threonine-protein kinase/endoribonuclease IRE1 Source.37: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705 Source.38: DFBPPR0944 ---- Plant proteins ---- UDP-arabinopyranose mutase 3 Source.39: DFBPPR0949 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK7 Source.40: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1 Source.41: DFBPPR0953 ---- Plant proteins ---- Hexokinase-5 Source.42: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1 Source.43: DFBPPR0961 ---- Plant proteins ---- Ent-kaurenoic acid oxidase Source.44: DFBPPR0963 ---- Plant proteins ---- E3 ubiquitin-protein ligase CCNB1IP1 homolog Source.45: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1 Source.46: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1 Source.47: DFBPPR0976 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme, chloroplastic/amyloplastic Source.48: DFBPPR0977 ---- Plant proteins ---- GPCR-type G protein COLD1 Source.49: DFBPPR0978 ---- Plant proteins ---- Transcription factor MYBS1 Source.50: DFBPPR0979 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.51: DFBPPR0982 ---- Plant proteins ---- Monodehydroascorbate reductase 3, cytosolic Source.52: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2 Source.53: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1 Source.54: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2 Source.55: DFBPPR0994 ---- Plant proteins ---- Zinc finger protein HD1 Source.56: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR Source.57: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31 Source.58: DFBPPR1001 ---- Plant proteins ---- GRF-interacting factor 1 Source.59: DFBPPR1007 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ1 Source.60: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2 Source.61: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5 Source.62: DFBPPR1019 ---- Plant proteins ---- Respiratory burst oxidase homolog protein B Source.63: DFBPPR1024 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK4 Source.64: DFBPPR1034 ---- Plant proteins ---- bZIP transcription factor 50 Source.65: DFBPPR1042 ---- Plant proteins ---- Hexokinase-3 Source.66: DFBPPR1043 ---- Plant proteins ---- Probable histidine kinase 4 Source.67: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3 Source.68: DFBPPR1058 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 5 Source.69: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2 Source.70: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A Source.71: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6 Source.72: DFBPPR1068 ---- Plant proteins ---- E3 ubiquitin-protein ligase DIS1 Source.73: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9 Source.74: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5 Source.75: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7 Source.76: DFBPPR1080 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 1 Source.77: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit Source.78: DFBPPR1084 ---- Plant proteins ---- Protein AUXIN-REGULATED GENE INVOLVED IN ORGAN SIZE Source.79: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24 Source.80: DFBPPR1095 ---- Plant proteins ---- Transcription factor GAMYB Source.81: DFBPPR1096 ---- Plant proteins ---- Peptide deformylase 1B, chloroplastic Source.82: DFBPPR1098 ---- Plant proteins ---- Hexokinase-2 Source.83: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2 Source.84: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic Source.85: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic Source.86: DFBPPR1131 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 1 Source.87: DFBPPR1137 ---- Plant proteins ---- MADS-box transcription factor 3 Source.88: DFBPPR1138 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3L, mitochondrial Source.89: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6 Source.90: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2 Source.91: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19 Source.92: DFBPPR1159 ---- Plant proteins ---- Replication protein A 70 kDa DNA-binding subunit B Source.93: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2 Source.94: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1 Source.95: DFBPPR1164 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.96: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2 Source.97: DFBPPR1169 ---- Plant proteins ---- Phototropin-1A Source.98: DFBPPR1179 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 1, mitochondrial Source.99: DFBPPR1185 ---- Plant proteins ---- PHD finger protein EHD3 Source.100: DFBPPR1206 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.101: DFBPPR1209 ---- Plant proteins ---- Aquaporin NIP2-1 Source.102: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM Source.103: DFBPPR1225 ---- Plant proteins ---- Protein phosphatase 2C 35 Source.104: DFBPPR1226 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 3 Source.105: DFBPPR1244 ---- Plant proteins ---- MADS-box transcription factor 58 Source.106: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10 Source.107: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a Source.108: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A Source.109: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1 Source.110: DFBPPR1275 ---- Plant proteins ---- Transcription factor TIP2 Source.111: DFBPPR1281 ---- Plant proteins ---- Arsenate reductase 2.2 Source.112: DFBPPR1282 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.113: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D Source.114: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5 Source.115: DFBPPR1289 ---- Plant proteins ---- bZIP transcription factor 39 Source.116: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B Source.117: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5 Source.118: DFBPPR1295 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 1, chloroplastic Source.119: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A Source.120: DFBPPR1308 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 4 Source.121: DFBPPR1317 ---- Plant proteins ---- Copper transporter 2 Source.122: DFBPPR1322 ---- Plant proteins ---- Copper transporter 1 Source.123: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d Source.124: DFBPPR1334 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 21, chloroplastic Source.125: DFBPPR1336 ---- Plant proteins ---- Protein argonaute 7 Source.126: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1 Source.127: DFBPPR1341 ---- Plant proteins ---- Calcium-dependent protein kinase 14 Source.128: DFBPPR1344 ---- Plant proteins ---- Probable glutamate carboxypeptidase PLA3 Source.129: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2 Source.130: DFBPPR1348 ---- Plant proteins ---- Cytochrome b Source.131: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C Source.132: DFBPPR1364 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial Source.133: DFBPPR1365 ---- Plant proteins ---- Replication protein A 32 kDa subunit A Source.134: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F Source.135: DFBPPR1370 ---- Plant proteins ---- Phototropin-1B Source.136: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L Source.137: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.138: DFBPPR1374 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme 2, chloroplastic Source.139: DFBPPR1386 ---- Plant proteins ---- Transcription factor LATE FLOWERING Source.140: DFBPPR1388 ---- Plant proteins ---- Acetylserotonin O-methyltransferase 2 Source.141: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic Source.142: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4 Source.143: DFBPPR1405 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 2 Source.144: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1 Source.145: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3 Source.146: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4 Source.147: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1 Source.148: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2 Source.149: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4 Source.150: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29 Source.151: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14 Source.152: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37 Source.153: DFBPPR1451 ---- Plant proteins ---- Mitogen-activated protein kinase 8 Source.154: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E Source.155: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase Source.156: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9 Source.157: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.158: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2 Source.159: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1 Source.160: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5 Source.161: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase Source.162: DFBPPR1474 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 7 Source.163: DFBPPR1479 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic Source.164: DFBPPR1480 ---- Plant proteins ---- CASP-like protein BLE3 Source.165: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9 Source.166: DFBPPR1488 ---- Plant proteins ---- Carbamoyl-phosphate synthase large chain, chloroplastic Source.167: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic Source.168: DFBPPR1495 ---- Plant proteins ---- Indole-3-pyruvate monooxygenase YUCCA1 Source.169: DFBPPR1499 ---- Plant proteins ---- Protein kinase and PP2C-like domain-containing protein Source.170: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial Source.171: DFBPPR1502 ---- Plant proteins ---- Nuclear transcription factor Y subunit C-4 Source.172: DFBPPR1505 ---- Plant proteins ---- Bidirectional sugar transporter SWEET5 Source.173: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial Source.174: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.175: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic Source.176: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1 Source.177: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.178: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1 Source.179: DFBPPR1547 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor CRL5 Source.180: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic Source.181: DFBPPR1554 ---- Plant proteins ---- Signal peptidase complex-like protein DTM1 Source.182: DFBPPR1556 ---- Plant proteins ---- CBL-interacting protein kinase 19 Source.183: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK Source.184: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1 Source.185: DFBPPR1591 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 3-like 1b Source.186: DFBPPR1595 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.187: DFBPPR1598 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.188: DFBPPR1602 ---- Plant proteins ---- SNW/SKI-interacting protein A Source.189: DFBPPR1603 ---- Plant proteins ---- MADS-box transcription factor 5 Source.190: DFBPPR1604 ---- Plant proteins ---- Putative bifunctional dihydrofolate reductase-thymidylate synthase Source.191: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.192: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1 Source.193: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase Source.194: DFBPPR1616 ---- Plant proteins ---- Anthranilate synthase alpha subunit 2, chloroplastic Source.195: DFBPPR1619 ---- Plant proteins ---- Xylanase inhibitor protein 1 Source.196: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3 Source.197: DFBPPR1626 ---- Plant proteins ---- NAC domain-containing protein 71 Source.198: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5 Source.199: DFBPPR1630 ---- Plant proteins ---- Exportin-T Source.200: DFBPPR1633 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1a Source.201: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3 Source.202: DFBPPR1635 ---- Plant proteins ---- Cytosolic invertase 1 Source.203: DFBPPR1637 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 2 Source.204: DFBPPR1646 ---- Plant proteins ---- ADP,ATP carrier protein, mitochondrial Source.205: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.206: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic Source.207: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic Source.208: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1 Source.209: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase Source.210: DFBPPR1666 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1 homolog, chloroplastic/mitochondrial Source.211: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A Source.212: DFBPPR1675 ---- Plant proteins ---- Protein LSD1 Source.213: DFBPPR1677 ---- Plant proteins ---- Aspartate aminotransferase, cytoplasmic Source.214: DFBPPR1678 ---- Plant proteins ---- Mitogen-activated protein kinase 7 Source.215: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.216: DFBPPR1681 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase 2, cytosolic Source.217: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2 Source.218: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming] Source.219: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6 Source.220: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2 Source.221: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase Source.222: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4 Source.223: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.224: DFBPPR1724 ---- Plant proteins ---- Protein disulfide isomerase-like 1-4 Source.225: DFBPPR1726 ---- Plant proteins ---- SPX domain-containing protein 1 Source.226: DFBPPR1727 ---- Plant proteins ---- Cyclin-dependent kinase C-3 Source.227: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a Source.228: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9 Source.229: DFBPPR1737 ---- Plant proteins ---- Probable (S)-ureidoglycine aminohydrolase Source.230: DFBPPR1738 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase ZFP1 Source.231: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1 Source.232: DFBPPR1743 ---- Plant proteins ---- Phosphatidylinositol 4-phosphate 5-kinase 1 Source.233: DFBPPR1745 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic Source.234: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic Source.235: DFBPPR1756 ---- Plant proteins ---- Soluble starch synthase 2-1, chloroplastic/amyloplastic Source.236: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a Source.237: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2 Source.238: DFBPPR1762 ---- Plant proteins ---- Meiotic recombination protein SPO11-1 Source.239: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1 Source.240: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial Source.241: DFBPPR1771 ---- Plant proteins ---- Replication protein A 32 kDa subunit B Source.242: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b Source.243: DFBPPR1775 ---- Plant proteins ---- B3 domain-containing protein IDEF1 Source.244: DFBPPR1782 ---- Plant proteins ---- Transcription factor BHLH133 Source.245: DFBPPR1784 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OTP51, chloroplastic Source.246: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial Source.247: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6 Source.248: DFBPPR1793 ---- Plant proteins ---- Phosphate transporter PHO1-1 Source.249: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.250: DFBPPR1808 ---- Plant proteins ---- Flap endonuclease GEN-like 2 Source.251: DFBPPR1810 ---- Plant proteins ---- Shaggy-related protein kinase GSK4 Source.252: DFBPPR1814 ---- Plant proteins ---- Histone deacetylase 2 Source.253: DFBPPR1823 ---- Plant proteins ---- Protein YABBY 1 Source.254: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17 Source.255: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3 Source.256: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a Source.257: DFBPPR1839 ---- Plant proteins ---- Laccase-24 Source.258: DFBPPR1861 ---- Plant proteins ---- Laccase-25 Source.259: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c Source.260: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1 Source.261: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1 Source.262: DFBPPR1896 ---- Plant proteins ---- Laccase-8 Source.263: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2 Source.264: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic Source.265: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase Source.266: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6 Source.267: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial Source.268: DFBPPR1920 ---- Plant proteins ---- Mitogen-activated protein kinase 10 Source.269: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3 Source.270: DFBPPR1930 ---- Plant proteins ---- Ent-isokaur-15-ene synthase Source.271: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase Source.272: DFBPPR1946 ---- Plant proteins ---- Phytochrome A Source.273: DFBPPR1948 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5B Source.274: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic Source.275: DFBPPR1951 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.276: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b Source.277: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2 Source.278: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial Source.279: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2 Source.280: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial Source.281: DFBPPR1967 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.282: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I Source.283: DFBPPR1971 ---- Plant proteins ---- Protein disulfide isomerase-like 1-3 Source.284: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15 Source.285: DFBPPR1978 ---- Plant proteins ---- Glutamate dehydrogenase 2, mitochondrial Source.286: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16 Source.287: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1 Source.288: DFBPPR2002 ---- Plant proteins ---- bZIP transcription factor 60 Source.289: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8 Source.290: DFBPPR2007 ---- Plant proteins ---- Plasma membrane ATPase Source.291: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1 Source.292: DFBPPR2018 ---- Plant proteins ---- Ferredoxin--NADP reductase, embryo isozyme, chloroplastic Source.293: DFBPPR2020 ---- Plant proteins ---- Tubulin alpha-1 chain Source.294: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9 Source.295: DFBPPR2030 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-en-1-yl diphosphate synthase (ferredoxin), chloroplastic Source.296: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B Source.297: DFBPPR2037 ---- Plant proteins ---- Laccase-10 Source.298: DFBPPR2042 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.299: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1 Source.300: DFBPPR2050 ---- Plant proteins ---- CBL-interacting protein kinase 15 Source.301: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7 Source.302: DFBPPR2057 ---- Plant proteins ---- Cytochrome P450 87A3 Source.303: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3 Source.304: DFBPPR2066 ---- Plant proteins ---- Pantothenate kinase 2 Source.305: DFBPPR2067 ---- Plant proteins ---- Protein kinase PINOID 2 Source.306: DFBPPR2068 ---- Plant proteins ---- Oleosin 16 kDa Source.307: DFBPPR2071 ---- Plant proteins ---- Auxin response factor 11 Source.308: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.309: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43 Source.310: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7 Source.311: DFBPPR2077 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8C Source.312: DFBPPR2081 ---- Plant proteins ---- Expansin-A1 Source.313: DFBPPR2085 ---- Plant proteins ---- Protein LOL5 Source.314: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6 Source.315: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10 Source.316: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3 Source.317: DFBPPR2092 ---- Plant proteins ---- Transcription factor MYB80 Source.318: DFBPPR2093 ---- Plant proteins ---- Ent-kaurene oxidase-like 5 Source.319: DFBPPR2095 ---- Plant proteins ---- Geranylgeranyl diphosphate reductase, chloroplastic Source.320: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5 Source.321: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1 Source.322: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6 Source.323: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14 Source.324: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5 Source.325: DFBPPR2145 ---- Plant proteins ---- Glutamyl-tRNA reductase, chloroplastic Source.326: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type Source.327: DFBPPR2150 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 5A Source.328: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4 Source.329: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2 Source.330: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11 Source.331: DFBPPR2161 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK7 Source.332: DFBPPR2166 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.333: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2 Source.334: DFBPPR2169 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT2 Source.335: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3 Source.336: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8 Source.337: DFBPPR2172 ---- Plant proteins ---- S-adenosyl-L-methionine-dependent tRNA 4-demethylwyosine synthase Source.338: DFBPPR2173 ---- Plant proteins ---- Cullin-1 Source.339: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29 Source.340: DFBPPR2182 ---- Plant proteins ---- ATP-citrate synthase beta chain protein 1 Source.341: DFBPPR2187 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-B Source.342: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4 Source.343: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2 Source.344: DFBPPR2191 ---- Plant proteins ---- Ent-pimara-8(14),15-diene synthase Source.345: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type Source.346: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1 Source.347: DFBPPR2200 ---- Plant proteins ---- COBRA-like protein 5 Source.348: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9 Source.349: DFBPPR2205 ---- Plant proteins ---- Cation transporter HKT1 Source.350: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3 Source.351: DFBPPR2213 ---- Plant proteins ---- Probable sucrose-phosphate synthase 3 Source.352: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50 Source.353: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12 Source.354: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial Source.355: DFBPPR2223 ---- Plant proteins ---- Urease Source.356: DFBPPR2225 ---- Plant proteins ---- Calcium-transporting ATPase 1, plasma membrane-type Source.357: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5 Source.358: DFBPPR2232 ---- Plant proteins ---- Tubulin alpha-2 chain Source.359: DFBPPR2235 ---- Plant proteins ---- Homeobox protein knotted-1-like 12 Source.360: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24 Source.361: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2 Source.362: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4 Source.363: DFBPPR2254 ---- Plant proteins ---- Homeobox protein knotted-1-like 13 Source.364: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial Source.365: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3 Source.366: DFBPPR2258 ---- Plant proteins ---- Proteasome subunit beta type-3 Source.367: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1 Source.368: DFBPPR2263 ---- Plant proteins ---- CBL-interacting protein kinase 29 Source.369: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52 Source.370: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog Source.371: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7 Source.372: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3 Source.373: DFBPPR2272 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 2 Source.374: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6 Source.375: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5 Source.376: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type Source.377: DFBPPR2281 ---- Plant proteins ---- Cytokinin dehydrogenase 8 Source.378: DFBPPR2286 ---- Plant proteins ---- Proteasome subunit alpha type-4-1 Source.379: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B Source.380: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial Source.381: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic Source.382: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.383: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1 Source.384: DFBPPR2312 ---- Plant proteins ---- Probable GTP diphosphokinase RSH3, chloroplastic Source.385: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.386: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain Source.387: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2 Source.388: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3 Source.389: DFBPPR2327 ---- Plant proteins ---- Kinesin-like protein KIN-7K, chloroplastic Source.390: DFBPPR2332 ---- Plant proteins ---- Tryptophan aminotransferase-related protein 1 Source.391: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4 Source.392: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2 Source.393: DFBPPR2346 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.394: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2 Source.395: DFBPPR2348 ---- Plant proteins ---- Histidinol dehydrogenase, chloroplastic Source.396: DFBPPR2349 ---- Plant proteins ---- Coatomer subunit gamma-1 Source.397: DFBPPR2351 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit Source.398: DFBPPR2370 ---- Plant proteins ---- Monodehydroascorbate reductase 5, chlorplastic Source.399: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3 Source.400: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10 Source.401: DFBPPR2390 ---- Plant proteins ---- Proteasome subunit alpha type-4-2 Source.402: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic Source.403: DFBPPR2396 ---- Plant proteins ---- CBL-interacting protein kinase 5 Source.404: DFBPPR2397 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2A Source.405: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1 Source.406: DFBPPR2409 ---- Plant proteins ---- Histone deacetylase 3 Source.407: DFBPPR2411 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 2 Source.408: DFBPPR2413 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK8 Source.409: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic Source.410: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28 Source.411: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1 Source.412: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1 Source.413: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A Source.414: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13 Source.415: DFBPPR2429 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 5 Source.416: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic Source.417: DFBPPR2444 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.418: DFBPPR2448 ---- Plant proteins ---- Expansin-A9 Source.419: DFBPPR2449 ---- Plant proteins ---- Glutamate--cysteine ligase B, chloroplastic Source.420: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9 Source.421: DFBPPR2457 ---- Plant proteins ---- Proteasome subunit alpha type-4-3 Source.422: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25 Source.423: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.424: DFBPPR2466 ---- Plant proteins ---- MADS-box transcription factor 26 Source.425: DFBPPR2479 ---- Plant proteins ---- CBL-interacting protein kinase 14 Source.426: DFBPPR2483 ---- Plant proteins ---- P-loop NTPase domain-containing protein LPA1 Source.427: DFBPPR2486 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR2 Source.428: DFBPPR2488 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 1 Source.429: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic Source.430: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3 Source.431: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20 Source.432: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5 Source.433: DFBPPR2502 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os04g0590900 Source.434: DFBPPR2509 ---- Plant proteins ---- Magnesium transporter MRS2-A, chloroplastic Source.435: DFBPPR2511 ---- Plant proteins ---- Putative CBL-interacting protein kinase 13 Source.436: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.437: DFBPPR2520 ---- Plant proteins ---- Metallothionein-like protein 4C Source.438: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22 Source.439: DFBPPR2522 ---- Plant proteins ---- Puromycin-sensitive aminopeptidase Source.440: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3 Source.441: DFBPPR2530 ---- Plant proteins ---- Beta-glucosidase 20 Source.442: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1 Source.443: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.444: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6 Source.445: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic Source.446: DFBPPR2561 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-4 Source.447: DFBPPR2568 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 40 Source.448: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12 Source.449: DFBPPR2576 ---- Plant proteins ---- Probable glycosyltransferase 4 Source.450: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial Source.451: DFBPPR2580 ---- Plant proteins ---- Molybdenum cofactor sulfurase Source.452: DFBPPR2584 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1 Source.453: DFBPPR2585 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8B Source.454: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic Source.455: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4 Source.456: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1 Source.457: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic Source.458: DFBPPR2606 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 4 Source.459: DFBPPR2612 ---- Plant proteins ---- Chalcone synthase 1 Source.460: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3 Source.461: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial Source.462: DFBPPR2628 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.463: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3 Source.464: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24 Source.465: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8 Source.466: DFBPPR2639 ---- Plant proteins ---- Seed allergenic protein RAG2 Source.467: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26 Source.468: DFBPPR2641 ---- Plant proteins ---- 18.8 kDa class V heat shock protein Source.469: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18 Source.470: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b Source.471: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2 Source.472: DFBPPR2649 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-8 Source.473: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2 Source.474: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1 Source.475: DFBPPR2663 ---- Plant proteins ---- Protein arginine N-methyltransferase PRMT10 Source.476: DFBPPR2668 ---- Plant proteins ---- Two-component response regulator ORR33 Source.477: DFBPPR2672 ---- Plant proteins ---- 63 kDa globulin-like protein Source.478: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3 Source.479: DFBPPR2677 ---- Plant proteins ---- Glutamate--cysteine ligase A, chloroplastic Source.480: DFBPPR2685 ---- Plant proteins ---- Homogentisate 1,2-dioxygenase Source.481: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog Source.482: DFBPPR2692 ---- Plant proteins ---- FACT complex subunit SSRP1-A Source.483: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase Source.484: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27 Source.485: DFBPPR2702 ---- Plant proteins ---- Beta-glucosidase 27 Source.486: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1 Source.487: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M Source.488: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.489: DFBPPR2733 ---- Plant proteins ---- Metallothionein-like protein 1B Source.490: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2 Source.491: DFBPPR2735 ---- Plant proteins ---- Expansin-A24 Source.492: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase Source.493: DFBPPR2746 ---- Plant proteins ---- Potassium transporter 10 Source.494: DFBPPR2748 ---- Plant proteins ---- Secretory carrier-associated membrane protein 6 Source.495: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15 Source.496: DFBPPR2751 ---- Plant proteins ---- Actin-7 Source.497: DFBPPR2752 ---- Plant proteins ---- Secretory carrier-associated membrane protein 5 Source.498: DFBPPR2759 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL9 Source.499: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog Source.500: DFBPPR2763 ---- Plant proteins ---- Actin-1 Source.501: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26 Source.502: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic Source.503: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.504: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44 Source.505: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17 Source.506: DFBPPR2776 ---- Plant proteins ---- Splicing factor U2af small subunit A Source.507: DFBPPR2778 ---- Plant proteins ---- PHD finger protein PERSISTENT TAPETAL CELL 1 Source.508: DFBPPR2780 ---- Plant proteins ---- Coatomer subunit gamma-2 Source.509: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.510: DFBPPR2792 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8A Source.511: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16 Source.512: DFBPPR2798 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 6 Source.513: DFBPPR2799 ---- Plant proteins ---- ABC transporter G family member 49 Source.514: DFBPPR2802 ---- Plant proteins ---- UDP-glucose 4-epimerase 3 Source.515: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32 Source.516: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1 Source.517: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.518: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like Source.519: DFBPPR2814 ---- Plant proteins ---- Probable cinnamyl alcohol dehydrogenase 8D Source.520: DFBPPR2816 ---- Plant proteins ---- WUSCHEL-related homeobox 3 Source.521: DFBPPR2820 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-10 Source.522: DFBPPR2821 ---- Plant proteins ---- ABC transporter G family member 35 Source.523: DFBPPR2828 ---- Plant proteins ---- ABC transporter G family member 36 Source.524: DFBPPR2830 ---- Plant proteins ---- 26S proteasome regulatory subunit 7A Source.525: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1 Source.526: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3 Source.527: DFBPPR2835 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 4 Source.528: DFBPPR2837 ---- Plant proteins ---- 26S proteasome regulatory subunit 7B Source.529: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37 Source.530: DFBPPR2839 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 2 Source.531: DFBPPR2840 ---- Plant proteins ---- Sialyltransferase-like protein 2 Source.532: DFBPPR2841 ---- Plant proteins ---- Homeobox protein knotted-1-like 8 Source.533: DFBPPR2842 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 6 Source.534: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2 Source.535: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47 Source.536: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46 Source.537: DFBPPR2853 ---- Plant proteins ---- Barley B recombinant-like protein D Source.538: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34 Source.539: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42 Source.540: DFBPPR2874 ---- Plant proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.541: DFBPPR2877 ---- Plant proteins ---- Splicing factor U2af small subunit B Source.542: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1 Source.543: DFBPPR2882 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 2 Source.544: DFBPPR2891 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 2 Source.545: DFBPPR2892 ---- Plant proteins ---- 30S ribosomal protein S18, chloroplastic Source.546: DFBPPR2903 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 3 Source.547: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2 Source.548: DFBPPR2911 ---- Plant proteins ---- Probable V-type proton ATPase subunit d Source.549: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b Source.550: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1 Source.551: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11 Source.552: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1 Source.553: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3 Source.554: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5 Source.555: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1 Source.556: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog Source.557: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1 Source.558: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14 Source.559: DFBPPR2974 ---- Plant proteins ---- Derlin-1 Source.560: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4 Source.561: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19 Source.562: DFBPPR2983 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX23 Source.563: DFBPPR2989 ---- Plant proteins ---- Actin-2 Source.564: DFBPPR2997 ---- Plant proteins ---- Beta-galactosidase 13 Source.565: DFBPPR2999 ---- Plant proteins ---- FACT complex subunit SSRP1-B Source.566: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2 Source.567: DFBPPR3010 ---- Plant proteins ---- Probable glucuronosyltransferase Os03g0287800 Source.568: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15 Source.569: DFBPPR3038 ---- Plant proteins ---- Alpha N-terminal protein methyltransferase 1 Source.570: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b Source.571: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic Source.572: DFBPPR3043 ---- Plant proteins ---- Beta-glucosidase 24 Source.573: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase Source.574: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17 Source.575: DFBPPR3052 ---- Plant proteins ---- MADS-box transcription factor 31 Source.576: DFBPPR3059 ---- Plant proteins ---- Beta-glucosidase 16 Source.577: DFBPPR3064 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL9 Source.578: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic Source.579: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45 Source.580: DFBPPR3074 ---- Plant proteins ---- ABC transporter G family member 53 Source.581: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31 Source.582: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3 Source.583: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38 Source.584: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33 Source.585: DFBPPR3087 ---- Plant proteins ---- Actin-3 Source.586: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12 Source.587: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11 Source.588: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48 Source.589: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic Source.590: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12 Source.591: DFBPPR3105 ---- Plant proteins ---- Beta-glucosidase 21 Source.592: DFBPPR3106 ---- Plant proteins ---- Protein HIRA Source.593: DFBPPR3114 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 2, mitochondrial Source.594: DFBPPR3116 ---- Plant proteins ---- Nucleosome assembly protein 1;2 Source.595: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39 Source.596: DFBPPR3122 ---- Plant proteins ---- Probable GTP diphosphokinase RSH2, chloroplastic Source.597: DFBPPR3127 ---- Plant proteins ---- Probable D-2-hydroxyglutarate dehydrogenase, mitochondrial Source.598: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41 Source.599: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2 Source.600: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1 Source.601: DFBPPR3138 ---- Plant proteins ---- Villin-1 Source.602: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51 Source.603: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1 Source.604: DFBPPR3148 ---- Plant proteins ---- Growth-regulating factor 8 Source.605: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic Source.606: DFBPPR3153 ---- Plant proteins ---- Auxin-responsive protein IAA11 Source.607: DFBPPR3160 ---- Plant proteins ---- Endoglucanase 11 Source.608: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32 Source.609: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32 Source.610: DFBPPR3173 ---- Plant proteins ---- Beta-glucosidase 29 Source.611: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10 Source.612: DFBPPR3187 ---- Plant proteins ---- Probable glucuronosyltransferase Os10g0205300 Source.613: DFBPPR3189 ---- Plant proteins ---- Endoglucanase 13 Source.614: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3 Source.615: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3 Source.616: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B Source.617: DFBPPR3216 ---- Plant proteins ---- 7-hydroxymethyl chlorophyll a reductase, chloroplastic Source.618: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3 Source.619: DFBPPR3226 ---- Plant proteins ---- Proline transporter 1 Source.620: DFBPPR3227 ---- Plant proteins ---- Oryzain gamma chain Source.621: DFBPPR3236 ---- Plant proteins ---- Probable adenylate kinase 6, chloroplastic Source.622: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2 Source.623: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1 Source.624: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18 Source.625: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3 Source.626: DFBPPR3283 ---- Plant proteins ---- Auxin-responsive protein IAA21 Source.627: DFBPPR3289 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3b Source.628: DFBPPR3293 ---- Plant proteins ---- Protein-ribulosamine 3-kinase, chloroplastic Source.629: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2 Source.630: DFBPPR3306 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3a Source.631: DFBPPR3307 ---- Plant proteins ---- Endoglucanase 18 Source.632: DFBPPR3311 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 2 Source.633: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a Source.634: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4 Source.635: DFBPPR3319 ---- Plant proteins ---- Transcription factor TGAL8 Source.636: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3 Source.637: DFBPPR3327 ---- Plant proteins ---- Putative mannan endo-1,4-beta-mannosidase 9 Source.638: DFBPPR3328 ---- Plant proteins ---- Putative expansin-A30 Source.639: DFBPPR3338 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1a Source.640: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5 Source.641: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2 Source.642: DFBPPR3344 ---- Plant proteins ---- Bidirectional sugar transporter SWEET4 Source.643: DFBPPR3356 ---- Plant proteins ---- Probable aquaporin PIP2-6 Source.644: DFBPPR3358 ---- Plant proteins ---- Glutelin type-B 4 Source.645: DFBPPR3359 ---- Plant proteins ---- Beta-galactosidase 1 Source.646: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700 Source.647: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2 Source.648: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C Source.649: DFBPPR3378 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 6 Source.650: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14 Source.651: DFBPPR3383 ---- Plant proteins ---- Chalcone synthase 2 Source.652: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3 Source.653: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14 Source.654: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7 Source.655: DFBPPR3395 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.7 Source.656: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2 Source.657: DFBPPR3400 ---- Plant proteins ---- Auxin-responsive protein IAA12 Source.658: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c Source.659: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5 Source.660: DFBPPR3409 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 9 Source.661: DFBPPR3410 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-5 Source.662: DFBPPR3414 ---- Plant proteins ---- Seed allergenic protein RA5 Source.663: DFBPPR3416 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.6 Source.664: DFBPPR3419 ---- Plant proteins ---- Endoglucanase 15 Source.665: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12 Source.666: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40 Source.667: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1 Source.668: DFBPPR3432 ---- Plant proteins ---- Potassium channel KAT2 Source.669: DFBPPR3436 ---- Plant proteins ---- Magnesium transporter MRS2-F Source.670: DFBPPR3437 ---- Plant proteins ---- Putative acetyl-coenzyme A carboxylase carboxyl transferase subunit beta-like protein Source.671: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial Source.672: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR Source.673: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic Source.674: DFBPPR3456 ---- Plant proteins ---- Maturase K Source.675: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6 Source.676: DFBPPR3465 ---- Plant proteins ---- Deoxyhypusine hydroxylase-A Source.677: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4 Source.678: DFBPPR3484 ---- Plant proteins ---- Monothiol glutaredoxin-S5 Source.679: DFBPPR3489 ---- Plant proteins ---- Deoxyhypusine hydroxylase-B Source.680: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9 Source.681: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N Source.682: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4 Source.683: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2 Source.684: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3 Source.685: DFBPPR3542 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 2 Source.686: DFBPPR3553 ---- Plant proteins ---- Probable auxin efflux carrier component 8 Source.687: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8 Source.688: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22 Source.689: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33 Source.690: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600 Source.691: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16 Source.692: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8 Source.693: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9 Source.694: DFBPPR3576 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os11g0515500 Source.695: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog Source.696: DFBPPR3582 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7c Source.697: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B Source.698: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2 Source.699: DFBPPR3586 ---- Plant proteins ---- Probable protein phosphatase 2C 19 Source.700: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG Source.701: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11 Source.702: DFBPPR3605 ---- Plant proteins ---- Thioredoxin F, chloroplastic Source.703: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3 Source.704: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1 Source.705: DFBPPR3612 ---- Plant proteins ---- Kinesin-like protein KIN-6 Source.706: DFBPPR3615 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7b Source.707: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3 Source.708: DFBPPR3628 ---- Plant proteins ---- Kinesin-like protein KIN-13B Source.709: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10 Source.710: DFBPPR3630 ---- Plant proteins ---- Probable anion transporter 6 Source.711: DFBPPR3642 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7e Source.712: DFBPPR3643 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6a Source.713: DFBPPR3650 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.2 Source.714: DFBPPR3654 ---- Plant proteins ---- Bidirectional sugar transporter SWEET7a Source.715: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9 Source.716: DFBPPR3666 ---- Plant proteins ---- Glutelin type-B 5 Source.717: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2 Source.718: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3 Source.719: DFBPPR3691 ---- Plant proteins ---- Putative bidirectional sugar transporter SWEET7d Source.720: DFBPPR3702 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.1 Source.721: DFBPPR3707 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.11 Source.722: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic Source.723: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15 Source.724: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic Source.725: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9 Source.726: DFBPPR3722 ---- Plant proteins ---- Probable monogalactosyldiacylglycerol synthase 2, chloroplastic Source.727: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7 Source.728: DFBPPR3727 ---- Plant proteins ---- Serine decarboxylase 1 Source.729: DFBPPR3734 ---- Plant proteins ---- Cation transporter HKT8 Source.730: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24 Source.731: DFBPPR3746 ---- Plant proteins ---- Actin-related protein 2 Source.732: DFBPPR3754 ---- Plant proteins ---- Auxin-responsive protein IAA30 Source.733: DFBPPR3758 ---- Plant proteins ---- Target of rapamycin complex subunit LST8 Source.734: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F Source.735: DFBPPR3775 ---- Plant proteins ---- Kinesin-like protein KIN-14G Source.736: DFBPPR3795 ---- Plant proteins ---- NRR repressor homolog 1 Source.737: DFBPPR3803 ---- Plant proteins ---- Probable trehalase Source.738: DFBPPR3809 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52A Source.739: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2 Source.740: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4 Source.741: DFBPPR3819 ---- Plant proteins ---- Patatin-like protein 1 Source.742: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d Source.743: DFBPPR3837 ---- Plant proteins ---- Kinesin-like protein KIN-14C Source.744: DFBPPR3839 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.745: DFBPPR3841 ---- Plant proteins ---- Probable aquaporin TIP3-2 Source.746: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2 Source.747: DFBPPR3847 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.13 Source.748: DFBPPR3849 ---- Plant proteins ---- Auxin-responsive protein IAA13 Source.749: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21 Source.750: DFBPPR3861 ---- Plant proteins ---- Cytoplasmic tRNA 2-thiolation protein 1 Source.751: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1 Source.752: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1 Source.753: DFBPPR3869 ---- Plant proteins ---- Potassium transporter 23 Source.754: DFBPPR3877 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NH5.1 Source.755: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E Source.756: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17 Source.757: DFBPPR3886 ---- Plant proteins ---- Probable protein phosphatase 2C 20 Source.758: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24 Source.759: DFBPPR3892 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 26 Source.760: DFBPPR3897 ---- Plant proteins ---- Putative inorganic phosphate transporter 1-13 Source.761: DFBPPR3904 ---- Plant proteins ---- Cyclin-B1-5 Source.762: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3 Source.763: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.764: DFBPPR3912 ---- Plant proteins ---- Sialyltransferase-like protein 4 Source.765: DFBPPR3913 ---- Plant proteins ---- Serine decarboxylase 2 Source.766: DFBPPR3916 ---- Plant proteins ---- Bidirectional sugar transporter SWEET1b Source.767: DFBPPR3917 ---- Plant proteins ---- Bidirectional sugar transporter SWEET6b Source.768: DFBPPR3923 ---- Plant proteins ---- Protein PHOTOSYSTEM I ASSEMBLY 2, chloroplastic Source.769: DFBPPR3929 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 1 Source.770: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7 Source.771: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2 Source.772: DFBPPR3939 ---- Plant proteins ---- Non-specific lipid-transfer protein 4 Source.773: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2 Source.774: DFBPPR3950 ---- Plant proteins ---- Serpin-ZXA Source.775: DFBPPR3968 ---- Plant proteins ---- CRS2-associated factor 1, chloroplastic Source.776: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3 Source.777: DFBPPR3973 ---- Plant proteins ---- Homeobox protein knotted-1-like 9 Source.778: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7 Source.779: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5 Source.780: DFBPPR3995 ---- Plant proteins ---- Probable potassium transporter 4 Source.781: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18 Source.782: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6 Source.783: DFBPPR4020 ---- Plant proteins ---- Probable cation transporter HKT3 Source.784: DFBPPR4022 ---- Plant proteins ---- Protein TIFY 11f Source.785: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19 Source.786: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20 Source.787: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein Source.788: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A Source.789: DFBPPR4037 ---- Plant proteins ---- Probable aquaporin TIP3-1 Source.790: DFBPPR4039 ---- Plant proteins ---- Silicon efflux transporter LSI3 Source.791: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3 Source.792: DFBPPR4042 ---- Plant proteins ---- Probable cation transporter HKT9 Source.793: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69 Source.794: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9 Source.795: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1 Source.796: DFBPPR4055 ---- Plant proteins ---- Serpin-ZXB Source.797: DFBPPR4062 ---- Plant proteins ---- Vacuolar fusion protein MON1 homolog Source.798: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like Source.799: DFBPPR4073 ---- Plant proteins ---- Auxin-responsive protein IAA5 Source.800: DFBPPR4075 ---- Plant proteins ---- Villin-4 Source.801: DFBPPR4076 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 48 Source.802: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3 Source.803: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3 Source.804: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b Source.805: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic Source.806: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25 Source.807: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2 Source.808: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4 Source.809: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8 Source.810: DFBPPR4093 ---- Plant proteins ---- Villin-5 Source.811: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic Source.812: DFBPPR4099 ---- Plant proteins ---- Cycloartenol-C-24-methyltransferase 1 Source.813: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15 Source.814: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2 Source.815: DFBPPR4138 ---- Plant proteins ---- B3 domain-containing protein Os04g0676600 Source.816: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16 Source.817: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2 Source.818: DFBPPR4143 ---- Plant proteins ---- Elongation factor 1-gamma 2 Source.819: DFBPPR4144 ---- Plant proteins ---- Origin of replication complex subunit 2 Source.820: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7 Source.821: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7 Source.822: DFBPPR4151 ---- Plant proteins ---- Metallothionein-like protein 4A Source.823: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c Source.824: DFBPPR4160 ---- Plant proteins ---- Squamosa promoter-binding-like protein 10 Source.825: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3 Source.826: DFBPPR4192 ---- Plant proteins ---- Chloroplastic group IIB intron splicing facilitator CRS2, chloroplastic Source.827: DFBPPR4193 ---- Plant proteins ---- Peptidyl-tRNA hydrolase, mitochondrial Source.828: DFBPPR4195 ---- Plant proteins ---- Elongation factor 1-gamma 1 Source.829: DFBPPR4196 ---- Plant proteins ---- Cyclin-D5-3 Source.830: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1 Source.831: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C Source.832: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial Source.833: DFBPPR4213 ---- Plant proteins ---- Mitochondrial import inner membrane translocase subunit Tim9 Source.834: DFBPPR4219 ---- Plant proteins ---- Aquaporin NIP3-2 Source.835: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic Source.836: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8 Source.837: DFBPPR4228 ---- Plant proteins ---- Probable NADPH:quinone oxidoreductase 2 Source.838: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1 Source.839: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3 Source.840: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9 Source.841: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2 Source.842: DFBPPR4248 ---- Plant proteins ---- Phospholipase A1-II 1 Source.843: DFBPPR4251 ---- Plant proteins ---- Hypersensitive-induced response protein 1 Source.844: DFBPPR4256 ---- Plant proteins ---- Copper transporter 4 Source.845: DFBPPR4258 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL11 Source.846: DFBPPR4261 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 16 Source.847: DFBPPR4268 ---- Plant proteins ---- Copper transporter 6 Source.848: DFBPPR4269 ---- Plant proteins ---- Serine decarboxylase 3 Source.849: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2 Source.850: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10 Source.851: DFBPPR4278 ---- Plant proteins ---- Calcium-binding protein CBP Source.852: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2 Source.853: DFBPPR4287 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2D Source.854: DFBPPR4291 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B beta isoform Source.855: DFBPPR4296 ---- Plant proteins ---- Squamosa promoter-binding-like protein 6 Source.856: DFBPPR4298 ---- Plant proteins ---- Squamosa promoter-binding-like protein 1 Source.857: DFBPPR4301 ---- Plant proteins ---- Protein argonaute 16 Source.858: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B Source.859: DFBPPR4304 ---- Plant proteins ---- Signal recognition particle 14 kDa protein Source.860: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1 Source.861: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C Source.862: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A Source.863: DFBPPR4318 ---- Plant proteins ---- Golgin-84 Source.864: DFBPPR4325 ---- Plant proteins ---- Putative non-inhibitory serpin-Z11 Source.865: DFBPPR4328 ---- Plant proteins ---- Metallothionein-like protein 2A Source.866: DFBPPR4332 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 55 kDa regulatory subunit B alpha isoform Source.867: DFBPPR4334 ---- Plant proteins ---- Putative protein phosphatase 2C 24 Source.868: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic Source.869: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3 Source.870: DFBPPR4371 ---- Plant proteins ---- Protein NLP3 Source.871: DFBPPR4373 ---- Plant proteins ---- COBRA-like protein 4 Source.872: DFBPPR4375 ---- Plant proteins ---- Magnesium transporter MRS2-E Source.873: DFBPPR4384 ---- Plant proteins ---- Putative WUSCHEL-related homeobox 2 Source.874: DFBPPR4385 ---- Plant proteins ---- Double-stranded RNA-binding protein 2 Source.875: DFBPPR4386 ---- Plant proteins ---- WUSCHEL-related homeobox 5 Source.876: DFBPPR4391 ---- Plant proteins ---- Maltose excess protein 1-like, chloroplastic Source.877: DFBPPR4393 ---- Plant proteins ---- Late embryogenesis abundant protein 14 Source.878: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31 Source.879: DFBPPR4399 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 5 Source.880: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8 Source.881: DFBPPR4412 ---- Plant proteins ---- Double-stranded RNA-binding protein 6 Source.882: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4 Source.883: DFBPPR4427 ---- Plant proteins ---- Probable auxin efflux carrier component 9 Source.884: DFBPPR4431 ---- Plant proteins ---- Spindle and kinetochore-associated protein 1 homolog Source.885: DFBPPR4434 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL18 Source.886: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP Source.887: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6 Source.888: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B Source.889: DFBPPR4446 ---- Plant proteins ---- Lecithin-cholesterol acyltransferase-like 1 Source.890: DFBPPR4449 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 45 Source.891: DFBPPR4450 ---- Plant proteins ---- Copper transporter 3 Source.892: DFBPPR4452 ---- Plant proteins ---- CASP-like protein 5B3 Source.893: DFBPPR4458 ---- Plant proteins ---- CASP-like protein 2C2 Source.894: DFBPPR4461 ---- Plant proteins ---- Probable calcium-binding protein CML18 Source.895: DFBPPR4468 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1 homolog, chloroplastic Source.896: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2 Source.897: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3 Source.898: DFBPPR4488 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial Source.899: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2 Source.900: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1 Source.901: DFBPPR4500 ---- Plant proteins ---- Membrane protein PM19L Source.902: DFBPPR4501 ---- Plant proteins ---- Metallothionein-like protein 4B Source.903: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5 Source.904: DFBPPR4520 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 33 Source.905: DFBPPR4522 ---- Plant proteins ---- Probable calcium-binding protein CML25/26 Source.906: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic Source.907: DFBPPR4531 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 63 Source.908: DFBPPR4537 ---- Plant proteins ---- Elongation factor 1-gamma 3 Source.909: DFBPPR4543 ---- Plant proteins ---- Tubby-like F-box protein 14 Source.910: DFBPPR4547 ---- Plant proteins ---- Probable calcium-binding protein CML31 Source.911: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300 Source.912: DFBPPR4553 ---- Plant proteins ---- Phospholipase A1-II 7 Source.913: DFBPPR4555 ---- Plant proteins ---- Actin-related protein 9 Source.914: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1 Source.915: DFBPPR4572 ---- Plant proteins ---- DNA-binding protein S1FA1 Source.916: DFBPPR4578 ---- Plant proteins ---- Protein argonaute 1D Source.917: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200 Source.918: DFBPPR4588 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 65 Source.919: DFBPPR4590 ---- Plant proteins ---- Protein MEI2-like 5 Source.920: DFBPPR4596 ---- Plant proteins ---- Putative calcium-binding protein CML19 Source.921: DFBPPR4597 ---- Plant proteins ---- Putative calcium-binding protein CML23 Source.922: DFBPPR4607 ---- Plant proteins ---- Protein LOL2 Source.923: DFBPPR4610 ---- Plant proteins ---- Protein LOL3 Source.924: DFBPPR4615 ---- Plant proteins ---- CASP-like protein 1U3 Source.925: DFBPPR4620 ---- Plant proteins ---- Protein LOL1 Source.926: DFBPPR4635 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 43 Source.927: DFBPPR4640 ---- Plant proteins ---- Protein Brevis radix-like 4 Source.928: DFBPPR4641 ---- Plant proteins ---- Ninja-family protein Os07g0602900 Source.929: DFBPPR4643 ---- Plant proteins ---- 40S ribosomal protein S7 Source.930: DFBPPR4650 ---- Plant proteins ---- BURP domain-containing protein 2 Source.931: DFBPPR4656 ---- Plant proteins ---- SPX domain-containing membrane protein Os09g0521800 Source.932: DFBPPR4665 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 24 Source.933: DFBPPR4667 ---- Plant proteins ---- Zinc finger A20 and AN1 domain-containing stress-associated protein 4 Source.934: DFBPPR4670 ---- Plant proteins ---- Tubby-like F-box protein 1 Source.935: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1 Source.936: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3 Source.937: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1 Source.938: DFBPPR4692 ---- Plant proteins ---- Probable protein ABIL4 Source.939: DFBPPR4699 ---- Plant proteins ---- Probable GTP-binding protein OBGC2 Source.940: DFBPPR4700 ---- Plant proteins ---- Protein DEHYDRATION-INDUCED 19 homolog 6 Source.941: DFBPPR4707 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 32 Source.942: DFBPPR4710 ---- Plant proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1 Source.943: DFBPPR4711 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 51 Source.944: DFBPPR4716 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 5 Source.945: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50 Source.946: DFBPPR4724 ---- Plant proteins ---- Anoctamin-like protein Os01g0706700 Source.947: DFBPPR4733 ---- Plant proteins ---- B3 domain-containing protein Os07g0679700 Source.948: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67 Source.949: DFBPPR4739 ---- Plant proteins ---- B3 domain-containing protein Os03g0620400 Source.950: DFBPPR4742 ---- Plant proteins ---- Putative aldehyde oxidase-like protein Source.951: DFBPPR4751 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 30 Source.952: DFBPPR4758 ---- Plant proteins ---- BURP domain-containing protein 7 Source.953: DFBPPR4759 ---- Plant proteins ---- 60S ribosomal protein L18a Source.954: DFBPPR4761 ---- Plant proteins ---- Zinc finger AN1 domain-containing stress-associated protein 13 Source.955: DFBPPR4762 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 35 Source.956: DFBPPR4770 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 4 Source.957: DFBPPR4782 ---- Plant proteins ---- BURP domain-containing protein 10 Source.958: DFBPPR4788 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600 Source.959: DFBPPR4802 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 34 Source.960: DFBPPR4803 ---- Plant proteins ---- B3 domain-containing protein Os11g0156000 Source.961: DFBPPR4813 ---- Plant proteins ---- Putative B3 domain-containing protein Os08g0157700 Source.962: DFBPPR4827 ---- Plant proteins ---- BURP domain-containing protein 1 Source.963: DFBPPR4834 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 66 Source.964: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2 Source.965: DFBPPR4840 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 3 Source.966: DFBPPR4841 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 5 Source.967: DFBPPR4850 ---- Plant proteins ---- Putative ripening-related protein 1 Source.968: DFBPPR4860 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600 Source.969: DFBPPR4862 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 37 Source.970: DFBPPR4878 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 10 Source.971: DFBPPR4890 ---- Plant proteins ---- NAC domain-containing protein 48 Source.972: DFBPPR4899 ---- Plant proteins ---- Casein kinase 1 Source.973: DFBPPR4901 ---- Plant proteins ---- Serine/threonine-protein kinase-like protein CR4 Source.974: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1 Source.975: DFBPPR4905 ---- Plant proteins ---- Light-regulated protein, chloroplastic Source.976: DFBPPR4907 ---- Plant proteins ---- Protein GLUTELIN PRECURSOR ACCUMULATION 3 Source.977: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10 Source.978: DFBPPR4912 ---- Plant proteins ---- Probable xyloglucan 6-xylosyltransferase 1 Source.979: DFBPPR4916 ---- Plant proteins ---- Anthranilate synthase alpha subunit 1, chloroplastic Source.980: DFBPPR4918 ---- Plant proteins ---- Protein kinase PINOID Source.981: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8 Source.982: DFBPPR4926 ---- Plant proteins ---- Beta-1,2-xylosyltransferase RCN11 Source.983: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic Source.984: DFBPPR4931 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 2 Source.985: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic Source.986: DFBPPR4938 ---- Plant proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit 2, mitochondrial Source.987: DFBPPR4939 ---- Plant proteins ---- Telomere-binding protein 1 Source.988: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.989: DFBPPR4944 ---- Plant proteins ---- B3 domain-containing protein LFL1 Source.990: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6 Source.991: DFBPPR4952 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0676650 Source.992: DFBPPR4965 ---- Plant proteins ---- Glycinin G1 Source.993: DFBPPR4971 ---- Plant proteins ---- Purple acid phosphatase Source.994: DFBPPR4973 ---- Plant proteins ---- Glycinin G2 Source.995: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1 Source.996: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP] Source.997: DFBPPR4992 ---- Plant proteins ---- Glycinin G3 Source.998: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase Source.999: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme Source.1000: DFBPPR5021 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.1001: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.1002: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform Source.1003: DFBPPR5038 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.1004: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.1005: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.1006: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1007: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1 Source.1008: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase Source.1009: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.1010: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1011: DFBPPR5075 ---- Plant proteins ---- DNA polymerase delta catalytic subunit Source.1012: DFBPPR5076 ---- Plant proteins ---- Xyloglucan endotransglucosylase/hydrolase 1 Source.1013: DFBPPR5092 ---- Plant proteins ---- Glutathione S-transferase 3 Source.1014: DFBPPR5099 ---- Plant proteins ---- Metalloendoproteinase 1 Source.1015: DFBPPR5101 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic Source.1016: DFBPPR5116 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1017: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.1018: DFBPPR5119 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-6 Source.1019: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1020: DFBPPR5125 ---- Plant proteins ---- G2/mitotic-specific cyclin S13-7 Source.1021: DFBPPR5142 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.1022: DFBPPR5153 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1023: DFBPPR5156 ---- Plant proteins ---- UDP-glycosyltransferase 79B30 Source.1024: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1 Source.1025: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1026: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1027: DFBPPR5173 ---- Plant proteins ---- Stem 31 kDa glycoprotein Source.1028: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6 Source.1029: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7 Source.1030: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1 Source.1031: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5 Source.1032: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2 Source.1033: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3 Source.1034: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214 Source.1035: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme Source.1036: DFBPPR5238 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1037: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein Source.1038: DFBPPR5265 ---- Plant proteins ---- Auxin-induced protein AUX22 Source.1039: DFBPPR5271 ---- Plant proteins ---- Auxin-induced protein AUX28 Source.1040: DFBPPR5275 ---- Plant proteins ---- Cytochrome P450 71D9 Source.1041: DFBPPR5280 ---- Plant proteins ---- CASP-like protein 6 Source.1042: DFBPPR5283 ---- Plant proteins ---- Actin-3 Source.1043: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2 Source.1044: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2 Source.1045: DFBPPR5304 ---- Plant proteins ---- Maturase K Source.1046: DFBPPR5312 ---- Plant proteins ---- CASP-like protein 2D1 Source.1047: DFBPPR5330 ---- Plant proteins ---- CASP-like protein 2C1 Source.1048: DFBPPR5377 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1, chloroplastic Source.1049: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1 Source.1050: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase Source.1051: DFBPPR5383 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.1052: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.1053: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1 Source.1054: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase Source.1055: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic Source.1056: DFBPPR5400 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.1057: DFBPPR5405 ---- Plant proteins ---- Terpene synthase 2, chloroplastic Source.1058: DFBPPR5408 ---- Plant proteins ---- 7-epi-sesquithujene synthase Source.1059: DFBPPR5409 ---- Plant proteins ---- Sesquithujene synthase A Source.1060: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic Source.1061: DFBPPR5413 ---- Plant proteins ---- Putative receptor protein kinase CRINKLY4 Source.1062: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase Source.1063: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1 Source.1064: DFBPPR5433 ---- Plant proteins ---- DIBOA-glucoside dioxygenase BX6 Source.1065: DFBPPR5434 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1 Source.1066: DFBPPR5437 ---- Plant proteins ---- Exopolygalacturonase Source.1067: DFBPPR5442 ---- Plant proteins ---- GRF-interacting factor 1 Source.1068: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic Source.1069: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1 Source.1070: DFBPPR5447 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 1, chloroplastic Source.1071: DFBPPR5451 ---- Plant proteins ---- Histone deacetylase HDT1 Source.1072: DFBPPR5456 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 2, chloroplastic Source.1073: DFBPPR5462 ---- Plant proteins ---- Cysteine--tRNA ligase CPS1, chloroplastic/mitochondrial Source.1074: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic Source.1075: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase Source.1076: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1077: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic Source.1078: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1079: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic Source.1080: DFBPPR5481 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic Source.1081: DFBPPR5483 ---- Plant proteins ---- Caffeic acid 3-O-methyltransferase Source.1082: DFBPPR5498 ---- Plant proteins ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase Source.1083: DFBPPR5502 ---- Plant proteins ---- Tubulin alpha-3 chain Source.1084: DFBPPR5509 ---- Plant proteins ---- Tubulin alpha-1 chain Source.1085: DFBPPR5513 ---- Plant proteins ---- Bifunctional TENA2 protein Source.1086: DFBPPR5514 ---- Plant proteins ---- Tubulin alpha-2 chain Source.1087: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic Source.1088: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2 Source.1089: DFBPPR5527 ---- Plant proteins ---- Exopolygalacturonase Source.1090: DFBPPR5528 ---- Plant proteins ---- Exopolygalacturonase Source.1091: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1092: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic Source.1093: DFBPPR5536 ---- Plant proteins ---- FACT complex subunit SSRP1 Source.1094: DFBPPR5540 ---- Plant proteins ---- Tubulin alpha-5 chain Source.1095: DFBPPR5541 ---- Plant proteins ---- Tubulin alpha-6 chain Source.1096: DFBPPR5542 ---- Plant proteins ---- Inactive sesquithujene synthase Source.1097: DFBPPR5543 ---- Plant proteins ---- Bifunctional dihydrofolate reductase-thymidylate synthase Source.1098: DFBPPR5548 ---- Plant proteins ---- DNA repair protein RAD51 homolog B Source.1099: DFBPPR5555 ---- Plant proteins ---- Chaperonin CPN60-1, mitochondrial Source.1100: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.1101: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1102: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic Source.1103: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic Source.1104: DFBPPR5579 ---- Plant proteins ---- Indole-3-acetaldehyde oxidase Source.1105: DFBPPR5587 ---- Plant proteins ---- Protein PHOTOSYSTEM I ASSEMBLY 2, chloroplastic Source.1106: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1107: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2 Source.1108: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic Source.1109: DFBPPR5600 ---- Plant proteins ---- Chorismate mutase 2, cytosolic Source.1110: DFBPPR5601 ---- Plant proteins ---- Protein HIRA Source.1111: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1 Source.1112: DFBPPR5605 ---- Plant proteins ---- Oleosin Zm-I Source.1113: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic Source.1114: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic Source.1115: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1 Source.1116: DFBPPR5633 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1117: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic Source.1118: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1 Source.1119: DFBPPR5645 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1120: DFBPPR5657 ---- Plant proteins ---- Cytochrome P450 88A1 Source.1121: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic Source.1122: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1 Source.1123: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1124: DFBPPR5669 ---- Plant proteins ---- Cytochrome b Source.1125: DFBPPR5682 ---- Plant proteins ---- Probable terpene synthase 3, chloroplastic Source.1126: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1 Source.1127: DFBPPR5698 ---- Plant proteins ---- Phytochrome A Source.1128: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase Source.1129: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic Source.1130: DFBPPR5707 ---- Plant proteins ---- indole-2-monooxygenase Source.1131: DFBPPR5708 ---- Plant proteins ---- 3-hydroxyindolin-2-one monooxygenase Source.1132: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase Source.1133: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2 Source.1134: DFBPPR5745 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 1 Source.1135: DFBPPR5746 ---- Plant proteins ---- Mitochondrial thiamine diphosphate carrier 2 Source.1136: DFBPPR5748 ---- Plant proteins ---- Anthranilate O-methyltransferase 2 Source.1137: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1 Source.1138: DFBPPR5757 ---- Plant proteins ---- Tetratricopeptide repeat domain-containing protein PYG7, chloroplastic Source.1139: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1140: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3 Source.1141: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.1142: DFBPPR5785 ---- Plant proteins ---- (E)-beta-caryophyllene synthase Source.1143: DFBPPR5798 ---- Plant proteins ---- Inactive sesquithujene synthase B Source.1144: DFBPPR5818 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ2 Source.1145: DFBPPR5824 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.1146: DFBPPR5831 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.1147: DFBPPR5834 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4E-2 Source.1148: DFBPPR5835 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.1149: DFBPPR5841 ---- Plant proteins ---- Actin-1 Source.1150: DFBPPR5847 ---- Plant proteins ---- Large ribosomal RNA subunit accumulation protein YCED homolog 1, chloroplastic Source.1151: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2 Source.1152: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3 Source.1153: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1 Source.1154: DFBPPR5859 ---- Plant proteins ---- 30S ribosomal protein S18, chloroplastic Source.1155: DFBPPR5861 ---- Plant proteins ---- Endo-1,3;1,4-beta-D-glucanase Source.1156: DFBPPR5871 ---- Plant proteins ---- Cell number regulator 2 Source.1157: DFBPPR5889 ---- Plant proteins ---- Homeobox protein rough sheath 1 Source.1158: DFBPPR5900 ---- Plant proteins ---- Histone deacetylase HDT2 Source.1159: DFBPPR5904 ---- Plant proteins ---- Histone-lysine N-methyltransferase EZ3 Source.1160: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase Source.1161: DFBPPR5908 ---- Plant proteins ---- Chalcone synthase WHP1 Source.1162: DFBPPR5912 ---- Plant proteins ---- Histone deacetylase HDT3 Source.1163: DFBPPR5913 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.1164: DFBPPR5920 ---- Plant proteins ---- Cell number regulator 1 Source.1165: DFBPPR5926 ---- Plant proteins ---- Chalcone synthase C2 Source.1166: DFBPPR5938 ---- Plant proteins ---- WUSCHEL-related homeobox 3A Source.1167: DFBPPR5946 ---- Plant proteins ---- Maturase K Source.1168: DFBPPR5948 ---- Plant proteins ---- Aquaporin TIP3-1 Source.1169: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B Source.1170: DFBPPR5958 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.1171: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein Source.1172: DFBPPR5989 ---- Plant proteins ---- CASP-like protein 1C2 Source.1173: DFBPPR6002 ---- Plant proteins ---- Aquaporin TIP3-2 Source.1174: DFBPPR6008 ---- Plant proteins ---- Zein-beta Source.1175: DFBPPR6013 ---- Plant proteins ---- Cell number regulator 9 Source.1176: DFBPPR6018 ---- Plant proteins ---- Probable tocopherol cyclase, chloroplastic Source.1177: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP) Source.1178: DFBPPR6052 ---- Plant proteins ---- Cystatin-1 Source.1179: DFBPPR6053 ---- Plant proteins ---- CASP-like protein 5B3 Source.1180: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1 Source.1181: DFBPPR6083 ---- Plant proteins ---- Cell number regulator 7 Source.1182: DFBPPR6092 ---- Plant proteins ---- Cell number regulator 10 Source.1183: DFBPPR6106 ---- Plant proteins ---- Cell number regulator 4 Source.1184: DFBPPR6112 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial Source.1185: DFBPPR6125 ---- Plant proteins ---- Cell number regulator 3 Source.1186: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein Source.1187: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase Source.1188: DFBPPR6177 ---- Plant proteins ---- Unknown protein from spot 159 of 2D-PAGE of etiolated coleoptile Source.1189: DFBPPR6187 ---- Plant proteins ---- Transposable element activator uncharacterized 12 kDa protein Source.1190: DFBPPR6207 ---- Plant proteins ---- Chaperonin CPN60-2, mitochondrial Source.1191: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial Source.1192: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial Source.1193: DFBPPR6224 ---- Plant proteins ---- Ferredoxin--NADP reductase, leaf isozyme, chloroplastic Source.1194: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.1195: DFBPPR6228 ---- Plant proteins ---- Probable UDP-arabinopyranose mutase 1 Source.1196: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic Source.1197: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase Source.1198: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.1199: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2 Source.1200: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.1201: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic Source.1202: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic Source.1203: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1204: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic Source.1205: DFBPPR6284 ---- Plant proteins ---- Tubulin alpha-1 chain Source.1206: DFBPPR6291 ---- Plant proteins ---- Translocon at the outer membrane of chloroplasts 64 Source.1207: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1208: DFBPPR6309 ---- Plant proteins ---- Cytochrome b Source.1209: DFBPPR6312 ---- Plant proteins ---- Mixed-amyrin synthase Source.1210: DFBPPR6316 ---- Plant proteins ---- Protein TIC 20, chloroplastic Source.1211: DFBPPR6323 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein COCH Source.1212: DFBPPR6333 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2 Source.1213: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1214: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic Source.1215: DFBPPR6347 ---- Plant proteins ---- Granule-bound starch synthase 2, chloroplastic/amyloplastic Source.1216: DFBPPR6348 ---- Plant proteins ---- Ferredoxin--NADP reductase, root isozyme, chloroplastic Source.1217: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase Source.1218: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1219: DFBPPR6369 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.1220: DFBPPR6380 ---- Plant proteins ---- Legumin A Source.1221: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase Source.1222: DFBPPR6396 ---- Plant proteins ---- Hydroxyproline O-arabinosyltransferase NOD3 Source.1223: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'' Source.1224: DFBPPR6412 ---- Plant proteins ---- Lipoyl synthase 1, mitochondrial Source.1225: DFBPPR6413 ---- Plant proteins ---- Lipoyl synthase 2, mitochondrial Source.1226: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase Source.1227: DFBPPR6425 ---- Plant proteins ---- Legumin A2 Source.1228: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6 Source.1229: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B Source.1230: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2 Source.1231: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A Source.1232: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3 Source.1233: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4 Source.1234: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5 Source.1235: DFBPPR6456 ---- Plant proteins ---- Nucleoside-triphosphatase Source.1236: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1 Source.1237: DFBPPR6471 ---- Plant proteins ---- Beta-amyrin synthase Source.1238: DFBPPR6473 ---- Plant proteins ---- OBERON-like protein Source.1239: DFBPPR6478 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.1240: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A Source.1241: DFBPPR6509 ---- Plant proteins ---- Auxin-induced protein IAA6 Source.1242: DFBPPR6542 ---- Plant proteins ---- Maturase K Source.1243: DFBPPR6550 ---- Plant proteins ---- Actin-3 Source.1244: DFBPPR6551 ---- Plant proteins ---- Actin-2 Source.1245: DFBPPR6552 ---- Plant proteins ---- Actin-1 Source.1246: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1247: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1248: DFBPPR6559 ---- Plant proteins ---- Truncated basic helix-loop-helix protein A Source.1249: DFBPPR6628 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1a, chloroplastic Source.1250: DFBPPR6629 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1d, chloroplastic Source.1251: DFBPPR6630 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1b, chloroplastic Source.1252: DFBPPR6631 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase 1c, chloroplastic Source.1253: DFBPPR6632 ---- Plant proteins ---- Tricetin 3',4',5'-O-trimethyltransferase Source.1254: DFBPPR6633 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.1255: DFBPPR6634 ---- Plant proteins ---- Xylanase inhibitor protein 1 Source.1256: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1 Source.1257: DFBPPR6644 ---- Plant proteins ---- Flavone O-methyltransferase 1 Source.1258: DFBPPR6659 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit Source.1259: DFBPPR6668 ---- Plant proteins ---- Cytochrome b Source.1260: DFBPPR6669 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.1261: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.1262: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic Source.1263: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3 Source.1264: DFBPPR6673 ---- Plant proteins ---- Alpha-amylase inhibitor 0.19 Source.1265: DFBPPR6677 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2 2 Source.1266: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1 Source.1267: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2 Source.1268: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1269: DFBPPR6701 ---- Plant proteins ---- Tubulin alpha chain Source.1270: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3 Source.1271: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2 Source.1272: DFBPPR6724 ---- Plant proteins ---- Putative ATP synthase protein YMF19 Source.1273: DFBPPR6731 ---- Plant proteins ---- Plasma membrane ATPase Source.1274: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1275: DFBPPR6737 ---- Plant proteins ---- Alpha-amylase inhibitor 0.53 Source.1276: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase Source.1277: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain Source.1278: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain Source.1279: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain Source.1280: DFBPPR6762 ---- Plant proteins ---- Nuclear ribonuclease Z Source.1281: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1282: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3 Source.1283: DFBPPR6781 ---- Plant proteins ---- Serpin-Z1A Source.1284: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.1285: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1 Source.1286: DFBPPR6797 ---- Plant proteins ---- Serpin-Z2B Source.1287: DFBPPR6799 ---- Plant proteins ---- Serpin-Z1B Source.1288: DFBPPR6804 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1289: DFBPPR6806 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1290: DFBPPR6811 ---- Plant proteins ---- Transcription factor HBP-1a Source.1291: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1292: DFBPPR6818 ---- Plant proteins ---- Serpin-Z2A Source.1293: DFBPPR6820 ---- Plant proteins ---- Serpin-Z1C Source.1294: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1295: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17 Source.1296: DFBPPR6840 ---- Plant proteins ---- 30S ribosomal protein S18, chloroplastic Source.1297: DFBPPR6862 ---- Plant proteins ---- Avenin-like b1 Source.1298: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1 Source.1299: DFBPPR6870 ---- Plant proteins ---- Homogentisate geranylgeranyltransferase Source.1300: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G Source.1301: DFBPPR6876 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1302: DFBPPR6882 ---- Plant proteins ---- Maturase K Source.1303: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1 Source.1304: DFBPPR6947 ---- Plant proteins ---- Avenin-like b5 Source.1305: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2 Source.1306: DFBPPR6959 ---- Plant proteins ---- Ninja-family protein 2 Source.1307: DFBPPR6963 ---- Plant proteins ---- Metallothionein-like protein 1 Source.1308: DFBPPR6966 ---- Plant proteins ---- Avenin-like b6 Source.1309: DFBPPR6969 ---- Plant proteins ---- Avenin-like b7 Source.1310: DFBPPR6985 ---- Plant proteins ---- Avenin-like b4 Source.1311: DFBPPR6986 ---- Plant proteins ---- Avenin-like b11 Source.1312: DFBPPR6988 ---- Plant proteins ---- Avenin-like b10 Source.1313: DFBPPR6989 ---- Plant proteins ---- Avenin-like b9 Source.1314: DFBPPR6990 ---- Plant proteins ---- Avenin-like b8 Source.1315: DFBPPR6992 ---- Plant proteins ---- Avenin-like b2 Source.1316: DFBPPR6993 ---- Plant proteins ---- Avenin-like b3 Source.1317: DFBPPR7006 ---- Plant proteins ---- WRKY transcription factor SUSIBA2 Source.1318: DFBPPR7012 ---- Plant proteins ---- Serine carboxypeptidase 2 Source.1319: DFBPPR7013 ---- Plant proteins ---- Protein MLO Source.1320: DFBPPR7017 ---- Plant proteins ---- Glutamyl-tRNA reductase 1, chloroplastic Source.1321: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic Source.1322: DFBPPR7022 ---- Plant proteins ---- Alpha-amylase inhibitor BMAI-1 Source.1323: DFBPPR7025 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2 Source.1324: DFBPPR7038 ---- Plant proteins ---- Serpin-Z7 Source.1325: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H] Source.1326: DFBPPR7043 ---- Plant proteins ---- Beta-amylase Source.1327: DFBPPR7057 ---- Plant proteins ---- Pyrophosphate-energized vacuolar membrane proton pump Source.1328: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1329: DFBPPR7059 ---- Plant proteins ---- Tubulin alpha-2 chain Source.1330: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1331: DFBPPR7064 ---- Plant proteins ---- Tubulin alpha-3 chain Source.1332: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.1333: DFBPPR7066 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.1334: DFBPPR7071 ---- Plant proteins ---- Serpin-Z4 Source.1335: DFBPPR7075 ---- Plant proteins ---- Mugineic-acid 3-dioxygenase Source.1336: DFBPPR7079 ---- Plant proteins ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase, chloroplastic Source.1337: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1 Source.1338: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic Source.1339: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY Source.1340: DFBPPR7086 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.1341: DFBPPR7089 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.1342: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic Source.1343: DFBPPR7093 ---- Plant proteins ---- Glutamyl-tRNA reductase 2 Source.1344: DFBPPR7099 ---- Plant proteins ---- Tubulin alpha-1 chain Source.1345: DFBPPR7100 ---- Plant proteins ---- Alanine aminotransferase 2 Source.1346: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1 Source.1347: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase Source.1348: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1349: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2 Source.1350: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.1351: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1 Source.1352: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.1353: DFBPPR7136 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GIV Source.1354: DFBPPR7147 ---- Plant proteins ---- Serpin-ZX Source.1355: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic Source.1356: DFBPPR7150 ---- Plant proteins ---- Alcohol dehydrogenase 1 Source.1357: DFBPPR7153 ---- Plant proteins ---- Alcohol dehydrogenase 3 Source.1358: DFBPPR7155 ---- Plant proteins ---- Alcohol dehydrogenase 2 Source.1359: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase Source.1360: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3 Source.1361: DFBPPR7165 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase A, chloroplastic Source.1362: DFBPPR7170 ---- Plant proteins ---- Maturase K Source.1363: DFBPPR7174 ---- Plant proteins ---- Photosystem I reaction center subunit XI, chloroplastic Source.1364: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic Source.1365: DFBPPR7195 ---- Plant proteins ---- Chalcone synthase 2 Source.1366: DFBPPR7210 ---- Plant proteins ---- V-type proton ATPase subunit B 2 Source.1367: DFBPPR7211 ---- Plant proteins ---- V-type proton ATPase subunit B 1 Source.1368: DFBPPR7212 ---- Plant proteins ---- Dihydroflavonol 4-reductase Source.1369: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase Source.1370: DFBPPR7220 ---- Plant proteins ---- Chalcone synthase 1 Source.1371: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit Source.1372: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase Source.1373: DFBPPR7241 ---- Plant proteins ---- Cysteine proteinase EP-B 2 Source.1374: DFBPPR7249 ---- Plant proteins ---- Cysteine proteinase EP-B 1 Source.1375: DFBPPR7263 ---- Plant proteins ---- Ribulose bisphosphate carboxylase/oxygenase activase B, chloroplastic Source.1376: DFBPPR7308 ---- Plant proteins ---- 30S ribosomal protein S18, chloroplastic Source.1377: DFBPPR7322 ---- Plant proteins ---- Metallothionein-like protein 1 Source.1378: DFBPPR7338 ---- Plant proteins ---- 60S ribosomal protein L24 Source.1379: DFBPPR7342 ---- Plant proteins ---- 40S ribosomal protein S7 Source.1380: DFBPPR7402 ---- Plant proteins ---- Probable pectinesterase/pectinesterase inhibitor Source.1381: DFBPPR7405 ---- Plant proteins ---- Sinapine esterase Source.1382: DFBPPR7409 ---- Plant proteins ---- 3-isopropylmalate dehydrogenase, chloroplastic Source.1383: DFBPPR7424 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 A, chloroplastic Source.1384: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic Source.1385: DFBPPR7427 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic Source.1386: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412 Source.1387: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405 Source.1388: DFBPPR7434 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic Source.1389: DFBPPR7437 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic Source.1390: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A Source.1391: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic Source.1392: DFBPPR7455 ---- Plant proteins ---- Phosphoglucomutase, chloroplastic Source.1393: DFBPPR7467 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 2, chloroplastic Source.1394: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial Source.1395: DFBPPR7479 ---- Plant proteins ---- Short-chain dehydrogenase TIC 32 B, chloroplastic Source.1396: DFBPPR7484 ---- Plant proteins ---- Oleosin Bn-III Source.1397: DFBPPR7486 ---- Plant proteins ---- Major oleosin NAP-II Source.1398: DFBPPR7487 ---- Plant proteins ---- Malate dehydrogenase, mitochondrial Source.1399: DFBPPR7488 ---- Plant proteins ---- Homeobox protein HD1 Source.1400: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1 Source.1401: DFBPPR7492 ---- Plant proteins ---- Thioredoxin F-type, chloroplastic Source.1402: DFBPPR7494 ---- Plant proteins ---- Putative ATP synthase protein YMF19 Source.1403: DFBPPR7495 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, cytosolic Source.1404: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1 Source.1405: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2 Source.1406: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION Source.1407: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1408: DFBPPR7519 ---- Plant proteins ---- Chaperonin CPN60, mitochondrial Source.1409: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A Source.1410: DFBPPR7526 ---- Plant proteins ---- Inositol-3-phosphate synthase Source.1411: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C Source.1412: DFBPPR7536 ---- Plant proteins ---- 60S ribosomal protein L16, mitochondrial Source.1413: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase Source.1414: DFBPPR7603 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.1415: DFBPPR7608 ---- Milk proteins ---- Kappa-casein Source.1416: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1 Source.1417: DFBPPR7624 ---- Milk proteins ---- Pancreatic lipase-related protein 2 Source.1418: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4 Source.1419: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2 Source.1420: DFBPPR7635 ---- Milk proteins ---- Prosaposin Source.1421: DFBPPR7639 ---- Milk proteins ---- MICAL-like protein 2 Source.1422: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase Source.1423: DFBPPR7649 ---- Milk proteins ---- Cadherin-1 Source.1424: DFBPPR7652 ---- Milk proteins ---- Zinc transporter 4 Source.1425: DFBPPR7653 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.1426: DFBPPR7665 ---- Milk proteins ---- Beta-casein Source.1427: DFBPPR7693 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.1428: DFBPPR7699 ---- Milk proteins ---- Chymosin Source.1429: DFBPPR7720 ---- Plant proteins ---- Avenacosidase 1 Source.1430: DFBPPR7724 ---- Plant proteins ---- Avenacosidase 2 Source.1431: DFBPPR7731 ---- Plant proteins ---- Tubulin alpha chain Source.1432: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase Source.1433: DFBPPR7744 ---- Plant proteins ---- Maturase K Source.1434: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta Source.1435: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH] Source.1436: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic Source.1437: DFBPPR8199 ---- Plant proteins ---- Citrate synthase, glyoxysomal Source.1438: DFBPPR8201 ---- Plant proteins ---- 16 kDa phloem protein 1 Source.1439: DFBPPR8202 ---- Plant proteins ---- 16 kDa phloem protein 2 Source.1440: DFBPPR8205 ---- Plant proteins ---- DELLA protein GAIP Source.1441: DFBPPR8206 ---- Plant proteins ---- DELLA protein GAIP-B Source.1442: DFBPPR8207 ---- Plant proteins ---- Malate synthase, glyoxysomal Source.1443: DFBPPR8370 ---- Plant proteins ---- Maturase K Source.1444: DFBPPR8380 ---- Plant proteins ---- Major allergen Api g 1, isoallergen 2 Source.1445: DFBPPR8393 ---- Plant proteins ---- Stilbene synthase 3 Source.1446: DFBPPR8396 ---- Plant proteins ---- Putative stilbene synthase 2 Source.1447: DFBPPR8397 ---- Plant proteins ---- Stilbene synthase 1 Source.1448: DFBPPR8419 ---- Plant proteins ---- Arachin 21 kDa protein Source.1449: DFBPPR8422 ---- Plant proteins ---- 11-beta-hydroxysteroid dehydrogenase A Source.1450: DFBPPR8445 ---- Plant proteins ---- Maturase K Source.1451: DFBPPR8448 ---- Plant proteins ---- Maturase K Source.1452: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic Source.1453: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein Source.1454: DFBPPR8462 ---- Plant proteins ---- 30S ribosomal protein S18, chloroplastic Source.1455: DFBPPR8469 ---- Plant proteins ---- Chalcone synthase 2 Source.1456: DFBPPR8470 ---- Plant proteins ---- Chalcone synthase 1 Source.1457: DFBPPR8483 ---- Plant proteins ---- 40S ribosomal protein S7 Source.1458: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1 Source.1459: DFBPPR8498 ---- Milk proteins ---- Xanthine dehydrogenase/oxidase Source.1460: DFBPPR8503 ---- Milk proteins ---- Lipoprotein lipase Source.1461: DFBPPR8505 ---- Milk proteins ---- Chymosin Source.1462: DFBPPR8506 ---- Milk proteins ---- Signal transducer and activator of transcription 5A Source.1463: DFBPPR8524 ---- Milk proteins ---- Lactogenin Source.1464: DFBPPR15941 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.1465: DFBPPR15942 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3B Source.1466: DFBPPR15945 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.1467: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2 Source.1468: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.1469: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1 Source.1470: DFBPPR15958 ---- Animal proteins ---- Myosin-9 Source.1471: DFBPPR15963 ---- Animal proteins ---- Cadherin-1 Source.1472: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1 Source.1473: DFBPPR15965 ---- Animal proteins ---- Dystroglycan Source.1474: DFBPPR15974 ---- Animal proteins ---- Androgen receptor Source.1475: DFBPPR15976 ---- Animal proteins ---- T-box transcription factor T Source.1476: DFBPPR15980 ---- Animal proteins ---- Peroxisome proliferator-activated receptor alpha Source.1477: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta Source.1478: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1 Source.1479: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor Source.1480: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9 Source.1481: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.1482: DFBPPR15995 ---- Animal proteins ---- Ras-related protein Rab-5A Source.1483: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1484: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase Source.1485: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2 Source.1486: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.1487: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1 Source.1488: DFBPPR16022 ---- Animal proteins ---- Phospholipase A2 group XV Source.1489: DFBPPR16027 ---- Animal proteins ---- Rho GTPase-activating protein 35 Source.1490: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.1491: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.1492: DFBPPR16033 ---- Animal proteins ---- Phosphatidylinositol 3,4,5-trisphosphate 3-phosphatase and dual-specificity protein phosphatase PTEN Source.1493: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5 Source.1494: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2 Source.1495: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1 Source.1496: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1497: DFBPPR16056 ---- Animal proteins ---- Glutamine synthetase Source.1498: DFBPPR16059 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.1499: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type Source.1500: DFBPPR16067 ---- Animal proteins ---- CD40 ligand Source.1501: DFBPPR16077 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.1502: DFBPPR16084 ---- Animal proteins ---- T-box transcription factor TBX2 Source.1503: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.1504: DFBPPR16093 ---- Animal proteins ---- Menin Source.1505: DFBPPR16095 ---- Animal proteins ---- Myosin-7 Source.1506: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor Source.1507: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1508: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2 Source.1509: DFBPPR16111 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.1510: DFBPPR16118 ---- Animal proteins ---- Signal recognition particle 54 kDa protein Source.1511: DFBPPR16121 ---- Animal proteins ---- Vitamin K-dependent protein C Source.1512: DFBPPR16125 ---- Animal proteins ---- Heat shock factor protein 4 Source.1513: DFBPPR16128 ---- Animal proteins ---- Cubilin Source.1514: DFBPPR16129 ---- Animal proteins ---- Cytochrome P450 3A12 Source.1515: DFBPPR16130 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.1516: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1517: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.1518: DFBPPR16156 ---- Animal proteins ---- Ras-related protein Rab-22A Source.1519: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1 Source.1520: DFBPPR16168 ---- Animal proteins ---- Annexin A2 Source.1521: DFBPPR16170 ---- Animal proteins ---- Inversin Source.1522: DFBPPR16173 ---- Animal proteins ---- Aromatase Source.1523: DFBPPR16174 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.1524: DFBPPR16177 ---- Animal proteins ---- Adhesion G protein-coupled receptor E2 Source.1525: DFBPPR16178 ---- Animal proteins ---- Wee1-like protein kinase 2 Source.1526: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.1527: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.1528: DFBPPR16193 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.1529: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1 Source.1530: DFBPPR16201 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator Source.1531: DFBPPR16204 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.1532: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.1533: DFBPPR16206 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.1534: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1 Source.1535: DFBPPR16208 ---- Animal proteins ---- Ammonium transporter Rh type B Source.1536: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.1537: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.1538: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor Source.1539: DFBPPR16214 ---- Animal proteins ---- Insulin-like growth factor I Source.1540: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.1541: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha Source.1542: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2 Source.1543: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.1544: DFBPPR16224 ---- Animal proteins ---- Uromodulin Source.1545: DFBPPR16227 ---- Animal proteins ---- Myelin proteolipid protein Source.1546: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72 Source.1547: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.1548: DFBPPR16241 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.1549: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.1550: DFBPPR16244 ---- Animal proteins ---- Interleukin-2 Source.1551: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.1552: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a Source.1553: DFBPPR16254 ---- Animal proteins ---- Transferrin receptor protein 1 Source.1554: DFBPPR16255 ---- Animal proteins ---- Frizzled-6 Source.1555: DFBPPR16256 ---- Animal proteins ---- Transcription factor GATA-4 Source.1556: DFBPPR16263 ---- Animal proteins ---- Protein 4.1 Source.1557: DFBPPR16265 ---- Animal proteins ---- Caspase-1 Source.1558: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C Source.1559: DFBPPR16271 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.1560: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1 Source.1561: DFBPPR16278 ---- Animal proteins ---- Major prion protein Source.1562: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor Source.1563: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain Source.1564: DFBPPR16304 ---- Animal proteins ---- Cathepsin K Source.1565: DFBPPR16313 ---- Animal proteins ---- Ras-related protein Rab-5C Source.1566: DFBPPR16314 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.1567: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1 Source.1568: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1 Source.1569: DFBPPR16322 ---- Animal proteins ---- Interleukin-18 Source.1570: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.1571: DFBPPR16337 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.1572: DFBPPR16339 ---- Animal proteins ---- Dynamin-binding protein Source.1573: DFBPPR16340 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain Source.1574: DFBPPR16342 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.1575: DFBPPR16343 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.1576: DFBPPR16434 ---- Animal proteins ---- Thyrotropin subunit beta Source.1577: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme Source.1578: DFBPPR16438 ---- Animal proteins ---- Myosin-13 Source.1579: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6 Source.1580: DFBPPR16444 ---- Animal proteins ---- Interleukin-33 Source.1581: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2 Source.1582: DFBPPR16455 ---- Animal proteins ---- Substance-P receptor Source.1583: DFBPPR16461 ---- Animal proteins ---- InaD-like protein Source.1584: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.1585: DFBPPR16484 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain Source.1586: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII Source.1587: DFBPPR16499 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 5 Source.1588: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein Source.1589: DFBPPR16506 ---- Animal proteins ---- Pepsin B Source.1590: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor Source.1591: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor Source.1592: DFBPPR16519 ---- Animal proteins ---- Palmitoyltransferase ZDHHC8 Source.1593: DFBPPR16523 ---- Animal proteins ---- Hepatocyte growth factor activator Source.1594: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.1595: DFBPPR16531 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3 Source.1596: DFBPPR16535 ---- Animal proteins ---- Cobalamin binding intrinsic factor Source.1597: DFBPPR16548 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.1598: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor Source.1599: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.1600: DFBPPR16559 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.1601: DFBPPR16560 ---- Animal proteins ---- Keratinocyte-associated protein 2 Source.1602: DFBPPR16563 ---- Animal proteins ---- Myosin-16 Source.1603: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.1604: DFBPPR16575 ---- Animal proteins ---- Dystrophin Source.1605: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3 Source.1606: DFBPPR16587 ---- Animal proteins ---- B-lymphocyte antigen CD20 Source.1607: DFBPPR16590 ---- Animal proteins ---- Arylsulfatase K Source.1608: DFBPPR16591 ---- Animal proteins ---- Gamma-crystallin S Source.1609: DFBPPR16592 ---- Animal proteins ---- T-box transcription factor TBX4 Source.1610: DFBPPR16602 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial Source.1611: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2 Source.1612: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1 Source.1613: DFBPPR16612 ---- Animal proteins ---- T-box transcription factor TBX19 Source.1614: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.1615: DFBPPR16630 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.1616: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10 Source.1617: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.1618: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5 Source.1619: DFBPPR16661 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.1620: DFBPPR16676 ---- Animal proteins ---- Olfactory receptor-like protein OLF2 Source.1621: DFBPPR16680 ---- Animal proteins ---- Gastrin-releasing peptide Source.1622: DFBPPR16681 ---- Animal proteins ---- Olfactory receptor-like protein OLF3 Source.1623: DFBPPR16686 ---- Animal proteins ---- Olfactory receptor-like protein DTMT Source.1624: DFBPPR16688 ---- Animal proteins ---- Olfactory receptor-like protein OLF4 Source.1625: DFBPPR16705 ---- Animal proteins ---- G2/mitotic-specific cyclin-B3 Source.1626: DFBPPR16706 ---- Animal proteins ---- 60S ribosomal protein L19 Source.1627: DFBPPR16709 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.1628: DFBPPR16721 ---- Animal proteins ---- Testin Source.1629: DFBPPR16724 ---- Animal proteins ---- Calcitonin receptor-stimulating peptide 2 Source.1630: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10 Source.1631: DFBPPR16760 ---- Animal proteins ---- Carnitine O-acetyltransferase Source.1632: DFBPPR16765 ---- Animal proteins ---- Annexin A1 isoform p37 Source.1633: DFBPPR16774 ---- Animal proteins ---- Annexin A1 isoform p35 Source.1634: DFBPPR16775 ---- Animal proteins ---- Pinopsin Source.1635: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.1636: DFBPPR16795 ---- Animal proteins ---- AP-3 complex subunit delta-1 Source.1637: DFBPPR16805 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.1638: DFBPPR16831 ---- Animal proteins ---- Fibrinogen beta chain Source.1639: DFBPPR16836 ---- Animal proteins ---- Fibronectin Source.1640: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein Source.1641: DFBPPR16845 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.1642: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor Source.1643: DFBPPR16868 ---- Animal proteins ---- Insulin-like growth factor I Source.1644: DFBPPR16875 ---- Animal proteins ---- von Willebrand factor Source.1645: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase Source.1646: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.1647: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle Source.1648: DFBPPR16885 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.1649: DFBPPR16889 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 2, mitochondrial Source.1650: DFBPPR16892 ---- Animal proteins ---- Acyl-coenzyme A synthetase ACSM1, mitochondrial Source.1651: DFBPPR16900 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.1652: DFBPPR16901 ---- Animal proteins ---- Lens fiber membrane intrinsic protein Source.1653: DFBPPR16910 ---- Animal proteins ---- Casein kinase II subunit alpha Source.1654: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial Source.1655: DFBPPR16914 ---- Animal proteins ---- Phospholipase A2 group XV Source.1656: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase Source.1657: DFBPPR16922 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.1658: DFBPPR16923 ---- Animal proteins ---- TNF receptor-associated factor 6 Source.1659: DFBPPR16925 ---- Animal proteins ---- Supervillin Source.1660: DFBPPR16926 ---- Animal proteins ---- Very long-chain specific acyl-CoA dehydrogenase, mitochondrial Source.1661: DFBPPR16931 ---- Animal proteins ---- Low-density lipoprotein receptor Source.1662: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V Source.1663: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.1664: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1 Source.1665: DFBPPR16943 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.1666: DFBPPR16951 ---- Animal proteins ---- Prostaglandin E synthase 2 Source.1667: DFBPPR16952 ---- Animal proteins ---- Annexin A2 Source.1668: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A Source.1669: DFBPPR16954 ---- Animal proteins ---- Alpha-2-antiplasmin Source.1670: DFBPPR16962 ---- Animal proteins ---- Interleukin-18 Source.1671: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4 Source.1672: DFBPPR16975 ---- Animal proteins ---- Glycerophosphocholine choline phosphodiesterase ENPP6 Source.1673: DFBPPR16978 ---- Animal proteins ---- Enteropeptidase Source.1674: DFBPPR16979 ---- Animal proteins ---- Aquaporin-1 Source.1675: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3 Source.1676: DFBPPR16985 ---- Animal proteins ---- Filensin Source.1677: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase Source.1678: DFBPPR16995 ---- Animal proteins ---- Urea transporter 1 Source.1679: DFBPPR16997 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.1680: DFBPPR17010 ---- Animal proteins ---- Sestrin-2 Source.1681: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase Source.1682: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.1683: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase Source.1684: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.1685: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1 Source.1686: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.1687: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.1688: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2 Source.1689: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type Source.1690: DFBPPR17043 ---- Animal proteins ---- Protein kinase C beta type Source.1691: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase Source.1692: DFBPPR17051 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.1693: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin Source.1694: DFBPPR17056 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.1695: DFBPPR17059 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2B catalytic subunit alpha isoform Source.1696: DFBPPR17060 ---- Animal proteins ---- Sphingosine 1-phosphate receptor 1 Source.1697: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.1698: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5 Source.1699: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1 Source.1700: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.1701: DFBPPR17076 ---- Animal proteins ---- Ras-related protein Rab-3A Source.1702: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.1703: DFBPPR17079 ---- Animal proteins ---- Long-chain fatty acid transport protein 1 Source.1704: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36 Source.1705: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase Source.1706: DFBPPR17085 ---- Animal proteins ---- Cadherin-2 Source.1707: DFBPPR17087 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.1708: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4 Source.1709: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1 Source.1710: DFBPPR17099 ---- Animal proteins ---- cGMP-gated cation channel alpha-1 Source.1711: DFBPPR17102 ---- Animal proteins ---- Dystroglycan Source.1712: DFBPPR17103 ---- Animal proteins ---- Dystroglycan Source.1713: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2 Source.1714: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2 Source.1715: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta Source.1716: DFBPPR17126 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit Source.1717: DFBPPR17129 ---- Animal proteins ---- Inositol monophosphatase 1 Source.1718: DFBPPR17130 ---- Animal proteins ---- Glycine receptor subunit alpha-1 Source.1719: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.1720: DFBPPR17138 ---- Animal proteins ---- Casein kinase I isoform delta Source.1721: DFBPPR17139 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-2 Source.1722: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.1723: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.1724: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A Source.1725: DFBPPR17166 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel beta-1 Source.1726: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha Source.1727: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6 Source.1728: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33 Source.1729: DFBPPR17266 ---- Animal proteins ---- WASH complex subunit 1 Source.1730: DFBPPR17269 ---- Animal proteins ---- Phosphatidylinositol-glycan-specific phospholipase D Source.1731: DFBPPR17271 ---- Animal proteins ---- Phospholipid phosphatase 3 Source.1732: DFBPPR17273 ---- Animal proteins ---- Integrin-linked protein kinase Source.1733: DFBPPR17281 ---- Animal proteins ---- Proteinase-activated receptor 2 Source.1734: DFBPPR17282 ---- Animal proteins ---- Myosin-10 Source.1735: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7 Source.1736: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.1737: DFBPPR17289 ---- Animal proteins ---- Receptor-interacting serine/threonine-protein kinase 2 Source.1738: DFBPPR17291 ---- Animal proteins ---- Heat shock factor protein 1 Source.1739: DFBPPR17294 ---- Animal proteins ---- Ezrin Source.1740: DFBPPR17295 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.1741: DFBPPR17296 ---- Animal proteins ---- Dynamin-2 Source.1742: DFBPPR17300 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.1743: DFBPPR17306 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1 Source.1744: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein Source.1745: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2 Source.1746: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta Source.1747: DFBPPR17317 ---- Animal proteins ---- NACHT, LRR and PYD domains-containing protein 3 Source.1748: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.1749: DFBPPR17328 ---- Animal proteins ---- Ras-related protein Rab-5A Source.1750: DFBPPR17329 ---- Animal proteins ---- Steroidogenic factor 1 Source.1751: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X Source.1752: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI Source.1753: DFBPPR17341 ---- Animal proteins ---- Radixin Source.1754: DFBPPR17344 ---- Animal proteins ---- Neurexin-1 Source.1755: DFBPPR17348 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-1 Source.1756: DFBPPR17356 ---- Animal proteins ---- Proteinase-activated receptor 1 Source.1757: DFBPPR17363 ---- Animal proteins ---- Putative tyrosine-protein phosphatase auxilin Source.1758: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H Source.1759: DFBPPR17366 ---- Animal proteins ---- Beta-adrenergic receptor kinase 1 Source.1760: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1 Source.1761: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase Source.1762: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1 Source.1763: DFBPPR17381 ---- Animal proteins ---- Excitatory amino acid transporter 3 Source.1764: DFBPPR17382 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 5 Source.1765: DFBPPR17386 ---- Animal proteins ---- Epithelial membrane protein 2 Source.1766: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB Source.1767: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A Source.1768: DFBPPR17395 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase CYLD Source.1769: DFBPPR17397 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-2 Source.1770: DFBPPR17401 ---- Animal proteins ---- Moesin Source.1771: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme Source.1772: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1 Source.1773: DFBPPR17408 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.1774: DFBPPR17413 ---- Animal proteins ---- Protein kinase C alpha type Source.1775: DFBPPR17417 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.1776: DFBPPR17418 ---- Animal proteins ---- Casein kinase I isoform alpha Source.1777: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1 Source.1778: DFBPPR17424 ---- Animal proteins ---- G protein-coupled receptor kinase 5 Source.1779: DFBPPR17425 ---- Animal proteins ---- Dynamin-1 Source.1780: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5 Source.1781: DFBPPR17436 ---- Animal proteins ---- Ectonucleotide pyrophosphatase/phosphodiesterase family member 2 Source.1782: DFBPPR17438 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.1783: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1 Source.1784: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3 Source.1785: DFBPPR17459 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 3 Source.1786: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.1787: DFBPPR17470 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.1788: DFBPPR17471 ---- Animal proteins ---- Interstitial collagenase Source.1789: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2 Source.1790: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1 Source.1791: DFBPPR17479 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.1792: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1 Source.1793: DFBPPR17485 ---- Animal proteins ---- B-cell antigen receptor complex-associated protein alpha chain Source.1794: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta Source.1795: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4 Source.1796: DFBPPR17492 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-1 Source.1797: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id Source.1798: DFBPPR17499 ---- Animal proteins ---- Allograft inflammatory factor 1 Source.1799: DFBPPR17502 ---- Animal proteins ---- V-type proton ATPase subunit B, kidney isoform Source.1800: DFBPPR17512 ---- Animal proteins ---- ADP/ATP translocase 1 Source.1801: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.1802: DFBPPR17525 ---- Animal proteins ---- Neural Wiskott-Aldrich syndrome protein Source.1803: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3 Source.1804: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1 Source.1805: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.1806: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4 Source.1807: DFBPPR17566 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial Source.1808: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta Source.1809: DFBPPR17574 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial Source.1810: DFBPPR17595 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.1811: DFBPPR17596 ---- Animal proteins ---- [Pyruvate dehydrogenase [acetyl-transferring]]-phosphatase 1, mitochondrial Source.1812: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.1813: DFBPPR17601 ---- Animal proteins ---- Rab5 GDP/GTP exchange factor Source.1814: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta Source.1815: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.1816: DFBPPR17614 ---- Animal proteins ---- E3 ubiquitin-protein ligase ARIH1 Source.1817: DFBPPR17662 ---- Animal proteins ---- Glutathione S-transferase A1 Source.1818: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.1819: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.1820: DFBPPR17691 ---- Animal proteins ---- Integrin alpha-L Source.1821: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial Source.1822: DFBPPR17694 ---- Animal proteins ---- Pyridoxal kinase Source.1823: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B Source.1824: DFBPPR17735 ---- Animal proteins ---- Farnesyl pyrophosphate synthase Source.1825: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.1826: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2 Source.1827: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A Source.1828: DFBPPR17746 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 2 Source.1829: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.1830: DFBPPR17756 ---- Animal proteins ---- Ras-related protein Rab-3B Source.1831: DFBPPR17759 ---- Animal proteins ---- 3 beta-hydroxysteroid dehydrogenase/Delta 5-->4-isomerase Source.1832: DFBPPR17769 ---- Animal proteins ---- Polycomb complex protein BMI-1 Source.1833: DFBPPR17771 ---- Animal proteins ---- Thyrotropin subunit beta Source.1834: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase Source.1835: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V Source.1836: DFBPPR17785 ---- Animal proteins ---- MAP kinase-activated protein kinase 3 Source.1837: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor Source.1838: DFBPPR17794 ---- Animal proteins ---- Pyruvate carboxylase, mitochondrial Source.1839: DFBPPR17796 ---- Animal proteins ---- DNA damage-binding protein 1 Source.1840: DFBPPR17798 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.1841: DFBPPR17799 ---- Animal proteins ---- Gamma-synuclein Source.1842: DFBPPR17805 ---- Animal proteins ---- SNW domain-containing protein 1 Source.1843: DFBPPR17812 ---- Animal proteins ---- Dynein light chain Tctex-type 1 Source.1844: DFBPPR17814 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.1845: DFBPPR17816 ---- Animal proteins ---- Lumican Source.1846: DFBPPR17820 ---- Animal proteins ---- Osteomodulin Source.1847: DFBPPR17828 ---- Animal proteins ---- Aromatase Source.1848: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1 Source.1849: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor Source.1850: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B Source.1851: DFBPPR17838 ---- Animal proteins ---- Lon protease homolog, mitochondrial Source.1852: DFBPPR17845 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.1853: DFBPPR17848 ---- Animal proteins ---- 5'-3' exonuclease PLD3 Source.1854: DFBPPR17849 ---- Animal proteins ---- Fibromodulin Source.1855: DFBPPR17851 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.1856: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3 Source.1857: DFBPPR17857 ---- Animal proteins ---- Trifunctional enzyme subunit beta, mitochondrial Source.1858: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3 Source.1859: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1 Source.1860: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.1861: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.1862: DFBPPR17876 ---- Animal proteins ---- Secreted frizzled-related protein 3 Source.1863: DFBPPR17879 ---- Animal proteins ---- Menin Source.1864: DFBPPR17888 ---- Animal proteins ---- Cation-dependent mannose-6-phosphate receptor Source.1865: DFBPPR17889 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.1866: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3 Source.1867: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase Source.1868: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.1869: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain Source.1870: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.1871: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7 Source.1872: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3 Source.1873: DFBPPR17928 ---- Animal proteins ---- CD40 ligand Source.1874: DFBPPR17929 ---- Animal proteins ---- Phosphatidate cytidylyltransferase 2 Source.1875: DFBPPR17935 ---- Animal proteins ---- Polymeric immunoglobulin receptor Source.1876: DFBPPR17937 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.1877: DFBPPR17941 ---- Animal proteins ---- Hepatocyte growth factor-regulated tyrosine kinase substrate Source.1878: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog Source.1879: DFBPPR17945 ---- Animal proteins ---- Retinol dehydrogenase 10 Source.1880: DFBPPR17950 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40 Source.1881: DFBPPR17951 ---- Animal proteins ---- Phospholipase DDHD1 Source.1882: DFBPPR17953 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.1883: DFBPPR17967 ---- Animal proteins ---- Purine nucleoside phosphorylase Source.1884: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.1885: DFBPPR17980 ---- Animal proteins ---- Serine/threonine-protein kinase haspin Source.1886: DFBPPR17991 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.1887: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.1888: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK Source.1889: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10 Source.1890: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial Source.1891: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.1892: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein Source.1893: DFBPPR18019 ---- Animal proteins ---- Prostatic acid phosphatase Source.1894: DFBPPR18027 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.1895: DFBPPR18028 ---- Animal proteins ---- Atlastin-1 Source.1896: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta Source.1897: DFBPPR18035 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.1898: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase Source.1899: DFBPPR18055 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF8 Source.1900: DFBPPR18060 ---- Animal proteins ---- 2',5'-phosphodiesterase 12 Source.1901: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S Source.1902: DFBPPR18068 ---- Animal proteins ---- Annexin A11 Source.1903: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8 Source.1904: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8 Source.1905: DFBPPR18081 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase beta-4 Source.1906: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator Source.1907: DFBPPR18084 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.1908: DFBPPR18086 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.1909: DFBPPR18090 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1 Source.1910: DFBPPR18091 ---- Animal proteins ---- Urokinase-type plasminogen activator Source.1911: DFBPPR18094 ---- Animal proteins ---- Neutrophil cytosol factor 1 Source.1912: DFBPPR18097 ---- Animal proteins ---- Deoxycytidine kinase Source.1913: DFBPPR18099 ---- Animal proteins ---- Transcription factor NF-E2 45 kDa subunit Source.1914: DFBPPR18109 ---- Animal proteins ---- Synaptosomal-associated protein 29 Source.1915: DFBPPR18110 ---- Animal proteins ---- Protein inturned Source.1916: DFBPPR18113 ---- Animal proteins ---- Serine/threonine-protein kinase 38 Source.1917: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1 Source.1918: DFBPPR18119 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.1919: DFBPPR18120 ---- Animal proteins ---- Synaptic vesicular amine transporter Source.1920: DFBPPR18124 ---- Animal proteins ---- ADP/ATP translocase 3 Source.1921: DFBPPR18132 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.1922: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7 Source.1923: DFBPPR18140 ---- Animal proteins ---- Semaphorin-3C Source.1924: DFBPPR18141 ---- Animal proteins ---- Glutathione S-transferase LANCL1 Source.1925: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain Source.1926: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1 Source.1927: DFBPPR18161 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 2 Source.1928: DFBPPR18162 ---- Animal proteins ---- Renin receptor Source.1929: DFBPPR18164 ---- Animal proteins ---- Thromboxane-A synthase Source.1930: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2 Source.1931: DFBPPR18189 ---- Animal proteins ---- Palmitoyltransferase ZDHHC6 Source.1932: DFBPPR18198 ---- Animal proteins ---- V-type proton ATPase subunit B, brain isoform Source.1933: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.1934: DFBPPR18216 ---- Animal proteins ---- Collectin-12 Source.1935: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2 Source.1936: DFBPPR18225 ---- Animal proteins ---- Isovaleryl-CoA dehydrogenase, mitochondrial Source.1937: DFBPPR18226 ---- Animal proteins ---- Interleukin-1 receptor-associated kinase 4 Source.1938: DFBPPR18243 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit pi Source.1939: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3 Source.1940: DFBPPR18253 ---- Animal proteins ---- BOLA class I histocompatibility antigen, alpha chain BL3-7 Source.1941: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial Source.1942: DFBPPR18263 ---- Animal proteins ---- Neurocalcin-delta Source.1943: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2 Source.1944: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI Source.1945: DFBPPR18279 ---- Animal proteins ---- Sodium channel subunit beta-3 Source.1946: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase Source.1947: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20 Source.1948: DFBPPR18290 ---- Animal proteins ---- Cyclin-dependent kinase 10 Source.1949: DFBPPR18297 ---- Animal proteins ---- Casein kinase I isoform beta Source.1950: DFBPPR18298 ---- Animal proteins ---- Glucose-6-phosphatase Source.1951: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.1952: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial Source.1953: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10 Source.1954: DFBPPR18309 ---- Animal proteins ---- Tubulin alpha-4A chain Source.1955: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.1956: DFBPPR18333 ---- Animal proteins ---- Neuronal membrane glycoprotein M6-a Source.1957: DFBPPR18334 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.1958: DFBPPR18339 ---- Animal proteins ---- SPARC Source.1959: DFBPPR18342 ---- Animal proteins ---- Damage-control phosphatase ARMT1 Source.1960: DFBPPR18347 ---- Animal proteins ---- Nucleolar complex protein 2 homolog Source.1961: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.1962: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.1963: DFBPPR18357 ---- Animal proteins ---- Phosphatidylethanolamine N-methyltransferase Source.1964: DFBPPR18359 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.1965: DFBPPR18361 ---- Animal proteins ---- Casein kinase I isoform gamma-1 Source.1966: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.1967: DFBPPR18364 ---- Animal proteins ---- Inhibitor of growth protein 4 Source.1968: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.1969: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5 Source.1970: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.1971: DFBPPR18384 ---- Animal proteins ---- Inosine-5'-monophosphate dehydrogenase 1 Source.1972: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa Source.1973: DFBPPR18402 ---- Animal proteins ---- Uromodulin Source.1974: DFBPPR18406 ---- Animal proteins ---- Angiotensinogen Source.1975: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1 Source.1976: DFBPPR18413 ---- Animal proteins ---- Zinc finger protein Aiolos Source.1977: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase Source.1978: DFBPPR18415 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit alpha-14 Source.1979: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor Source.1980: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2 Source.1981: DFBPPR18430 ---- Animal proteins ---- cAMP-responsive element-binding protein-like 2 Source.1982: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H Source.1983: DFBPPR18437 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.1984: DFBPPR18440 ---- Animal proteins ---- Protein 4.2 Source.1985: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog Source.1986: DFBPPR18450 ---- Animal proteins ---- ADP/ATP translocase 2 Source.1987: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22 Source.1988: DFBPPR18454 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 4 Source.1989: DFBPPR18460 ---- Animal proteins ---- ATP synthase-coupling factor 6, mitochondrial Source.1990: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2 Source.1991: DFBPPR18464 ---- Animal proteins ---- Regucalcin Source.1992: DFBPPR18467 ---- Animal proteins ---- Alpha-aminoadipic semialdehyde synthase, mitochondrial Source.1993: DFBPPR18468 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1 Source.1994: DFBPPR18477 ---- Animal proteins ---- Signal recognition particle 54 kDa protein Source.1995: DFBPPR18480 ---- Animal proteins ---- Casein kinase I isoform gamma-3 Source.1996: DFBPPR18481 ---- Animal proteins ---- Plasma kallikrein Source.1997: DFBPPR18482 ---- Animal proteins ---- Clathrin interactor 1 Source.1998: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2 Source.1999: DFBPPR18494 ---- Animal proteins ---- Prostacyclin receptor Source.2000: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.2001: DFBPPR18498 ---- Animal proteins ---- Neutral cholesterol ester hydrolase 1 Source.2002: DFBPPR18501 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain Source.2003: DFBPPR18503 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex subunit 10, mitochondrial Source.2004: DFBPPR18511 ---- Animal proteins ---- Complement C1s subcomponent Source.2005: DFBPPR18512 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.2006: DFBPPR18514 ---- Animal proteins ---- Ras-related protein Rab-3C Source.2007: DFBPPR18515 ---- Animal proteins ---- cAMP-dependent protein kinase type II-beta regulatory subunit Source.2008: DFBPPR18527 ---- Animal proteins ---- Tubulin alpha-3 chain Source.2009: DFBPPR18531 ---- Animal proteins ---- Tubulin alpha-1C chain Source.2010: DFBPPR18532 ---- Animal proteins ---- Tubulin alpha-1D chain Source.2011: DFBPPR18535 ---- Animal proteins ---- M-phase inducer phosphatase 1 Source.2012: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase Source.2013: DFBPPR18541 ---- Animal proteins ---- Chromatin modification-related protein MEAF6 Source.2014: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5 Source.2015: DFBPPR18575 ---- Animal proteins ---- Gamma-crystallin S Source.2016: DFBPPR18576 ---- Animal proteins ---- Lon protease homolog 2, peroxisomal Source.2017: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.2018: DFBPPR18589 ---- Animal proteins ---- Interleukin-13 Source.2019: DFBPPR18594 ---- Animal proteins ---- Aprataxin and PNK-like factor Source.2020: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein Source.2021: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.2022: DFBPPR18617 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial Source.2023: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.2024: DFBPPR18621 ---- Animal proteins ---- Cytochrome b561 Source.2025: DFBPPR18624 ---- Animal proteins ---- Semaphorin-4A Source.2026: DFBPPR18634 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.2027: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2 Source.2028: DFBPPR18646 ---- Animal proteins ---- Angiopoietin-2 Source.2029: DFBPPR18706 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A Source.2030: DFBPPR18708 ---- Animal proteins ---- ATPase family AAA domain-containing protein 3 Source.2031: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial Source.2032: DFBPPR18720 ---- Animal proteins ---- Protein quaking Source.2033: DFBPPR18725 ---- Animal proteins ---- Substance-K receptor Source.2034: DFBPPR18727 ---- Animal proteins ---- Interleukin-2 Source.2035: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2 Source.2036: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2 Source.2037: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta' Source.2038: DFBPPR18754 ---- Animal proteins ---- Collectin-11 Source.2039: DFBPPR18760 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A containing DEAD/H box 1 Source.2040: DFBPPR18772 ---- Animal proteins ---- Myosin-7 Source.2041: DFBPPR18773 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM9 Source.2042: DFBPPR18776 ---- Animal proteins ---- Nucleoporin GLE1 Source.2043: DFBPPR18786 ---- Animal proteins ---- Bis(5'-adenosyl)-triphosphatase ENPP4 Source.2044: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3 Source.2045: DFBPPR18795 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 subunit C2 Source.2046: DFBPPR18796 ---- Animal proteins ---- Junctional adhesion molecule A Source.2047: DFBPPR18798 ---- Animal proteins ---- Upstream stimulatory factor 1 Source.2048: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type Source.2049: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2 Source.2050: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog Source.2051: DFBPPR18808 ---- Animal proteins ---- Solute carrier organic anion transporter family member 3A1 Source.2052: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial Source.2053: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3 Source.2054: DFBPPR18818 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2 Source.2055: DFBPPR18824 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.2056: DFBPPR18833 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 1 Source.2057: DFBPPR18835 ---- Animal proteins ---- Beta-adrenergic receptor kinase 2 Source.2058: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha Source.2059: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha Source.2060: DFBPPR18850 ---- Animal proteins ---- Protein transport protein Sec24A Source.2061: DFBPPR18855 ---- Animal proteins ---- Tubulin-specific chaperone A Source.2062: DFBPPR18859 ---- Animal proteins ---- Matrix remodeling-associated protein 8 Source.2063: DFBPPR18862 ---- Animal proteins ---- C-C chemokine receptor type 7 Source.2064: DFBPPR18873 ---- Animal proteins ---- Proteasome subunit beta type-3 Source.2065: DFBPPR18876 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.2066: DFBPPR18877 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.2067: DFBPPR18881 ---- Animal proteins ---- Proteasome subunit beta type-4 Source.2068: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase Source.2069: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial Source.2070: DFBPPR18904 ---- Animal proteins ---- Protein KASH5 Source.2071: DFBPPR18905 ---- Animal proteins ---- Beta-catenin-interacting protein 1 Source.2072: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless Source.2073: DFBPPR18916 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 3 Source.2074: DFBPPR18918 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 5 Source.2075: DFBPPR18933 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.2076: DFBPPR18943 ---- Animal proteins ---- C-terminal-binding protein 2 Source.2077: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9 Source.2078: DFBPPR18945 ---- Animal proteins ---- Stanniocalcin-1 Source.2079: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein Source.2080: DFBPPR18948 ---- Animal proteins ---- Probable tubulin polyglutamylase TTLL1 Source.2081: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3 Source.2082: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase Source.2083: DFBPPR18964 ---- Animal proteins ---- Placental prolactin-related protein 1 Source.2084: DFBPPR18974 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.2085: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin Source.2086: DFBPPR18981 ---- Animal proteins ---- Succinate--CoA ligase [ADP/GDP-forming] subunit alpha, mitochondrial Source.2087: DFBPPR18982 ---- Animal proteins ---- Gastrin-releasing peptide Source.2088: DFBPPR18984 ---- Animal proteins ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein Source.2089: DFBPPR18988 ---- Animal proteins ---- Lysosomal Pro-X carboxypeptidase Source.2090: DFBPPR19019 ---- Animal proteins ---- Casein kinase II subunit alpha' Source.2091: DFBPPR19035 ---- Animal proteins ---- DNA helicase MCM9 Source.2092: DFBPPR19036 ---- Animal proteins ---- Elongation factor 2 Source.2093: DFBPPR19041 ---- Animal proteins ---- Presenilins-associated rhomboid-like protein, mitochondrial Source.2094: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic Source.2095: DFBPPR19047 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-1 Source.2096: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2 Source.2097: DFBPPR19063 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.2098: DFBPPR19065 ---- Animal proteins ---- Cadherin-6 Source.2099: DFBPPR19067 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.2100: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1 Source.2101: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5 Source.2102: DFBPPR19076 ---- Animal proteins ---- Protein MGARP Source.2103: DFBPPR19089 ---- Animal proteins ---- Ubiquinol-cytochrome-c reductase complex assembly factor 2 Source.2104: DFBPPR19090 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2 Source.2105: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial Source.2106: DFBPPR19102 ---- Animal proteins ---- Cytoplasmic FMR1-interacting protein 1 Source.2107: DFBPPR19103 ---- Animal proteins ---- U1 small nuclear ribonucleoprotein 70 kDa Source.2108: DFBPPR19106 ---- Animal proteins ---- Natural killer cells antigen CD94 Source.2109: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.2110: DFBPPR19112 ---- Animal proteins ---- Ubiquitin-like-conjugating enzyme ATG3 Source.2111: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain Source.2112: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1 Source.2113: DFBPPR19124 ---- Animal proteins ---- Neuroguidin Source.2114: DFBPPR19126 ---- Animal proteins ---- Calpain small subunit 1 Source.2115: DFBPPR19129 ---- Animal proteins ---- Protein NDRG1 Source.2116: DFBPPR19135 ---- Animal proteins ---- Palmitoyltransferase ZDHHC5 Source.2117: DFBPPR19139 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-2 Source.2118: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8 Source.2119: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1 Source.2120: DFBPPR19148 ---- Animal proteins ---- Ribonuclease 4 Source.2121: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like Source.2122: DFBPPR19162 ---- Animal proteins ---- Macrophage-capping protein Source.2123: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2 Source.2124: DFBPPR19178 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter SLC6A17 Source.2125: DFBPPR19186 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1 Source.2126: DFBPPR19190 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit gamma Source.2127: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2 Source.2128: DFBPPR19198 ---- Animal proteins ---- Cadherin-3 Source.2129: DFBPPR19215 ---- Animal proteins ---- Dysferlin Source.2130: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3 Source.2131: DFBPPR19219 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A2, mitochondrial Source.2132: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A Source.2133: DFBPPR19233 ---- Animal proteins ---- CMP-N-acetylneuraminate-poly-alpha-2,8-sialyltransferase Source.2134: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein Source.2135: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog Source.2136: DFBPPR19248 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.2137: DFBPPR19250 ---- Animal proteins ---- Brevican core protein Source.2138: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2 Source.2139: DFBPPR19264 ---- Animal proteins ---- Claudin-16 Source.2140: DFBPPR19276 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit beta, mitochondrial Source.2141: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.2142: DFBPPR19282 ---- Animal proteins ---- Serine/threonine-protein kinase 33 Source.2143: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic Source.2144: DFBPPR19299 ---- Animal proteins ---- Annexin A7 Source.2145: DFBPPR19301 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF220 Source.2146: DFBPPR19302 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 12 Source.2147: DFBPPR19307 ---- Animal proteins ---- Microprocessor complex subunit DGCR8 Source.2148: DFBPPR19309 ---- Animal proteins ---- Cadherin-related family member 1 Source.2149: DFBPPR19328 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 12 Source.2150: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase Source.2151: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.2152: DFBPPR19344 ---- Animal proteins ---- Regulator of G-protein signaling 9 Source.2153: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2 Source.2154: DFBPPR19364 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 3 Source.2155: DFBPPR19373 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.2156: DFBPPR19380 ---- Animal proteins ---- Proteasome subunit alpha type-3 Source.2157: DFBPPR19388 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.2158: DFBPPR19394 ---- Animal proteins ---- Solute carrier family 10 member 6 Source.2159: DFBPPR19395 ---- Animal proteins ---- Ras-related protein Rab-5C Source.2160: DFBPPR19398 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 18 Source.2161: DFBPPR19410 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein F Source.2162: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein Source.2163: DFBPPR19413 ---- Animal proteins ---- Peptidylprolyl isomerase domain and WD repeat-containing protein 1 Source.2164: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8 Source.2165: DFBPPR19419 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit Source.2166: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1 Source.2167: DFBPPR19424 ---- Animal proteins ---- 3-hydroxybutyrate dehydrogenase type 2 Source.2168: DFBPPR19425 ---- Animal proteins ---- Microfibrillar-associated protein 5 Source.2169: DFBPPR19427 ---- Animal proteins ---- Probable tRNA(His) guanylyltransferase Source.2170: DFBPPR19431 ---- Animal proteins ---- Aminoacyl tRNA synthase complex-interacting multifunctional protein 2 Source.2171: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70 Source.2172: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase Source.2173: DFBPPR19468 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 2 Source.2174: DFBPPR19470 ---- Animal proteins ---- Acidic amino acid decarboxylase GADL1 Source.2175: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7 Source.2176: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.2177: DFBPPR19488 ---- Animal proteins ---- Placental prolactin-related protein 3 Source.2178: DFBPPR19494 ---- Animal proteins ---- Ganglioside-induced differentiation-associated protein 1 Source.2179: DFBPPR19506 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.2180: DFBPPR19509 ---- Animal proteins ---- Adenosylhomocysteinase Source.2181: DFBPPR19510 ---- Animal proteins ---- Transportin-1 Source.2182: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial Source.2183: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2 Source.2184: DFBPPR19519 ---- Animal proteins ---- DnaJ homolog subfamily C member 24 Source.2185: DFBPPR19523 ---- Animal proteins ---- Origin recognition complex subunit 1 Source.2186: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16 Source.2187: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A Source.2188: DFBPPR19559 ---- Animal proteins ---- CCN family member 2 Source.2189: DFBPPR19561 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.2190: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase Source.2191: DFBPPR19568 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin Source.2192: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.2193: DFBPPR19572 ---- Animal proteins ---- Pentatricopeptide repeat domain-containing protein 3, mitochondrial Source.2194: DFBPPR19575 ---- Animal proteins ---- Acylphosphatase-2 Source.2195: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial Source.2196: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2 Source.2197: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2 Source.2198: DFBPPR19587 ---- Animal proteins ---- Volume-regulated anion channel subunit LRRC8C Source.2199: DFBPPR19593 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.2200: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4 Source.2201: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4 Source.2202: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase Source.2203: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator Source.2204: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.2205: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta Source.2206: DFBPPR19627 ---- Animal proteins ---- T-cell surface glycoprotein CD8 alpha chain Source.2207: DFBPPR19631 ---- Animal proteins ---- Fumarylacetoacetase Source.2208: DFBPPR19643 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1-like Source.2209: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.2210: DFBPPR19655 ---- Animal proteins ---- GPI-anchor transamidase Source.2211: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator Source.2212: DFBPPR19668 ---- Animal proteins ---- Calicin Source.2213: DFBPPR19669 ---- Animal proteins ---- Cullin-associated NEDD8-dissociated protein 1 Source.2214: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein Source.2215: DFBPPR19680 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.2216: DFBPPR19684 ---- Animal proteins ---- Urotensin-2 receptor Source.2217: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.2218: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter Source.2219: DFBPPR19702 ---- Animal proteins ---- Placental prolactin-related protein 4 Source.2220: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase Source.2221: DFBPPR19715 ---- Animal proteins ---- Chorionic somatomammotropin hormone 2 Source.2222: DFBPPR19716 ---- Animal proteins ---- Proteasome subunit beta type-1 Source.2223: DFBPPR19725 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 1 Source.2224: DFBPPR19730 ---- Animal proteins ---- Tensin-1 Source.2225: DFBPPR19735 ---- Animal proteins ---- Complement component C7 Source.2226: DFBPPR19740 ---- Animal proteins ---- Sin3 histone deacetylase corepressor complex component SDS3 Source.2227: DFBPPR19744 ---- Animal proteins ---- Placental prolactin-related protein 2 Source.2228: DFBPPR19749 ---- Animal proteins ---- Prostaglandin reductase-3 Source.2229: DFBPPR19753 ---- Animal proteins ---- Thrombospondin-2 Source.2230: DFBPPR19761 ---- Animal proteins ---- N-chimaerin Source.2231: DFBPPR19762 ---- Animal proteins ---- Mitochondrial fission factor Source.2232: DFBPPR19769 ---- Animal proteins ---- Septin-14 Source.2233: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25 Source.2234: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1 Source.2235: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter Source.2236: DFBPPR19789 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.2237: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4 Source.2238: DFBPPR19800 ---- Animal proteins ---- Microsomal glutathione S-transferase 3 Source.2239: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial Source.2240: DFBPPR19809 ---- Animal proteins ---- Hippocalcin-like protein 4 Source.2241: DFBPPR19810 ---- Animal proteins ---- Seipin Source.2242: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L Source.2243: DFBPPR19813 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 gamma Source.2244: DFBPPR19817 ---- Animal proteins ---- Tyrosine aminotransferase Source.2245: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1 Source.2246: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein Source.2247: DFBPPR19825 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like 2 Source.2248: DFBPPR19833 ---- Animal proteins ---- Contactin-1 Source.2249: DFBPPR19834 ---- Animal proteins ---- Harmonin Source.2250: DFBPPR19835 ---- Animal proteins ---- GMP reductase 2 Source.2251: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5 Source.2252: DFBPPR19842 ---- Animal proteins ---- ATP-dependent Clp protease proteolytic subunit, mitochondrial Source.2253: DFBPPR19845 ---- Animal proteins ---- Beta-soluble NSF attachment protein Source.2254: DFBPPR19854 ---- Animal proteins ---- Nuclear migration protein nudC Source.2255: DFBPPR19855 ---- Animal proteins ---- AP-3 complex subunit mu-1 Source.2256: DFBPPR19856 ---- Animal proteins ---- L-gulonolactone oxidase Source.2257: DFBPPR19859 ---- Animal proteins ---- Tubulin-folding cofactor B Source.2258: DFBPPR19861 ---- Animal proteins ---- Phospholipid phosphatase-related protein type 2 Source.2259: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8 Source.2260: DFBPPR19870 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta Source.2261: DFBPPR19889 ---- Animal proteins ---- tRNA (cytosine(34)-C(5))-methyltransferase, mitochondrial Source.2262: DFBPPR19904 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 30 Source.2263: DFBPPR19905 ---- Animal proteins ---- Complement component C6 Source.2264: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.2265: DFBPPR19913 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 8, mitochondrial Source.2266: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1 Source.2267: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial Source.2268: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2 Source.2269: DFBPPR19922 ---- Animal proteins ---- Tubulin alpha-8 chain Source.2270: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3 Source.2271: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18 Source.2272: DFBPPR19928 ---- Animal proteins ---- Interferon beta-1 Source.2273: DFBPPR19932 ---- Animal proteins ---- ETS translocation variant 1 Source.2274: DFBPPR19936 ---- Animal proteins ---- Myelin-associated neurite-outgrowth inhibitor Source.2275: DFBPPR19941 ---- Animal proteins ---- MAGUK p55 subfamily member 7 Source.2276: DFBPPR19949 ---- Animal proteins ---- Syndecan-2 Source.2277: DFBPPR19957 ---- Animal proteins ---- Gap junction beta-2 protein Source.2278: DFBPPR19961 ---- Animal proteins ---- Sulfate transporter Source.2279: DFBPPR19972 ---- Animal proteins ---- Prefoldin subunit 5 Source.2280: DFBPPR19977 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX27 Source.2281: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3 Source.2282: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3 Source.2283: DFBPPR19990 ---- Animal proteins ---- Synaptonemal complex protein 3 Source.2284: DFBPPR19998 ---- Animal proteins ---- Mitochondrial chaperone BCS1 Source.2285: DFBPPR20002 ---- Animal proteins ---- Regulator of microtubule dynamics protein 2 Source.2286: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1 Source.2287: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3 Source.2288: DFBPPR20009 ---- Animal proteins ---- Proteasome inhibitor PI31 subunit Source.2289: DFBPPR20016 ---- Animal proteins ---- Nucleoside diphosphate kinase 7 Source.2290: DFBPPR20027 ---- Animal proteins ---- DnaJ homolog subfamily B member 12 Source.2291: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1 Source.2292: DFBPPR20030 ---- Animal proteins ---- Calumenin Source.2293: DFBPPR20033 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 9 Source.2294: DFBPPR20041 ---- Animal proteins ---- Arylacetamide deacetylase Source.2295: DFBPPR20047 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 11B Source.2296: DFBPPR20048 ---- Animal proteins ---- Ubiquitin conjugation factor E4 A Source.2297: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5 Source.2298: DFBPPR20063 ---- Animal proteins ---- Histone H2B subacrosomal variant Source.2299: DFBPPR20067 ---- Animal proteins ---- Glutaredoxin-2, mitochondrial Source.2300: DFBPPR20071 ---- Animal proteins ---- Glutathione S-transferase A4 Source.2301: DFBPPR20078 ---- Animal proteins ---- Ragulator complex protein LAMTOR2 Source.2302: DFBPPR20080 ---- Animal proteins ---- 26S proteasome regulatory subunit 6B Source.2303: DFBPPR20081 ---- Animal proteins ---- ADP-ribosylation factor-related protein 1 Source.2304: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.2305: DFBPPR20091 ---- Animal proteins ---- Carboxypeptidase O Source.2306: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.2307: DFBPPR20106 ---- Animal proteins ---- Visinin-like protein 1 Source.2308: DFBPPR20110 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.2309: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase Source.2310: DFBPPR20136 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 2 Source.2311: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6 Source.2312: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1 Source.2313: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.2314: DFBPPR20155 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF181 Source.2315: DFBPPR20172 ---- Animal proteins ---- NF-kappa-B inhibitor zeta Source.2316: DFBPPR20186 ---- Animal proteins ---- Transmembrane protein 98 Source.2317: DFBPPR20199 ---- Animal proteins ---- Claudin-7 Source.2318: DFBPPR20200 ---- Animal proteins ---- N-lysine methyltransferase SETD6 Source.2319: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A Source.2320: DFBPPR20217 ---- Animal proteins ---- Cytochrome c oxidase assembly factor 8 Source.2321: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2 Source.2322: DFBPPR20226 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.2323: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2 Source.2324: DFBPPR20236 ---- Animal proteins ---- ADP-ribosylation factor GTPase-activating protein 3 Source.2325: DFBPPR20243 ---- Animal proteins ---- Tissue factor pathway inhibitor 2 Source.2326: DFBPPR20249 ---- Animal proteins ---- Ras-related protein Rab-30 Source.2327: DFBPPR20251 ---- Animal proteins ---- Follistatin-related protein 3 Source.2328: DFBPPR20259 ---- Animal proteins ---- Protein NEDD1 Source.2329: DFBPPR20261 ---- Animal proteins ---- Protein SCO1 homolog, mitochondrial Source.2330: DFBPPR20265 ---- Animal proteins ---- Histone-lysine N-methyltransferase EZH1 Source.2331: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.2332: DFBPPR20276 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37-like 1 Source.2333: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2 Source.2334: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN Source.2335: DFBPPR20300 ---- Animal proteins ---- Inducible T-cell costimulator Source.2336: DFBPPR20307 ---- Animal proteins ---- Ras-related protein Rab-6B Source.2337: DFBPPR20309 ---- Animal proteins ---- Cell death activator CIDE-3 Source.2338: DFBPPR20314 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC3 Source.2339: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa Source.2340: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial Source.2341: DFBPPR20330 ---- Animal proteins ---- Sorting nexin-27 Source.2342: DFBPPR20331 ---- Animal proteins ---- Diphthine--ammonia ligase Source.2343: DFBPPR20343 ---- Animal proteins ---- RNA binding protein fox-1 homolog 1 Source.2344: DFBPPR20347 ---- Animal proteins ---- Deoxyribonuclease-1-like 1 Source.2345: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta Source.2346: DFBPPR20362 ---- Animal proteins ---- [Protein ADP-ribosylarginine] hydrolase Source.2347: DFBPPR20364 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 3 Source.2348: DFBPPR20366 ---- Animal proteins ---- Protein phosphatase methylesterase 1 Source.2349: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial Source.2350: DFBPPR20374 ---- Animal proteins ---- 5'-deoxynucleotidase HDDC2 Source.2351: DFBPPR20378 ---- Animal proteins ---- GPI mannosyltransferase 1 Source.2352: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog Source.2353: DFBPPR20393 ---- Animal proteins ---- Putative nuclease HARBI1 Source.2354: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase Source.2355: DFBPPR20401 ---- Animal proteins ---- Bystin Source.2356: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma Source.2357: DFBPPR20424 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF170 Source.2358: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile Source.2359: DFBPPR20443 ---- Animal proteins ---- Putative phospholipase B-like 2 Source.2360: DFBPPR20460 ---- Animal proteins ---- Monocarboxylate transporter 1 Source.2361: DFBPPR20462 ---- Animal proteins ---- Mitochondrial glutamate carrier 1 Source.2362: DFBPPR20465 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.2363: DFBPPR20469 ---- Animal proteins ---- Zinc finger protein Pegasus Source.2364: DFBPPR20471 ---- Animal proteins ---- F-box/LRR-repeat protein 21 Source.2365: DFBPPR20488 ---- Animal proteins ---- Gamma-soluble NSF attachment protein Source.2366: DFBPPR20489 ---- Animal proteins ---- Translocon-associated protein subunit alpha Source.2367: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein Source.2368: DFBPPR20505 ---- Animal proteins ---- T-box transcription factor TBX6 Source.2369: DFBPPR20514 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 1, mitochondrial Source.2370: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1 Source.2371: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1 Source.2372: DFBPPR20555 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C Source.2373: DFBPPR20556 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.2374: DFBPPR20574 ---- Animal proteins ---- Transmembrane protein 201 Source.2375: DFBPPR20577 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor-interacting protein Source.2376: DFBPPR20581 ---- Animal proteins ---- Membrane magnesium transporter 1 Source.2377: DFBPPR20589 ---- Animal proteins ---- Post-GPI attachment to proteins factor 3 Source.2378: DFBPPR20590 ---- Animal proteins ---- POU domain class 2-associating factor 1 Source.2379: DFBPPR20594 ---- Animal proteins ---- Vitamin D-binding protein Source.2380: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1 Source.2381: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6 Source.2382: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor Source.2383: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog Source.2384: DFBPPR20611 ---- Animal proteins ---- Engulfment and cell motility protein 2 Source.2385: DFBPPR20617 ---- Animal proteins ---- GTPase-activating protein and VPS9 domain-containing protein 1 Source.2386: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2 Source.2387: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1 Source.2388: DFBPPR20626 ---- Animal proteins ---- Melanocortin receptor 5 Source.2389: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1 Source.2390: DFBPPR20647 ---- Animal proteins ---- Annexin A8 Source.2391: DFBPPR20648 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM22 homolog Source.2392: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A Source.2393: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C Source.2394: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.2395: DFBPPR20674 ---- Animal proteins ---- Stromal membrane-associated protein 2 Source.2396: DFBPPR20675 ---- Animal proteins ---- MYG1 exonuclease Source.2397: DFBPPR20676 ---- Animal proteins ---- Myelin protein zero-like protein 2 Source.2398: DFBPPR20678 ---- Animal proteins ---- Growth factor receptor-bound protein 14 Source.2399: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5 Source.2400: DFBPPR20685 ---- Animal proteins ---- ER membrane protein complex subunit 10 Source.2401: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase Source.2402: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12 Source.2403: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.2404: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog Source.2405: DFBPPR20705 ---- Animal proteins ---- Anaphase-promoting complex subunit 10 Source.2406: DFBPPR20706 ---- Animal proteins ---- Chloride channel CLIC-like protein 1 Source.2407: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1 Source.2408: DFBPPR20713 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.2409: DFBPPR20717 ---- Animal proteins ---- Inositol oxygenase Source.2410: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1 Source.2411: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial Source.2412: DFBPPR20726 ---- Animal proteins ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72 Source.2413: DFBPPR20727 ---- Animal proteins ---- Receptor expression-enhancing protein 4 Source.2414: DFBPPR20729 ---- Animal proteins ---- 60S ribosomal protein L6 Source.2415: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2 Source.2416: DFBPPR20735 ---- Animal proteins ---- Microtubule-associated tumor suppressor 1 homolog Source.2417: DFBPPR20737 ---- Animal proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, mitochondrial Source.2418: DFBPPR20740 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 6 Source.2419: DFBPPR20748 ---- Animal proteins ---- Protein ABHD14B Source.2420: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog Source.2421: DFBPPR20752 ---- Animal proteins ---- Tetraspanin-33 Source.2422: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7 Source.2423: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9 Source.2424: DFBPPR20773 ---- Animal proteins ---- Mitochondrial-processing peptidase subunit alpha Source.2425: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2 Source.2426: DFBPPR20778 ---- Animal proteins ---- Tetraspanin-15 Source.2427: DFBPPR20783 ---- Animal proteins ---- CLK4-associating serine/arginine rich protein Source.2428: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27 Source.2429: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171 Source.2430: DFBPPR20806 ---- Animal proteins ---- Transcriptional adapter 1 Source.2431: DFBPPR20807 ---- Animal proteins ---- Receptor expression-enhancing protein 2 Source.2432: DFBPPR20827 ---- Animal proteins ---- Kelch-like protein 13 Source.2433: DFBPPR20833 ---- Animal proteins ---- Src kinase-associated phosphoprotein 2 Source.2434: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog Source.2435: DFBPPR20850 ---- Animal proteins ---- Arylsulfatase K Source.2436: DFBPPR20856 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim10 Source.2437: DFBPPR20857 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15 Source.2438: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1 Source.2439: DFBPPR20872 ---- Animal proteins ---- Transmembrane protein 150C Source.2440: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1 Source.2441: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B Source.2442: DFBPPR20915 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2443: DFBPPR20919 ---- Animal proteins ---- Protein cornichon homolog 4 Source.2444: DFBPPR20920 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2445: DFBPPR20928 ---- Animal proteins ---- Nuclear envelope integral membrane protein 1 Source.2446: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14 Source.2447: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta Source.2448: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.2449: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like Source.2450: DFBPPR20987 ---- Animal proteins ---- Leucine-rich repeat neuronal protein 1 Source.2451: DFBPPR20988 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 9C member 7 Source.2452: DFBPPR21004 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.2453: DFBPPR21008 ---- Animal proteins ---- Gamma-glutamylaminecyclotransferase Source.2454: DFBPPR21011 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.2455: DFBPPR21012 ---- Animal proteins ---- tRNA (adenine(58)-N(1))-methyltransferase non-catalytic subunit TRM6 Source.2456: DFBPPR21025 ---- Animal proteins ---- Radial spoke head protein 3 homolog Source.2457: DFBPPR21027 ---- Animal proteins ---- Germ cell-specific gene 1 protein Source.2458: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21 Source.2459: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10 Source.2460: DFBPPR21064 ---- Animal proteins ---- Ribosome production factor 2 homolog Source.2461: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C Source.2462: DFBPPR21067 ---- Animal proteins ---- LIM and SH3 domain protein 1 Source.2463: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1 Source.2464: DFBPPR21079 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17A Source.2465: DFBPPR21086 ---- Animal proteins ---- Zinc transporter 6 Source.2466: DFBPPR21097 ---- Animal proteins ---- Friend leukemia integration 1 transcription factor Source.2467: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7 Source.2468: DFBPPR21102 ---- Animal proteins ---- Gamma-glutamylcyclotransferase Source.2469: DFBPPR21103 ---- Animal proteins ---- F-box only protein 32 Source.2470: DFBPPR21104 ---- Animal proteins ---- Keratinocyte-associated protein 2 Source.2471: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.2472: DFBPPR21112 ---- Animal proteins ---- TBC1 domain family member 7 Source.2473: DFBPPR21117 ---- Animal proteins ---- Spindlin-2 Source.2474: DFBPPR21132 ---- Animal proteins ---- Regulator of G-protein signaling 7-binding protein Source.2475: DFBPPR21141 ---- Animal proteins ---- Biotinidase Source.2476: DFBPPR21155 ---- Animal proteins ---- Cyclin-H Source.2477: DFBPPR21157 ---- Animal proteins ---- Mitochondrial thiamine pyrophosphate carrier Source.2478: DFBPPR21171 ---- Animal proteins ---- 28S ribosomal protein S22, mitochondrial Source.2479: DFBPPR21178 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A5 Source.2480: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1 Source.2481: DFBPPR21195 ---- Animal proteins ---- Vesicular, overexpressed in cancer, prosurvival protein 1 Source.2482: DFBPPR21199 ---- Animal proteins ---- Trans-L-3-hydroxyproline dehydratase Source.2483: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1 Source.2484: DFBPPR21205 ---- Animal proteins ---- ATP synthase mitochondrial F1 complex assembly factor 2 Source.2485: DFBPPR21212 ---- Animal proteins ---- Tropomodulin-4 Source.2486: DFBPPR21215 ---- Animal proteins ---- Origin recognition complex subunit 6 Source.2487: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3 Source.2488: DFBPPR21241 ---- Animal proteins ---- Cytochrome b-245 chaperone 1 Source.2489: DFBPPR21249 ---- Animal proteins ---- G1/S-specific cyclin-D3 Source.2490: DFBPPR21261 ---- Animal proteins ---- tRNA selenocysteine 1-associated protein 1 Source.2491: DFBPPR21263 ---- Animal proteins ---- Enhancer of rudimentary homolog Source.2492: DFBPPR21266 ---- Animal proteins ---- COP9 signalosome complex subunit 4 Source.2493: DFBPPR21272 ---- Animal proteins ---- Testin Source.2494: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein Source.2495: DFBPPR21300 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.2496: DFBPPR21306 ---- Animal proteins ---- Protein ATP1B4 Source.2497: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39 Source.2498: DFBPPR21321 ---- Animal proteins ---- Zinc finger matrin-type protein 3 Source.2499: DFBPPR21329 ---- Animal proteins ---- L-2-hydroxyglutarate dehydrogenase, mitochondrial Source.2500: DFBPPR21332 ---- Animal proteins ---- ER membrane protein complex subunit 4 Source.2501: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial Source.2502: DFBPPR21345 ---- Animal proteins ---- XIAP-associated factor 1 Source.2503: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter Source.2504: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151 Source.2505: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3 Source.2506: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18 Source.2507: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2 Source.2508: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2 Source.2509: DFBPPR21381 ---- Animal proteins ---- Cytochrome c oxidase subunit 7A-related protein, mitochondrial Source.2510: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2 Source.2511: DFBPPR21391 ---- Animal proteins ---- Prolactin-inducible protein homolog Source.2512: DFBPPR21392 ---- Animal proteins ---- Mitoferrin-1 Source.2513: DFBPPR21394 ---- Animal proteins ---- Elongin-C Source.2514: DFBPPR21408 ---- Animal proteins ---- Cytochrome c oxidase assembly protein COX15 homolog Source.2515: DFBPPR21418 ---- Animal proteins ---- Angiopoietin-related protein 1 Source.2516: DFBPPR21426 ---- Animal proteins ---- ORM1-like protein 3 Source.2517: DFBPPR21433 ---- Animal proteins ---- Ubiquitin-fold modifier-conjugating enzyme 1 Source.2518: DFBPPR21449 ---- Animal proteins ---- Magnesium transporter NIPA2 Source.2519: DFBPPR21454 ---- Animal proteins ---- Cyclin-dependent kinase 2-interacting protein Source.2520: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2 Source.2521: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1 Source.2522: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3 Source.2523: DFBPPR21473 ---- Animal proteins ---- TRPM8 channel-associated factor 1 Source.2524: DFBPPR21475 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 8 Source.2525: DFBPPR21479 ---- Animal proteins ---- Pentraxin-related protein PTX3 Source.2526: DFBPPR21487 ---- Animal proteins ---- 28S ribosomal protein S30, mitochondrial Source.2527: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1 Source.2528: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1 Source.2529: DFBPPR21511 ---- Animal proteins ---- GRB2-associated-binding protein 1 Source.2530: DFBPPR21520 ---- Animal proteins ---- LYR motif-containing protein 4 Source.2531: DFBPPR21539 ---- Animal proteins ---- Kelch-like protein 9 Source.2532: DFBPPR21550 ---- Animal proteins ---- DnaJ homolog subfamily C member 22 Source.2533: DFBPPR21553 ---- Animal proteins ---- Transmembrane protein 135 Source.2534: DFBPPR21560 ---- Animal proteins ---- Sperm equatorial segment protein 1 Source.2535: DFBPPR21566 ---- Animal proteins ---- Phosducin-like protein 3 Source.2536: DFBPPR21576 ---- Animal proteins ---- Signal recognition particle 19 kDa protein Source.2537: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A Source.2538: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.2539: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma Source.2540: DFBPPR21597 ---- Animal proteins ---- Hydroxylysine kinase Source.2541: DFBPPR21598 ---- Animal proteins ---- GPN-loop GTPase 3 Source.2542: DFBPPR21608 ---- Animal proteins ---- Protein pitchfork Source.2543: DFBPPR21618 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.2544: DFBPPR21620 ---- Animal proteins ---- Claudin-12 Source.2545: DFBPPR21625 ---- Animal proteins ---- 40S ribosomal protein S24 Source.2546: DFBPPR21630 ---- Animal proteins ---- Maspardin Source.2547: DFBPPR21642 ---- Animal proteins ---- Endoplasmic reticulum resident protein 44 Source.2548: DFBPPR21648 ---- Animal proteins ---- Keratin, type I cytoskeletal 26 Source.2549: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial Source.2550: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8 Source.2551: DFBPPR21666 ---- Animal proteins ---- Importin-13 Source.2552: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10 Source.2553: DFBPPR21694 ---- Animal proteins ---- C1GALT1-specific chaperone 1 Source.2554: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3 Source.2555: DFBPPR21701 ---- Animal proteins ---- Prefoldin subunit 1 Source.2556: DFBPPR21710 ---- Animal proteins ---- Differentially expressed in FDCP 8 homolog Source.2557: DFBPPR21712 ---- Animal proteins ---- Serpin E3 Source.2558: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog Source.2559: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2 Source.2560: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1 Source.2561: DFBPPR21753 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase domain-containing protein 1 Source.2562: DFBPPR21754 ---- Animal proteins ---- BLOC-1-related complex subunit 6 Source.2563: DFBPPR21755 ---- Animal proteins ---- ELMO domain-containing protein 2 Source.2564: DFBPPR21764 ---- Animal proteins ---- F-box only protein 25 Source.2565: DFBPPR21767 ---- Animal proteins ---- Tudor domain-containing protein 5 Source.2566: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3 Source.2567: DFBPPR21797 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase interacting protein-like Source.2568: DFBPPR21800 ---- Animal proteins ---- Carbonic anhydrase-related protein 10 Source.2569: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog Source.2570: DFBPPR21805 ---- Animal proteins ---- 60S ribosomal protein L19 Source.2571: DFBPPR21815 ---- Animal proteins ---- ORM1-like protein 2 Source.2572: DFBPPR21820 ---- Animal proteins ---- Mitochondrial carrier homolog 2 Source.2573: DFBPPR21827 ---- Animal proteins ---- LETM1 domain-containing protein 1 Source.2574: DFBPPR21831 ---- Animal proteins ---- MAPK regulated corepressor interacting protein 2 Source.2575: DFBPPR21834 ---- Animal proteins ---- Phytanoyl-CoA hydroxylase-interacting protein Source.2576: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.2577: DFBPPR21851 ---- Animal proteins ---- TSC22 domain family protein 1 Source.2578: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog Source.2579: DFBPPR21881 ---- Animal proteins ---- THUMP domain-containing protein 1 Source.2580: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein Source.2581: DFBPPR21911 ---- Animal proteins ---- ORM1-like protein 1 Source.2582: DFBPPR21914 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 13 Source.2583: DFBPPR21931 ---- Animal proteins ---- Oocyte-secreted protein 1 Source.2584: DFBPPR21938 ---- Animal proteins ---- Protein RER1 Source.2585: DFBPPR21944 ---- Animal proteins ---- Plakophilin-1 Source.2586: DFBPPR21960 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD15 Source.2587: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial Source.2588: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10 Source.2589: DFBPPR21997 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD1 Source.2590: DFBPPR21998 ---- Animal proteins ---- Putative monooxygenase p33MONOX Source.2591: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog Source.2592: DFBPPR22011 ---- Animal proteins ---- 40S ribosomal protein S12 Source.2593: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3 Source.2594: DFBPPR22016 ---- Animal proteins ---- Telomere repeats-binding bouquet formation protein 2 Source.2595: DFBPPR22017 ---- Animal proteins ---- 39S ribosomal protein L35, mitochondrial Source.2596: DFBPPR22038 ---- Animal proteins ---- Kelch domain-containing protein 3 Source.2597: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12 Source.2598: DFBPPR22050 ---- Animal proteins ---- Protein lin-37 homolog Source.2599: DFBPPR22051 ---- Animal proteins ---- Cilia- and flagella-associated protein HOATZ Source.2600: DFBPPR22054 ---- Animal proteins ---- Probable UDP-sugar transporter protein SLC35A4 Source.2601: DFBPPR22082 ---- Animal proteins ---- Homocysteine-responsive endoplasmic reticulum-resident ubiquitin-like domain member 2 protein Source.2602: DFBPPR22086 ---- Animal proteins ---- Trafficking protein particle complex subunit 1 Source.2603: DFBPPR22094 ---- Animal proteins ---- Protein MMS22-like Source.2604: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog Source.2605: DFBPPR22132 ---- Animal proteins ---- 60S ribosomal protein L18a Source.2606: DFBPPR22148 ---- Animal proteins ---- Hemogen Source.2607: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143 Source.2608: DFBPPR22181 ---- Animal proteins ---- Tigger transposable element-derived protein 5 Source.2609: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1 Source.2610: DFBPPR22186 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 2 Source.2611: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8 Source.2612: DFBPPR22196 ---- Animal proteins ---- Bladder cancer-associated protein Source.2613: DFBPPR22200 ---- Animal proteins ---- Profilin-4 Source.2614: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.2615: DFBPPR22210 ---- Animal proteins ---- Peroxisomal membrane protein 4 Source.2616: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B Source.2617: DFBPPR22215 ---- Animal proteins ---- General transcription factor II-I repeat domain-containing protein 2 Source.2618: DFBPPR22224 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 3 Source.2619: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.2620: DFBPPR22234 ---- Animal proteins ---- COMM domain-containing protein 3 Source.2621: DFBPPR22240 ---- Animal proteins ---- Ataxin-10 Source.2622: DFBPPR22248 ---- Animal proteins ---- rRNA-processing protein FCF1 homolog Source.2623: DFBPPR22255 ---- Animal proteins ---- Rab9 effector protein with kelch motifs Source.2624: DFBPPR22257 ---- Animal proteins ---- TLC domain-containing protein 5 Source.2625: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1 Source.2626: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial Source.2627: DFBPPR22278 ---- Animal proteins ---- Solute carrier family 25 member 40 Source.2628: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C Source.2629: DFBPPR22285 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1-interacting protein 2 Source.2630: DFBPPR22294 ---- Animal proteins ---- Ubinuclein-2 Source.2631: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B Source.2632: DFBPPR22316 ---- Animal proteins ---- MAPK-interacting and spindle-stabilizing protein-like Source.2633: DFBPPR22320 ---- Animal proteins ---- Transmembrane protein 229B Source.2634: DFBPPR22321 ---- Animal proteins ---- Solute carrier family 25 member 35 Source.2635: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8 Source.2636: DFBPPR22332 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 alpha subcomplex assembly factor 3 Source.2637: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63 Source.2638: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1 Source.2639: DFBPPR22362 ---- Animal proteins ---- Decreased expression in renal and prostate cancer protein Source.2640: DFBPPR22371 ---- Animal proteins ---- Saccharopine dehydrogenase-like oxidoreductase Source.2641: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39 Source.2642: DFBPPR22388 ---- Animal proteins ---- Oxidative stress-responsive serine-rich protein 1 Source.2643: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9 Source.2644: DFBPPR22407 ---- Animal proteins ---- TSSK6-activating co-chaperone protein Source.2645: DFBPPR22411 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 2 Source.2646: DFBPPR22415 ---- Animal proteins ---- Methyltransferase-like protein 9 Source.2647: DFBPPR22420 ---- Animal proteins ---- Small integral membrane protein 19 Source.2648: DFBPPR22423 ---- Animal proteins ---- Transmembrane protein 45B Source.2649: DFBPPR22431 ---- Animal proteins ---- BolA-like protein 3 Source.2650: DFBPPR22469 ---- Animal proteins ---- Protein FAM136A Source.2651: DFBPPR22481 ---- Animal proteins ---- Uncharacterized protein FAM241A Source.2652: DFBPPR22492 ---- Animal proteins ---- SAYSvFN domain-containing protein 1 Source.2653: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68 Source.2654: DFBPPR22499 ---- Animal proteins ---- Transmembrane protein 183 Source.2655: DFBPPR22509 ---- Animal proteins ---- Transmembrane protein 101 Source.2656: DFBPPR22521 ---- Animal proteins ---- Protein OSCP1 Source.2657: DFBPPR22537 ---- Animal proteins ---- Radial spoke head 10 homolog B Source.2658: DFBPPR22539 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 18 Source.2659: DFBPPR22544 ---- Animal proteins ---- SH3 domain-binding glutamic acid-rich-like protein 2 Source.2660: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1 Source.2661: DFBPPR22574 ---- Animal proteins ---- Uncharacterized protein C1orf54 homolog Source.2662: DFBPPR22590 ---- Animal proteins ---- Transmembrane protein 267 Source.2663: DFBPPR22597 ---- Animal proteins ---- Methyltransferase-like 26 Source.2664: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13 Source.2665: DFBPPR22611 ---- Animal proteins ---- Coiled-coil domain-containing protein 105 Source.2666: DFBPPR22615 ---- Animal proteins ---- Coiled-coil domain-containing protein 54 Source.2667: DFBPPR22631 ---- Animal proteins ---- Protein FAM131B Source.2668: DFBPPR22636 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 1 Source.2669: DFBPPR22637 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 61 Source.2670: DFBPPR22679 ---- Animal proteins ---- MORN repeat-containing protein 3 Source.2671: DFBPPR22694 ---- Animal proteins ---- Testis-specific gene 13 protein Source.2672: DFBPPR22711 ---- Animal proteins ---- BTB/POZ domain-containing protein 16 Source.2673: DFBPPR22721 ---- Animal proteins ---- Uncharacterized protein KIAA1143 homolog Source.2674: DFBPPR22727 ---- Animal proteins ---- Uncharacterized protein C6orf163 homolog Source.2675: DFBPPR22745 ---- Animal proteins ---- Uncharacterized protein C3orf14 homolog Source.2676: DFBPPR22762 ---- Animal proteins ---- Uncharacterized protein C6orf136 homolog Source.2677: DFBPPR8528 ---- Animal proteins ---- Succinyl-CoA:3-ketoacid coenzyme A transferase 1, mitochondrial Source.2678: DFBPPR8532 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.2679: DFBPPR8541 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.2680: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1 Source.2681: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2 Source.2682: DFBPPR8548 ---- Animal proteins ---- Interstitial collagenase Source.2683: DFBPPR8550 ---- Animal proteins ---- Complement C3 Source.2684: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N Source.2685: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.2686: DFBPPR8554 ---- Animal proteins ---- Glutamate carboxypeptidase 2 Source.2687: DFBPPR8557 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.2688: DFBPPR8558 ---- Animal proteins ---- Glycerophosphocholine cholinephosphodiesterase ENPP6 Source.2689: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1 Source.2690: DFBPPR8577 ---- Animal proteins ---- Nectin-1 Source.2691: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing] Source.2692: DFBPPR8584 ---- Animal proteins ---- Disintegrin and metalloproteinase domain-containing protein 10 Source.2693: DFBPPR8592 ---- Animal proteins ---- Interleukin-18 Source.2694: DFBPPR8600 ---- Animal proteins ---- Steroidogenic factor 1 Source.2695: DFBPPR8603 ---- Animal proteins ---- Signal transducer and activator of transcription 1 Source.2696: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin Source.2697: DFBPPR8618 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.2698: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial Source.2699: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor Source.2700: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK Source.2701: DFBPPR8632 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.2702: DFBPPR8635 ---- Animal proteins ---- Mu-type opioid receptor Source.2703: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase Source.2704: DFBPPR8639 ---- Animal proteins ---- Mannose-binding protein A Source.2705: DFBPPR8641 ---- Animal proteins ---- Phospholipid phosphatase 1 Source.2706: DFBPPR8642 ---- Animal proteins ---- Major prion protein Source.2707: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor Source.2708: DFBPPR8648 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 2 Source.2709: DFBPPR8649 ---- Animal proteins ---- Acrosin Source.2710: DFBPPR8657 ---- Animal proteins ---- Annexin A2 Source.2711: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2712: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase Source.2713: DFBPPR8672 ---- Animal proteins ---- Fatty-acid amide hydrolase 1 Source.2714: DFBPPR8674 ---- Animal proteins ---- Calpain-3 Source.2715: DFBPPR8690 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.2716: DFBPPR8692 ---- Animal proteins ---- TNF receptor-associated factor 6 Source.2717: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.2718: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI Source.2719: DFBPPR8709 ---- Animal proteins ---- Glucocorticoid receptor Source.2720: DFBPPR8710 ---- Animal proteins ---- Leptin receptor Source.2721: DFBPPR8713 ---- Animal proteins ---- Dihydrolipoyllysine-residue succinyltransferase component of 2-oxoglutarate dehydrogenase complex, mitochondrial Source.2722: DFBPPR8722 ---- Animal proteins ---- Ras-related protein Rab-5A Source.2723: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9 Source.2724: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM Source.2725: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1 Source.2726: DFBPPR8729 ---- Animal proteins ---- Beta-1,4-galactosyltransferase 5 Source.2727: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)] Source.2728: DFBPPR8735 ---- Animal proteins ---- Pro-cathepsin H Source.2729: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.2730: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2 Source.2731: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2 Source.2732: DFBPPR8753 ---- Animal proteins ---- Androgen receptor Source.2733: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1 Source.2734: DFBPPR8755 ---- Animal proteins ---- Antiviral innate immune response receptor RIG-I Source.2735: DFBPPR8763 ---- Animal proteins ---- cAMP-dependent protein kinase type II-alpha regulatory subunit Source.2736: DFBPPR8769 ---- Animal proteins ---- GPI-anchor transamidase Source.2737: DFBPPR8772 ---- Animal proteins ---- Dystroglycan Source.2738: DFBPPR8773 ---- Animal proteins ---- DNA topoisomerase 2-alpha Source.2739: DFBPPR8776 ---- Animal proteins ---- Serine/threonine-protein kinase WNK1 Source.2740: DFBPPR8782 ---- Animal proteins ---- Tubulin alpha-1A chain Source.2741: DFBPPR8790 ---- Animal proteins ---- Tubulin alpha-1B chain Source.2742: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1 Source.2743: DFBPPR8795 ---- Animal proteins ---- Pro-adrenomedullin Source.2744: DFBPPR8798 ---- Animal proteins ---- Low-density lipoprotein receptor Source.2745: DFBPPR8801 ---- Animal proteins ---- Glutamine synthetase Source.2746: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.2747: DFBPPR8806 ---- Animal proteins ---- Cadherin-5 Source.2748: DFBPPR8808 ---- Animal proteins ---- Cytochrome P450 7A1 Source.2749: DFBPPR8811 ---- Animal proteins ---- Succinate dehydrogenase cytochrome b560 subunit, mitochondrial Source.2750: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase Source.2751: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.2752: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1 Source.2753: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase Source.2754: DFBPPR8828 ---- Animal proteins ---- Thromboxane-A synthase Source.2755: DFBPPR8829 ---- Animal proteins ---- Oxidized low-density lipoprotein receptor 1 Source.2756: DFBPPR8830 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.2757: DFBPPR8832 ---- Animal proteins ---- Ras-related protein Rab-3A Source.2758: DFBPPR8838 ---- Animal proteins ---- Cathepsin K Source.2759: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.2760: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1 Source.2761: DFBPPR8847 ---- Animal proteins ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.2762: DFBPPR8855 ---- Animal proteins ---- Thyroxine 5-deiodinase Source.2763: DFBPPR8857 ---- Animal proteins ---- Allograft inflammatory factor 1 Source.2764: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.2765: DFBPPR8887 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.2766: DFBPPR8889 ---- Animal proteins ---- Hexokinase-2 Source.2767: DFBPPR8896 ---- Animal proteins ---- Heat-stable enterotoxin receptor Source.2768: DFBPPR8903 ---- Animal proteins ---- Zona pellucida sperm-binding protein 2 Source.2769: DFBPPR8905 ---- Animal proteins ---- Zonadhesin Source.2770: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase Source.2771: DFBPPR8923 ---- Animal proteins ---- Cubilin Source.2772: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V Source.2773: DFBPPR8966 ---- Animal proteins ---- Calpain small subunit 1 Source.2774: DFBPPR8971 ---- Animal proteins ---- Fibrillin-1 Source.2775: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein Source.2776: DFBPPR8982 ---- Animal proteins ---- Mannose-1-phosphate guanyltransferase beta Source.2777: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.2778: DFBPPR9019 ---- Animal proteins ---- Inositol monophosphatase 1 Source.2779: DFBPPR9022 ---- Animal proteins ---- Prothrombin Source.2780: DFBPPR9024 ---- Animal proteins ---- Glutamate dehydrogenase 1, mitochondrial Source.2781: DFBPPR9025 ---- Animal proteins ---- Glutamate decarboxylase 2 Source.2782: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1 Source.2783: DFBPPR9031 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.2784: DFBPPR9032 ---- Animal proteins ---- NADP-dependent malic enzyme Source.2785: DFBPPR9033 ---- Animal proteins ---- Interleukin-2 Source.2786: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80 Source.2787: DFBPPR9067 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.2788: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.2789: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.2790: DFBPPR9082 ---- Animal proteins ---- Insulin-induced gene 2 protein Source.2791: DFBPPR9088 ---- Animal proteins ---- Hepatocyte nuclear factor 1-beta Source.2792: DFBPPR9097 ---- Animal proteins ---- UDP-GalNAc:beta-1,3-N-acetylgalactosaminyltransferase 1 Source.2793: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase Source.2794: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C Source.2795: DFBPPR9107 ---- Animal proteins ---- Tissue-type plasminogen activator Source.2796: DFBPPR9110 ---- Animal proteins ---- Insulin-like growth factor I Source.2797: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.2798: DFBPPR9114 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.2799: DFBPPR9115 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.2800: DFBPPR9120 ---- Animal proteins ---- 60S ribosomal protein L6 Source.2801: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1 Source.2802: DFBPPR9132 ---- Animal proteins ---- Dystrophin Source.2803: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial Source.2804: DFBPPR9145 ---- Animal proteins ---- Nociceptin receptor Source.2805: DFBPPR9147 ---- Animal proteins ---- Kynurenine 3-monooxygenase Source.2806: DFBPPR9148 ---- Animal proteins ---- Alpha-tubulin N-acetyltransferase 1 Source.2807: DFBPPR9152 ---- Animal proteins ---- Insulin-like growth factor 1 receptor Source.2808: DFBPPR9156 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.2809: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.2810: DFBPPR9167 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.2811: DFBPPR9171 ---- Animal proteins ---- Sorbin and SH3 domain-containing protein 2 Source.2812: DFBPPR9177 ---- Animal proteins ---- Matrix metalloproteinase-20 Source.2813: DFBPPR9181 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4 Source.2814: DFBPPR9183 ---- Animal proteins ---- Glutamate decarboxylase 1 Source.2815: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein Source.2816: DFBPPR9195 ---- Animal proteins ---- Sex-determining region Y protein Source.2817: DFBPPR9197 ---- Animal proteins ---- Myosin-7 Source.2818: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.2819: DFBPPR9201 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 1 Source.2820: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.2821: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1 Source.2822: DFBPPR9216 ---- Animal proteins ---- Netrin-1 Source.2823: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII Source.2824: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.2825: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial Source.2826: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta Source.2827: DFBPPR9236 ---- Animal proteins ---- Radixin Source.2828: DFBPPR9240 ---- Animal proteins ---- Thyrotropin subunit beta Source.2829: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin Source.2830: DFBPPR9257 ---- Animal proteins ---- Ribonuclease 4 Source.2831: DFBPPR9258 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha Source.2832: DFBPPR9260 ---- Animal proteins ---- ADP/ATP translocase 3 Source.2833: DFBPPR9261 ---- Animal proteins ---- S-formylglutathione hydrolase Source.2834: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3 Source.2835: DFBPPR9265 ---- Animal proteins ---- Pantetheinase Source.2836: DFBPPR9269 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.2837: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent Source.2838: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase Source.2839: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type Source.2840: DFBPPR9281 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.2841: DFBPPR9298 ---- Animal proteins ---- Melanocortin receptor 4 Source.2842: DFBPPR9301 ---- Animal proteins ---- Adenosylhomocysteinase Source.2843: DFBPPR9308 ---- Animal proteins ---- Aromatase 3 Source.2844: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor Source.2845: DFBPPR9314 ---- Animal proteins ---- Regucalcin Source.2846: DFBPPR9321 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.2847: DFBPPR9331 ---- Animal proteins ---- Proteasome subunit beta type-8 Source.2848: DFBPPR9337 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.2849: DFBPPR9338 ---- Animal proteins ---- SPARC Source.2850: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2 Source.2851: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1 Source.2852: DFBPPR9344 ---- Animal proteins ---- Desmoglein-1 Source.2853: DFBPPR9349 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.2854: DFBPPR9350 ---- Animal proteins ---- RNA-binding protein 4B Source.2855: DFBPPR9358 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, mitochondrial Source.2856: DFBPPR9363 ---- Animal proteins ---- Moesin Source.2857: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein Source.2858: DFBPPR9365 ---- Animal proteins ---- Aromatase 2 Source.2859: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial Source.2860: DFBPPR9377 ---- Animal proteins ---- Myosin regulatory light polypeptide 9 Source.2861: DFBPPR9378 ---- Animal proteins ---- Ammonium transporter Rh type C Source.2862: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1 Source.2863: DFBPPR9382 ---- Animal proteins ---- Proteasome subunit beta type-4 Source.2864: DFBPPR9384 ---- Animal proteins ---- Interferon epsilon Source.2865: DFBPPR9387 ---- Animal proteins ---- Protein ATP1B4 Source.2866: DFBPPR9413 ---- Animal proteins ---- Microsomal triglyceride transfer protein large subunit Source.2867: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.2868: DFBPPR9427 ---- Animal proteins ---- Protein quaking Source.2869: DFBPPR9434 ---- Animal proteins ---- Deubiquitinase DESI2 Source.2870: DFBPPR9450 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.2871: DFBPPR9461 ---- Animal proteins ---- CCN family member 2 Source.2872: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor Source.2873: DFBPPR9494 ---- Animal proteins ---- Neuron-specific calcium-binding protein hippocalcin Source.2874: DFBPPR9495 ---- Animal proteins ---- Complement factor B Source.2875: DFBPPR9504 ---- Animal proteins ---- Angiopoietin-2 Source.2876: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2 Source.2877: DFBPPR9512 ---- Animal proteins ---- Acylphosphatase-2 Source.2878: DFBPPR9513 ---- Animal proteins ---- Small conductance calcium-activated potassium channel protein 3 Source.2879: DFBPPR9520 ---- Animal proteins ---- L-gulonolactone oxidase Source.2880: DFBPPR9532 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit alpha, mitochondrial Source.2881: DFBPPR9534 ---- Animal proteins ---- Transcription factor GATA-6 Source.2882: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.2883: DFBPPR9541 ---- Animal proteins ---- Choline O-acetyltransferase Source.2884: DFBPPR9544 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.2885: DFBPPR9545 ---- Animal proteins ---- Thioredoxin reductase 1, cytoplasmic Source.2886: DFBPPR9546 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1E Source.2887: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2 Source.2888: DFBPPR9569 ---- Animal proteins ---- Myelin proteolipid protein Source.2889: DFBPPR9602 ---- Animal proteins ---- Gastrin-releasing peptide Source.2890: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1 Source.2891: DFBPPR9625 ---- Animal proteins ---- HORMA domain-containing protein 1 Source.2892: DFBPPR9628 ---- Animal proteins ---- Mineralocorticoid receptor Source.2893: DFBPPR9637 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.2894: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2 Source.2895: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1 Source.2896: DFBPPR9658 ---- Animal proteins ---- Melanocortin receptor 5 Source.2897: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.2898: DFBPPR9684 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.2899: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein Source.2900: DFBPPR9709 ---- Animal proteins ---- UDP-N-acetylglucosamine/UDP-glucose/GDP-mannose transporter Source.2901: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.2902: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.2903: DFBPPR9785 ---- Animal proteins ---- F-box only protein 32 Source.2904: DFBPPR9788 ---- Animal proteins ---- ATP synthase-coupling factor 6, mitochondrial Source.2905: DFBPPR9791 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1 Source.2906: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2 Source.2907: DFBPPR9804 ---- Animal proteins ---- COP9 signalosome complex subunit 4 Source.2908: DFBPPR9814 ---- Animal proteins ---- Testin Source.2909: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.2910: DFBPPR9832 ---- Animal proteins ---- Olfactomedin-like protein 2A Source.2911: DFBPPR9834 ---- Animal proteins ---- Interferon-related developmental regulator 1 Source.2912: DFBPPR9843 ---- Animal proteins ---- P protein Source.2913: DFBPPR9852 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.2914: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase Source.2915: DFBPPR9883 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.2916: DFBPPR9895 ---- Animal proteins ---- 40S ribosomal protein S12 Source.2917: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2 Source.2918: DFBPPR9927 ---- Animal proteins ---- Protein BTG3 Source.2919: DFBPPR9959 ---- Animal proteins ---- Interferon gamma Source.2920: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey Source.2921: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein Source.2922: DFBPPR9987 ---- Animal proteins ---- Transforming growth factor beta-3 proprotein Source.2923: DFBPPR9991 ---- Animal proteins ---- Insulin-like growth factor I Source.2924: DFBPPR9993 ---- Animal proteins ---- Ovalbumin Source.2925: DFBPPR9996 ---- Animal proteins ---- Riboflavin-binding protein Source.2926: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial Source.2927: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.2928: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain Source.2929: DFBPPR10011 ---- Animal proteins ---- Myosin-11 Source.2930: DFBPPR10012 ---- Animal proteins ---- Tumor necrosis factor receptor superfamily member 16 Source.2931: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor Source.2932: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2 Source.2933: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D Source.2934: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B Source.2935: DFBPPR10030 ---- Animal proteins ---- Calbindin Source.2936: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase Source.2937: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A Source.2938: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor Source.2939: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1 Source.2940: DFBPPR10049 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 4 Source.2941: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15 Source.2942: DFBPPR10063 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase, cytosolic [GTP] Source.2943: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9 Source.2944: DFBPPR10073 ---- Animal proteins ---- Lipoprotein lipase Source.2945: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.2946: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.2947: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2 Source.2948: DFBPPR10083 ---- Animal proteins ---- Myosin-9 Source.2949: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type Source.2950: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2 Source.2951: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2 Source.2952: DFBPPR10091 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.2953: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor Source.2954: DFBPPR10098 ---- Animal proteins ---- Mucin-6 Source.2955: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.2956: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7 Source.2957: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2 Source.2958: DFBPPR10114 ---- Animal proteins ---- Cadherin-5 Source.2959: DFBPPR10116 ---- Animal proteins ---- Cadherin-2 Source.2960: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog Source.2961: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2 Source.2962: DFBPPR10122 ---- Animal proteins ---- Heat shock factor protein 3 Source.2963: DFBPPR10123 ---- Animal proteins ---- Ephrin type-A receptor 3 Source.2964: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2 Source.2965: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3 Source.2966: DFBPPR10126 ---- Animal proteins ---- Glutamine synthetase Source.2967: DFBPPR10127 ---- Animal proteins ---- Heat shock factor protein 1 Source.2968: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit Source.2969: DFBPPR10134 ---- Animal proteins ---- Deoxycytidine kinase Source.2970: DFBPPR10136 ---- Animal proteins ---- Annexin A2 Source.2971: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor Source.2972: DFBPPR10142 ---- Animal proteins ---- Calpain-3 Source.2973: DFBPPR10145 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.2974: DFBPPR10146 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-3 Source.2975: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS Source.2976: DFBPPR10151 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] iron-sulfur subunit, mitochondrial Source.2977: DFBPPR10153 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2 Source.2978: DFBPPR10158 ---- Animal proteins ---- B-cell lymphoma 6 protein homolog Source.2979: DFBPPR10162 ---- Animal proteins ---- Dynamin-like 120 kDa protein, mitochondrial Source.2980: DFBPPR10166 ---- Animal proteins ---- Kinetochore protein NDC80 homolog Source.2981: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein Source.2982: DFBPPR10169 ---- Animal proteins ---- Proto-oncogene c-Fos Source.2983: DFBPPR10170 ---- Animal proteins ---- Drebrin Source.2984: DFBPPR10171 ---- Animal proteins ---- Heterochromatin-associated protein MENT Source.2985: DFBPPR10173 ---- Animal proteins ---- Teneurin-1 Source.2986: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha Source.2987: DFBPPR10176 ---- Animal proteins ---- T-box transcription factor TBX5 Source.2988: DFBPPR10180 ---- Animal proteins ---- Teneurin-2 Source.2989: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase Source.2990: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia Source.2991: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1 Source.2992: DFBPPR10197 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-7 Source.2993: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4 Source.2994: DFBPPR10205 ---- Animal proteins ---- Noelin Source.2995: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI Source.2996: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1 Source.2997: DFBPPR10227 ---- Animal proteins ---- Serine/threonine-protein kinase STK11 Source.2998: DFBPPR10230 ---- Animal proteins ---- B-cell linker protein Source.2999: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4 Source.3000: DFBPPR10233 ---- Animal proteins ---- Glutathione S-transferase 3 Source.3001: DFBPPR10242 ---- Animal proteins ---- Farnesyl pyrophosphate synthase Source.3002: DFBPPR10245 ---- Animal proteins ---- Histone deacetylase 4 Source.3003: DFBPPR10253 ---- Animal proteins ---- Integrin beta-1 Source.3004: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5 Source.3005: DFBPPR10259 ---- Animal proteins ---- Frizzled-4 Source.3006: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6 Source.3007: DFBPPR10270 ---- Animal proteins ---- Agrin Source.3008: DFBPPR10271 ---- Animal proteins ---- Cadherin-7 Source.3009: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B Source.3010: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible Source.3011: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.3012: DFBPPR10285 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 6 Source.3013: DFBPPR10288 ---- Animal proteins ---- Protein-lysine 6-oxidase Source.3014: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3 Source.3015: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor Source.3016: DFBPPR10296 ---- Animal proteins ---- Mucin-5B Source.3017: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2 Source.3018: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va Source.3019: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2 Source.3020: DFBPPR10304 ---- Animal proteins ---- Rhodopsin Source.3021: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1 Source.3022: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.3023: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase Source.3024: DFBPPR10315 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit beta-4 Source.3025: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1 Source.3026: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK Source.3027: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7 Source.3028: DFBPPR10329 ---- Animal proteins ---- Activity-regulated cytoskeleton-associated protein Source.3029: DFBPPR10330 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase eta Source.3030: DFBPPR10331 ---- Animal proteins ---- Calcineurin B homologous protein 3 Source.3031: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma Source.3032: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.3033: DFBPPR10350 ---- Animal proteins ---- Protein dispatched homolog 3 Source.3034: DFBPPR10355 ---- Animal proteins ---- Down syndrome cell adhesion molecule-like protein 1 homolog Source.3035: DFBPPR10358 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase Source.3036: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel Source.3037: DFBPPR10361 ---- Animal proteins ---- Protein HIRA Source.3038: DFBPPR10362 ---- Animal proteins ---- Casein kinase I isoform alpha Source.3039: DFBPPR10366 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein Source.3040: DFBPPR10374 ---- Animal proteins ---- Cadherin-1 Source.3041: DFBPPR10376 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.3042: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase Source.3043: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial Source.3044: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein Source.3045: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5 Source.3046: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1 Source.3047: DFBPPR10395 ---- Animal proteins ---- X-ray repair cross-complementing protein 5 Source.3048: DFBPPR10402 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1 Source.3049: DFBPPR10410 ---- Animal proteins ---- Cone cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha' Source.3050: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit Source.3051: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A Source.3052: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5 Source.3053: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2 Source.3054: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain Source.3055: DFBPPR10427 ---- Animal proteins ---- Myosin regulatory light chain 2, smooth muscle major isoform Source.3056: DFBPPR10428 ---- Animal proteins ---- Polycomb complex protein BMI-1 Source.3057: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1 Source.3058: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle Source.3059: DFBPPR10442 ---- Animal proteins ---- Neurexin-1 Source.3060: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain Source.3061: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c Source.3062: DFBPPR10450 ---- Animal proteins ---- cAMP-dependent protein kinase type I-alpha regulatory subunit Source.3063: DFBPPR10452 ---- Animal proteins ---- Desmin Source.3064: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1 Source.3065: DFBPPR10456 ---- Animal proteins ---- Neuroserpin Source.3066: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3 Source.3067: DFBPPR10458 ---- Animal proteins ---- Neurofascin Source.3068: DFBPPR10459 ---- Animal proteins ---- Reelin Source.3069: DFBPPR10463 ---- Animal proteins ---- Sulfhydryl oxidase 1 Source.3070: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain Source.3071: DFBPPR10474 ---- Animal proteins ---- Serine/threonine-protein kinase greatwall Source.3072: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle Source.3073: DFBPPR10485 ---- Animal proteins ---- LIM domain-binding protein 1 Source.3074: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1 Source.3075: DFBPPR10494 ---- Animal proteins ---- Interferon lambda receptor 1 Source.3076: DFBPPR10495 ---- Animal proteins ---- Y-box-binding protein 1 Source.3077: DFBPPR10497 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 7 Source.3078: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4 Source.3079: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor Source.3080: DFBPPR10500 ---- Animal proteins ---- Casein kinase I isoform epsilon Source.3081: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor Source.3082: DFBPPR10502 ---- Animal proteins ---- Pumilio homolog 1 Source.3083: DFBPPR10505 ---- Animal proteins ---- DNA-binding protein Ikaros Source.3084: DFBPPR10507 ---- Animal proteins ---- Neurexin-1-beta Source.3085: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain Source.3086: DFBPPR10518 ---- Animal proteins ---- Neural cell adhesion molecule 1 Source.3087: DFBPPR10522 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-2 Source.3088: DFBPPR10529 ---- Animal proteins ---- Cadherin-20 Source.3089: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4 Source.3090: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein Source.3091: DFBPPR10539 ---- Animal proteins ---- Netrin receptor UNC5C Source.3092: DFBPPR10541 ---- Animal proteins ---- Glypican-1 Source.3093: DFBPPR10543 ---- Animal proteins ---- Histone deacetylase 3 Source.3094: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1 Source.3095: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein Source.3096: DFBPPR10556 ---- Animal proteins ---- Tenascin-R Source.3097: DFBPPR10564 ---- Animal proteins ---- DNA damage-binding protein 1 Source.3098: DFBPPR10566 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-3 Source.3099: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein Source.3100: DFBPPR10575 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA lyase, mitochondrial Source.3101: DFBPPR10584 ---- Animal proteins ---- Nuclear distribution protein nudE homolog 1 Source.3102: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.3103: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6 Source.3104: DFBPPR10594 ---- Animal proteins ---- Aromatase Source.3105: DFBPPR10595 ---- Animal proteins ---- Replication protein A 70 kDa DNA-binding subunit Source.3106: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1 Source.3107: DFBPPR10600 ---- Animal proteins ---- Tubulin alpha-1 chain Source.3108: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A Source.3109: DFBPPR10608 ---- Animal proteins ---- Semaphorin-3D Source.3110: DFBPPR10611 ---- Animal proteins ---- Inhibitor of growth protein 4 Source.3111: DFBPPR10612 ---- Animal proteins ---- Carboxypeptidase Z Source.3112: DFBPPR10613 ---- Animal proteins ---- Diamine acetyltransferase 1 Source.3113: DFBPPR10616 ---- Animal proteins ---- Cholecystokinin Source.3114: DFBPPR10619 ---- Animal proteins ---- Adenosine receptor A2b Source.3115: DFBPPR10622 ---- Animal proteins ---- Violet-sensitive opsin Source.3116: DFBPPR10625 ---- Animal proteins ---- N-lysine methyltransferase SMYD2 Source.3117: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain Source.3118: DFBPPR10630 ---- Animal proteins ---- Contactin-2 Source.3119: DFBPPR10632 ---- Animal proteins ---- E3 ubiquitin-protein ligase Hakai Source.3120: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1 Source.3121: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B Source.3122: DFBPPR10646 ---- Animal proteins ---- Netrin-1 Source.3123: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.3124: DFBPPR10653 ---- Animal proteins ---- Contactin-1 Source.3125: DFBPPR10656 ---- Animal proteins ---- BRCA1-A complex subunit Abraxas 1 Source.3126: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8 Source.3127: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U Source.3128: DFBPPR10667 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1 Source.3129: DFBPPR10669 ---- Animal proteins ---- T-box transcription factor TBX3 Source.3130: DFBPPR10677 ---- Animal proteins ---- Blue-sensitive opsin Source.3131: DFBPPR10681 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.3132: DFBPPR10686 ---- Animal proteins ---- Collectin-11 Source.3133: DFBPPR10687 ---- Animal proteins ---- Transcriptional activator Myb Source.3134: DFBPPR10689 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 13 Source.3135: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.3136: DFBPPR10698 ---- Animal proteins ---- Adenylosuccinate synthetase isozyme 2 Source.3137: DFBPPR10703 ---- Animal proteins ---- Tensin Source.3138: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain Source.3139: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2 Source.3140: DFBPPR10715 ---- Animal proteins ---- Lumican Source.3141: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2 Source.3142: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog Source.3143: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10 Source.3144: DFBPPR10729 ---- Animal proteins ---- Versican core protein Source.3145: DFBPPR10730 ---- Animal proteins ---- Casein kinase II subunit alpha Source.3146: DFBPPR10731 ---- Animal proteins ---- Protein cereblon Source.3147: DFBPPR10733 ---- Animal proteins ---- Ras-related protein Rab-6A Source.3148: DFBPPR10734 ---- Animal proteins ---- Homeobox protein Hox-B4 Source.3149: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E Source.3150: DFBPPR10737 ---- Animal proteins ---- Programmed cell death protein 10 Source.3151: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1 Source.3152: DFBPPR10747 ---- Animal proteins ---- Cathepsin B Source.3153: DFBPPR10748 ---- Animal proteins ---- Sodium-coupled neutral amino acid transporter 2 Source.3154: DFBPPR10752 ---- Animal proteins ---- Protein ATP1B4 Source.3155: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein Source.3156: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic Source.3157: DFBPPR10758 ---- Animal proteins ---- Tubulin-specific chaperone A Source.3158: DFBPPR10762 ---- Animal proteins ---- Cadherin-6 Source.3159: DFBPPR10763 ---- Animal proteins ---- Serum paraoxonase/arylesterase 2 Source.3160: DFBPPR10767 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.3161: DFBPPR10770 ---- Animal proteins ---- Mannose-binding protein Source.3162: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.3163: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.3164: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3 Source.3165: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5 Source.3166: DFBPPR10785 ---- Animal proteins ---- Cytochrome b5 Source.3167: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12 Source.3168: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1 Source.3169: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B Source.3170: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V Source.3171: DFBPPR10807 ---- Animal proteins ---- Dystrophin Source.3172: DFBPPR10809 ---- Animal proteins ---- Lysine-specific demethylase 3A Source.3173: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2 Source.3174: DFBPPR10819 ---- Animal proteins ---- Ribosomal protein S6 kinase alpha-5 Source.3175: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.3176: DFBPPR10832 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1 Source.3177: DFBPPR10839 ---- Animal proteins ---- G2/mitotic-specific cyclin-B2 Source.3178: DFBPPR10844 ---- Animal proteins ---- 60S ribosomal protein L5 Source.3179: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1 Source.3180: DFBPPR10850 ---- Animal proteins ---- Ovostatin Source.3181: DFBPPR10851 ---- Animal proteins ---- Wee1-like protein kinase 2 Source.3182: DFBPPR10852 ---- Animal proteins ---- Wee1-like protein kinase 2 Source.3183: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3 Source.3184: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26 Source.3185: DFBPPR10861 ---- Animal proteins ---- Parathyroid hormone-related protein Source.3186: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7 Source.3187: DFBPPR10875 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.3188: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1 Source.3189: DFBPPR10878 ---- Animal proteins ---- Zinc finger protein DPF3 Source.3190: DFBPPR10879 ---- Animal proteins ---- Casein kinase II subunit alpha' Source.3191: DFBPPR10881 ---- Animal proteins ---- Tubulin alpha-5 chain Source.3192: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2 Source.3193: DFBPPR10887 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.3194: DFBPPR10896 ---- Animal proteins ---- Contactin-5 Source.3195: DFBPPR10900 ---- Animal proteins ---- Thyroxine 5-deiodinase Source.3196: DFBPPR10904 ---- Animal proteins ---- Signal transducing adapter molecule 2 Source.3197: DFBPPR10910 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial Source.3198: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta Source.3199: DFBPPR10918 ---- Animal proteins ---- Frizzled-2 Source.3200: DFBPPR10919 ---- Animal proteins ---- Ski oncogene Source.3201: DFBPPR10923 ---- Animal proteins ---- Ras-related protein Rab-5B Source.3202: DFBPPR10927 ---- Animal proteins ---- Frizzled-7 Source.3203: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28 Source.3204: DFBPPR10931 ---- Animal proteins ---- Nuclear receptor subfamily 2 group E member 1 Source.3205: DFBPPR10940 ---- Animal proteins ---- Protein piccolo Source.3206: DFBPPR10942 ---- Animal proteins ---- Histone deacetylase 2 Source.3207: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1 Source.3208: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type Source.3209: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type Source.3210: DFBPPR10963 ---- Animal proteins ---- Semaphorin-3C Source.3211: DFBPPR10965 ---- Animal proteins ---- Nuclear factor 1 X-type Source.3212: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2 Source.3213: DFBPPR10972 ---- Animal proteins ---- Structural maintenance of chromosomes protein 5 Source.3214: DFBPPR10973 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 homolog Source.3215: DFBPPR10977 ---- Animal proteins ---- Tubulin alpha-2 chain Source.3216: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A Source.3217: DFBPPR10980 ---- Animal proteins ---- Elongation factor 2 Source.3218: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8 Source.3219: DFBPPR10995 ---- Animal proteins ---- Protein-tyrosine sulfotransferase 2 Source.3220: DFBPPR11005 ---- Animal proteins ---- N6-adenosine-methyltransferase non-catalytic subunit Source.3221: DFBPPR11019 ---- Animal proteins ---- Cadherin-4 Source.3222: DFBPPR11021 ---- Animal proteins ---- Protein Jumonji Source.3223: DFBPPR11029 ---- Animal proteins ---- Myelin proteolipid protein Source.3224: DFBPPR11030 ---- Animal proteins ---- Protein C-ets-2 Source.3225: DFBPPR11039 ---- Animal proteins ---- Neurexin-3 Source.3226: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7 Source.3227: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein Source.3228: DFBPPR11046 ---- Animal proteins ---- Phosphatidylinositol 5-phosphate 4-kinase type-2 alpha Source.3229: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6 Source.3230: DFBPPR11054 ---- Animal proteins ---- Hyaluronan synthase 2 Source.3231: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A Source.3232: DFBPPR11061 ---- Animal proteins ---- Cyclin-A2 Source.3233: DFBPPR11062 ---- Animal proteins ---- Regucalcin Source.3234: DFBPPR11067 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-3 Source.3235: DFBPPR11069 ---- Animal proteins ---- Casein kinase I isoform gamma-1 Source.3236: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1 Source.3237: DFBPPR11079 ---- Animal proteins ---- Frizzled-1 Source.3238: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase Source.3239: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2 Source.3240: DFBPPR11086 ---- Animal proteins ---- Zinc finger E-box-binding homeobox 1 Source.3241: DFBPPR11096 ---- Animal proteins ---- WASH complex subunit 1 Source.3242: DFBPPR11097 ---- Animal proteins ---- Twinkle protein, mitochondrial Source.3243: DFBPPR11112 ---- Animal proteins ---- Protein quaking Source.3244: DFBPPR11118 ---- Animal proteins ---- Filensin Source.3245: DFBPPR11122 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 14 Source.3246: DFBPPR11129 ---- Animal proteins ---- Zinc finger protein ZIC 1 Source.3247: DFBPPR11132 ---- Animal proteins ---- Glycine amidinotransferase, mitochondrial Source.3248: DFBPPR11144 ---- Animal proteins ---- Tubulin alpha-4 chain Source.3249: DFBPPR11148 ---- Animal proteins ---- Pro-thyrotropin-releasing hormone Source.3250: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A Source.3251: DFBPPR11150 ---- Animal proteins ---- Opioid-binding protein/cell adhesion molecule homolog Source.3252: DFBPPR11151 ---- Animal proteins ---- SPARC Source.3253: DFBPPR11154 ---- Animal proteins ---- Tubulin alpha-3 chain Source.3254: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A Source.3255: DFBPPR11163 ---- Animal proteins ---- TSC22 domain family protein 1 Source.3256: DFBPPR11167 ---- Animal proteins ---- Insulin-induced gene 2 protein Source.3257: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3 Source.3258: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1 Source.3259: DFBPPR11199 ---- Animal proteins ---- Secreted frizzled-related protein 3 Source.3260: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30 Source.3261: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha Source.3262: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1 Source.3263: DFBPPR11205 ---- Animal proteins ---- Protein 4.1 Source.3264: DFBPPR11207 ---- Animal proteins ---- T-box transcription factor T Source.3265: DFBPPR11211 ---- Animal proteins ---- Acylphosphatase-2 Source.3266: DFBPPR11212 ---- Animal proteins ---- Glycoprotein-N-acetylgalactosamine 3-beta-galactosyltransferase 1 Source.3267: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein Source.3268: DFBPPR11217 ---- Animal proteins ---- WD repeat domain phosphoinositide-interacting protein 2 Source.3269: DFBPPR11224 ---- Animal proteins ---- Nuclear receptor subfamily 5 group A member 2 Source.3270: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase Source.3271: DFBPPR11228 ---- Animal proteins ---- CTP synthase 2 Source.3272: DFBPPR11231 ---- Animal proteins ---- 116 kDa U5 small nuclear ribonucleoprotein component Source.3273: DFBPPR11232 ---- Animal proteins ---- AP-3 complex subunit mu-1 Source.3274: DFBPPR11235 ---- Animal proteins ---- G1/S-specific cyclin-D2 Source.3275: DFBPPR11240 ---- Animal proteins ---- Deubiquitinase DESI2 Source.3276: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1 Source.3277: DFBPPR11243 ---- Animal proteins ---- Epiphycan Source.3278: DFBPPR11244 ---- Animal proteins ---- Frizzled-6 Source.3279: DFBPPR11246 ---- Animal proteins ---- 5'-3' exoribonuclease 2 Source.3280: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing] Source.3281: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5 Source.3282: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1 Source.3283: DFBPPR11261 ---- Animal proteins ---- Zinc transporter 6 Source.3284: DFBPPR11266 ---- Animal proteins ---- Protogenin Source.3285: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase Source.3286: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1 Source.3287: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3 Source.3288: DFBPPR11275 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 15 Source.3289: DFBPPR11279 ---- Animal proteins ---- Zinc finger protein neuro-d4 Source.3290: DFBPPR11282 ---- Animal proteins ---- Ras-related protein Rab-5C Source.3291: DFBPPR11287 ---- Animal proteins ---- Lethal(3)malignant brain tumor-like protein 1 Source.3292: DFBPPR11288 ---- Animal proteins ---- AKT-interacting protein Source.3293: DFBPPR11289 ---- Animal proteins ---- Alpha/beta hydrolase domain-containing protein 17C Source.3294: DFBPPR11290 ---- Animal proteins ---- Cyclic nucleotide-gated channel cone photoreceptor subunit alpha Source.3295: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3 Source.3296: DFBPPR11295 ---- Animal proteins ---- Histone H2A deubiquitinase MYSM1 Source.3297: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2 Source.3298: DFBPPR11298 ---- Animal proteins ---- Transcription elongation factor SPT5 Source.3299: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1 Source.3300: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6 Source.3301: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog Source.3302: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2 Source.3303: DFBPPR11318 ---- Animal proteins ---- Chromatin modification-related protein MEAF6 Source.3304: DFBPPR11324 ---- Animal proteins ---- DNA nucleotidylexotransferase Source.3305: DFBPPR11326 ---- Animal proteins ---- P2Y purinoceptor 8 Source.3306: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2 Source.3307: DFBPPR11329 ---- Animal proteins ---- Bone sialoprotein 2 Source.3308: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A Source.3309: DFBPPR11346 ---- Animal proteins ---- Diencephalon/mesencephalon homeobox protein 1 Source.3310: DFBPPR11349 ---- Animal proteins ---- Glutathione S-transferase Source.3311: DFBPPR11357 ---- Animal proteins ---- Fibroblast growth factor 4 Source.3312: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase Source.3313: DFBPPR11364 ---- Animal proteins ---- Interleukin-18 Source.3314: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1 Source.3315: DFBPPR11374 ---- Animal proteins ---- Membrane-associated guanylate kinase, WW and PDZ domain-containing protein 3 Source.3316: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1 Source.3317: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase Source.3318: DFBPPR11389 ---- Animal proteins ---- 60S ribosomal protein L7 Source.3319: DFBPPR11392 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 37 Source.3320: DFBPPR11400 ---- Animal proteins ---- Thrombospondin-2 Source.3321: DFBPPR11405 ---- Animal proteins ---- Cadherin-related family member 1 Source.3322: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47 Source.3323: DFBPPR11408 ---- Animal proteins ---- Cadherin-10 Source.3324: DFBPPR11411 ---- Animal proteins ---- Zinc finger protein ubi-d4 Source.3325: DFBPPR11412 ---- Animal proteins ---- Hyaluronan synthase 3 Source.3326: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7 Source.3327: DFBPPR11419 ---- Animal proteins ---- Glutathione S-transferase Source.3328: DFBPPR11432 ---- Animal proteins ---- Homeobox protein Hox-D9 Source.3329: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4 Source.3330: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator Source.3331: DFBPPR11450 ---- Animal proteins ---- Potassium voltage-gated channel subfamily G member 2 Source.3332: DFBPPR11461 ---- Animal proteins ---- Solute carrier family 25 member 46 Source.3333: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.3334: DFBPPR11464 ---- Animal proteins ---- Homeobox protein Hox-D10 Source.3335: DFBPPR11466 ---- Animal proteins ---- GDNF family receptor alpha-2 Source.3336: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog Source.3337: DFBPPR11472 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein Source.3338: DFBPPR11474 ---- Animal proteins ---- KH homology domain-containing protein 4 Source.3339: DFBPPR11477 ---- Animal proteins ---- Transcription factor GATA-5 Source.3340: DFBPPR11480 ---- Animal proteins ---- Cytochrome P450 1A2 Source.3341: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1 Source.3342: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase Source.3343: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7 Source.3344: DFBPPR11497 ---- Animal proteins ---- Dolichyl pyrophosphate Man9GlcNAc2 alpha-1,3-glucosyltransferase Source.3345: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog Source.3346: DFBPPR11513 ---- Animal proteins ---- Corepressor interacting with RBPJ 1 Source.3347: DFBPPR11514 ---- Animal proteins ---- Homeobox protein Hox-D11 Source.3348: DFBPPR11519 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 5 Source.3349: DFBPPR11526 ---- Animal proteins ---- Fibromodulin Source.3350: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80 Source.3351: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD Source.3352: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1 Source.3353: DFBPPR11541 ---- Animal proteins ---- Tetraspanin-12 Source.3354: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L Source.3355: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial Source.3356: DFBPPR11555 ---- Animal proteins ---- Choline O-acetyltransferase Source.3357: DFBPPR11557 ---- Animal proteins ---- Regulator of G-protein signaling 17 Source.3358: DFBPPR11558 ---- Animal proteins ---- Nuclear migration protein nudC Source.3359: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70 Source.3360: DFBPPR11564 ---- Animal proteins ---- Transcriptional regulator Erg Source.3361: DFBPPR11567 ---- Animal proteins ---- Ovocalyxin-32 Source.3362: DFBPPR11572 ---- Animal proteins ---- Deoxyhypusine hydroxylase Source.3363: DFBPPR11579 ---- Animal proteins ---- Actin-related protein 6 Source.3364: DFBPPR11584 ---- Animal proteins ---- NF-kappa-B inhibitor alpha Source.3365: DFBPPR11588 ---- Animal proteins ---- Acetylserotonin O-methyltransferase Source.3366: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein Source.3367: DFBPPR11595 ---- Animal proteins ---- Histone-lysine N-methyltransferase SETD1B Source.3368: DFBPPR11599 ---- Animal proteins ---- Homeobox protein Hox-A9 Source.3369: DFBPPR11602 ---- Animal proteins ---- Arylsulfatase K Source.3370: DFBPPR11604 ---- Animal proteins ---- Centromere protein I Source.3371: DFBPPR11611 ---- Animal proteins ---- Potassium channel subfamily T member 1 Source.3372: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8 Source.3373: DFBPPR11622 ---- Animal proteins ---- Ammonium transporter Rh type C Source.3374: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5 Source.3375: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1 Source.3376: DFBPPR11633 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC1 Source.3377: DFBPPR11641 ---- Animal proteins ---- MICOS complex subunit MIC27 Source.3378: DFBPPR11642 ---- Animal proteins ---- T-box transcription factor TBX19 Source.3379: DFBPPR11643 ---- Animal proteins ---- GDNF family receptor alpha-4 Source.3380: DFBPPR11647 ---- Animal proteins ---- RNA polymerase II subunit A C-terminal domain phosphatase SSU72 Source.3381: DFBPPR11650 ---- Animal proteins ---- Zinc finger protein Pegasus Source.3382: DFBPPR11659 ---- Animal proteins ---- Matrix remodeling-associated protein 8 Source.3383: DFBPPR11660 ---- Animal proteins ---- Cathepsin K Source.3384: DFBPPR11664 ---- Animal proteins ---- Swi5-dependent recombination DNA repair protein 1 homolog Source.3385: DFBPPR11667 ---- Animal proteins ---- Heme transporter HRG1 Source.3386: DFBPPR11697 ---- Animal proteins ---- N-alpha-acetyltransferase 35, NatC auxiliary subunit Source.3387: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.3388: DFBPPR11705 ---- Animal proteins ---- SCO-spondin Source.3389: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3 Source.3390: DFBPPR11715 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.3391: DFBPPR11719 ---- Animal proteins ---- Protein RER1 Source.3392: DFBPPR11722 ---- Animal proteins ---- T-cell surface glycoprotein CD3 epsilon chain Source.3393: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1 Source.3394: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein Source.3395: DFBPPR11752 ---- Animal proteins ---- Actin-related protein 5 Source.3396: DFBPPR11753 ---- Animal proteins ---- Amyloid beta A4 precursor protein-binding family B member 1-interacting protein Source.3397: DFBPPR11754 ---- Animal proteins ---- Neurocalcin-delta Source.3398: DFBPPR11760 ---- Animal proteins ---- Cysteine-rich motor neuron 1 protein Source.3399: DFBPPR11761 ---- Animal proteins ---- Olfactory receptor-like protein COR6 Source.3400: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1 Source.3401: DFBPPR11767 ---- Animal proteins ---- Olfactory receptor-like protein COR1 Source.3402: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like Source.3403: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5 Source.3404: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4 Source.3405: DFBPPR11782 ---- Animal proteins ---- Trafficking protein particle complex subunit 3 Source.3406: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2 Source.3407: DFBPPR11787 ---- Animal proteins ---- V-type proton ATPase subunit B Source.3408: DFBPPR11798 ---- Animal proteins ---- Olfactory receptor-like protein COR3 Source.3409: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5 Source.3410: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91 Source.3411: DFBPPR11811 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog Source.3412: DFBPPR11820 ---- Animal proteins ---- Lipoma-preferred partner homolog Source.3413: DFBPPR11822 ---- Animal proteins ---- Inversin Source.3414: DFBPPR11825 ---- Animal proteins ---- Solute carrier family 35 member B1 Source.3415: DFBPPR11828 ---- Animal proteins ---- Spindlin-Z Source.3416: DFBPPR11830 ---- Animal proteins ---- Kelch-like protein 13 Source.3417: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6 Source.3418: DFBPPR11841 ---- Animal proteins ---- Trafficking protein particle complex subunit 2 Source.3419: DFBPPR11843 ---- Animal proteins ---- Visinin-like protein 1 Source.3420: DFBPPR11856 ---- Animal proteins ---- Spindlin-W Source.3421: DFBPPR11863 ---- Animal proteins ---- Purpurin Source.3422: DFBPPR11864 ---- Animal proteins ---- Radixin Source.3423: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4 Source.3424: DFBPPR11873 ---- Animal proteins ---- Ligand-dependent nuclear receptor corepressor-like protein Source.3425: DFBPPR11874 ---- Animal proteins ---- Serum response factor Source.3426: DFBPPR11876 ---- Animal proteins ---- Terminal nucleotidyltransferase 5C Source.3427: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14 Source.3428: DFBPPR11895 ---- Animal proteins ---- 40S ribosomal protein S12 Source.3429: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN Source.3430: DFBPPR11910 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2 Source.3431: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3 Source.3432: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59 Source.3433: DFBPPR11931 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 20 Source.3434: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2 Source.3435: DFBPPR11954 ---- Animal proteins ---- SIN3-HDAC complex-associated factor Source.3436: DFBPPR11959 ---- Animal proteins ---- Deubiquitinase OTUD6B Source.3437: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1 Source.3438: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2 Source.3439: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase Source.3440: DFBPPR11972 ---- Animal proteins ---- Cyclin-L1 Source.3441: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein Source.3442: DFBPPR11987 ---- Animal proteins ---- NEDD4-binding protein 3 homolog Source.3443: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3 Source.3444: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1 Source.3445: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15 Source.3446: DFBPPR12004 ---- Animal proteins ---- Fibronectin type-III domain-containing protein 3a Source.3447: DFBPPR12016 ---- Animal proteins ---- ORM1-like protein 2 Source.3448: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2 Source.3449: DFBPPR12031 ---- Animal proteins ---- Exportin-7 Source.3450: DFBPPR12032 ---- Animal proteins ---- Pleckstrin homology domain-containing family B member 2 Source.3451: DFBPPR12054 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein Source.3452: DFBPPR12055 ---- Animal proteins ---- Importin-13 Source.3453: DFBPPR12056 ---- Animal proteins ---- Protein PRRC1 Source.3454: DFBPPR12060 ---- Animal proteins ---- Neurobeachin Source.3455: DFBPPR12065 ---- Animal proteins ---- Testin Source.3456: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7 Source.3457: DFBPPR12085 ---- Animal proteins ---- Lariat debranching enzyme Source.3458: DFBPPR12094 ---- Animal proteins ---- Golgi to ER traffic protein 4 homolog Source.3459: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1 Source.3460: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10 Source.3461: DFBPPR12122 ---- Animal proteins ---- Fibroblast growth factor-binding protein 2 Source.3462: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C Source.3463: DFBPPR12131 ---- Animal proteins ---- Exportin-4 Source.3464: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23 Source.3465: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11 Source.3466: DFBPPR12159 ---- Animal proteins ---- Transmembrane protein 104 Source.3467: DFBPPR12160 ---- Animal proteins ---- Transmembrane protein 229B Source.3468: DFBPPR12163 ---- Animal proteins ---- Ankyrin repeat and MYND domain-containing protein 2 Source.3469: DFBPPR12187 ---- Animal proteins ---- RNA polymerase II-associated protein 3 Source.3470: DFBPPR12195 ---- Animal proteins ---- Vacuolar fusion protein CCZ1 homolog Source.3471: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180 Source.3472: DFBPPR12217 ---- Animal proteins ---- Methyltransferase-like protein 9 Source.3473: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein Source.3474: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2 Source.3475: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68 Source.3476: DFBPPR12231 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 10 Source.3477: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27 Source.3478: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2 Source.3479: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog Source.3480: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1 Source.3481: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2 Source.3482: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1 Source.3483: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme Source.3484: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.3485: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1 Source.3486: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3 Source.3487: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1 Source.3488: DFBPPR12278 ---- Animal proteins ---- Major prion protein Source.3489: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform Source.3490: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1 Source.3491: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1 Source.3492: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta Source.3493: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2 Source.3494: DFBPPR12291 ---- Animal proteins ---- Ribosomal protein S6 kinase beta-1 Source.3495: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type Source.3496: DFBPPR12301 ---- Animal proteins ---- Protein kinase C beta type Source.3497: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C Source.3498: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF Source.3499: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2 Source.3500: DFBPPR12320 ---- Animal proteins ---- Dystroglycan Source.3501: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B Source.3502: DFBPPR12323 ---- Animal proteins ---- Flavin-containing monooxygenase 5 Source.3503: DFBPPR12324 ---- Animal proteins ---- Androgen receptor Source.3504: DFBPPR12325 ---- Animal proteins ---- Glucocorticoid receptor Source.3505: DFBPPR12328 ---- Animal proteins ---- Protein kinase C alpha type Source.3506: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1 Source.3507: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1 Source.3508: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.3509: DFBPPR12343 ---- Animal proteins ---- Protein SLFN14 Source.3510: DFBPPR12344 ---- Animal proteins ---- MAP kinase-activated protein kinase 2 Source.3511: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5 Source.3512: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase Source.3513: DFBPPR12360 ---- Animal proteins ---- cGMP-dependent protein kinase 1 Source.3514: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1 Source.3515: DFBPPR12363 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 5 Source.3516: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal Source.3517: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2 Source.3518: DFBPPR12370 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, skeletal muscle/heart isoform Source.3519: DFBPPR12371 ---- Animal proteins ---- Y-box-binding protein 1 Source.3520: DFBPPR12376 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 1 Source.3521: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein Source.3522: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type Source.3523: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1 Source.3524: DFBPPR12383 ---- Animal proteins ---- Prostaglandin reductase 1 Source.3525: DFBPPR12384 ---- Animal proteins ---- Calcium-independent phospholipase A2-gamma Source.3526: DFBPPR12385 ---- Animal proteins ---- Myosin-11 Source.3527: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S Source.3528: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2 Source.3529: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A Source.3530: DFBPPR12400 ---- Animal proteins ---- RNA-binding protein 4 Source.3531: DFBPPR12402 ---- Animal proteins ---- Casein kinase I isoform alpha Source.3532: DFBPPR12403 ---- Animal proteins ---- Cytochrome P450 7A1 Source.3533: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor Source.3534: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial Source.3535: DFBPPR12411 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit epsilon Source.3536: DFBPPR12416 ---- Animal proteins ---- Oxysterol-binding protein 1 Source.3537: DFBPPR12421 ---- Animal proteins ---- Arylacetamide deacetylase Source.3538: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E Source.3539: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.3540: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha Source.3541: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4 Source.3542: DFBPPR12436 ---- Animal proteins ---- Cytochrome b5 Source.3543: DFBPPR12437 ---- Animal proteins ---- Trehalase Source.3544: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2 Source.3545: DFBPPR12443 ---- Animal proteins ---- DNA repair protein RAD51 homolog 1 Source.3546: DFBPPR12444 ---- Animal proteins ---- C->U-editing enzyme APOBEC-1 Source.3547: DFBPPR12448 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 1 Source.3548: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.3549: DFBPPR12452 ---- Animal proteins ---- Solute carrier family 15 member 2 Source.3550: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase Source.3551: DFBPPR12455 ---- Animal proteins ---- Voltage-gated potassium channel subunit beta-1 Source.3552: DFBPPR12456 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.3553: DFBPPR12458 ---- Animal proteins ---- Electrogenic sodium bicarbonate cotransporter 1 Source.3554: DFBPPR12461 ---- Animal proteins ---- Serine/threonine-protein kinase Sgk1 Source.3555: DFBPPR12462 ---- Animal proteins ---- Coagulation factor X Source.3556: DFBPPR12465 ---- Animal proteins ---- Interstitial collagenase Source.3557: DFBPPR12470 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 1 Source.3558: DFBPPR12472 ---- Animal proteins ---- Prostaglandin E2 receptor EP4 subtype Source.3559: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain Source.3560: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator Source.3561: DFBPPR12481 ---- Animal proteins ---- Casein kinase II subunit alpha Source.3562: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2 Source.3563: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10 Source.3564: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9 Source.3565: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1 Source.3566: DFBPPR12498 ---- Animal proteins ---- Low-density lipoprotein receptor Source.3567: DFBPPR12501 ---- Animal proteins ---- Ezrin Source.3568: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1 Source.3569: DFBPPR12507 ---- Animal proteins ---- Cathepsin K Source.3570: DFBPPR12508 ---- Animal proteins ---- Interleukin-2 Source.3571: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3 Source.3572: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha Source.3573: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase Source.3574: DFBPPR12525 ---- Animal proteins ---- Coagulation factor VII Source.3575: DFBPPR12526 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.3576: DFBPPR12529 ---- Animal proteins ---- Peroxisomal sarcosine oxidase Source.3577: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4 Source.3578: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein Source.3579: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor Source.3580: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1 Source.3581: DFBPPR12546 ---- Animal proteins ---- Mannosyl-oligosaccharide 1,2-alpha-mannosidase IA Source.3582: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1 Source.3583: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2 Source.3584: DFBPPR12552 ---- Animal proteins ---- Acylphosphatase-2 Source.3585: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme Source.3586: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle Source.3587: DFBPPR12560 ---- Animal proteins ---- Calumenin Source.3588: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1 Source.3589: DFBPPR12564 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.3590: DFBPPR12567 ---- Animal proteins ---- Calpain small subunit 1 Source.3591: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2 Source.3592: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11 Source.3593: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel Source.3594: DFBPPR12589 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5 Source.3595: DFBPPR12591 ---- Animal proteins ---- Annexin A11 Source.3596: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20 Source.3597: DFBPPR12614 ---- Animal proteins ---- Interleukin-6 Source.3598: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.3599: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6 Source.3600: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.3601: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3 Source.3602: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12 Source.3603: DFBPPR12630 ---- Animal proteins ---- Insulin-like growth factor I Source.3604: DFBPPR12649 ---- Animal proteins ---- C-C chemokine receptor type 5 Source.3605: DFBPPR12650 ---- Animal proteins ---- ADP/ATP translocase 1 Source.3606: DFBPPR12660 ---- Animal proteins ---- ATP-binding cassette sub-family C member 9 Source.3607: DFBPPR12677 ---- Animal proteins ---- Substance-K receptor Source.3608: DFBPPR12680 ---- Animal proteins ---- Tubulin-specific chaperone A Source.3609: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.3610: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.3611: DFBPPR12711 ---- Animal proteins ---- Tryptophan--tRNA ligase, cytoplasmic Source.3612: DFBPPR12716 ---- Animal proteins ---- Cytochrome P450 2G1 Source.3613: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform Source.3614: DFBPPR12722 ---- Animal proteins ---- Myelin proteolipid protein Source.3615: DFBPPR12723 ---- Animal proteins ---- Glutathione S-transferase alpha I Source.3616: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta Source.3617: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2 Source.3618: DFBPPR12732 ---- Animal proteins ---- Tryptophan 5-hydroxylase 1 Source.3619: DFBPPR12740 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2 Source.3620: DFBPPR12741 ---- Animal proteins ---- Cytochrome P450 2C14 Source.3621: DFBPPR12756 ---- Animal proteins ---- Aromatase Source.3622: DFBPPR12762 ---- Animal proteins ---- SPARC Source.3623: DFBPPR12768 ---- Animal proteins ---- Pepsin-3 Source.3624: DFBPPR12769 ---- Animal proteins ---- Short transient receptor potential channel 5 Source.3625: DFBPPR12770 ---- Animal proteins ---- Filamin-B Source.3626: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1 Source.3627: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator Source.3628: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial Source.3629: DFBPPR12777 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-3 Source.3630: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor Source.3631: DFBPPR12792 ---- Animal proteins ---- T-cell-specific surface glycoprotein CD28 Source.3632: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2 Source.3633: DFBPPR12796 ---- Animal proteins ---- Caspase-3 Source.3634: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10 Source.3635: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6 Source.3636: DFBPPR12810 ---- Animal proteins ---- Upstream stimulatory factor 1 Source.3637: DFBPPR12815 ---- Animal proteins ---- Cytotoxic T-lymphocyte protein 4 Source.3638: DFBPPR12816 ---- Animal proteins ---- Transforming growth factor-beta-induced protein ig-h3 Source.3639: DFBPPR12829 ---- Animal proteins ---- Glutathione S-transferase Yc Source.3640: DFBPPR12831 ---- Animal proteins ---- Serine--pyruvate aminotransferase Source.3641: DFBPPR12832 ---- Animal proteins ---- Secretin receptor Source.3642: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.3643: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor Source.3644: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2 Source.3645: DFBPPR12845 ---- Animal proteins ---- Complement component C8 alpha chain Source.3646: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7 Source.3647: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain Source.3648: DFBPPR12866 ---- Animal proteins ---- L-lactate dehydrogenase B chain Source.3649: DFBPPR12883 ---- Animal proteins ---- Cytochrome P450 2J1 Source.3650: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase Source.3651: DFBPPR12892 ---- Animal proteins ---- Translocon-associated protein subunit alpha Source.3652: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16 Source.3653: DFBPPR12898 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.3654: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1 Source.3655: DFBPPR12914 ---- Animal proteins ---- Lipase member H Source.3656: DFBPPR12932 ---- Animal proteins ---- Heterogeneous nuclear ribonucleoprotein C Source.3657: DFBPPR12937 ---- Animal proteins ---- Zonadhesin Source.3658: DFBPPR12953 ---- Animal proteins ---- LIM and SH3 domain protein 1 Source.3659: DFBPPR12956 ---- Animal proteins ---- Sodium/glucose cotransporter 5 Source.3660: DFBPPR12958 ---- Animal proteins ---- Neuromedin-K receptor Source.3661: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter Source.3662: DFBPPR12975 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.3663: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2 Source.3664: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1 Source.3665: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3 Source.3666: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1 Source.3667: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter Source.3668: DFBPPR13022 ---- Animal proteins ---- Solute carrier family 13 member 2 Source.3669: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1 Source.3670: DFBPPR13036 ---- Animal proteins ---- Gamma-crystallin S Source.3671: DFBPPR13054 ---- Animal proteins ---- Relaxin-like protein SQ10 Source.3672: DFBPPR13062 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.3673: DFBPPR13080 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1 Source.3674: DFBPPR13090 ---- Animal proteins ---- Annexin A8 Source.3675: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2 Source.3676: DFBPPR13092 ---- Animal proteins ---- Testin Source.3677: DFBPPR13145 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.3678: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1 Source.3679: DFBPPR13153 ---- Animal proteins ---- Interleukin-18 Source.3680: DFBPPR13154 ---- Animal proteins ---- Annexin A1 Source.3681: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.3682: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.3683: DFBPPR13172 ---- Animal proteins ---- Hexokinase-2 Source.3684: DFBPPR13174 ---- Animal proteins ---- Clusterin Source.3685: DFBPPR13176 ---- Animal proteins ---- Aromatase Source.3686: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase Source.3687: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B Source.3688: DFBPPR13190 ---- Animal proteins ---- Sodium channel protein type 4 subunit alpha Source.3689: DFBPPR13194 ---- Animal proteins ---- Dopamine beta-hydroxylase Source.3690: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase Source.3691: DFBPPR13222 ---- Animal proteins ---- Metalloproteinase inhibitor 3 Source.3692: DFBPPR13223 ---- Animal proteins ---- Caspase-1 Source.3693: DFBPPR13230 ---- Animal proteins ---- Stromelysin-1 Source.3694: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.3695: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1 Source.3696: DFBPPR13251 ---- Animal proteins ---- Cytochrome b5 Source.3697: DFBPPR13256 ---- Animal proteins ---- Interleukin-1 beta Source.3698: DFBPPR13259 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.3699: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme Source.3700: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform Source.3701: DFBPPR13276 ---- Animal proteins ---- Protein quaking Source.3702: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.3703: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a Source.3704: DFBPPR13285 ---- Animal proteins ---- Steroidogenic factor 1 Source.3705: DFBPPR13287 ---- Animal proteins ---- 1,4-alpha-glucan-branching enzyme Source.3706: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor Source.3707: DFBPPR13291 ---- Animal proteins ---- Myosin-7 Source.3708: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.3709: DFBPPR13309 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.3710: DFBPPR13310 ---- Animal proteins ---- Thyrotropin subunit beta Source.3711: DFBPPR13313 ---- Animal proteins ---- Insulin-like growth factor I Source.3712: DFBPPR13315 ---- Animal proteins ---- Ski oncogene Source.3713: DFBPPR13324 ---- Animal proteins ---- Acylphosphatase-2 Source.3714: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha Source.3715: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.3716: DFBPPR13340 ---- Animal proteins ---- Sulfate transporter Source.3717: DFBPPR13342 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.3718: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.3719: DFBPPR13363 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.3720: DFBPPR13368 ---- Animal proteins ---- Pulmonary surfactant-associated protein A Source.3721: DFBPPR13370 ---- Animal proteins ---- Interleukin-2 Source.3722: DFBPPR13373 ---- Animal proteins ---- Tryptophan 5-hydroxylase 2 Source.3723: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein Source.3724: DFBPPR13385 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.3725: DFBPPR13393 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.3726: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2 Source.3727: DFBPPR13409 ---- Animal proteins ---- Testin Source.3728: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit Source.3729: DFBPPR13433 ---- Animal proteins ---- Major prion protein Source.3730: DFBPPR13434 ---- Animal proteins ---- Aromatase Source.3731: DFBPPR13440 ---- Animal proteins ---- CSC1-like protein 1 Source.3732: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1 Source.3733: DFBPPR13447 ---- Animal proteins ---- Insulin-like growth factor I Source.3734: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2 Source.3735: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase Source.3736: DFBPPR13469 ---- Animal proteins ---- Cytochrome b Source.3737: DFBPPR13480 ---- Animal proteins ---- Cytochrome P450 2F3 Source.3738: DFBPPR13483 ---- Animal proteins ---- Interleukin-18 Source.3739: DFBPPR13494 ---- Animal proteins ---- Urea transporter 1 Source.3740: DFBPPR13498 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.3741: DFBPPR13506 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.3742: DFBPPR13509 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.3743: DFBPPR13512 ---- Animal proteins ---- Interleukin-2 Source.3744: DFBPPR13530 ---- Animal proteins ---- Major prion protein Source.3745: DFBPPR13535 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.3746: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2 Source.3747: DFBPPR13542 ---- Animal proteins ---- Pyridoxal kinase Source.3748: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha Source.3749: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2 Source.3750: DFBPPR13561 ---- Animal proteins ---- Integrin beta-1 Source.3751: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1 Source.3752: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase Source.3753: DFBPPR13571 ---- Animal proteins ---- Fructose-1,6-bisphosphatase 1 Source.3754: DFBPPR13578 ---- Animal proteins ---- Nuclear receptor subfamily 1 group D member 1 Source.3755: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor Source.3756: DFBPPR13584 ---- Animal proteins ---- Calpain-3 Source.3757: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor Source.3758: DFBPPR13587 ---- Animal proteins ---- Aquaporin-1 Source.3759: DFBPPR13588 ---- Animal proteins ---- Transcription factor AP-2-alpha Source.3760: DFBPPR13593 ---- Animal proteins ---- Lens fiber major intrinsic protein Source.3761: DFBPPR13600 ---- Animal proteins ---- Glucocorticoid receptor Source.3762: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1 Source.3763: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial Source.3764: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta Source.3765: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor Source.3766: DFBPPR13637 ---- Animal proteins ---- ATP synthase F(0) complex subunit C2, mitochondrial Source.3767: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2 Source.3768: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A Source.3769: DFBPPR13647 ---- Animal proteins ---- Casein kinase I isoform alpha Source.3770: DFBPPR13672 ---- Animal proteins ---- Annexin A2 Source.3771: DFBPPR13673 ---- Animal proteins ---- Insulin-like growth factor I Source.3772: DFBPPR13675 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.3773: DFBPPR13676 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP] cytoplasmic Source.3774: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor Source.3775: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2 Source.3776: DFBPPR13682 ---- Animal proteins ---- Class E basic helix-loop-helix protein 40 Source.3777: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III Source.3778: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3 Source.3779: DFBPPR13712 ---- Animal proteins ---- Cytochrome b Source.3780: DFBPPR13726 ---- Animal proteins ---- Thyroxine 5-deiodinase Source.3781: DFBPPR13728 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor Source.3782: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21 Source.3783: DFBPPR13730 ---- Animal proteins ---- Vitamin K-dependent gamma-carboxylase Source.3784: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase Source.3785: DFBPPR13739 ---- Animal proteins ---- T-cell surface glycoprotein CD3 delta chain Source.3786: DFBPPR13750 ---- Animal proteins ---- Branched-chain-amino-acid aminotransferase, cytosolic Source.3787: DFBPPR13755 ---- Animal proteins ---- Aromatase Source.3788: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin Source.3789: DFBPPR13761 ---- Animal proteins ---- Gap junction beta-2 protein Source.3790: DFBPPR13763 ---- Animal proteins ---- Interleukin-2 Source.3791: DFBPPR13768 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5 Source.3792: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.3793: DFBPPR13782 ---- Animal proteins ---- BMP and activin membrane-bound inhibitor homolog Source.3794: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form Source.3795: DFBPPR13806 ---- Animal proteins ---- Arachidonate 5-lipoxygenase-activating protein Source.3796: DFBPPR13823 ---- Animal proteins ---- Adrenocorticotropic hormone receptor Source.3797: DFBPPR13840 ---- Animal proteins ---- Cytochrome b561 Source.3798: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3 Source.3799: DFBPPR13852 ---- Animal proteins ---- Urea transporter 1 Source.3800: DFBPPR13854 ---- Animal proteins ---- Ankyrin repeat, SAM and basic leucine zipper domain-containing protein 1 Source.3801: DFBPPR13856 ---- Animal proteins ---- Gonadotropin-releasing hormone receptor Source.3802: DFBPPR13857 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4L Source.3803: DFBPPR13865 ---- Animal proteins ---- C-C chemokine receptor type 9 Source.3804: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1 Source.3805: DFBPPR13892 ---- Animal proteins ---- Melanocortin receptor 5 Source.3806: DFBPPR13904 ---- Animal proteins ---- Sulfate transporter Source.3807: DFBPPR13905 ---- Animal proteins ---- Melatonin-related receptor Source.3808: DFBPPR13909 ---- Animal proteins ---- Homeobox protein Hox-C9 Source.3809: DFBPPR13912 ---- Animal proteins ---- Amine oxidase [flavin-containing] A Source.3810: DFBPPR13915 ---- Animal proteins ---- Gastrin-releasing peptide Source.3811: DFBPPR13917 ---- Animal proteins ---- CCAAT/enhancer-binding protein delta Source.3812: DFBPPR13918 ---- Animal proteins ---- Testin Source.3813: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog Source.3814: DFBPPR13944 ---- Animal proteins ---- Hippocalcin-like protein 1 Source.3815: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2 Source.3816: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1 Source.3817: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle Source.3818: DFBPPR13992 ---- Animal proteins ---- Rhodopsin Source.3819: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle Source.3820: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1 Source.3821: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1 Source.3822: DFBPPR14005 ---- Animal proteins ---- Fish-egg lectin Source.3823: DFBPPR14007 ---- Animal proteins ---- Cystatin Source.3824: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3 Source.3825: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1 Source.3826: DFBPPR14042 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6 Source.3827: DFBPPR14052 ---- Animal proteins ---- Insulin-like growth factor I, adult form Source.3828: DFBPPR14055 ---- Animal proteins ---- Insulin-like growth factor I, juvenile form Source.3829: DFBPPR14056 ---- Animal proteins ---- Gamma-crystallin M3 Source.3830: DFBPPR14060 ---- Animal proteins ---- Gamma-crystallin M2 Source.3831: DFBPPR14062 ---- Animal proteins ---- Alpha-1-antitrypsin homolog Source.3832: DFBPPR14063 ---- Animal proteins ---- Homeobox protein Hox-B1 Source.3833: DFBPPR14064 ---- Animal proteins ---- Brain-derived neurotrophic factor Source.3834: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36 Source.3835: DFBPPR14089 ---- Marine protein ---- Flap endonuclease 1 Source.3836: DFBPPR14092 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 B Source.3837: DFBPPR14093 ---- Marine protein ---- Hepatocyte nuclear factor 1-alpha Source.3838: DFBPPR14094 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 C Source.3839: DFBPPR14101 ---- Marine protein ---- Adenylosuccinate synthetase isozyme 1 A Source.3840: DFBPPR14109 ---- Marine protein ---- Fructose-bisphosphate aldolase A Source.3841: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3 Source.3842: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1 Source.3843: DFBPPR14132 ---- Marine protein ---- Calumenin-A Source.3844: DFBPPR14133 ---- Marine protein ---- Calumenin-B Source.3845: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I Source.3846: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1 Source.3847: DFBPPR14149 ---- Marine protein ---- AKT-interacting protein Source.3848: DFBPPR14160 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.3849: DFBPPR14162 ---- Marine protein ---- Pescadillo homolog Source.3850: DFBPPR14163 ---- Marine protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit C, mitochondrial Source.3851: DFBPPR14164 ---- Marine protein ---- Ragulator complex protein LAMTOR2 Source.3852: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8 Source.3853: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator Source.3854: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6 Source.3855: DFBPPR14184 ---- Marine protein ---- Glycosylated lysosomal membrane protein Source.3856: DFBPPR14193 ---- Marine protein ---- ER membrane protein complex subunit 4 Source.3857: DFBPPR14195 ---- Marine protein ---- Golgi to ER traffic protein 4 homolog Source.3858: DFBPPR14197 ---- Marine protein ---- Ubiquitin-fold modifier-conjugating enzyme 1 Source.3859: DFBPPR14215 ---- Marine protein ---- Protein SMG9 Source.3860: DFBPPR14218 ---- Marine protein ---- 60S ribosomal protein L18a Source.3861: DFBPPR14226 ---- Marine protein ---- LYR motif-containing protein 4A Source.3862: DFBPPR14227 ---- Marine protein ---- LYR motif-containing protein 4B Source.3863: DFBPPR14234 ---- Marine protein ---- Tubulin alpha chain Source.3864: DFBPPR14235 ---- Marine protein ---- Calcitonin-1 Source.3865: DFBPPR14239 ---- Marine protein ---- Gonadotropin subunit beta-1 Source.3866: DFBPPR14288 ---- Marine protein ---- Allophycocyanin beta chain Source.3867: DFBPPR14289 ---- Marine protein ---- Allophycocyanin alpha chain Source.3868: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain Source.3869: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.3870: DFBPPR14305 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.3871: DFBPPR14314 ---- Marine protein ---- Probable ATP-dependent transporter ycf16 Source.3872: DFBPPR14326 ---- Marine protein ---- Allophycocyanin alpha chain Source.3873: DFBPPR14327 ---- Marine protein ---- Allophycocyanin beta chain Source.3874: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.3875: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain Source.3876: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.3877: DFBPPR14338 ---- Marine protein ---- Photosystem II D2 protein Source.3878: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B Source.3879: DFBPPR14342 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit beta, chloroplastic Source.3880: DFBPPR14360 ---- Marine protein ---- Phenylalanine--tRNA ligase beta subunit, chloroplastic Source.3881: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic Source.3882: DFBPPR14364 ---- Marine protein ---- Ribulose bisphosphate carboxylase small chain Source.3883: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'' Source.3884: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta Source.3885: DFBPPR14387 ---- Marine protein ---- Photosystem II 12 kDa extrinsic protein, chloroplastic Source.3886: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase Source.3887: DFBPPR14389 ---- Marine protein ---- 60 kDa chaperonin, chloroplastic Source.3888: DFBPPR14401 ---- Marine protein ---- 50S ribosomal protein L4, chloroplastic Source.3889: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha Source.3890: DFBPPR14406 ---- Marine protein ---- ATP synthase subunit a, chloroplastic Source.3891: DFBPPR14407 ---- Marine protein ---- Allophycocyanin alpha-B chain Source.3892: DFBPPR14417 ---- Marine protein ---- Histidine--tRNA ligase, chloroplastic Source.3893: DFBPPR14421 ---- Marine protein ---- Protein translocase subunit SecA Source.3894: DFBPPR14439 ---- Marine protein ---- 50S ribosomal protein L5, chloroplastic Source.3895: DFBPPR14472 ---- Marine protein ---- Photosystem I reaction center subunit XI Source.3896: DFBPPR14473 ---- Marine protein ---- Photosystem II reaction center Psb28 protein Source.3897: DFBPPR14488 ---- Marine protein ---- Putative cytochrome c-type biogenesis protein DbsD-like Source.3898: DFBPPR14504 ---- Marine protein ---- Probable ABC transporter permease protein ycf63 Source.3899: DFBPPR14520 ---- Marine protein ---- Uncharacterized protein ycf23 Source.3900: DFBPPR14526 ---- Marine protein ---- Uncharacterized protein ycf91 Source.3901: DFBPPR14532 ---- Marine protein ---- Uncharacterized protein ORF621 Source.3902: DFBPPR14538 ---- Marine protein ---- Estrogen receptor Source.3903: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator Source.3904: DFBPPR14548 ---- Marine protein ---- Mineralocorticoid receptor Source.3905: DFBPPR14557 ---- Marine protein ---- Interferon a3 Source.3906: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2 Source.3907: DFBPPR14571 ---- Marine protein ---- Tubulin alpha chain, testis-specific Source.3908: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1 Source.3909: DFBPPR14577 ---- Marine protein ---- Cytochrome P450 2K1 Source.3910: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1 Source.3911: DFBPPR14583 ---- Marine protein ---- Insulin-like growth factor I Source.3912: DFBPPR14586 ---- Marine protein ---- DNA-binding protein Ikaros Source.3913: DFBPPR14587 ---- Marine protein ---- Thyrotropin subunit beta Source.3914: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible Source.3915: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b Source.3916: DFBPPR14602 ---- Marine protein ---- Proteasome subunit beta type-3 Source.3917: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2 Source.3918: DFBPPR14609 ---- Marine protein ---- Amine oxidase [flavin-containing] Source.3919: DFBPPR14614 ---- Marine protein ---- Translocon-associated protein subunit alpha Source.3920: DFBPPR14622 ---- Marine protein ---- Band 3 anion exchange protein Source.3921: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3 Source.3922: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1 Source.3923: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a Source.3924: DFBPPR14634 ---- Marine protein ---- Neuroglobin-2 Source.3925: DFBPPR14656 ---- Marine protein ---- Neuroglobin-1 Source.3926: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme Source.3927: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I Source.3928: DFBPPR14678 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 6 Source.3929: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II Source.3930: DFBPPR14702 ---- Marine protein ---- Cytochrome P450 2K3 Source.3931: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A Source.3932: DFBPPR14708 ---- Marine protein ---- Cytochrome P450 2K4 Source.3933: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B Source.3934: DFBPPR14756 ---- Marine protein ---- Clotting factor G beta subunit Source.3935: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit Source.3936: DFBPPR14758 ---- Marine protein ---- Techylectin-5B Source.3937: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase Source.3938: DFBPPR14781 ---- Marine protein ---- Hemocyanin Source.3939: DFBPPR14783 ---- Marine protein ---- Enolase Source.3940: DFBPPR14785 ---- Marine protein ---- Hemocyanin B chain Source.3941: DFBPPR14788 ---- Marine protein ---- Tubulin alpha-3 chain Source.3942: DFBPPR14789 ---- Marine protein ---- Tubulin alpha-2 chain Source.3943: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain Source.3944: DFBPPR14796 ---- Marine protein ---- Guanine nucleotide-binding protein G(q) subunit alpha Source.3945: DFBPPR14802 ---- Marine protein ---- Glutamine synthetase Source.3946: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain Source.3947: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain Source.3948: DFBPPR14810 ---- Marine protein ---- V-type proton ATPase 16 kDa proteolipid subunit Source.3949: DFBPPR14813 ---- Marine protein ---- Digestive cysteine proteinase 1 Source.3950: DFBPPR14821 ---- Marine protein ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1 Source.3951: DFBPPR14853 ---- Marine protein ---- Sarcoplasmic calcium-binding protein 1 Source.3952: DFBPPR14855 ---- Marine protein ---- Rhodopsin, freshwater form Source.3953: DFBPPR14859 ---- Marine protein ---- Sodium/potassium-transporting ATPase subunit alpha-1 Source.3954: DFBPPR14873 ---- Marine protein ---- Somatolactin Source.3955: DFBPPR14878 ---- Microorganism protein ---- Mitogen-activated protein kinase HOG1 Source.3956: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3 Source.3957: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A Source.3958: DFBPPR14894 ---- Microorganism protein ---- Serine/threonine-protein kinase ATG1 Source.3959: DFBPPR14898 ---- Microorganism protein ---- Transcription factor IIIB 70 kDa subunit Source.3960: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase Source.3961: DFBPPR14904 ---- Microorganism protein ---- Myosin-1 Source.3962: DFBPPR14911 ---- Microorganism protein ---- Eukaryotic peptide chain release factor GTP-binding subunit Source.3963: DFBPPR14912 ---- Microorganism protein ---- Heat shock factor protein Source.3964: DFBPPR14913 ---- Microorganism protein ---- Serine/threonine-protein kinase CBK1 Source.3965: DFBPPR14915 ---- Microorganism protein ---- Histidine biosynthesis trifunctional protein Source.3966: DFBPPR14919 ---- Microorganism protein ---- Transcription elongation factor SPT4 Source.3967: DFBPPR14923 ---- Microorganism protein ---- Bifunctional protein GAL10 Source.3968: DFBPPR14927 ---- Microorganism protein ---- Autophagy-related protein 18 Source.3969: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27 Source.3970: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1 Source.3971: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4 Source.3972: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1 Source.3973: DFBPPR14948 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 4 Source.3974: DFBPPR14957 ---- Microorganism protein ---- Cytochrome c oxidase subunit 2 Source.3975: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27 Source.3976: DFBPPR14966 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2 Source.3977: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15 Source.3978: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase Source.3979: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial Source.3980: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like Source.3981: DFBPPR14985 ---- Microorganism protein ---- ATP-dependent DNA helicase MPH1 Source.3982: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial Source.3983: DFBPPR14987 ---- Microorganism protein ---- Serine hydroxymethyltransferase, mitochondrial Source.3984: DFBPPR14989 ---- Microorganism protein ---- cAMP-dependent protein kinase regulatory subunit Source.3985: DFBPPR14991 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein PAN1 Source.3986: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1 Source.3987: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1 Source.3988: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1 Source.3989: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b Source.3990: DFBPPR15012 ---- Microorganism protein ---- Glutathione reductase Source.3991: DFBPPR15014 ---- Microorganism protein ---- AP-1-like transcription factor YAP1 Source.3992: DFBPPR15017 ---- Microorganism protein ---- Serine/threonine-protein kinase TEL1 Source.3993: DFBPPR15023 ---- Microorganism protein ---- ADP,ATP carrier protein Source.3994: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial Source.3995: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2 Source.3996: DFBPPR15032 ---- Microorganism protein ---- Pyruvate kinase Source.3997: DFBPPR15042 ---- Microorganism protein ---- 4-aminobutyrate aminotransferase Source.3998: DFBPPR15054 ---- Microorganism protein ---- Autophagy-related protein 9 Source.3999: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3 Source.4000: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1 Source.4001: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9 Source.4002: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B Source.4003: DFBPPR15068 ---- Microorganism protein ---- Translation factor GUF1, mitochondrial Source.4004: DFBPPR15069 ---- Microorganism protein ---- Class E vacuolar protein-sorting machinery protein HSE1 Source.4005: DFBPPR15070 ---- Microorganism protein ---- Transcription factor MBP1 Source.4006: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase Source.4007: DFBPPR15079 ---- Microorganism protein ---- Autophagy-related protein 3 Source.4008: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase Source.4009: DFBPPR15087 ---- Microorganism protein ---- Transcriptional activator HAP3 Source.4010: DFBPPR15095 ---- Microorganism protein ---- Endoplasmic reticulum oxidoreductin-1 Source.4011: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2 Source.4012: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1 Source.4013: DFBPPR15098 ---- Microorganism protein ---- Deoxyhypusine hydroxylase Source.4014: DFBPPR15101 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 1 Source.4015: DFBPPR15105 ---- Microorganism protein ---- Arginase Source.4016: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial Source.4017: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase Source.4018: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase Source.4019: DFBPPR15111 ---- Microorganism protein ---- mRNA cap guanine-N7 methyltransferase Source.4020: DFBPPR15113 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 1 Source.4021: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1 Source.4022: DFBPPR15117 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP10 Source.4023: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1 Source.4024: DFBPPR15120 ---- Microorganism protein ---- Exonuclease V, mitochondrial Source.4025: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1 Source.4026: DFBPPR15127 ---- Microorganism protein ---- Polyadenylate-binding protein, cytoplasmic and nuclear Source.4027: DFBPPR15142 ---- Microorganism protein ---- Dol-P-Man:Man(5)GlcNAc(2)-PP-Dol alpha-1,3-mannosyltransferase Source.4028: DFBPPR15143 ---- Microorganism protein ---- Low-affinity glucose transporter Source.4029: DFBPPR15153 ---- Microorganism protein ---- Mitochondrial intermediate peptidase Source.4030: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease Source.4031: DFBPPR15162 ---- Microorganism protein ---- MFS-type transporter PUL3 Source.4032: DFBPPR15169 ---- Microorganism protein ---- Protein VTS1 Source.4033: DFBPPR15170 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM50 Source.4034: DFBPPR15172 ---- Microorganism protein ---- Pro-apoptotic serine protease NMA111 Source.4035: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5 Source.4036: DFBPPR15180 ---- Microorganism protein ---- Protein ROT1 Source.4037: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3 Source.4038: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3 Source.4039: DFBPPR15189 ---- Microorganism protein ---- Inner kinetochore subunit NKP2 Source.4040: DFBPPR15208 ---- Microorganism protein ---- Lon protease homolog 2, peroxisomal Source.4041: DFBPPR15211 ---- Microorganism protein ---- Autophagy-related protein 17 Source.4042: DFBPPR15215 ---- Microorganism protein ---- Protein transport protein SEC24 Source.4043: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1 Source.4044: DFBPPR15225 ---- Microorganism protein ---- Acetylornithine aminotransferase, mitochondrial Source.4045: DFBPPR15226 ---- Microorganism protein ---- GPI mannosyltransferase 4 Source.4046: DFBPPR15230 ---- Microorganism protein ---- Histone acetyltransferase type B subunit 2 Source.4047: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1 Source.4048: DFBPPR15240 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-B Source.4049: DFBPPR15241 ---- Microorganism protein ---- GPI mannosyltransferase 3 Source.4050: DFBPPR15242 ---- Microorganism protein ---- Golgi to ER traffic protein 2 Source.4051: DFBPPR15256 ---- Microorganism protein ---- SEC14 cytosolic factor Source.4052: DFBPPR15257 ---- Microorganism protein ---- Ribosome biogenesis protein YTM1 Source.4053: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase Source.4054: DFBPPR15268 ---- Microorganism protein ---- Diphthamide biosynthesis protein 3 Source.4055: DFBPPR15275 ---- Microorganism protein ---- Exocyst complex protein EXO70 Source.4056: DFBPPR15279 ---- Microorganism protein ---- Nuclear fusion protein KAR5 Source.4057: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2 Source.4058: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9 Source.4059: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2 Source.4060: DFBPPR15294 ---- Microorganism protein ---- Lactose permease Source.4061: DFBPPR15296 ---- Microorganism protein ---- High-affinity glucose transporter Source.4062: DFBPPR15298 ---- Microorganism protein ---- tRNA(His) guanylyltransferase Source.4063: DFBPPR15300 ---- Microorganism protein ---- Vacuolar protein-sorting protein BRO1 Source.4064: DFBPPR15311 ---- Microorganism protein ---- Chitin synthase export chaperone Source.4065: DFBPPR15312 ---- Microorganism protein ---- Chitin synthase export chaperone Source.4066: DFBPPR15314 ---- Microorganism protein ---- Probable metalloprotease ARX1 Source.4067: DFBPPR15316 ---- Microorganism protein ---- Protein URE2 Source.4068: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial Source.4069: DFBPPR15322 ---- Microorganism protein ---- Sorting nexin-3 Source.4070: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10 Source.4071: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10 Source.4072: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18 Source.4073: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3 Source.4074: DFBPPR15354 ---- Microorganism protein ---- Sterol 24-C-methyltransferase Source.4075: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase Source.4076: DFBPPR15368 ---- Microorganism protein ---- Clustered mitochondria protein homolog Source.4077: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2 Source.4078: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1 Source.4079: DFBPPR15383 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 17 Source.4080: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14 Source.4081: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1 Source.4082: DFBPPR15392 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 16 Source.4083: DFBPPR15394 ---- Microorganism protein ---- 1,4-alpha-glucan-branching enzyme Source.4084: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2 Source.4085: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1 Source.4086: DFBPPR15407 ---- Microorganism protein ---- Mitochondrial escape protein 2 Source.4087: DFBPPR15409 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter MRS2 Source.4088: DFBPPR15422 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.4089: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial Source.4090: DFBPPR15430 ---- Microorganism protein ---- Exportin-T Source.4091: DFBPPR15431 ---- Microorganism protein ---- RNA exonuclease 3 Source.4092: DFBPPR15447 ---- Microorganism protein ---- Genetic interactor of prohibitins 3, mitochondrial Source.4093: DFBPPR15452 ---- Microorganism protein ---- Ribose-5-phosphate isomerase Source.4094: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase Source.4095: DFBPPR15458 ---- Microorganism protein ---- Mitochondrial glycine transporter Source.4096: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6 Source.4097: DFBPPR15462 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM21 Source.4098: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3 Source.4099: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10 Source.4100: DFBPPR15470 ---- Microorganism protein ---- Protein BUR2 Source.4101: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3 Source.4102: DFBPPR15476 ---- Microorganism protein ---- Mitochondrial inner membrane i-AAA protease complex subunit MGR1 Source.4103: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP) Source.4104: DFBPPR15490 ---- Microorganism protein ---- H/ACA ribonucleoprotein complex subunit NOP10 Source.4105: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1 Source.4106: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22 Source.4107: DFBPPR15507 ---- Microorganism protein ---- Guanine nucleotide exchange factor LTE1 Source.4108: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3 Source.4109: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20 Source.4110: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase Source.4111: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16 Source.4112: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1 Source.4113: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1 Source.4114: DFBPPR15588 ---- Microorganism protein ---- Protein PNS1 Source.4115: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1 Source.4116: DFBPPR15602 ---- Microorganism protein ---- Helper of Tim protein 13 Source.4117: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase Source.4118: DFBPPR15604 ---- Microorganism protein ---- Vacuolar fusion protein MON1 Source.4119: DFBPPR15605 ---- Microorganism protein ---- Ribosome biogenesis protein NSA2 Source.4120: DFBPPR15615 ---- Microorganism protein ---- Probable transporter MCH1 Source.4121: DFBPPR15616 ---- Microorganism protein ---- Chromatin modification-related protein EAF5 Source.4122: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial Source.4123: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase Source.4124: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1 Source.4125: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4 Source.4126: DFBPPR15645 ---- Microorganism protein ---- Putative transferase CAF17, mitochondrial Source.4127: DFBPPR15653 ---- Microorganism protein ---- Conserved oligomeric Golgi complex subunit 6 Source.4128: DFBPPR15656 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC25 Source.4129: DFBPPR15657 ---- Microorganism protein ---- COP9 signalosome complex subunit 11 Source.4130: DFBPPR15658 ---- Microorganism protein ---- Protein DSE1 Source.4131: DFBPPR15663 ---- Microorganism protein ---- Spindle pole component BBP1 Source.4132: DFBPPR15675 ---- Microorganism protein ---- DNA replication complex GINS protein PSF1 Source.4133: DFBPPR15680 ---- Microorganism protein ---- Protein SYM1 Source.4134: DFBPPR15681 ---- Microorganism protein ---- Protein SWT21 Source.4135: DFBPPR15683 ---- Microorganism protein ---- GLC7-interacting protein 4 Source.4136: DFBPPR15693 ---- Microorganism protein ---- Restriction of telomere capping protein 4 Source.4137: DFBPPR15698 ---- Microorganism protein ---- Stress response protein NST1 Source.4138: DFBPPR15699 ---- Microorganism protein ---- Meiotic sister-chromatid recombination protein 3 Source.4139: DFBPPR15714 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 39, mitochondrial Source.4140: DFBPPR15717 ---- Microorganism protein ---- 37S ribosomal protein S9, mitochondrial Source.4141: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1 Source.4142: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial Source.4143: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3 Source.4144: DFBPPR15733 ---- Microorganism protein ---- J protein JJJ2 Source.4145: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5 Source.4146: DFBPPR15741 ---- Microorganism protein ---- Increased recombination centers protein 19 Source.4147: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1 Source.4148: DFBPPR15744 ---- Microorganism protein ---- Peroxisomal membrane protein PEX21 Source.4149: DFBPPR15746 ---- Microorganism protein ---- Topoisomerase I damage affected protein 11 Source.4150: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6 Source.4151: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5 Source.4152: DFBPPR15766 ---- Microorganism protein ---- Protein ATC1/LIC4 Source.4153: DFBPPR15767 ---- Microorganism protein ---- Protein LOT5 Source.4154: DFBPPR15780 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 8 Source.4155: DFBPPR15782 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKl-2 protein 3 Source.4156: DFBPPR15788 ---- Microorganism protein ---- Maintenance of telomere capping protein 2 Source.4157: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g Source.4158: DFBPPR15799 ---- Microorganism protein ---- PTS system lactose-specific EIICB component Source.4159: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL Source.4160: DFBPPR15816 ---- Microorganism protein ---- Tyrosine recombinase XerD Source.4161: DFBPPR15818 ---- Microorganism protein ---- PTS system sorbose-specific EIID component Source.4162: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase Source.4163: DFBPPR15824 ---- Microorganism protein ---- 5-dehydro-2-deoxygluconokinase Source.4164: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit Source.4165: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1 Source.4166: DFBPPR15840 ---- Microorganism protein ---- Protein RecA Source.4167: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3 Source.4168: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2 Source.4169: DFBPPR15851 ---- Microorganism protein ---- Glyceraldehyde-3-phosphate dehydrogenase 2 Source.4170: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1 Source.4171: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase Source.4172: DFBPPR15861 ---- Microorganism protein ---- Pyruvate kinase Source.4173: DFBPPR15876 ---- Microorganism protein ---- Probable DNA-directed RNA polymerase Source.4174: DFBPPR15879 ---- Microorganism protein ---- Probable DNA polymerase Source.4175: DFBPPR15885 ---- Microorganism protein ---- RNA-directed RNA polymerase Source.4176: DFBPPR15886 ---- Microorganism protein ---- Capsid protein Source.4177: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase Source.4178: DFBPPR7754 ---- Plant protein ---- 5-pentadecatrienyl resorcinol O-methyltransferase Source.4179: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase Source.4180: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3 Source.4181: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1 Source.4182: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase Source.4183: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1 Source.4184: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.4185: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase Source.4186: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.4187: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2 Source.4188: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3 Source.4189: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.4190: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.4191: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit Source.4192: DFBPPR7803 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.4193: DFBPPR7805 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.4194: DFBPPR7806 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit A, chloroplastic/mitochondrial Source.4195: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2 Source.4196: DFBPPR7813 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1 Source.4197: DFBPPR7814 ---- Plant protein ---- Phytochrome a Source.4198: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.4199: DFBPPR7825 ---- Plant protein ---- Phytochrome C Source.4200: DFBPPR7834 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase homolog 2 Source.4201: DFBPPR7835 ---- Plant protein ---- Bidirectional sugar transporter SWEET1a Source.4202: DFBPPR7838 ---- Plant protein ---- Chalcone synthase 6 Source.4203: DFBPPR7839 ---- Plant protein ---- Chalcone synthase 7 Source.4204: DFBPPR7840 ---- Plant protein ---- Chalcone synthase 1 Source.4205: DFBPPR7841 ---- Plant protein ---- Chalcone synthase 4 Source.4206: DFBPPR7842 ---- Plant protein ---- Chalcone synthase 3 Source.4207: DFBPPR7844 ---- Plant protein ---- Actin-1 Source.4208: DFBPPR7845 ---- Plant protein ---- Chalcone synthase 5 Source.4209: DFBPPR7848 ---- Plant protein ---- Chalcone synthase 2 Source.4210: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1 Source.4211: DFBPPR7856 ---- Plant protein ---- Maturase K Source.4212: DFBPPR7858 ---- Plant protein ---- 30S ribosomal protein S18, chloroplastic Source.4213: DFBPPR7860 ---- Plant protein ---- CASP-like protein 1C1 Source.4214: DFBPPR7889 ---- Plant protein ---- Cytochrome P450 CYP99A1 Source.4215: DFBPPR7935 ---- Plant protein ---- Cytochrome b Source.4216: DFBPPR7938 ---- Plant protein ---- Ferredoxin--NADP reductase, chloroplastic Source.4217: DFBPPR7942 ---- Plant protein ---- Polyphenol oxidase A1, chloroplastic Source.4218: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.4219: DFBPPR7964 ---- Plant protein ---- Sucrose synthase Source.4220: DFBPPR7973 ---- Plant protein ---- Maturase K Source.4221: DFBPPR7976 ---- Plant protein ---- Metallothionein-like protein type 2 Source.4222: DFBPPR7986 ---- Plant protein ---- Uncharacterized mitochondrial protein ORF154 Source.4223: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic Source.4224: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.4225: DFBPPR7995 ---- Plant protein ---- Light-independent protochlorophyllide reductase subunit B Source.4226: DFBPPR8013 ---- Plant protein ---- Chloroplast envelope membrane protein Source.4227: DFBPPR8029 ---- Plant protein ---- Vignain Source.4228: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1 Source.4229: DFBPPR8043 ---- Plant protein ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic Source.4230: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.4231: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase Source.4232: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme Source.4233: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.4234: DFBPPR8057 ---- Plant protein ---- Probable aquaporin TIP-type alpha Source.4235: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.4236: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.4237: DFBPPR8068 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.4238: DFBPPR8071 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.4239: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase Source.4240: DFBPPR8079 ---- Plant protein ---- Vacuolar-processing enzyme Source.4241: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.4242: DFBPPR8101 ---- Plant protein ---- DNA-directed RNA polymerase subunit alpha Source.4243: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17 Source.4244: DFBPPR8109 ---- Plant protein ---- Cytochrome P450 85A Source.4245: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic Source.4246: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme Source.4247: DFBPPR8144 ---- Plant protein ---- Maturase K Source.4248: DFBPPR8155 ---- Plant protein ---- Protein Ycf2 Source.4249: DFBPPR8160 ---- Plant protein ---- 230 kDa cell wall protein Source.4250: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1 Source.4251: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2 Source.4252: DFBPPR8228 ---- Plant protein ---- Albumin-8 Source.4253: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein Source.4254: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic Source.4255: DFBPPR8248 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 B, chloroplastic Source.4256: DFBPPR8249 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 2 A, chloroplastic Source.4257: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic Source.4258: DFBPPR8266 ---- Plant protein ---- Putative ATP synthase protein YMF19 Source.4259: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta Source.4260: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3 Source.4261: DFBPPR8283 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic Source.4262: DFBPPR8296 ---- Plant protein ---- 50S ribosomal protein L22, chloroplastic Source.4263: DFBPPR8300 ---- Plant protein ---- Protein Ycf2 Source.4264: DFBPPR8304 ---- Plant protein ---- Protein TIC 214 Source.4265: DFBPPR8309 ---- Plant protein ---- 30S ribosomal protein S8, chloroplastic Source.4266: DFBPPR8314 ---- Plant protein ---- Maturase K Source.4267: DFBPPR8341 ---- Plant protein ---- Cysteine proteinase inhibitor A
Link-research Inductive analysis	There are no literature reports on the discovery of this sequence in other food-source proteins.

Biological/Functional activity & target protein

Antioxidative activity	The peptide Met-Tyr protects endothelial cells from oxidative stress via induction of HO-1 and ferritin in a concentration-depended manner but independently of its ACE inhibitory properties. This pathway represents a novel, potentially antiatherogenic mechanism of Met-Tyr and dietary proteins releasing Met-Tyr during gastrointestinal digestion.
Specific target protein(s)	N.D

Taste properties & Structure

Bitterness

Literature report	N.D
Bitter prediction tools	Bitter taste ^prediction

SMILES

N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O

Preparation method

Mode of preparation	Enzymatic hydrolysis
Enzyme(s)/starter culture	Sardine muscle protein was hydrolyzed with alkaline protease ^[1].

Stability & Cytotoxicity

Peptide stability

Literature report:	N.D
EHP-Tool:	Enzymatic Hydrolysis Prediction Tool (EHP-Tool)

Peptide cytotoxicity

Literature report:	N.D
Prediction:	ToxinPred

Additional information

N.D

Database cross-references

DFBP

[D1]	DFBPACEI0491, DFBPACEI1891
[D2]	DFBPMUFU0425

BIOPEP-UWM

[D3]

3388, 8090, 8838

APD

[D4]

BioPepDB

[D5]

MBPDB

[D6]

Reference(s)

Primary literature	Erdmann K, Grosser N, Schipporeit K, Schröder H. The ACE inhibitory dipeptide Met-Tyr diminishes free radical formation in human endothelial cells via induction of heme oxygenase-1 and ferritin. J Nutr. 2006 Aug;136(8):2148-52. PMID: 16857833 DOI: 10.1093/jn/136.8.2148
Other literature(s)	[1] Matsufuji H, Matsui T, Seki E, et al. Angiotensin I-converting Enzyme Inhibitory Peptides in an Alkaline Protease Hydrolyzate Derived from Sardine Muscle[J]. Bioscience Biotechnology & Biochemistry, 1994, 58(12):2244-2245.
PubDate	2006