| DFBP ID - DFBPACEI0383(ACE-inhibitory peptide) |
| DFBP ID |
DFBPACEI0383 |
| Peptide sequence |
IYP |
| Type |
Native peptide |
| Peptide/Function name |
ACE-inhibitory peptide |
|
| Function-activity relationship |
| Main bioactivity |
ACE-inhibitory activity |
| Otheir bioactivity |
PEP-inhibitory activity [D1], Multifunctional activity [D2] |
|
| Calculated physicochemical properties |
| Three-letter amino acid |
Ile-Tyr-Pro |
| Single-letter amino acid |
IYP |
| Peptide length |
3 |
| Peptide mass |
| Experimental mass |
Theoretical mass |
| N.D |
391.46 Da c |
|
| Net charge |
0.00 c |
| Isoelectric point (pI) |
5.92 c |
| IC50 |
61 μM
|
| pIC50 |
-1.785 |
| GRAVY |
0.5333 c |
| Hydrophilic residue ratio |
66.67% c |
| Peptide calculator |
|
|
| Biological/Functional activity & target protein |
| ACE-inhibitory activity |
The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50
value of 61 uM. |
| Specific target protein(s) |
Specific Target Protein(s): Angiotensin-converting enzyme |
|
| Taste properties & Structure |
| Bitterness |
| Literature report |
N.D |
| Bitter prediction tools |
Bitter taste prediction |
|
| SMILES |
N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N1[C@@]([H])(CCC1)C(=O)O |
|
| Preparation method |
| Mode of preparation |
Synthesis
|
| Enzyme(s)/starter culture |
The peptides used in this study were synthesized by the solid-phase method. |
|
| Stability & Cytotoxicity |
| Peptide stability |
|
| Peptide cytotoxicity |
|
|
| Additional information |
| Additional information |
N.D |
|
| Database cross-references |
|
|
|
|
|
|
|
|
|
|
| Reference(s) |
| Primary literature |
Kohmura, M., Nio, N., Kubo, K., Minoshima, Y., Munekata, E., Ariyoshi, Y. Inhibition of Angiotensin-converting Enzyme by Synthetic Peptides of Human β-Casein. Agricultural and Biological Chemistry. 2014, 53, 2107-14.
|
| Other literature(s) |
N.D |
| PubDate |
2014 |
|