E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI1184(ACE-inhibitory peptide)
DFBP ID DFBPACEI1184
Peptide sequence AEL
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity Antihypertensive activity [D1], Multifunctional activity [D2]
Calculated physicochemical properties
Three-letter amino acid Ala-Glu-Leu
Single-letter amino acid AEL
Peptide length 3
Peptide mass
Experimental mass Theoretical mass
N.D 331.36 Da c
Net charge 0.00 c
Isoelectric point (pI) 3.34 c
IC50

57.1 uM

pIC50 -1.757
GRAVY 0.7000 c
Hydrophilic residue ratio 66.67% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Animal, Marine
Organism/Source Short-necked clam (Tapes philippinarum)
Precursor protein Short-necked clam powder hydrolysates
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0810 ---- Plant proteins ---- APETALA2-like protein 1
Source.2: DFBPPR0813 ---- Plant proteins ---- Protein RICE FLOWERING LOCUS T 1
Source.3: DFBPPR0816 ---- Plant proteins ---- Aspartyl protease 25
Source.4: DFBPPR0818 ---- Plant proteins ---- Meiosis-specific protein PAIR3
Source.5: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.6: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.7: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5
Source.8: DFBPPR0830 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC6
Source.9: DFBPPR0835 ---- Plant proteins ---- WRKY transcription factor WRKY71
Source.10: DFBPPR0842 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR1
Source.11: DFBPPR0845 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.12: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.13: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.14: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.15: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46
Source.16: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.17: DFBPPR0873 ---- Plant proteins ---- Calcium-dependent protein kinase 9
Source.18: DFBPPR0874 ---- Plant proteins ---- Cyclin-dependent kinase D-1
Source.19: DFBPPR0884 ---- Plant proteins ---- Chitin elicitor receptor kinase 1
Source.20: DFBPPR0889 ---- Plant proteins ---- E3 ubiquitin-protein ligase SPL11
Source.21: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1
Source.22: DFBPPR0895 ---- Plant proteins ---- Cytochrome P450 85A1
Source.23: DFBPPR0898 ---- Plant proteins ---- Protein phosphatase 2C 53
Source.24: DFBPPR0900 ---- Plant proteins ---- GTPase activating protein 1
Source.25: DFBPPR0903 ---- Plant proteins ---- Shaggy-related protein kinase GSK2
Source.26: DFBPPR0915 ---- Plant proteins ---- Kinesin-like protein KIN-4A
Source.27: DFBPPR0916 ---- Plant proteins ---- Oryzalexin D synthase
Source.28: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.29: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.30: DFBPPR0925 ---- Plant proteins ---- Hexokinase-6
Source.31: DFBPPR0926 ---- Plant proteins ---- Salt tolerance receptor-like cytoplasmic kinase 1
Source.32: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.33: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.34: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.35: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.36: DFBPPR0956 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase SIK1
Source.37: DFBPPR0964 ---- Plant proteins ---- Thioredoxin reductase NTRC
Source.38: DFBPPR0966 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein FLORAL ORGAN NUMBER1
Source.39: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.40: DFBPPR0980 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.41: DFBPPR0984 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU70
Source.42: DFBPPR0990 ---- Plant proteins ---- LysM domain receptor-like kinase 10
Source.43: DFBPPR0993 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 2
Source.44: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.45: DFBPPR0999 ---- Plant proteins ---- Shaggy-related protein kinase GSK1
Source.46: DFBPPR1002 ---- Plant proteins ---- Calcium-dependent protein kinase 23
Source.47: DFBPPR1003 ---- Plant proteins ---- Soluble starch synthase 1, chloroplastic/amyloplastic
Source.48: DFBPPR1008 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 9 [UDP-forming]
Source.49: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.50: DFBPPR1011 ---- Plant proteins ---- U-box domain-containing protein 75
Source.51: DFBPPR1012 ---- Plant proteins ---- Kinesin-like protein KIN-7D, chloroplastic
Source.52: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.53: DFBPPR1021 ---- Plant proteins ---- L-ascorbate peroxidase 1, cytosolic
Source.54: DFBPPR1022 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK3
Source.55: DFBPPR1026 ---- Plant proteins ---- Serine/threonine protein phosphatase 2A 57 kDa regulatory subunit B' kappa isoform
Source.56: DFBPPR1035 ---- Plant proteins ---- Probable L-ascorbate peroxidase 8, chloroplastic
Source.57: DFBPPR1046 ---- Plant proteins ---- Probable histidine kinase 3
Source.58: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8
Source.59: DFBPPR1053 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 56
Source.60: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.61: DFBPPR1055 ---- Plant proteins ---- Phospholipase A1 EG1, chloroplastic/mitochondrial
Source.62: DFBPPR1059 ---- Plant proteins ---- DNA replication licensing factor MCM2
Source.63: DFBPPR1063 ---- Plant proteins ---- Vacuolar protein sorting-associated protein 9A
Source.64: DFBPPR1064 ---- Plant proteins ---- Probable histidine kinase 6
Source.65: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c
Source.66: DFBPPR1069 ---- Plant proteins ---- Cinnamoyl-CoA reductase 1
Source.67: DFBPPR1071 ---- Plant proteins ---- UDP-glycosyltransferase 79
Source.68: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.69: DFBPPR1077 ---- Plant proteins ---- Hexokinase-9
Source.70: DFBPPR1079 ---- Plant proteins ---- Hexokinase-7
Source.71: DFBPPR1081 ---- Plant proteins ---- Protein phosphatase 2C 51
Source.72: DFBPPR1082 ---- Plant proteins ---- DNA polymerase alpha catalytic subunit
Source.73: DFBPPR1091 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER1
Source.74: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.75: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.76: DFBPPR1100 ---- Plant proteins ---- Soluble starch synthase 2-3, chloroplastic/amyloplastic
Source.77: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.78: DFBPPR1106 ---- Plant proteins ---- Hexokinase-10
Source.79: DFBPPR1112 ---- Plant proteins ---- Solanesyl-diphosphate synthase 2, chloroplastic
Source.80: DFBPPR1118 ---- Plant proteins ---- LRR receptor-like serine/threonine-protein kinase ER2
Source.81: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E
Source.82: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4
Source.83: DFBPPR1122 ---- Plant proteins ---- Tryptamine 5-hydroxylase
Source.84: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic
Source.85: DFBPPR1130 ---- Plant proteins ---- Hexokinase-4, chloroplastic
Source.86: DFBPPR1160 ---- Plant proteins ---- Cytochrome P450 90A3
Source.87: DFBPPR1162 ---- Plant proteins ---- NAC domain-containing protein 2
Source.88: DFBPPR1166 ---- Plant proteins ---- Transcription factor MYB3R-2
Source.89: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.90: DFBPPR1211 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.91: DFBPPR1213 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FSM
Source.92: DFBPPR1221 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH1, chloroplastic
Source.93: DFBPPR1227 ---- Plant proteins ---- Two pore potassium channel b
Source.94: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.95: DFBPPR1245 ---- Plant proteins ---- TPR repeat-containing protein ZIP4
Source.96: DFBPPR1249 ---- Plant proteins ---- WRKY transcription factor WRKY28
Source.97: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.98: DFBPPR1251 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 15
Source.99: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.100: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.101: DFBPPR1263 ---- Plant proteins ---- Probable inactive leucine-rich repeat receptor kinase XIAO
Source.102: DFBPPR1264 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1A
Source.103: DFBPPR1266 ---- Plant proteins ---- Protein SGT1 homolog
Source.104: DFBPPR1270 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL1
Source.105: DFBPPR1271 ---- Plant proteins ---- CBL-interacting protein kinase 23
Source.106: DFBPPR1273 ---- Plant proteins ---- Peroxisomal (S)-2-hydroxy-acid oxidase GLO3
Source.107: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.108: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.109: DFBPPR1278 ---- Plant proteins ---- Ureidoglycolate hydrolase
Source.110: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.111: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.112: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.113: DFBPPR1290 ---- Plant proteins ---- Dehydration-responsive element-binding protein 2B
Source.114: DFBPPR1291 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 2, chloroplastic
Source.115: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.116: DFBPPR1300 ---- Plant proteins ---- Protein G1
Source.117: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.118: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.119: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.120: DFBPPR1313 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 1
Source.121: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.122: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22
Source.123: DFBPPR1320 ---- Plant proteins ---- Ribulose-phosphate 3-epimerase, chloroplastic
Source.124: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d
Source.125: DFBPPR1329 ---- Plant proteins ---- Tubulin beta-8 chain
Source.126: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.127: DFBPPR1335 ---- Plant proteins ---- Tubulin beta-3 chain
Source.128: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.129: DFBPPR1342 ---- Plant proteins ---- KH domain-containing protein SPIN1
Source.130: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.131: DFBPPR1347 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX14
Source.132: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.133: DFBPPR1354 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL3
Source.134: DFBPPR1355 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH3, chloroplastic
Source.135: DFBPPR1366 ---- Plant proteins ---- Kinesin-like protein KIN-7F
Source.136: DFBPPR1367 ---- Plant proteins ---- Histone deacetylase 1
Source.137: DFBPPR1368 ---- Plant proteins ---- Cytochrome P450 90A4
Source.138: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.139: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic
Source.140: DFBPPR1379 ---- Plant proteins ---- 1-deoxy-D-xylulose-5-phosphate synthase 1, chloroplastic
Source.141: DFBPPR1382 ---- Plant proteins ---- Cytochrome P450 76M5
Source.142: DFBPPR1383 ---- Plant proteins ---- Protein rough sheath 2 homolog
Source.143: DFBPPR1384 ---- Plant proteins ---- Oryzalexin E synthase
Source.144: DFBPPR1395 ---- Plant proteins ---- Probable L-ascorbate peroxidase 7, chloroplastic
Source.145: DFBPPR1396 ---- Plant proteins ---- Peroxidase 2
Source.146: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.147: DFBPPR1404 ---- Plant proteins ---- DNA topoisomerase 6 subunit B
Source.148: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.149: DFBPPR1410 ---- Plant proteins ---- Auxin response factor 23
Source.150: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.151: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.152: DFBPPR1418 ---- Plant proteins ---- SCARECROW-LIKE protein 7
Source.153: DFBPPR1421 ---- Plant proteins ---- GDP-mannose 3,5-epimerase 1
Source.154: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.155: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.156: DFBPPR1429 ---- Plant proteins ---- Tubulin beta-4 chain
Source.157: DFBPPR1432 ---- Plant proteins ---- Probable GTP diphosphokinase CRSH2, chloroplastic
Source.158: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.159: DFBPPR1434 ---- Plant proteins ---- Two-component response regulator ORR29
Source.160: DFBPPR1439 ---- Plant proteins ---- Cytochrome P450 714B1
Source.161: DFBPPR1440 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRL2
Source.162: DFBPPR1442 ---- Plant proteins ---- Protein SCARECROW 1
Source.163: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.164: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.165: DFBPPR1457 ---- Plant proteins ---- Inositol-tetrakisphosphate 1-kinase 3
Source.166: DFBPPR1466 ---- Plant proteins ---- Hexokinase-1
Source.167: DFBPPR1467 ---- Plant proteins ---- Chaperone protein ClpD1, chloroplastic
Source.168: DFBPPR1469 ---- Plant proteins ---- Apoptosis inhibitor 5-like protein API5
Source.169: DFBPPR1472 ---- Plant proteins ---- Protein LAZY 1
Source.170: DFBPPR1473 ---- Plant proteins ---- Protein HEADING DATE 3A
Source.171: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.172: DFBPPR1481 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSL1
Source.173: DFBPPR1482 ---- Plant proteins ---- Fructokinase-1
Source.174: DFBPPR1483 ---- Plant proteins ---- Isoamylase 3, chloroplastic
Source.175: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.176: DFBPPR1493 ---- Plant proteins ---- Ent-isokaurene C2/C3-hydroxylase
Source.177: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.178: DFBPPR1498 ---- Plant proteins ---- Protein SCARECROW 2
Source.179: DFBPPR1500 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit beta, mitochondrial
Source.180: DFBPPR1503 ---- Plant proteins ---- Porphobilinogen deaminase, chloroplastic
Source.181: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.182: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.183: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d
Source.184: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.185: DFBPPR1513 ---- Plant proteins ---- 14-3-3-like protein GF14-F
Source.186: DFBPPR1514 ---- Plant proteins ---- DNA polymerase delta catalytic subunit
Source.187: DFBPPR1515 ---- Plant proteins ---- Serine/threonine-protein kinase Nek3
Source.188: DFBPPR1517 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.189: DFBPPR1521 ---- Plant proteins ---- Abscisic acid 8'-hydroxylase 3
Source.190: DFBPPR1525 ---- Plant proteins ---- 6-phosphogluconate dehydrogenase, decarboxylating 1
Source.191: DFBPPR1528 ---- Plant proteins ---- Cyclin-dependent kinase C-2
Source.192: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.193: DFBPPR1533 ---- Plant proteins ---- Chaperone protein ClpB1
Source.194: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.195: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.196: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.197: DFBPPR1551 ---- Plant proteins ---- Syn-pimara-7,15-diene synthase
Source.198: DFBPPR1562 ---- Plant proteins ---- Tubulin beta-5 chain
Source.199: DFBPPR1564 ---- Plant proteins ---- Transcription factor PHYTOCHROME INTERACTING FACTOR-LIKE 15
Source.200: DFBPPR1567 ---- Plant proteins ---- Protein argonaute PNH1
Source.201: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.202: DFBPPR1574 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 1, chloroplastic
Source.203: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.204: DFBPPR1590 ---- Plant proteins ---- Cyclin-dependent kinase F-1
Source.205: DFBPPR1592 ---- Plant proteins ---- Adenylosuccinate synthetase 1, chloroplastic
Source.206: DFBPPR1594 ---- Plant proteins ---- Disease resistance protein Pik-1
Source.207: DFBPPR1600 ---- Plant proteins ---- Phytosulfokines 5
Source.208: DFBPPR1601 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.209: DFBPPR1605 ---- Plant proteins ---- Phytochrome B
Source.210: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.211: DFBPPR1611 ---- Plant proteins ---- Fructokinase-2
Source.212: DFBPPR1612 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 1
Source.213: DFBPPR1614 ---- Plant proteins ---- Bisdemethoxycurcumin synthase
Source.214: DFBPPR1622 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.215: DFBPPR1623 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 2, chloroplastic
Source.216: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.217: DFBPPR1631 ---- Plant proteins ---- LysM domain-containing GPI-anchored protein LYP4
Source.218: DFBPPR1632 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 6, chloroplastic
Source.219: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.220: DFBPPR1638 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase 3
Source.221: DFBPPR1640 ---- Plant proteins ---- Crossover junction endonuclease EME1
Source.222: DFBPPR1641 ---- Plant proteins ---- Enolase
Source.223: DFBPPR1643 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 3, chloroplastic/amyloplastic
Source.224: DFBPPR1645 ---- Plant proteins ---- Tubulin beta-7 chain
Source.225: DFBPPR1650 ---- Plant proteins ---- Tubulin beta-1 chain
Source.226: DFBPPR1660 ---- Plant proteins ---- Magnesium-chelatase subunit ChlH, chloroplastic
Source.227: DFBPPR1661 ---- Plant proteins ---- Flavanone 3-dioxygenase 1
Source.228: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.229: DFBPPR1664 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 10
Source.230: DFBPPR1680 ---- Plant proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.231: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.232: DFBPPR1685 ---- Plant proteins ---- Pyruvate, phosphate dikinase 2
Source.233: DFBPPR1687 ---- Plant proteins ---- Transcription factor ILI1
Source.234: DFBPPR1690 ---- Plant proteins ---- Transcription factor APG
Source.235: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.236: DFBPPR1699 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 6
Source.237: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.238: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a
Source.239: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.240: DFBPPR1713 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.241: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.242: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.243: DFBPPR1719 ---- Plant proteins ---- Beta-1,2-xylosyltransferase XYXT1
Source.244: DFBPPR1721 ---- Plant proteins ---- Cyclin-dependent kinase C-1
Source.245: DFBPPR1722 ---- Plant proteins ---- Protein TIFY 11a
Source.246: DFBPPR1726 ---- Plant proteins ---- SPX domain-containing protein 1
Source.247: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.248: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.249: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.250: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.251: DFBPPR1749 ---- Plant proteins ---- Probable L-ascorbate peroxidase 6, chloroplastic/mitochondrial
Source.252: DFBPPR1754 ---- Plant proteins ---- Transcription factor BHLH094
Source.253: DFBPPR1760 ---- Plant proteins ---- Tubulin beta-2 chain
Source.254: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.255: DFBPPR1769 ---- Plant proteins ---- Two-component response regulator ORR3
Source.256: DFBPPR1777 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK1
Source.257: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.258: DFBPPR1785 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein OGR1, mitochondrial
Source.259: DFBPPR1787 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.260: DFBPPR1797 ---- Plant proteins ---- Probable L-ascorbate peroxidase 5, chloroplastic
Source.261: DFBPPR1800 ---- Plant proteins ---- APETALA2-like protein 4
Source.262: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.263: DFBPPR1804 ---- Plant proteins ---- Ent-cassadiene hydroxylase
Source.264: DFBPPR1809 ---- Plant proteins ---- Chaperone protein ClpB3, mitochondrial
Source.265: DFBPPR1810 ---- Plant proteins ---- Shaggy-related protein kinase GSK4
Source.266: DFBPPR1811 ---- Plant proteins ---- Sulfhydryl oxidase 1
Source.267: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.268: DFBPPR1816 ---- Plant proteins ---- Transcription factor RF2a
Source.269: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.270: DFBPPR1824 ---- Plant proteins ---- Mitogen-activated protein kinase 17
Source.271: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.272: DFBPPR1841 ---- Plant proteins ---- SPX domain-containing protein 2
Source.273: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.274: DFBPPR1846 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.275: DFBPPR1852 ---- Plant proteins ---- RAP domain-containing protein, chloroplastic
Source.276: DFBPPR1855 ---- Plant proteins ---- Aminopeptidase M1-B
Source.277: DFBPPR1856 ---- Plant proteins ---- Aminopeptidase M1-D
Source.278: DFBPPR1860 ---- Plant proteins ---- Kinesin-like protein KIN-7A
Source.279: DFBPPR1866 ---- Plant proteins ---- Probable DNA gyrase subunit A, chloroplastic/mitochondrial
Source.280: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.281: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4
Source.282: DFBPPR1881 ---- Plant proteins ---- Protein TIFY 11d
Source.283: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.284: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.285: DFBPPR1905 ---- Plant proteins ---- 2-methyl-6-phytyl-1,4-hydroquinone methyltransferase 1, chloroplastic
Source.286: DFBPPR1906 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 1, chloroplastic
Source.287: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.288: DFBPPR1915 ---- Plant proteins ---- Succinate--CoA ligase [ADP-forming] subunit alpha, mitochondrial
Source.289: DFBPPR1917 ---- Plant proteins ---- Kinesin-like protein KIN-12A
Source.290: DFBPPR1918 ---- Plant proteins ---- DNA replication licensing factor MCM6
Source.291: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.292: DFBPPR1922 ---- Plant proteins ---- Cyclin-dependent kinase G-2
Source.293: DFBPPR1925 ---- Plant proteins ---- Cytokinin dehydrogenase 3
Source.294: DFBPPR1929 ---- Plant proteins ---- Guanylate kinase 1
Source.295: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.296: DFBPPR1949 ---- Plant proteins ---- Beta-glucosidase-like SFR2, chloroplastic
Source.297: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.298: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.299: DFBPPR1963 ---- Plant proteins ---- Potassium channel AKT1
Source.300: DFBPPR1968 ---- Plant proteins ---- Kinesin-like protein KIN-14I
Source.301: DFBPPR1969 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR3
Source.302: DFBPPR1976 ---- Plant proteins ---- Mitogen-activated protein kinase 15
Source.303: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A
Source.304: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.305: DFBPPR1988 ---- Plant proteins ---- Protein FLORAL ORGAN NUMBER2
Source.306: DFBPPR1994 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.307: DFBPPR1995 ---- Plant proteins ---- Pectinesterase inhibitor 28
Source.308: DFBPPR2000 ---- Plant proteins ---- Sodium/calcium exchanger NCL1
Source.309: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.310: DFBPPR2014 ---- Plant proteins ---- Chaperone protein ClpB2, chloroplastic
Source.311: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.312: DFBPPR2031 ---- Plant proteins ---- DNA replication licensing factor MCM3
Source.313: DFBPPR2034 ---- Plant proteins ---- Kinesin-like protein KIN-8B
Source.314: DFBPPR2038 ---- Plant proteins ---- Importin subunit alpha-2
Source.315: DFBPPR2043 ---- Plant proteins ---- Cyclin-dependent kinase E-1
Source.316: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.317: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.318: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.319: DFBPPR2069 ---- Plant proteins ---- CBL-interacting protein kinase 7
Source.320: DFBPPR2070 ---- Plant proteins ---- Calmodulin-1
Source.321: DFBPPR2072 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.322: DFBPPR2079 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.323: DFBPPR2083 ---- Plant proteins ---- Lectin
Source.324: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.325: DFBPPR2089 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 3, mitochondrial
Source.326: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.327: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.328: DFBPPR2097 ---- Plant proteins ---- Tubulin beta-6 chain
Source.329: DFBPPR2098 ---- Plant proteins ---- DNA replication licensing factor MCM5
Source.330: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase
Source.331: DFBPPR2107 ---- Plant proteins ---- Probable sucrose-phosphate synthase 1
Source.332: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.333: DFBPPR2109 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT1
Source.334: DFBPPR2114 ---- Plant proteins ---- Mitogen-activated protein kinase 14
Source.335: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.336: DFBPPR2120 ---- Plant proteins ---- Putative cyclin-dependent kinase F-2
Source.337: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.338: DFBPPR2133 ---- Plant proteins ---- Probable diaminopimelate decarboxylase, chloroplastic
Source.339: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.340: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.341: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.342: DFBPPR2153 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 5, mitochondrial
Source.343: DFBPPR2156 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 2
Source.344: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.345: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.346: DFBPPR2173 ---- Plant proteins ---- Cullin-1
Source.347: DFBPPR2179 ---- Plant proteins ---- 14-3-3-like protein GF14-C
Source.348: DFBPPR2186 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.349: DFBPPR2188 ---- Plant proteins ---- Probable 2-oxoglutarate-dependent dioxygenase SLC2
Source.350: DFBPPR2194 ---- Plant proteins ---- U-box domain-containing protein 4
Source.351: DFBPPR2216 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit gamma 1
Source.352: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.353: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.354: DFBPPR2221 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 2, mitochondrial
Source.355: DFBPPR2222 ---- Plant proteins ---- Methylthioribose kinase 1
Source.356: DFBPPR2231 ---- Plant proteins ---- Serine/threonine-protein kinase Nek5
Source.357: DFBPPR2236 ---- Plant proteins ---- Auxin response factor 24
Source.358: DFBPPR2237 ---- Plant proteins ---- Probable glutathione S-transferase GSTU1
Source.359: DFBPPR2239 ---- Plant proteins ---- Elongation factor 1-alpha
Source.360: DFBPPR2240 ---- Plant proteins ---- Probable protein phosphatase 2C BIPP2C1
Source.361: DFBPPR2246 ---- Plant proteins ---- Probable DNA helicase MCM9
Source.362: DFBPPR2247 ---- Plant proteins ---- Phytochrome C
Source.363: DFBPPR2248 ---- Plant proteins ---- Membrane steroid-binding protein 1
Source.364: DFBPPR2250 ---- Plant proteins ---- Serine/threonine-protein kinase Nek4
Source.365: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.366: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.367: DFBPPR2271 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK3
Source.368: DFBPPR2275 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.369: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.370: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3
Source.371: DFBPPR2294 ---- Plant proteins ---- Probable 1-deoxy-D-xylulose-5-phosphate synthase 2, chloroplastic
Source.372: DFBPPR2296 ---- Plant proteins ---- L-galactono-1,4-lactone dehydrogenase 1, mitochondrial
Source.373: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4
Source.374: DFBPPR2306 ---- Plant proteins ---- Germin-like protein 3-7
Source.375: DFBPPR2314 ---- Plant proteins ---- Phosphoacetylglucosamine mutase
Source.376: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.377: DFBPPR2318 ---- Plant proteins ---- Probable chromatin-remodeling complex ATPase chain
Source.378: DFBPPR2322 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 2
Source.379: DFBPPR2325 ---- Plant proteins ---- Peroxiredoxin-2E-2, chloroplastic
Source.380: DFBPPR2335 ---- Plant proteins ---- Acyl-CoA-binding domain-containing protein 4
Source.381: DFBPPR2347 ---- Plant proteins ---- Cellulose synthase-like protein E2
Source.382: DFBPPR2355 ---- Plant proteins ---- Probable glycosyltransferase 5
Source.383: DFBPPR2364 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.384: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5
Source.385: DFBPPR2372 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.386: DFBPPR2379 ---- Plant proteins ---- Cysteine synthase
Source.387: DFBPPR2384 ---- Plant proteins ---- ATP-dependent zinc metalloprotease FTSH 4, mitochondrial
Source.388: DFBPPR2385 ---- Plant proteins ---- Cyclin-A1-1
Source.389: DFBPPR2387 ---- Plant proteins ---- Chitinase 8
Source.390: DFBPPR2389 ---- Plant proteins ---- Nuclear transcription factor Y subunit B-1
Source.391: DFBPPR2391 ---- Plant proteins ---- Probable 4-hydroxy-tetrahydrodipicolinate reductase 1, chloroplastic
Source.392: DFBPPR2400 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX22
Source.393: DFBPPR2404 ---- Plant proteins ---- Homeobox-leucine zipper protein TF1
Source.394: DFBPPR2405 ---- Plant proteins ---- Transcription factor BHLH089
Source.395: DFBPPR2406 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK6
Source.396: DFBPPR2415 ---- Plant proteins ---- Putative aconitate hydratase, cytoplasmic
Source.397: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.398: DFBPPR2422 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED2, chloroplastic
Source.399: DFBPPR2424 ---- Plant proteins ---- CMP-sialic acid transporter 1
Source.400: DFBPPR2426 ---- Plant proteins ---- Transcription factor NIGT1
Source.401: DFBPPR2435 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED1, chloroplastic
Source.402: DFBPPR2437 ---- Plant proteins ---- Sialyltransferase-like protein 1
Source.403: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.404: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.405: DFBPPR2471 ---- Plant proteins ---- Arginase 1, mitochondrial
Source.406: DFBPPR2473 ---- Plant proteins ---- 2-hydroxyacyl-CoA lyase
Source.407: DFBPPR2504 ---- Plant proteins ---- 14-3-3-like protein GF14-B
Source.408: DFBPPR2508 ---- Plant proteins ---- Transcription factor RF2b
Source.409: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.410: DFBPPR2523 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.411: DFBPPR2524 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.412: DFBPPR2533 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 1
Source.413: DFBPPR2539 ---- Plant proteins ---- Probable aldehyde oxidase 1
Source.414: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.415: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.416: DFBPPR2545 ---- Plant proteins ---- Serine/threonine-protein kinase Nek1
Source.417: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.418: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.419: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.420: DFBPPR2552 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.421: DFBPPR2553 ---- Plant proteins ---- Probable signal recognition particle 43 kDa protein, chloroplastic
Source.422: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.423: DFBPPR2557 ---- Plant proteins ---- Auxin response factor 6
Source.424: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.425: DFBPPR2565 ---- Plant proteins ---- Monodehydroascorbate reductase 1, peroxisomal
Source.426: DFBPPR2570 ---- Plant proteins ---- Endoglucanase 12
Source.427: DFBPPR2574 ---- Plant proteins ---- Protein TIFY 10b
Source.428: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial
Source.429: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic
Source.430: DFBPPR2589 ---- Plant proteins ---- Probable solanesyl-diphosphate synthase 3, chloroplastic
Source.431: DFBPPR2591 ---- Plant proteins ---- Secretory carrier-associated membrane protein 1
Source.432: DFBPPR2604 ---- Plant proteins ---- Auxin response factor 10
Source.433: DFBPPR2619 ---- Plant proteins ---- Phosphate transporter PHO1-3
Source.434: DFBPPR2620 ---- Plant proteins ---- Glutamate dehydrogenase 3, mitochondrial
Source.435: DFBPPR2631 ---- Plant proteins ---- Cytochrome P450 93G2
Source.436: DFBPPR2632 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 4
Source.437: DFBPPR2633 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.438: DFBPPR2635 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX24
Source.439: DFBPPR2637 ---- Plant proteins ---- Auxin response factor 8
Source.440: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.441: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.442: DFBPPR2644 ---- Plant proteins ---- mRNA cap guanine-N7 methyltransferase 1
Source.443: DFBPPR2647 ---- Plant proteins ---- Silicon efflux transporter LSI2
Source.444: DFBPPR2654 ---- Plant proteins ---- Cytochrome P450 714C1
Source.445: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.446: DFBPPR2687 ---- Plant proteins ---- Protein AMEIOTIC 1 homolog
Source.447: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.448: DFBPPR2704 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 18
Source.449: DFBPPR2706 ---- Plant proteins ---- Kinesin-like protein KIN-14H
Source.450: DFBPPR2719 ---- Plant proteins ---- Monothiol glutaredoxin-S11
Source.451: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.452: DFBPPR2731 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.453: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5
Source.454: DFBPPR2743 ---- Plant proteins ---- Glutamine-dependent NAD(+) synthetase
Source.455: DFBPPR2749 ---- Plant proteins ---- Bidirectional sugar transporter SWEET15
Source.456: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.457: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.458: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2
Source.459: DFBPPR2770 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.460: DFBPPR2771 ---- Plant proteins ---- Auxin response factor 9
Source.461: DFBPPR2775 ---- Plant proteins ---- Auxin response factor 17
Source.462: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.463: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.464: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.465: DFBPPR2804 ---- Plant proteins ---- Protein GIGANTEA
Source.466: DFBPPR2808 ---- Plant proteins ---- Origin of replication complex subunit 1
Source.467: DFBPPR2809 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.468: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.469: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.470: DFBPPR2832 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 1
Source.471: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.472: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.473: DFBPPR2843 ---- Plant proteins ---- Probable aldehyde oxidase 2
Source.474: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.475: DFBPPR2846 ---- Plant proteins ---- ABC transporter G family member 46
Source.476: DFBPPR2847 ---- Plant proteins ---- Glutaredoxin-C4, chloroplastic
Source.477: DFBPPR2848 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.478: DFBPPR2855 ---- Plant proteins ---- Transcription factor TGAL9
Source.479: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.480: DFBPPR2862 ---- Plant proteins ---- Cysteine synthase
Source.481: DFBPPR2865 ---- Plant proteins ---- TPR repeat-containing thioredoxin TDX
Source.482: DFBPPR2868 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 2
Source.483: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.484: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.485: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.486: DFBPPR2875 ---- Plant proteins ---- Electron transfer flavoprotein subunit alpha, mitochondrial
Source.487: DFBPPR2876 ---- Plant proteins ---- Kinesin-like protein KIN-5A
Source.488: DFBPPR2896 ---- Plant proteins ---- Kinesin-like protein KIN-7E, chloroplastic
Source.489: DFBPPR2901 ---- Plant proteins ---- Thioredoxin reductase NTRB
Source.490: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.491: DFBPPR2927 ---- Plant proteins ---- Probable aldehyde oxidase 3
Source.492: DFBPPR2929 ---- Plant proteins ---- Germin-like protein 2-4
Source.493: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.494: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.495: DFBPPR2947 ---- Plant proteins ---- Peroxisomal membrane protein 11-5
Source.496: DFBPPR2960 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 1
Source.497: DFBPPR2962 ---- Plant proteins ---- Transcription factor PCF8
Source.498: DFBPPR2963 ---- Plant proteins ---- Phytanoyl-CoA dioxygenase 1
Source.499: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.500: DFBPPR2972 ---- Plant proteins ---- Probable potassium transporter 14
Source.501: DFBPPR2978 ---- Plant proteins ---- Disease resistance protein RGA4
Source.502: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1
Source.503: DFBPPR3000 ---- Plant proteins ---- Kinesin-like protein KIN-14L
Source.504: DFBPPR3006 ---- Plant proteins ---- 3'(2'),5'-bisphosphate nucleotidase
Source.505: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.506: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.507: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.508: DFBPPR3041 ---- Plant proteins ---- FAD synthetase, chloroplastic
Source.509: DFBPPR3045 ---- Plant proteins ---- Probable inositol oxygenase
Source.510: DFBPPR3054 ---- Plant proteins ---- Pectinesterase inhibitor 8
Source.511: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.512: DFBPPR3065 ---- Plant proteins ---- Transcription factor TGAL5
Source.513: DFBPPR3067 ---- Plant proteins ---- 5-methyltetrahydropteroyltriglutamate--homocysteine methyltransferase 2
Source.514: DFBPPR3069 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 6, chloroplastic
Source.515: DFBPPR3076 ---- Plant proteins ---- GTP-binding nuclear protein Ran-1
Source.516: DFBPPR3077 ---- Plant proteins ---- ABC transporter G family member 31
Source.517: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2
Source.518: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.519: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.520: DFBPPR3099 ---- Plant proteins ---- Putative GTP diphosphokinase RSH1, chloroplastic
Source.521: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.522: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.523: DFBPPR3107 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate oxidase 1
Source.524: DFBPPR3110 ---- Plant proteins ---- Thioredoxin H5
Source.525: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.526: DFBPPR3126 ---- Plant proteins ---- Tryptamine benzoyltransferase 1
Source.527: DFBPPR3128 ---- Plant proteins ---- ABC transporter G family member 41
Source.528: DFBPPR3134 ---- Plant proteins ---- Secretory carrier-associated membrane protein 2
Source.529: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.530: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.531: DFBPPR3156 ---- Plant proteins ---- Kinesin-like protein KIN-14O
Source.532: DFBPPR3157 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 2
Source.533: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3
Source.534: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.535: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2
Source.536: DFBPPR3174 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 5
Source.537: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48
Source.538: DFBPPR3193 ---- Plant proteins ---- Potassium channel AKT3
Source.539: DFBPPR3199 ---- Plant proteins ---- Cyclin-B1-3
Source.540: DFBPPR3201 ---- Plant proteins ---- L-aspartate oxidase, chloroplastic
Source.541: DFBPPR3202 ---- Plant proteins ---- Probable 4-coumarate--CoA ligase 3
Source.542: DFBPPR3208 ---- Plant proteins ---- Probable potassium transporter 15
Source.543: DFBPPR3211 ---- Plant proteins ---- Exocyst complex component 5
Source.544: DFBPPR3215 ---- Plant proteins ---- Inositol-3-phosphate synthase 1
Source.545: DFBPPR3219 ---- Plant proteins ---- Secretory carrier-associated membrane protein 4
Source.546: DFBPPR3220 ---- Plant proteins ---- ATP-citrate synthase subunit alpha chain protein 1
Source.547: DFBPPR3223 ---- Plant proteins ---- Phospho-2-dehydro-3-deoxyheptonate aldolase 1, chloroplastic
Source.548: DFBPPR3224 ---- Plant proteins ---- Germin-like protein 9-3
Source.549: DFBPPR3225 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit M, chloroplastic
Source.550: DFBPPR3228 ---- Plant proteins ---- Probable aquaporin PIP2-1
Source.551: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37
Source.552: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.553: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26
Source.554: DFBPPR3240 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 35A
Source.555: DFBPPR3242 ---- Plant proteins ---- Peroxisomal membrane protein 11-1
Source.556: DFBPPR3244 ---- Plant proteins ---- Kinesin-like protein KIN-12B
Source.557: DFBPPR3247 ---- Plant proteins ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.558: DFBPPR3252 ---- Plant proteins ---- Probable protein phosphatase 2C 70
Source.559: DFBPPR3265 ---- Plant proteins ---- Probable protein phosphatase 2C 18
Source.560: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.561: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.562: DFBPPR3270 ---- Plant proteins ---- Calmodulin-like protein 1
Source.563: DFBPPR3276 ---- Plant proteins ---- MADS-box transcription factor 27
Source.564: DFBPPR3296 ---- Plant proteins ---- MADS-box transcription factor 32
Source.565: DFBPPR3297 ---- Plant proteins ---- Transcription factor TGAL4
Source.566: DFBPPR3299 ---- Plant proteins ---- Metal transporter Nramp4
Source.567: DFBPPR3301 ---- Plant proteins ---- 14-3-3-like protein GF14-E
Source.568: DFBPPR3304 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.2
Source.569: DFBPPR3309 ---- Plant proteins ---- Membrane steroid-binding protein 2
Source.570: DFBPPR3315 ---- Plant proteins ---- Replication factor C subunit 5
Source.571: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.572: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.573: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.574: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3
Source.575: DFBPPR3341 ---- Plant proteins ---- Transcriptional adapter ADA2
Source.576: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8
Source.577: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.578: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2
Source.579: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.580: DFBPPR3366 ---- Plant proteins ---- Kinesin-like protein KIN-12C
Source.581: DFBPPR3370 ---- Plant proteins ---- Potassium channel KAT1
Source.582: DFBPPR3373 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 1
Source.583: DFBPPR3375 ---- Plant proteins ---- Probable protein phosphatase 2C 1
Source.584: DFBPPR3376 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 28
Source.585: DFBPPR3379 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 42
Source.586: DFBPPR3382 ---- Plant proteins ---- Auxin-responsive protein IAA14
Source.587: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.588: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.589: DFBPPR3393 ---- Plant proteins ---- Auxin-responsive protein IAA20
Source.590: DFBPPR3443 ---- Plant proteins ---- Calmodulin-2
Source.591: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.592: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.593: DFBPPR3454 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 7, chloroplastic
Source.594: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12
Source.595: DFBPPR3463 ---- Plant proteins ---- Protein THYLAKOID RHODANESE-LIKE, chloroplastic
Source.596: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1
Source.597: DFBPPR3468 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS34
Source.598: DFBPPR3469 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 27
Source.599: DFBPPR3472 ---- Plant proteins ---- NAC domain-containing protein 68
Source.600: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.601: DFBPPR3487 ---- Plant proteins ---- ATP-citrate synthase alpha chain protein 3
Source.602: DFBPPR3496 ---- Plant proteins ---- Monothiol glutaredoxin-S9
Source.603: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2
Source.604: DFBPPR3503 ---- Plant proteins ---- Kinesin-like protein KIN-14P
Source.605: DFBPPR3509 ---- Plant proteins ---- Tryptamine benzoyltransferase 2
Source.606: DFBPPR3511 ---- Plant proteins ---- Kinesin-like protein KIN-14N
Source.607: DFBPPR3512 ---- Plant proteins ---- Probable protein phosphatase 2C 3
Source.608: DFBPPR3514 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 4, chloroplastic
Source.609: DFBPPR3516 ---- Plant proteins ---- Squamosa promoter-binding-like protein 18
Source.610: DFBPPR3524 ---- Plant proteins ---- Vacuolar iron transporter homolog 4
Source.611: DFBPPR3532 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 4
Source.612: DFBPPR3539 ---- Plant proteins ---- GTP-binding nuclear protein Ran-2
Source.613: DFBPPR3543 ---- Plant proteins ---- 26.7 kDa heat shock protein, chloroplastic
Source.614: DFBPPR3544 ---- Plant proteins ---- Growth-regulating factor 5
Source.615: DFBPPR3548 ---- Plant proteins ---- Methylthioribose kinase 2
Source.616: DFBPPR3562 ---- Plant proteins ---- Probable protein phosphatase 2C 61
Source.617: DFBPPR3572 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-9
Source.618: DFBPPR3577 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 3
Source.619: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5
Source.620: DFBPPR3583 ---- Plant proteins ---- TATA box-binding protein-associated factor RNA polymerase I subunit B
Source.621: DFBPPR3584 ---- Plant proteins ---- Signal recognition particle 19 kDa protein
Source.622: DFBPPR3590 ---- Plant proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.623: DFBPPR3598 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 2
Source.624: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.625: DFBPPR3608 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 3
Source.626: DFBPPR3617 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog
Source.627: DFBPPR3621 ---- Plant proteins ---- Cytochrome P450 714C3
Source.628: DFBPPR3629 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-10
Source.629: DFBPPR3631 ---- Plant proteins ---- BTB/POZ domain and ankyrin repeat-containing protein NPR5
Source.630: DFBPPR3638 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 6
Source.631: DFBPPR3639 ---- Plant proteins ---- Calmodulin-3
Source.632: DFBPPR3646 ---- Plant proteins ---- Cyclin-A1-3
Source.633: DFBPPR3656 ---- Plant proteins ---- Kinesin-like protein KIN-7C
Source.634: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.635: DFBPPR3674 ---- Plant proteins ---- Putative calmodulin-like protein 2
Source.636: DFBPPR3680 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.637: DFBPPR3681 ---- Plant proteins ---- Transcription factor JAMYB
Source.638: DFBPPR3682 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 5
Source.639: DFBPPR3693 ---- Plant proteins ---- Probable potassium transporter 9
Source.640: DFBPPR3712 ---- Plant proteins ---- Solute carrier family 40 member 2, chloroplastic
Source.641: DFBPPR3716 ---- Plant proteins ---- Kinesin-like protein KIN-12G
Source.642: DFBPPR3719 ---- Plant proteins ---- GDT1-like protein 5
Source.643: DFBPPR3720 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 36
Source.644: DFBPPR3721 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.9
Source.645: DFBPPR3748 ---- Plant proteins ---- Probable nucleoredoxin 1-1
Source.646: DFBPPR3751 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 9
Source.647: DFBPPR3757 ---- Plant proteins ---- Probable protein phosphatase 2C 71
Source.648: DFBPPR3766 ---- Plant proteins ---- Probable sucrose-phosphatase 1
Source.649: DFBPPR3768 ---- Plant proteins ---- Kinesin-like protein KIN-12F
Source.650: DFBPPR3779 ---- Plant proteins ---- Probable nucleoredoxin 2
Source.651: DFBPPR3780 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 52C
Source.652: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3
Source.653: DFBPPR3790 ---- Plant proteins ---- Pantothenate kinase 1
Source.654: DFBPPR3792 ---- Plant proteins ---- Phosphopantetheine adenylyltransferase 1
Source.655: DFBPPR3805 ---- Plant proteins ---- Putative inactive kinesin-like protein KIN-7B
Source.656: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.657: DFBPPR3821 ---- Plant proteins ---- Kinesin-like protein KIN-7G
Source.658: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.659: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.660: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.661: DFBPPR3844 ---- Plant proteins ---- Probable protein phosphatase 2C 41
Source.662: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78
Source.663: DFBPPR3860 ---- Plant proteins ---- Probable protein phosphatase 2C 62
Source.664: DFBPPR3863 ---- Plant proteins ---- Cyclin-B1-1
Source.665: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.666: DFBPPR3868 ---- Plant proteins ---- Calmodulin-like protein 5
Source.667: DFBPPR3872 ---- Plant proteins ---- Endoglucanase 19
Source.668: DFBPPR3876 ---- Plant proteins ---- Bifunctional nuclease 2
Source.669: DFBPPR3879 ---- Plant proteins ---- Kinesin-like protein KIN-12E
Source.670: DFBPPR3885 ---- Plant proteins ---- Probable protein phosphatase 2C 17
Source.671: DFBPPR3887 ---- Plant proteins ---- Endoglucanase 8
Source.672: DFBPPR3889 ---- Plant proteins ---- Lysine-specific histone demethylase 1 homolog 2
Source.673: DFBPPR3891 ---- Plant proteins ---- Transcription factor TGAL11
Source.674: DFBPPR3894 ---- Plant proteins ---- Cyclin-A3-1
Source.675: DFBPPR3899 ---- Plant proteins ---- Potassium transporter 5
Source.676: DFBPPR3907 ---- Plant proteins ---- Cyclin-A1-4
Source.677: DFBPPR3911 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.678: DFBPPR3920 ---- Plant proteins ---- Glutaredoxin-C9
Source.679: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.680: DFBPPR3930 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 7
Source.681: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.682: DFBPPR3932 ---- Plant proteins ---- Cyclin-A1-2
Source.683: DFBPPR3933 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-2 catalytic subunit
Source.684: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.685: DFBPPR3938 ---- Plant proteins ---- Calmodulin-like protein 3
Source.686: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.687: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10
Source.688: DFBPPR3951 ---- Plant proteins ---- Xyloglucan galactosyltransferase KATAMARI1 homolog
Source.689: DFBPPR3953 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 16
Source.690: DFBPPR3955 ---- Plant proteins ---- Cysteine proteinase inhibitor 3
Source.691: DFBPPR3956 ---- Plant proteins ---- Aquaporin SIP1-1
Source.692: DFBPPR3966 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 7
Source.693: DFBPPR3977 ---- Plant proteins ---- Formin-like protein 5
Source.694: DFBPPR3980 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 7
Source.695: DFBPPR3988 ---- Plant proteins ---- Phospholipase A1-II 3
Source.696: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.697: DFBPPR3997 ---- Plant proteins ---- Microtubule-associated protein 70-4
Source.698: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.699: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.700: DFBPPR4010 ---- Plant proteins ---- CMP-sialic acid transporter 5
Source.701: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.702: DFBPPR4019 ---- Plant proteins ---- Cyclin-D2-1
Source.703: DFBPPR4028 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 31
Source.704: DFBPPR4031 ---- Plant proteins ---- Probable protein phosphatase 2C 27
Source.705: DFBPPR4034 ---- Plant proteins ---- Putative serpin-Z6A
Source.706: DFBPPR4043 ---- Plant proteins ---- Momilactone A synthase
Source.707: DFBPPR4047 ---- Plant proteins ---- Glucosidase 2 subunit beta
Source.708: DFBPPR4048 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 2
Source.709: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.710: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.711: DFBPPR4064 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1F
Source.712: DFBPPR4071 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 6
Source.713: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3
Source.714: DFBPPR4078 ---- Plant proteins ---- ERAD-associated E3 ubiquitin-protein ligase component HRD3
Source.715: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.716: DFBPPR4080 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-3, chloroplastic
Source.717: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2
Source.718: DFBPPR4083 ---- Plant proteins ---- Serpin-Z6B
Source.719: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.720: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.721: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5
Source.722: DFBPPR4098 ---- Plant proteins ---- ESCRT-related protein CHMP1
Source.723: DFBPPR4105 ---- Plant proteins ---- Squamosa promoter-binding-like protein 15
Source.724: DFBPPR4110 ---- Plant proteins ---- Cyclin-A3-2
Source.725: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.726: DFBPPR4115 ---- Plant proteins ---- Cyclin-B1-2
Source.727: DFBPPR4118 ---- Plant proteins ---- Probable protein phosphatase 2C 33
Source.728: DFBPPR4119 ---- Plant proteins ---- Cyclin-A2-1
Source.729: DFBPPR4120 ---- Plant proteins ---- Probable aquaporin TIP4-3
Source.730: DFBPPR4127 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 5
Source.731: DFBPPR4131 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 22
Source.732: DFBPPR4139 ---- Plant proteins ---- Probable protein phosphatase 2C 16
Source.733: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1
Source.734: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.735: DFBPPR4152 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 6
Source.736: DFBPPR4156 ---- Plant proteins ---- Aquaporin NIP3-3
Source.737: DFBPPR4157 ---- Plant proteins ---- NAC domain-containing protein 67
Source.738: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.739: DFBPPR4174 ---- Plant proteins ---- Mitochondrial intermembrane space import and assembly protein 40 homolog
Source.740: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.741: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.742: DFBPPR4189 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.743: DFBPPR4191 ---- Plant proteins ---- Cyclin-D2-2
Source.744: DFBPPR4202 ---- Plant proteins ---- Cyclin-D3-2
Source.745: DFBPPR4206 ---- Plant proteins ---- Magnesium transporter MRS2-C
Source.746: DFBPPR4208 ---- Plant proteins ---- 4-coumarate--CoA ligase-like 4
Source.747: DFBPPR4210 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-1, mitochondrial
Source.748: DFBPPR4213 ---- Plant proteins ---- Mitochondrial import inner membrane translocase subunit Tim9
Source.749: DFBPPR4221 ---- Plant proteins ---- Solute carrier family 40 member 3, chloroplastic
Source.750: DFBPPR4222 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 8
Source.751: DFBPPR4224 ---- Plant proteins ---- Probable calcium-binding protein CML22
Source.752: DFBPPR4225 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha-2, mitochondrial
Source.753: DFBPPR4229 ---- Plant proteins ---- GDT1-like protein 1, chloroplastic
Source.754: DFBPPR4230 ---- Plant proteins ---- Cyclin-D1-1
Source.755: DFBPPR4232 ---- Plant proteins ---- Formin-like protein 14
Source.756: DFBPPR4236 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 9
Source.757: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.758: DFBPPR4241 ---- Plant proteins ---- Flotillin-like protein 2
Source.759: DFBPPR4242 ---- Plant proteins ---- Flotillin-like protein 3
Source.760: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.761: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.762: DFBPPR4252 ---- Plant proteins ---- CASP-like protein 2A1
Source.763: DFBPPR4264 ---- Plant proteins ---- Putative 4-coumarate--CoA ligase-like 8
Source.764: DFBPPR4273 ---- Plant proteins ---- Cyclase-like protein 2
Source.765: DFBPPR4275 ---- Plant proteins ---- Putative indole-3-acetic acid-amido synthetase GH3.10
Source.766: DFBPPR4281 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 3
Source.767: DFBPPR4290 ---- Plant proteins ---- Probable trehalose-phosphate phosphatase 3
Source.768: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like
Source.769: DFBPPR4305 ---- Plant proteins ---- Microtubule-associated protein 70-1
Source.770: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.771: DFBPPR4318 ---- Plant proteins ---- Golgin-84
Source.772: DFBPPR4322 ---- Plant proteins ---- Microtubule-associated protein 70-3
Source.773: DFBPPR4323 ---- Plant proteins ---- Microtubule-associated protein 70-2
Source.774: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.775: DFBPPR4335 ---- Plant proteins ---- Actin-related protein 5
Source.776: DFBPPR4336 ---- Plant proteins ---- Putative cyclin-F3-2
Source.777: DFBPPR4338 ---- Plant proteins ---- Cysteine proteinase inhibitor 5
Source.778: DFBPPR4343 ---- Plant proteins ---- Transcription factor ILI7
Source.779: DFBPPR4344 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1E
Source.780: DFBPPR4347 ---- Plant proteins ---- Metal transporter Nramp2
Source.781: DFBPPR4348 ---- Plant proteins ---- Probable calcium-binding protein CML11
Source.782: DFBPPR4350 ---- Plant proteins ---- Putative cyclin-F3-1
Source.783: DFBPPR4355 ---- Plant proteins ---- Putative cyclin-F1-3
Source.784: DFBPPR4356 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 4
Source.785: DFBPPR4358 ---- Plant proteins ---- Photosystem II reaction center PSB28 protein, chloroplastic
Source.786: DFBPPR4362 ---- Plant proteins ---- Putative cyclin-F1-1
Source.787: DFBPPR4363 ---- Plant proteins ---- Putative cyclin-F1-2
Source.788: DFBPPR4368 ---- Plant proteins ---- Probable aldo-keto reductase 1
Source.789: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.790: DFBPPR4377 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 120 homolog
Source.791: DFBPPR4382 ---- Plant proteins ---- Vacuolar fusion protein CCZ1 homolog
Source.792: DFBPPR4392 ---- Plant proteins ---- WUSCHEL-related homeobox 7
Source.793: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4
Source.794: DFBPPR4397 ---- Plant proteins ---- Two-component response regulator ORR31
Source.795: DFBPPR4406 ---- Plant proteins ---- WUSCHEL-related homeobox 8
Source.796: DFBPPR4409 ---- Plant proteins ---- 14-3-3-like protein GF14-D
Source.797: DFBPPR4410 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 53
Source.798: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.799: DFBPPR4416 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 4
Source.800: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.801: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.802: DFBPPR4436 ---- Plant proteins ---- Disease resistance protein PIK6-NP
Source.803: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.804: DFBPPR4443 ---- Plant proteins ---- Magnesium transporter MRS2-B
Source.805: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.806: DFBPPR4447 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL1
Source.807: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1
Source.808: DFBPPR4460 ---- Plant proteins ---- Protein argonaute 3
Source.809: DFBPPR4461 ---- Plant proteins ---- Probable calcium-binding protein CML18
Source.810: DFBPPR4463 ---- Plant proteins ---- Probable calcium-binding protein CML17
Source.811: DFBPPR4467 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 1
Source.812: DFBPPR4470 ---- Plant proteins ---- Probable mannose-1-phosphate guanylyltransferase 2
Source.813: DFBPPR4474 ---- Plant proteins ---- Probable calcium-binding protein CML16
Source.814: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.815: DFBPPR4479 ---- Plant proteins ---- Metal transporter Nramp6
Source.816: DFBPPR4481 ---- Plant proteins ---- Formin-like protein 12
Source.817: DFBPPR4482 ---- Plant proteins ---- Probable calcium-binding protein CML30
Source.818: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.819: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1
Source.820: DFBPPR4505 ---- Plant proteins ---- TPD1 protein homolog 1B
Source.821: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.822: DFBPPR4518 ---- Plant proteins ---- Probable calcium-binding protein CML14
Source.823: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.824: DFBPPR4523 ---- Plant proteins ---- Probable aldo-keto reductase 2
Source.825: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.826: DFBPPR4527 ---- Plant proteins ---- Origin of replication complex subunit 6
Source.827: DFBPPR4528 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.828: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.829: DFBPPR4539 ---- Plant proteins ---- Cyclin-dependent kinase inhibitor 3
Source.830: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.831: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27
Source.832: DFBPPR4542 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 59
Source.833: DFBPPR4547 ---- Plant proteins ---- Probable calcium-binding protein CML31
Source.834: DFBPPR4550 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 23
Source.835: DFBPPR4552 ---- Plant proteins ---- B3 domain-containing protein Os07g0563300
Source.836: DFBPPR4556 ---- Plant proteins ---- Probable V-type proton ATPase subunit H
Source.837: DFBPPR4568 ---- Plant proteins ---- CASP-like protein 1C1
Source.838: DFBPPR4577 ---- Plant proteins ---- Probable calcium-binding protein CML10
Source.839: DFBPPR4582 ---- Plant proteins ---- Probable calcium-binding protein CML12
Source.840: DFBPPR4583 ---- Plant proteins ---- Probable calcium-binding protein CML15
Source.841: DFBPPR4594 ---- Plant proteins ---- Probable calcium-binding protein CML21
Source.842: DFBPPR4596 ---- Plant proteins ---- Putative calcium-binding protein CML19
Source.843: DFBPPR4598 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 39
Source.844: DFBPPR4614 ---- Plant proteins ---- Protein EXECUTER 2, chloroplastic
Source.845: DFBPPR4617 ---- Plant proteins ---- Probable cleavage and polyadenylation specificity factor subunit 1
Source.846: DFBPPR4640 ---- Plant proteins ---- Protein Brevis radix-like 4
Source.847: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5
Source.848: DFBPPR4660 ---- Plant proteins ---- Transcription factor ILI2
Source.849: DFBPPR4681 ---- Plant proteins ---- Acidic leucine-rich nuclear phosphoprotein 32-related protein 2
Source.850: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.851: DFBPPR4689 ---- Plant proteins ---- Probable plastid-lipid-associated protein 2, chloroplastic
Source.852: DFBPPR4719 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 50
Source.853: DFBPPR4725 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 19
Source.854: DFBPPR4734 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 67
Source.855: DFBPPR4749 ---- Plant proteins ---- BURP domain-containing protein 8
Source.856: DFBPPR4750 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 9
Source.857: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400
Source.858: DFBPPR4756 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 18
Source.859: DFBPPR4760 ---- Plant proteins ---- Putative zinc finger CCCH domain-containing protein 21
Source.860: DFBPPR4763 ---- Plant proteins ---- Cyclin-P2-1
Source.861: DFBPPR4764 ---- Plant proteins ---- 14-3-3-like protein GF14-A
Source.862: DFBPPR4766 ---- Plant proteins ---- 14-3-3-like protein GF14-G
Source.863: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700
Source.864: DFBPPR4789 ---- Plant proteins ---- B3 domain-containing protein Os11g0197600
Source.865: DFBPPR4795 ---- Plant proteins ---- B3 domain-containing protein Os02g0598200
Source.866: DFBPPR4808 ---- Plant proteins ---- Putative UPF0496 protein 2
Source.867: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000
Source.868: DFBPPR4833 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 56
Source.869: DFBPPR4852 ---- Plant proteins ---- B3 domain-containing protein Os01g0905400
Source.870: DFBPPR4860 ---- Plant proteins ---- Putative B3 domain-containing protein Os03g0621600
Source.871: DFBPPR4886 ---- Plant proteins ---- DELLA protein SLR1
Source.872: DFBPPR4894 ---- Plant proteins ---- Mitogen-activated protein kinase 12
Source.873: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.874: DFBPPR4903 ---- Plant proteins ---- E3 ubiquitin-protein ligase EL5
Source.875: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.876: DFBPPR4914 ---- Plant proteins ---- Serine/threonine-protein kinase BSK1-2
Source.877: DFBPPR4924 ---- Plant proteins ---- Hexokinase-8
Source.878: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.879: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.880: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.881: DFBPPR4950 ---- Plant proteins ---- Putative protein phosphatase 2C 23
Source.882: DFBPPR4961 ---- Plant proteins ---- Dynamin-related protein 12A
Source.883: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.884: DFBPPR4969 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.885: DFBPPR4975 ---- Plant proteins ---- Beta-conglycinin beta subunit 1
Source.886: DFBPPR4976 ---- Plant proteins ---- Dynamin-related protein 5A
Source.887: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.888: DFBPPR4990 ---- Plant proteins ---- Beta-conglycinin alpha' subunit
Source.889: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase
Source.890: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.891: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.892: DFBPPR5006 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.893: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.894: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.895: DFBPPR5017 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.896: DFBPPR5018 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.897: DFBPPR5022 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.898: DFBPPR5025 ---- Plant proteins ---- Beta-conglycinin alpha subunit 1
Source.899: DFBPPR5028 ---- Plant proteins ---- Glutathione reductase, chloroplastic
Source.900: DFBPPR5035 ---- Plant proteins ---- Beta-conglycinin beta subunit 2
Source.901: DFBPPR5036 ---- Plant proteins ---- Beta-conglycinin alpha subunit 2
Source.902: DFBPPR5040 ---- Plant proteins ---- Glutamate-1-semialdehyde 2,1-aminomutase, chloroplastic
Source.903: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.904: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.905: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.906: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.907: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.908: DFBPPR5058 ---- Plant proteins ---- Magnesium-chelatase subunit ChlI, chloroplastic
Source.909: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.910: DFBPPR5064 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.911: DFBPPR5065 ---- Plant proteins ---- Tubulin beta chain
Source.912: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.913: DFBPPR5088 ---- Plant proteins ---- Tubulin beta-2 chain
Source.914: DFBPPR5089 ---- Plant proteins ---- Tubulin beta-1 chain
Source.915: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.916: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.917: DFBPPR5103 ---- Plant proteins ---- Beta-amyrin 24-hydroxylase
Source.918: DFBPPR5118 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.919: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.920: DFBPPR5133 ---- Plant proteins ---- Elongation factor 1-alpha
Source.921: DFBPPR5135 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-2
Source.922: DFBPPR5136 ---- Plant proteins ---- UDP-glycosyltransferase 79A6
Source.923: DFBPPR5165 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.924: DFBPPR5166 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.925: DFBPPR5172 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.926: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.927: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.928: DFBPPR5206 ---- Plant proteins ---- Calmodulin-2
Source.929: DFBPPR5212 ---- Plant proteins ---- Small ribosomal subunit protein S13, mitochondrial
Source.930: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.931: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3
Source.932: DFBPPR5229 ---- Plant proteins ---- Seed biotin-containing protein SBP65
Source.933: DFBPPR5236 ---- Plant proteins ---- Vacuolar-processing enzyme
Source.934: DFBPPR5242 ---- Plant proteins ---- Chalcone--flavonone isomerase 1B-1
Source.935: DFBPPR5255 ---- Plant proteins ---- Chalcone--flavonone isomerase 2-B
Source.936: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.937: DFBPPR5266 ---- Plant proteins ---- Cyanate hydratase
Source.938: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.939: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.940: DFBPPR5279 ---- Plant proteins ---- Cytochrome P450 71D8
Source.941: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.942: DFBPPR5296 ---- Plant proteins ---- 18 kDa seed maturation protein
Source.943: DFBPPR5302 ---- Plant proteins ---- 4-coumarate--CoA ligase 2
Source.944: DFBPPR5307 ---- Plant proteins ---- 4-coumarate--CoA ligase 1
Source.945: DFBPPR5321 ---- Plant proteins ---- Cytochrome P450 71D10
Source.946: DFBPPR5322 ---- Plant proteins ---- Inactive UDP-glycosyltransferase 79A6
Source.947: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.948: DFBPPR5331 ---- Plant proteins ---- CASP-like protein 1B1
Source.949: DFBPPR5353 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.950: DFBPPR5360 ---- Plant proteins ---- 14-3-3-like protein A
Source.951: DFBPPR5361 ---- Plant proteins ---- 14-3-3-like protein B
Source.952: DFBPPR5362 ---- Plant proteins ---- 14-3-3-like protein C
Source.953: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.954: DFBPPR5379 ---- Plant proteins ---- (E)-beta-farnesene synthase
Source.955: DFBPPR5386 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.956: DFBPPR5388 ---- Plant proteins ---- (S)-beta-macrocarpene synthase
Source.957: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.958: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.959: DFBPPR5398 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.960: DFBPPR5406 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.961: DFBPPR5411 ---- Plant proteins ---- Riboflavin biosynthesis protein PYRR, chloroplastic
Source.962: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.963: DFBPPR5420 ---- Plant proteins ---- Phenylalanine/tyrosine ammonia-lyase
Source.964: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.965: DFBPPR5426 ---- Plant proteins ---- Dimethylnonatriene synthase
Source.966: DFBPPR5427 ---- Plant proteins ---- Transcription factor TEOSINTE BRANCHED 1
Source.967: DFBPPR5430 ---- Plant proteins ---- Leucine-rich repeat receptor-like protein FASCIATED EAR2
Source.968: DFBPPR5445 ---- Plant proteins ---- Bifunctional aspartokinase/homoserine dehydrogenase 2, chloroplastic
Source.969: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.970: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.971: DFBPPR5455 ---- Plant proteins ---- Fructokinase-2
Source.972: DFBPPR5466 ---- Plant proteins ---- Protein LAZY 1
Source.973: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.974: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.975: DFBPPR5473 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.976: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1
Source.977: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.978: DFBPPR5480 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 2, chloroplastic/amyloplastic
Source.979: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.980: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic
Source.981: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.982: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.983: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.984: DFBPPR5511 ---- Plant proteins ---- Aquaporin PIP2-1
Source.985: DFBPPR5517 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein 10, chloroplastic
Source.986: DFBPPR5521 ---- Plant proteins ---- Single myb histone 1
Source.987: DFBPPR5533 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein CRP1, chloroplastic
Source.988: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.989: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.990: DFBPPR5566 ---- Plant proteins ---- UDP-N-acetylmuramoyl-L-alanyl-D-glutamate--2,6-diaminopimelate ligase MurE homolog, chloroplastic
Source.991: DFBPPR5572 ---- Plant proteins ---- CRM-domain containing factor CFM3, chloroplastic/mitochondrial
Source.992: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.993: DFBPPR5574 ---- Plant proteins ---- Protein WHAT'S THIS FACTOR 1, chloroplastic
Source.994: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.995: DFBPPR5581 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.996: DFBPPR5591 ---- Plant proteins ---- Transcription factor LG2
Source.997: DFBPPR5593 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.998: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.999: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.1000: DFBPPR5604 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 1
Source.1001: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.1002: DFBPPR5608 ---- Plant proteins ---- Dolabradiene synthase KSL4, chloroplastic
Source.1003: DFBPPR5614 ---- Plant proteins ---- Protein SCARECROW
Source.1004: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9
Source.1005: DFBPPR5626 ---- Plant proteins ---- Single myb histone 6
Source.1006: DFBPPR5628 ---- Plant proteins ---- 3-hydroxy-3-methylglutaryl-coenzyme A reductase
Source.1007: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.1008: DFBPPR5642 ---- Plant proteins ---- Zeamatin
Source.1009: DFBPPR5661 ---- Plant proteins ---- Albumin b-32
Source.1010: DFBPPR5662 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 1
Source.1011: DFBPPR5668 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1012: DFBPPR5684 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 2
Source.1013: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.1014: DFBPPR5687 ---- Plant proteins ---- Protein AMEIOTIC 1
Source.1015: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.1016: DFBPPR5696 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1017: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.1018: DFBPPR5701 ---- Plant proteins ---- Chorismate mutase 1, chloroplastic
Source.1019: DFBPPR5705 ---- Plant proteins ---- Tubulin beta-4 chain
Source.1020: DFBPPR5709 ---- Plant proteins ---- indolin-2-one monooxygenase
Source.1021: DFBPPR5710 ---- Plant proteins ---- DNA replication licensing factor MCM3 homolog 3
Source.1022: DFBPPR5711 ---- Plant proteins ---- Tubulin beta-5 chain
Source.1023: DFBPPR5712 ---- Plant proteins ---- Tubulin beta-7 chain
Source.1024: DFBPPR5713 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1025: DFBPPR5714 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1026: DFBPPR5719 ---- Plant proteins ---- Single myb histone 5
Source.1027: DFBPPR5720 ---- Plant proteins ---- Tubulin beta-8 chain
Source.1028: DFBPPR5721 ---- Plant proteins ---- Single myb histone 2
Source.1029: DFBPPR5724 ---- Plant proteins ---- Retinoblastoma-related protein 2
Source.1030: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.1031: DFBPPR5744 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2
Source.1032: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.1033: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1034: DFBPPR5767 ---- Plant proteins ---- Teosinte glume architecture 1
Source.1035: DFBPPR5768 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1036: DFBPPR5773 ---- Plant proteins ---- Leucoanthocyanidin dioxygenase
Source.1037: DFBPPR5776 ---- Plant proteins ---- Tubulin beta-6 chain
Source.1038: DFBPPR5778 ---- Plant proteins ---- DNA mismatch repair protein MSH2
Source.1039: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.1040: DFBPPR5787 ---- Plant proteins ---- Lipoyl synthase, mitochondrial
Source.1041: DFBPPR5792 ---- Plant proteins ---- Glutamate dehydrogenase
Source.1042: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1
Source.1043: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1044: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.1045: DFBPPR5822 ---- Plant proteins ---- Elongation factor 1-alpha
Source.1046: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.1047: DFBPPR5844 ---- Plant proteins ---- Cytochrome P450 714B3
Source.1048: DFBPPR5845 ---- Plant proteins ---- 14-3-3-like protein GF14-12
Source.1049: DFBPPR5848 ---- Plant proteins ---- Methionine S-methyltransferase
Source.1050: DFBPPR5854 ---- Plant proteins ---- Retinoblastoma-related protein 3
Source.1051: DFBPPR5855 ---- Plant proteins ---- 14-3-3-like protein GF14-6
Source.1052: DFBPPR5858 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1053: DFBPPR5866 ---- Plant proteins ---- Outer plastidial membrane protein porin
Source.1054: DFBPPR5878 ---- Plant proteins ---- Ocs element-binding factor 1
Source.1055: DFBPPR5891 ---- Plant proteins ---- Sucrose-phosphatase 1
Source.1056: DFBPPR5903 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.1057: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2
Source.1058: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4
Source.1059: DFBPPR5923 ---- Plant proteins ---- Homocysteine S-methyltransferase 4
Source.1060: DFBPPR5945 ---- Plant proteins ---- Calmodulin
Source.1061: DFBPPR5969 ---- Plant proteins ---- Aquaporin PIP2-2
Source.1062: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.1063: DFBPPR5975 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.1064: DFBPPR5976 ---- Plant proteins ---- Ubiquitin-related modifier 1 homolog
Source.1065: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2
Source.1066: DFBPPR5983 ---- Plant proteins ---- Aquaporin TIP4-1
Source.1067: DFBPPR5986 ---- Plant proteins ---- Beta-amylase
Source.1068: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.1069: DFBPPR5993 ---- Plant proteins ---- CASP-like protein 4A1
Source.1070: DFBPPR6000 ---- Plant proteins ---- Aquaporin SIP1-2
Source.1071: DFBPPR6010 ---- Plant proteins ---- Teosinte glume architecture 1
Source.1072: DFBPPR6023 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1073: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.1074: DFBPPR6043 ---- Plant proteins ---- CASP-like protein 2A1
Source.1075: DFBPPR6068 ---- Plant proteins ---- CASP-like protein 4A2
Source.1076: DFBPPR6071 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1077: DFBPPR6076 ---- Plant proteins ---- Putative Pol polyprotein from transposon element Bs1
Source.1078: DFBPPR6084 ---- Plant proteins ---- CASP-like protein 1B1
Source.1079: DFBPPR6097 ---- Plant proteins ---- CASP-like protein 2A2
Source.1080: DFBPPR6111 ---- Plant proteins ---- CASP-like protein 2D1
Source.1081: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.1082: DFBPPR6174 ---- Plant proteins ---- Oil body-associated protein 2A
Source.1083: DFBPPR6210 ---- Plant proteins ---- Cysteine synthase
Source.1084: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic
Source.1085: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic
Source.1086: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.1087: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1088: DFBPPR6222 ---- Plant proteins ---- Folate synthesis bifunctional protein, mitochondrial
Source.1089: DFBPPR6229 ---- Plant proteins ---- Malate dehydrogenase [NADP], chloroplastic
Source.1090: DFBPPR6230 ---- Plant proteins ---- L-ascorbate peroxidase, cytosolic
Source.1091: DFBPPR6234 ---- Plant proteins ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha, chloroplastic
Source.1092: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic
Source.1093: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic
Source.1094: DFBPPR6244 ---- Plant proteins ---- Carbonic anhydrase, chloroplastic
Source.1095: DFBPPR6245 ---- Plant proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.1096: DFBPPR6247 ---- Plant proteins ---- DNA topoisomerase 2
Source.1097: DFBPPR6251 ---- Plant proteins ---- Glutathione reductase, chloroplastic/mitochondrial
Source.1098: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96
Source.1099: DFBPPR6259 ---- Plant proteins ---- Chlorophyll a-b binding protein P4, chloroplastic
Source.1100: DFBPPR6260 ---- Plant proteins ---- Delta(24)-sterol reductase
Source.1101: DFBPPR6261 ---- Plant proteins ---- Protein translocase subunit SecA, chloroplastic
Source.1102: DFBPPR6264 ---- Plant proteins ---- Fructose-1,6-bisphosphatase, chloroplastic
Source.1103: DFBPPR6265 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-2 subunit
Source.1104: DFBPPR6267 ---- Plant proteins ---- Guanine nucleotide-binding protein alpha-1 subunit
Source.1105: DFBPPR6269 ---- Plant proteins ---- Protein TIC 62, chloroplastic
Source.1106: DFBPPR6283 ---- Plant proteins ---- Ketol-acid reductoisomerase, chloroplastic
Source.1107: DFBPPR6293 ---- Plant proteins ---- Glyceraldehyde-3-phosphate dehydrogenase B, chloroplastic
Source.1108: DFBPPR6306 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1109: DFBPPR6328 ---- Plant proteins ---- Magnesium-chelatase subunit ChlD, chloroplastic
Source.1110: DFBPPR6339 ---- Plant proteins ---- Phytochrome A
Source.1111: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.1112: DFBPPR6356 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1113: DFBPPR6357 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1114: DFBPPR6360 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1115: DFBPPR6363 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1116: DFBPPR6366 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.1117: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1118: DFBPPR6386 ---- Plant proteins ---- ATP synthase subunit delta', mitochondrial
Source.1119: DFBPPR6398 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1120: DFBPPR6405 ---- Plant proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.1121: DFBPPR6408 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1122: DFBPPR6411 ---- Plant proteins ---- ATP synthase gamma chain, chloroplastic
Source.1123: DFBPPR6415 ---- Plant proteins ---- Trans-cinnamate 4-monooxygenase
Source.1124: DFBPPR6424 ---- Plant proteins ---- 50S ribosomal protein L9, chloroplastic
Source.1125: DFBPPR6429 ---- Plant proteins ---- Thioredoxin M-type, chloroplastic
Source.1126: DFBPPR6435 ---- Plant proteins ---- Elongation factor 1-alpha
Source.1127: DFBPPR6462 ---- Plant proteins ---- Protein UNIFOLIATA
Source.1128: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.1129: DFBPPR6488 ---- Plant proteins ---- Protein SCARECROW
Source.1130: DFBPPR6490 ---- Plant proteins ---- Secretory carrier-associated membrane protein
Source.1131: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.1132: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1133: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1134: DFBPPR6558 ---- Plant proteins ---- Heat shock 70 kDa protein, mitochondrial
Source.1135: DFBPPR6571 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.1136: DFBPPR6611 ---- Plant proteins ---- 14-3-3-like protein
Source.1137: DFBPPR6636 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1138: DFBPPR6638 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.1139: DFBPPR6643 ---- Plant proteins ---- Gibberellin 20 oxidase 1-D
Source.1140: DFBPPR6647 ---- Plant proteins ---- 2-carboxy-D-arabinitol-1-phosphatase
Source.1141: DFBPPR6649 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit, chloroplastic/amyloplastic
Source.1142: DFBPPR6658 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1143: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1
Source.1144: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1145: DFBPPR6671 ---- Plant proteins ---- Phosphoribulokinase, chloroplastic
Source.1146: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.1147: DFBPPR6675 ---- Plant proteins ---- Adenylosuccinate synthetase, chloroplastic
Source.1148: DFBPPR6678 ---- Plant proteins ---- Gibberellin 20 oxidase 1-B
Source.1149: DFBPPR6680 ---- Plant proteins ---- Gibberellin 20 oxidase 1-A
Source.1150: DFBPPR6693 ---- Plant proteins ---- Phosphoglycerate kinase, chloroplastic
Source.1151: DFBPPR6705 ---- Plant proteins ---- Calmodulin
Source.1152: DFBPPR6743 ---- Plant proteins ---- Tubulin beta-3 chain
Source.1153: DFBPPR6744 ---- Plant proteins ---- Tubulin beta-5 chain
Source.1154: DFBPPR6746 ---- Plant proteins ---- Tubulin beta-2 chain
Source.1155: DFBPPR6747 ---- Plant proteins ---- Tubulin beta-4 chain
Source.1156: DFBPPR6748 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1157: DFBPPR6750 ---- Plant proteins ---- Phosphoglycerate kinase, cytosolic
Source.1158: DFBPPR6756 ---- Plant proteins ---- Cysteine synthase
Source.1159: DFBPPR6763 ---- Plant proteins ---- Starch synthase 1, chloroplastic/amyloplastic
Source.1160: DFBPPR6787 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.1161: DFBPPR6794 ---- Plant proteins ---- Elongation factor 1-alpha
Source.1162: DFBPPR6809 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1163: DFBPPR6816 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1164: DFBPPR6822 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1165: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.1166: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1167: DFBPPR6839 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1168: DFBPPR6861 ---- Plant proteins ---- Alpha-glucan phosphorylase, H isozyme
Source.1169: DFBPPR6867 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1170: DFBPPR6875 ---- Plant proteins ---- Eukaryotic translation initiation factor 4G
Source.1171: DFBPPR6902 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.1172: DFBPPR6905 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1173: DFBPPR6927 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-1
Source.1174: DFBPPR6944 ---- Plant proteins ---- Mitochondrial outer membrane porin
Source.1175: DFBPPR6950 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1176: DFBPPR6952 ---- Plant proteins ---- Eukaryotic translation initiation factor isoform 4G-2
Source.1177: DFBPPR6953 ---- Plant proteins ---- Small heat shock protein, chloroplastic
Source.1178: DFBPPR6982 ---- Plant proteins ---- 60S ribosomal protein L35
Source.1179: DFBPPR6987 ---- Plant proteins ---- Ninja-family protein 1
Source.1180: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme
Source.1181: DFBPPR7013 ---- Plant proteins ---- Protein MLO
Source.1182: DFBPPR7018 ---- Plant proteins ---- Glucose-1-phosphate adenylyltransferase large subunit 1, chloroplastic/amyloplastic
Source.1183: DFBPPR7024 ---- Plant proteins ---- Peroxidase 1
Source.1184: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1185: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1186: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.1187: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic
Source.1188: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.1189: DFBPPR7044 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor CMd
Source.1190: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.1191: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1192: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1193: DFBPPR7080 ---- Plant proteins ---- Ent-kaurenoic acid oxidase 1
Source.1194: DFBPPR7091 ---- Plant proteins ---- Glutamyl-tRNA reductase 3, chloroplastic
Source.1195: DFBPPR7111 ---- Plant proteins ---- Methionine S-methyltransferase
Source.1196: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1197: DFBPPR7122 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.1198: DFBPPR7126 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 1
Source.1199: DFBPPR7127 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 2
Source.1200: DFBPPR7131 ---- Plant proteins ---- Signal recognition particle 54 kDa protein 3
Source.1201: DFBPPR7140 ---- Plant proteins ---- Glutamate--tRNA ligase, chloroplastic/mitochondrial
Source.1202: DFBPPR7148 ---- Plant proteins ---- Tubulin beta chain
Source.1203: DFBPPR7180 ---- Plant proteins ---- Chalcone--flavonone isomerase
Source.1204: DFBPPR7183 ---- Plant proteins ---- ATP synthase subunit alpha, chloroplastic
Source.1205: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1206: DFBPPR7197 ---- Plant proteins ---- Nicotianamine synthase 1
Source.1207: DFBPPR7205 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta''
Source.1208: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1209: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.1210: DFBPPR7228 ---- Plant proteins ---- Calmodulin
Source.1211: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1
Source.1212: DFBPPR7258 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV90, chloroplastic
Source.1213: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic
Source.1214: DFBPPR7260 ---- Plant proteins ---- Low molecular mass early light-inducible protein HV60, chloroplastic
Source.1215: DFBPPR7266 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.1216: DFBPPR7285 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1217: DFBPPR7300 ---- Plant proteins ---- 40S ribosomal protein S27
Source.1218: DFBPPR7316 ---- Plant proteins ---- Photosystem I assembly protein Ycf4
Source.1219: DFBPPR7320 ---- Plant proteins ---- Nicotianamine synthase-like 5 protein
Source.1220: DFBPPR7333 ---- Plant proteins ---- C-hordein
Source.1221: DFBPPR7334 ---- Plant proteins ---- C-hordein
Source.1222: DFBPPR7343 ---- Plant proteins ---- 14-3-3-like protein A
Source.1223: DFBPPR7347 ---- Plant proteins ---- 14-3-3-like protein B
Source.1224: DFBPPR7397 ---- Plant proteins ---- Thiamine biosynthetic bifunctional enzyme BTH1, chloroplastic
Source.1225: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.1226: DFBPPR7414 ---- Plant proteins ---- Glyoxysomal fatty acid beta-oxidation multifunctional protein MFP-a
Source.1227: DFBPPR7426 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.1228: DFBPPR7429 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.1229: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.1230: DFBPPR7432 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1405
Source.1231: DFBPPR7435 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.1232: DFBPPR7436 ---- Plant proteins ---- Acyl carrier protein, chloroplastic
Source.1233: DFBPPR7454 ---- Plant proteins ---- Peptide methionine sulfoxide reductase
Source.1234: DFBPPR7459 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit beta, chloroplastic
Source.1235: DFBPPR7460 ---- Plant proteins ---- RuBisCO large subunit-binding protein subunit alpha, chloroplastic
Source.1236: DFBPPR7461 ---- Plant proteins ---- Shaggy-related protein kinase theta
Source.1237: DFBPPR7470 ---- Plant proteins ---- ATP synthase subunit alpha, mitochondrial
Source.1238: DFBPPR7510 ---- Plant proteins ---- Protein EFFECTOR OF TRANSCRIPTION
Source.1239: DFBPPR7512 ---- Plant proteins ---- Malate synthase, glyoxysomal
Source.1240: DFBPPR7518 ---- Plant proteins ---- Agamous-like MADS-box protein AGL15
Source.1241: DFBPPR7528 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.1242: DFBPPR7530 ---- Plant proteins ---- Glycine-rich RNA-binding protein 10
Source.1243: DFBPPR7541 ---- Plant proteins ---- Polcalcin Bra n 1
Source.1244: DFBPPR7612 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.1245: DFBPPR7614 ---- Milk proteins ---- Tenascin
Source.1246: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.1247: DFBPPR7628 ---- Milk proteins ---- Complement C4-A
Source.1248: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.1249: DFBPPR7643 ---- Milk proteins ---- MICAL-like protein 1
Source.1250: DFBPPR7649 ---- Milk proteins ---- Cadherin-1
Source.1251: DFBPPR7650 ---- Milk proteins ---- Broad substrate specificity ATP-binding cassette transporter ABCG2
Source.1252: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.1253: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.1254: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.1255: DFBPPR7705 ---- Milk proteins ---- Late lactation protein A, LLP-A
Source.1256: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.1257: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.1258: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.1259: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.1260: DFBPPR7730 ---- Plant proteins ---- Tubulin beta-1 chain
Source.1261: DFBPPR8195 ---- Plant proteins ---- Isocitrate lyase
Source.1262: DFBPPR8197 ---- Plant proteins ---- Aconitate hydratase, cytoplasmic
Source.1263: DFBPPR8371 ---- Plant proteins ---- NADP-dependent glyceraldehyde-3-phosphate dehydrogenase
Source.1264: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1265: DFBPPR8428 ---- Plant proteins ---- 11S globulin seed storage protein 2
Source.1266: DFBPPR8433 ---- Plant proteins ---- Inositol-3-phosphate synthase
Source.1267: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.1268: DFBPPR8437 ---- Plant proteins ---- Linoleate 9S-lipoxygenase
Source.1269: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.1270: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic
Source.1271: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.1272: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.1273: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.1274: DFBPPR8516 ---- Milk proteins ---- Butyrophilin subfamily 1 member A1
Source.1275: DFBPPR15936 ---- Animal proteins ---- Apolipoprotein E
Source.1276: DFBPPR15948 ---- Animal proteins ---- Homeobox protein MSX-2
Source.1277: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.1278: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.1279: DFBPPR15953 ---- Animal proteins ---- Occludin
Source.1280: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.1281: DFBPPR15957 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.1282: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.1283: DFBPPR15960 ---- Animal proteins ---- Apolipoprotein A-IV
Source.1284: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.1285: DFBPPR15963 ---- Animal proteins ---- Cadherin-1
Source.1286: DFBPPR15972 ---- Animal proteins ---- Catenin beta-1
Source.1287: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.1288: DFBPPR15987 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.1289: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9
Source.1290: DFBPPR15996 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1291: DFBPPR16008 ---- Animal proteins ---- Mitogen-activated protein kinase 14
Source.1292: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.1293: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1294: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.1295: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1296: DFBPPR16039 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.1297: DFBPPR16050 ---- Animal proteins ---- Dual oxidase 1
Source.1298: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1299: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.1300: DFBPPR16073 ---- Animal proteins ---- Endothelin-1
Source.1301: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.1302: DFBPPR16093 ---- Animal proteins ---- Menin
Source.1303: DFBPPR16095 ---- Animal proteins ---- Myosin-7
Source.1304: DFBPPR16102 ---- Animal proteins ---- 40S ribosomal protein S3
Source.1305: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.1306: DFBPPR16105 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1307: DFBPPR16117 ---- Animal proteins ---- Tripeptidyl-peptidase 1
Source.1308: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1309: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.1310: DFBPPR16146 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.1311: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.1312: DFBPPR16166 ---- Animal proteins ---- Ras-related protein Rab-12
Source.1313: DFBPPR16171 ---- Animal proteins ---- Nuclear receptor subfamily 4 group A member 1
Source.1314: DFBPPR16187 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1315: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1316: DFBPPR16199 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.1317: DFBPPR16205 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.1318: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1319: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1320: DFBPPR16214 ---- Animal proteins ---- Insulin-like growth factor I
Source.1321: DFBPPR16216 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.1322: DFBPPR16217 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.1323: DFBPPR16219 ---- Animal proteins ---- Sodium channel protein type 10 subunit alpha
Source.1324: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.1325: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.1326: DFBPPR16233 ---- Animal proteins ---- Signal recognition particle subunit SRP72
Source.1327: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2
Source.1328: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.1329: DFBPPR16243 ---- Animal proteins ---- Retinoic acid receptor RXR-beta
Source.1330: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type
Source.1331: DFBPPR16264 ---- Animal proteins ---- Pancreatic prohormone
Source.1332: DFBPPR16265 ---- Animal proteins ---- Caspase-1
Source.1333: DFBPPR16270 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.1334: DFBPPR16280 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1335: DFBPPR16282 ---- Animal proteins ---- COMM domain-containing protein 1
Source.1336: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1337: DFBPPR16291 ---- Animal proteins ---- DLA class I histocompatibility antigen, A9/A9 alpha chain
Source.1338: DFBPPR16302 ---- Animal proteins ---- Myosin-2
Source.1339: DFBPPR16307 ---- Animal proteins ---- DNA-binding protein inhibitor ID-3
Source.1340: DFBPPR16321 ---- Animal proteins ---- Aggrecan core protein
Source.1341: DFBPPR16380 ---- Animal proteins ---- Myosin-8
Source.1342: DFBPPR16418 ---- Animal proteins ---- Myosin-1
Source.1343: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1344: DFBPPR16437 ---- Animal proteins ---- Myosin-4
Source.1345: DFBPPR16438 ---- Animal proteins ---- Myosin-13
Source.1346: DFBPPR16445 ---- Animal proteins ---- Pancreatic secretory granule membrane major glycoprotein GP2
Source.1347: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.1348: DFBPPR16461 ---- Animal proteins ---- InaD-like protein
Source.1349: DFBPPR16466 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1350: DFBPPR16476 ---- Animal proteins ---- Thrombomodulin
Source.1351: DFBPPR16479 ---- Animal proteins ---- Carboxypeptidase B
Source.1352: DFBPPR16495 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 52 homolog
Source.1353: DFBPPR16516 ---- Animal proteins ---- Cytospin-A
Source.1354: DFBPPR16534 ---- Animal proteins ---- Myoglobin
Source.1355: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31
Source.1356: DFBPPR16563 ---- Animal proteins ---- Myosin-16
Source.1357: DFBPPR16567 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.1358: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.1359: DFBPPR16593 ---- Animal proteins ---- Calcyphosin
Source.1360: DFBPPR16622 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.1361: DFBPPR16626 ---- Animal proteins ---- RING finger protein unkempt homolog
Source.1362: DFBPPR16629 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.1363: DFBPPR16636 ---- Animal proteins ---- Prefoldin subunit 6
Source.1364: DFBPPR16646 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.1365: DFBPPR16647 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.1366: DFBPPR16651 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.1367: DFBPPR16652 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.1368: DFBPPR16655 ---- Animal proteins ---- Somatostatin
Source.1369: DFBPPR16659 ---- Animal proteins ---- Band 4.1-like protein 5
Source.1370: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.1371: DFBPPR16685 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.1372: DFBPPR16693 ---- Animal proteins ---- Cingulin
Source.1373: DFBPPR16698 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-3
Source.1374: DFBPPR16699 ---- Animal proteins ---- Heat shock 70 kDa protein 4
Source.1375: DFBPPR16714 ---- Animal proteins ---- Protein fosB
Source.1376: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2
Source.1377: DFBPPR16730 ---- Animal proteins ---- RING finger protein 141
Source.1378: DFBPPR16736 ---- Animal proteins ---- WD repeat-containing protein 46
Source.1379: DFBPPR16776 ---- Animal proteins ---- Nucleoside diphosphate kinase
Source.1380: DFBPPR16798 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.1381: DFBPPR16802 ---- Animal proteins ---- Chromogranin-A
Source.1382: DFBPPR16803 ---- Animal proteins ---- Pro-opiomelanocortin
Source.1383: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1384: DFBPPR16820 ---- Animal proteins ---- Secretogranin-1
Source.1385: DFBPPR16834 ---- Animal proteins ---- Seminal plasma protein PDC-109
Source.1386: DFBPPR16836 ---- Animal proteins ---- Fibronectin
Source.1387: DFBPPR16843 ---- Animal proteins ---- Calmodulin
Source.1388: DFBPPR16855 ---- Animal proteins ---- E3 UFM1-protein ligase 1
Source.1389: DFBPPR16859 ---- Animal proteins ---- Ubiquitin-like protein ISG15
Source.1390: DFBPPR16862 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3
Source.1391: DFBPPR16868 ---- Animal proteins ---- Insulin-like growth factor I
Source.1392: DFBPPR16882 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.1393: DFBPPR16891 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.1394: DFBPPR16904 ---- Animal proteins ---- Hormone-sensitive lipase
Source.1395: DFBPPR16911 ---- Animal proteins ---- Dihydroorotate dehydrogenase (quinone), mitochondrial
Source.1396: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.1397: DFBPPR16938 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.1398: DFBPPR16949 ---- Animal proteins ---- Cellular tumor antigen p53
Source.1399: DFBPPR16964 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 4
Source.1400: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.1401: DFBPPR16987 ---- Animal proteins ---- Aggrecan core protein
Source.1402: DFBPPR16990 ---- Animal proteins ---- Carbonic anhydrase 2
Source.1403: DFBPPR17000 ---- Animal proteins ---- Vimentin
Source.1404: DFBPPR17010 ---- Animal proteins ---- Sestrin-2
Source.1405: DFBPPR17012 ---- Animal proteins ---- Synaptotagmin-1
Source.1406: DFBPPR17016 ---- Animal proteins ---- cGMP-specific 3',5'-cyclic phosphodiesterase
Source.1407: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.1408: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.1409: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1410: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.1411: DFBPPR17042 ---- Animal proteins ---- Guanine nucleotide-binding protein G(i) subunit alpha-1
Source.1412: DFBPPR17049 ---- Animal proteins ---- cGMP-dependent 3',5'-cyclic phosphodiesterase
Source.1413: DFBPPR17053 ---- Animal proteins ---- Junction plakoglobin
Source.1414: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5
Source.1415: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.1416: DFBPPR17075 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM21
Source.1417: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.1418: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.1419: DFBPPR17090 ---- Animal proteins ---- Phakinin
Source.1420: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.1421: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.1422: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1423: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1424: DFBPPR17141 ---- Animal proteins ---- Integrin beta-2
Source.1425: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.1426: DFBPPR17179 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 1
Source.1427: DFBPPR17180 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.1428: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.1429: DFBPPR17189 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.1430: DFBPPR17197 ---- Animal proteins ---- Peroxiredoxin-5, mitochondrial
Source.1431: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.1432: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.1433: DFBPPR17259 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 35
Source.1434: DFBPPR17264 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.1435: DFBPPR17272 ---- Animal proteins ---- Dysbindin
Source.1436: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.1437: DFBPPR17284 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.1438: DFBPPR17286 ---- Animal proteins ---- Septin-2
Source.1439: DFBPPR17287 ---- Animal proteins ---- Structural maintenance of chromosomes protein 1A
Source.1440: DFBPPR17290 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase D
Source.1441: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.1442: DFBPPR17303 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit alpha
Source.1443: DFBPPR17308 ---- Animal proteins ---- Homeobox protein MSX-2
Source.1444: DFBPPR17314 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit beta
Source.1445: DFBPPR17315 ---- Animal proteins ---- Neurexin-1-beta
Source.1446: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.1447: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.1448: DFBPPR17331 ---- Animal proteins ---- Pyridoxal phosphate phosphatase
Source.1449: DFBPPR17334 ---- Animal proteins ---- Prohibitin
Source.1450: DFBPPR17337 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.1451: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.1452: DFBPPR17341 ---- Animal proteins ---- Radixin
Source.1453: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B
Source.1454: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.1455: DFBPPR17346 ---- Animal proteins ---- RING finger protein 112
Source.1456: DFBPPR17350 ---- Animal proteins ---- DNA mismatch repair protein Msh2
Source.1457: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.1458: DFBPPR17364 ---- Animal proteins ---- Pro-cathepsin H
Source.1459: DFBPPR17370 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.1460: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.1461: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.1462: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.1463: DFBPPR17380 ---- Animal proteins ---- Dipeptidase 1
Source.1464: DFBPPR17390 ---- Animal proteins ---- Dual specificity protein phosphatase 10
Source.1465: DFBPPR17401 ---- Animal proteins ---- Moesin
Source.1466: DFBPPR17403 ---- Animal proteins ---- Insulin-degrading enzyme
Source.1467: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.1468: DFBPPR17412 ---- Animal proteins ---- Fragile X mental retardation syndrome-related protein 1
Source.1469: DFBPPR17419 ---- Animal proteins ---- Inositol 1,4,5-triphosphate receptor associated 1
Source.1470: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial
Source.1471: DFBPPR17426 ---- Animal proteins ---- DNA polymerase delta catalytic subunit
Source.1472: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.1473: DFBPPR17434 ---- Animal proteins ---- Cyclin-dependent-like kinase 5
Source.1474: DFBPPR17439 ---- Animal proteins ---- Folliculin
Source.1475: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.1476: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.1477: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.1478: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.1479: DFBPPR17461 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.1480: DFBPPR17462 ---- Animal proteins ---- DNA replication ATP-dependent helicase/nuclease DNA2
Source.1481: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.1482: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.1483: DFBPPR17507 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.1484: DFBPPR17511 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.1485: DFBPPR17522 ---- Animal proteins ---- Homer protein homolog 1
Source.1486: DFBPPR17536 ---- Animal proteins ---- Protein arginine N-methyltransferase 6
Source.1487: DFBPPR17538 ---- Animal proteins ---- Septin-7
Source.1488: DFBPPR17540 ---- Animal proteins ---- Breast cancer type 1 susceptibility protein homolog
Source.1489: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.1490: DFBPPR17553 ---- Animal proteins ---- Microtubule-associated protein RP/EB family member 1
Source.1491: DFBPPR17567 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL1
Source.1492: DFBPPR17597 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.1493: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1494: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.1495: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.1496: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.1497: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.1498: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.1499: DFBPPR17659 ---- Animal proteins ---- Calcium/calmodulin-dependent 3',5'-cyclic nucleotide phosphodiesterase 1B
Source.1500: DFBPPR17660 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.1501: DFBPPR17661 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.1502: DFBPPR17670 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.1503: DFBPPR17671 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.1504: DFBPPR17683 ---- Animal proteins ---- Cyanocobalamin reductase / alkylcobalamin dealkylase
Source.1505: DFBPPR17693 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 2, mitochondrial
Source.1506: DFBPPR17694 ---- Animal proteins ---- Pyridoxal kinase
Source.1507: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B
Source.1508: DFBPPR17733 ---- Animal proteins ---- Protein phosphatase 1B
Source.1509: DFBPPR17741 ---- Animal proteins ---- Polyadenylate-binding protein 1
Source.1510: DFBPPR17745 ---- Animal proteins ---- N-lysine methyltransferase KMT5A
Source.1511: DFBPPR17751 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.1512: DFBPPR17753 ---- Animal proteins ---- Apoptosis-associated speck-like protein containing a CARD
Source.1513: DFBPPR17764 ---- Animal proteins ---- L-selectin
Source.1514: DFBPPR17767 ---- Animal proteins ---- Bifunctional peptidase and arginyl-hydroxylase JMJD5
Source.1515: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.1516: DFBPPR17781 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 C
Source.1517: DFBPPR17783 ---- Animal proteins ---- 40S ribosomal protein S3
Source.1518: DFBPPR17787 ---- Animal proteins ---- Septin-6
Source.1519: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.1520: DFBPPR17791 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.1521: DFBPPR17802 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.1522: DFBPPR17829 ---- Animal proteins ---- Thrombospondin-1
Source.1523: DFBPPR17830 ---- Animal proteins ---- Vasopressin V2 receptor
Source.1524: DFBPPR17831 ---- Animal proteins ---- Histone-lysine N-methyltransferase KMT5B
Source.1525: DFBPPR17852 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.1526: DFBPPR17853 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL3
Source.1527: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.1528: DFBPPR17866 ---- Animal proteins ---- PIH1 domain-containing protein 1
Source.1529: DFBPPR17869 ---- Animal proteins ---- Inositol hexakisphosphate and diphosphoinositol-pentakisphosphate kinase 1
Source.1530: DFBPPR17870 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 4
Source.1531: DFBPPR17873 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.1532: DFBPPR17879 ---- Animal proteins ---- Menin
Source.1533: DFBPPR17880 ---- Animal proteins ---- Apolipoprotein A-IV
Source.1534: DFBPPR17890 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.1535: DFBPPR17892 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily A-like protein 1
Source.1536: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.1537: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.1538: DFBPPR17901 ---- Animal proteins ---- Tubulin beta-3 chain
Source.1539: DFBPPR17904 ---- Animal proteins ---- Tubulin beta-4A chain
Source.1540: DFBPPR17915 ---- Animal proteins ---- Kinesin-like protein KIF20A
Source.1541: DFBPPR17923 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.1542: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.1543: DFBPPR17930 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.1544: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.1545: DFBPPR17939 ---- Animal proteins ---- Delta(14)-sterol reductase TM7SF2
Source.1546: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.1547: DFBPPR17949 ---- Animal proteins ---- Insulinoma-associated protein 1
Source.1548: DFBPPR17955 ---- Animal proteins ---- m7GpppX diphosphatase
Source.1549: DFBPPR17956 ---- Animal proteins ---- PRKCA-binding protein
Source.1550: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.1551: DFBPPR17966 ---- Animal proteins ---- Clathrin light chain A
Source.1552: DFBPPR17973 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 7
Source.1553: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.1554: DFBPPR17988 ---- Animal proteins ---- Poly(A)-specific ribonuclease PARN
Source.1555: DFBPPR17993 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.1556: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.1557: DFBPPR18005 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.1558: DFBPPR18007 ---- Animal proteins ---- Complement C4
Source.1559: DFBPPR18014 ---- Animal proteins ---- Glycolipid transfer protein
Source.1560: DFBPPR18018 ---- Animal proteins ---- ADP-ribose glycohydrolase MACROD1
Source.1561: DFBPPR18041 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 S
Source.1562: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6
Source.1563: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5
Source.1564: DFBPPR18052 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.1565: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1566: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.1567: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.1568: DFBPPR18065 ---- Animal proteins ---- Isopentenyl-diphosphate Delta-isomerase 1
Source.1569: DFBPPR18069 ---- Animal proteins ---- Glypican-1
Source.1570: DFBPPR18076 ---- Animal proteins ---- 26S proteasome regulatory subunit 8
Source.1571: DFBPPR18078 ---- Animal proteins ---- 14-3-3 protein eta
Source.1572: DFBPPR18080 ---- Animal proteins ---- Keratin, type II cytoskeletal 8
Source.1573: DFBPPR18101 ---- Animal proteins ---- DNA annealing helicase and endonuclease ZRANB3
Source.1574: DFBPPR18110 ---- Animal proteins ---- Protein inturned
Source.1575: DFBPPR18111 ---- Animal proteins ---- Transcriptional adapter 3
Source.1576: DFBPPR18114 ---- Animal proteins ---- Charged multivesicular body protein 4a
Source.1577: DFBPPR18129 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 15
Source.1578: DFBPPR18133 ---- Animal proteins ---- Rhodopsin kinase GRK7
Source.1579: DFBPPR18150 ---- Animal proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase 1
Source.1580: DFBPPR18174 ---- Animal proteins ---- Interferon-inducible double-stranded RNA-dependent protein kinase activator A
Source.1581: DFBPPR18180 ---- Animal proteins ---- [F-actin]-monooxygenase MICAL2
Source.1582: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.1583: DFBPPR18220 ---- Animal proteins ---- Platelet-activating factor receptor
Source.1584: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.1585: DFBPPR18236 ---- Animal proteins ---- Latent-transforming growth factor beta-binding protein 2
Source.1586: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1
Source.1587: DFBPPR18242 ---- Animal proteins ---- Heparanase
Source.1588: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.1589: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase
Source.1590: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.1591: DFBPPR18265 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.1592: DFBPPR18267 ---- Animal proteins ---- Actin-related protein 2
Source.1593: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.1594: DFBPPR18287 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM56
Source.1595: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.1596: DFBPPR18290 ---- Animal proteins ---- Cyclin-dependent kinase 10
Source.1597: DFBPPR18293 ---- Animal proteins ---- Chymotrypsin-C
Source.1598: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.1599: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.1600: DFBPPR18325 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.1601: DFBPPR18329 ---- Animal proteins ---- Coatomer subunit epsilon
Source.1602: DFBPPR18330 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.1603: DFBPPR18331 ---- Animal proteins ---- Calcium uptake protein 1, mitochondrial
Source.1604: DFBPPR18335 ---- Animal proteins ---- Septin-11
Source.1605: DFBPPR18337 ---- Animal proteins ---- Growth arrest and DNA damage-inducible protein GADD45 alpha
Source.1606: DFBPPR18346 ---- Animal proteins ---- DNA-binding protein inhibitor ID-3
Source.1607: DFBPPR18360 ---- Animal proteins ---- Desmocollin-3
Source.1608: DFBPPR18368 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIP12
Source.1609: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.1610: DFBPPR18378 ---- Animal proteins ---- Plasminogen activator inhibitor 1
Source.1611: DFBPPR18382 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.1612: DFBPPR18383 ---- Animal proteins ---- Transcription factor E3
Source.1613: DFBPPR18389 ---- Animal proteins ---- Short transient receptor potential channel 6
Source.1614: DFBPPR18392 ---- Animal proteins ---- Centrosomal protein of 290 kDa
Source.1615: DFBPPR18393 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.1616: DFBPPR18408 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.1617: DFBPPR18412 ---- Animal proteins ---- Three-prime repair exonuclease 1
Source.1618: DFBPPR18422 ---- Animal proteins ---- Endonuclease III-like protein 1
Source.1619: DFBPPR18423 ---- Animal proteins ---- Bile acid receptor
Source.1620: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.1621: DFBPPR18426 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.1622: DFBPPR18429 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.1623: DFBPPR18431 ---- Animal proteins ---- Alpha-1-syntrophin
Source.1624: DFBPPR18435 ---- Animal proteins ---- Paraspeckle component 1
Source.1625: DFBPPR18442 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.1626: DFBPPR18445 ---- Animal proteins ---- Serine/threonine-protein kinase PRP4 homolog
Source.1627: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22
Source.1628: DFBPPR18453 ---- Animal proteins ---- Potassium voltage-gated channel subfamily KQT member 3
Source.1629: DFBPPR18456 ---- Animal proteins ---- Beta-crystallin B1
Source.1630: DFBPPR18459 ---- Animal proteins ---- Transcription factor AP-1
Source.1631: DFBPPR18466 ---- Animal proteins ---- Retinoic acid receptor responder protein 2
Source.1632: DFBPPR18470 ---- Animal proteins ---- Perilipin-5
Source.1633: DFBPPR18475 ---- Animal proteins ---- Myosin-2
Source.1634: DFBPPR18486 ---- Animal proteins ---- NSFL1 cofactor p47
Source.1635: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein
Source.1636: DFBPPR18497 ---- Animal proteins ---- Synaptobrevin homolog YKT6
Source.1637: DFBPPR18507 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.1638: DFBPPR18529 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.1639: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.1640: DFBPPR18534 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.1641: DFBPPR18539 ---- Animal proteins ---- Dermatan-sulfate epimerase
Source.1642: DFBPPR18541 ---- Animal proteins ---- Chromatin modification-related protein MEAF6
Source.1643: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.1644: DFBPPR18578 ---- Animal proteins ---- 5-demethoxyubiquinone hydroxylase, mitochondrial
Source.1645: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.1646: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.1647: DFBPPR18584 ---- Animal proteins ---- Transcription factor IIIB 50 kDa subunit
Source.1648: DFBPPR18585 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2
Source.1649: DFBPPR18596 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.1650: DFBPPR18605 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.1651: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1
Source.1652: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.1653: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta
Source.1654: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.1655: DFBPPR18641 ---- Animal proteins ---- Cadherin-5
Source.1656: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type
Source.1657: DFBPPR18649 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.1658: DFBPPR18698 ---- Animal proteins ---- ATPase GET3
Source.1659: DFBPPR18702 ---- Animal proteins ---- E3 ubiquitin-protein ligase E3D
Source.1660: DFBPPR18720 ---- Animal proteins ---- Protein quaking
Source.1661: DFBPPR18729 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.1662: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.1663: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.1664: DFBPPR18745 ---- Animal proteins ---- Cocaine- and amphetamine-regulated transcript protein
Source.1665: DFBPPR18754 ---- Animal proteins ---- Collectin-11
Source.1666: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.1667: DFBPPR18761 ---- Animal proteins ---- Cytosolic non-specific dipeptidase
Source.1668: DFBPPR18766 ---- Animal proteins ---- Negative elongation factor E
Source.1669: DFBPPR18768 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.1670: DFBPPR18772 ---- Animal proteins ---- Myosin-7
Source.1671: DFBPPR18789 ---- Animal proteins ---- Cyclic nucleotide-gated cation channel alpha-3
Source.1672: DFBPPR18799 ---- Animal proteins ---- Myosin-1
Source.1673: DFBPPR18809 ---- Animal proteins ---- Adenylate kinase isoenzyme 5
Source.1674: DFBPPR18811 ---- Animal proteins ---- Tubulin beta-4B chain
Source.1675: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.1676: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.1677: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6
Source.1678: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.1679: DFBPPR18840 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F
Source.1680: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.1681: DFBPPR18845 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.1682: DFBPPR18848 ---- Animal proteins ---- Ras-related protein Rab-15
Source.1683: DFBPPR18854 ---- Animal proteins ---- Ketimine reductase mu-crystallin
Source.1684: DFBPPR18872 ---- Animal proteins ---- Dipeptidyl aminopeptidase-like protein 6
Source.1685: DFBPPR18875 ---- Animal proteins ---- S-adenosylmethionine synthase isoform type-1
Source.1686: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.1687: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.1688: DFBPPR18912 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.1689: DFBPPR18921 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM11
Source.1690: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.1691: DFBPPR18924 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.1692: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.1693: DFBPPR18933 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.1694: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.1695: DFBPPR18946 ---- Animal proteins ---- Paternally-expressed gene 3 protein
Source.1696: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.1697: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2
Source.1698: DFBPPR18956 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 1
Source.1699: DFBPPR18960 ---- Animal proteins ---- Spondin-1
Source.1700: DFBPPR18966 ---- Animal proteins ---- Lupus La protein homolog
Source.1701: DFBPPR18967 ---- Animal proteins ---- Krev interaction trapped protein 1
Source.1702: DFBPPR18979 ---- Animal proteins ---- Alpha-2-macroglobulin
Source.1703: DFBPPR18990 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit epsilon isoform
Source.1704: DFBPPR18992 ---- Animal proteins ---- Coatomer subunit beta
Source.1705: DFBPPR18993 ---- Animal proteins ---- Dynein regulatory complex protein 1
Source.1706: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.1707: DFBPPR19017 ---- Animal proteins ---- Fez family zinc finger protein 2
Source.1708: DFBPPR19028 ---- Animal proteins ---- DNA repair protein XRCC3
Source.1709: DFBPPR19030 ---- Animal proteins ---- Protein FAM83D
Source.1710: DFBPPR19040 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 11
Source.1711: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic
Source.1712: DFBPPR19044 ---- Animal proteins ---- Adenylosuccinate lyase
Source.1713: DFBPPR19050 ---- Animal proteins ---- Tripartite motif-containing protein 2
Source.1714: DFBPPR19053 ---- Animal proteins ---- Transmembrane protein 100
Source.1715: DFBPPR19054 ---- Animal proteins ---- Histidine--tRNA ligase, cytoplasmic
Source.1716: DFBPPR19057 ---- Animal proteins ---- Tubulin-specific chaperone E
Source.1717: DFBPPR19069 ---- Animal proteins ---- Small glutamine-rich tetratricopeptide repeat-containing protein alpha
Source.1718: DFBPPR19076 ---- Animal proteins ---- Protein MGARP
Source.1719: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1
Source.1720: DFBPPR19083 ---- Animal proteins ---- UBX domain-containing protein 1
Source.1721: DFBPPR19085 ---- Animal proteins ---- AP-4 complex subunit mu-1
Source.1722: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.1723: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.1724: DFBPPR19105 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein
Source.1725: DFBPPR19107 ---- Animal proteins ---- Lymphocyte transmembrane adapter 1
Source.1726: DFBPPR19111 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.1727: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3
Source.1728: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8
Source.1729: DFBPPR19147 ---- Animal proteins ---- X-linked retinitis pigmentosa GTPase regulator-interacting protein 1
Source.1730: DFBPPR19149 ---- Animal proteins ---- DNA excision repair protein ERCC-6-like
Source.1731: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2
Source.1732: DFBPPR19169 ---- Animal proteins ---- 17-beta-hydroxysteroid dehydrogenase 14
Source.1733: DFBPPR19171 ---- Animal proteins ---- PCI domain-containing protein 2
Source.1734: DFBPPR19173 ---- Animal proteins ---- Carbonic anhydrase 1
Source.1735: DFBPPR19179 ---- Animal proteins ---- Pancreatic prohormone
Source.1736: DFBPPR19180 ---- Animal proteins ---- Reticulocalbin-3
Source.1737: DFBPPR19187 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.1738: DFBPPR19189 ---- Animal proteins ---- Dynein regulatory complex subunit 4
Source.1739: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.1740: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5
Source.1741: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial
Source.1742: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.1743: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.1744: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.1745: DFBPPR19237 ---- Animal proteins ---- Cadherin-18
Source.1746: DFBPPR19239 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 42
Source.1747: DFBPPR19240 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.1748: DFBPPR19244 ---- Animal proteins ---- Cell division cycle protein 23 homolog
Source.1749: DFBPPR19246 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.1750: DFBPPR19253 ---- Animal proteins ---- Limbin
Source.1751: DFBPPR19254 ---- Animal proteins ---- Periaxin
Source.1752: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.1753: DFBPPR19279 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase, mitochondrial
Source.1754: DFBPPR19281 ---- Animal proteins ---- Sorting nexin-1
Source.1755: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.1756: DFBPPR19292 ---- Animal proteins ---- Threonine--tRNA ligase 2, cytoplasmic
Source.1757: DFBPPR19321 ---- Animal proteins ---- Tubulin beta-2B chain
Source.1758: DFBPPR19333 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.1759: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.1760: DFBPPR19336 ---- Animal proteins ---- Arf-GAP domain and FG repeat-containing protein 1
Source.1761: DFBPPR19338 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.1762: DFBPPR19341 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.1763: DFBPPR19352 ---- Animal proteins ---- DNA-directed RNA polymerase II subunit GRINL1A
Source.1764: DFBPPR19355 ---- Animal proteins ---- CTP synthase 2
Source.1765: DFBPPR19361 ---- Animal proteins ---- Retinol dehydrogenase 14
Source.1766: DFBPPR19369 ---- Animal proteins ---- Intraflagellar transport protein 57 homolog
Source.1767: DFBPPR19371 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase-like 1
Source.1768: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor
Source.1769: DFBPPR19381 ---- Animal proteins ---- BRCA2 and CDKN1A-interacting protein
Source.1770: DFBPPR19396 ---- Animal proteins ---- SAM and SH3 domain-containing protein 3
Source.1771: DFBPPR19397 ---- Animal proteins ---- Gap junction delta-2 protein
Source.1772: DFBPPR19412 ---- Animal proteins ---- N-terminal kinase-like protein
Source.1773: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.1774: DFBPPR19429 ---- Animal proteins ---- Protein Spindly
Source.1775: DFBPPR19433 ---- Animal proteins ---- Switch-associated protein 70
Source.1776: DFBPPR19436 ---- Animal proteins ---- Myeloid-derived growth factor
Source.1777: DFBPPR19437 ---- Animal proteins ---- Transmembrane protein 59
Source.1778: DFBPPR19440 ---- Animal proteins ---- Phosphoglycerate mutase 2
Source.1779: DFBPPR19446 ---- Animal proteins ---- Glutaredoxin-3
Source.1780: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.1781: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.1782: DFBPPR19457 ---- Animal proteins ---- Protein NDRG2
Source.1783: DFBPPR19463 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide VF
Source.1784: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.1785: DFBPPR19472 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 2
Source.1786: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.1787: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.1788: DFBPPR19476 ---- Animal proteins ---- Rho GTPase-activating protein 7
Source.1789: DFBPPR19477 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.1790: DFBPPR19479 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.1791: DFBPPR19482 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.1792: DFBPPR19483 ---- Animal proteins ---- Peroxisomal membrane protein PEX13
Source.1793: DFBPPR19486 ---- Animal proteins ---- Probable dimethyladenosine transferase
Source.1794: DFBPPR19491 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.1795: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.1796: DFBPPR19498 ---- Animal proteins ---- Keratin, type II cytoskeletal 73
Source.1797: DFBPPR19499 ---- Animal proteins ---- Transcription factor MafG
Source.1798: DFBPPR19518 ---- Animal proteins ---- Rab GTPase-binding effector protein 2
Source.1799: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.1800: DFBPPR19532 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase PRP16
Source.1801: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.1802: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.1803: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.1804: DFBPPR19566 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.1805: DFBPPR19567 ---- Animal proteins ---- Peroxisomal sarcosine oxidase
Source.1806: DFBPPR19571 ---- Animal proteins ---- Tonsoku-like protein
Source.1807: DFBPPR19577 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.1808: DFBPPR19578 ---- Animal proteins ---- Dimethyladenosine transferase 2, mitochondrial
Source.1809: DFBPPR19581 ---- Animal proteins ---- Leucine zipper putative tumor suppressor 2
Source.1810: DFBPPR19582 ---- Animal proteins ---- dCTP pyrophosphatase 1
Source.1811: DFBPPR19596 ---- Animal proteins ---- Alpha-internexin
Source.1812: DFBPPR19598 ---- Animal proteins ---- 5-methylcytosine rRNA methyltransferase NSUN4
Source.1813: DFBPPR19600 ---- Animal proteins ---- Macrophage-expressed gene 1 protein
Source.1814: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.1815: DFBPPR19611 ---- Animal proteins ---- Phenylalanine-4-hydroxylase
Source.1816: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.1817: DFBPPR19615 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.1818: DFBPPR19624 ---- Animal proteins ---- Keratin, type II cytoskeletal 5
Source.1819: DFBPPR19625 ---- Animal proteins ---- Angiomotin-like protein 2
Source.1820: DFBPPR19626 ---- Animal proteins ---- Glia maturation factor beta
Source.1821: DFBPPR19628 ---- Animal proteins ---- Mothers against decapentaplegic homolog 2
Source.1822: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.1823: DFBPPR19635 ---- Animal proteins ---- Glial fibrillary acidic protein
Source.1824: DFBPPR19648 ---- Animal proteins ---- Splicing factor U2AF 35 kDa subunit
Source.1825: DFBPPR19668 ---- Animal proteins ---- Calicin
Source.1826: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein
Source.1827: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2
Source.1828: DFBPPR19683 ---- Animal proteins ---- COMM domain-containing protein 1
Source.1829: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.1830: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.1831: DFBPPR19690 ---- Animal proteins ---- Mannose-6-phosphate isomerase
Source.1832: DFBPPR19692 ---- Animal proteins ---- Basal cell adhesion molecule
Source.1833: DFBPPR19700 ---- Animal proteins ---- Arrestin domain-containing protein 3
Source.1834: DFBPPR19705 ---- Animal proteins ---- Tubulin beta-6 chain
Source.1835: DFBPPR19708 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.1836: DFBPPR19709 ---- Animal proteins ---- Centromere protein X
Source.1837: DFBPPR19713 ---- Animal proteins ---- Shadow of prion protein
Source.1838: DFBPPR19718 ---- Animal proteins ---- Type 2 phosphatidylinositol 4,5-bisphosphate 4-phosphatase
Source.1839: DFBPPR19719 ---- Animal proteins ---- Kelch-like protein 3
Source.1840: DFBPPR19730 ---- Animal proteins ---- Tensin-1
Source.1841: DFBPPR19736 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.1842: DFBPPR19740 ---- Animal proteins ---- Sin3 histone deacetylase corepressor complex component SDS3
Source.1843: DFBPPR19752 ---- Animal proteins ---- Chromatin target of PRMT1 protein
Source.1844: DFBPPR19755 ---- Animal proteins ---- Mitochondrial dimethyladenosine transferase 1
Source.1845: DFBPPR19776 ---- Animal proteins ---- Tropomyosin alpha-3 chain
Source.1846: DFBPPR19785 ---- Animal proteins ---- Calcyclin-binding protein
Source.1847: DFBPPR19790 ---- Animal proteins ---- Calcium-binding protein 4
Source.1848: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.1849: DFBPPR19795 ---- Animal proteins ---- Fibroblast growth factor 4
Source.1850: DFBPPR19805 ---- Animal proteins ---- Translation factor GUF1, mitochondrial
Source.1851: DFBPPR19811 ---- Animal proteins ---- Mitochondrial inner membrane protein OXA1L
Source.1852: DFBPPR19821 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.1853: DFBPPR19823 ---- Animal proteins ---- Alanine aminotransferase 1
Source.1854: DFBPPR19826 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 5, mitochondrial
Source.1855: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.1856: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.1857: DFBPPR19836 ---- Animal proteins ---- Tubulin beta-5 chain
Source.1858: DFBPPR19838 ---- Animal proteins ---- Transcription factor GATA-5
Source.1859: DFBPPR19874 ---- Animal proteins ---- Cyclin-dependent kinase 4 inhibitor B
Source.1860: DFBPPR19876 ---- Animal proteins ---- Placenta-expressed transcript 1 protein
Source.1861: DFBPPR19881 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.1862: DFBPPR19884 ---- Animal proteins ---- Activator of basal transcription 1
Source.1863: DFBPPR19903 ---- Animal proteins ---- Endoplasmic reticulum resident protein 27
Source.1864: DFBPPR19908 ---- Animal proteins ---- DNA replication licensing factor MCM6
Source.1865: DFBPPR19917 ---- Animal proteins ---- PH and SEC7 domain-containing protein 1
Source.1866: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.1867: DFBPPR19924 ---- Animal proteins ---- Protocadherin-18
Source.1868: DFBPPR19926 ---- Animal proteins ---- Gamma-interferon-inducible lysosomal thiol reductase
Source.1869: DFBPPR19935 ---- Animal proteins ---- Reticulon-3
Source.1870: DFBPPR19940 ---- Animal proteins ---- Keratin, type II cytoskeletal 78
Source.1871: DFBPPR19947 ---- Animal proteins ---- Keratin, type I cytoskeletal 40
Source.1872: DFBPPR19949 ---- Animal proteins ---- Syndecan-2
Source.1873: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.1874: DFBPPR19970 ---- Animal proteins ---- 14-3-3 protein gamma
Source.1875: DFBPPR19980 ---- Animal proteins ---- Exocyst complex component 3
Source.1876: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7
Source.1877: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.1878: DFBPPR19989 ---- Animal proteins ---- Luc7-like protein 3
Source.1879: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.1880: DFBPPR20004 ---- Animal proteins ---- Protein associated with UVRAG as autophagy enhancer
Source.1881: DFBPPR20040 ---- Animal proteins ---- DnaJ homolog subfamily C member 2
Source.1882: DFBPPR20043 ---- Animal proteins ---- Pre-B-cell leukemia transcription factor-interacting protein 1
Source.1883: DFBPPR20058 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2
Source.1884: DFBPPR20059 ---- Animal proteins ---- Band 4.1-like protein 5
Source.1885: DFBPPR20066 ---- Animal proteins ---- Hydroxyacid oxidase 2
Source.1886: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.1887: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1
Source.1888: DFBPPR20088 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.1889: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.1890: DFBPPR20094 ---- Animal proteins ---- Prolyl endopeptidase
Source.1891: DFBPPR20096 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.1892: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1
Source.1893: DFBPPR20099 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit WDR4
Source.1894: DFBPPR20100 ---- Animal proteins ---- Sideroflexin-1
Source.1895: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.1896: DFBPPR20149 ---- Animal proteins ---- Flotillin-2
Source.1897: DFBPPR20152 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.1898: DFBPPR20155 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF181
Source.1899: DFBPPR20161 ---- Animal proteins ---- Calponin-2
Source.1900: DFBPPR20166 ---- Animal proteins ---- Programmed cell death protein 5
Source.1901: DFBPPR20171 ---- Animal proteins ---- Rap1 GTPase-GDP dissociation stimulator 1
Source.1902: DFBPPR20183 ---- Animal proteins ---- Mitochondrial intermembrane space import and assembly protein 40
Source.1903: DFBPPR20191 ---- Animal proteins ---- 5-oxoprolinase
Source.1904: DFBPPR20192 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.1905: DFBPPR20195 ---- Animal proteins ---- GSK3B-interacting protein
Source.1906: DFBPPR20197 ---- Animal proteins ---- Ribonuclease P protein subunit p20
Source.1907: DFBPPR20219 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 1
Source.1908: DFBPPR20224 ---- Animal proteins ---- Sclerostin
Source.1909: DFBPPR20232 ---- Animal proteins ---- Omega-amidase NIT2
Source.1910: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase
Source.1911: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.1912: DFBPPR20250 ---- Animal proteins ---- General transcription factor IIH subunit 5
Source.1913: DFBPPR20255 ---- Animal proteins ---- Brain-specific angiogenesis inhibitor 1-associated protein 2-like protein 2
Source.1914: DFBPPR20258 ---- Animal proteins ---- Ribosome biogenesis regulatory protein homolog
Source.1915: DFBPPR20260 ---- Animal proteins ---- Keratin, type II cytoskeletal 79
Source.1916: DFBPPR20270 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.1917: DFBPPR20284 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 3
Source.1918: DFBPPR20290 ---- Animal proteins ---- Dynein light chain 1, axonemal
Source.1919: DFBPPR20305 ---- Animal proteins ---- Nostrin
Source.1920: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.1921: DFBPPR20323 ---- Animal proteins ---- Myosin light chain 3
Source.1922: DFBPPR20333 ---- Animal proteins ---- RNA-binding protein 14
Source.1923: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.1924: DFBPPR20344 ---- Animal proteins ---- Dynactin subunit 2
Source.1925: DFBPPR20354 ---- Animal proteins ---- Single-strand selective monofunctional uracil DNA glycosylase
Source.1926: DFBPPR20359 ---- Animal proteins ---- Glutathione S-transferase theta-1
Source.1927: DFBPPR20361 ---- Animal proteins ---- Cation channel sperm-associated protein subunit delta
Source.1928: DFBPPR20384 ---- Animal proteins ---- Heat shock protein beta-6
Source.1929: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.1930: DFBPPR20388 ---- Animal proteins ---- SOSS complex subunit C
Source.1931: DFBPPR20394 ---- Animal proteins ---- Actin filament-associated protein 1-like 2
Source.1932: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.1933: DFBPPR20399 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC4
Source.1934: DFBPPR20400 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-2
Source.1935: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.1936: DFBPPR20418 ---- Animal proteins ---- Alpha-1B-glycoprotein
Source.1937: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.1938: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.1939: DFBPPR20442 ---- Animal proteins ---- DNA replication complex GINS protein SLD5
Source.1940: DFBPPR20449 ---- Animal proteins ---- Tetratricopeptide repeat protein 4
Source.1941: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C
Source.1942: DFBPPR20468 ---- Animal proteins ---- 28S ribosomal protein S28, mitochondrial
Source.1943: DFBPPR20481 ---- Animal proteins ---- Ropporin-1
Source.1944: DFBPPR20492 ---- Animal proteins ---- Microtubule-associated protein 10
Source.1945: DFBPPR20493 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.1946: DFBPPR20495 ---- Animal proteins ---- Spliceosome-associated protein CWC15 homolog
Source.1947: DFBPPR20527 ---- Animal proteins ---- Active breakpoint cluster region-related protein
Source.1948: DFBPPR20531 ---- Animal proteins ---- Myozenin-2
Source.1949: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.1950: DFBPPR20544 ---- Animal proteins ---- 28S ribosomal protein S34, mitochondrial
Source.1951: DFBPPR20557 ---- Animal proteins ---- Asporin
Source.1952: DFBPPR20560 ---- Animal proteins ---- Draxin
Source.1953: DFBPPR20571 ---- Animal proteins ---- Galactose-3-O-sulfotransferase 4
Source.1954: DFBPPR20573 ---- Animal proteins ---- T-complex protein 1 subunit delta
Source.1955: DFBPPR20586 ---- Animal proteins ---- SWI/SNF-related matrix-associated actin-dependent regulator of chromatin subfamily E member 1-related
Source.1956: DFBPPR20593 ---- Animal proteins ---- Pro-interleukin-16
Source.1957: DFBPPR20606 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.1958: DFBPPR20610 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1 homolog
Source.1959: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase
Source.1960: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.1961: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.1962: DFBPPR20627 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.1963: DFBPPR20652 ---- Animal proteins ---- HAUS augmin-like complex subunit 1
Source.1964: DFBPPR20654 ---- Animal proteins ---- Centrosomal protein of 44 kDa
Source.1965: DFBPPR20666 ---- Animal proteins ---- Tektin-2
Source.1966: DFBPPR20691 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD11
Source.1967: DFBPPR20695 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 28 homolog
Source.1968: DFBPPR20702 ---- Animal proteins ---- 5-azacytidine-induced protein 2
Source.1969: DFBPPR20718 ---- Animal proteins ---- Homeobox protein MSX-1
Source.1970: DFBPPR20719 ---- Animal proteins ---- DnaJ homolog subfamily C member 21
Source.1971: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.1972: DFBPPR20741 ---- Animal proteins ---- Cilia- and flagella-associated protein 206
Source.1973: DFBPPR20743 ---- Animal proteins ---- Myozenin-1
Source.1974: DFBPPR20753 ---- Animal proteins ---- UV-stimulated scaffold protein A
Source.1975: DFBPPR20762 ---- Animal proteins ---- Mucosal pentraxin
Source.1976: DFBPPR20770 ---- Animal proteins ---- Angiomotin-like protein 1
Source.1977: DFBPPR20776 ---- Animal proteins ---- C4b-binding protein beta chain
Source.1978: DFBPPR20788 ---- Animal proteins ---- MICOS complex subunit MIC27
Source.1979: DFBPPR20789 ---- Animal proteins ---- Prefoldin subunit 6
Source.1980: DFBPPR20791 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 13
Source.1981: DFBPPR20796 ---- Animal proteins ---- Up-regulator of cell proliferation
Source.1982: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase
Source.1983: DFBPPR20823 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.1984: DFBPPR20824 ---- Animal proteins ---- CD151 antigen
Source.1985: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.1986: DFBPPR20848 ---- Animal proteins ---- Protein VAC14 homolog
Source.1987: DFBPPR20856 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim10
Source.1988: DFBPPR20858 ---- Animal proteins ---- YrdC domain-containing protein, mitochondrial
Source.1989: DFBPPR20860 ---- Animal proteins ---- Vesicle-associated membrane protein 5
Source.1990: DFBPPR20861 ---- Animal proteins ---- Zinc finger protein 135
Source.1991: DFBPPR20883 ---- Animal proteins ---- Pre-mRNA-splicing factor 38A
Source.1992: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237
Source.1993: DFBPPR20894 ---- Animal proteins ---- THAP domain-containing protein 11
Source.1994: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.1995: DFBPPR20899 ---- Animal proteins ---- Centrosomal protein kizuna
Source.1996: DFBPPR20906 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.1997: DFBPPR20912 ---- Animal proteins ---- Zinc finger protein 668
Source.1998: DFBPPR20913 ---- Animal proteins ---- Somatostatin
Source.1999: DFBPPR20914 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.2000: DFBPPR20916 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit TIM50
Source.2001: DFBPPR20934 ---- Animal proteins ---- Early growth response protein 4
Source.2002: DFBPPR20942 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.2003: DFBPPR20943 ---- Animal proteins ---- Protein fem-1 homolog A
Source.2004: DFBPPR20946 ---- Animal proteins ---- Potassium voltage-gated channel subfamily V member 1
Source.2005: DFBPPR20954 ---- Animal proteins ---- Secretagogin
Source.2006: DFBPPR20959 ---- Animal proteins ---- Janus kinase and microtubule-interacting protein 1
Source.2007: DFBPPR20965 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.2008: DFBPPR20972 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP11
Source.2009: DFBPPR20981 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.2010: DFBPPR20985 ---- Animal proteins ---- Transmembrane protein 131-like
Source.2011: DFBPPR20997 ---- Animal proteins ---- Prefoldin subunit 2
Source.2012: DFBPPR21000 ---- Animal proteins ---- Replication termination factor 2
Source.2013: DFBPPR21001 ---- Animal proteins ---- T-complex protein 1 subunit alpha
Source.2014: DFBPPR21003 ---- Animal proteins ---- Protein BCAP
Source.2015: DFBPPR21007 ---- Animal proteins ---- Protein ABHD1
Source.2016: DFBPPR21033 ---- Animal proteins ---- 26S proteasome complex subunit SEM1
Source.2017: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.2018: DFBPPR21045 ---- Animal proteins ---- Rho GTPase-activating protein 10
Source.2019: DFBPPR21052 ---- Animal proteins ---- Keratin, type I cytoskeletal 28
Source.2020: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.2021: DFBPPR21065 ---- Animal proteins ---- Protein fem-1 homolog C
Source.2022: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.2023: DFBPPR21078 ---- Animal proteins ---- Guanine nucleotide-binding protein-like 3-like protein
Source.2024: DFBPPR21088 ---- Animal proteins ---- Centrosomal protein 43
Source.2025: DFBPPR21093 ---- Animal proteins ---- UDP-glucuronosyltransferase 3A1
Source.2026: DFBPPR21096 ---- Animal proteins ---- Kinesin light chain 4
Source.2027: DFBPPR21099 ---- Animal proteins ---- 60S ribosomal protein L7
Source.2028: DFBPPR21101 ---- Animal proteins ---- Bromodomain-containing protein 2
Source.2029: DFBPPR21107 ---- Animal proteins ---- Proteasome assembly chaperone 2
Source.2030: DFBPPR21109 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.2031: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.2032: DFBPPR21121 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-3
Source.2033: DFBPPR21138 ---- Animal proteins ---- ER membrane protein complex subunit 2
Source.2034: DFBPPR21155 ---- Animal proteins ---- Cyclin-H
Source.2035: DFBPPR21163 ---- Animal proteins ---- Uridine diphosphate glucose pyrophosphatase NUDT22
Source.2036: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.2037: DFBPPR21176 ---- Animal proteins ---- Deaminated glutathione amidase
Source.2038: DFBPPR21180 ---- Animal proteins ---- Golgin subfamily A member 7
Source.2039: DFBPPR21184 ---- Animal proteins ---- Kinetochore protein Spc24
Source.2040: DFBPPR21189 ---- Animal proteins ---- Dynein assembly factor 1, axonemal
Source.2041: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.2042: DFBPPR21192 ---- Animal proteins ---- Oxidation resistance protein 1
Source.2043: DFBPPR21198 ---- Animal proteins ---- Tax1-binding protein 1 homolog
Source.2044: DFBPPR21200 ---- Animal proteins ---- RAB6A-GEF complex partner protein 2
Source.2045: DFBPPR21224 ---- Animal proteins ---- Smoothelin-like protein 2
Source.2046: DFBPPR21231 ---- Animal proteins ---- eEF1A lysine and N-terminal methyltransferase
Source.2047: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.2048: DFBPPR21265 ---- Animal proteins ---- A-kinase anchor protein 3
Source.2049: DFBPPR21271 ---- Animal proteins ---- Selenocysteine lyase
Source.2050: DFBPPR21282 ---- Animal proteins ---- Spindle and centriole-associated protein 1
Source.2051: DFBPPR21293 ---- Animal proteins ---- IST1 homolog
Source.2052: DFBPPR21296 ---- Animal proteins ---- Parathymosin
Source.2053: DFBPPR21303 ---- Animal proteins ---- Palmdelphin
Source.2054: DFBPPR21309 ---- Animal proteins ---- Coiled-coil domain-containing protein 39
Source.2055: DFBPPR21312 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim8 B
Source.2056: DFBPPR21314 ---- Animal proteins ---- KIF-binding protein
Source.2057: DFBPPR21315 ---- Animal proteins ---- PCNA-interacting partner
Source.2058: DFBPPR21334 ---- Animal proteins ---- LisH domain-containing protein ARMC9
Source.2059: DFBPPR21342 ---- Animal proteins ---- G kinase-anchoring protein 1
Source.2060: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.2061: DFBPPR21357 ---- Animal proteins ---- Secretory carrier-associated membrane protein 3
Source.2062: DFBPPR21358 ---- Animal proteins ---- Myosin light chain 1/3, skeletal muscle isoform
Source.2063: DFBPPR21366 ---- Animal proteins ---- Fibroblast growth factor 18
Source.2064: DFBPPR21369 ---- Animal proteins ---- Protein MIS12 homolog
Source.2065: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.2066: DFBPPR21377 ---- Animal proteins ---- Hemoglobin subunit mu
Source.2067: DFBPPR21386 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3B
Source.2068: DFBPPR21388 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.2069: DFBPPR21390 ---- Animal proteins ---- Rho GTPase-activating protein 15
Source.2070: DFBPPR21393 ---- Animal proteins ---- mRNA-decapping enzyme 1B
Source.2071: DFBPPR21397 ---- Animal proteins ---- Leucine zipper transcription factor-like protein 1
Source.2072: DFBPPR21399 ---- Animal proteins ---- Trafficking protein particle complex subunit 6A
Source.2073: DFBPPR21401 ---- Animal proteins ---- THAP domain-containing protein 5
Source.2074: DFBPPR21404 ---- Animal proteins ---- Phosphoribosyl pyrophosphate synthase-associated protein 1
Source.2075: DFBPPR21407 ---- Animal proteins ---- Ribosome biogenesis protein BRX1 homolog
Source.2076: DFBPPR21409 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 14 homolog A
Source.2077: DFBPPR21419 ---- Animal proteins ---- Protein FAM3C
Source.2078: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B
Source.2079: DFBPPR21440 ---- Animal proteins ---- Regulator of microtubule dynamics protein 1
Source.2080: DFBPPR21451 ---- Animal proteins ---- Nurim
Source.2081: DFBPPR21464 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.2082: DFBPPR21467 ---- Animal proteins ---- Striatin-interacting protein 1
Source.2083: DFBPPR21468 ---- Animal proteins ---- RNA-binding region-containing protein 3
Source.2084: DFBPPR21470 ---- Animal proteins ---- Angiopoietin-4
Source.2085: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.2086: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.2087: DFBPPR21479 ---- Animal proteins ---- Pentraxin-related protein PTX3
Source.2088: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8
Source.2089: DFBPPR21498 ---- Animal proteins ---- Alanyl-tRNA editing protein Aarsd1
Source.2090: DFBPPR21507 ---- Animal proteins ---- Nitric oxide-associated protein 1
Source.2091: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2
Source.2092: DFBPPR21532 ---- Animal proteins ---- Transmembrane protein 225
Source.2093: DFBPPR21562 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.2094: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.2095: DFBPPR21586 ---- Animal proteins ---- Cyclin-C
Source.2096: DFBPPR21592 ---- Animal proteins ---- Glia maturation factor gamma
Source.2097: DFBPPR21594 ---- Animal proteins ---- SH3 domain-binding protein 5-like
Source.2098: DFBPPR21596 ---- Animal proteins ---- Origin recognition complex subunit 2
Source.2099: DFBPPR21616 ---- Animal proteins ---- Olfactomedin-like protein 3
Source.2100: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.2101: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.2102: DFBPPR21689 ---- Animal proteins ---- ADP-ribosylation factor-like protein 11
Source.2103: DFBPPR21691 ---- Animal proteins ---- Protein LRATD1
Source.2104: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.2105: DFBPPR21731 ---- Animal proteins ---- DnaJ homolog subfamily C member 17
Source.2106: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.2107: DFBPPR21736 ---- Animal proteins ---- EF-hand domain-containing protein D1
Source.2108: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15
Source.2109: DFBPPR21746 ---- Animal proteins ---- Protein ABHD8
Source.2110: DFBPPR21750 ---- Animal proteins ---- 14-3-3 protein theta
Source.2111: DFBPPR21760 ---- Animal proteins ---- Nucleotide exchange factor SIL1
Source.2112: DFBPPR21763 ---- Animal proteins ---- Protein GOLM2
Source.2113: DFBPPR21768 ---- Animal proteins ---- Tektin-4
Source.2114: DFBPPR21770 ---- Animal proteins ---- Cbp/p300-interacting transactivator 4
Source.2115: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.2116: DFBPPR21779 ---- Animal proteins ---- Serpin B8
Source.2117: DFBPPR21783 ---- Animal proteins ---- Radial spoke head protein 9 homolog
Source.2118: DFBPPR21796 ---- Animal proteins ---- snRNA-activating protein complex subunit 3
Source.2119: DFBPPR21798 ---- Animal proteins ---- RNA-binding protein 44
Source.2120: DFBPPR21799 ---- Animal proteins ---- Major vault protein
Source.2121: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.2122: DFBPPR21803 ---- Animal proteins ---- Uracil phosphoribosyltransferase homolog
Source.2123: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.2124: DFBPPR21821 ---- Animal proteins ---- Dephospho-CoA kinase domain-containing protein
Source.2125: DFBPPR21825 ---- Animal proteins ---- Meiosis-specific nuclear structural protein 1
Source.2126: DFBPPR21826 ---- Animal proteins ---- RING finger protein 141
Source.2127: DFBPPR21828 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 11
Source.2128: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1
Source.2129: DFBPPR21856 ---- Animal proteins ---- Protein FAM32A
Source.2130: DFBPPR21879 ---- Animal proteins ---- Protein SDA1 homolog
Source.2131: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.2132: DFBPPR21897 ---- Animal proteins ---- ZW10 interactor
Source.2133: DFBPPR21901 ---- Animal proteins ---- Calcyphosin
Source.2134: DFBPPR21907 ---- Animal proteins ---- Molybdate-anion transporter
Source.2135: DFBPPR21910 ---- Animal proteins ---- Protein LTV1 homolog
Source.2136: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.2137: DFBPPR21943 ---- Animal proteins ---- HBS1-like protein
Source.2138: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog
Source.2139: DFBPPR21965 ---- Animal proteins ---- Peptide chain release factor 1, mitochondrial
Source.2140: DFBPPR21968 ---- Animal proteins ---- F-box only protein 28
Source.2141: DFBPPR21969 ---- Animal proteins ---- 1-aminocyclopropane-1-carboxylate synthase-like protein 1
Source.2142: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein
Source.2143: DFBPPR21979 ---- Animal proteins ---- X-ray radiation resistance-associated protein 1
Source.2144: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.2145: DFBPPR21983 ---- Animal proteins ---- IGF-like family receptor 1
Source.2146: DFBPPR21985 ---- Animal proteins ---- Leucine-rich repeat-containing protein 14
Source.2147: DFBPPR22012 ---- Animal proteins ---- GRB2-related adapter protein
Source.2148: DFBPPR22021 ---- Animal proteins ---- Fibrous sheath CABYR-binding protein
Source.2149: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.2150: DFBPPR22027 ---- Animal proteins ---- F-box/LRR-repeat protein 4
Source.2151: DFBPPR22040 ---- Animal proteins ---- Zinc finger CCHC domain-containing protein 12
Source.2152: DFBPPR22042 ---- Animal proteins ---- Peroxiredoxin-like 2C
Source.2153: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.2154: DFBPPR22066 ---- Animal proteins ---- Pyridoxal phosphate homeostasis protein
Source.2155: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.2156: DFBPPR22079 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 5
Source.2157: DFBPPR22080 ---- Animal proteins ---- Integrator complex subunit 9
Source.2158: DFBPPR22085 ---- Animal proteins ---- Zinc finger protein 512
Source.2159: DFBPPR22089 ---- Animal proteins ---- N-myc-interactor
Source.2160: DFBPPR22090 ---- Animal proteins ---- 5'-nucleotidase domain-containing protein 1
Source.2161: DFBPPR22098 ---- Animal proteins ---- Esterase OVCA2
Source.2162: DFBPPR22101 ---- Animal proteins ---- DNA polymerase epsilon subunit 4
Source.2163: DFBPPR22112 ---- Animal proteins ---- DPY30 domain-containing protein 1
Source.2164: DFBPPR22113 ---- Animal proteins ---- DPY30 domain-containing protein 1
Source.2165: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2
Source.2166: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2
Source.2167: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B
Source.2168: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein
Source.2169: DFBPPR22159 ---- Animal proteins ---- Fanconi anemia core complex-associated protein 24
Source.2170: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.2171: DFBPPR22165 ---- Animal proteins ---- Coiled-coil domain-containing protein 106
Source.2172: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.2173: DFBPPR22171 ---- Animal proteins ---- Leucine-rich repeat flightless-interacting protein 2
Source.2174: DFBPPR22178 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 6
Source.2175: DFBPPR22185 ---- Animal proteins ---- Ribosome-recycling factor, mitochondrial
Source.2176: DFBPPR22187 ---- Animal proteins ---- Conserved oligomeric Golgi complex subunit 8
Source.2177: DFBPPR22189 ---- Animal proteins ---- Zinc finger matrin-type protein 5
Source.2178: DFBPPR22201 ---- Animal proteins ---- Pleckstrin homology domain-containing family J member 1
Source.2179: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.2180: DFBPPR22209 ---- Animal proteins ---- Transmembrane protein 147
Source.2181: DFBPPR22213 ---- Animal proteins ---- Protein TEX261
Source.2182: DFBPPR22219 ---- Animal proteins ---- EF-hand and coiled-coil domain-containing protein 1
Source.2183: DFBPPR22223 ---- Animal proteins ---- Calretinin
Source.2184: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.2185: DFBPPR22230 ---- Animal proteins ---- Hydroxyacylglutathione hydrolase-like protein
Source.2186: DFBPPR22233 ---- Animal proteins ---- RNA exonuclease 5
Source.2187: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.2188: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.2189: DFBPPR22241 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 7
Source.2190: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.2191: DFBPPR22262 ---- Animal proteins ---- Tetraspanin-18
Source.2192: DFBPPR22265 ---- Animal proteins ---- Protein KTI12 homolog
Source.2193: DFBPPR22275 ---- Animal proteins ---- 60S ribosomal protein L17
Source.2194: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B
Source.2195: DFBPPR22282 ---- Animal proteins ---- Optic atrophy 3 protein homolog
Source.2196: DFBPPR22288 ---- Animal proteins ---- Protein FAM110B
Source.2197: DFBPPR22291 ---- Animal proteins ---- Keratin-like protein KRT222
Source.2198: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2
Source.2199: DFBPPR22305 ---- Animal proteins ---- Transmembrane protein 41A
Source.2200: DFBPPR22322 ---- Animal proteins ---- Testis-specific protein 10-interacting protein
Source.2201: DFBPPR22324 ---- Animal proteins ---- Arginine and glutamate-rich protein 1
Source.2202: DFBPPR22325 ---- Animal proteins ---- Armadillo repeat-containing protein 2
Source.2203: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.2204: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.2205: DFBPPR22344 ---- Animal proteins ---- Divergent protein kinase domain 2B
Source.2206: DFBPPR22346 ---- Animal proteins ---- FUN14 domain-containing protein 2
Source.2207: DFBPPR22348 ---- Animal proteins ---- Coiled-coil domain-containing protein 63
Source.2208: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.2209: DFBPPR22356 ---- Animal proteins ---- RNA 3'-terminal phosphate cyclase-like protein
Source.2210: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.2211: DFBPPR22369 ---- Animal proteins ---- Transmembrane protein 247
Source.2212: DFBPPR22377 ---- Animal proteins ---- Ras suppressor protein 1
Source.2213: DFBPPR22380 ---- Animal proteins ---- G patch domain-containing protein 4
Source.2214: DFBPPR22385 ---- Animal proteins ---- Coiled-coil domain-containing protein 102A
Source.2215: DFBPPR22395 ---- Animal proteins ---- UPF0524 protein C3orf70 homolog
Source.2216: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9
Source.2217: DFBPPR22406 ---- Animal proteins ---- Uncharacterized protein KIAA2013 homolog
Source.2218: DFBPPR22419 ---- Animal proteins ---- Prolyl-tRNA synthetase associated domain-containing protein 1
Source.2219: DFBPPR22422 ---- Animal proteins ---- UPF0428 protein CXorf56 homolog
Source.2220: DFBPPR22431 ---- Animal proteins ---- BolA-like protein 3
Source.2221: DFBPPR22445 ---- Animal proteins ---- Tetratricopeptide repeat protein 1
Source.2222: DFBPPR22447 ---- Animal proteins ---- Quinone oxidoreductase-like protein 2
Source.2223: DFBPPR22448 ---- Animal proteins ---- Transmembrane and coiled-coil domain-containing protein 5B
Source.2224: DFBPPR22455 ---- Animal proteins ---- Phosducin-like protein 2
Source.2225: DFBPPR22460 ---- Animal proteins ---- Coiled-coil domain-containing protein 149
Source.2226: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein
Source.2227: DFBPPR22469 ---- Animal proteins ---- Protein FAM136A
Source.2228: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.2229: DFBPPR22473 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD19
Source.2230: DFBPPR22497 ---- Animal proteins ---- Enkurin domain-containing protein 1
Source.2231: DFBPPR22508 ---- Animal proteins ---- LysM and putative peptidoglycan-binding domain-containing protein 2
Source.2232: DFBPPR22520 ---- Animal proteins ---- RIB43A-like with coiled-coils protein 2
Source.2233: DFBPPR22525 ---- Animal proteins ---- Protein ZBED8
Source.2234: DFBPPR22553 ---- Animal proteins ---- Protein FAM114A2
Source.2235: DFBPPR22559 ---- Animal proteins ---- Vimentin-type intermediate filament-associated coiled-coil protein
Source.2236: DFBPPR22560 ---- Animal proteins ---- Mesenteric estrogen-dependent adipogenesis protein
Source.2237: DFBPPR22572 ---- Animal proteins ---- Maestro heat-like repeat-containing protein family member 1
Source.2238: DFBPPR22575 ---- Animal proteins ---- UPF0687 protein C20orf27 homolog
Source.2239: DFBPPR22584 ---- Animal proteins ---- Arginine vasopressin-induced protein 1
Source.2240: DFBPPR22586 ---- Animal proteins ---- Uncharacterized protein KIAA2012 homolog
Source.2241: DFBPPR22594 ---- Animal proteins ---- BTB/POZ domain-containing protein 19
Source.2242: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13
Source.2243: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.2244: DFBPPR22609 ---- Animal proteins ---- Protein TSSC4
Source.2245: DFBPPR22614 ---- Animal proteins ---- Protein FAM81B
Source.2246: DFBPPR22617 ---- Animal proteins ---- SNRPN upstream reading frame protein
Source.2247: DFBPPR22621 ---- Animal proteins ---- Leucine-rich repeat-containing protein 72
Source.2248: DFBPPR22629 ---- Animal proteins ---- Coiled-coil domain-containing protein 153
Source.2249: DFBPPR22639 ---- Animal proteins ---- UPF0235 protein C15orf40 homolog
Source.2250: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.2251: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65
Source.2252: DFBPPR22652 ---- Animal proteins ---- PX domain-containing protein 1
Source.2253: DFBPPR22667 ---- Animal proteins ---- Uncharacterized protein C17orf78 homolog
Source.2254: DFBPPR22681 ---- Animal proteins ---- Uncharacterized protein C2orf81 homolog
Source.2255: DFBPPR22685 ---- Animal proteins ---- Protein FAM166C
Source.2256: DFBPPR22699 ---- Animal proteins ---- LYR motif-containing protein 9
Source.2257: DFBPPR22724 ---- Animal proteins ---- UPF0415 protein C7orf25 homolog
Source.2258: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein
Source.2259: DFBPPR22749 ---- Animal proteins ---- Uncharacterized protein C2orf73 homolog
Source.2260: DFBPPR22760 ---- Animal proteins ---- Uncharacterized protein C7orf57 homolog
Source.2261: DFBPPR8531 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.2262: DFBPPR8533 ---- Animal proteins ---- Dipeptidase 1
Source.2263: DFBPPR8542 ---- Animal proteins ---- Carbonyl reductase [NADPH] 1
Source.2264: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.2265: DFBPPR8552 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2266: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.2267: DFBPPR8566 ---- Animal proteins ---- Scavenger receptor class B member 1
Source.2268: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.2269: DFBPPR8576 ---- Animal proteins ---- Hormone-sensitive lipase
Source.2270: DFBPPR8591 ---- Animal proteins ---- Glutathione hydrolase 1 proenzyme
Source.2271: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.2272: DFBPPR8613 ---- Animal proteins ---- Thyroglobulin
Source.2273: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.2274: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.2275: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.2276: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.2277: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.2278: DFBPPR8637 ---- Animal proteins ---- Phosphoinositide 3-kinase regulatory subunit 5
Source.2279: DFBPPR8639 ---- Animal proteins ---- Mannose-binding protein A
Source.2280: DFBPPR8640 ---- Animal proteins ---- Rho-associated protein kinase 2
Source.2281: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.2282: DFBPPR8656 ---- Animal proteins ---- Chromogranin-A
Source.2283: DFBPPR8661 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2284: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.2285: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.2286: DFBPPR8688 ---- Animal proteins ---- Vinculin
Source.2287: DFBPPR8700 ---- Animal proteins ---- Endoglin
Source.2288: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.2289: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.2290: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C
Source.2291: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9
Source.2292: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.2293: DFBPPR8732 ---- Animal proteins ---- Dihydropyrimidine dehydrogenase [NADP(+)]
Source.2294: DFBPPR8738 ---- Animal proteins ---- Interleukin-8
Source.2295: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2296: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.2297: DFBPPR8743 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.2298: DFBPPR8748 ---- Animal proteins ---- Dual oxidase 2
Source.2299: DFBPPR8749 ---- Animal proteins ---- E3 SUMO-protein ligase EGR2
Source.2300: DFBPPR8754 ---- Animal proteins ---- Dual oxidase 1
Source.2301: DFBPPR8756 ---- Animal proteins ---- Pro-opiomelanocortin
Source.2302: DFBPPR8767 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.2303: DFBPPR8778 ---- Animal proteins ---- Malate dehydrogenase, mitochondrial
Source.2304: DFBPPR8783 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 1
Source.2305: DFBPPR8784 ---- Animal proteins ---- Transcription factor AP-1
Source.2306: DFBPPR8785 ---- Animal proteins ---- 40S ribosomal protein S3
Source.2307: DFBPPR8805 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.2308: DFBPPR8806 ---- Animal proteins ---- Cadherin-5
Source.2309: DFBPPR8814 ---- Animal proteins ---- Aromatic-L-amino-acid decarboxylase
Source.2310: DFBPPR8819 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 5
Source.2311: DFBPPR8820 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 1
Source.2312: DFBPPR8823 ---- Animal proteins ---- Sodium/potassium ATPase inhibitor SPAI-2
Source.2313: DFBPPR8824 ---- Animal proteins ---- Pyridoxal kinase
Source.2314: DFBPPR8825 ---- Animal proteins ---- Optineurin
Source.2315: DFBPPR8842 ---- Animal proteins ---- Kelch-like ECH-associated protein 1
Source.2316: DFBPPR8845 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 1, mitochondrial
Source.2317: DFBPPR8849 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.2318: DFBPPR8850 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.2319: DFBPPR8851 ---- Animal proteins ---- Vimentin
Source.2320: DFBPPR8852 ---- Animal proteins ---- Vimentin
Source.2321: DFBPPR8854 ---- Animal proteins ---- Vimentin
Source.2322: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog
Source.2323: DFBPPR8862 ---- Animal proteins ---- Neurofilament light polypeptide
Source.2324: DFBPPR8885 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.2325: DFBPPR8888 ---- Animal proteins ---- Propionyl-CoA carboxylase alpha chain, mitochondrial
Source.2326: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.2327: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.2328: DFBPPR8917 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.2329: DFBPPR8920 ---- Animal proteins ---- Serine/threonine-protein kinase OSR1
Source.2330: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.2331: DFBPPR8969 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha
Source.2332: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.2333: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.2334: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.2335: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.2336: DFBPPR9010 ---- Animal proteins ---- 5'-AMP-activated protein kinase subunit gamma-3
Source.2337: DFBPPR9022 ---- Animal proteins ---- Prothrombin
Source.2338: DFBPPR9029 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase isozyme L5
Source.2339: DFBPPR9048 ---- Animal proteins ---- Neuroendocrine protein 7B2
Source.2340: DFBPPR9050 ---- Animal proteins ---- Tubulin beta chain
Source.2341: DFBPPR9055 ---- Animal proteins ---- Ameloblastin
Source.2342: DFBPPR9071 ---- Animal proteins ---- Nuclear receptor coactivator 1
Source.2343: DFBPPR9075 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.2344: DFBPPR9083 ---- Animal proteins ---- Leukocyte surface antigen CD47
Source.2345: DFBPPR9085 ---- Animal proteins ---- Membrane-associated progesterone receptor component 1
Source.2346: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.2347: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.2348: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.2349: DFBPPR9108 ---- Animal proteins ---- Somatostatin
Source.2350: DFBPPR9110 ---- Animal proteins ---- Insulin-like growth factor I
Source.2351: DFBPPR9125 ---- Animal proteins ---- G protein-activated inward rectifier potassium channel 4
Source.2352: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.2353: DFBPPR9133 ---- Animal proteins ---- Pyruvate dehydrogenase E1 component subunit alpha, somatic form, mitochondrial
Source.2354: DFBPPR9153 ---- Animal proteins ---- D-3-phosphoglycerate dehydrogenase
Source.2355: DFBPPR9163 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.2356: DFBPPR9165 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.2357: DFBPPR9170 ---- Animal proteins ---- 4-trimethylaminobutyraldehyde dehydrogenase
Source.2358: DFBPPR9184 ---- Animal proteins ---- Prolyl endopeptidase
Source.2359: DFBPPR9193 ---- Animal proteins ---- Glycolipid transfer protein
Source.2360: DFBPPR9197 ---- Animal proteins ---- Myosin-7
Source.2361: DFBPPR9203 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.2362: DFBPPR9224 ---- Animal proteins ---- Solute carrier family 22 member 6
Source.2363: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10
Source.2364: DFBPPR9236 ---- Animal proteins ---- Radixin
Source.2365: DFBPPR9237 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3
Source.2366: DFBPPR9242 ---- Animal proteins ---- Carboxypeptidase B
Source.2367: DFBPPR9250 ---- Animal proteins ---- Junction plakoglobin
Source.2368: DFBPPR9254 ---- Animal proteins ---- Complement factor D
Source.2369: DFBPPR9270 ---- Animal proteins ---- Complement C1s subcomponent
Source.2370: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.2371: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3
Source.2372: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.2373: DFBPPR9305 ---- Animal proteins ---- Myosin-4
Source.2374: DFBPPR9309 ---- Animal proteins ---- Sperm flagellar protein 2
Source.2375: DFBPPR9315 ---- Animal proteins ---- Protein S100-G
Source.2376: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.2377: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase
Source.2378: DFBPPR9341 ---- Animal proteins ---- Paralemmin-1
Source.2379: DFBPPR9342 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.2380: DFBPPR9346 ---- Animal proteins ---- Myozenin-1
Source.2381: DFBPPR9351 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 65 kDa regulatory subunit A alpha isoform
Source.2382: DFBPPR9352 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.2383: DFBPPR9363 ---- Animal proteins ---- Moesin
Source.2384: DFBPPR9369 ---- Animal proteins ---- Nuclear receptor subfamily 6 group A member 1
Source.2385: DFBPPR9370 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.2386: DFBPPR9372 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.2387: DFBPPR9373 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.2388: DFBPPR9375 ---- Animal proteins ---- L-threonine 3-dehydrogenase, mitochondrial
Source.2389: DFBPPR9379 ---- Animal proteins ---- Secretory carrier-associated membrane protein 1
Source.2390: DFBPPR9395 ---- Animal proteins ---- Calponin-2
Source.2391: DFBPPR9398 ---- Animal proteins ---- Myosin-2
Source.2392: DFBPPR9403 ---- Animal proteins ---- Ras-related protein Rab-34
Source.2393: DFBPPR9405 ---- Animal proteins ---- Myosin-1
Source.2394: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type
Source.2395: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type
Source.2396: DFBPPR9408 ---- Animal proteins ---- CD70 antigen
Source.2397: DFBPPR9409 ---- Animal proteins ---- Doublesex- and mab-3-related transcription factor 1
Source.2398: DFBPPR9414 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2399: DFBPPR9415 ---- Animal proteins ---- Iron-responsive element-binding protein 2
Source.2400: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.2401: DFBPPR9427 ---- Animal proteins ---- Protein quaking
Source.2402: DFBPPR9429 ---- Animal proteins ---- Transmembrane protein 59
Source.2403: DFBPPR9430 ---- Animal proteins ---- Transmembrane protein 59
Source.2404: DFBPPR9432 ---- Animal proteins ---- Pre-mRNA-splicing factor ATP-dependent RNA helicase DHX16
Source.2405: DFBPPR9447 ---- Animal proteins ---- Myosin light chain 4
Source.2406: DFBPPR9451 ---- Animal proteins ---- M-phase inducer phosphatase 3
Source.2407: DFBPPR9452 ---- Animal proteins ---- Tubulin beta chain
Source.2408: DFBPPR9497 ---- Animal proteins ---- Myoglobin
Source.2409: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1
Source.2410: DFBPPR9507 ---- Animal proteins ---- Coatomer subunit beta
Source.2411: DFBPPR9510 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 2
Source.2412: DFBPPR9519 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.2413: DFBPPR9524 ---- Animal proteins ---- Sideroflexin-1
Source.2414: DFBPPR9535 ---- Animal proteins ---- Ribonuclease inhibitor
Source.2415: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.2416: DFBPPR9552 ---- Animal proteins ---- Electron transfer flavoprotein subunit beta
Source.2417: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.2418: DFBPPR9583 ---- Animal proteins ---- Protocadherin-11 X-linked
Source.2419: DFBPPR9592 ---- Animal proteins ---- Sodium/nucleoside cotransporter 1
Source.2420: DFBPPR9595 ---- Animal proteins ---- Platelet-activating factor receptor
Source.2421: DFBPPR9604 ---- Animal proteins ---- Mitochondrial uncoupling protein 2
Source.2422: DFBPPR9606 ---- Animal proteins ---- Pancreatic prohormone precursor
Source.2423: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2424: DFBPPR9650 ---- Animal proteins ---- Muellerian-inhibiting factor
Source.2425: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.2426: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.2427: DFBPPR9729 ---- Animal proteins ---- Secretagogin
Source.2428: DFBPPR9734 ---- Animal proteins ---- Replication termination factor 2
Source.2429: DFBPPR9739 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.2430: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain
Source.2431: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.2432: DFBPPR9751 ---- Animal proteins ---- Perilipin-3
Source.2433: DFBPPR9759 ---- Animal proteins ---- Palmdelphin
Source.2434: DFBPPR9801 ---- Animal proteins ---- Tropomyosin alpha-3 chain
Source.2435: DFBPPR9808 ---- Animal proteins ---- Epidermal growth factor-like protein 8
Source.2436: DFBPPR9816 ---- Animal proteins ---- Metaxin-2
Source.2437: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.2438: DFBPPR9821 ---- Animal proteins ---- COP9 signalosome complex subunit 6
Source.2439: DFBPPR9839 ---- Animal proteins ---- Nurim
Source.2440: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.2441: DFBPPR9859 ---- Animal proteins ---- Coiled-coil alpha-helical rod protein 1
Source.2442: DFBPPR9860 ---- Animal proteins ---- Transcription factor 19
Source.2443: DFBPPR9897 ---- Animal proteins ---- Negative elongation factor D
Source.2444: DFBPPR9898 ---- Animal proteins ---- Isocitrate dehydrogenase [NAD] subunit beta, mitochondrial
Source.2445: DFBPPR9904 ---- Animal proteins ---- EKC/KEOPS complex subunit GON7
Source.2446: DFBPPR9906 ---- Animal proteins ---- Tetraspanin-9
Source.2447: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.2448: DFBPPR9938 ---- Animal proteins ---- FUN14 domain-containing protein 2
Source.2449: DFBPPR9940 ---- Animal proteins ---- Neuronatin
Source.2450: DFBPPR9963 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.2451: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2452: DFBPPR9978 ---- Animal proteins ---- Carbonic anhydrase 2
Source.2453: DFBPPR9986 ---- Animal proteins ---- Aggrecan core protein
Source.2454: DFBPPR9988 ---- Animal proteins ---- Vinculin
Source.2455: DFBPPR9991 ---- Animal proteins ---- Insulin-like growth factor I
Source.2456: DFBPPR9998 ---- Animal proteins ---- Glycine dehydrogenase (decarboxylating), mitochondrial
Source.2457: DFBPPR10000 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2458: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.2459: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.2460: DFBPPR10022 ---- Animal proteins ---- Homeobox protein MSX-2
Source.2461: DFBPPR10030 ---- Animal proteins ---- Calbindin
Source.2462: DFBPPR10033 ---- Animal proteins ---- Apolipoprotein A-I
Source.2463: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.2464: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.2465: DFBPPR10042 ---- Animal proteins ---- Retinoic acid receptor beta
Source.2466: DFBPPR10043 ---- Animal proteins ---- Poly [ADP-ribose] polymerase 1
Source.2467: DFBPPR10050 ---- Animal proteins ---- Protocadherin-15
Source.2468: DFBPPR10061 ---- Animal proteins ---- Ovocleidin-17
Source.2469: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11
Source.2470: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9
Source.2471: DFBPPR10078 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2472: DFBPPR10080 ---- Animal proteins ---- High affinity nerve growth factor receptor
Source.2473: DFBPPR10081 ---- Animal proteins ---- Heat shock factor protein 2
Source.2474: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.2475: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.2476: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2
Source.2477: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.2478: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog
Source.2479: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.2480: DFBPPR10099 ---- Animal proteins ---- Bcl-2-like protein 1
Source.2481: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.2482: DFBPPR10109 ---- Animal proteins ---- Homeobox protein GHOX-7
Source.2483: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.2484: DFBPPR10117 ---- Animal proteins ---- 60 kDa heat shock protein, mitochondrial
Source.2485: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.2486: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.2487: DFBPPR10125 ---- Animal proteins ---- Leucine-rich repeat transmembrane protein FLRT3
Source.2488: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.2489: DFBPPR10132 ---- Animal proteins ---- Calpain-1 catalytic subunit
Source.2490: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.2491: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.2492: DFBPPR10163 ---- Animal proteins ---- Annexin A6
Source.2493: DFBPPR10165 ---- Animal proteins ---- DNA helicase MCM8
Source.2494: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.2495: DFBPPR10177 ---- Animal proteins ---- Talin-1
Source.2496: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.2497: DFBPPR10182 ---- Animal proteins ---- Synaptotagmin-1
Source.2498: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.2499: DFBPPR10185 ---- Animal proteins ---- Unconventional myosin-Ia
Source.2500: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.2501: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.2502: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.2503: DFBPPR10207 ---- Animal proteins ---- Paralemmin-1
Source.2504: DFBPPR10215 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.2505: DFBPPR10229 ---- Animal proteins ---- Phosphoinositide 3-kinase adapter protein 1
Source.2506: DFBPPR10240 ---- Animal proteins ---- Cerberus
Source.2507: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.2508: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.2509: DFBPPR10262 ---- Animal proteins ---- Dorsalin-1
Source.2510: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.2511: DFBPPR10273 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.2512: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.2513: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2514: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.2515: DFBPPR10284 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.2516: DFBPPR10290 ---- Animal proteins ---- Trifunctional purine biosynthetic protein adenosine-3
Source.2517: DFBPPR10291 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.2518: DFBPPR10292 ---- Animal proteins ---- Lutropin-choriogonadotropic hormone receptor
Source.2519: DFBPPR10294 ---- Animal proteins ---- Transcription factor VBP
Source.2520: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.2521: DFBPPR10307 ---- Animal proteins ---- Multiple inositol polyphosphate phosphatase 1
Source.2522: DFBPPR10309 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.2523: DFBPPR10310 ---- Animal proteins ---- Xanthine dehydrogenase/oxidase
Source.2524: DFBPPR10311 ---- Animal proteins ---- Homeobox protein engrailed-2
Source.2525: DFBPPR10316 ---- Animal proteins ---- Dynactin subunit 1
Source.2526: DFBPPR10321 ---- Animal proteins ---- ADP-ribose glycohydrolase ARH3
Source.2527: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.2528: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7
Source.2529: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.2530: DFBPPR10334 ---- Animal proteins ---- Retinoic acid receptor RXR-gamma
Source.2531: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.2532: DFBPPR10359 ---- Animal proteins ---- Proto-oncogene c-Rel
Source.2533: DFBPPR10364 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.2534: DFBPPR10366 ---- Animal proteins ---- Nuclear factor interleukin-3-regulated protein
Source.2535: DFBPPR10374 ---- Animal proteins ---- Cadherin-1
Source.2536: DFBPPR10381 ---- Animal proteins ---- ATP-dependent RNA helicase SUPV3L1, mitochondrial
Source.2537: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.2538: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.2539: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65
Source.2540: DFBPPR10396 ---- Animal proteins ---- DNA helicase MCM9
Source.2541: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.2542: DFBPPR10406 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle, adult
Source.2543: DFBPPR10409 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.2544: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.2545: DFBPPR10412 ---- Animal proteins ---- Dysbindin
Source.2546: DFBPPR10416 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.2547: DFBPPR10417 ---- Animal proteins ---- Cytochrome P450 1A5
Source.2548: DFBPPR10419 ---- Animal proteins ---- Rho family-interacting cell polarization regulator 2
Source.2549: DFBPPR10424 ---- Animal proteins ---- Charged multivesicular body protein 4b
Source.2550: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10
Source.2551: DFBPPR10435 ---- Animal proteins ---- Spectrin alpha chain, non-erythrocytic 1
Source.2552: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.2553: DFBPPR10456 ---- Animal proteins ---- Neuroserpin
Source.2554: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2555: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.2556: DFBPPR10481 ---- Animal proteins ---- Syndecan-3
Source.2557: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.2558: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.2559: DFBPPR10490 ---- Animal proteins ---- Tudor-interacting repair regulator protein
Source.2560: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.2561: DFBPPR10496 ---- Animal proteins ---- Vascular endothelial growth factor A
Source.2562: DFBPPR10498 ---- Animal proteins ---- Cytochrome P450 1A4
Source.2563: DFBPPR10501 ---- Animal proteins ---- Very low-density lipoprotein receptor
Source.2564: DFBPPR10504 ---- Animal proteins ---- Elongator complex protein 3
Source.2565: DFBPPR10508 ---- Animal proteins ---- Septin-2
Source.2566: DFBPPR10524 ---- Animal proteins ---- Protein disulfide-isomerase
Source.2567: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.2568: DFBPPR10534 ---- Animal proteins ---- DNA ligase 4
Source.2569: DFBPPR10538 ---- Animal proteins ---- Retinoblastoma-associated protein
Source.2570: DFBPPR10540 ---- Animal proteins ---- Nucleoside diphosphate kinase
Source.2571: DFBPPR10544 ---- Animal proteins ---- Thioredoxin
Source.2572: DFBPPR10546 ---- Animal proteins ---- Calmodulin
Source.2573: DFBPPR10552 ---- Animal proteins ---- Transcription factor AP-1
Source.2574: DFBPPR10555 ---- Animal proteins ---- Fanconi anemia group M protein
Source.2575: DFBPPR10563 ---- Animal proteins ---- Optineurin
Source.2576: DFBPPR10567 ---- Animal proteins ---- Glycine cleavage system H protein, mitochondrial
Source.2577: DFBPPR10576 ---- Animal proteins ---- Inosine triphosphate pyrophosphatase
Source.2578: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.2579: DFBPPR10580 ---- Animal proteins ---- Creatine kinase U-type, mitochondrial
Source.2580: DFBPPR10584 ---- Animal proteins ---- Nuclear distribution protein nudE homolog 1
Source.2581: DFBPPR10588 ---- Animal proteins ---- Myosin-1B
Source.2582: DFBPPR10589 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.2583: DFBPPR10590 ---- Animal proteins ---- Centromere protein X
Source.2584: DFBPPR10599 ---- Animal proteins ---- Chromosome-associated kinesin KIF4
Source.2585: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.2586: DFBPPR10603 ---- Animal proteins ---- Collagen alpha-3(VI) chain
Source.2587: DFBPPR10604 ---- Animal proteins ---- Integrin alpha-8
Source.2588: DFBPPR10607 ---- Animal proteins ---- Collagen alpha-2(VI) chain
Source.2589: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.2590: DFBPPR10616 ---- Animal proteins ---- Cholecystokinin
Source.2591: DFBPPR10618 ---- Animal proteins ---- Mismatch repair endonuclease PMS2
Source.2592: DFBPPR10620 ---- Animal proteins ---- Centromere protein T
Source.2593: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.2594: DFBPPR10628 ---- Animal proteins ---- Nuclear factor NF-kappa-B p100 subunit
Source.2595: DFBPPR10629 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.2596: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.2597: DFBPPR10631 ---- Animal proteins ---- Kinetochore protein Nuf2
Source.2598: DFBPPR10635 ---- Animal proteins ---- Dual serine/threonine and tyrosine protein kinase
Source.2599: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.2600: DFBPPR10648 ---- Animal proteins ---- PAN2-PAN3 deadenylation complex catalytic subunit PAN2
Source.2601: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.2602: DFBPPR10653 ---- Animal proteins ---- Contactin-1
Source.2603: DFBPPR10654 ---- Animal proteins ---- Fibronectin
Source.2604: DFBPPR10657 ---- Animal proteins ---- Tubulin beta-7 chain
Source.2605: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.2606: DFBPPR10666 ---- Animal proteins ---- Tubulin beta-2 chain
Source.2607: DFBPPR10670 ---- Animal proteins ---- Interferon lambda-3
Source.2608: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.2609: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.2610: DFBPPR10678 ---- Animal proteins ---- Inositol-tetrakisphosphate 1-kinase
Source.2611: DFBPPR10679 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.2612: DFBPPR10682 ---- Animal proteins ---- Endophilin-A3
Source.2613: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.2614: DFBPPR10696 ---- Animal proteins ---- pre-rRNA 2'-O-ribose RNA methyltransferase FTSJ3
Source.2615: DFBPPR10703 ---- Animal proteins ---- Tensin
Source.2616: DFBPPR10704 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 2
Source.2617: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.2618: DFBPPR10707 ---- Animal proteins ---- Tubulin beta-4 chain
Source.2619: DFBPPR10708 ---- Animal proteins ---- Structural maintenance of chromosomes protein 2
Source.2620: DFBPPR10709 ---- Animal proteins ---- Docking protein 3
Source.2621: DFBPPR10718 ---- Animal proteins ---- Myosin light chain 1, skeletal muscle isoform
Source.2622: DFBPPR10722 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 10
Source.2623: DFBPPR10726 ---- Animal proteins ---- Ciliary neurotrophic factor
Source.2624: DFBPPR10727 ---- Animal proteins ---- Vimentin
Source.2625: DFBPPR10728 ---- Animal proteins ---- Myelomonocytic growth factor
Source.2626: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.2627: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1
Source.2628: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.2629: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.2630: DFBPPR10750 ---- Animal proteins ---- Phosphatidylserine synthase 2
Source.2631: DFBPPR10753 ---- Animal proteins ---- Hypermethylated in cancer 1 protein
Source.2632: DFBPPR10754 ---- Animal proteins ---- Hydroxymethylglutaryl-CoA synthase, cytoplasmic
Source.2633: DFBPPR10784 ---- Animal proteins ---- Tubulin beta-3 chain
Source.2634: DFBPPR10797 ---- Animal proteins ---- Homeobox protein Hox-D12
Source.2635: DFBPPR10801 ---- Animal proteins ---- Collagen alpha-1(VI) chain
Source.2636: DFBPPR10802 ---- Animal proteins ---- Kinesin-like protein KIF18B
Source.2637: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.2638: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.2639: DFBPPR10813 ---- Animal proteins ---- Neurofilament medium polypeptide
Source.2640: DFBPPR10822 ---- Animal proteins ---- Ribosomal protein S6 kinase 2 alpha
Source.2641: DFBPPR10823 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.2642: DFBPPR10834 ---- Animal proteins ---- Centrosomal protein of 63 kDa
Source.2643: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.2644: DFBPPR10858 ---- Animal proteins ---- Rho GTPase-activating protein 26
Source.2645: DFBPPR10862 ---- Animal proteins ---- Glycerol-3-phosphate phosphatase
Source.2646: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.2647: DFBPPR10880 ---- Animal proteins ---- Golgi apparatus protein 1
Source.2648: DFBPPR10882 ---- Animal proteins ---- Noggin
Source.2649: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.2650: DFBPPR10884 ---- Animal proteins ---- Tapasin
Source.2651: DFBPPR10888 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.2652: DFBPPR10893 ---- Animal proteins ---- Tubulin beta-6 chain
Source.2653: DFBPPR10895 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.2654: DFBPPR10896 ---- Animal proteins ---- Contactin-5
Source.2655: DFBPPR10903 ---- Animal proteins ---- Myosin light chain 3, skeletal muscle isoform
Source.2656: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.2657: DFBPPR10919 ---- Animal proteins ---- Ski oncogene
Source.2658: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2
Source.2659: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.2660: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.2661: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.2662: DFBPPR10938 ---- Animal proteins ---- Serine/threonine-protein kinase mos
Source.2663: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.2664: DFBPPR10941 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 1
Source.2665: DFBPPR10944 ---- Animal proteins ---- Tubulin beta-1 chain
Source.2666: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.2667: DFBPPR10949 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-2
Source.2668: DFBPPR10951 ---- Animal proteins ---- Probable glutamate receptor
Source.2669: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like
Source.2670: DFBPPR10969 ---- Animal proteins ---- Paraspeckle component 1
Source.2671: DFBPPR10970 ---- Animal proteins ---- Prohibitin
Source.2672: DFBPPR10975 ---- Animal proteins ---- Cytoplasmic dynein 1 light intermediate chain 1
Source.2673: DFBPPR10976 ---- Animal proteins ---- Lamin-B2
Source.2674: DFBPPR10981 ---- Animal proteins ---- Kinectin
Source.2675: DFBPPR10983 ---- Animal proteins ---- DNA replication licensing factor MCM3
Source.2676: DFBPPR10993 ---- Animal proteins ---- Pericentriolar material 1 protein
Source.2677: DFBPPR10994 ---- Animal proteins ---- Tubulin beta-5 chain
Source.2678: DFBPPR10997 ---- Animal proteins ---- Tubulin-specific chaperone D
Source.2679: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein
Source.2680: DFBPPR11009 ---- Animal proteins ---- Cathelicidin-B1
Source.2681: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.2682: DFBPPR11014 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F
Source.2683: DFBPPR11023 ---- Animal proteins ---- 43 kDa receptor-associated protein of the synapse
Source.2684: DFBPPR11032 ---- Animal proteins ---- B-cadherin
Source.2685: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.2686: DFBPPR11035 ---- Animal proteins ---- Protein Dr1
Source.2687: DFBPPR11037 ---- Animal proteins ---- Disheveled-associated activator of morphogenesis 2
Source.2688: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.2689: DFBPPR11044 ---- Animal proteins ---- Mitochondrial proton/calcium exchanger protein
Source.2690: DFBPPR11056 ---- Animal proteins ---- Anti-apoptotic protein NR13
Source.2691: DFBPPR11064 ---- Animal proteins ---- General transcription factor IIH subunit 5
Source.2692: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2693: DFBPPR11073 ---- Animal proteins ---- Axin-1
Source.2694: DFBPPR11075 ---- Animal proteins ---- Sigma non-opioid intracellular receptor 1
Source.2695: DFBPPR11079 ---- Animal proteins ---- Frizzled-1
Source.2696: DFBPPR11080 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 51 homolog
Source.2697: DFBPPR11083 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.2698: DFBPPR11094 ---- Animal proteins ---- Transcription factor MafA
Source.2699: DFBPPR11095 ---- Animal proteins ---- Ras-related protein Rab-33B
Source.2700: DFBPPR11100 ---- Animal proteins ---- Beta-taxilin
Source.2701: DFBPPR11106 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator-like protein 2
Source.2702: DFBPPR11112 ---- Animal proteins ---- Protein quaking
Source.2703: DFBPPR11114 ---- Animal proteins ---- E3 ubiquitin-protein ligase listerin
Source.2704: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.2705: DFBPPR11130 ---- Animal proteins ---- Myosin heavy chain, cardiac muscle isoform
Source.2706: DFBPPR11131 ---- Animal proteins ---- Phenylalanine--tRNA ligase alpha subunit
Source.2707: DFBPPR11133 ---- Animal proteins ---- Transcription factor MafG
Source.2708: DFBPPR11140 ---- Animal proteins ---- Forkhead box protein G1
Source.2709: DFBPPR11141 ---- Animal proteins ---- Serine/threonine-protein kinase ULK3
Source.2710: DFBPPR11158 ---- Animal proteins ---- Phosphatase and actin regulator 1
Source.2711: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.2712: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.2713: DFBPPR11175 ---- Animal proteins ---- Oligodendrocyte transcription factor 2
Source.2714: DFBPPR11179 ---- Animal proteins ---- Cartilage-associated protein
Source.2715: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.2716: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1
Source.2717: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.2718: DFBPPR11195 ---- Animal proteins ---- Mitochondrial Rho GTPase 1
Source.2719: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.2720: DFBPPR11197 ---- Animal proteins ---- Phosphatase and actin regulator 4
Source.2721: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.2722: DFBPPR11204 ---- Animal proteins ---- Protein Hook homolog 1
Source.2723: DFBPPR11210 ---- Animal proteins ---- UbiA prenyltransferase domain-containing protein 1
Source.2724: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.2725: DFBPPR11219 ---- Animal proteins ---- Cytospin-A
Source.2726: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.2727: DFBPPR11225 ---- Animal proteins ---- Ornithine decarboxylase
Source.2728: DFBPPR11230 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.2729: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.2730: DFBPPR11249 ---- Animal proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.2731: DFBPPR11254 ---- Animal proteins ---- Intracellular hyaluronan-binding protein 4
Source.2732: DFBPPR11259 ---- Animal proteins ---- Homeobox protein MSX-1
Source.2733: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.2734: DFBPPR11264 ---- Animal proteins ---- Charged multivesicular body protein 7
Source.2735: DFBPPR11273 ---- Animal proteins ---- Carbohydrate sulfotransferase 3
Source.2736: DFBPPR11291 ---- Animal proteins ---- Activating signal cointegrator 1 complex subunit 3
Source.2737: DFBPPR11292 ---- Animal proteins ---- Neurogenic differentiation factor 4
Source.2738: DFBPPR11293 ---- Animal proteins ---- RIMS-binding protein 2
Source.2739: DFBPPR11294 ---- Animal proteins ---- Frizzled-8
Source.2740: DFBPPR11297 ---- Animal proteins ---- Prohibitin-2
Source.2741: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.2742: DFBPPR11303 ---- Animal proteins ---- Keratin, type I cytoskeletal 14
Source.2743: DFBPPR11311 ---- Animal proteins ---- Forkhead box protein D1
Source.2744: DFBPPR11313 ---- Animal proteins ---- Transmembrane anterior posterior transformation protein 1 homolog
Source.2745: DFBPPR11316 ---- Animal proteins ---- Actin-related protein 2
Source.2746: DFBPPR11318 ---- Animal proteins ---- Chromatin modification-related protein MEAF6
Source.2747: DFBPPR11319 ---- Animal proteins ---- Dihydropyrimidinase-related protein 2
Source.2748: DFBPPR11328 ---- Animal proteins ---- Fos-related antigen 2
Source.2749: DFBPPR11330 ---- Animal proteins ---- Proteasome activator complex subunit 3
Source.2750: DFBPPR11334 ---- Animal proteins ---- Heme oxygenase 1
Source.2751: DFBPPR11335 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.2752: DFBPPR11342 ---- Animal proteins ---- E3 ubiquitin-protein ligase BRE1A
Source.2753: DFBPPR11347 ---- Animal proteins ---- Neogenin
Source.2754: DFBPPR11360 ---- Animal proteins ---- NSFL1 cofactor p47
Source.2755: DFBPPR11361 ---- Animal proteins ---- Glutamine-dependent NAD(+) synthetase
Source.2756: DFBPPR11369 ---- Animal proteins ---- SAGA-associated factor 29
Source.2757: DFBPPR11376 ---- Animal proteins ---- Lamin-A
Source.2758: DFBPPR11377 ---- Animal proteins ---- UBX domain-containing protein 2B
Source.2759: DFBPPR11379 ---- Animal proteins ---- Guanylyl cyclase-activating protein 2
Source.2760: DFBPPR11383 ---- Animal proteins ---- Homeobox protein CDX-1
Source.2761: DFBPPR11385 ---- Animal proteins ---- EGF domain-specific O-linked N-acetylglucosamine transferase
Source.2762: DFBPPR11391 ---- Animal proteins ---- Insulin-like growth factor-binding protein 2
Source.2763: DFBPPR11404 ---- Animal proteins ---- PCNA-interacting partner
Source.2764: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.2765: DFBPPR11415 ---- Animal proteins ---- Elongation factor Tu, mitochondrial
Source.2766: DFBPPR11421 ---- Animal proteins ---- Keratin, type I cytoskeletal 19
Source.2767: DFBPPR11429 ---- Animal proteins ---- Centrosomal protein 20
Source.2768: DFBPPR11431 ---- Animal proteins ---- Putative glycerol kinase 5
Source.2769: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.2770: DFBPPR11455 ---- Animal proteins ---- Growth factor receptor-bound protein 2
Source.2771: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.2772: DFBPPR11472 ---- Animal proteins ---- Regulator of G-protein signaling 9-binding protein
Source.2773: DFBPPR11480 ---- Animal proteins ---- Cytochrome P450 1A2
Source.2774: DFBPPR11481 ---- Animal proteins ---- Homeobox protein HMX3
Source.2775: DFBPPR11487 ---- Animal proteins ---- WW domain-containing oxidoreductase
Source.2776: DFBPPR11490 ---- Animal proteins ---- Twinfilin-2
Source.2777: DFBPPR11493 ---- Animal proteins ---- Interferon regulatory factor 1
Source.2778: DFBPPR11495 ---- Animal proteins ---- Calretinin
Source.2779: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7
Source.2780: DFBPPR11507 ---- Animal proteins ---- Outer dense fiber protein 2
Source.2781: DFBPPR11509 ---- Animal proteins ---- T-cell acute lymphocytic leukemia protein 1 homolog
Source.2782: DFBPPR11511 ---- Animal proteins ---- E3 ubiquitin-protein ligase MIB2
Source.2783: DFBPPR11516 ---- Animal proteins ---- Gastrin/cholecystokinin-like peptide
Source.2784: DFBPPR11535 ---- Animal proteins ---- Homeobox protein CHOX-CAD
Source.2785: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.2786: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.2787: DFBPPR11559 ---- Animal proteins ---- Queuine tRNA-ribosyltransferase accessory subunit 2
Source.2788: DFBPPR11560 ---- Animal proteins ---- Protein pelota homolog
Source.2789: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.2790: DFBPPR11566 ---- Animal proteins ---- Cysteine--tRNA ligase, cytoplasmic
Source.2791: DFBPPR11568 ---- Animal proteins ---- N-myc proto-oncogene protein
Source.2792: DFBPPR11569 ---- Animal proteins ---- Homeobox protein Hox-D8
Source.2793: DFBPPR11573 ---- Animal proteins ---- tRNA-specific adenosine deaminase 1
Source.2794: DFBPPR11575 ---- Animal proteins ---- Myosin light chain 1, cardiac muscle
Source.2795: DFBPPR11577 ---- Animal proteins ---- Vasotocin-neurophysin VT
Source.2796: DFBPPR11582 ---- Animal proteins ---- Coatomer subunit beta
Source.2797: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.2798: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622
Source.2799: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein
Source.2800: DFBPPR11593 ---- Animal proteins ---- Syndetin
Source.2801: DFBPPR11604 ---- Animal proteins ---- Centromere protein I
Source.2802: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.2803: DFBPPR11620 ---- Animal proteins ---- Dynactin subunit 2
Source.2804: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5
Source.2805: DFBPPR11626 ---- Animal proteins ---- tRNA-splicing endonuclease subunit Sen2
Source.2806: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.2807: DFBPPR11631 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 1
Source.2808: DFBPPR11653 ---- Animal proteins ---- Erythroblast NAD(P)(+)--arginine ADP-ribosyltransferase
Source.2809: DFBPPR11661 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.2810: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.2811: DFBPPR11673 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 4
Source.2812: DFBPPR11677 ---- Animal proteins ---- SOSS complex subunit C
Source.2813: DFBPPR11679 ---- Animal proteins ---- Spondin-1
Source.2814: DFBPPR11683 ---- Animal proteins ---- Somatostatin
Source.2815: DFBPPR11684 ---- Animal proteins ---- 14-3-3 protein theta
Source.2816: DFBPPR11696 ---- Animal proteins ---- Brain-specific homeobox protein homolog
Source.2817: DFBPPR11698 ---- Animal proteins ---- NADH-cytochrome b5 reductase 2
Source.2818: DFBPPR11699 ---- Animal proteins ---- NEDD8-activating enzyme E1 regulatory subunit
Source.2819: DFBPPR11700 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.2820: DFBPPR11701 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.2821: DFBPPR11704 ---- Animal proteins ---- Pre-mRNA-splicing factor SLU7
Source.2822: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.2823: DFBPPR11709 ---- Animal proteins ---- Xin actin-binding repeat-containing protein 1
Source.2824: DFBPPR11717 ---- Animal proteins ---- DNA polymerase delta subunit 3
Source.2825: DFBPPR11720 ---- Animal proteins ---- Interleukin-17 receptor D
Source.2826: DFBPPR11724 ---- Animal proteins ---- Protein TENP
Source.2827: DFBPPR11731 ---- Animal proteins ---- Protein polybromo-1
Source.2828: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.2829: DFBPPR11740 ---- Animal proteins ---- 55 kDa erythrocyte membrane protein
Source.2830: DFBPPR11744 ---- Animal proteins ---- Centrosomal protein of 41 kDa
Source.2831: DFBPPR11745 ---- Animal proteins ---- Digestive organ expansion factor homolog
Source.2832: DFBPPR11747 ---- Animal proteins ---- Microfibrillar-associated protein 1
Source.2833: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1
Source.2834: DFBPPR11759 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit M
Source.2835: DFBPPR11762 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.2836: DFBPPR11775 ---- Animal proteins ---- Anaphase-promoting complex subunit 5
Source.2837: DFBPPR11792 ---- Animal proteins ---- Selenoprotein W
Source.2838: DFBPPR11793 ---- Animal proteins ---- Fas-binding factor 1 homolog
Source.2839: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.2840: DFBPPR11809 ---- Animal proteins ---- Ras-specific guanine nucleotide-releasing factor RalGPS1
Source.2841: DFBPPR11814 ---- Animal proteins ---- Centromere protein R
Source.2842: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.2843: DFBPPR11846 ---- Animal proteins ---- Golgin subfamily A member 7
Source.2844: DFBPPR11851 ---- Animal proteins ---- Borealin
Source.2845: DFBPPR11864 ---- Animal proteins ---- Radixin
Source.2846: DFBPPR11866 ---- Animal proteins ---- Replication termination factor 2
Source.2847: DFBPPR11867 ---- Animal proteins ---- Protein MIS12 homolog
Source.2848: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.2849: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.2850: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A
Source.2851: DFBPPR11911 ---- Animal proteins ---- NmrA-like family domain-containing protein 1
Source.2852: DFBPPR11918 ---- Animal proteins ---- Nucleoside diphosphate-linked moiety X motif 19
Source.2853: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.2854: DFBPPR11924 ---- Animal proteins ---- Centromere protein P
Source.2855: DFBPPR11928 ---- Animal proteins ---- Cyclin-C
Source.2856: DFBPPR11932 ---- Animal proteins ---- 14-3-3 protein zeta
Source.2857: DFBPPR11937 ---- Animal proteins ---- Bromodomain-containing protein 7
Source.2858: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.2859: DFBPPR11940 ---- Animal proteins ---- Calmodulin, striated muscle
Source.2860: DFBPPR11944 ---- Animal proteins ---- High mobility group protein 20A
Source.2861: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.2862: DFBPPR11949 ---- Animal proteins ---- Spindle assembly abnormal protein 6 homolog
Source.2863: DFBPPR11951 ---- Animal proteins ---- Integrator complex subunit 2
Source.2864: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.2865: DFBPPR11959 ---- Animal proteins ---- Deubiquitinase OTUD6B
Source.2866: DFBPPR11968 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5B
Source.2867: DFBPPR11975 ---- Animal proteins ---- Mini-chromosome maintenance complex-binding protein
Source.2868: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.2869: DFBPPR11983 ---- Animal proteins ---- Tumor protein D53 homolog
Source.2870: DFBPPR11988 ---- Animal proteins ---- Transmembrane channel-like protein 3
Source.2871: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.2872: DFBPPR12008 ---- Animal proteins ---- Keratin, type II cytoskeletal cochleal
Source.2873: DFBPPR12014 ---- Animal proteins ---- Raftlin
Source.2874: DFBPPR12029 ---- Animal proteins ---- SET and MYND domain-containing protein 5
Source.2875: DFBPPR12031 ---- Animal proteins ---- Exportin-7
Source.2876: DFBPPR12039 ---- Animal proteins ---- Protein GOLM2
Source.2877: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24
Source.2878: DFBPPR12055 ---- Animal proteins ---- Importin-13
Source.2879: DFBPPR12064 ---- Animal proteins ---- Integrator complex subunit 9
Source.2880: DFBPPR12068 ---- Animal proteins ---- Serine/arginine repetitive matrix protein 1
Source.2881: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.2882: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.2883: DFBPPR12071 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1
Source.2884: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.2885: DFBPPR12081 ---- Animal proteins ---- 14-3-3 protein gamma
Source.2886: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.2887: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.2888: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.2889: DFBPPR12101 ---- Animal proteins ---- Highly divergent homeobox
Source.2890: DFBPPR12110 ---- Animal proteins ---- Myosin light chain, embryonic
Source.2891: DFBPPR12114 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 21
Source.2892: DFBPPR12130 ---- Animal proteins ---- Rho GTPase-activating protein 19
Source.2893: DFBPPR12134 ---- Animal proteins ---- Coiled-coil domain-containing protein 93
Source.2894: DFBPPR12149 ---- Animal proteins ---- Major vault protein
Source.2895: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.2896: DFBPPR12164 ---- Animal proteins ---- Neo-calmodulin
Source.2897: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45
Source.2898: DFBPPR12189 ---- Animal proteins ---- Arginine and glutamate-rich protein 1
Source.2899: DFBPPR12198 ---- Animal proteins ---- RING finger protein 141
Source.2900: DFBPPR12201 ---- Animal proteins ---- Protein lin-52 homolog
Source.2901: DFBPPR12207 ---- Animal proteins ---- WD repeat, SAM and U-box domain-containing protein 1
Source.2902: DFBPPR12216 ---- Animal proteins ---- 39S ribosomal protein L50, mitochondrial
Source.2903: DFBPPR12221 ---- Animal proteins ---- Coiled-coil domain-containing protein 174
Source.2904: DFBPPR12226 ---- Animal proteins ---- Protein DGCR6
Source.2905: DFBPPR12227 ---- Animal proteins ---- Cerebellar degeneration-related protein 2
Source.2906: DFBPPR12229 ---- Animal proteins ---- Out at first protein homolog
Source.2907: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.2908: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.2909: DFBPPR12239 ---- Animal proteins ---- Protein FAM214A
Source.2910: DFBPPR12241 ---- Animal proteins ---- BSD domain-containing protein 1
Source.2911: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.2912: DFBPPR12253 ---- Animal proteins ---- Aldehyde oxidase 1
Source.2913: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.2914: DFBPPR12264 ---- Animal proteins ---- Serum paraoxonase/arylesterase 1
Source.2915: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.2916: DFBPPR12273 ---- Animal proteins ---- Sodium/hydrogen exchanger 1
Source.2917: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.2918: DFBPPR12277 ---- Animal proteins ---- Calcium-activated potassium channel subunit alpha-1
Source.2919: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.2920: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.2921: DFBPPR12288 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 2-beta-N-acetylglucosaminyltransferase
Source.2922: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.2923: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.2924: DFBPPR12312 ---- Animal proteins ---- Bone morphogenetic protein 2
Source.2925: DFBPPR12317 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP4
Source.2926: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.2927: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.2928: DFBPPR12331 ---- Animal proteins ---- Eukaryotic translation initiation factor 2-alpha kinase 1
Source.2929: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.2930: DFBPPR12334 ---- Animal proteins ---- Dipeptidase 1
Source.2931: DFBPPR12335 ---- Animal proteins ---- Bone morphogenetic protein 4
Source.2932: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2933: DFBPPR12348 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.2934: DFBPPR12362 ---- Animal proteins ---- Transient receptor potential cation channel subfamily V member 1
Source.2935: DFBPPR12375 ---- Animal proteins ---- Sterol 26-hydroxylase, mitochondrial
Source.2936: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2937: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.2938: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.2939: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.2940: DFBPPR12387 ---- Animal proteins ---- Voltage-dependent calcium channel subunit alpha-2/delta-1
Source.2941: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.2942: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.2943: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.2944: DFBPPR12405 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.2945: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.2946: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.2947: DFBPPR12429 ---- Animal proteins ---- Apolipoprotein A-I
Source.2948: DFBPPR12433 ---- Animal proteins ---- Carbonic anhydrase 2
Source.2949: DFBPPR12437 ---- Animal proteins ---- Trehalase
Source.2950: DFBPPR12446 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.2951: DFBPPR12451 ---- Animal proteins ---- Non-specific lipid-transfer protein
Source.2952: DFBPPR12460 ---- Animal proteins ---- ATP-dependent 6-phosphofructokinase, platelet type
Source.2953: DFBPPR12478 ---- Animal proteins ---- Protein phosphatase 1A
Source.2954: DFBPPR12483 ---- Animal proteins ---- Elongation factor 1-alpha 2
Source.2955: DFBPPR12484 ---- Animal proteins ---- Myosin-4
Source.2956: DFBPPR12485 ---- Animal proteins ---- Potassium-transporting ATPase alpha chain 2
Source.2957: DFBPPR12487 ---- Animal proteins ---- Myosin heavy chain, skeletal muscle
Source.2958: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.2959: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.2960: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.2961: DFBPPR12509 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 3
Source.2962: DFBPPR12515 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit alpha
Source.2963: DFBPPR12517 ---- Animal proteins ---- 5-formyltetrahydrofolate cyclo-ligase
Source.2964: DFBPPR12523 ---- Animal proteins ---- Tropomyosin alpha-1 chain
Source.2965: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.2966: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.2967: DFBPPR12539 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1
Source.2968: DFBPPR12544 ---- Animal proteins ---- Ubiquitin-like modifier-activating enzyme 1
Source.2969: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2970: DFBPPR12551 ---- Animal proteins ---- C-reactive protein
Source.2971: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.2972: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.2973: DFBPPR12571 ---- Animal proteins ---- Inositol hexakisphosphate kinase 2
Source.2974: DFBPPR12572 ---- Animal proteins ---- Calcium-binding mitochondrial carrier protein SCaMC-1
Source.2975: DFBPPR12576 ---- Animal proteins ---- Chloride intracellular channel protein 6
Source.2976: DFBPPR12578 ---- Animal proteins ---- Troponin I, cardiac muscle
Source.2977: DFBPPR12580 ---- Animal proteins ---- Eukaryotic translation initiation factor 2 subunit 2
Source.2978: DFBPPR12581 ---- Animal proteins ---- Potassium voltage-gated channel subfamily B member 2
Source.2979: DFBPPR12584 ---- Animal proteins ---- Nuclear distribution protein nudE-like 1
Source.2980: DFBPPR12585 ---- Animal proteins ---- Calmodulin
Source.2981: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.2982: DFBPPR12597 ---- Animal proteins ---- b(0,+)-type amino acid transporter 1
Source.2983: DFBPPR12598 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit beta-1
Source.2984: DFBPPR12618 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.2985: DFBPPR12619 ---- Animal proteins ---- Na(+)/H(+) exchange regulatory cofactor NHE-RF3
Source.2986: DFBPPR12628 ---- Animal proteins ---- Carbonic anhydrase 12
Source.2987: DFBPPR12630 ---- Animal proteins ---- Insulin-like growth factor I
Source.2988: DFBPPR12631 ---- Animal proteins ---- Alpha-1-syntrophin
Source.2989: DFBPPR12681 ---- Animal proteins ---- Myosin-7
Source.2990: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2991: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.2992: DFBPPR12718 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit delta isoform
Source.2993: DFBPPR12727 ---- Animal proteins ---- Translation initiation factor eIF-2B subunit delta
Source.2994: DFBPPR12729 ---- Animal proteins ---- Solute carrier family 22 member 2
Source.2995: DFBPPR12742 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 Q2
Source.2996: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1
Source.2997: DFBPPR12752 ---- Animal proteins ---- Complement component C8 beta chain
Source.2998: DFBPPR12763 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit gamma isoform
Source.2999: DFBPPR12764 ---- Animal proteins ---- Keratin, type II cytoskeletal 3
Source.3000: DFBPPR12778 ---- Animal proteins ---- Aryl hydrocarbon receptor
Source.3001: DFBPPR12783 ---- Animal proteins ---- Nuclear autoantigenic sperm protein
Source.3002: DFBPPR12785 ---- Animal proteins ---- A-kinase anchor protein 9
Source.3003: DFBPPR12786 ---- Animal proteins ---- Intercellular adhesion molecule 5
Source.3004: DFBPPR12806 ---- Animal proteins ---- T-complex protein 1 subunit zeta
Source.3005: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor
Source.3006: DFBPPR12833 ---- Animal proteins ---- Cullin-5
Source.3007: DFBPPR12853 ---- Animal proteins ---- Insulin
Source.3008: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.3009: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.3010: DFBPPR12880 ---- Animal proteins ---- Corticostatin 1
Source.3011: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.3012: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.3013: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.3014: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.3015: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.3016: DFBPPR12912 ---- Animal proteins ---- Junctophilin-1
Source.3017: DFBPPR12918 ---- Animal proteins ---- Myosin heavy chain, embryonic smooth muscle isoform
Source.3018: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.3019: DFBPPR12944 ---- Animal proteins ---- Multidrug and toxin extrusion protein 1
Source.3020: DFBPPR12950 ---- Animal proteins ---- Vitamin D-binding protein
Source.3021: DFBPPR12954 ---- Animal proteins ---- Apolipoprotein B
Source.3022: DFBPPR12959 ---- Animal proteins ---- Keratin, type I cytoskeletal 12
Source.3023: DFBPPR12964 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-5
Source.3024: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.3025: DFBPPR12973 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 56 kDa regulatory subunit beta isoform
Source.3026: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.3027: DFBPPR12981 ---- Animal proteins ---- Neutrophil antibiotic peptide NP-4
Source.3028: DFBPPR12985 ---- Animal proteins ---- Arf-GAP with coiled-coil, ANK repeat and PH domain-containing protein 2
Source.3029: DFBPPR12996 ---- Animal proteins ---- UDP-glucuronosyltransferase 2C1
Source.3030: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.3031: DFBPPR13080 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 1
Source.3032: DFBPPR13089 ---- Animal proteins ---- 14-3-3 protein theta
Source.3033: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.3034: DFBPPR13094 ---- Animal proteins ---- Atherin
Source.3035: DFBPPR13138 ---- Animal proteins ---- SNRPN upstream reading frame protein
Source.3036: DFBPPR13139 ---- Animal proteins ---- Ig kappa chain b5 variant C region
Source.3037: DFBPPR13150 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.3038: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3039: DFBPPR13170 ---- Animal proteins ---- Carbonic anhydrase 1
Source.3040: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3041: DFBPPR13180 ---- Animal proteins ---- Aspartate aminotransferase, mitochondrial
Source.3042: DFBPPR13185 ---- Animal proteins ---- Chromogranin-A
Source.3043: DFBPPR13195 ---- Animal proteins ---- Albumin
Source.3044: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.3045: DFBPPR13217 ---- Animal proteins ---- Interstitial collagenase
Source.3046: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3
Source.3047: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3048: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.3049: DFBPPR13236 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3
Source.3050: DFBPPR13238 ---- Animal proteins ---- Laminin subunit gamma-2
Source.3051: DFBPPR13241 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3052: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.3053: DFBPPR13250 ---- Animal proteins ---- Doublesex and mab-3 related transcription factor 3, truncated
Source.3054: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.3055: DFBPPR13269 ---- Animal proteins ---- Elongation factor 1-alpha 1
Source.3056: DFBPPR13276 ---- Animal proteins ---- Protein quaking
Source.3057: DFBPPR13278 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 5
Source.3058: DFBPPR13284 ---- Animal proteins ---- Interleukin-8
Source.3059: DFBPPR13289 ---- Animal proteins ---- Leukocyte elastase inhibitor
Source.3060: DFBPPR13291 ---- Animal proteins ---- Myosin-7
Source.3061: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.3062: DFBPPR13301 ---- Animal proteins ---- Protein S100-A6
Source.3063: DFBPPR13313 ---- Animal proteins ---- Insulin-like growth factor I
Source.3064: DFBPPR13314 ---- Animal proteins ---- Myosin-1
Source.3065: DFBPPR13315 ---- Animal proteins ---- Ski oncogene
Source.3066: DFBPPR13317 ---- Animal proteins ---- Myosin-2
Source.3067: DFBPPR13323 ---- Animal proteins ---- Myoglobin
Source.3068: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha
Source.3069: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.3070: DFBPPR13436 ---- Animal proteins ---- Transmembrane protein 147
Source.3071: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3072: DFBPPR13447 ---- Animal proteins ---- Insulin-like growth factor I
Source.3073: DFBPPR13449 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3074: DFBPPR13453 ---- Animal proteins ---- Hemoglobin subunit beta-C
Source.3075: DFBPPR13466 ---- Animal proteins ---- KAT8 regulatory NSL complex subunit 2
Source.3076: DFBPPR13502 ---- Animal proteins ---- 45 kDa calcium-binding protein
Source.3077: DFBPPR13504 ---- Animal proteins ---- Platelet-activating factor receptor
Source.3078: DFBPPR13505 ---- Animal proteins ---- Spectrin beta chain, non-erythrocytic 1
Source.3079: DFBPPR13506 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3080: DFBPPR13513 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.3081: DFBPPR13531 ---- Animal proteins ---- Pro-opiomelanocortin
Source.3082: DFBPPR13532 ---- Animal proteins ---- Prostaglandin G/H synthase 1
Source.3083: DFBPPR13542 ---- Animal proteins ---- Pyridoxal kinase
Source.3084: DFBPPR13546 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.3085: DFBPPR13547 ---- Animal proteins ---- Interleukin-12 subunit alpha
Source.3086: DFBPPR13548 ---- Animal proteins ---- Dipeptidase 1
Source.3087: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3088: DFBPPR13564 ---- Animal proteins ---- Calmodulin
Source.3089: DFBPPR13565 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 1
Source.3090: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.3091: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.3092: DFBPPR13581 ---- Animal proteins ---- Cellular tumor antigen p53
Source.3093: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3094: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3095: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.3096: DFBPPR13604 ---- Animal proteins ---- Carbonic anhydrase 2
Source.3097: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.3098: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.3099: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.3100: DFBPPR13641 ---- Animal proteins ---- Interferon alpha/beta receptor 1
Source.3101: DFBPPR13655 ---- Animal proteins ---- Cholesterol side-chain cleavage enzyme, mitochondrial
Source.3102: DFBPPR13673 ---- Animal proteins ---- Insulin-like growth factor I
Source.3103: DFBPPR13686 ---- Animal proteins ---- Vimentin
Source.3104: DFBPPR13697 ---- Animal proteins ---- Carbonic anhydrase 1
Source.3105: DFBPPR13699 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 3
Source.3106: DFBPPR13714 ---- Animal proteins ---- Corticosteroid 11-beta-dehydrogenase isozyme 2
Source.3107: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.3108: DFBPPR13734 ---- Animal proteins ---- Perilipin-5
Source.3109: DFBPPR13747 ---- Animal proteins ---- 14-3-3 protein beta/alpha
Source.3110: DFBPPR13751 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-2
Source.3111: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.3112: DFBPPR13756 ---- Animal proteins ---- 14-3-3 protein epsilon
Source.3113: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.3114: DFBPPR13784 ---- Animal proteins ---- Glycogen phosphorylase, liver form
Source.3115: DFBPPR13795 ---- Animal proteins ---- Keratin, type I microfibrillar 48 kDa, component 8C-1
Source.3116: DFBPPR13802 ---- Animal proteins ---- Pancreatic prohormone
Source.3117: DFBPPR13803 ---- Animal proteins ---- 14-3-3 protein zeta/delta
Source.3118: DFBPPR13811 ---- Animal proteins ---- 14-3-3 protein gamma
Source.3119: DFBPPR13814 ---- Animal proteins ---- Pro-FMRFamide-related neuropeptide VF
Source.3120: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1
Source.3121: DFBPPR13849 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-3
Source.3122: DFBPPR13858 ---- Animal proteins ---- Keratin, type I microfibrillar, 47.6 kDa
Source.3123: DFBPPR13861 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.3124: DFBPPR13863 ---- Animal proteins ---- Granulocyte colony-stimulating factor
Source.3125: DFBPPR13886 ---- Animal proteins ---- Sideroflexin-1
Source.3126: DFBPPR13894 ---- Animal proteins ---- Brain-enriched guanylate kinase-associated protein
Source.3127: DFBPPR13896 ---- Animal proteins ---- Somatostatin
Source.3128: DFBPPR13907 ---- Animal proteins ---- Shadow of prion protein
Source.3129: DFBPPR13908 ---- Animal proteins ---- Shadow of prion protein
Source.3130: DFBPPR13924 ---- Animal proteins ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.3131: DFBPPR13939 ---- Animal proteins ---- T-cell surface glycoprotein CD4
Source.3132: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.3133: DFBPPR13953 ---- Animal proteins ---- Tetraspanin-9
Source.3134: DFBPPR13954 ---- Animal proteins ---- Keratin, type I cuticular Ha5
Source.3135: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.3136: DFBPPR13981 ---- Animal proteins ---- Mitogen-activated protein kinase 14B
Source.3137: DFBPPR13982 ---- Animal proteins ---- Mitogen-activated protein kinase 14A
Source.3138: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3139: DFBPPR13990 ---- Animal proteins ---- Myosin heavy chain, fast skeletal muscle
Source.3140: DFBPPR14000 ---- Animal proteins ---- ATP synthase subunit beta, mitochondrial
Source.3141: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.3142: DFBPPR14019 ---- Animal proteins ---- Vimentin
Source.3143: DFBPPR14046 ---- Animal proteins ---- Myoglobin
Source.3144: DFBPPR14049 ---- Animal proteins ---- Proto-oncogene c-Fos
Source.3145: DFBPPR14052 ---- Animal proteins ---- Insulin-like growth factor I, adult form
Source.3146: DFBPPR14055 ---- Animal proteins ---- Insulin-like growth factor I, juvenile form
Source.3147: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.3148: DFBPPR14087 ---- Marine protein ---- Lissencephaly-1 homolog A
Source.3149: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B
Source.3150: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1
Source.3151: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183
Source.3152: DFBPPR14123 ---- Marine protein ---- Albumin 1
Source.3153: DFBPPR14124 ---- Marine protein ---- Albumin 2
Source.3154: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.3155: DFBPPR14136 ---- Marine protein ---- Lysine-specific demethylase 8
Source.3156: DFBPPR14142 ---- Marine protein ---- Apolipoprotein A-I
Source.3157: DFBPPR14170 ---- Marine protein ---- SOSS complex subunit C
Source.3158: DFBPPR14190 ---- Marine protein ---- Zinc finger CCCH-type with G patch domain-containing protein
Source.3159: DFBPPR14196 ---- Marine protein ---- Mini-chromosome maintenance complex-binding protein
Source.3160: DFBPPR14210 ---- Marine protein ---- Tetraspanin-9
Source.3161: DFBPPR14223 ---- Marine protein ---- Isochorismatase domain-containing protein 1
Source.3162: DFBPPR14257 ---- Marine protein ---- Somatolactin
Source.3163: DFBPPR14296 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.3164: DFBPPR14299 ---- Marine protein ---- Phycobiliprotein ApcE
Source.3165: DFBPPR14313 ---- Marine protein ---- Photosystem I reaction center subunit PsaK
Source.3166: DFBPPR14341 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit B
Source.3167: DFBPPR14345 ---- Marine protein ---- 2,3-bisphosphoglycerate-independent phosphoglycerate mutase
Source.3168: DFBPPR14347 ---- Marine protein ---- Light-independent protochlorophyllide reductase subunit N
Source.3169: DFBPPR14348 ---- Marine protein ---- Tubulin beta chain
Source.3170: DFBPPR14354 ---- Marine protein ---- Cytochrome c-550
Source.3171: DFBPPR14356 ---- Marine protein ---- Acetyl-coenzyme A carboxylase carboxyl transferase subunit alpha
Source.3172: DFBPPR14362 ---- Marine protein ---- ATP synthase subunit alpha, chloroplastic
Source.3173: DFBPPR14369 ---- Marine protein ---- C-phycocyanin beta chain
Source.3174: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.3175: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.3176: DFBPPR14381 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit beta
Source.3177: DFBPPR14390 ---- Marine protein ---- ATP-dependent Clp protease ATP-binding subunit ClpA homolog
Source.3178: DFBPPR14404 ---- Marine protein ---- Pyruvate dehydrogenase E1 component subunit alpha
Source.3179: DFBPPR14412 ---- Marine protein ---- Elongation factor Tu, chloroplastic
Source.3180: DFBPPR14422 ---- Marine protein ---- Translation initiation factor IF-2, chloroplastic
Source.3181: DFBPPR14458 ---- Marine protein ---- 50S ribosomal protein L12, chloroplastic
Source.3182: DFBPPR14460 ---- Marine protein ---- Probable 30S ribosomal protein 3, chloroplastic
Source.3183: DFBPPR14487 ---- Marine protein ---- Chloroplast envelope membrane protein
Source.3184: DFBPPR14495 ---- Marine protein ---- 30S ribosomal protein S2, chloroplastic
Source.3185: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.3186: DFBPPR14525 ---- Marine protein ---- Uncharacterized protein ycf55
Source.3187: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.3188: DFBPPR14545 ---- Marine protein ---- Ghrelin
Source.3189: DFBPPR14547 ---- Marine protein ---- Interleukin-6
Source.3190: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.3191: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.3192: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.3193: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.3194: DFBPPR14583 ---- Marine protein ---- Insulin-like growth factor I
Source.3195: DFBPPR14591 ---- Marine protein ---- Vimentin
Source.3196: DFBPPR14594 ---- Marine protein ---- Interferon alpha/beta receptor 1b
Source.3197: DFBPPR14600 ---- Marine protein ---- Transforming growth factor beta-1 proprotein
Source.3198: DFBPPR14615 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx1
Source.3199: DFBPPR14629 ---- Marine protein ---- Apolipoprotein A-I-1
Source.3200: DFBPPR14631 ---- Marine protein ---- Interferon alpha/beta receptor 1a
Source.3201: DFBPPR14640 ---- Marine protein ---- Interferon-induced GTP-binding protein Mx3
Source.3202: DFBPPR14641 ---- Marine protein ---- Complement component C8 beta chain
Source.3203: DFBPPR14687 ---- Marine protein ---- Tumor necrosis factor receptor type 1-associated DEATH domain protein
Source.3204: DFBPPR14688 ---- Marine protein ---- Apolipoprotein A-I-2
Source.3205: DFBPPR14703 ---- Marine protein ---- Keratin, type I cytoskeletal 13
Source.3206: DFBPPR14706 ---- Marine protein ---- 14-3-3 protein beta/alpha-1
Source.3207: DFBPPR14707 ---- Marine protein ---- 14-3-3 protein beta/alpha-2
Source.3208: DFBPPR14709 ---- Marine protein ---- Protein lin-52 homolog
Source.3209: DFBPPR14711 ---- Marine protein ---- UI
Source.3210: DFBPPR14714 ---- Marine protein ---- 14-3-3 protein gamma-2
Source.3211: DFBPPR14715 ---- Marine protein ---- 14-3-3 protein gamma-1
Source.3212: DFBPPR14716 ---- Marine protein ---- Secreted phosphoprotein 24
Source.3213: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.3214: DFBPPR14783 ---- Marine protein ---- Enolase
Source.3215: DFBPPR14806 ---- Marine protein ---- Tubulin beta-2 chain
Source.3216: DFBPPR14807 ---- Marine protein ---- Tubulin beta-1 chain
Source.3217: DFBPPR14832 ---- Marine protein ---- Troponin C, isoform 2B
Source.3218: DFBPPR14853 ---- Marine protein ---- Sarcoplasmic calcium-binding protein 1
Source.3219: DFBPPR14860 ---- Marine protein ---- Thyrotropin subunit beta
Source.3220: DFBPPR14873 ---- Marine protein ---- Somatolactin
Source.3221: DFBPPR14876 ---- Microorganism protein ---- Hexokinase
Source.3222: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.3223: DFBPPR14886 ---- Microorganism protein ---- Serine/threonine-protein kinase SSN3
Source.3224: DFBPPR14891 ---- Microorganism protein ---- DNA polymerase epsilon catalytic subunit A
Source.3225: DFBPPR14895 ---- Microorganism protein ---- Chromatin-remodeling ATPase INO80
Source.3226: DFBPPR14897 ---- Microorganism protein ---- Calmodulin
Source.3227: DFBPPR14898 ---- Microorganism protein ---- Transcription factor IIIB 70 kDa subunit
Source.3228: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.3229: DFBPPR14904 ---- Microorganism protein ---- Myosin-1
Source.3230: DFBPPR14908 ---- Microorganism protein ---- Flap endonuclease 1
Source.3231: DFBPPR14921 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-79 specific
Source.3232: DFBPPR14922 ---- Microorganism protein ---- Histone-lysine N-methyltransferase, H3 lysine-36 specific
Source.3233: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.3234: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.3235: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.3236: DFBPPR14942 ---- Microorganism protein ---- Transcription initiation factor IIB
Source.3237: DFBPPR14943 ---- Microorganism protein ---- Nuclear protein localization protein 4
Source.3238: DFBPPR14945 ---- Microorganism protein ---- Decapping nuclease RAI1
Source.3239: DFBPPR14958 ---- Microorganism protein ---- ATP-dependent RNA helicase HAS1
Source.3240: DFBPPR14969 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 15
Source.3241: DFBPPR14970 ---- Microorganism protein ---- Fructose-1,6-bisphosphatase
Source.3242: DFBPPR14972 ---- Microorganism protein ---- ATP synthase subunit alpha, mitochondrial
Source.3243: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.3244: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.3245: DFBPPR14983 ---- Microorganism protein ---- PAN2-PAN3 deadenylation complex subunit PAN3
Source.3246: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.3247: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.3248: DFBPPR15005 ---- Microorganism protein ---- Origin recognition complex subunit 1
Source.3249: DFBPPR15006 ---- Microorganism protein ---- Lysophospholipase NTE1
Source.3250: DFBPPR15031 ---- Microorganism protein ---- NAD-dependent histone deacetylase SIR2
Source.3251: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.3252: DFBPPR15035 ---- Microorganism protein ---- Dihydroorotate dehydrogenase (fumarate)
Source.3253: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase
Source.3254: DFBPPR15040 ---- Microorganism protein ---- RuvB-like helicase 1
Source.3255: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.3256: DFBPPR15052 ---- Microorganism protein ---- 5'-3' exoribonuclease 2
Source.3257: DFBPPR15061 ---- Microorganism protein ---- AdoMet-dependent rRNA methyltransferase SPB1
Source.3258: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.3259: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.3260: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1
Source.3261: DFBPPR15075 ---- Microorganism protein ---- ATP-dependent RNA helicase DBP4
Source.3262: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.3263: DFBPPR15080 ---- Microorganism protein ---- Dimethyladenosine transferase
Source.3264: DFBPPR15088 ---- Microorganism protein ---- Autophagy-related protein 13
Source.3265: DFBPPR15099 ---- Microorganism protein ---- Glucose N-acetyltransferase 1-A
Source.3266: DFBPPR15103 ---- Microorganism protein ---- Actin cytoskeleton-regulatory complex protein END3
Source.3267: DFBPPR15108 ---- Microorganism protein ---- Pyruvate dehydrogenase E1 component subunit alpha, mitochondrial
Source.3268: DFBPPR15110 ---- Microorganism protein ---- Sterol 3-beta-glucosyltransferase
Source.3269: DFBPPR15115 ---- Microorganism protein ---- Helicase SWR1
Source.3270: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2
Source.3271: DFBPPR15148 ---- Microorganism protein ---- Riboflavin kinase
Source.3272: DFBPPR15150 ---- Microorganism protein ---- Ubiquitin carboxyl-terminal hydrolase 2
Source.3273: DFBPPR15152 ---- Microorganism protein ---- NADH-cytochrome b5 reductase 2
Source.3274: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3
Source.3275: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.3276: DFBPPR15181 ---- Microorganism protein ---- Nitrogen permease regulator 3
Source.3277: DFBPPR15209 ---- Microorganism protein ---- Chromatin modification-related protein EAF3
Source.3278: DFBPPR15212 ---- Microorganism protein ---- Protein transport protein SEC23
Source.3279: DFBPPR15213 ---- Microorganism protein ---- Orotidine 5'-phosphate decarboxylase
Source.3280: DFBPPR15218 ---- Microorganism protein ---- MICOS complex subunit MIC60
Source.3281: DFBPPR15219 ---- Microorganism protein ---- Chromatin structure-remodeling complex subunit SFH1
Source.3282: DFBPPR15227 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 8
Source.3283: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.3284: DFBPPR15233 ---- Microorganism protein ---- Autophagy-related protein 20
Source.3285: DFBPPR15238 ---- Microorganism protein ---- Pre-mRNA-splicing factor CLF1
Source.3286: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.3287: DFBPPR15270 ---- Microorganism protein ---- Protein SQS1
Source.3288: DFBPPR15278 ---- Microorganism protein ---- Protein arginine N-methyltransferase 2
Source.3289: DFBPPR15282 ---- Microorganism protein ---- Peroxisomal biogenesis factor 3
Source.3290: DFBPPR15309 ---- Microorganism protein ---- Respiratory supercomplex factor 1, mitochondrial
Source.3291: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.3292: DFBPPR15321 ---- Microorganism protein ---- Peptide chain release factor 1, mitochondrial
Source.3293: DFBPPR15325 ---- Microorganism protein ---- Protein FYV10
Source.3294: DFBPPR15326 ---- Microorganism protein ---- Protein FYV10
Source.3295: DFBPPR15327 ---- Microorganism protein ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.3296: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18
Source.3297: DFBPPR15344 ---- Microorganism protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, mitochondrial
Source.3298: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.3299: DFBPPR15353 ---- Microorganism protein ---- Pre-mRNA-splicing factor ISY1
Source.3300: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.3301: DFBPPR15382 ---- Microorganism protein ---- Sensitive to high expression protein 9 homolog, mitochondrial
Source.3302: DFBPPR15391 ---- Microorganism protein ---- Metacaspase-1
Source.3303: DFBPPR15395 ---- Microorganism protein ---- Pyrroline-5-carboxylate reductase
Source.3304: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1
Source.3305: DFBPPR15400 ---- Microorganism protein ---- Sorting nexin-41
Source.3306: DFBPPR15404 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM10
Source.3307: DFBPPR15430 ---- Microorganism protein ---- Exportin-T
Source.3308: DFBPPR15434 ---- Microorganism protein ---- pH-response transcription factor pacC/RIM101
Source.3309: DFBPPR15454 ---- Microorganism protein ---- Beta-galactosidase
Source.3310: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.3311: DFBPPR15461 ---- Microorganism protein ---- EKC/KEOPS complex subunit CGI121
Source.3312: DFBPPR15462 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM21
Source.3313: DFBPPR15468 ---- Microorganism protein ---- Mitochondrial inner membrane magnesium transporter LPE10
Source.3314: DFBPPR15478 ---- Microorganism protein ---- COP9 signalosome complex subunit 9
Source.3315: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.3316: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.3317: DFBPPR15488 ---- Microorganism protein ---- Multiple RNA-binding domain-containing protein 1
Source.3318: DFBPPR15501 ---- Microorganism protein ---- Plasma membrane fusion protein PRM1
Source.3319: DFBPPR15504 ---- Microorganism protein ---- Mitochondrial import inner membrane translocase subunit TIM54
Source.3320: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.3321: DFBPPR15521 ---- Microorganism protein ---- rRNA-processing protein EFG1
Source.3322: DFBPPR15531 ---- Microorganism protein ---- DNA replication complex GINS protein SLD5
Source.3323: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.3324: DFBPPR15558 ---- Microorganism protein ---- Protein CFT1
Source.3325: DFBPPR15560 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 13
Source.3326: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.3327: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.3328: DFBPPR15590 ---- Microorganism protein ---- Protein transport protein SEC9
Source.3329: DFBPPR15596 ---- Microorganism protein ---- Biogenesis of lysosome-related organelles complex 1 subunit BLS1
Source.3330: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1
Source.3331: DFBPPR15603 ---- Microorganism protein ---- tRNA (uracil-O(2)-)-methyltransferase
Source.3332: DFBPPR15628 ---- Microorganism protein ---- DNA-binding protein REB1
Source.3333: DFBPPR15631 ---- Microorganism protein ---- Pre-mRNA-splicing factor RSE1
Source.3334: DFBPPR15633 ---- Microorganism protein ---- Bud site selection protein 4
Source.3335: DFBPPR15642 ---- Microorganism protein ---- Spindle pole component 29
Source.3336: DFBPPR15659 ---- Microorganism protein ---- Signal recognition particle SEC65 subunit
Source.3337: DFBPPR15662 ---- Microorganism protein ---- Nuclear rim protein 1
Source.3338: DFBPPR15678 ---- Microorganism protein ---- Autophagy-related protein 2
Source.3339: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.3340: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5
Source.3341: DFBPPR15719 ---- Microorganism protein ---- Enhancer of translation termination 1
Source.3342: DFBPPR15720 ---- Microorganism protein ---- Protein BFR2
Source.3343: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.3344: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.3345: DFBPPR15740 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 21
Source.3346: DFBPPR15742 ---- Microorganism protein ---- High-osmolarity-induced transcription protein 1
Source.3347: DFBPPR15744 ---- Microorganism protein ---- Peroxisomal membrane protein PEX21
Source.3348: DFBPPR15745 ---- Microorganism protein ---- Protein FYV8
Source.3349: DFBPPR15761 ---- Microorganism protein ---- Eisosome protein 1
Source.3350: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.3351: DFBPPR15771 ---- Microorganism protein ---- Required for respiratory growth protein 1, mitochondrial
Source.3352: DFBPPR15773 ---- Microorganism protein ---- 37S ribosomal protein S25, mitochondrial
Source.3353: DFBPPR15775 ---- Microorganism protein ---- Increased recombination centers protein 6
Source.3354: DFBPPR15778 ---- Microorganism protein ---- Protein EFR3
Source.3355: DFBPPR15789 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 4
Source.3356: DFBPPR15790 ---- Microorganism protein ---- UPF0507 protein KLLA0D01133g
Source.3357: DFBPPR15801 ---- Microorganism protein ---- Phosphoribosylformylglycinamidine synthase subunit PurL
Source.3358: DFBPPR15809 ---- Microorganism protein ---- PTS system sorbose-specific EIIA component
Source.3359: DFBPPR15811 ---- Microorganism protein ---- 3D-(3,5/4)-trihydroxycyclohexane-1,2-dione hydrolase
Source.3360: DFBPPR15820 ---- Microorganism protein ---- 6-phospho-beta-galactosidase
Source.3361: DFBPPR15822 ---- Microorganism protein ---- Tryptophan synthase beta chain
Source.3362: DFBPPR15840 ---- Microorganism protein ---- Protein RecA
Source.3363: DFBPPR15845 ---- Microorganism protein ---- Calmodulin
Source.3364: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.3365: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.3366: DFBPPR15863 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.3367: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase
Source.3368: DFBPPR15869 ---- Microorganism protein ---- Phenylalanine ammonia-lyase
Source.3369: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.3370: DFBPPR0012 ---- Plant protein ---- Tubulin beta-2 chain
Source.3371: DFBPPR0013 ---- Plant protein ---- Tubulin beta-1 chain
Source.3372: DFBPPR7752 ---- Plant protein ---- Trans-cinnamate 4-monooxygenase
Source.3373: DFBPPR7753 ---- Plant protein ---- Malate dehydrogenase [NADP] 1, chloroplastic
Source.3374: DFBPPR7755 ---- Plant protein ---- Malate dehydrogenase [NADP] 2, chloroplastic
Source.3375: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.3376: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.3377: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.3378: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.3379: DFBPPR7764 ---- Plant protein ---- Zingiberene synthase
Source.3380: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.3381: DFBPPR7770 ---- Plant protein ---- Adenylosuccinate synthetase 1, chloroplastic
Source.3382: DFBPPR7776 ---- Plant protein ---- Beta-sesquiphellandrene synthase
Source.3383: DFBPPR7780 ---- Plant protein ---- Lipoyl synthase, mitochondrial
Source.3384: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.3385: DFBPPR7792 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.3386: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.3387: DFBPPR7802 ---- Plant protein ---- Phytochrome B
Source.3388: DFBPPR7807 ---- Plant protein ---- Probable O-methyltransferase 2
Source.3389: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.3390: DFBPPR7818 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.3391: DFBPPR7821 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3392: DFBPPR7825 ---- Plant protein ---- Phytochrome C
Source.3393: DFBPPR7828 ---- Plant protein ---- Glutamyl-tRNA(Gln) amidotransferase subunit B, chloroplastic/mitochondrial
Source.3394: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.3395: DFBPPR7864 ---- Plant protein ---- ATP synthase epsilon chain, chloroplastic
Source.3396: DFBPPR7891 ---- Plant protein ---- CASP-like protein 1B1
Source.3397: DFBPPR7892 ---- Plant protein ---- CASP-like protein 2A1
Source.3398: DFBPPR7905 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.3399: DFBPPR7906 ---- Plant protein ---- CASP-like protein 2U2
Source.3400: DFBPPR7909 ---- Plant protein ---- CASP-like protein 2D1
Source.3401: DFBPPR7928 ---- Plant protein ---- Putative cis-zeatin O-glucosyltransferase
Source.3402: DFBPPR7932 ---- Plant protein ---- Alpha-1,4 glucan phosphorylase L isozyme, chloroplastic/amyloplastic
Source.3403: DFBPPR7936 ---- Plant protein ---- Peptidyl-prolyl cis-trans isomerase, chloroplastic
Source.3404: DFBPPR7953 ---- Plant protein ---- Elongation factor 1-alpha
Source.3405: DFBPPR7983 ---- Plant protein ---- 14-3-3-like protein B
Source.3406: DFBPPR7984 ---- Plant protein ---- 14-3-3-like protein A
Source.3407: DFBPPR8001 ---- Plant protein ---- Putative anthocyanidin reductase
Source.3408: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.3409: DFBPPR8046 ---- Plant protein ---- Phaseolin, alpha-type
Source.3410: DFBPPR8048 ---- Plant protein ---- NADP-dependent malic enzyme
Source.3411: DFBPPR8051 ---- Plant protein ---- Phaseolin, beta-type
Source.3412: DFBPPR8065 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase chain 4, chloroplastic
Source.3413: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.3414: DFBPPR8085 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.3415: DFBPPR8093 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.3416: DFBPPR8097 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta''
Source.3417: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.3418: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.3419: DFBPPR8123 ---- Plant protein ---- Protein kinase PVPK-1
Source.3420: DFBPPR8124 ---- Plant protein ---- Vacuolar-processing enzyme
Source.3421: DFBPPR8138 ---- Plant protein ---- Inositol-3-phosphate synthase
Source.3422: DFBPPR8161 ---- Plant protein ---- Heat shock 70 kDa protein, mitochondrial
Source.3423: DFBPPR8217 ---- Plant protein ---- Germacrene A hydroxylase
Source.3424: DFBPPR8219 ---- Plant protein ---- Farnesyl pyrophosphate synthase
Source.3425: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1
Source.3426: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.3427: DFBPPR8240 ---- Plant protein ---- ATP synthase subunit alpha, mitochondrial
Source.3428: DFBPPR8251 ---- Plant protein ---- ATP synthase subunit alpha, chloroplastic
Source.3429: DFBPPR8284 ---- Plant protein ---- Calmodulin
Source.3430: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.3431: DFBPPR8335 ---- Plant protein ---- Photosystem I assembly protein Ycf4
Source.3432: DFBPPR8355 ---- Plant protein ---- 14-3-3-like protein
Link-research
Link 1: DFBPACEI1514----Chlorella vulgaris and Spirulina platensis----Microalgae powder hydrolysates
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 57.1 uM.

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Non-bitter taste prediction
SMILES N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)O
Preparation method
Mode of preparation

Enzymatic hydrolysis

Enzyme(s)/starter culture

Hydrolysis with pepsin (Porcine tomach mucosa; Wako Pure Chemicals, Osaka, Japan).

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: N.D
Prediction: ToxinPred
Additional information
Additional information

The purified peptide AEL is a possible candidate for application as a dietary supplement or as a component of a functional food product.

Database cross-references
DFBP
[D1] DFBPANHY0446, DFBPANHY0849
[D2] DFBPMUFU0240
BIOPEP-UWM [D3] 9088
APD [D4] -
BioPepDB [D5] -
MBPDB [D6] -
Reference(s)
Primary literature Suetsuna, K. Identification of antihypertensive peptides from peptic digest of the short-necked clam Tapes philippinarum and the pearl oyster Pinctada fucata martensii. Fisheries Science. 2002, 68, 233-5.
Other literature(s) N.D
PubDate 2002
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214