E-mail:gzliang@cqu.edu.cn    Tel: (86)2365102507

List of peptide properties
DFBP ID - DFBPACEI1198(ACE-inhibitory peptide)
DFBP ID DFBPACEI1198
Peptide sequence VW
Type Native peptide
Peptide/Function name ACE-inhibitory peptide
Function-activity relationship
Main bioactivity ACE-inhibitory activity
Otheir bioactivity Antihypertensive activity [D1], Antioxidative activity [D2], α-Glucosidase inhibitory activity [D3], Other bioactive activity [D4], Multifunctional activity [D5]
Calculated physicochemical properties
Three-letter amino acid Val-Trp
Single-letter amino acid VW
Peptide length 2
Peptide mass
Experimental mass Theoretical mass
304.7 Da 303.36 Da c
Net charge 0.00 c
Isoelectric point (pI) 5.97 c
IC50

1.1 uM (1.6 uM)

pIC50 -0.041
GRAVY 1.6500 c
Hydrophilic residue ratio 100% c
Peptide calculator
To calculate the physicochemical properties of bioactive peptide.
Peptide source & Food-borne protein(s) search
Classification Plant
Organism/Source Alfalfa (Medicago sativa)
Precursor protein Alfalfa white protein RuBisCO
Residue position N.D
Precursor protein(s) search
Source.1: DFBPPR0049 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.2: DFBPPR0747 ---- Plant proteins ---- 11S globulin seed storage protein
Source.3: DFBPPR0776 ---- Plant proteins ---- 11S globulin
Source.4: DFBPPR0820 ---- Plant proteins ---- bZIP transcription factor RISBZ5
Source.5: DFBPPR0822 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC4
Source.6: DFBPPR0827 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC9
Source.7: DFBPPR0829 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC5
Source.8: DFBPPR0834 ---- Plant proteins ---- Protein ABERRANT PANICLE ORGANIZATION 1
Source.9: DFBPPR0836 ---- Plant proteins ---- Catalase isozyme C
Source.10: DFBPPR0841 ---- Plant proteins ---- Catalase isozyme A
Source.11: DFBPPR0844 ---- Plant proteins ---- Jasmonoyl--L-amino acid synthetase GH3.5
Source.12: DFBPPR0846 ---- Plant proteins ---- Catalase isozyme B
Source.13: DFBPPR0849 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.14: DFBPPR0850 ---- Plant proteins ---- Calcium-dependent protein kinase 7
Source.15: DFBPPR0851 ---- Plant proteins ---- Calcium-dependent protein kinase 13
Source.16: DFBPPR0855 ---- Plant proteins ---- LRR receptor kinase BAK1
Source.17: DFBPPR0856 ---- Plant proteins ---- Gibberellin 20 oxidase 2
Source.18: DFBPPR0857 ---- Plant proteins ---- Mitogen-activated protein kinase 5
Source.19: DFBPPR0860 ---- Plant proteins ---- Soluble starch synthase 3a, chloroplastic/amyloplastic
Source.20: DFBPPR0861 ---- Plant proteins ---- Calcium-dependent protein kinase 18
Source.21: DFBPPR0862 ---- Plant proteins ---- bZIP transcription factor 46
Source.22: DFBPPR0863 ---- Plant proteins ---- Brassinosteroid LRR receptor kinase BRI1
Source.23: DFBPPR0865 ---- Plant proteins ---- Ent-sandaracopimaradiene 3-hydroxylase
Source.24: DFBPPR0868 ---- Plant proteins ---- Casein kinase 1-like protein HD16
Source.25: DFBPPR0869 ---- Plant proteins ---- Sucrose transport protein SUT1
Source.26: DFBPPR0871 ---- Plant proteins ---- LRR receptor kinase SERK2
Source.27: DFBPPR0881 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.28: DFBPPR0882 ---- Plant proteins ---- Betaine aldehyde dehydrogenase 1
Source.29: DFBPPR0886 ---- Plant proteins ---- Abscisic acid receptor PYL5
Source.30: DFBPPR0887 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.31: DFBPPR0888 ---- Plant proteins ---- Protein NARROW LEAF 1
Source.32: DFBPPR0892 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 1
Source.33: DFBPPR0893 ---- Plant proteins ---- Cyclin-dependent kinase B2-1
Source.34: DFBPPR0904 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK2
Source.35: DFBPPR0905 ---- Plant proteins ---- Deoxyribodipyrimidine photo-lyase
Source.36: DFBPPR0913 ---- Plant proteins ---- Endoribonuclease Dicer homolog 4
Source.37: DFBPPR0917 ---- Plant proteins ---- Ethylene receptor 2
Source.38: DFBPPR0918 ---- Plant proteins ---- bZIP transcription factor ABI5 homolog
Source.39: DFBPPR0921 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-5
Source.40: DFBPPR0927 ---- Plant proteins ---- Serine/threonine-protein kinase TOR
Source.41: DFBPPR0930 ---- Plant proteins ---- Abscisic acid receptor PYL3
Source.42: DFBPPR0933 ---- Plant proteins ---- ATP-dependent RNA helicase SUV3, mitochondrial
Source.43: DFBPPR0936 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK8
Source.44: DFBPPR0937 ---- Plant proteins ---- Glutamate synthase 1 [NADH], chloroplastic
Source.45: DFBPPR0938 ---- Plant proteins ---- Mitogen-activated protein kinase 1
Source.46: DFBPPR0939 ---- Plant proteins ---- Protein argonaute MEL1
Source.47: DFBPPR0942 ---- Plant proteins ---- Lysine-specific demethylase JMJ705
Source.48: DFBPPR0945 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK10
Source.49: DFBPPR0946 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT1
Source.50: DFBPPR0947 ---- Plant proteins ---- Histone-lysine N-methyltransferase TRX1
Source.51: DFBPPR0949 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK7
Source.52: DFBPPR0951 ---- Plant proteins ---- Calpain-type cysteine protease ADL1
Source.53: DFBPPR0952 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1a
Source.54: DFBPPR0954 ---- Plant proteins ---- Leucine-rich repeat receptor protein kinase MSP1
Source.55: DFBPPR0957 ---- Plant proteins ---- Beta-glucosidase 26
Source.56: DFBPPR0965 ---- Plant proteins ---- Abscisic acid receptor PYL9
Source.57: DFBPPR0970 ---- Plant proteins ---- E3 ubiquitin-protein ligase BRE1-like 1
Source.58: DFBPPR0972 ---- Plant proteins ---- DNA polymerase lambda
Source.59: DFBPPR0973 ---- Plant proteins ---- Polyamine oxidase 7
Source.60: DFBPPR0974 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.61: DFBPPR0981 ---- Plant proteins ---- MADS-box transcription factor 7
Source.62: DFBPPR0983 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 2
Source.63: DFBPPR0985 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK6
Source.64: DFBPPR0986 ---- Plant proteins ---- Protein phosphatase 2C 50
Source.65: DFBPPR0987 ---- Plant proteins ---- Vacuolar-processing enzyme beta-isozyme 1
Source.66: DFBPPR0988 ---- Plant proteins ---- Sucrose synthase 2
Source.67: DFBPPR0989 ---- Plant proteins ---- Calcium-dependent protein kinase 21
Source.68: DFBPPR0995 ---- Plant proteins ---- Transcription factor TDR
Source.69: DFBPPR0996 ---- Plant proteins ---- Ceramide kinase
Source.70: DFBPPR0998 ---- Plant proteins ---- CBL-interacting protein kinase 31
Source.71: DFBPPR1004 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK9
Source.72: DFBPPR1005 ---- Plant proteins ---- Cellulose synthase A catalytic subunit 7 [UDP-forming]
Source.73: DFBPPR1010 ---- Plant proteins ---- Bifunctional dethiobiotin synthetase/7,8-diamino-pelargonic acid aminotransferase, mitochondrial
Source.74: DFBPPR1013 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase 1B
Source.75: DFBPPR1015 ---- Plant proteins ---- Ent-kaurene oxidase 2
Source.76: DFBPPR1018 ---- Plant proteins ---- Disease resistance protein RGA5
Source.77: DFBPPR1022 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK3
Source.78: DFBPPR1024 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK4
Source.79: DFBPPR1027 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-2
Source.80: DFBPPR1033 ---- Plant proteins ---- Chitinase CLP
Source.81: DFBPPR1036 ---- Plant proteins ---- Polycomb group protein FIE1
Source.82: DFBPPR1044 ---- Plant proteins ---- Neutral ceramidase
Source.83: DFBPPR1048 ---- Plant proteins ---- ABC transporter B family member 25
Source.84: DFBPPR1052 ---- Plant proteins ---- Xyloglucan endotransglycosylase/hydrolase protein 8
Source.85: DFBPPR1054 ---- Plant proteins ---- bZIP transcription factor 12
Source.86: DFBPPR1057 ---- Plant proteins ---- Abscisic acid receptor PYL10
Source.87: DFBPPR1066 ---- Plant proteins ---- Heat stress transcription factor A-2c
Source.88: DFBPPR1067 ---- Plant proteins ---- Serine/threonine protein kinase OSK4
Source.89: DFBPPR1073 ---- Plant proteins ---- Chlorophyll(ide) b reductase NOL, chloroplastic
Source.90: DFBPPR1074 ---- Plant proteins ---- Protein DWARF AND LOW-TILLERING
Source.91: DFBPPR1076 ---- Plant proteins ---- Calcium-dependent protein kinase 24
Source.92: DFBPPR1078 ---- Plant proteins ---- Sucrose transport protein SUT5
Source.93: DFBPPR1084 ---- Plant proteins ---- Protein AUXIN-REGULATED GENE INVOLVED IN ORGAN SIZE
Source.94: DFBPPR1085 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK5
Source.95: DFBPPR1087 ---- Plant proteins ---- Protein TPR1
Source.96: DFBPPR1089 ---- Plant proteins ---- Protein TOPLESS-RELATED PROTEIN 2
Source.97: DFBPPR1092 ---- Plant proteins ---- LOB domain-containing protein CRL1
Source.98: DFBPPR1093 ---- Plant proteins ---- U-box domain-containing protein 24
Source.99: DFBPPR1099 ---- Plant proteins ---- Ent-cassadiene C11-alpha-hydroxylase 1
Source.100: DFBPPR1103 ---- Plant proteins ---- Villin-2
Source.101: DFBPPR1108 ---- Plant proteins ---- Tricin synthase 2
Source.102: DFBPPR1114 ---- Plant proteins ---- Pyruvate kinase 1, cytosolic
Source.103: DFBPPR1117 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA3
Source.104: DFBPPR1119 ---- Plant proteins ---- Alpha-amylase isozyme 3E
Source.105: DFBPPR1120 ---- Plant proteins ---- Cytokinin riboside 5'-monophosphate phosphoribohydrolase LOG
Source.106: DFBPPR1121 ---- Plant proteins ---- Calcium-dependent protein kinase 4
Source.107: DFBPPR1123 ---- Plant proteins ---- Allene oxide synthase 1, chloroplastic
Source.108: DFBPPR1125 ---- Plant proteins ---- Protein FLOURY ENDOSPERM 6, chloroplastic
Source.109: DFBPPR1127 ---- Plant proteins ---- Shikimate kinase 1, chloroplastic
Source.110: DFBPPR1132 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog B
Source.111: DFBPPR1133 ---- Plant proteins ---- Polycomb group protein FIE1
Source.112: DFBPPR1136 ---- Plant proteins ---- Exosome complex exonuclease RRP46 homolog
Source.113: DFBPPR1141 ---- Plant proteins ---- Cysteine-rich receptor-like protein kinase 6
Source.114: DFBPPR1144 ---- Plant proteins ---- Meiotic recombination protein SPO11-4
Source.115: DFBPPR1145 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.116: DFBPPR1146 ---- Plant proteins ---- Eukaryotic initiation factor 4A-III homolog A
Source.117: DFBPPR1147 ---- Plant proteins ---- ABC transporter C family member 13
Source.118: DFBPPR1148 ---- Plant proteins ---- L-type lectin-domain containing receptor kinase SIT2
Source.119: DFBPPR1152 ---- Plant proteins ---- Cytochrome P450 703A2
Source.120: DFBPPR1153 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein A
Source.121: DFBPPR1156 ---- Plant proteins ---- Calcium-dependent protein kinase 19
Source.122: DFBPPR1163 ---- Plant proteins ---- Cation-chloride cotransporter 1
Source.123: DFBPPR1168 ---- Plant proteins ---- bZIP transcription factor 23
Source.124: DFBPPR1170 ---- Plant proteins ---- Shikimate kinase 2, chloroplastic
Source.125: DFBPPR1181 ---- Plant proteins ---- Calcium-dependent protein kinase 20
Source.126: DFBPPR1184 ---- Plant proteins ---- Lysine-specific demethylase SE14
Source.127: DFBPPR1228 ---- Plant proteins ---- Isoamylase 2, chloroplastic
Source.128: DFBPPR1248 ---- Plant proteins ---- Glycosyltransferase BC10
Source.129: DFBPPR1250 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.130: DFBPPR1252 ---- Plant proteins ---- CBL-interacting protein kinase 24
Source.131: DFBPPR1254 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.132: DFBPPR1255 ---- Plant proteins ---- Ethylene receptor 3
Source.133: DFBPPR1256 ---- Plant proteins ---- Cytochrome P450 78A11
Source.134: DFBPPR1258 ---- Plant proteins ---- Calcium-dependent protein kinase 27
Source.135: DFBPPR1261 ---- Plant proteins ---- Auxin efflux carrier component 3a
Source.136: DFBPPR1267 ---- Plant proteins ---- Regulator of telomere elongation helicase 1 homolog
Source.137: DFBPPR1274 ---- Plant proteins ---- Alpha-amylase isozyme 3C
Source.138: DFBPPR1276 ---- Plant proteins ---- E3 ubiquitin-protein ligase XB3
Source.139: DFBPPR1277 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 8 [UDP-forming]
Source.140: DFBPPR1280 ---- Plant proteins ---- Heat stress transcription factor A-2a
Source.141: DFBPPR1284 ---- Plant proteins ---- Alpha-amylase isozyme 3D
Source.142: DFBPPR1287 ---- Plant proteins ---- DNA mismatch repair protein MSH5
Source.143: DFBPPR1288 ---- Plant proteins ---- Calcium-dependent protein kinase 5
Source.144: DFBPPR1293 ---- Plant proteins ---- Copper-transporting ATPase HMA5
Source.145: DFBPPR1294 ---- Plant proteins ---- MADS-box transcription factor 8
Source.146: DFBPPR1298 ---- Plant proteins ---- Alpha-amylase isozyme 3B
Source.147: DFBPPR1299 ---- Plant proteins ---- Heat stress transcription factor B-4b
Source.148: DFBPPR1304 ---- Plant proteins ---- Two-component response regulator ORR22
Source.149: DFBPPR1305 ---- Plant proteins ---- Alpha-amylase isozyme 3A
Source.150: DFBPPR1306 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.151: DFBPPR1307 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.152: DFBPPR1312 ---- Plant proteins ---- Calcium-dependent protein kinase 8
Source.153: DFBPPR1314 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.154: DFBPPR1315 ---- Plant proteins ---- Gibberellin 20 oxidase 3
Source.155: DFBPPR1318 ---- Plant proteins ---- Calcium-dependent protein kinase 22
Source.156: DFBPPR1319 ---- Plant proteins ---- Calcium-dependent protein kinase 17
Source.157: DFBPPR1324 ---- Plant proteins ---- Calcium-dependent protein kinase 11
Source.158: DFBPPR1325 ---- Plant proteins ---- FT-interacting protein 7
Source.159: DFBPPR1326 ---- Plant proteins ---- Protein SHORTAGE IN CHIASMATA 1 homolog
Source.160: DFBPPR1327 ---- Plant proteins ---- Heat stress transcription factor A-4d
Source.161: DFBPPR1328 ---- Plant proteins ---- Probable ethylene response sensor 1
Source.162: DFBPPR1331 ---- Plant proteins ---- Peroxidase 1
Source.163: DFBPPR1333 ---- Plant proteins ---- Endoglucanase 2
Source.164: DFBPPR1339 ---- Plant proteins ---- Glucosamine inositolphosphorylceramide transferase 1
Source.165: DFBPPR1345 ---- Plant proteins ---- Cadmium/zinc-transporting ATPase HMA2
Source.166: DFBPPR1348 ---- Plant proteins ---- Cytochrome b
Source.167: DFBPPR1350 ---- Plant proteins ---- Metal transporter NRAT1
Source.168: DFBPPR1358 ---- Plant proteins ---- Fructose-bisphosphate aldolase, chloroplastic
Source.169: DFBPPR1359 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.170: DFBPPR1362 ---- Plant proteins ---- Protein ROS1C
Source.171: DFBPPR1369 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 1 [UDP-forming]
Source.172: DFBPPR1371 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM2
Source.173: DFBPPR1372 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase IRX9L
Source.174: DFBPPR1373 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.175: DFBPPR1375 ---- Plant proteins ---- Chlorophyllide a oxygenase, chloroplastic
Source.176: DFBPPR1377 ---- Plant proteins ---- Calcium-dependent protein kinase 6
Source.177: DFBPPR1378 ---- Plant proteins ---- bZIP transcription factor TRAB1
Source.178: DFBPPR1381 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK1
Source.179: DFBPPR1385 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-2
Source.180: DFBPPR1387 ---- Plant proteins ---- Calcium-transporting ATPase 7, plasma membrane-type
Source.181: DFBPPR1392 ---- Plant proteins ---- Isocitrate lyase
Source.182: DFBPPR1394 ---- Plant proteins ---- Lipoxygenase 7, chloroplastic
Source.183: DFBPPR1399 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.184: DFBPPR1400 ---- Plant proteins ---- Cellulose synthase-like protein D4
Source.185: DFBPPR1403 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 2, chloroplastic
Source.186: DFBPPR1406 ---- Plant proteins ---- Acetyl-CoA carboxylase 1
Source.187: DFBPPR1408 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK3
Source.188: DFBPPR1414 ---- Plant proteins ---- Cellulose synthase-like protein D1
Source.189: DFBPPR1416 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 4
Source.190: DFBPPR1419 ---- Plant proteins ---- Gibberellin 3-beta-dioxygenase 1
Source.191: DFBPPR1423 ---- Plant proteins ---- Acetyl-CoA carboxylase 2
Source.192: DFBPPR1426 ---- Plant proteins ---- Mitogen-activated protein kinase 4
Source.193: DFBPPR1427 ---- Plant proteins ---- Probable esterase D14L
Source.194: DFBPPR1433 ---- Plant proteins ---- Cytochrome P450 714B2
Source.195: DFBPPR1436 ---- Plant proteins ---- Bidirectional sugar transporter SWEET14
Source.196: DFBPPR1441 ---- Plant proteins ---- Cysteine protease 1
Source.197: DFBPPR1444 ---- Plant proteins ---- Cysteine proteinase inhibitor 1
Source.198: DFBPPR1445 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK4
Source.199: DFBPPR1446 ---- Plant proteins ---- Nucleoside diphosphate kinase 1
Source.200: DFBPPR1447 ---- Plant proteins ---- Two-component response regulator-like PRR37
Source.201: DFBPPR1449 ---- Plant proteins ---- G-type lectin S-receptor-like serine/threonine-protein kinase LECRK2
Source.202: DFBPPR1452 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 2 [UDP-forming]
Source.203: DFBPPR1453 ---- Plant proteins ---- Crossover junction endonuclease MUS81
Source.204: DFBPPR1454 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43E
Source.205: DFBPPR1455 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 5 [UDP-forming]
Source.206: DFBPPR1456 ---- Plant proteins ---- Syn-copalyl diphosphate synthase
Source.207: DFBPPR1458 ---- Plant proteins ---- Endoglucanase 9
Source.208: DFBPPR1461 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 3 [UDP-forming]
Source.209: DFBPPR1462 ---- Plant proteins ---- Probable cellulose synthase A catalytic subunit 6 [UDP-forming]
Source.210: DFBPPR1463 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.211: DFBPPR1465 ---- Plant proteins ---- Auxin efflux carrier component 2
Source.212: DFBPPR1468 ---- Plant proteins ---- Serotonin N-acetyltransferase 2, chloroplastic
Source.213: DFBPPR1470 ---- Plant proteins ---- Alpha-galactosidase
Source.214: DFBPPR1471 ---- Plant proteins ---- DNA replication licensing factor MCM4
Source.215: DFBPPR1475 ---- Plant proteins ---- Glutamate receptor 3.1
Source.216: DFBPPR1478 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 2
Source.217: DFBPPR1484 ---- Plant proteins ---- Allene oxide synthase 2
Source.218: DFBPPR1485 ---- Plant proteins ---- Pheophorbide a oxygenase, chloroplastic
Source.219: DFBPPR1486 ---- Plant proteins ---- Probable transcription factor RL9
Source.220: DFBPPR1489 ---- Plant proteins ---- Protein SUBSTANDARD STARCH GRAIN 4, chloroplastic
Source.221: DFBPPR1492 ---- Plant proteins ---- Cation-transporting ATPase HMA5
Source.222: DFBPPR1494 ---- Plant proteins ---- Protein SHORT-ROOT 1
Source.223: DFBPPR1496 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.224: DFBPPR1504 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 50
Source.225: DFBPPR1507 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-4
Source.226: DFBPPR1508 ---- Plant proteins ---- Gamma-aminobutyrate transaminase 1, mitochondrial
Source.227: DFBPPR1509 ---- Plant proteins ---- Heat stress transcription factor A-2d
Source.228: DFBPPR1511 ---- Plant proteins ---- Alpha-amylase isozyme 2A
Source.229: DFBPPR1516 ---- Plant proteins ---- S-(+)-linalool synthase, chloroplastic
Source.230: DFBPPR1518 ---- Plant proteins ---- GATA transcription factor 15
Source.231: DFBPPR1520 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-3
Source.232: DFBPPR1524 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.233: DFBPPR1526 ---- Plant proteins ---- Flavanone 3-dioxygenase 2
Source.234: DFBPPR1527 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 1
Source.235: DFBPPR1529 ---- Plant proteins ---- Nitrate reductase [NADH] 1
Source.236: DFBPPR1531 ---- Plant proteins ---- Zinc finger protein STAR3
Source.237: DFBPPR1534 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 5
Source.238: DFBPPR1535 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.239: DFBPPR1536 ---- Plant proteins ---- Protein DWARF 53
Source.240: DFBPPR1538 ---- Plant proteins ---- Heat stress transcription factor A-2e
Source.241: DFBPPR1541 ---- Plant proteins ---- FT-interacting protein 1
Source.242: DFBPPR1542 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-1
Source.243: DFBPPR1543 ---- Plant proteins ---- Soluble starch synthase 2-2, chloroplastic/amyloplastic
Source.244: DFBPPR1544 ---- Plant proteins ---- Protein disulfide isomerase-like 2-3
Source.245: DFBPPR1546 ---- Plant proteins ---- Potassium transporter 1
Source.246: DFBPPR1548 ---- Plant proteins ---- Ent-copalyl diphosphate synthase 1, chloroplastic
Source.247: DFBPPR1549 ---- Plant proteins ---- Ubiquinol oxidase 1a, mitochondrial
Source.248: DFBPPR1554 ---- Plant proteins ---- Signal peptidase complex-like protein DTM1
Source.249: DFBPPR1558 ---- Plant proteins ---- ATP-dependent DNA helicase 2 subunit KU80
Source.250: DFBPPR1559 ---- Plant proteins ---- Probable kinase CHARK
Source.251: DFBPPR1560 ---- Plant proteins ---- Serine/threonine protein kinase OSK3
Source.252: DFBPPR1568 ---- Plant proteins ---- Phosphate transporter PHO1-2
Source.253: DFBPPR1569 ---- Plant proteins ---- 2-oxoglutarate-dependent dioxygenase 33
Source.254: DFBPPR1571 ---- Plant proteins ---- Sucrose transport protein SUT2
Source.255: DFBPPR1577 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-6
Source.256: DFBPPR1582 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX4
Source.257: DFBPPR1583 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.258: DFBPPR1584 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.259: DFBPPR1585 ---- Plant proteins ---- Carbamoyl-phosphate synthase small chain, chloroplastic
Source.260: DFBPPR1589 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.261: DFBPPR1607 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.262: DFBPPR1608 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.263: DFBPPR1613 ---- Plant proteins ---- Villin-3
Source.264: DFBPPR1617 ---- Plant proteins ---- DNA replication licensing factor MCM7
Source.265: DFBPPR1625 ---- Plant proteins ---- Mitogen-activated protein kinase 3
Source.266: DFBPPR1627 ---- Plant proteins ---- Probable histidine kinase 5
Source.267: DFBPPR1634 ---- Plant proteins ---- Urea-proton symporter DUR3
Source.268: DFBPPR1657 ---- Plant proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit STT3A
Source.269: DFBPPR1659 ---- Plant proteins ---- 4-hydroxy-3-methylbut-2-enyl diphosphate reductase, chloroplastic
Source.270: DFBPPR1662 ---- Plant proteins ---- Probable allantoate deiminase
Source.271: DFBPPR1668 ---- Plant proteins ---- Heat stress transcription factor A-2b
Source.272: DFBPPR1670 ---- Plant proteins ---- Probable beta-1,4-xylosyltransferase GT43A
Source.273: DFBPPR1672 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.274: DFBPPR1673 ---- Plant proteins ---- Ent-cassa-12,15-diene synthase
Source.275: DFBPPR1684 ---- Plant proteins ---- Mixed-linked glucan synthase 2
Source.276: DFBPPR1689 ---- Plant proteins ---- Auxin response factor 21
Source.277: DFBPPR1691 ---- Plant proteins ---- Transcription factor BHLH062
Source.278: DFBPPR1692 ---- Plant proteins ---- Phosphoenolpyruvate/phosphate translocator 2, chloroplastic
Source.279: DFBPPR1693 ---- Plant proteins ---- Cytochrome P450 734A4
Source.280: DFBPPR1694 ---- Plant proteins ---- Cytochrome P450 734A2
Source.281: DFBPPR1695 ---- Plant proteins ---- Putative cellulose synthase A catalytic subunit 11 [UDP-forming]
Source.282: DFBPPR1697 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase SHL2
Source.283: DFBPPR1698 ---- Plant proteins ---- Probable glutathione S-transferase GSTF2
Source.284: DFBPPR1705 ---- Plant proteins ---- Probable GTP-binding protein OBGC1, chloroplastic
Source.285: DFBPPR1707 ---- Plant proteins ---- Probable histidine kinase 2
Source.286: DFBPPR1708 ---- Plant proteins ---- Heat stress transcription factor B-2a
Source.287: DFBPPR1709 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 1
Source.288: DFBPPR1710 ---- Plant proteins ---- Ent-sandaracopimara-8(14),15-diene synthase
Source.289: DFBPPR1712 ---- Plant proteins ---- Mixed-linked glucan synthase 4
Source.290: DFBPPR1716 ---- Plant proteins ---- Probable AMP deaminase
Source.291: DFBPPR1717 ---- Plant proteins ---- Allene oxide synthase 4
Source.292: DFBPPR1718 ---- Plant proteins ---- Allene oxide synthase 3
Source.293: DFBPPR1720 ---- Plant proteins ---- Calcium-dependent protein kinase 28
Source.294: DFBPPR1725 ---- Plant proteins ---- Probable inactive UDP-arabinopyranose mutase 2
Source.295: DFBPPR1728 ---- Plant proteins ---- NAC domain-containing protein 74
Source.296: DFBPPR1729 ---- Plant proteins ---- Auxin efflux carrier component 1a
Source.297: DFBPPR1730 ---- Plant proteins ---- DNA repair and recombination protein RAD54
Source.298: DFBPPR1732 ---- Plant proteins ---- DNA damage-binding protein 2
Source.299: DFBPPR1733 ---- Plant proteins ---- Xylanase inhibitor protein XIP
Source.300: DFBPPR1734 ---- Plant proteins ---- Probable mixed-linked glucan synthase 9
Source.301: DFBPPR1739 ---- Plant proteins ---- Ribose-phosphate pyrophosphokinase 2, chloroplastic
Source.302: DFBPPR1740 ---- Plant proteins ---- Protein ETHYLENE-INSENSITIVE 2
Source.303: DFBPPR1741 ---- Plant proteins ---- Cellulose synthase-like protein E1
Source.304: DFBPPR1744 ---- Plant proteins ---- Heat stress transcription factor A-1
Source.305: DFBPPR1746 ---- Plant proteins ---- Protein LAX PANICLE 2
Source.306: DFBPPR1753 ---- Plant proteins ---- Protein TPR3
Source.307: DFBPPR1755 ---- Plant proteins ---- Superoxide dismutase [Fe] 2, chloroplastic
Source.308: DFBPPR1759 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2a
Source.309: DFBPPR1761 ---- Plant proteins ---- Nuclear/nucleolar GTPase 2
Source.310: DFBPPR1764 ---- Plant proteins ---- B3 domain-containing protein VP1
Source.311: DFBPPR1766 ---- Plant proteins ---- Ethylene receptor 4
Source.312: DFBPPR1767 ---- Plant proteins ---- Phosphatidylserine decarboxylase proenzyme 1, mitochondrial
Source.313: DFBPPR1772 ---- Plant proteins ---- Endoribonuclease Dicer homolog 2b
Source.314: DFBPPR1774 ---- Plant proteins ---- Probable apyrase 1
Source.315: DFBPPR1780 ---- Plant proteins ---- Cyclin-dependent kinase F-3
Source.316: DFBPPR1783 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic A
Source.317: DFBPPR1786 ---- Plant proteins ---- Bidirectional sugar transporter SWEET12
Source.318: DFBPPR1788 ---- Plant proteins ---- Beta-galactosidase 6
Source.319: DFBPPR1792 ---- Plant proteins ---- Probable 3-ketoacyl-CoA synthase 20
Source.320: DFBPPR1794 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.321: DFBPPR1801 ---- Plant proteins ---- Transcription factor MYB4
Source.322: DFBPPR1802 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B3
Source.323: DFBPPR1813 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX5
Source.324: DFBPPR1815 ---- Plant proteins ---- Probable mixed-linked glucan synthase 7
Source.325: DFBPPR1817 ---- Plant proteins ---- Heat shock protein 81-3
Source.326: DFBPPR1821 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX1
Source.327: DFBPPR1822 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase HIP1
Source.328: DFBPPR1826 ---- Plant proteins ---- Protein terminal ear1 homolog
Source.329: DFBPPR1827 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 3
Source.330: DFBPPR1830 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3a
Source.331: DFBPPR1834 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX3
Source.332: DFBPPR1837 ---- Plant proteins ---- Calcium-transporting ATPase 3, plasma membrane-type
Source.333: DFBPPR1839 ---- Plant proteins ---- Laccase-24
Source.334: DFBPPR1843 ---- Plant proteins ---- Laccase-13
Source.335: DFBPPR1845 ---- Plant proteins ---- Putative laccase-17
Source.336: DFBPPR1849 ---- Plant proteins ---- Probable 5'-adenylylsulfate reductase 1, chloroplastic
Source.337: DFBPPR1853 ---- Plant proteins ---- Laccase-4
Source.338: DFBPPR1857 ---- Plant proteins ---- Importin subunit alpha-1a
Source.339: DFBPPR1859 ---- Plant proteins ---- Heat stress transcription factor B-2b
Source.340: DFBPPR1862 ---- Plant proteins ---- Heat stress transcription factor B-2c
Source.341: DFBPPR1865 ---- Plant proteins ---- Laccase-22
Source.342: DFBPPR1867 ---- Plant proteins ---- Laccase-21
Source.343: DFBPPR1872 ---- Plant proteins ---- Cytokinin dehydrogenase 5
Source.344: DFBPPR1874 ---- Plant proteins ---- Inorganic phosphate transporter 1-6
Source.345: DFBPPR1877 ---- Plant proteins ---- Cyclin-dependent kinase F-4
Source.346: DFBPPR1880 ---- Plant proteins ---- Putative laccase-11
Source.347: DFBPPR1882 ---- Plant proteins ---- Laccase-12
Source.348: DFBPPR1884 ---- Plant proteins ---- Putative laccase-1
Source.349: DFBPPR1885 ---- Plant proteins ---- Protoporphyrinogen oxidase, chloroplastic
Source.350: DFBPPR1886 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.351: DFBPPR1892 ---- Plant proteins ---- Sucrose synthase 1
Source.352: DFBPPR1894 ---- Plant proteins ---- Clathrin heavy chain 1
Source.353: DFBPPR1895 ---- Plant proteins ---- DNA topoisomerase 3-alpha
Source.354: DFBPPR1898 ---- Plant proteins ---- Clathrin heavy chain 2
Source.355: DFBPPR1903 ---- Plant proteins ---- Probable apyrase 3
Source.356: DFBPPR1907 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-8
Source.357: DFBPPR1910 ---- Plant proteins ---- Mitogen-activated protein kinase 6
Source.358: DFBPPR1911 ---- Plant proteins ---- Heat stress transcription factor A-6a
Source.359: DFBPPR1913 ---- Plant proteins ---- Phosphoglucan, water dikinase, chloroplastic
Source.360: DFBPPR1914 ---- Plant proteins ---- Xanthine dehydrogenase
Source.361: DFBPPR1916 ---- Plant proteins ---- Protein PYRICULARIA ORYZAE RESISTANCE 21
Source.362: DFBPPR1919 ---- Plant proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.363: DFBPPR1921 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX7
Source.364: DFBPPR1928 ---- Plant proteins ---- Protein disulfide isomerase-like 5-2
Source.365: DFBPPR1937 ---- Plant proteins ---- Formate dehydrogenase 1, mitochondrial
Source.366: DFBPPR1939 ---- Plant proteins ---- Signal peptide peptidase-like 2
Source.367: DFBPPR1943 ---- Plant proteins ---- Naringenin 7-O-methyltransferase
Source.368: DFBPPR1946 ---- Plant proteins ---- Phytochrome A
Source.369: DFBPPR1947 ---- Plant proteins ---- Calcium-transporting ATPase 10, plasma membrane-type
Source.370: DFBPPR1950 ---- Plant proteins ---- Flavonoid 3'-monooxygenase CYP75B4
Source.371: DFBPPR1955 ---- Plant proteins ---- Endoribonuclease Dicer homolog 3b
Source.372: DFBPPR1956 ---- Plant proteins ---- Aminopeptidase M1-A
Source.373: DFBPPR1958 ---- Plant proteins ---- Phospholipase D alpha 2
Source.374: DFBPPR1959 ---- Plant proteins ---- DNA gyrase subunit B, chloroplastic/mitochondrial
Source.375: DFBPPR1960 ---- Plant proteins ---- Probable mixed-linked glucan synthase 6
Source.376: DFBPPR1961 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX2
Source.377: DFBPPR1964 ---- Plant proteins ---- Heat stress transcription factor A-5
Source.378: DFBPPR1965 ---- Plant proteins ---- DNA polymerase I B, mitochondrial
Source.379: DFBPPR1972 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.380: DFBPPR1973 ---- Plant proteins ---- Transcription factor MYB30
Source.381: DFBPPR1979 ---- Plant proteins ---- Quinolinate synthase, chloroplastic
Source.382: DFBPPR1981 ---- Plant proteins ---- Signal peptide peptidase 2
Source.383: DFBPPR1985 ---- Plant proteins ---- Poly [ADP-ribose] polymerase 2-A
Source.384: DFBPPR1987 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 4
Source.385: DFBPPR1989 ---- Plant proteins ---- CBL-interacting protein kinase 16
Source.386: DFBPPR1997 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic B
Source.387: DFBPPR2001 ---- Plant proteins ---- Importin subunit alpha-1b
Source.388: DFBPPR2005 ---- Plant proteins ---- Telomerase reverse transcriptase
Source.389: DFBPPR2006 ---- Plant proteins ---- Probable DNA helicase MCM8
Source.390: DFBPPR2009 ---- Plant proteins ---- Laccase-14
Source.391: DFBPPR2010 ---- Plant proteins ---- CBL-interacting protein kinase 33
Source.392: DFBPPR2012 ---- Plant proteins ---- Sugar transport protein MST6
Source.393: DFBPPR2016 ---- Plant proteins ---- Putative heat stress transcription factor A-6a
Source.394: DFBPPR2017 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 1
Source.395: DFBPPR2023 ---- Plant proteins ---- Mitogen-activated protein kinase 9
Source.396: DFBPPR2024 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.397: DFBPPR2025 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED5, chloroplastic
Source.398: DFBPPR2033 ---- Plant proteins ---- Laccase-2
Source.399: DFBPPR2036 ---- Plant proteins ---- Putative laccase-16
Source.400: DFBPPR2037 ---- Plant proteins ---- Laccase-10
Source.401: DFBPPR2040 ---- Plant proteins ---- Laccase-3
Source.402: DFBPPR2044 ---- Plant proteins ---- Putative mixed-linked glucan synthase 1
Source.403: DFBPPR2046 ---- Plant proteins ---- Double-strand break repair protein MRE11
Source.404: DFBPPR2048 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ23
Source.405: DFBPPR2049 ---- Plant proteins ---- Auxin response factor 19
Source.406: DFBPPR2051 ---- Plant proteins ---- Nicotinamide/nicotinic acid mononucleotide adenylyltransferase
Source.407: DFBPPR2052 ---- Plant proteins ---- Laccase-23
Source.408: DFBPPR2053 ---- Plant proteins ---- Putative laccase-5
Source.409: DFBPPR2055 ---- Plant proteins ---- Cytokinin dehydrogenase 7
Source.410: DFBPPR2060 ---- Plant proteins ---- CBL-interacting protein kinase 3
Source.411: DFBPPR2062 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing] 2
Source.412: DFBPPR2064 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.413: DFBPPR2073 ---- Plant proteins ---- ABC transporter G family member 43
Source.414: DFBPPR2074 ---- Plant proteins ---- Potassium transporter 7
Source.415: DFBPPR2080 ---- Plant proteins ---- Heat stress transcription factor B-1
Source.416: DFBPPR2082 ---- Plant proteins ---- Putative laccase-9
Source.417: DFBPPR2084 ---- Plant proteins ---- Pyruvate kinase 2, cytosolic
Source.418: DFBPPR2086 ---- Plant proteins ---- Cytokinin dehydrogenase 6
Source.419: DFBPPR2087 ---- Plant proteins ---- Cytokinin dehydrogenase 10
Source.420: DFBPPR2088 ---- Plant proteins ---- Probable histidine kinase 1
Source.421: DFBPPR2090 ---- Plant proteins ---- Cytochrome P450 93G1
Source.422: DFBPPR2091 ---- Plant proteins ---- Cellulose synthase-like protein D3
Source.423: DFBPPR2094 ---- Plant proteins ---- Leucine aminopeptidase 2, chloroplastic
Source.424: DFBPPR2099 ---- Plant proteins ---- Nijmegen breakage syndrome 1 protein
Source.425: DFBPPR2103 ---- Plant proteins ---- Probable 3-beta-hydroxysteroid-Delta(8),Delta(7)-isomerase
Source.426: DFBPPR2104 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3
Source.427: DFBPPR2105 ---- Plant proteins ---- Cellulose synthase-like protein D2
Source.428: DFBPPR2108 ---- Plant proteins ---- Cellulose synthase-like protein E6
Source.429: DFBPPR2110 ---- Plant proteins ---- Sugar transport protein MST4
Source.430: DFBPPR2112 ---- Plant proteins ---- Cellulose synthase-like protein H1
Source.431: DFBPPR2119 ---- Plant proteins ---- Meiotic recombination protein SPO11-2
Source.432: DFBPPR2121 ---- Plant proteins ---- Cellulose synthase-like protein D5
Source.433: DFBPPR2127 ---- Plant proteins ---- U-box domain-containing protein 57
Source.434: DFBPPR2132 ---- Plant proteins ---- Oryzain beta chain
Source.435: DFBPPR2135 ---- Plant proteins ---- Putative DNA ligase 4
Source.436: DFBPPR2136 ---- Plant proteins ---- Alpha-1,3-arabinosyltransferase XAT3
Source.437: DFBPPR2139 ---- Plant proteins ---- Receptor homology region, transmembrane domain- and RING domain-containing protein 2
Source.438: DFBPPR2140 ---- Plant proteins ---- Zinc transporter 1
Source.439: DFBPPR2141 ---- Plant proteins ---- Beta-amylase 1, chloroplastic
Source.440: DFBPPR2142 ---- Plant proteins ---- Probable sucrose-phosphate synthase 4
Source.441: DFBPPR2147 ---- Plant proteins ---- Two-component response regulator ORR23
Source.442: DFBPPR2149 ---- Plant proteins ---- Probable calcium-transporting ATPase 9, plasma membrane-type
Source.443: DFBPPR2152 ---- Plant proteins ---- Sucrose transport protein SUT4
Source.444: DFBPPR2155 ---- Plant proteins ---- Two-component response regulator-like PRR1
Source.445: DFBPPR2157 ---- Plant proteins ---- Expansin-B6
Source.446: DFBPPR2160 ---- Plant proteins ---- CBL-interacting protein kinase 11
Source.447: DFBPPR2162 ---- Plant proteins ---- Very-long-chain aldehyde decarbonylase GL1-7
Source.448: DFBPPR2167 ---- Plant proteins ---- Probable tocopherol O-methyltransferase, chloroplastic
Source.449: DFBPPR2168 ---- Plant proteins ---- DnaJ protein ERDJ2
Source.450: DFBPPR2170 ---- Plant proteins ---- Signal peptide peptidase-like 3
Source.451: DFBPPR2171 ---- Plant proteins ---- Probable mixed-linked glucan synthase 8
Source.452: DFBPPR2174 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX29
Source.453: DFBPPR2180 ---- Plant proteins ---- UDP-sugar pyrophosphorylase
Source.454: DFBPPR2181 ---- Plant proteins ---- 9-cis-epoxycarotenoid dioxygenase NCED3, chloroplastic
Source.455: DFBPPR2189 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 4
Source.456: DFBPPR2190 ---- Plant proteins ---- CBL-interacting protein kinase 2
Source.457: DFBPPR2192 ---- Plant proteins ---- Probable calcium-transporting ATPase 8, plasma membrane-type
Source.458: DFBPPR2193 ---- Plant proteins ---- Glucomannan 4-beta-mannosyltransferase 1
Source.459: DFBPPR2195 ---- Plant proteins ---- Signal peptide peptidase 1
Source.460: DFBPPR2196 ---- Plant proteins ---- Probable glucuronosyltransferase GUT1
Source.461: DFBPPR2202 ---- Plant proteins ---- Putative leucine aminopeptidase 1
Source.462: DFBPPR2203 ---- Plant proteins ---- Protein SHORT-ROOT 2
Source.463: DFBPPR2204 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 9
Source.464: DFBPPR2210 ---- Plant proteins ---- CBL-interacting protein kinase 32
Source.465: DFBPPR2211 ---- Plant proteins ---- Probable mixed-linked glucan synthase 3
Source.466: DFBPPR2212 ---- Plant proteins ---- BURP domain-containing protein 13
Source.467: DFBPPR2215 ---- Plant proteins ---- ABC transporter G family member 50
Source.468: DFBPPR2217 ---- Plant proteins ---- Serine carboxypeptidase-like 26
Source.469: DFBPPR2218 ---- Plant proteins ---- Auxin response factor 12
Source.470: DFBPPR2219 ---- Plant proteins ---- DNA excision repair protein CSB
Source.471: DFBPPR2224 ---- Plant proteins ---- CBL-interacting protein kinase 9
Source.472: DFBPPR2229 ---- Plant proteins ---- Probable glutathione S-transferase GSTF1
Source.473: DFBPPR2238 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 2
Source.474: DFBPPR2251 ---- Plant proteins ---- CBL-interacting protein kinase 30
Source.475: DFBPPR2253 ---- Plant proteins ---- Probable methylenetetrahydrofolate reductase
Source.476: DFBPPR2255 ---- Plant proteins ---- Formate dehydrogenase 2, mitochondrial
Source.477: DFBPPR2256 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 3
Source.478: DFBPPR2257 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 11
Source.479: DFBPPR2259 ---- Plant proteins ---- Inorganic phosphate transporter 1-1
Source.480: DFBPPR2264 ---- Plant proteins ---- Protein ROOT HAIR DEFECTIVE 3 homolog 1
Source.481: DFBPPR2265 ---- Plant proteins ---- ABC transporter G family member 52
Source.482: DFBPPR2267 ---- Plant proteins ---- CAAX prenyl protease 1 homolog
Source.483: DFBPPR2268 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 7
Source.484: DFBPPR2269 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX8
Source.485: DFBPPR2272 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 2
Source.486: DFBPPR2273 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 6
Source.487: DFBPPR2276 ---- Plant proteins ---- Probable calcium-transporting ATPase 6, plasma membrane-type
Source.488: DFBPPR2277 ---- Plant proteins ---- Protein TOC75, chloroplastic
Source.489: DFBPPR2280 ---- Plant proteins ---- Origin of replication complex subunit 3
Source.490: DFBPPR2282 ---- Plant proteins ---- Heat shock protein 81-1
Source.491: DFBPPR2285 ---- Plant proteins ---- Protein CYCLOPS
Source.492: DFBPPR2291 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 3
Source.493: DFBPPR2292 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.494: DFBPPR2295 ---- Plant proteins ---- DnaJ protein ERDJ3B
Source.495: DFBPPR2297 ---- Plant proteins ---- Probable LL-diaminopimelate aminotransferase, chloroplastic
Source.496: DFBPPR2298 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 4
Source.497: DFBPPR2300 ---- Plant proteins ---- Cellulose synthase-like protein H2
Source.498: DFBPPR2304 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.499: DFBPPR2307 ---- Plant proteins ---- Heat stress transcription factor C-2b
Source.500: DFBPPR2308 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 1
Source.501: DFBPPR2310 ---- Plant proteins ---- Heat stress transcription factor A-3
Source.502: DFBPPR2315 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.503: DFBPPR2323 ---- Plant proteins ---- Ent-kaurene oxidase-like 3
Source.504: DFBPPR2326 ---- Plant proteins ---- Sucrose transport protein SUT3
Source.505: DFBPPR2328 ---- Plant proteins ---- Two-component response regulator ORR26
Source.506: DFBPPR2333 ---- Plant proteins ---- Bifunctional nitrilase/nitrile hydratase NIT4
Source.507: DFBPPR2334 ---- Plant proteins ---- Probable sucrose-phosphate synthase 5
Source.508: DFBPPR2336 ---- Plant proteins ---- Protein arginine N-methyltransferase 5
Source.509: DFBPPR2339 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 2
Source.510: DFBPPR2341 ---- Plant proteins ---- E3 ubiquitin-protein ligase Os06g0535400
Source.511: DFBPPR2350 ---- Plant proteins ---- Metal tolerance protein 4
Source.512: DFBPPR2353 ---- Plant proteins ---- Expansin-B12
Source.513: DFBPPR2364 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.514: DFBPPR2365 ---- Plant proteins ---- Auxin response factor 5
Source.515: DFBPPR2366 ---- Plant proteins ---- Protein NODULATION SIGNALING PATHWAY 2
Source.516: DFBPPR2367 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 5
Source.517: DFBPPR2371 ---- Plant proteins ---- Seed allergenic protein RAG1
Source.518: DFBPPR2373 ---- Plant proteins ---- Adagio-like protein 3
Source.519: DFBPPR2376 ---- Plant proteins ---- Probable glutathione S-transferase GSTU6
Source.520: DFBPPR2378 ---- Plant proteins ---- Probable sucrose-phosphate synthase 2
Source.521: DFBPPR2380 ---- Plant proteins ---- Protein disulfide isomerase-like 5-3
Source.522: DFBPPR2382 ---- Plant proteins ---- Putative cellulose synthase-like protein H3
Source.523: DFBPPR2388 ---- Plant proteins ---- CBL-interacting protein kinase 10
Source.524: DFBPPR2393 ---- Plant proteins ---- 4-alpha-glucanotransferase DPE1, chloroplastic/amyloplastic
Source.525: DFBPPR2401 ---- Plant proteins ---- Kinesin-like protein KIN-4C
Source.526: DFBPPR2402 ---- Plant proteins ---- Tyrosine decarboxylase
Source.527: DFBPPR2407 ---- Plant proteins ---- Homeobox protein knotted-1-like 7
Source.528: DFBPPR2418 ---- Plant proteins ---- CBL-interacting protein kinase 28
Source.529: DFBPPR2420 ---- Plant proteins ---- Probable transcription factor GLK1
Source.530: DFBPPR2425 ---- Plant proteins ---- Cysteine protease ATG4A
Source.531: DFBPPR2427 ---- Plant proteins ---- (6-4)DNA photolyase
Source.532: DFBPPR2428 ---- Plant proteins ---- Bidirectional sugar transporter SWEET13
Source.533: DFBPPR2431 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 5, chloroplastic
Source.534: DFBPPR2432 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.535: DFBPPR2436 ---- Plant proteins ---- NADH dehydrogenase [ubiquinone] iron-sulfur protein 3
Source.536: DFBPPR2442 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1c
Source.537: DFBPPR2447 ---- Plant proteins ---- CBL-interacting protein kinase 6
Source.538: DFBPPR2450 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain A, chloroplastic
Source.539: DFBPPR2452 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX9
Source.540: DFBPPR2455 ---- Plant proteins ---- Auxin response factor 4
Source.541: DFBPPR2456 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 9
Source.542: DFBPPR2459 ---- Plant proteins ---- Auxin response factor 25
Source.543: DFBPPR2463 ---- Plant proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.544: DFBPPR2464 ---- Plant proteins ---- Two-component response regulator ORR25
Source.545: DFBPPR2472 ---- Plant proteins ---- Heat stress transcription factor B-4d
Source.546: DFBPPR2476 ---- Plant proteins ---- Fumarylacetoacetase
Source.547: DFBPPR2478 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.548: DFBPPR2482 ---- Plant proteins ---- Probable allantoinase
Source.549: DFBPPR2490 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 2, cytosolic
Source.550: DFBPPR2495 ---- Plant proteins ---- Probable histone acetyltransferase HAC-like 3
Source.551: DFBPPR2498 ---- Plant proteins ---- CBL-interacting protein kinase 20
Source.552: DFBPPR2499 ---- Plant proteins ---- Probable glucomannan 4-beta-mannosyltransferase 5
Source.553: DFBPPR2512 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.554: DFBPPR2513 ---- Plant proteins ---- Beta-glucosidase 25
Source.555: DFBPPR2515 ---- Plant proteins ---- Thioredoxin O, mitochondrial
Source.556: DFBPPR2517 ---- Plant proteins ---- Ethylene-responsive transcription factor 1
Source.557: DFBPPR2521 ---- Plant proteins ---- CBL-interacting protein kinase 22
Source.558: DFBPPR2525 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX10
Source.559: DFBPPR2527 ---- Plant proteins ---- Two-component response regulator ORR24
Source.560: DFBPPR2529 ---- Plant proteins ---- Two-component response regulator ORR21
Source.561: DFBPPR2536 ---- Plant proteins ---- Heat stress transcription factor B-4c
Source.562: DFBPPR2541 ---- Plant proteins ---- Auxin response factor 18
Source.563: DFBPPR2542 ---- Plant proteins ---- Heat shock protein 81-2
Source.564: DFBPPR2546 ---- Plant proteins ---- Auxin response factor 1
Source.565: DFBPPR2548 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 2, mitochondrial
Source.566: DFBPPR2550 ---- Plant proteins ---- Polyamine transporter PUT1
Source.567: DFBPPR2556 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.568: DFBPPR2559 ---- Plant proteins ---- Two-component response regulator ORR27
Source.569: DFBPPR2560 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 3, cytosolic
Source.570: DFBPPR2571 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.571: DFBPPR2577 ---- Plant proteins ---- Probable gamma-aminobutyrate transaminase 3, mitochondrial
Source.572: DFBPPR2579 ---- Plant proteins ---- Probable glycerol-3-phosphate dehydrogenase [NAD(+)] 1, cytosolic
Source.573: DFBPPR2581 ---- Plant proteins ---- Polyamine oxidase 6
Source.574: DFBPPR2584 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1
Source.575: DFBPPR2588 ---- Plant proteins ---- Putative heat stress transcription factor B-4a
Source.576: DFBPPR2590 ---- Plant proteins ---- Cation transporter HKT4
Source.577: DFBPPR2592 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase CMT2
Source.578: DFBPPR2593 ---- Plant proteins ---- Probable lipoxygenase 8, chloroplastic
Source.579: DFBPPR2594 ---- Plant proteins ---- Protein HAPLESS 2-A
Source.580: DFBPPR2595 ---- Plant proteins ---- Expansin-B7
Source.581: DFBPPR2599 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-1
Source.582: DFBPPR2600 ---- Plant proteins ---- Autophagy protein 5
Source.583: DFBPPR2602 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX19
Source.584: DFBPPR2603 ---- Plant proteins ---- Disease resistance protein Pik-2
Source.585: DFBPPR2608 ---- Plant proteins ---- Prolamin PPROL 14E
Source.586: DFBPPR2613 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 1
Source.587: DFBPPR2615 ---- Plant proteins ---- Cytochrome P450 734A5
Source.588: DFBPPR2624 ---- Plant proteins ---- Transcription initiation factor IIA subunit 2
Source.589: DFBPPR2626 ---- Plant proteins ---- ADP-ribosylation factor 1
Source.590: DFBPPR2634 ---- Plant proteins ---- 16.0 kDa heat shock protein, peroxisomal
Source.591: DFBPPR2636 ---- Plant proteins ---- Expansin-B8
Source.592: DFBPPR2640 ---- Plant proteins ---- CBL-interacting protein kinase 26
Source.593: DFBPPR2642 ---- Plant proteins ---- CBL-interacting protein kinase 18
Source.594: DFBPPR2643 ---- Plant proteins ---- Coronatine-insensitive protein homolog 1b
Source.595: DFBPPR2646 ---- Plant proteins ---- CBL-interacting protein kinase 25
Source.596: DFBPPR2652 ---- Plant proteins ---- Probable tRNA-splicing endonuclease subunit Sen2
Source.597: DFBPPR2656 ---- Plant proteins ---- Expansin-A15
Source.598: DFBPPR2657 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ1
Source.599: DFBPPR2658 ---- Plant proteins ---- Vacuolar cation/proton exchanger 1b
Source.600: DFBPPR2660 ---- Plant proteins ---- ABC transporter G family member 25
Source.601: DFBPPR2661 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 5
Source.602: DFBPPR2674 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-3
Source.603: DFBPPR2679 ---- Plant proteins ---- Expansin-A22
Source.604: DFBPPR2680 ---- Plant proteins ---- Aspartic proteinase oryzasin-1
Source.605: DFBPPR2682 ---- Plant proteins ---- Beta-glucosidase 30
Source.606: DFBPPR2686 ---- Plant proteins ---- Adagio-like protein 1
Source.607: DFBPPR2688 ---- Plant proteins ---- Regulatory-associated protein of TOR 2
Source.608: DFBPPR2690 ---- Plant proteins ---- E3 ubiquitin-protein ligase makorin
Source.609: DFBPPR2691 ---- Plant proteins ---- Achilleol B synthase
Source.610: DFBPPR2693 ---- Plant proteins ---- Parkeol synthase
Source.611: DFBPPR2695 ---- Plant proteins ---- Putative CBL-interacting protein kinase 27
Source.612: DFBPPR2696 ---- Plant proteins ---- Probable GDP-L-fucose synthase 1
Source.613: DFBPPR2700 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX16
Source.614: DFBPPR2705 ---- Plant proteins ---- Probable protein phosphatase 2C 72
Source.615: DFBPPR2711 ---- Plant proteins ---- ADP-ribosylation factor 2
Source.616: DFBPPR2713 ---- Plant proteins ---- Potassium channel KOR2
Source.617: DFBPPR2716 ---- Plant proteins ---- Endoglucanase 1
Source.618: DFBPPR2718 ---- Plant proteins ---- Kinesin-like protein KIN-14M
Source.619: DFBPPR2720 ---- Plant proteins ---- Monodehydroascorbate reductase 2, peroxisomal
Source.620: DFBPPR2726 ---- Plant proteins ---- Probable histone acetyltransferase type B catalytic subunit
Source.621: DFBPPR2734 ---- Plant proteins ---- Cation-chloride cotransporter 2
Source.622: DFBPPR2735 ---- Plant proteins ---- Expansin-A24
Source.623: DFBPPR2739 ---- Plant proteins ---- Probable cytokinin riboside 5'-monophosphate phosphoribohydrolase LOGL8
Source.624: DFBPPR2741 ---- Plant proteins ---- Probable serine/threonine-protein kinase WNK5
Source.625: DFBPPR2744 ---- Plant proteins ---- Zinc finger BED domain-containing protein RICESLEEPER 3
Source.626: DFBPPR2750 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX25
Source.627: DFBPPR2751 ---- Plant proteins ---- Actin-7
Source.628: DFBPPR2753 ---- Plant proteins ---- Transportin-1
Source.629: DFBPPR2758 ---- Plant proteins ---- Expansin-B17
Source.630: DFBPPR2762 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL1 homolog
Source.631: DFBPPR2763 ---- Plant proteins ---- Actin-1
Source.632: DFBPPR2765 ---- Plant proteins ---- Regulatory-associated protein of TOR 1
Source.633: DFBPPR2766 ---- Plant proteins ---- Ubiquitin carboxyl-terminal hydrolase 26
Source.634: DFBPPR2767 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1-2
Source.635: DFBPPR2768 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase 1, chloroplastic
Source.636: DFBPPR2772 ---- Plant proteins ---- ABC transporter G family member 44
Source.637: DFBPPR2773 ---- Plant proteins ---- Tripeptidyl-peptidase 2
Source.638: DFBPPR2781 ---- Plant proteins ---- Gibberellin 2-beta-dioxygenase 2
Source.639: DFBPPR2782 ---- Plant proteins ---- Thioredoxin reductase NTRA
Source.640: DFBPPR2785 ---- Plant proteins ---- Aspartic proteinase
Source.641: DFBPPR2789 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.642: DFBPPR2790 ---- Plant proteins ---- Auxin response factor 22
Source.643: DFBPPR2794 ---- Plant proteins ---- FACT complex subunit SPT16
Source.644: DFBPPR2806 ---- Plant proteins ---- Ferrochelatase-2, chloroplastic
Source.645: DFBPPR2807 ---- Plant proteins ---- Beta-glucosidase 32
Source.646: DFBPPR2810 ---- Plant proteins ---- Probable N6-adenosine-methyltransferase MT-A70-like
Source.647: DFBPPR2815 ---- Plant proteins ---- Putative adagio-like protein 2
Source.648: DFBPPR2819 ---- Plant proteins ---- Squamosa promoter-binding-like protein 4
Source.649: DFBPPR2824 ---- Plant proteins ---- Putative GDP-L-fucose synthase 2
Source.650: DFBPPR2829 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 2
Source.651: DFBPPR2833 ---- Plant proteins ---- Putative beta-glucosidase 23
Source.652: DFBPPR2834 ---- Plant proteins ---- Sugar transport protein MST3
Source.653: DFBPPR2838 ---- Plant proteins ---- ABC transporter G family member 37
Source.654: DFBPPR2845 ---- Plant proteins ---- ABC transporter G family member 47
Source.655: DFBPPR2852 ---- Plant proteins ---- Acyl transferase 4
Source.656: DFBPPR2854 ---- Plant proteins ---- ABC transporter G family member 34
Source.657: DFBPPR2856 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.658: DFBPPR2857 ---- Plant proteins ---- ABC transporter G family member 42
Source.659: DFBPPR2861 ---- Plant proteins ---- Probable aquaporin TIP1-1
Source.660: DFBPPR2863 ---- Plant proteins ---- Serine carboxypeptidase-like
Source.661: DFBPPR2869 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX11
Source.662: DFBPPR2870 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX27
Source.663: DFBPPR2871 ---- Plant proteins ---- Protein SEMI-ROLLED LEAF 2
Source.664: DFBPPR2881 ---- Plant proteins ---- Probable protein NAP1
Source.665: DFBPPR2884 ---- Plant proteins ---- Expansin-B2
Source.666: DFBPPR2885 ---- Plant proteins ---- Ammonium transporter 2 member 1
Source.667: DFBPPR2894 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21A
Source.668: DFBPPR2895 ---- Plant proteins ---- Serine/arginine-rich splicing factor RSZ21
Source.669: DFBPPR2905 ---- Plant proteins ---- Cytochrome P450 714C2
Source.670: DFBPPR2907 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.671: DFBPPR2912 ---- Plant proteins ---- Probable auxin efflux carrier component 3b
Source.672: DFBPPR2913 ---- Plant proteins ---- DNA damage-binding protein 1
Source.673: DFBPPR2918 ---- Plant proteins ---- Inorganic phosphate transporter 1-11
Source.674: DFBPPR2921 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 3
Source.675: DFBPPR2924 ---- Plant proteins ---- Probable glycosyltransferase 7
Source.676: DFBPPR2926 ---- Plant proteins ---- Signal peptide peptidase-like 1
Source.677: DFBPPR2931 ---- Plant proteins ---- Putative expansin-B14
Source.678: DFBPPR2934 ---- Plant proteins ---- Metal transporter Nramp1
Source.679: DFBPPR2937 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 7
Source.680: DFBPPR2940 ---- Plant proteins ---- Sialyltransferase-like protein 5
Source.681: DFBPPR2941 ---- Plant proteins ---- Probable histone-arginine methyltransferase CARM1
Source.682: DFBPPR2947 ---- Plant proteins ---- Peroxisomal membrane protein 11-5
Source.683: DFBPPR2949 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 1
Source.684: DFBPPR2957 ---- Plant proteins ---- Probable protein phosphatase 2C 40
Source.685: DFBPPR2959 ---- Plant proteins ---- Serine/threonine-protein phosphatase BSL2 homolog
Source.686: DFBPPR2964 ---- Plant proteins ---- Expansin-A14
Source.687: DFBPPR2969 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 3
Source.688: DFBPPR2974 ---- Plant proteins ---- Derlin-1
Source.689: DFBPPR2975 ---- Plant proteins ---- Hydroxycinnamoyltransferase 4
Source.690: DFBPPR2976 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 2, chloroplastic
Source.691: DFBPPR2979 ---- Plant proteins ---- Mitochondrial outer membrane protein porin 1
Source.692: DFBPPR2980 ---- Plant proteins ---- Uroporphyrinogen decarboxylase 1, chloroplastic
Source.693: DFBPPR2981 ---- Plant proteins ---- Beta-glucosidase 19
Source.694: DFBPPR2989 ---- Plant proteins ---- Actin-2
Source.695: DFBPPR2993 ---- Plant proteins ---- Beta-glucosidase 5
Source.696: DFBPPR3002 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX20
Source.697: DFBPPR3003 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX13
Source.698: DFBPPR3008 ---- Plant proteins ---- Potassium channel KOR1
Source.699: DFBPPR3009 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 2
Source.700: DFBPPR3013 ---- Plant proteins ---- Putative 12-oxophytodienoate reductase 3
Source.701: DFBPPR3018 ---- Plant proteins ---- Molybdopterin synthase catalytic subunit
Source.702: DFBPPR3024 ---- Plant proteins ---- Beta-glucosidase 31
Source.703: DFBPPR3026 ---- Plant proteins ---- Polyprenol reductase 1
Source.704: DFBPPR3029 ---- Plant proteins ---- Beta-galactosidase 15
Source.705: DFBPPR3033 ---- Plant proteins ---- Putative beta-glucosidase 17
Source.706: DFBPPR3039 ---- Plant proteins ---- Probable auxin efflux carrier component 5b
Source.707: DFBPPR3049 ---- Plant proteins ---- Probable potassium transporter 17
Source.708: DFBPPR3050 ---- Plant proteins ---- Inositol polyphosphate multikinase IPK2
Source.709: DFBPPR3062 ---- Plant proteins ---- Polyprenol reductase 2
Source.710: DFBPPR3063 ---- Plant proteins ---- Profilin-A
Source.711: DFBPPR3070 ---- Plant proteins ---- Putative D-cysteine desulfhydrase 1, mitochondrial
Source.712: DFBPPR3071 ---- Plant proteins ---- ABC transporter G family member 45
Source.713: DFBPPR3073 ---- Plant proteins ---- Kinesin-like protein KIN-7H
Source.714: DFBPPR3080 ---- Plant proteins ---- Beta-galactosidase 3
Source.715: DFBPPR3081 ---- Plant proteins ---- ABC transporter G family member 38
Source.716: DFBPPR3084 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL13
Source.717: DFBPPR3086 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX33
Source.718: DFBPPR3087 ---- Plant proteins ---- Actin-3
Source.719: DFBPPR3089 ---- Plant proteins ---- E3 SUMO-protein ligase SIZ2
Source.720: DFBPPR3090 ---- Plant proteins ---- MLO protein homolog 1
Source.721: DFBPPR3092 ---- Plant proteins ---- Beta-galactosidase 12
Source.722: DFBPPR3093 ---- Plant proteins ---- Beta-galactosidase 11
Source.723: DFBPPR3095 ---- Plant proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 4
Source.724: DFBPPR3097 ---- Plant proteins ---- ABC transporter G family member 48
Source.725: DFBPPR3100 ---- Plant proteins ---- Kinesin-like protein KIN-14E
Source.726: DFBPPR3101 ---- Plant proteins ---- Putative potassium transporter 12
Source.727: DFBPPR3102 ---- Plant proteins ---- Expansin-B18
Source.728: DFBPPR3106 ---- Plant proteins ---- Protein HIRA
Source.729: DFBPPR3119 ---- Plant proteins ---- ABC transporter G family member 39
Source.730: DFBPPR3123 ---- Plant proteins ---- Probable mitochondrial import receptor subunit TOM20
Source.731: DFBPPR3125 ---- Plant proteins ---- Putative alpha-L-fucosidase 1
Source.732: DFBPPR3136 ---- Plant proteins ---- Magnesium/proton exchanger 1
Source.733: DFBPPR3138 ---- Plant proteins ---- Villin-1
Source.734: DFBPPR3140 ---- Plant proteins ---- ABC transporter G family member 51
Source.735: DFBPPR3141 ---- Plant proteins ---- Multicopper oxidase LPR1 homolog 1
Source.736: DFBPPR3150 ---- Plant proteins ---- Probable glycosyltransferase 3
Source.737: DFBPPR3152 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 3, chloroplastic
Source.738: DFBPPR3155 ---- Plant proteins ---- Acyl transferase 1
Source.739: DFBPPR3159 ---- Plant proteins ---- Peroxisomal membrane protein 11-3
Source.740: DFBPPR3163 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX32
Source.741: DFBPPR3164 ---- Plant proteins ---- Cysteine proteinase inhibitor 2
Source.742: DFBPPR3168 ---- Plant proteins ---- ABC transporter G family member 32
Source.743: DFBPPR3171 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase
Source.744: DFBPPR3172 ---- Plant proteins ---- Putative germin-like protein 9-2
Source.745: DFBPPR3176 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8
Source.746: DFBPPR3179 ---- Plant proteins ---- Probable protein phosphatase 2C 48
Source.747: DFBPPR3180 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926700
Source.748: DFBPPR3181 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX15
Source.749: DFBPPR3184 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.750: DFBPPR3186 ---- Plant proteins ---- Endoglucanase 10
Source.751: DFBPPR3188 ---- Plant proteins ---- Auxin-responsive protein IAA27
Source.752: DFBPPR3190 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX17
Source.753: DFBPPR3204 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 2
Source.754: DFBPPR3206 ---- Plant proteins ---- Expansin-B15
Source.755: DFBPPR3207 ---- Plant proteins ---- Cysteine protease ATG4B
Source.756: DFBPPR3218 ---- Plant proteins ---- Probable lipoxygenase 6
Source.757: DFBPPR3225 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit M, chloroplastic
Source.758: DFBPPR3229 ---- Plant proteins ---- Transcription factor TGAL7
Source.759: DFBPPR3230 ---- Plant proteins ---- Probable protein phosphatase 2C 37
Source.760: DFBPPR3233 ---- Plant proteins ---- Diaminopimelate epimerase, chloroplastic
Source.761: DFBPPR3234 ---- Plant proteins ---- Putative homeobox-leucine zipper protein HOX26
Source.762: DFBPPR3237 ---- Plant proteins ---- Arginine decarboxylase 2
Source.763: DFBPPR3238 ---- Plant proteins ---- Hydrophobic protein LTI6A
Source.764: DFBPPR3242 ---- Plant proteins ---- Peroxisomal membrane protein 11-1
Source.765: DFBPPR3249 ---- Plant proteins ---- Coatomer subunit beta'-1
Source.766: DFBPPR3250 ---- Plant proteins ---- Disease resistance protein Pikm2-TS
Source.767: DFBPPR3251 ---- Plant proteins ---- Probable glycosyltransferase 6
Source.768: DFBPPR3256 ---- Plant proteins ---- Beta-glucosidase 1
Source.769: DFBPPR3259 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-3 catalytic subunit
Source.770: DFBPPR3266 ---- Plant proteins ---- Protein MOR1
Source.771: DFBPPR3267 ---- Plant proteins ---- CDP-diacylglycerol--serine O-phosphatidyltransferase 3
Source.772: DFBPPR3269 ---- Plant proteins ---- Auxin response factor 13
Source.773: DFBPPR3271 ---- Plant proteins ---- Eukaryotic translation initiation factor NCBP
Source.774: DFBPPR3273 ---- Plant proteins ---- Dephospho-CoA kinase
Source.775: DFBPPR3274 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX18
Source.776: DFBPPR3279 ---- Plant proteins ---- 24.1 kDa heat shock protein, mitochondrial
Source.777: DFBPPR3285 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926400
Source.778: DFBPPR3290 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os05g0150500
Source.779: DFBPPR3296 ---- Plant proteins ---- MADS-box transcription factor 32
Source.780: DFBPPR3303 ---- Plant proteins ---- Beta-glucosidase 2
Source.781: DFBPPR3306 ---- Plant proteins ---- Bidirectional sugar transporter SWEET3a
Source.782: DFBPPR3310 ---- Plant proteins ---- Transcription factor PCF2
Source.783: DFBPPR3312 ---- Plant proteins ---- Bifunctional nuclease 1
Source.784: DFBPPR3314 ---- Plant proteins ---- Probable auxin efflux carrier component 5a
Source.785: DFBPPR3318 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.4
Source.786: DFBPPR3320 ---- Plant proteins ---- Probable xyloglucan glycosyltransferase 1
Source.787: DFBPPR3322 ---- Plant proteins ---- Putative xyloglucan glycosyltransferase 10
Source.788: DFBPPR3325 ---- Plant proteins ---- Secretory carrier-associated membrane protein 3
Source.789: DFBPPR3331 ---- Plant proteins ---- RNA pseudouridine synthase 3, mitochondrial
Source.790: DFBPPR3334 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL12
Source.791: DFBPPR3340 ---- Plant proteins ---- Beta-galactosidase 5
Source.792: DFBPPR3343 ---- Plant proteins ---- Plant intracellular Ras-group-related LRR protein 8
Source.793: DFBPPR3345 ---- Plant proteins ---- Acyl-[acyl-carrier-protein] desaturase 4, chloroplastic
Source.794: DFBPPR3346 ---- Plant proteins ---- Peroxisomal membrane protein 11-2
Source.795: DFBPPR3348 ---- Plant proteins ---- Probable methionine--tRNA ligase
Source.796: DFBPPR3350 ---- Plant proteins ---- DEAD-box ATP-dependent RNA helicase 22
Source.797: DFBPPR3351 ---- Plant proteins ---- ATP phosphoribosyltransferase, chloroplastic
Source.798: DFBPPR3354 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1A
Source.799: DFBPPR3355 ---- Plant proteins ---- Beta-glucosidase 22
Source.800: DFBPPR3357 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein B
Source.801: DFBPPR3360 ---- Plant proteins ---- Cycloartenol synthase
Source.802: DFBPPR3362 ---- Plant proteins ---- Probable alpha-glucosidase Os06g0675700
Source.803: DFBPPR3363 ---- Plant proteins ---- Beta-galactosidase 2
Source.804: DFBPPR3364 ---- Plant proteins ---- Beta-glucosidase 38
Source.805: DFBPPR3384 ---- Plant proteins ---- Putative coatomer subunit beta'-3
Source.806: DFBPPR3388 ---- Plant proteins ---- Beta-galactosidase 14
Source.807: DFBPPR3389 ---- Plant proteins ---- Beta-galactosidase 7
Source.808: DFBPPR3391 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX28
Source.809: DFBPPR3396 ---- Plant proteins ---- Probable transcription factor GLK2
Source.810: DFBPPR3399 ---- Plant proteins ---- Mannan endo-1,4-beta-mannosidase 4
Source.811: DFBPPR3402 ---- Plant proteins ---- Probable auxin efflux carrier component 5c
Source.812: DFBPPR3403 ---- Plant proteins ---- Sugar transport protein MST5
Source.813: DFBPPR3412 ---- Plant proteins ---- CMP-sialic acid transporter 2
Source.814: DFBPPR3415 ---- Plant proteins ---- Expansin-A33
Source.815: DFBPPR3420 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.12
Source.816: DFBPPR3423 ---- Plant proteins ---- ABC transporter G family member 40
Source.817: DFBPPR3425 ---- Plant proteins ---- Transcription initiation factor TFIID subunit 1
Source.818: DFBPPR3426 ---- Plant proteins ---- Aquaporin NIP1-1
Source.819: DFBPPR3427 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 1
Source.820: DFBPPR3439 ---- Plant proteins ---- Cryptochrome DASH, chloroplastic/mitochondrial
Source.821: DFBPPR3441 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.822: DFBPPR3445 ---- Plant proteins ---- Serine/threonine-protein kinase ATR
Source.823: DFBPPR3447 ---- Plant proteins ---- Putative potassium transporter 8
Source.824: DFBPPR3449 ---- Plant proteins ---- 13 kDa prolamin C
Source.825: DFBPPR3450 ---- Plant proteins ---- Disease resistance protein RGA5
Source.826: DFBPPR3451 ---- Plant proteins ---- Probable aquaporin TIP1-2
Source.827: DFBPPR3455 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX12
Source.828: DFBPPR3458 ---- Plant proteins ---- Probable cation transporter HKT6
Source.829: DFBPPR3460 ---- Plant proteins ---- Histone-binding protein MSI1 homolog
Source.830: DFBPPR3464 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 1
Source.831: DFBPPR3466 ---- Plant proteins ---- Two-component response regulator-like PRR73
Source.832: DFBPPR3475 ---- Plant proteins ---- Homeobox-leucine zipper protein HOX14
Source.833: DFBPPR3479 ---- Plant proteins ---- Expansin-like A1
Source.834: DFBPPR3480 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 4
Source.835: DFBPPR3491 ---- Plant proteins ---- Aminotransferase ALD1 homolog
Source.836: DFBPPR3497 ---- Plant proteins ---- Potassium channel KAT4
Source.837: DFBPPR3498 ---- Plant proteins ---- Actin-related protein 6
Source.838: DFBPPR3499 ---- Plant proteins ---- Probable anion transporter 3, chloroplastic
Source.839: DFBPPR3500 ---- Plant proteins ---- Probable ascorbate-specific transmembrane electron transporter 2
Source.840: DFBPPR3501 ---- Plant proteins ---- Probable glucuronosyltransferase Os01g0926600
Source.841: DFBPPR3505 ---- Plant proteins ---- Ribosome biogenesis protein WDR12 homolog
Source.842: DFBPPR3517 ---- Plant proteins ---- Triose phosphate/phosphate translocator TPT, chloroplastic
Source.843: DFBPPR3520 ---- Plant proteins ---- COBRA-like protein 1
Source.844: DFBPPR3529 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS36
Source.845: DFBPPR3536 ---- Plant proteins ---- Putative auxin transporter-like protein 4
Source.846: DFBPPR3540 ---- Plant proteins ---- Auxin transporter-like protein 2
Source.847: DFBPPR3541 ---- Plant proteins ---- Sucrose synthase 3
Source.848: DFBPPR3549 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-3
Source.849: DFBPPR3555 ---- Plant proteins ---- Actin-related protein 8
Source.850: DFBPPR3559 ---- Plant proteins ---- Putative protein phosphatase 2C 22
Source.851: DFBPPR3560 ---- Plant proteins ---- Probable inactive beta-glucosidase 33
Source.852: DFBPPR3561 ---- Plant proteins ---- Probable protein phosphatase 2C 60
Source.853: DFBPPR3563 ---- Plant proteins ---- Transport inhibitor response 1-like protein Os04g0395600
Source.854: DFBPPR3564 ---- Plant proteins ---- Probable protein phosphatase 2C 36
Source.855: DFBPPR3565 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.856: DFBPPR3566 ---- Plant proteins ---- Probable protein phosphatase 2C 65
Source.857: DFBPPR3568 ---- Plant proteins ---- Bidirectional sugar transporter SWEET16
Source.858: DFBPPR3571 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-8
Source.859: DFBPPR3579 ---- Plant proteins ---- Peptide methionine sulfoxide reductase A5
Source.860: DFBPPR3580 ---- Plant proteins ---- Ribosome biogenesis protein BOP1 homolog
Source.861: DFBPPR3585 ---- Plant proteins ---- Probable potassium transporter 2
Source.862: DFBPPR3587 ---- Plant proteins ---- Auxin transport protein BIG
Source.863: DFBPPR3589 ---- Plant proteins ---- Expansin-like A2
Source.864: DFBPPR3592 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-12
Source.865: DFBPPR3597 ---- Plant proteins ---- Probable potassium transporter 11
Source.866: DFBPPR3599 ---- Plant proteins ---- Protein PHOSPHATE-INDUCED 1 homolog
Source.867: DFBPPR3602 ---- Plant proteins ---- Coatomer subunit alpha-2
Source.868: DFBPPR3607 ---- Plant proteins ---- Expansin-like A3
Source.869: DFBPPR3610 ---- Plant proteins ---- Auxin transporter-like protein 1
Source.870: DFBPPR3611 ---- Plant proteins ---- Protein N-terminal glutamine amidohydrolase
Source.871: DFBPPR3613 ---- Plant proteins ---- Transcription factor PCF6
Source.872: DFBPPR3618 ---- Plant proteins ---- Putative auxin response factor 20
Source.873: DFBPPR3625 ---- Plant proteins ---- Aquaporin SIP2-1
Source.874: DFBPPR3626 ---- Plant proteins ---- Acyl transferase 7
Source.875: DFBPPR3633 ---- Plant proteins ---- Aquaporin NIP1-2
Source.876: DFBPPR3637 ---- Plant proteins ---- Zinc-finger homeodomain protein 4
Source.877: DFBPPR3648 ---- Plant proteins ---- Putative lipoxygenase 5
Source.878: DFBPPR3661 ---- Plant proteins ---- Probable non-inhibitory serpin-Z9
Source.879: DFBPPR3662 ---- Plant proteins ---- 60S ribosomal protein L3
Source.880: DFBPPR3671 ---- Plant proteins ---- Putative linoleate 9S-lipoxygenase 3
Source.881: DFBPPR3672 ---- Plant proteins ---- Coatomer subunit beta'-2
Source.882: DFBPPR3673 ---- Plant proteins ---- Zinc-finger homeodomain protein 3
Source.883: DFBPPR3679 ---- Plant proteins ---- Zinc-finger homeodomain protein 9
Source.884: DFBPPR3683 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL14
Source.885: DFBPPR3688 ---- Plant proteins ---- Probable protein phosphatase 2C 67
Source.886: DFBPPR3689 ---- Plant proteins ---- Probable inorganic phosphate transporter 1-7
Source.887: DFBPPR3690 ---- Plant proteins ---- Patatin-like protein 3
Source.888: DFBPPR3692 ---- Plant proteins ---- Protein disulfide isomerase-like 5-1
Source.889: DFBPPR3696 ---- Plant proteins ---- Zinc-finger homeodomain protein 6
Source.890: DFBPPR3698 ---- Plant proteins ---- Sugar transport protein MST2
Source.891: DFBPPR3703 ---- Plant proteins ---- Zinc-finger homeodomain protein 1
Source.892: DFBPPR3704 ---- Plant proteins ---- Zinc-finger homeodomain protein 2
Source.893: DFBPPR3709 ---- Plant proteins ---- Probable anion transporter 1, chloroplastic
Source.894: DFBPPR3710 ---- Plant proteins ---- Putative beta-glucosidase 15
Source.895: DFBPPR3713 ---- Plant proteins ---- Probable NADH kinase
Source.896: DFBPPR3715 ---- Plant proteins ---- Auxin transporter-like protein 3
Source.897: DFBPPR3718 ---- Plant proteins ---- Expansin-like B1
Source.898: DFBPPR3724 ---- Plant proteins ---- Probable cation transporter HKT7
Source.899: DFBPPR3737 ---- Plant proteins ---- Probable protein phosphatase 2C 28
Source.900: DFBPPR3738 ---- Plant proteins ---- Potassium transporter 24
Source.901: DFBPPR3742 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.902: DFBPPR3744 ---- Plant proteins ---- Probable protein phosphatase 2C 64
Source.903: DFBPPR3747 ---- Plant proteins ---- Cysteine proteinase inhibitor 12
Source.904: DFBPPR3758 ---- Plant proteins ---- Target of rapamycin complex subunit LST8
Source.905: DFBPPR3762 ---- Plant proteins ---- Chromatin assembly factor 1 subunit FAS2 homolog
Source.906: DFBPPR3771 ---- Plant proteins ---- 24-methylenesterol C-methyltransferase 2
Source.907: DFBPPR3777 ---- Plant proteins ---- Probable protein phosphatase 2C 38
Source.908: DFBPPR3784 ---- Plant proteins ---- Potassium channel KAT6
Source.909: DFBPPR3788 ---- Plant proteins ---- Probable sucrose-phosphatase 3
Source.910: DFBPPR3796 ---- Plant proteins ---- Probable protein phosphatase 2C 77
Source.911: DFBPPR3799 ---- Plant proteins ---- Probable protein phosphatase 2C 42
Source.912: DFBPPR3811 ---- Plant proteins ---- Cytochrome c-type biogenesis CcmH-like mitochondrial protein
Source.913: DFBPPR3814 ---- Plant proteins ---- Probable RNA-dependent RNA polymerase 2
Source.914: DFBPPR3815 ---- Plant proteins ---- Dehydration-responsive element-binding protein 1B
Source.915: DFBPPR3817 ---- Plant proteins ---- Beta-galactosidase 4
Source.916: DFBPPR3822 ---- Plant proteins ---- Coatomer subunit alpha-3
Source.917: DFBPPR3825 ---- Plant proteins ---- Amino-acid permease BAT1 homolog
Source.918: DFBPPR3826 ---- Plant proteins ---- Profilin LP04
Source.919: DFBPPR3829 ---- Plant proteins ---- Probable auxin efflux carrier component 1d
Source.920: DFBPPR3831 ---- Plant proteins ---- Probable protein phosphatase 2C 12
Source.921: DFBPPR3832 ---- Plant proteins ---- 26.2 kDa heat shock protein, mitochondrial
Source.922: DFBPPR3833 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-1 catalytic subunit
Source.923: DFBPPR3843 ---- Plant proteins ---- Probable protein phosphatase 2C 14
Source.924: DFBPPR3846 ---- Plant proteins ---- Probable NAD(P)H-dependent oxidoreductase 2
Source.925: DFBPPR3848 ---- Plant proteins ---- Probable protein phosphatase 2C 78
Source.926: DFBPPR3850 ---- Plant proteins ---- Probable protein phosphatase 2C 73
Source.927: DFBPPR3851 ---- Plant proteins ---- Metal tolerance protein 8
Source.928: DFBPPR3852 ---- Plant proteins ---- Superoxide dismutase [Fe] 1, chloroplastic
Source.929: DFBPPR3853 ---- Plant proteins ---- Probable inactive beta-glucosidase 14
Source.930: DFBPPR3855 ---- Plant proteins ---- Probable protein phosphatase 2C 66
Source.931: DFBPPR3856 ---- Plant proteins ---- Probable protein phosphatase 2C 21
Source.932: DFBPPR3859 ---- Plant proteins ---- Probable protein phosphatase 2C 29
Source.933: DFBPPR3862 ---- Plant proteins ---- Aquaporin NIP4-1
Source.934: DFBPPR3864 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS2, chloroplastic
Source.935: DFBPPR3865 ---- Plant proteins ---- CDK5RAP1-like protein
Source.936: DFBPPR3870 ---- Plant proteins ---- Coatomer subunit beta-2
Source.937: DFBPPR3875 ---- Plant proteins ---- Probable glutamyl endopeptidase, chloroplastic
Source.938: DFBPPR3881 ---- Plant proteins ---- Probable E3 ubiquitin-protein ligase XBOS31
Source.939: DFBPPR3888 ---- Plant proteins ---- Endoglucanase 24
Source.940: DFBPPR3902 ---- Plant proteins ---- Probable serine acetyltransferase 5
Source.941: DFBPPR3910 ---- Plant proteins ---- Probable potassium transporter 3
Source.942: DFBPPR3914 ---- Plant proteins ---- Derlin-2
Source.943: DFBPPR3919 ---- Plant proteins ---- RecQ-mediated genome instability protein 1
Source.944: DFBPPR3922 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-4 catalytic subunit
Source.945: DFBPPR3924 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL17
Source.946: DFBPPR3926 ---- Plant proteins ---- Probable potassium transporter 13
Source.947: DFBPPR3928 ---- Plant proteins ---- Coatomer subunit alpha-1
Source.948: DFBPPR3931 ---- Plant proteins ---- Cyclin-D1-2
Source.949: DFBPPR3933 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A-2 catalytic subunit
Source.950: DFBPPR3935 ---- Plant proteins ---- Sucrose synthase 4
Source.951: DFBPPR3937 ---- Plant proteins ---- Zinc-finger homeodomain protein 10
Source.952: DFBPPR3943 ---- Plant proteins ---- RNA pseudouridine synthase 7
Source.953: DFBPPR3944 ---- Plant proteins ---- Magnesium/proton exchanger 2
Source.954: DFBPPR3946 ---- Plant proteins ---- Transcription factor TGAL10
Source.955: DFBPPR3948 ---- Plant proteins ---- Probable anion transporter 5, chloroplastic
Source.956: DFBPPR3955 ---- Plant proteins ---- Cysteine proteinase inhibitor 3
Source.957: DFBPPR3961 ---- Plant proteins ---- Zinc-finger homeodomain protein 8
Source.958: DFBPPR3963 ---- Plant proteins ---- Squamosa promoter-binding-like protein 9
Source.959: DFBPPR3969 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS1, chloroplastic
Source.960: DFBPPR3970 ---- Plant proteins ---- Ribonuclease 3-like protein 3
Source.961: DFBPPR3990 ---- Plant proteins ---- Potassium transporter 27
Source.962: DFBPPR3993 ---- Plant proteins ---- Double-stranded RNA-binding protein 5
Source.963: DFBPPR3994 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4 homolog, chloroplastic
Source.964: DFBPPR3996 ---- Plant proteins ---- Kinesin-like protein KIN-14J
Source.965: DFBPPR3999 ---- Plant proteins ---- DNA (cytosine-5)-methyltransferase DRM1A
Source.966: DFBPPR4000 ---- Plant proteins ---- Potassium transporter 18
Source.967: DFBPPR4007 ---- Plant proteins ---- Zinc-finger homeodomain protein 7
Source.968: DFBPPR4008 ---- Plant proteins ---- Putative serpin-Z12
Source.969: DFBPPR4009 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL6
Source.970: DFBPPR4011 ---- Plant proteins ---- Sugar transport protein MST1
Source.971: DFBPPR4013 ---- Plant proteins ---- Zinc-finger homeodomain protein 11
Source.972: DFBPPR4016 ---- Plant proteins ---- Probable anion transporter 2, chloroplastic
Source.973: DFBPPR4018 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL5
Source.974: DFBPPR4026 ---- Plant proteins ---- Potassium transporter 19
Source.975: DFBPPR4027 ---- Plant proteins ---- Potassium transporter 20
Source.976: DFBPPR4029 ---- Plant proteins ---- Putative multidrug resistance protein
Source.977: DFBPPR4033 ---- Plant proteins ---- Urease accessory protein G
Source.978: DFBPPR4038 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL8
Source.979: DFBPPR4040 ---- Plant proteins ---- Potassium channel KAT3
Source.980: DFBPPR4046 ---- Plant proteins ---- Probable protein phosphatase 2C 69
Source.981: DFBPPR4052 ---- Plant proteins ---- Beta-galactosidase 9
Source.982: DFBPPR4053 ---- Plant proteins ---- Protein argonaute 1B
Source.983: DFBPPR4054 ---- Plant proteins ---- Coatomer subunit beta-1
Source.984: DFBPPR4056 ---- Plant proteins ---- Probable protein phosphatase 2C 25
Source.985: DFBPPR4061 ---- Plant proteins ---- Chaperone protein ClpC4, chloroplastic
Source.986: DFBPPR4063 ---- Plant proteins ---- Cleavage and polyadenylation specificity factor subunit 2
Source.987: DFBPPR4070 ---- Plant proteins ---- Sphingolipid delta(4)-desaturase DES1-like
Source.988: DFBPPR4075 ---- Plant proteins ---- Villin-4
Source.989: DFBPPR4077 ---- Plant proteins ---- Probable dolichyl-diphosphooligosaccharide--protein glycosyltransferase subunit 3
Source.990: DFBPPR4079 ---- Plant proteins ---- Probable auxin efflux carrier component 1b
Source.991: DFBPPR4081 ---- Plant proteins ---- Potassium transporter 25
Source.992: DFBPPR4082 ---- Plant proteins ---- ASC1-like protein 2
Source.993: DFBPPR4084 ---- Plant proteins ---- Putative serpin-Z8
Source.994: DFBPPR4087 ---- Plant proteins ---- Actin-related protein 4
Source.995: DFBPPR4090 ---- Plant proteins ---- Probable indole-3-acetic acid-amido synthetase GH3.8
Source.996: DFBPPR4092 ---- Plant proteins ---- Putative serpin-Z5
Source.997: DFBPPR4093 ---- Plant proteins ---- Villin-5
Source.998: DFBPPR4094 ---- Plant proteins ---- Probable inactive DNA (cytosine-5)-methyltransferase DRM1B
Source.999: DFBPPR4095 ---- Plant proteins ---- Probable anion transporter 4, chloroplastic
Source.1000: DFBPPR4097 ---- Plant proteins ---- Trafficking protein particle complex II-specific subunit 130 homolog
Source.1001: DFBPPR4100 ---- Plant proteins ---- Glycosyltransferase family 92 protein Os08g0121900
Source.1002: DFBPPR4103 ---- Plant proteins ---- Probable serine acetyltransferase 4
Source.1003: DFBPPR4113 ---- Plant proteins ---- Probable protein phosphatase 2C 43
Source.1004: DFBPPR4114 ---- Plant proteins ---- SPX domain-containing membrane protein Os06g0129400
Source.1005: DFBPPR4123 ---- Plant proteins ---- Probable protein phosphatase 2C 74
Source.1006: DFBPPR4126 ---- Plant proteins ---- Probable protein phosphatase 2C 75
Source.1007: DFBPPR4128 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 2
Source.1008: DFBPPR4129 ---- Plant proteins ---- Probable 6-phosphogluconolactonase 1
Source.1009: DFBPPR4130 ---- Plant proteins ---- Two-component response regulator-like PRR95
Source.1010: DFBPPR4133 ---- Plant proteins ---- Probable protein phosphatase 2C 15
Source.1011: DFBPPR4142 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 2
Source.1012: DFBPPR4145 ---- Plant proteins ---- Protein arginine N-methyltransferase 7
Source.1013: DFBPPR4146 ---- Plant proteins ---- Formin-like protein 13
Source.1014: DFBPPR4147 ---- Plant proteins ---- Probable aquaporin TIP4-1
Source.1015: DFBPPR4148 ---- Plant proteins ---- Disease resistance protein PIK5-NP
Source.1016: DFBPPR4149 ---- Plant proteins ---- Probable anion transporter 7
Source.1017: DFBPPR4150 ---- Plant proteins ---- Probable potassium transporter 16
Source.1018: DFBPPR4153 ---- Plant proteins ---- Probable serine acetyltransferase 1
Source.1019: DFBPPR4158 ---- Plant proteins ---- Probable auxin efflux carrier component 1c
Source.1020: DFBPPR4162 ---- Plant proteins ---- Potassium transporter 6
Source.1021: DFBPPR4165 ---- Plant proteins ---- Heptahelical transmembrane protein ADIPOR3
Source.1022: DFBPPR4167 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 3
Source.1023: DFBPPR4175 ---- Plant proteins ---- Formin-like protein 1
Source.1024: DFBPPR4177 ---- Plant proteins ---- Formin-like protein 16
Source.1025: DFBPPR4178 ---- Plant proteins ---- Acyl transferase 5
Source.1026: DFBPPR4181 ---- Plant proteins ---- Acylamino-acid-releasing enzyme 1
Source.1027: DFBPPR4186 ---- Plant proteins ---- Formin-like protein 18
Source.1028: DFBPPR4194 ---- Plant proteins ---- Potassium transporter 22
Source.1029: DFBPPR4197 ---- Plant proteins ---- Probable serine acetyltransferase 3
Source.1030: DFBPPR4200 ---- Plant proteins ---- Serpin-Z1
Source.1031: DFBPPR4203 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 27
Source.1032: DFBPPR4211 ---- Plant proteins ---- Probable GTP-binding protein OBGM, mitochondrial
Source.1033: DFBPPR4235 ---- Plant proteins ---- Actin-related protein 3
Source.1034: DFBPPR4237 ---- Plant proteins ---- Transcription factor PCL1
Source.1035: DFBPPR4238 ---- Plant proteins ---- Putative magnesium transporter MRS2-H
Source.1036: DFBPPR4239 ---- Plant proteins ---- Probable metal-nicotianamine transporter YSL10
Source.1037: DFBPPR4240 ---- Plant proteins ---- Protein DWARF 53-LIKE
Source.1038: DFBPPR4243 ---- Plant proteins ---- UDP-glucose:2-hydroxyflavanone C-glucosyltransferase
Source.1039: DFBPPR4244 ---- Plant proteins ---- Flotillin-like protein 1
Source.1040: DFBPPR4246 ---- Plant proteins ---- Expansin-like A4
Source.1041: DFBPPR4253 ---- Plant proteins ---- Zinc-finger homeodomain protein 5
Source.1042: DFBPPR4260 ---- Plant proteins ---- Putrescine hydroxycinnamoyltransferase 2
Source.1043: DFBPPR4271 ---- Plant proteins ---- Cyclin-T1-3
Source.1044: DFBPPR4274 ---- Plant proteins ---- Tubby-like F-box protein 6
Source.1045: DFBPPR4280 ---- Plant proteins ---- Potassium transporter 21
Source.1046: DFBPPR4286 ---- Plant proteins ---- Cyclin-T1-2
Source.1047: DFBPPR4299 ---- Plant proteins ---- Cyclin-J18-like
Source.1048: DFBPPR4302 ---- Plant proteins ---- Serpin-Z2B
Source.1049: DFBPPR4303 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 17
Source.1050: DFBPPR4304 ---- Plant proteins ---- Signal recognition particle 14 kDa protein
Source.1051: DFBPPR4307 ---- Plant proteins ---- Acyl transferase 8
Source.1052: DFBPPR4312 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.1053: DFBPPR4313 ---- Plant proteins ---- ASC1-like protein 1
Source.1054: DFBPPR4314 ---- Plant proteins ---- Hydroxycinnamoyltransferase 1
Source.1055: DFBPPR4316 ---- Plant proteins ---- Putative serpin-Z6C
Source.1056: DFBPPR4317 ---- Plant proteins ---- Serpin-Z2A
Source.1057: DFBPPR4330 ---- Plant proteins ---- E3 UFM1-protein ligase 1 homolog
Source.1058: DFBPPR4333 ---- Plant proteins ---- Putative potassium channel KAT5
Source.1059: DFBPPR4349 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5 homolog, chloroplastic
Source.1060: DFBPPR4359 ---- Plant proteins ---- Protein STAY-GREEN LIKE, chloroplastic
Source.1061: DFBPPR4361 ---- Plant proteins ---- Formin-like protein 8
Source.1062: DFBPPR4371 ---- Plant proteins ---- Protein NLP3
Source.1063: DFBPPR4390 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 2
Source.1064: DFBPPR4394 ---- Plant proteins ---- Formin-like protein 9
Source.1065: DFBPPR4395 ---- Plant proteins ---- Putative cyclin-F1-4
Source.1066: DFBPPR4411 ---- Plant proteins ---- Ammonium transporter 2 member 2
Source.1067: DFBPPR4414 ---- Plant proteins ---- Formin-like protein 4
Source.1068: DFBPPR4415 ---- Plant proteins ---- Putative ataxin-3 homolog
Source.1069: DFBPPR4418 ---- Plant proteins ---- IAA-amino acid hydrolase ILR1-like 4
Source.1070: DFBPPR4419 ---- Plant proteins ---- Formin-like protein 15
Source.1071: DFBPPR4425 ---- Plant proteins ---- Formin-like protein 2
Source.1072: DFBPPR4428 ---- Plant proteins ---- Acyl transferase 9
Source.1073: DFBPPR4432 ---- Plant proteins ---- Formin-like protein 11
Source.1074: DFBPPR4435 ---- Plant proteins ---- Phospholipase A1-II 4
Source.1075: DFBPPR4438 ---- Plant proteins ---- Pre-mRNA-splicing factor SLU7
Source.1076: DFBPPR4441 ---- Plant proteins ---- Phospholipase A1-II 6
Source.1077: DFBPPR4442 ---- Plant proteins ---- Probable sodium/metabolite cotransporter BASS5, chloroplastic
Source.1078: DFBPPR4444 ---- Plant proteins ---- Formin-like protein 6
Source.1079: DFBPPR4459 ---- Plant proteins ---- CASP-like protein 2D1
Source.1080: DFBPPR4462 ---- Plant proteins ---- Ammonium transporter 2 member 3
Source.1081: DFBPPR4471 ---- Plant proteins ---- Disease resistance protein Piks-2
Source.1082: DFBPPR4473 ---- Plant proteins ---- Probable proline transporter 2
Source.1083: DFBPPR4477 ---- Plant proteins ---- Formin-like protein 3
Source.1084: DFBPPR4478 ---- Plant proteins ---- Ammonium transporter 3 member 1
Source.1085: DFBPPR4485 ---- Plant proteins ---- Cyclin-T1-4
Source.1086: DFBPPR4487 ---- Plant proteins ---- Spermidine hydroxycinnamoyltransferase 1
Source.1087: DFBPPR4489 ---- Plant proteins ---- Protein NLP1
Source.1088: DFBPPR4492 ---- Plant proteins ---- Ammonium transporter 3 member 2
Source.1089: DFBPPR4494 ---- Plant proteins ---- CRS2-associated factor 1, mitochondrial
Source.1090: DFBPPR4498 ---- Plant proteins ---- Cyclin-T1-1
Source.1091: DFBPPR4499 ---- Plant proteins ---- Hydroxycinnamoyltransferase 2
Source.1092: DFBPPR4503 ---- Plant proteins ---- Thaumatin-like protein
Source.1093: DFBPPR4510 ---- Plant proteins ---- Thioredoxin-like fold domain-containing protein MRL7L homolog, chloroplastic
Source.1094: DFBPPR4513 ---- Plant proteins ---- Protein SMAX1-like
Source.1095: DFBPPR4515 ---- Plant proteins ---- 5'-adenylylsulfate reductase-like 6
Source.1096: DFBPPR4519 ---- Plant proteins ---- Metal transporter Nramp5
Source.1097: DFBPPR4525 ---- Plant proteins ---- Metal transporter Nramp3
Source.1098: DFBPPR4535 ---- Plant proteins ---- Protein NLP2
Source.1099: DFBPPR4538 ---- Plant proteins ---- Protein argonaute 2
Source.1100: DFBPPR4540 ---- Plant proteins ---- Protein argonaute 1A
Source.1101: DFBPPR4541 ---- Plant proteins ---- Probable calcium-binding protein CML27
Source.1102: DFBPPR4549 ---- Plant proteins ---- Ammonium transporter 3 member 3
Source.1103: DFBPPR4573 ---- Plant proteins ---- CASP-like protein UU-1
Source.1104: DFBPPR4579 ---- Plant proteins ---- Probable calcium-binding protein CML32
Source.1105: DFBPPR4581 ---- Plant proteins ---- LIMR family protein Os06g0128200
Source.1106: DFBPPR4601 ---- Plant proteins ---- Probable Ufm1-specific protease
Source.1107: DFBPPR4628 ---- Plant proteins ---- Probable inactive carboxylesterase Os04g0669700
Source.1108: DFBPPR4632 ---- Plant proteins ---- Putative ammonium transporter 4 member 1
Source.1109: DFBPPR4633 ---- Plant proteins ---- B3 domain-containing protein Os07g0183700
Source.1110: DFBPPR4636 ---- Plant proteins ---- Putative actin-depolymerizing factor 8
Source.1111: DFBPPR4645 ---- Plant proteins ---- Putative protein Brevis radix-like 5
Source.1112: DFBPPR4673 ---- Plant proteins ---- Cyclin-L1-1
Source.1113: DFBPPR4674 ---- Plant proteins ---- Double-stranded RNA-binding protein 1
Source.1114: DFBPPR4677 ---- Plant proteins ---- Putative protein Brevis radix-like 3
Source.1115: DFBPPR4678 ---- Plant proteins ---- Solute carrier family 40 member 1
Source.1116: DFBPPR4679 ---- Plant proteins ---- Thaumatin-like protein
Source.1117: DFBPPR4684 ---- Plant proteins ---- BURP domain-containing protein 17
Source.1118: DFBPPR4693 ---- Plant proteins ---- Uncharacterized protein ycf68
Source.1119: DFBPPR4712 ---- Plant proteins ---- Putative UPF0496 protein 5
Source.1120: DFBPPR4723 ---- Plant proteins ---- Zinc finger A20 domain-containing stress-associated protein 18
Source.1121: DFBPPR4727 ---- Plant proteins ---- Putative ripening-related protein 4
Source.1122: DFBPPR4731 ---- Plant proteins ---- B3 domain-containing protein Os07g0183300/Os07g0183600
Source.1123: DFBPPR4732 ---- Plant proteins ---- BURP domain-containing protein 5
Source.1124: DFBPPR4741 ---- Plant proteins ---- Putative B3 domain-containing protein Os04g0347400
Source.1125: DFBPPR4744 ---- Plant proteins ---- BURP domain-containing protein 3
Source.1126: DFBPPR4747 ---- Plant proteins ---- Protein Brevis radix-like 2
Source.1127: DFBPPR4748 ---- Plant proteins ---- BURP domain-containing protein 11
Source.1128: DFBPPR4754 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0693400
Source.1129: DFBPPR4770 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 4
Source.1130: DFBPPR4771 ---- Plant proteins ---- Putative AP2/ERF and B3 domain-containing protein Os01g0140700
Source.1131: DFBPPR4780 ---- Plant proteins ---- Ripening-related protein 3
Source.1132: DFBPPR4783 ---- Plant proteins ---- Putative ripening-related protein 7
Source.1133: DFBPPR4787 ---- Plant proteins ---- 60S ribosomal protein L7a-1
Source.1134: DFBPPR4805 ---- Plant proteins ---- B3 domain-containing protein Os02g0764100
Source.1135: DFBPPR4806 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os05g0549800
Source.1136: DFBPPR4807 ---- Plant proteins ---- Protein MEI2-like 6
Source.1137: DFBPPR4818 ---- Plant proteins ---- Probable protein transport Sec1b
Source.1138: DFBPPR4822 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.1139: DFBPPR4823 ---- Plant proteins ---- 60S ribosomal protein L7a-2
Source.1140: DFBPPR4824 ---- Plant proteins ---- Putative B3 domain-containing protein Os06g0632500
Source.1141: DFBPPR4826 ---- Plant proteins ---- Probable protein transport Sec1a
Source.1142: DFBPPR4830 ---- Plant proteins ---- AP2/ERF and B3 domain-containing protein Os01g0141000
Source.1143: DFBPPR4831 ---- Plant proteins ---- Zinc finger CCCH domain-containing protein 36
Source.1144: DFBPPR4839 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 2
Source.1145: DFBPPR4840 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 3
Source.1146: DFBPPR4841 ---- Plant proteins ---- Flowering-promoting factor 1-like protein 5
Source.1147: DFBPPR4843 ---- Plant proteins ---- Putative ripening-related protein 2
Source.1148: DFBPPR4847 ---- Plant proteins ---- B3 domain-containing protein Os07g0183200
Source.1149: DFBPPR4849 ---- Plant proteins ---- Putative ripening-related protein 5
Source.1150: DFBPPR4850 ---- Plant proteins ---- Putative ripening-related protein 1
Source.1151: DFBPPR4853 ---- Plant proteins ---- B3 domain-containing protein LOC_Os12g40080
Source.1152: DFBPPR4854 ---- Plant proteins ---- Putative ripening-related protein 6
Source.1153: DFBPPR4856 ---- Plant proteins ---- B3 domain-containing protein Os01g0723500
Source.1154: DFBPPR4870 ---- Plant proteins ---- Protein NEOXANTHIN-DEFICIENT 1
Source.1155: DFBPPR4882 ---- Plant proteins ---- Salt stress root protein RS1
Source.1156: DFBPPR4889 ---- Plant proteins ---- Homeobox-leucine zipper protein ROC3
Source.1157: DFBPPR4891 ---- Plant proteins ---- Isoamylase 1, chloroplastic
Source.1158: DFBPPR4893 ---- Plant proteins ---- F-box/LRR-repeat MAX2 homolog
Source.1159: DFBPPR4897 ---- Plant proteins ---- Serine/threonine-protein kinase SAPK1
Source.1160: DFBPPR4902 ---- Plant proteins ---- Endoribonuclease Dicer homolog 1
Source.1161: DFBPPR4906 ---- Plant proteins ---- Alpha-amylase
Source.1162: DFBPPR4910 ---- Plant proteins ---- Calcium-dependent protein kinase 10
Source.1163: DFBPPR4911 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1164: DFBPPR4917 ---- Plant proteins ---- Gibberellin 20 oxidase 1
Source.1165: DFBPPR4919 ---- Plant proteins ---- Serine/threonine protein kinase OSK1
Source.1166: DFBPPR4925 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 1-1
Source.1167: DFBPPR4928 ---- Plant proteins ---- Copper-transporting ATPase HMA4
Source.1168: DFBPPR4929 ---- Plant proteins ---- DNA polymerase I A, chloroplastic
Source.1169: DFBPPR4934 ---- Plant proteins ---- U-box domain-containing protein 70
Source.1170: DFBPPR4937 ---- Plant proteins ---- Glutamate synthase 2 [NADH], chloroplastic
Source.1171: DFBPPR4940 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.1172: DFBPPR4942 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.1173: DFBPPR4945 ---- Plant proteins ---- Beta-amylase 2, chloroplastic
Source.1174: DFBPPR4946 ---- Plant proteins ---- Beta-fructofuranosidase, insoluble isoenzyme 6
Source.1175: DFBPPR4967 ---- Plant proteins ---- Beta-amylase
Source.1176: DFBPPR4978 ---- Plant proteins ---- 2-hydroxyisoflavanone dehydratase
Source.1177: DFBPPR4980 ---- Plant proteins ---- Lactoylglutathione lyase
Source.1178: DFBPPR4981 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1179: DFBPPR4982 ---- Plant proteins ---- Probable aspartic proteinase GIP1
Source.1180: DFBPPR4985 ---- Plant proteins ---- Allantoate deiminase 1
Source.1181: DFBPPR4986 ---- Plant proteins ---- Uricase-2 isozyme 1
Source.1182: DFBPPR4988 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1183: DFBPPR4989 ---- Plant proteins ---- Isocitrate dehydrogenase [NADP]
Source.1184: DFBPPR4991 ---- Plant proteins ---- Seed linoleate 9S-lipoxygenase
Source.1185: DFBPPR4994 ---- Plant proteins ---- 2-hydroxyisoflavanone synthase
Source.1186: DFBPPR4999 ---- Plant proteins ---- Leghemoglobin reductase
Source.1187: DFBPPR5000 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1188: DFBPPR5001 ---- Plant proteins ---- Chlorophyll a-b binding protein 3, chloroplastic
Source.1189: DFBPPR5007 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.1190: DFBPPR5008 ---- Plant proteins ---- Methylcrotonoyl-CoA carboxylase subunit alpha, mitochondrial
Source.1191: DFBPPR5009 ---- Plant proteins ---- Calcium-dependent protein kinase SK5
Source.1192: DFBPPR5011 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1A
Source.1193: DFBPPR5012 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.1194: DFBPPR5015 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase, housekeeping isozyme
Source.1195: DFBPPR5019 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1196: DFBPPR5020 ---- Plant proteins ---- Basic 7S globulin
Source.1197: DFBPPR5026 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, root isoform
Source.1198: DFBPPR5027 ---- Plant proteins ---- Phosphatidylinositol 3-kinase, nodule isoform
Source.1199: DFBPPR5032 ---- Plant proteins ---- NAD(P)H-dependent 6'-deoxychalcone synthase
Source.1200: DFBPPR5042 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1B
Source.1201: DFBPPR5044 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.1202: DFBPPR5046 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 2
Source.1203: DFBPPR5047 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1204: DFBPPR5049 ---- Plant proteins ---- Inducible nitrate reductase [NADH] 1
Source.1205: DFBPPR5050 ---- Plant proteins ---- 3,9-dihydroxypterocarpan 6A-monooxygenase
Source.1206: DFBPPR5052 ---- Plant proteins ---- Uricase-2 isozyme 2
Source.1207: DFBPPR5053 ---- Plant proteins ---- UDP-glucose 6-dehydrogenase 1
Source.1208: DFBPPR5056 ---- Plant proteins ---- Sucrose synthase
Source.1209: DFBPPR5057 ---- Plant proteins ---- Calnexin homolog
Source.1210: DFBPPR5059 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1211: DFBPPR5060 ---- Plant proteins ---- Ferritin-4, chloroplastic
Source.1212: DFBPPR5068 ---- Plant proteins ---- Ferritin-3, chloroplastic
Source.1213: DFBPPR5069 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1214: DFBPPR5070 ---- Plant proteins ---- Phosphoribosylglycinamide formyltransferase, chloroplastic
Source.1215: DFBPPR5073 ---- Plant proteins ---- Allantoate deiminase 2
Source.1216: DFBPPR5077 ---- Plant proteins ---- Digalactosyldiacylglycerol synthase 1, chloroplastic
Source.1217: DFBPPR5080 ---- Plant proteins ---- Phytochrome A
Source.1218: DFBPPR5082 ---- Plant proteins ---- Catalase-4
Source.1219: DFBPPR5090 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase
Source.1220: DFBPPR5092 ---- Plant proteins ---- Glutathione S-transferase 3
Source.1221: DFBPPR5094 ---- Plant proteins ---- Protein PROPEP914
Source.1222: DFBPPR5095 ---- Plant proteins ---- Superoxide dismutase [Fe], chloroplastic
Source.1223: DFBPPR5096 ---- Plant proteins ---- Isocitrate lyase 2
Source.1224: DFBPPR5098 ---- Plant proteins ---- Isocitrate lyase 1
Source.1225: DFBPPR5102 ---- Plant proteins ---- 4-hydroxy-tetrahydrodipicolinate synthase, chloroplastic
Source.1226: DFBPPR5104 ---- Plant proteins ---- UDP-sugar pyrophosphorylase 1
Source.1227: DFBPPR5112 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 1, chloroplastic
Source.1228: DFBPPR5113 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 4, chloroplastic
Source.1229: DFBPPR5120 ---- Plant proteins ---- 17.3 kDa class I heat shock protein
Source.1230: DFBPPR5123 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1231: DFBPPR5124 ---- Plant proteins ---- Nodulin-26
Source.1232: DFBPPR5129 ---- Plant proteins ---- Protein ADP-ribosyltransferase PARP3
Source.1233: DFBPPR5132 ---- Plant proteins ---- 18.5 kDa class I heat shock protein
Source.1234: DFBPPR5138 ---- Plant proteins ---- Subtilisin-like protease Glyma18g48580
Source.1235: DFBPPR5140 ---- Plant proteins ---- Basic 7S globulin 2
Source.1236: DFBPPR5143 ---- Plant proteins ---- 17.5 kDa class I heat shock protein
Source.1237: DFBPPR5149 ---- Plant proteins ---- Glutamine synthetase cytosolic isozyme 2
Source.1238: DFBPPR5150 ---- Plant proteins ---- Profilin-2
Source.1239: DFBPPR5152 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1240: DFBPPR5154 ---- Plant proteins ---- Profilin-1
Source.1241: DFBPPR5160 ---- Plant proteins ---- UDP-glycosyltransferase 708D1
Source.1242: DFBPPR5161 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 1
Source.1243: DFBPPR5163 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1244: DFBPPR5170 ---- Plant proteins ---- Elongation factor G-1, chloroplastic
Source.1245: DFBPPR5174 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1246: DFBPPR5184 ---- Plant proteins ---- Omega-6 fatty acid desaturase, endoplasmic reticulum isozyme 2
Source.1247: DFBPPR5185 ---- Plant proteins ---- Actin-1
Source.1248: DFBPPR5195 ---- Plant proteins ---- Diacylglycerol O-acyltransferase 1C
Source.1249: DFBPPR5198 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.1250: DFBPPR5199 ---- Plant proteins ---- Chalcone synthase 6
Source.1251: DFBPPR5200 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1252: DFBPPR5202 ---- Plant proteins ---- Chalcone synthase 7
Source.1253: DFBPPR5203 ---- Plant proteins ---- Chalcone synthase 1
Source.1254: DFBPPR5204 ---- Plant proteins ---- Chalcone synthase 5
Source.1255: DFBPPR5207 ---- Plant proteins ---- Chalcone synthase 2
Source.1256: DFBPPR5209 ---- Plant proteins ---- Elongation factor G-2, chloroplastic
Source.1257: DFBPPR5213 ---- Plant proteins ---- Chalcone synthase 3
Source.1258: DFBPPR5217 ---- Plant proteins ---- Soyasaponin III rhamnosyltransferase
Source.1259: DFBPPR5219 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8
Source.1260: DFBPPR5221 ---- Plant proteins ---- Protein TIC 214
Source.1261: DFBPPR5224 ---- Plant proteins ---- Cytochrome P450 93A3
Source.1262: DFBPPR5228 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.1263: DFBPPR5239 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.1264: DFBPPR5245 ---- Plant proteins ---- Omega-6 fatty acid desaturase, chloroplastic
Source.1265: DFBPPR5261 ---- Plant proteins ---- Cytochrome P450 82A2
Source.1266: DFBPPR5262 ---- Plant proteins ---- Cytochrome P450 82A3
Source.1267: DFBPPR5269 ---- Plant proteins ---- Cytochrome P450 82A4
Source.1268: DFBPPR5273 ---- Plant proteins ---- Cytochrome P450 98A2
Source.1269: DFBPPR5276 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.1270: DFBPPR5281 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1271: DFBPPR5282 ---- Plant proteins ---- Cytochrome P450 93A2
Source.1272: DFBPPR5283 ---- Plant proteins ---- Actin-3
Source.1273: DFBPPR5288 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1274: DFBPPR5291 ---- Plant proteins ---- 30S ribosomal protein S3, chloroplastic
Source.1275: DFBPPR5294 ---- Plant proteins ---- Protein Ycf2
Source.1276: DFBPPR5297 ---- Plant proteins ---- Protein PROPEP890
Source.1277: DFBPPR5304 ---- Plant proteins ---- Maturase K
Source.1278: DFBPPR5308 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein
Source.1279: DFBPPR5323 ---- Plant proteins ---- Cytochrome P450 78A3
Source.1280: DFBPPR5326 ---- Plant proteins ---- Cytochrome P450 77A3
Source.1281: DFBPPR5338 ---- Plant proteins ---- 40S ribosomal protein S13
Source.1282: DFBPPR5354 ---- Plant proteins ---- Protein P21
Source.1283: DFBPPR5378 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 1
Source.1284: DFBPPR5380 ---- Plant proteins ---- Catalase isozyme 2
Source.1285: DFBPPR5381 ---- Plant proteins ---- Polyamine oxidase 1
Source.1286: DFBPPR5382 ---- Plant proteins ---- Glutathione S-transferase 1
Source.1287: DFBPPR5385 ---- Plant proteins ---- Profilin-5
Source.1288: DFBPPR5387 ---- Plant proteins ---- Calpain-type cysteine protease DEK1
Source.1289: DFBPPR5389 ---- Plant proteins ---- Auxin-binding protein 1
Source.1290: DFBPPR5391 ---- Plant proteins ---- Glutathione S-transferase 4
Source.1291: DFBPPR5392 ---- Plant proteins ---- NADP-dependent malic enzyme, chloroplastic
Source.1292: DFBPPR5395 ---- Plant proteins ---- Protein rough sheath 2
Source.1293: DFBPPR5399 ---- Plant proteins ---- Catalase isozyme 3
Source.1294: DFBPPR5402 ---- Plant proteins ---- Nucleoside diphosphate kinase 1
Source.1295: DFBPPR5404 ---- Plant proteins ---- Catalase isozyme 1
Source.1296: DFBPPR5410 ---- Plant proteins ---- Profilin-4
Source.1297: DFBPPR5415 ---- Plant proteins ---- Eudesmanediol synthase
Source.1298: DFBPPR5416 ---- Plant proteins ---- Anthocyanin regulatory C1 protein
Source.1299: DFBPPR5417 ---- Plant proteins ---- Profilin-3
Source.1300: DFBPPR5419 ---- Plant proteins ---- Cytokinin dehydrogenase 1
Source.1301: DFBPPR5422 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1302: DFBPPR5424 ---- Plant proteins ---- Ferritin-2, chloroplastic
Source.1303: DFBPPR5425 ---- Plant proteins ---- Leucine-rich repeat receptor-like kinase protein THICK TASSEL DWARF1
Source.1304: DFBPPR5428 ---- Plant proteins ---- Histone acetyltransferase type B catalytic subunit
Source.1305: DFBPPR5436 ---- Plant proteins ---- Probable glutamate carboxypeptidase VP8
Source.1306: DFBPPR5437 ---- Plant proteins ---- Exopolygalacturonase
Source.1307: DFBPPR5438 ---- Plant proteins ---- Tau-cadinol synthase
Source.1308: DFBPPR5441 ---- Plant proteins ---- Peroxidase 1
Source.1309: DFBPPR5444 ---- Plant proteins ---- Cell division control protein 2 homolog
Source.1310: DFBPPR5446 ---- Plant proteins ---- Protein OPAQUE1
Source.1311: DFBPPR5454 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase, chloroplastic
Source.1312: DFBPPR5458 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1313: DFBPPR5461 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.1, mitochondrial
Source.1314: DFBPPR5463 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN2, chloroplastic
Source.1315: DFBPPR5464 ---- Plant proteins ---- Alpha-copaene synthase
Source.1316: DFBPPR5467 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1317: DFBPPR5470 ---- Plant proteins ---- Ent-copalyl diphosphate synthase AN1, chloroplastic
Source.1318: DFBPPR5475 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 1
Source.1319: DFBPPR5478 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 2, chloroplastic/amyloplastic
Source.1320: DFBPPR5479 ---- Plant proteins ---- Chlorophyll a-b binding protein 1, chloroplastic
Source.1321: DFBPPR5482 ---- Plant proteins ---- Glutathione S-transferase 3
Source.1322: DFBPPR5484 ---- Plant proteins ---- Single-stranded DNA-binding protein WHY1, chloroplastic
Source.1323: DFBPPR5485 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX9
Source.1324: DFBPPR5486 ---- Plant proteins ---- Chlorophyll a-b binding protein M9, chloroplastic
Source.1325: DFBPPR5491 ---- Plant proteins ---- Chlorophyll a-b binding protein 48, chloroplastic
Source.1326: DFBPPR5495 ---- Plant proteins ---- Trimethyltridecatetraene synthase
Source.1327: DFBPPR5496 ---- Plant proteins ---- DIMBOA UDP-glucosyltransferase BX8
Source.1328: DFBPPR5501 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1329: DFBPPR5507 ---- Plant proteins ---- Putative receptor protein kinase ZmPK1
Source.1330: DFBPPR5513 ---- Plant proteins ---- Bifunctional TENA2 protein
Source.1331: DFBPPR5519 ---- Plant proteins ---- Beta-selinene synthase
Source.1332: DFBPPR5523 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1333: DFBPPR5524 ---- Plant proteins ---- Calcium-dependent protein kinase 2
Source.1334: DFBPPR5527 ---- Plant proteins ---- Exopolygalacturonase
Source.1335: DFBPPR5528 ---- Plant proteins ---- Exopolygalacturonase
Source.1336: DFBPPR5529 ---- Plant proteins ---- Aquaporin TIP1-1
Source.1337: DFBPPR5530 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1338: DFBPPR5537 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1339: DFBPPR5538 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.1340: DFBPPR5547 ---- Plant proteins ---- Methylenetetrahydrofolate reductase 1
Source.1341: DFBPPR5549 ---- Plant proteins ---- 3-deoxy-manno-octulosonate cytidylyltransferase
Source.1342: DFBPPR5553 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein ATP4, chloroplastic
Source.1343: DFBPPR5562 ---- Plant proteins ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.1344: DFBPPR5563 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1345: DFBPPR5564 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.1346: DFBPPR5565 ---- Plant proteins ---- Chloroplastic group IIA intron splicing facilitator CRS1, chloroplastic
Source.1347: DFBPPR5573 ---- Plant proteins ---- Dolabradiene monooxygenase
Source.1348: DFBPPR5580 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 1
Source.1349: DFBPPR5582 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1350: DFBPPR5584 ---- Plant proteins ---- GRF-interacting factor 10
Source.1351: DFBPPR5586 ---- Plant proteins ---- Phytoene synthase 3, chloroplastic
Source.1352: DFBPPR5590 ---- Plant proteins ---- Probable serine/threonine-protein kinase CCRP1
Source.1353: DFBPPR5594 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase 2
Source.1354: DFBPPR5595 ---- Plant proteins ---- Calcium sensing receptor, chloroplastic
Source.1355: DFBPPR5599 ---- Plant proteins ---- Pentatricopeptide repeat-containing protein PPR5, chloroplastic
Source.1356: DFBPPR5601 ---- Plant proteins ---- Protein HIRA
Source.1357: DFBPPR5602 ---- Plant proteins ---- Ribosome-inactivating protein 3
Source.1358: DFBPPR5606 ---- Plant proteins ---- Zealexin A1 synthase
Source.1359: DFBPPR5607 ---- Plant proteins ---- Phytoene synthase 2, chloroplastic
Source.1360: DFBPPR5611 ---- Plant proteins ---- Hydroxyethylthiazole kinase
Source.1361: DFBPPR5615 ---- Plant proteins ---- Regulatory protein viviparous-1
Source.1362: DFBPPR5616 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.1363: DFBPPR5621 ---- Plant proteins ---- Lon protease homolog 2, peroxisomal
Source.1364: DFBPPR5624 ---- Plant proteins ---- Ribosome-inactivating protein 9
Source.1365: DFBPPR5625 ---- Plant proteins ---- Dof zinc finger protein MNB1A
Source.1366: DFBPPR5634 ---- Plant proteins ---- Eudesmanediol synthase
Source.1367: DFBPPR5635 ---- Plant proteins ---- Auxin-binding protein 4
Source.1368: DFBPPR5636 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.3, mitochondrial
Source.1369: DFBPPR5637 ---- Plant proteins ---- Beta-fructofuranosidase 1
Source.1370: DFBPPR5642 ---- Plant proteins ---- Zeamatin
Source.1371: DFBPPR5643 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.1372: DFBPPR5644 ---- Plant proteins ---- Phospholipase D alpha 1
Source.1373: DFBPPR5647 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1374: DFBPPR5651 ---- Plant proteins ---- Cytochrome c
Source.1375: DFBPPR5658 ---- Plant proteins ---- Kiwellin-1
Source.1376: DFBPPR5659 ---- Plant proteins ---- Phytoene synthase 1, chloroplastic
Source.1377: DFBPPR5660 ---- Plant proteins ---- Iron-phytosiderophore transporter yellow stripe 1
Source.1378: DFBPPR5661 ---- Plant proteins ---- Albumin b-32
Source.1379: DFBPPR5663 ---- Plant proteins ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.1380: DFBPPR5667 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1381: DFBPPR5669 ---- Plant proteins ---- Cytochrome b
Source.1382: DFBPPR5671 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1383: DFBPPR5674 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.4, mitochondrial
Source.1384: DFBPPR5677 ---- Plant proteins ---- Ribosome-inactivating protein
Source.1385: DFBPPR5679 ---- Plant proteins ---- Superoxide dismutase [Mn] 3.2, mitochondrial
Source.1386: DFBPPR5680 ---- Plant proteins ---- Glutamine synthetase root isozyme 3
Source.1387: DFBPPR5685 ---- Plant proteins ---- Protein ABERRANT POLLEN TRANSMISSION 1
Source.1388: DFBPPR5686 ---- Plant proteins ---- Auxin-binding protein 5
Source.1389: DFBPPR5689 ---- Plant proteins ---- Profilin-9
Source.1390: DFBPPR5690 ---- Plant proteins ---- Profilin-7
Source.1391: DFBPPR5691 ---- Plant proteins ---- Profilin-10
Source.1392: DFBPPR5692 ---- Plant proteins ---- Profilin-6
Source.1393: DFBPPR5693 ---- Plant proteins ---- Profilin-11
Source.1394: DFBPPR5695 ---- Plant proteins ---- Nitrate reductase [NADH] 3
Source.1395: DFBPPR5697 ---- Plant proteins ---- Profilin-12
Source.1396: DFBPPR5698 ---- Plant proteins ---- Phytochrome A
Source.1397: DFBPPR5699 ---- Plant proteins ---- Sucrose-phosphate synthase
Source.1398: DFBPPR5703 ---- Plant proteins ---- Asparagine synthetase [glutamine-hydrolyzing]
Source.1399: DFBPPR5715 ---- Plant proteins ---- Glutamine synthetase root isozyme 4
Source.1400: DFBPPR5716 ---- Plant proteins ---- Derlin-1.1
Source.1401: DFBPPR5717 ---- Plant proteins ---- Derlin-1.2
Source.1402: DFBPPR5725 ---- Plant proteins ---- Lipoyl synthase 2, chloroplastic
Source.1403: DFBPPR5726 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.1404: DFBPPR5731 ---- Plant proteins ---- Rubisco accumulation factor 1, chloroplastic
Source.1405: DFBPPR5737 ---- Plant proteins ---- Glutathione transferase GST 23
Source.1406: DFBPPR5738 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1407: DFBPPR5739 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR1
Source.1408: DFBPPR5740 ---- Plant proteins ---- Glutamine synthetase root isozyme 2
Source.1409: DFBPPR5742 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.1410: DFBPPR5743 ---- Plant proteins ---- Derlin-2.1
Source.1411: DFBPPR5749 ---- Plant proteins ---- Cis-zeatin O-glucosyltransferase 2
Source.1412: DFBPPR5750 ---- Plant proteins ---- Protein FLOURY 1
Source.1413: DFBPPR5751 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein 2-B
Source.1414: DFBPPR5754 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 1
Source.1415: DFBPPR5759 ---- Plant proteins ---- Protein TAB2 homolog, chloroplastic
Source.1416: DFBPPR5763 ---- Plant proteins ---- FACT complex subunit SPT16
Source.1417: DFBPPR5771 ---- Plant proteins ---- Derlin-2.2
Source.1418: DFBPPR5774 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1419: DFBPPR5780 ---- Plant proteins ---- Cytochrome P450 71C3
Source.1420: DFBPPR5784 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1421: DFBPPR5789 ---- Plant proteins ---- Phosphoglucomutase, cytoplasmic 2
Source.1422: DFBPPR5791 ---- Plant proteins ---- Uroporphyrinogen decarboxylase, chloroplastic
Source.1423: DFBPPR5794 ---- Plant proteins ---- CLAVATA3/ESR (CLE)-related protein ESR2
Source.1424: DFBPPR5797 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1425: DFBPPR5799 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase PLS1
Source.1426: DFBPPR5803 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1427: DFBPPR5804 ---- Plant proteins ---- L-lactate dehydrogenase
Source.1428: DFBPPR5810 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1429: DFBPPR5814 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1430: DFBPPR5815 ---- Plant proteins ---- Protein terminal ear1
Source.1431: DFBPPR5816 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1432: DFBPPR5821 ---- Plant proteins ---- Glucose-6-phosphate isomerase, cytosolic
Source.1433: DFBPPR5826 ---- Plant proteins ---- Heat shock protein 82
Source.1434: DFBPPR5829 ---- Plant proteins ---- Protein SUPPRESSOR OF GENE SILENCING 3 homolog
Source.1435: DFBPPR5841 ---- Plant proteins ---- Actin-1
Source.1436: DFBPPR5843 ---- Plant proteins ---- Sucrose-phosphatase 2
Source.1437: DFBPPR5852 ---- Plant proteins ---- Sucrose synthase 2
Source.1438: DFBPPR5856 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.1439: DFBPPR5857 ---- Plant proteins ---- Sucrose synthase 1
Source.1440: DFBPPR5860 ---- Plant proteins ---- Myb-related protein P
Source.1441: DFBPPR5869 ---- Plant proteins ---- Anthocyanin regulatory Lc protein
Source.1442: DFBPPR5874 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.1443: DFBPPR5876 ---- Plant proteins ---- ADP-ribosylation factor
Source.1444: DFBPPR5881 ---- Plant proteins ---- Divinyl chlorophyllide a 8-vinyl-reductase, chloroplastic
Source.1445: DFBPPR5883 ---- Plant proteins ---- Homocysteine S-methyltransferase 1
Source.1446: DFBPPR5903 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta
Source.1447: DFBPPR5907 ---- Plant proteins ---- Probable DNA-directed RNA polymerase
Source.1448: DFBPPR5910 ---- Plant proteins ---- Anthocyanin regulatory R-S protein
Source.1449: DFBPPR5911 ---- Plant proteins ---- Ascorbate-specific transmembrane electron transporter 2
Source.1450: DFBPPR5914 ---- Plant proteins ---- Ferredoxin-thioredoxin reductase, variable chain
Source.1451: DFBPPR5917 ---- Plant proteins ---- Aquaporin TIP4-4
Source.1452: DFBPPR5921 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8
Source.1453: DFBPPR5927 ---- Plant proteins ---- Aquaporin SIP2-1
Source.1454: DFBPPR5933 ---- Plant proteins ---- Pathogenesis-related protein PRMS
Source.1455: DFBPPR5946 ---- Plant proteins ---- Maturase K
Source.1456: DFBPPR5949 ---- Plant proteins ---- Polycomb group protein FIE1
Source.1457: DFBPPR5952 ---- Plant proteins ---- WUSCHEL-related homeobox 3B
Source.1458: DFBPPR5956 ---- Plant proteins ---- Aquaporin TIP1-2
Source.1459: DFBPPR5958 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.1460: DFBPPR5970 ---- Plant proteins ---- Heat shock 70 kDa protein
Source.1461: DFBPPR5972 ---- Plant proteins ---- Cytochrome P450 78A1
Source.1462: DFBPPR5977 ---- Plant proteins ---- Putative AC transposase
Source.1463: DFBPPR5979 ---- Plant proteins ---- Aquaporin TIP4-2
Source.1464: DFBPPR5985 ---- Plant proteins ---- Aquaporin TIP4-3
Source.1465: DFBPPR5986 ---- Plant proteins ---- Beta-amylase
Source.1466: DFBPPR5988 ---- Plant proteins ---- Alpha-amylase/trypsin inhibitor
Source.1467: DFBPPR5996 ---- Plant proteins ---- Myb-related protein Zm1
Source.1468: DFBPPR5999 ---- Plant proteins ---- Aquaporin NIP1-1
Source.1469: DFBPPR6005 ---- Plant proteins ---- Polycomb group protein FIE2
Source.1470: DFBPPR6007 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1471: DFBPPR6008 ---- Plant proteins ---- Zein-beta
Source.1472: DFBPPR6016 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1473: DFBPPR6022 ---- Plant proteins ---- Stress-related protein 1
Source.1474: DFBPPR6027 ---- Plant proteins ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.1475: DFBPPR6030 ---- Plant proteins ---- DNA polymerase
Source.1476: DFBPPR6052 ---- Plant proteins ---- Cystatin-1
Source.1477: DFBPPR6072 ---- Plant proteins ---- CASP-like protein 5A2
Source.1478: DFBPPR6098 ---- Plant proteins ---- CASP-like protein 5A1
Source.1479: DFBPPR6099 ---- Plant proteins ---- CASP-like protein 16
Source.1480: DFBPPR6147 ---- Plant proteins ---- 60S ribosomal protein L19
Source.1481: DFBPPR6150 ---- Plant proteins ---- Autonomous transposable element EN-1 mosaic protein
Source.1482: DFBPPR6162 ---- Plant proteins ---- Putative AC9 transposase
Source.1483: DFBPPR6170 ---- Plant proteins ---- Uncharacterized 29 kDa protein in mitochondrial S-1 DNA
Source.1484: DFBPPR6171 ---- Plant proteins ---- Uncharacterized 39 kDa protein in mitochondrial S-1 and S-2 DNA
Source.1485: DFBPPR6186 ---- Plant proteins ---- Transposable element activator uncharacterized 23 kDa protein
Source.1486: DFBPPR6202 ---- Plant proteins ---- Unknown protein from spot 308 of 2D-PAGE of etiolated coleoptile
Source.1487: DFBPPR6211 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1488: DFBPPR6215 ---- Plant proteins ---- Chlorophyll a-b binding protein AB80, chloroplastic
Source.1489: DFBPPR6216 ---- Plant proteins ---- Ribulose-1,5 bisphosphate carboxylase/oxygenase large subunit N-methyltransferase, chloroplastic
Source.1490: DFBPPR6217 ---- Plant proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.1491: DFBPPR6219 ---- Plant proteins ---- Primary amine oxidase
Source.1492: DFBPPR6221 ---- Plant proteins ---- Sulfite reductase [ferredoxin], chloroplastic
Source.1493: DFBPPR6225 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1494: DFBPPR6233 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1495: DFBPPR6235 ---- Plant proteins ---- Alcohol dehydrogenase class-3
Source.1496: DFBPPR6236 ---- Plant proteins ---- Calcium and calcium/calmodulin-dependent serine/threonine-protein kinase
Source.1497: DFBPPR6237 ---- Plant proteins ---- Chlorophyll a-b binding protein 8, chloroplastic
Source.1498: DFBPPR6238 ---- Plant proteins ---- UDP-sugar pyrophospharylase
Source.1499: DFBPPR6239 ---- Plant proteins ---- Vacuolar-sorting receptor 1
Source.1500: DFBPPR6240 ---- Plant proteins ---- Stromal processing peptidase, chloroplastic
Source.1501: DFBPPR6243 ---- Plant proteins ---- Chlorophyll a-b binding protein 215, chloroplastic
Source.1502: DFBPPR6253 ---- Plant proteins ---- Stachyose synthase
Source.1503: DFBPPR6255 ---- Plant proteins ---- Outer envelope pore protein 24, chloroplastic
Source.1504: DFBPPR6256 ---- Plant proteins ---- Chlorophyll a-b binding protein AB96
Source.1505: DFBPPR6257 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1506: DFBPPR6268 ---- Plant proteins ---- 1,4-alpha-glucan-branching enzyme 1, chloroplastic/amyloplastic
Source.1507: DFBPPR6270 ---- Plant proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.1508: DFBPPR6274 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1509: DFBPPR6278 ---- Plant proteins ---- Protein TIC 55, chloroplastic
Source.1510: DFBPPR6279 ---- Plant proteins ---- Sec-independent protein translocase protein TATC, chloroplastic
Source.1511: DFBPPR6281 ---- Plant proteins ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.1512: DFBPPR6296 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1513: DFBPPR6302 ---- Plant proteins ---- Calnexin homolog
Source.1514: DFBPPR6305 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1515: DFBPPR6307 ---- Plant proteins ---- Phytochrome-associated serine/threonine-protein phosphatase
Source.1516: DFBPPR6310 ---- Plant proteins ---- Catalase
Source.1517: DFBPPR6315 ---- Plant proteins ---- Inner membrane protein PPF-1, chloroplastic
Source.1518: DFBPPR6319 ---- Plant proteins ---- Galactinol--sucrose galactosyltransferase
Source.1519: DFBPPR6334 ---- Plant proteins ---- Triose phosphate/phosphate translocator, chloroplastic
Source.1520: DFBPPR6336 ---- Plant proteins ---- Asparagine synthetase, root [glutamine-hydrolyzing]
Source.1521: DFBPPR6338 ---- Plant proteins ---- Asparagine synthetase, nodule [glutamine-hydrolyzing]
Source.1522: DFBPPR6340 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1523: DFBPPR6341 ---- Plant proteins ---- Mitogen-activated protein kinase homolog D5
Source.1524: DFBPPR6342 ---- Plant proteins ---- Ent-copalyl diphosphate synthase, chloroplastic
Source.1525: DFBPPR6350 ---- Plant proteins ---- Galactoside 2-alpha-L-fucosyltransferase
Source.1526: DFBPPR6354 ---- Plant proteins ---- Protochlorophyllide reductase, chloroplastic
Source.1527: DFBPPR6361 ---- Plant proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.1528: DFBPPR6362 ---- Plant proteins ---- E3 ubiquitin-protein ligase COP1
Source.1529: DFBPPR6364 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3C, chloroplastic
Source.1530: DFBPPR6367 ---- Plant proteins ---- Ornithine carbamoyltransferase, chloroplastic
Source.1531: DFBPPR6373 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain 3A, chloroplastic
Source.1532: DFBPPR6374 ---- Plant proteins ---- 18.1 kDa class I heat shock protein
Source.1533: DFBPPR6382 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1534: DFBPPR6385 ---- Plant proteins ---- Phosphoenolpyruvate carboxylase
Source.1535: DFBPPR6387 ---- Plant proteins ---- Fructose-bisphosphate aldolase 1, chloroplastic
Source.1536: DFBPPR6388 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.1537: DFBPPR6393 ---- Plant proteins ---- Protein STAY-GREEN, chloroplastic
Source.1538: DFBPPR6404 ---- Plant proteins ---- Isoflavone reductase
Source.1539: DFBPPR6417 ---- Plant proteins ---- Beta-fructofuranosidase, cell wall isozyme
Source.1540: DFBPPR6422 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1541: DFBPPR6446 ---- Plant proteins ---- Chalcone synthase 6
Source.1542: DFBPPR6447 ---- Plant proteins ---- Fructose-bisphosphate aldolase 2, chloroplastic
Source.1543: DFBPPR6448 ---- Plant proteins ---- Chalcone synthase 1B
Source.1544: DFBPPR6449 ---- Plant proteins ---- Chalcone synthase 2
Source.1545: DFBPPR6450 ---- Plant proteins ---- Chalcone synthase 1A
Source.1546: DFBPPR6451 ---- Plant proteins ---- Chalcone synthase 3
Source.1547: DFBPPR6452 ---- Plant proteins ---- Chalcone synthase 4
Source.1548: DFBPPR6454 ---- Plant proteins ---- Chalcone synthase 5
Source.1549: DFBPPR6460 ---- Plant proteins ---- Chalcone synthase 1
Source.1550: DFBPPR6469 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.1551: DFBPPR6479 ---- Plant proteins ---- Non-functional protein STAY-GREEN, chloroplastic
Source.1552: DFBPPR6482 ---- Plant proteins ---- Cytochrome P450 82A1
Source.1553: DFBPPR6487 ---- Plant proteins ---- Basic helix-loop-helix protein A
Source.1554: DFBPPR6491 ---- Plant proteins ---- Early nodulin-5
Source.1555: DFBPPR6506 ---- Plant proteins ---- Sucrose synthase 2
Source.1556: DFBPPR6520 ---- Plant proteins ---- ATP synthase epsilon chain, chloroplastic
Source.1557: DFBPPR6522 ---- Plant proteins ---- Elongation factor G, chloroplastic
Source.1558: DFBPPR6542 ---- Plant proteins ---- Maturase K
Source.1559: DFBPPR6550 ---- Plant proteins ---- Actin-3
Source.1560: DFBPPR6551 ---- Plant proteins ---- Actin-2
Source.1561: DFBPPR6552 ---- Plant proteins ---- Actin-1
Source.1562: DFBPPR6554 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1563: DFBPPR6555 ---- Plant proteins ---- Retinoblastoma-related protein 1
Source.1564: DFBPPR6559 ---- Plant proteins ---- Truncated basic helix-loop-helix protein A
Source.1565: DFBPPR6585 ---- Plant proteins ---- 40S ribosomal protein S13
Source.1566: DFBPPR6627 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1567: DFBPPR6637 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 1
Source.1568: DFBPPR6645 ---- Plant proteins ---- Catalase-1
Source.1569: DFBPPR6653 ---- Plant proteins ---- Sedoheptulose-1,7-bisphosphatase, chloroplastic
Source.1570: DFBPPR6654 ---- Plant proteins ---- Deoxymugineic acid synthase 1-A
Source.1571: DFBPPR6656 ---- Plant proteins ---- Catalase
Source.1572: DFBPPR6664 ---- Plant proteins ---- Aluminum-activated malate transporter 1
Source.1573: DFBPPR6668 ---- Plant proteins ---- Cytochrome b
Source.1574: DFBPPR6670 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1575: DFBPPR6672 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 3
Source.1576: DFBPPR6676 ---- Plant proteins ---- Cytochrome c oxidase subunit 1
Source.1577: DFBPPR6682 ---- Plant proteins ---- Alpha-amylase AMY3
Source.1578: DFBPPR6689 ---- Plant proteins ---- Fructan 1-exohydrolase w1
Source.1579: DFBPPR6695 ---- Plant proteins ---- Ubiquitin-activating enzyme E1 2
Source.1580: DFBPPR6696 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1581: DFBPPR6715 ---- Plant proteins ---- Fructan 1-exohydrolase w3
Source.1582: DFBPPR6716 ---- Plant proteins ---- Protein disulfide-isomerase
Source.1583: DFBPPR6720 ---- Plant proteins ---- Fructan 1-exohydrolase w2
Source.1584: DFBPPR6722 ---- Plant proteins ---- Deoxymugineic acid synthase 1-B
Source.1585: DFBPPR6723 ---- Plant proteins ---- Ubiquitin-conjugating enzyme E2-23 kDa
Source.1586: DFBPPR6730 ---- Plant proteins ---- Abscisic acid-inducible protein kinase
Source.1587: DFBPPR6734 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1588: DFBPPR6739 ---- Plant proteins ---- Deoxymugineic acid synthase 1-D
Source.1589: DFBPPR6741 ---- Plant proteins ---- Fructan 6-exohydrolase
Source.1590: DFBPPR6751 ---- Plant proteins ---- Glutathione S-transferase 1
Source.1591: DFBPPR6759 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.1592: DFBPPR6772 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1593: DFBPPR6775 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.1594: DFBPPR6778 ---- Plant proteins ---- Cytochrome c oxidase subunit 3
Source.1595: DFBPPR6780 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1596: DFBPPR6785 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1597: DFBPPR6802 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PWS4.3, chloroplastic
Source.1598: DFBPPR6803 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain PW9, chloroplastic
Source.1599: DFBPPR6807 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1600: DFBPPR6808 ---- Plant proteins ---- Profilin-2
Source.1601: DFBPPR6810 ---- Plant proteins ---- Profilin-1
Source.1602: DFBPPR6813 ---- Plant proteins ---- Profilin-3
Source.1603: DFBPPR6814 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.1604: DFBPPR6826 ---- Plant proteins ---- Beta-amylase Tri a 17
Source.1605: DFBPPR6831 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1606: DFBPPR6837 ---- Plant proteins ---- Glutathione S-transferase 2
Source.1607: DFBPPR6850 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1608: DFBPPR6863 ---- Plant proteins ---- Eukaryotic translation initiation factor 1A
Source.1609: DFBPPR6864 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8
Source.1610: DFBPPR6888 ---- Plant proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1611: DFBPPR6889 ---- Plant proteins ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.1612: DFBPPR6899 ---- Plant proteins ---- Zinc finger protein 1
Source.1613: DFBPPR6906 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1614: DFBPPR6919 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1615: DFBPPR6931 ---- Plant proteins ---- Eukaryotic translation initiation factor NCBP
Source.1616: DFBPPR6970 ---- Plant proteins ---- 40S ribosomal protein S29
Source.1617: DFBPPR7008 ---- Plant proteins ---- Alpha-amylase type A isozyme
Source.1618: DFBPPR7010 ---- Plant proteins ---- Serine carboxypeptidase 3
Source.1619: DFBPPR7013 ---- Plant proteins ---- Protein MLO
Source.1620: DFBPPR7015 ---- Plant proteins ---- Phytepsin
Source.1621: DFBPPR7020 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1622: DFBPPR7021 ---- Plant proteins ---- Lipoxygenase 2.1, chloroplastic
Source.1623: DFBPPR7034 ---- Plant proteins ---- Chlorophyll a-b binding protein 2, chloroplastic
Source.1624: DFBPPR7037 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1625: DFBPPR7039 ---- Plant proteins ---- Nitrate reductase [NAD(P)H]
Source.1626: DFBPPR7040 ---- Plant proteins ---- Linoleate 9S-lipoxygenase 1
Source.1627: DFBPPR7041 ---- Plant proteins ---- Chlorophyll a-b binding protein of LHCII type III, chloroplastic
Source.1628: DFBPPR7043 ---- Plant proteins ---- Beta-amylase
Source.1629: DFBPPR7045 ---- Plant proteins ---- Ferredoxin-dependent glutamate synthase
Source.1630: DFBPPR7046 ---- Plant proteins ---- Deoxymugineic acid synthase 1
Source.1631: DFBPPR7048 ---- Plant proteins ---- Protein disulfide-isomerase
Source.1632: DFBPPR7051 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.1633: DFBPPR7056 ---- Plant proteins ---- Cysteine proteinase inhibitor
Source.1634: DFBPPR7058 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1635: DFBPPR7062 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1636: DFBPPR7065 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.1637: DFBPPR7067 ---- Plant proteins ---- Glucan endo-1,3-beta-glucosidase GI
Source.1638: DFBPPR7081 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1639: DFBPPR7082 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.1640: DFBPPR7083 ---- Plant proteins ---- Lipoxygenase 2.2, chloroplastic
Source.1641: DFBPPR7085 ---- Plant proteins ---- Probable UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase SPINDLY
Source.1642: DFBPPR7092 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1643: DFBPPR7101 ---- Plant proteins ---- Sucrose synthase 1
Source.1644: DFBPPR7102 ---- Plant proteins ---- Naringenin,2-oxoglutarate 3-dioxygenase
Source.1645: DFBPPR7104 ---- Plant proteins ---- Glutamine synthetase leaf isozyme, chloroplastic
Source.1646: DFBPPR7105 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1647: DFBPPR7106 ---- Plant proteins ---- Sucrose synthase 2
Source.1648: DFBPPR7107 ---- Plant proteins ---- Catalase isozyme 1
Source.1649: DFBPPR7108 ---- Plant proteins ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.1650: DFBPPR7117 ---- Plant proteins ---- Two pore calcium channel protein 1
Source.1651: DFBPPR7118 ---- Plant proteins ---- Oxygen-dependent coproporphyrinogen-III oxidase, chloroplastic
Source.1652: DFBPPR7119 ---- Plant proteins ---- Protochlorophyllide reductase A, chloroplastic
Source.1653: DFBPPR7125 ---- Plant proteins ---- Catalase isozyme 2
Source.1654: DFBPPR7128 ---- Plant proteins ---- Methylthioribose-1-phosphate isomerase
Source.1655: DFBPPR7129 ---- Plant proteins ---- Formate dehydrogenase, mitochondrial
Source.1656: DFBPPR7138 ---- Plant proteins ---- Protochlorophyllide reductase B, chloroplastic
Source.1657: DFBPPR7149 ---- Plant proteins ---- Granule-bound starch synthase 1b, chloroplastic/amyloplastic
Source.1658: DFBPPR7151 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1659: DFBPPR7156 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1660: DFBPPR7158 ---- Plant proteins ---- Nucleotide pyrophosphatase/phosphodiesterase
Source.1661: DFBPPR7160 ---- Plant proteins ---- Alpha-amylase type B isozyme
Source.1662: DFBPPR7161 ---- Plant proteins ---- Uroporphyrinogen decarboxylase
Source.1663: DFBPPR7162 ---- Plant proteins ---- Serine carboxypeptidase II-3
Source.1664: DFBPPR7169 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1665: DFBPPR7174 ---- Plant proteins ---- Photosystem I reaction center subunit XI, chloroplastic
Source.1666: DFBPPR7177 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta'
Source.1667: DFBPPR7187 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1668: DFBPPR7193 ---- Plant proteins ---- Endoplasmin homolog
Source.1669: DFBPPR7199 ---- Plant proteins ---- Pathogenesis-related protein PRB1-3
Source.1670: DFBPPR7203 ---- Plant proteins ---- Betaine aldehyde dehydrogenase
Source.1671: DFBPPR7207 ---- Plant proteins ---- Profilin-1
Source.1672: DFBPPR7213 ---- Plant proteins ---- Anthocyanidin 3-O-glucosyltransferase
Source.1673: DFBPPR7214 ---- Plant proteins ---- Alpha-glucosidase
Source.1674: DFBPPR7215 ---- Plant proteins ---- Aldose reductase
Source.1675: DFBPPR7218 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1676: DFBPPR7221 ---- Plant proteins ---- DNA-directed RNA polymerase subunit beta
Source.1677: DFBPPR7222 ---- Plant proteins ---- Protein HVA22
Source.1678: DFBPPR7225 ---- Plant proteins ---- ATP-dependent Clp protease proteolytic subunit
Source.1679: DFBPPR7230 ---- Plant proteins ---- Fructan 1-exohydrolase
Source.1680: DFBPPR7238 ---- Plant proteins ---- Pathogenesis-related protein 1
Source.1681: DFBPPR7239 ---- Plant proteins ---- Pathogenesis-related protein PRB1-2
Source.1682: DFBPPR7245 ---- Plant proteins ---- Cytochrome b6-f complex subunit 8
Source.1683: DFBPPR7248 ---- Plant proteins ---- Glutamine synthetase
Source.1684: DFBPPR7252 ---- Plant proteins ---- MLO protein homolog 1
Source.1685: DFBPPR7259 ---- Plant proteins ---- High molecular mass early light-inducible protein HV58, chloroplastic
Source.1686: DFBPPR7296 ---- Plant proteins ---- V-type proton ATPase subunit C
Source.1687: DFBPPR7298 ---- Plant proteins ---- Cytochrome c biogenesis protein CcsA
Source.1688: DFBPPR7323 ---- Plant proteins ---- Antifungal protein R
Source.1689: DFBPPR7324 ---- Plant proteins ---- Antifungal protein S
Source.1690: DFBPPR7350 ---- Plant proteins ---- Pathogen-related protein
Source.1691: DFBPPR7400 ---- Plant proteins ---- Myrosinase
Source.1692: DFBPPR7404 ---- Plant proteins ---- O-fucosyltransferase 20
Source.1693: DFBPPR7411 ---- Plant proteins ---- Acetolactate synthase 1, chloroplastic
Source.1694: DFBPPR7413 ---- Plant proteins ---- Acetolactate synthase 3, chloroplastic
Source.1695: DFBPPR7416 ---- Plant proteins ---- Cruciferin CRU4
Source.1696: DFBPPR7417 ---- Plant proteins ---- Cruciferin
Source.1697: DFBPPR7425 ---- Plant proteins ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, seed specific, chloroplastic
Source.1698: DFBPPR7430 ---- Plant proteins ---- Nitrate reductase [NADH], clone PBNBR1412
Source.1699: DFBPPR7440 ---- Plant proteins ---- V-type proton ATPase catalytic subunit A
Source.1700: DFBPPR7443 ---- Plant proteins ---- Ferritin-1, chloroplastic
Source.1701: DFBPPR7444 ---- Plant proteins ---- Cruciferin BnC2
Source.1702: DFBPPR7446 ---- Plant proteins ---- Cruciferin BnC1
Source.1703: DFBPPR7450 ---- Plant proteins ---- Aldehyde dehydrogenase family 7 member A1
Source.1704: DFBPPR7452 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.1705: DFBPPR7453 ---- Plant proteins ---- Ribulose bisphosphate carboxylase small chain F1, chloroplastic
Source.1706: DFBPPR7464 ---- Plant proteins ---- Glutamine synthetase, chloroplastic
Source.1707: DFBPPR7473 ---- Plant proteins ---- Squalene monooxygenase 1,2
Source.1708: DFBPPR7489 ---- Plant proteins ---- Glycerophosphocholine acyltransferase 1
Source.1709: DFBPPR7493 ---- Plant proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase 2
Source.1710: DFBPPR7496 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM1
Source.1711: DFBPPR7497 ---- Plant proteins ---- AP2-like ethylene-responsive transcription factor BBM2
Source.1712: DFBPPR7498 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.1713: DFBPPR7500 ---- Plant proteins ---- L-ascorbate oxidase homolog
Source.1714: DFBPPR7506 ---- Plant proteins ---- Thioredoxin H-type 1
Source.1715: DFBPPR7513 ---- Plant proteins ---- Thioredoxin H-type 2
Source.1716: DFBPPR7521 ---- Plant proteins ---- BURP domain-containing protein BNM2A
Source.1717: DFBPPR7528 ---- Plant proteins ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.1718: DFBPPR7529 ---- Plant proteins ---- Profilin
Source.1719: DFBPPR7531 ---- Plant proteins ---- BURP domain-containing protein BNM2C
Source.1720: DFBPPR7535 ---- Plant proteins ---- Ribosomal protein S3, mitochondrial
Source.1721: DFBPPR7550 ---- Plant proteins ---- Guanine nucleotide-binding protein subunit beta-like protein
Source.1722: DFBPPR7596 ---- Milk proteins ---- Lactotransferrin
Source.1723: DFBPPR7598 ---- Milk proteins ---- Lipoprotein lipase
Source.1724: DFBPPR7600 ---- Milk proteins ---- UDP-glucuronosyltransferase 1A1
Source.1725: DFBPPR7601 ---- Milk proteins ---- Lactoperoxidase
Source.1726: DFBPPR7602 ---- Milk proteins ---- Alpha-S1-casein
Source.1727: DFBPPR7607 ---- Milk proteins ---- Galectin-3-binding protein
Source.1728: DFBPPR7616 ---- Milk proteins ---- Macrophage mannose receptor 1
Source.1729: DFBPPR7621 ---- Milk proteins ---- Mucin-4
Source.1730: DFBPPR7627 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.1731: DFBPPR7630 ---- Milk proteins ---- Folate receptor alpha
Source.1732: DFBPPR7632 ---- Milk proteins ---- Receptor tyrosine-protein kinase erbB-4
Source.1733: DFBPPR7633 ---- Milk proteins ---- Chordin-like protein 2
Source.1734: DFBPPR7635 ---- Milk proteins ---- Prosaposin
Source.1735: DFBPPR7636 ---- Milk proteins ---- Suppressor of tumorigenicity 14 protein
Source.1736: DFBPPR7641 ---- Milk proteins ---- Lactase-phlorizin hydrolase
Source.1737: DFBPPR7648 ---- Milk proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.1738: DFBPPR7651 ---- Milk proteins ---- Macrophage colony-stimulating factor 1 receptor
Source.1739: DFBPPR7655 ---- Milk proteins ---- Protein FAM13A
Source.1740: DFBPPR7658 ---- Milk proteins ---- Lactotransferrin
Source.1741: DFBPPR7661 ---- Milk proteins ---- IgG receptor FcRn large subunit p51
Source.1742: DFBPPR7669 ---- Milk proteins ---- Lactotransferrin
Source.1743: DFBPPR7682 ---- Milk proteins ---- Lactoperoxidase
Source.1744: DFBPPR7683 ---- Milk proteins ---- Lactotransferrin
Source.1745: DFBPPR7712 ---- Milk proteins ---- Lactoperoxidase
Source.1746: DFBPPR7713 ---- Milk proteins ---- Lactotransferrin
Source.1747: DFBPPR7721 ---- Plant proteins ---- Chlorophyll synthase, chloroplastic
Source.1748: DFBPPR7723 ---- Plant proteins ---- Phytochrome A type 3
Source.1749: DFBPPR7726 ---- Plant proteins ---- Phytochrome A type 4
Source.1750: DFBPPR7727 ---- Plant proteins ---- Phytochrome A type 5
Source.1751: DFBPPR7728 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1752: DFBPPR7738 ---- Plant proteins ---- Arginine decarboxylase
Source.1753: DFBPPR7740 ---- Plant proteins ---- Protochlorophyllide reductase
Source.1754: DFBPPR7745 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 4
Source.1755: DFBPPR7746 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 2
Source.1756: DFBPPR7747 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 1
Source.1757: DFBPPR7748 ---- Plant proteins ---- Thaumatin-like pathogenesis-related protein 3
Source.1758: DFBPPR8186 ---- Plant proteins ---- 11S globulin subunit beta
Source.1759: DFBPPR8188 ---- Plant proteins ---- Nitrate reductase [NADH]
Source.1760: DFBPPR8189 ---- Plant proteins ---- Ent-kaur-16-ene synthase, chloroplastic
Source.1761: DFBPPR8191 ---- Plant proteins ---- L-ascorbate oxidase
Source.1762: DFBPPR8193 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMW33
Source.1763: DFBPPR8194 ---- Plant proteins ---- 1-aminocyclopropane-1-carboxylate synthase CMA101
Source.1764: DFBPPR8364 ---- Plant proteins ---- UDP-glycosyltransferase 708C1
Source.1765: DFBPPR8366 ---- Plant proteins ---- UDP-glycosyltransferase 708C2
Source.1766: DFBPPR8372 ---- Plant proteins ---- Chlorophyll a-b binding protein, chloroplastic
Source.1767: DFBPPR8374 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1768: DFBPPR8375 ---- Plant proteins ---- Psoralen synthase
Source.1769: DFBPPR8377 ---- Plant proteins ---- Profilin
Source.1770: DFBPPR8408 ---- Plant proteins ---- Profilin
Source.1771: DFBPPR8417 ---- Plant proteins ---- Elongation factor G, chloroplastic
Source.1772: DFBPPR8427 ---- Plant proteins ---- Ribulose bisphosphate carboxylase large chain
Source.1773: DFBPPR8430 ---- Plant proteins ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.1774: DFBPPR8432 ---- Plant proteins ---- Omega-3 fatty acid desaturase, chloroplastic
Source.1775: DFBPPR8435 ---- Plant proteins ---- Primary amine oxidase
Source.1776: DFBPPR8445 ---- Plant proteins ---- Maturase K
Source.1777: DFBPPR8448 ---- Plant proteins ---- Maturase K
Source.1778: DFBPPR8451 ---- Plant proteins ---- 4-hydroxy-7-methoxy-3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl glucoside beta-D-glucosidase, chloroplastic
Source.1779: DFBPPR8454 ---- Plant proteins ---- Photosystem II CP43 reaction center protein
Source.1780: DFBPPR8455 ---- Plant proteins ---- Triosephosphate isomerase, chloroplastic
Source.1781: DFBPPR8457 ---- Plant proteins ---- Triosephosphate isomerase, cytosolic
Source.1782: DFBPPR8458 ---- Plant proteins ---- Catalase
Source.1783: DFBPPR8459 ---- Plant proteins ---- Carbon catabolite-derepressing protein kinase
Source.1784: DFBPPR8471 ---- Plant proteins ---- Beta-amylase
Source.1785: DFBPPR8472 ---- Plant proteins ---- Photosystem II reaction center protein K
Source.1786: DFBPPR8493 ---- Milk proteins ---- Diacylglycerol O-acyltransferase 1
Source.1787: DFBPPR8497 ---- Milk proteins ---- Lactoperoxidase
Source.1788: DFBPPR8500 ---- Milk proteins ---- Lactotransferrin
Source.1789: DFBPPR8507 ---- Milk proteins ---- Polycystin-2
Source.1790: DFBPPR8510 ---- Milk proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.1791: DFBPPR8514 ---- Milk proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1792: DFBPPR8519 ---- Milk proteins ---- Acyl-CoA 6-desaturase
Source.1793: DFBPPR8520 ---- Milk proteins ---- Fatty acid desaturase 3
Source.1794: DFBPPR15933 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.1795: DFBPPR15935 ---- Animal proteins ---- Catalase
Source.1796: DFBPPR15944 ---- Animal proteins ---- Ras-related protein Rab-13
Source.1797: DFBPPR15946 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.1798: DFBPPR15947 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.1799: DFBPPR15949 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.1800: DFBPPR15950 ---- Animal proteins ---- Unconventional myosin-Id
Source.1801: DFBPPR15954 ---- Animal proteins ---- Thyroid peroxidase
Source.1802: DFBPPR15956 ---- Animal proteins ---- Phospholipase A2
Source.1803: DFBPPR15958 ---- Animal proteins ---- Myosin-9
Source.1804: DFBPPR15959 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.1805: DFBPPR15960 ---- Animal proteins ---- Apolipoprotein A-IV
Source.1806: DFBPPR15962 ---- Animal proteins ---- Bile salt export pump
Source.1807: DFBPPR15964 ---- Animal proteins ---- Aquaporin-1
Source.1808: DFBPPR15966 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.1809: DFBPPR15970 ---- Animal proteins ---- Aminopeptidase N
Source.1810: DFBPPR15971 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.1811: DFBPPR15974 ---- Animal proteins ---- Androgen receptor
Source.1812: DFBPPR15979 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.1813: DFBPPR15981 ---- Animal proteins ---- Peroxisome proliferator-activated receptor delta
Source.1814: DFBPPR15983 ---- Animal proteins ---- Tight junction protein ZO-1
Source.1815: DFBPPR15985 ---- Animal proteins ---- von Willebrand factor
Source.1816: DFBPPR15990 ---- Animal proteins ---- Transcription factor SOX-9
Source.1817: DFBPPR15991 ---- Animal proteins ---- Toll-like receptor 9
Source.1818: DFBPPR15993 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.1819: DFBPPR15997 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.1820: DFBPPR15999 ---- Animal proteins ---- Prostaglandin E synthase
Source.1821: DFBPPR16001 ---- Animal proteins ---- Battenin
Source.1822: DFBPPR16003 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.1823: DFBPPR16004 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.1824: DFBPPR16007 ---- Animal proteins ---- Myocilin
Source.1825: DFBPPR16009 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.1826: DFBPPR16012 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.1827: DFBPPR16017 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 1
Source.1828: DFBPPR16018 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.1829: DFBPPR16019 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.1830: DFBPPR16023 ---- Animal proteins ---- Platelet-derived growth factor receptor beta
Source.1831: DFBPPR16028 ---- Animal proteins ---- Presenilin-1
Source.1832: DFBPPR16029 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.1833: DFBPPR16031 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.1834: DFBPPR16035 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.1835: DFBPPR16040 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.1836: DFBPPR16042 ---- Animal proteins ---- Caveolin-2
Source.1837: DFBPPR16043 ---- Animal proteins ---- Adenylate cyclase type 6
Source.1838: DFBPPR16045 ---- Animal proteins ---- Endoplasmin
Source.1839: DFBPPR16047 ---- Animal proteins ---- Adenylate cyclase type 5
Source.1840: DFBPPR16048 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.1841: DFBPPR16049 ---- Animal proteins ---- Cytochrome P450 1A2
Source.1842: DFBPPR16052 ---- Animal proteins ---- Atypical chemokine receptor 3
Source.1843: DFBPPR16054 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.1844: DFBPPR16055 ---- Animal proteins ---- Glutamate receptor ionotropic, NMDA 2B
Source.1845: DFBPPR16058 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.1846: DFBPPR16060 ---- Animal proteins ---- Protein kinase C delta type
Source.1847: DFBPPR16063 ---- Animal proteins ---- Receptor tyrosine-protein kinase erbB-2
Source.1848: DFBPPR16064 ---- Animal proteins ---- Calnexin
Source.1849: DFBPPR16068 ---- Animal proteins ---- Cytochrome P450 2E1
Source.1850: DFBPPR16069 ---- Animal proteins ---- T-cell surface glycoprotein CD4
Source.1851: DFBPPR16070 ---- Animal proteins ---- Cytochrome P450 1A1
Source.1852: DFBPPR16074 ---- Animal proteins ---- Calsequestrin-2
Source.1853: DFBPPR16076 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.1854: DFBPPR16087 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.1855: DFBPPR16092 ---- Animal proteins ---- Tight junction protein ZO-2
Source.1856: DFBPPR16097 ---- Animal proteins ---- Thyrotropin receptor
Source.1857: DFBPPR16100 ---- Animal proteins ---- Nucleoside diphosphate kinase B
Source.1858: DFBPPR16104 ---- Animal proteins ---- Retinal guanylyl cyclase 1
Source.1859: DFBPPR16106 ---- Animal proteins ---- Orexin receptor type 2
Source.1860: DFBPPR16107 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.1861: DFBPPR16109 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.1862: DFBPPR16123 ---- Animal proteins ---- Coiled-coil domain-containing protein 66
Source.1863: DFBPPR16126 ---- Animal proteins ---- Histamine H2 receptor
Source.1864: DFBPPR16127 ---- Animal proteins ---- Tyrosine-protein kinase Fer
Source.1865: DFBPPR16128 ---- Animal proteins ---- Cubilin
Source.1866: DFBPPR16131 ---- Animal proteins ---- Pyruvate kinase PKLR
Source.1867: DFBPPR16133 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.1868: DFBPPR16135 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.1869: DFBPPR16136 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.1870: DFBPPR16141 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.1871: DFBPPR16142 ---- Animal proteins ---- Procathepsin L
Source.1872: DFBPPR16147 ---- Animal proteins ---- Telomerase reverse transcriptase
Source.1873: DFBPPR16150 ---- Animal proteins ---- Chloride channel protein 1
Source.1874: DFBPPR16156 ---- Animal proteins ---- Ras-related protein Rab-22A
Source.1875: DFBPPR16158 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.1876: DFBPPR16160 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.1877: DFBPPR16161 ---- Animal proteins ---- Dihydrolipoyl dehydrogenase, mitochondrial
Source.1878: DFBPPR16163 ---- Animal proteins ---- Beta-2-glycoprotein 1
Source.1879: DFBPPR16164 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 1
Source.1880: DFBPPR16165 ---- Animal proteins ---- Prostaglandin-H2 D-isomerase
Source.1881: DFBPPR16167 ---- Animal proteins ---- Estradiol 17-beta-dehydrogenase 8
Source.1882: DFBPPR16169 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.1883: DFBPPR16170 ---- Animal proteins ---- Inversin
Source.1884: DFBPPR16172 ---- Animal proteins ---- Translocator protein 2
Source.1885: DFBPPR16173 ---- Animal proteins ---- Aromatase
Source.1886: DFBPPR16176 ---- Animal proteins ---- Triosephosphate isomerase
Source.1887: DFBPPR16184 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.1888: DFBPPR16188 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.1889: DFBPPR16195 ---- Animal proteins ---- Xylosyltransferase 1
Source.1890: DFBPPR16197 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.1891: DFBPPR16202 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.1892: DFBPPR16207 ---- Animal proteins ---- Homeobox protein cut-like 1
Source.1893: DFBPPR16209 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.1894: DFBPPR16210 ---- Animal proteins ---- Creatine kinase M-type
Source.1895: DFBPPR16211 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.1896: DFBPPR16212 ---- Animal proteins ---- Alpha-1B adrenergic receptor
Source.1897: DFBPPR16218 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.1898: DFBPPR16221 ---- Animal proteins ---- Xylosyltransferase 2
Source.1899: DFBPPR16222 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.1900: DFBPPR16224 ---- Animal proteins ---- Uromodulin
Source.1901: DFBPPR16227 ---- Animal proteins ---- Myelin proteolipid protein
Source.1902: DFBPPR16230 ---- Animal proteins ---- Survival motor neuron protein
Source.1903: DFBPPR16232 ---- Animal proteins ---- Lysine-specific demethylase 5D
Source.1904: DFBPPR16236 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.1905: DFBPPR16238 ---- Animal proteins ---- Galactosylgalactosylxylosylprotein 3-beta-glucuronosyltransferase 2
Source.1906: DFBPPR16239 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.1907: DFBPPR16242 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.1908: DFBPPR16248 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.1909: DFBPPR16249 ---- Animal proteins ---- Alpha-L-iduronidase
Source.1910: DFBPPR16251 ---- Animal proteins ---- Adenosine receptor A2a
Source.1911: DFBPPR16252 ---- Animal proteins ---- Steroid hormone receptor ERR1
Source.1912: DFBPPR16253 ---- Animal proteins ---- Cytochrome P450 2D15
Source.1913: DFBPPR16255 ---- Animal proteins ---- Frizzled-6
Source.1914: DFBPPR16257 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.1915: DFBPPR16259 ---- Animal proteins ---- Galactocerebrosidase
Source.1916: DFBPPR16260 ---- Animal proteins ---- Creatine kinase B-type
Source.1917: DFBPPR16263 ---- Animal proteins ---- Protein 4.1
Source.1918: DFBPPR16266 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.1919: DFBPPR16268 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.1920: DFBPPR16269 ---- Animal proteins ---- Ammonium transporter Rh type C
Source.1921: DFBPPR16272 ---- Animal proteins ---- Thrombopoietin
Source.1922: DFBPPR16276 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 1
Source.1923: DFBPPR16283 ---- Animal proteins ---- Nucleoside diphosphate kinase A
Source.1924: DFBPPR16289 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.1925: DFBPPR16309 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.1926: DFBPPR16310 ---- Animal proteins ---- Zinc-activated ligand-gated ion channel
Source.1927: DFBPPR16311 ---- Animal proteins ---- D(2) dopamine receptor
Source.1928: DFBPPR16319 ---- Animal proteins ---- Stromelysin-1
Source.1929: DFBPPR16320 ---- Animal proteins ---- Guanylate cyclase soluble subunit beta-1
Source.1930: DFBPPR16325 ---- Animal proteins ---- Peripherin-2
Source.1931: DFBPPR16327 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.1932: DFBPPR16332 ---- Animal proteins ---- Transcription factor 4
Source.1933: DFBPPR16333 ---- Animal proteins ---- Transcription factor 4
Source.1934: DFBPPR16334 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.1935: DFBPPR16335 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.1936: DFBPPR16341 ---- Animal proteins ---- Calmegin
Source.1937: DFBPPR16367 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.1938: DFBPPR16368 ---- Animal proteins ---- Tyrosinase
Source.1939: DFBPPR16378 ---- Animal proteins ---- Arginine esterase
Source.1940: DFBPPR16436 ---- Animal proteins ---- Glycogen debranching enzyme
Source.1941: DFBPPR16439 ---- Animal proteins ---- Lutropin subunit beta
Source.1942: DFBPPR16441 ---- Animal proteins ---- Exocyst complex component 6
Source.1943: DFBPPR16442 ---- Animal proteins ---- Relaxin receptor 2
Source.1944: DFBPPR16454 ---- Animal proteins ---- Tubulin delta chain
Source.1945: DFBPPR16456 ---- Animal proteins ---- Ribosome-binding protein 1
Source.1946: DFBPPR16458 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.1947: DFBPPR16477 ---- Animal proteins ---- Beta-glucuronidase
Source.1948: DFBPPR16481 ---- Animal proteins ---- Caspase-12
Source.1949: DFBPPR16488 ---- Animal proteins ---- Coagulation factor VIII
Source.1950: DFBPPR16496 ---- Animal proteins ---- Somatostatin receptor type 1
Source.1951: DFBPPR16504 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.1952: DFBPPR16506 ---- Animal proteins ---- Pepsin B
Source.1953: DFBPPR16509 ---- Animal proteins ---- Substance-K receptor
Source.1954: DFBPPR16510 ---- Animal proteins ---- B1 bradykinin receptor
Source.1955: DFBPPR16511 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.1956: DFBPPR16517 ---- Animal proteins ---- Cholinesterase
Source.1957: DFBPPR16525 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.1958: DFBPPR16529 ---- Animal proteins ---- Carboxylesterase 5A
Source.1959: DFBPPR16532 ---- Animal proteins ---- Amine oxidase [flavin-containing] B
Source.1960: DFBPPR16540 ---- Animal proteins ---- Desmoglein-3
Source.1961: DFBPPR16550 ---- Animal proteins ---- Erythropoietin
Source.1962: DFBPPR16551 ---- Animal proteins ---- Pro-epidermal growth factor
Source.1963: DFBPPR16553 ---- Animal proteins ---- Tapasin
Source.1964: DFBPPR16554 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.1965: DFBPPR16555 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.1966: DFBPPR16561 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B31
Source.1967: DFBPPR16574 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.1968: DFBPPR16575 ---- Animal proteins ---- Dystrophin
Source.1969: DFBPPR16583 ---- Animal proteins ---- Taste receptor type 1 member 3
Source.1970: DFBPPR16585 ---- Animal proteins ---- Cone-rod homeobox protein
Source.1971: DFBPPR16591 ---- Animal proteins ---- Gamma-crystallin S
Source.1972: DFBPPR16594 ---- Animal proteins ---- Macoilin
Source.1973: DFBPPR16596 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.1974: DFBPPR16597 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.1975: DFBPPR16607 ---- Animal proteins ---- Taste receptor type 1 member 2
Source.1976: DFBPPR16608 ---- Animal proteins ---- Olfactory receptor-like protein OLF1
Source.1977: DFBPPR16615 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1
Source.1978: DFBPPR16617 ---- Animal proteins ---- Beta-crystallin A4
Source.1979: DFBPPR16625 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.1980: DFBPPR16641 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.1981: DFBPPR16644 ---- Animal proteins ---- Arylsulfatase H
Source.1982: DFBPPR16645 ---- Animal proteins ---- Putative protein SCAMPER
Source.1983: DFBPPR16668 ---- Animal proteins ---- Zinc finger and BTB domain-containing protein 22
Source.1984: DFBPPR16684 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.1985: DFBPPR16694 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.1986: DFBPPR16695 ---- Animal proteins ---- UDP-galactose translocator
Source.1987: DFBPPR16696 ---- Animal proteins ---- von Hippel-Lindau disease tumor suppressor
Source.1988: DFBPPR16698 ---- Animal proteins ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-3
Source.1989: DFBPPR16704 ---- Animal proteins ---- Retbindin
Source.1990: DFBPPR16706 ---- Animal proteins ---- 60S ribosomal protein L19
Source.1991: DFBPPR16708 ---- Animal proteins ---- Transmembrane protein 190
Source.1992: DFBPPR16720 ---- Animal proteins ---- Tudor domain-containing protein 5
Source.1993: DFBPPR16726 ---- Animal proteins ---- Ral guanine nucleotide dissociation stimulator-like 2
Source.1994: DFBPPR16748 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.1995: DFBPPR16754 ---- Animal proteins ---- Melanoma-associated antigen B10
Source.1996: DFBPPR16759 ---- Animal proteins ---- Ig mu chain C region
Source.1997: DFBPPR16767 ---- Animal proteins ---- Nucleoside diphosphate kinase, mitochondrial
Source.1998: DFBPPR16775 ---- Animal proteins ---- Pinopsin
Source.1999: DFBPPR16776 ---- Animal proteins ---- Nucleoside diphosphate kinase
Source.2000: DFBPPR16777 ---- Animal proteins ---- Hemoglobin subunit alpha-D
Source.2001: DFBPPR16778 ---- Animal proteins ---- Prolactin receptor
Source.2002: DFBPPR16781 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2003: DFBPPR16783 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.2004: DFBPPR16806 ---- Animal proteins ---- Cytosol aminopeptidase
Source.2005: DFBPPR16811 ---- Animal proteins ---- Carboxypeptidase A1
Source.2006: DFBPPR16813 ---- Animal proteins ---- Prolactin
Source.2007: DFBPPR16817 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.2008: DFBPPR16818 ---- Animal proteins ---- ATPase inhibitor, mitochondrial
Source.2009: DFBPPR16831 ---- Animal proteins ---- Fibrinogen beta chain
Source.2010: DFBPPR16833 ---- Animal proteins ---- Thiosulfate sulfurtransferase
Source.2011: DFBPPR16839 ---- Animal proteins ---- Myelin proteolipid protein
Source.2012: DFBPPR16842 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.2013: DFBPPR16846 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.2014: DFBPPR16849 ---- Animal proteins ---- NADPH:adrenodoxin oxidoreductase, mitochondrial
Source.2015: DFBPPR16850 ---- Animal proteins ---- Growth hormone receptor
Source.2016: DFBPPR16867 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.2017: DFBPPR16874 ---- Animal proteins ---- Toll-like receptor 2
Source.2018: DFBPPR16878 ---- Animal proteins ---- Prostacyclin synthase
Source.2019: DFBPPR16881 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 2
Source.2020: DFBPPR16883 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.2021: DFBPPR16884 ---- Animal proteins ---- Sodium/calcium exchanger 1
Source.2022: DFBPPR16894 ---- Animal proteins ---- Procathepsin L
Source.2023: DFBPPR16908 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.2024: DFBPPR16915 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.2025: DFBPPR16918 ---- Animal proteins ---- Spastin
Source.2026: DFBPPR16921 ---- Animal proteins ---- Lysosomal alpha-mannosidase
Source.2027: DFBPPR16925 ---- Animal proteins ---- Supervillin
Source.2028: DFBPPR16929 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.2029: DFBPPR16934 ---- Animal proteins ---- Coagulation factor V
Source.2030: DFBPPR16941 ---- Animal proteins ---- Sodium/potassium/calcium exchanger 1
Source.2031: DFBPPR16942 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.2032: DFBPPR16953 ---- Animal proteins ---- Activin receptor type-2A
Source.2033: DFBPPR16957 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.2034: DFBPPR16958 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.2035: DFBPPR16960 ---- Animal proteins ---- Catalase
Source.2036: DFBPPR16963 ---- Animal proteins ---- Lysosomal alpha-glucosidase
Source.2037: DFBPPR16965 ---- Animal proteins ---- Adseverin
Source.2038: DFBPPR16966 ---- Animal proteins ---- Estrogen receptor
Source.2039: DFBPPR16968 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit beta
Source.2040: DFBPPR16971 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.2041: DFBPPR16973 ---- Animal proteins ---- Fatty acid synthase
Source.2042: DFBPPR16979 ---- Animal proteins ---- Aquaporin-1
Source.2043: DFBPPR16980 ---- Animal proteins ---- 3-galactosyl-N-acetylglucosaminide 4-alpha-L-fucosyltransferase FUT3
Source.2044: DFBPPR16983 ---- Animal proteins ---- Membrane primary amine oxidase
Source.2045: DFBPPR16984 ---- Animal proteins ---- Caveolin-2
Source.2046: DFBPPR16986 ---- Animal proteins ---- Aspartyl/asparaginyl beta-hydroxylase
Source.2047: DFBPPR16994 ---- Animal proteins ---- Somatoliberin
Source.2048: DFBPPR16998 ---- Animal proteins ---- Poly(A) polymerase alpha
Source.2049: DFBPPR16999 ---- Animal proteins ---- TGF-beta receptor type-1
Source.2050: DFBPPR17002 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.2051: DFBPPR17003 ---- Animal proteins ---- Toll-like receptor 9
Source.2052: DFBPPR17004 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.2053: DFBPPR17006 ---- Animal proteins ---- Syntaxin-17
Source.2054: DFBPPR17011 ---- Animal proteins ---- E3 SUMO-protein ligase RanBP2
Source.2055: DFBPPR17013 ---- Animal proteins ---- Presenilin-1
Source.2056: DFBPPR17017 ---- Animal proteins ---- Nucleoside diphosphate kinase A 2
Source.2057: DFBPPR17018 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.2058: DFBPPR17019 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.2059: DFBPPR17020 ---- Animal proteins ---- Prostaglandin E synthase
Source.2060: DFBPPR17021 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.2061: DFBPPR17024 ---- Animal proteins ---- Sodium-dependent serotonin transporter
Source.2062: DFBPPR17025 ---- Animal proteins ---- Tissue-type plasminogen activator
Source.2063: DFBPPR17026 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.2064: DFBPPR17027 ---- Animal proteins ---- D(1A) dopamine receptor
Source.2065: DFBPPR17028 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.2066: DFBPPR17030 ---- Animal proteins ---- Endothelin-converting enzyme 1
Source.2067: DFBPPR17034 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.2068: DFBPPR17038 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.2069: DFBPPR17039 ---- Animal proteins ---- Nucleotide-binding oligomerization domain-containing protein 2
Source.2070: DFBPPR17040 ---- Animal proteins ---- Myocilin
Source.2071: DFBPPR17041 ---- Animal proteins ---- Protein kinase C gamma type
Source.2072: DFBPPR17052 ---- Animal proteins ---- Nucleoside diphosphate kinase A 1
Source.2073: DFBPPR17058 ---- Animal proteins ---- Ras-related protein Rab-13
Source.2074: DFBPPR17061 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx2
Source.2075: DFBPPR17062 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.2076: DFBPPR17063 ---- Animal proteins ---- Lysophospholipid acyltransferase 5
Source.2077: DFBPPR17064 ---- Animal proteins ---- Unconventional myosin-Ic
Source.2078: DFBPPR17065 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.2079: DFBPPR17066 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase gamma-1
Source.2080: DFBPPR17071 ---- Animal proteins ---- Insulin-like growth factor 1 receptor
Source.2081: DFBPPR17072 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.2082: DFBPPR17073 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.2083: DFBPPR17074 ---- Animal proteins ---- Group 3 secretory phospholipase A2
Source.2084: DFBPPR17078 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.2085: DFBPPR17080 ---- Animal proteins ---- Presenilin-2
Source.2086: DFBPPR17081 ---- Animal proteins ---- Lys-63-specific deubiquitinase BRCC36
Source.2087: DFBPPR17084 ---- Animal proteins ---- RAC-alpha serine/threonine-protein kinase
Source.2088: DFBPPR17085 ---- Animal proteins ---- Cadherin-2
Source.2089: DFBPPR17088 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.2090: DFBPPR17091 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.2091: DFBPPR17092 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 4
Source.2092: DFBPPR17094 ---- Animal proteins ---- Activin receptor type-1
Source.2093: DFBPPR17098 ---- Animal proteins ---- Cytochrome P450 2E1
Source.2094: DFBPPR17105 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.2095: DFBPPR17106 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.2096: DFBPPR17108 ---- Animal proteins ---- Coronin-1A
Source.2097: DFBPPR17109 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.2098: DFBPPR17110 ---- Animal proteins ---- Diacylglycerol O-acyltransferase 2
Source.2099: DFBPPR17111 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.2100: DFBPPR17112 ---- Animal proteins ---- Primary amine oxidase, liver isozyme
Source.2101: DFBPPR17114 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.2102: DFBPPR17117 ---- Animal proteins ---- Beta-hexosaminidase subunit alpha
Source.2103: DFBPPR17119 ---- Animal proteins ---- Hyaluronidase-2
Source.2104: DFBPPR17120 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 7
Source.2105: DFBPPR17122 ---- Animal proteins ---- Glycine receptor subunit beta
Source.2106: DFBPPR17123 ---- Animal proteins ---- Retinal guanylyl cyclase 2
Source.2107: DFBPPR17124 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.2108: DFBPPR17127 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.2109: DFBPPR17131 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.2110: DFBPPR17136 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.2111: DFBPPR17140 ---- Animal proteins ---- Adiponectin
Source.2112: DFBPPR17154 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.2113: DFBPPR17155 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.2114: DFBPPR17156 ---- Animal proteins ---- ATP-dependent RNA helicase A
Source.2115: DFBPPR17157 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.2116: DFBPPR17161 ---- Animal proteins ---- D(2) dopamine receptor
Source.2117: DFBPPR17162 ---- Animal proteins ---- Collagen alpha-1(IV) chain
Source.2118: DFBPPR17164 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.2119: DFBPPR17165 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.2120: DFBPPR17170 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 2
Source.2121: DFBPPR17188 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit alpha
Source.2122: DFBPPR17195 ---- Animal proteins ---- Receptor for retinol uptake STRA6
Source.2123: DFBPPR17204 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.2124: DFBPPR17232 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.2125: DFBPPR17233 ---- Animal proteins ---- Angiopoietin-1 receptor
Source.2126: DFBPPR17254 ---- Animal proteins ---- Zinc finger protein SNAI2
Source.2127: DFBPPR17262 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 33
Source.2128: DFBPPR17263 ---- Animal proteins ---- E3 ubiquitin-protein ligase UHRF1
Source.2129: DFBPPR17280 ---- Animal proteins ---- Serine racemase
Source.2130: DFBPPR17282 ---- Animal proteins ---- Myosin-10
Source.2131: DFBPPR17283 ---- Animal proteins ---- NAD-dependent protein deacetylase sirtuin-7
Source.2132: DFBPPR17288 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.2133: DFBPPR17294 ---- Animal proteins ---- Ezrin
Source.2134: DFBPPR17307 ---- Animal proteins ---- Major histocompatibility complex class I-related gene protein
Source.2135: DFBPPR17311 ---- Animal proteins ---- Nucleoside diphosphate kinase B
Source.2136: DFBPPR17313 ---- Animal proteins ---- Exostosin-1
Source.2137: DFBPPR17314 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit beta
Source.2138: DFBPPR17318 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.2139: DFBPPR17322 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.2140: DFBPPR17327 ---- Animal proteins ---- Myotubularin
Source.2141: DFBPPR17330 ---- Animal proteins ---- Unconventional myosin-X
Source.2142: DFBPPR17338 ---- Animal proteins ---- Unconventional myosin-VI
Source.2143: DFBPPR17341 ---- Animal proteins ---- Radixin
Source.2144: DFBPPR17342 ---- Animal proteins ---- Protein phosphatase 1 regulatory inhibitor subunit 16B
Source.2145: DFBPPR17343 ---- Animal proteins ---- Receptor of activated protein C kinase 1
Source.2146: DFBPPR17344 ---- Animal proteins ---- Neurexin-1
Source.2147: DFBPPR17347 ---- Animal proteins ---- Phytanoyl-CoA dioxygenase, peroxisomal
Source.2148: DFBPPR17349 ---- Animal proteins ---- Sialidase-3
Source.2149: DFBPPR17353 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase-like N
Source.2150: DFBPPR17354 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.2151: DFBPPR17357 ---- Animal proteins ---- Bardet-Biedl syndrome 4 protein homolog
Source.2152: DFBPPR17360 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.2153: DFBPPR17365 ---- Animal proteins ---- Phospholipase ABHD3
Source.2154: DFBPPR17368 ---- Animal proteins ---- Peroxisomal acyl-coenzyme A oxidase 1
Source.2155: DFBPPR17371 ---- Animal proteins ---- Autophagy protein 5
Source.2156: DFBPPR17372 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.2157: DFBPPR17374 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 1
Source.2158: DFBPPR17375 ---- Animal proteins ---- Peptidyl-glycine alpha-amidating monooxygenase
Source.2159: DFBPPR17377 ---- Animal proteins ---- Adenylate cyclase type 1
Source.2160: DFBPPR17378 ---- Animal proteins ---- Ceramide synthase 2
Source.2161: DFBPPR17379 ---- Animal proteins ---- Dematin
Source.2162: DFBPPR17382 ---- Animal proteins ---- Elongation of very long chain fatty acids protein 5
Source.2163: DFBPPR17389 ---- Animal proteins ---- Phospholipid-transporting ATPase IB
Source.2164: DFBPPR17393 ---- Animal proteins ---- Cell cycle control protein 50A
Source.2165: DFBPPR17394 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.2166: DFBPPR17401 ---- Animal proteins ---- Moesin
Source.2167: DFBPPR17404 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.2168: DFBPPR17406 ---- Animal proteins ---- Exostosin-2
Source.2169: DFBPPR17407 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 1
Source.2170: DFBPPR17410 ---- Animal proteins ---- Myotubularin-related protein 2
Source.2171: DFBPPR17411 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.2172: DFBPPR17414 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.2173: DFBPPR17416 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-5
Source.2174: DFBPPR17421 ---- Animal proteins ---- Serine protease HTRA2, mitochondrial
Source.2175: DFBPPR17422 ---- Animal proteins ---- Rhodopsin kinase GRK1
Source.2176: DFBPPR17423 ---- Animal proteins ---- Furin
Source.2177: DFBPPR17427 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit alpha-4
Source.2178: DFBPPR17429 ---- Animal proteins ---- EEF1AKMT4-ECE2 readthrough transcript protein
Source.2179: DFBPPR17433 ---- Animal proteins ---- Caveolin-3
Source.2180: DFBPPR17435 ---- Animal proteins ---- Ceramide transfer protein
Source.2181: DFBPPR17440 ---- Animal proteins ---- Clathrin heavy chain 1
Source.2182: DFBPPR17444 ---- Animal proteins ---- Adhesion G protein-coupled receptor L1
Source.2183: DFBPPR17448 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.2184: DFBPPR17450 ---- Animal proteins ---- Adhesion G protein-coupled receptor L3
Source.2185: DFBPPR17451 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.2186: DFBPPR17454 ---- Animal proteins ---- Peripherin-2
Source.2187: DFBPPR17456 ---- Animal proteins ---- Deoxynucleoside triphosphate triphosphohydrolase SAMHD1
Source.2188: DFBPPR17460 ---- Animal proteins ---- Endoplasmin
Source.2189: DFBPPR17464 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.2190: DFBPPR17472 ---- Animal proteins ---- Aminopeptidase N
Source.2191: DFBPPR17474 ---- Animal proteins ---- AFG3-like protein 2
Source.2192: DFBPPR17475 ---- Animal proteins ---- Protein O-glucosyltransferase 1
Source.2193: DFBPPR17480 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha1
Source.2194: DFBPPR17483 ---- Animal proteins ---- Speckle targeted PIP5K1A-regulated poly(A) polymerase
Source.2195: DFBPPR17486 ---- Animal proteins ---- Phosphatidylinositol 4-kinase beta
Source.2196: DFBPPR17487 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 4
Source.2197: DFBPPR17489 ---- Animal proteins ---- Adhesion G protein-coupled receptor L2
Source.2198: DFBPPR17491 ---- Animal proteins ---- NADH-cytochrome b5 reductase 3
Source.2199: DFBPPR17493 ---- Animal proteins ---- Catechol O-methyltransferase
Source.2200: DFBPPR17496 ---- Animal proteins ---- Unconventional myosin-Id
Source.2201: DFBPPR17514 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.2202: DFBPPR17516 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.2203: DFBPPR17518 ---- Animal proteins ---- ADP-ribosylation factor 1
Source.2204: DFBPPR17520 ---- Animal proteins ---- Protein arginine N-methyltransferase 5
Source.2205: DFBPPR17526 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 3
Source.2206: DFBPPR17527 ---- Animal proteins ---- Brefeldin A-inhibited guanine nucleotide-exchange protein 1
Source.2207: DFBPPR17533 ---- Animal proteins ---- Carboxypeptidase E
Source.2208: DFBPPR17537 ---- Animal proteins ---- Sphingomyelin phosphodiesterase
Source.2209: DFBPPR17539 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.2210: DFBPPR17542 ---- Animal proteins ---- Acetylcholine receptor subunit beta
Source.2211: DFBPPR17543 ---- Animal proteins ---- 4-hydroxy-2-oxoglutarate aldolase, mitochondrial
Source.2212: DFBPPR17548 ---- Animal proteins ---- E3 ubiquitin-protein transferase MAEA
Source.2213: DFBPPR17550 ---- Animal proteins ---- Serine/threonine-protein kinase PLK4
Source.2214: DFBPPR17561 ---- Animal proteins ---- Aquaporin-4
Source.2215: DFBPPR17569 ---- Animal proteins ---- Platelet endothelial cell adhesion molecule
Source.2216: DFBPPR17572 ---- Animal proteins ---- Estrogen receptor beta
Source.2217: DFBPPR17575 ---- Animal proteins ---- A disintegrin and metalloproteinase with thrombospondin motifs 4
Source.2218: DFBPPR17578 ---- Animal proteins ---- Acidic mammalian chitinase
Source.2219: DFBPPR17584 ---- Animal proteins ---- Cytochrome c oxidase subunit 7B, mitochondrial
Source.2220: DFBPPR17591 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.2221: DFBPPR17595 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.2222: DFBPPR17602 ---- Animal proteins ---- Rod cGMP-specific 3',5'-cyclic phosphodiesterase subunit beta
Source.2223: DFBPPR17604 ---- Animal proteins ---- Regulator of telomere elongation helicase 1
Source.2224: DFBPPR17613 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.2225: DFBPPR17616 ---- Animal proteins ---- Bifunctional heparan sulfate N-deacetylase/N-sulfotransferase 2
Source.2226: DFBPPR17634 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.2227: DFBPPR17644 ---- Animal proteins ---- CCAAT/enhancer-binding protein beta
Source.2228: DFBPPR17645 ---- Animal proteins ---- Endothelin-converting enzyme 2
Source.2229: DFBPPR17658 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.2230: DFBPPR17661 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.2231: DFBPPR17678 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 16
Source.2232: DFBPPR17684 ---- Animal proteins ---- Leukotriene A-4 hydrolase
Source.2233: DFBPPR17713 ---- Animal proteins ---- Urokinase plasminogen activator surface receptor
Source.2234: DFBPPR17718 ---- Animal proteins ---- Activin receptor type-2B
Source.2235: DFBPPR17737 ---- Animal proteins ---- Inactive serine/threonine-protein kinase TEX14
Source.2236: DFBPPR17738 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.2237: DFBPPR17742 ---- Animal proteins ---- Primary amine oxidase, lung isozyme
Source.2238: DFBPPR17744 ---- Animal proteins ---- Protein argonaute-2
Source.2239: DFBPPR17747 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.2240: DFBPPR17764 ---- Animal proteins ---- L-selectin
Source.2241: DFBPPR17766 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.2242: DFBPPR17772 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.2243: DFBPPR17774 ---- Animal proteins ---- Vasodilator-stimulated phosphoprotein
Source.2244: DFBPPR17778 ---- Animal proteins ---- Integrin alpha-V
Source.2245: DFBPPR17779 ---- Animal proteins ---- Integrin alpha-3
Source.2246: DFBPPR17780 ---- Animal proteins ---- Acetylcholinesterase
Source.2247: DFBPPR17784 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.2248: DFBPPR17788 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.2249: DFBPPR17789 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.2250: DFBPPR17806 ---- Animal proteins ---- Uroplakin-2
Source.2251: DFBPPR17811 ---- Animal proteins ---- YTH domain-containing family protein 2
Source.2252: DFBPPR17818 ---- Animal proteins ---- Endoribonuclease Dicer
Source.2253: DFBPPR17824 ---- Animal proteins ---- Transmembrane emp24 domain-containing protein 9
Source.2254: DFBPPR17825 ---- Animal proteins ---- Thyrotropin receptor
Source.2255: DFBPPR17828 ---- Animal proteins ---- Aromatase
Source.2256: DFBPPR17834 ---- Animal proteins ---- Apolipoprotein D
Source.2257: DFBPPR17836 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 6
Source.2258: DFBPPR17840 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.2259: DFBPPR17841 ---- Animal proteins ---- ER lumen protein-retaining receptor 1
Source.2260: DFBPPR17847 ---- Animal proteins ---- Palmitoyltransferase ZDHHC20
Source.2261: DFBPPR17850 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.2262: DFBPPR17859 ---- Animal proteins ---- Beta-nerve growth factor
Source.2263: DFBPPR17860 ---- Animal proteins ---- Leucine-rich repeat and fibronectin type-III domain-containing protein 3
Source.2264: DFBPPR17861 ---- Animal proteins ---- 3-hydroxyanthranilate 3,4-dioxygenase
Source.2265: DFBPPR17864 ---- Animal proteins ---- ATP-citrate synthase
Source.2266: DFBPPR17878 ---- Animal proteins ---- 4-galactosyl-N-acetylglucosaminide 3-alpha-L-fucosyltransferase 9
Source.2267: DFBPPR17883 ---- Animal proteins ---- Sialidase-1
Source.2268: DFBPPR17891 ---- Animal proteins ---- Intestinal-type alkaline phosphatase
Source.2269: DFBPPR17893 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 3
Source.2270: DFBPPR17897 ---- Animal proteins ---- L-dopachrome tautomerase
Source.2271: DFBPPR17900 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.2272: DFBPPR17906 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.2273: DFBPPR17907 ---- Animal proteins ---- Survival motor neuron protein
Source.2274: DFBPPR17910 ---- Animal proteins ---- Mitogen-activated protein kinase kinase kinase 13
Source.2275: DFBPPR17911 ---- Animal proteins ---- DNA replication licensing factor MCM7
Source.2276: DFBPPR17919 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.2277: DFBPPR17922 ---- Animal proteins ---- Serine/threonine-protein kinase RIO3
Source.2278: DFBPPR17924 ---- Animal proteins ---- Sodium-dependent dopamine transporter
Source.2279: DFBPPR17927 ---- Animal proteins ---- Synaptojanin-1
Source.2280: DFBPPR17931 ---- Animal proteins ---- Alpha-actinin-3
Source.2281: DFBPPR17936 ---- Animal proteins ---- Tyrosine-protein kinase receptor Tie-1
Source.2282: DFBPPR17943 ---- Animal proteins ---- Transport and Golgi organization protein 1 homolog
Source.2283: DFBPPR17944 ---- Animal proteins ---- P-selectin
Source.2284: DFBPPR17946 ---- Animal proteins ---- 6-phosphofructo-2-kinase/fructose-2,6-bisphosphatase 3
Source.2285: DFBPPR17947 ---- Animal proteins ---- Erythropoietin
Source.2286: DFBPPR17959 ---- Animal proteins ---- Atypical chemokine receptor 4
Source.2287: DFBPPR17961 ---- Animal proteins ---- Cyclin-dependent kinase 12
Source.2288: DFBPPR17969 ---- Animal proteins ---- Triosephosphate isomerase
Source.2289: DFBPPR17970 ---- Animal proteins ---- Profilin-2
Source.2290: DFBPPR17975 ---- Animal proteins ---- Peroxisomal N(1)-acetyl-spermine/spermidine oxidase
Source.2291: DFBPPR17977 ---- Animal proteins ---- Collagenase 3
Source.2292: DFBPPR17979 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.2293: DFBPPR17982 ---- Animal proteins ---- Sorting nexin-10
Source.2294: DFBPPR17983 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.2295: DFBPPR17984 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit beta
Source.2296: DFBPPR17990 ---- Animal proteins ---- Nuclear factor erythroid 2-related factor 2
Source.2297: DFBPPR17992 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4B
Source.2298: DFBPPR17995 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.2299: DFBPPR17997 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.2300: DFBPPR17999 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.2301: DFBPPR18002 ---- Animal proteins ---- Toll-like receptor 10
Source.2302: DFBPPR18003 ---- Animal proteins ---- 7-dehydrocholesterol reductase
Source.2303: DFBPPR18004 ---- Animal proteins ---- Phosphate carrier protein, mitochondrial
Source.2304: DFBPPR18010 ---- Animal proteins ---- Acetylcholine receptor subunit epsilon
Source.2305: DFBPPR18012 ---- Animal proteins ---- Neural cell adhesion molecule 1
Source.2306: DFBPPR18020 ---- Animal proteins ---- Integrin beta-5
Source.2307: DFBPPR18021 ---- Animal proteins ---- Lutropin subunit beta
Source.2308: DFBPPR18023 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.2309: DFBPPR18024 ---- Animal proteins ---- Kynurenine--oxoglutarate transaminase 3
Source.2310: DFBPPR18026 ---- Animal proteins ---- Triokinase/FMN cyclase
Source.2311: DFBPPR18030 ---- Animal proteins ---- Neurexin-3-beta
Source.2312: DFBPPR18037 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.2313: DFBPPR18038 ---- Animal proteins ---- Actin-related protein 3
Source.2314: DFBPPR18040 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase F
Source.2315: DFBPPR18042 ---- Animal proteins ---- Acyl-CoA desaturase
Source.2316: DFBPPR18043 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 6
Source.2317: DFBPPR18044 ---- Animal proteins ---- Sorting nexin-5
Source.2318: DFBPPR18053 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.2319: DFBPPR18055 ---- Animal proteins ---- E3 ubiquitin-protein ligase MARCHF8
Source.2320: DFBPPR18056 ---- Animal proteins ---- Tyrosyl-DNA phosphodiesterase 2
Source.2321: DFBPPR18061 ---- Animal proteins ---- Glutathione S-transferase Mu 1
Source.2322: DFBPPR18063 ---- Animal proteins ---- Microtubule-associated protein 1S
Source.2323: DFBPPR18066 ---- Animal proteins ---- DNA nucleotidylexotransferase
Source.2324: DFBPPR18073 ---- Animal proteins ---- Endoplasmic reticulum aminopeptidase 2
Source.2325: DFBPPR18074 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.2326: DFBPPR18077 ---- Animal proteins ---- Gastric triacylglycerol lipase
Source.2327: DFBPPR18082 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.2328: DFBPPR18083 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 1
Source.2329: DFBPPR18085 ---- Animal proteins ---- Staphylococcal nuclease domain-containing protein 1
Source.2330: DFBPPR18100 ---- Animal proteins ---- Derlin-1
Source.2331: DFBPPR18105 ---- Animal proteins ---- Ras GTPase-activating protein 1
Source.2332: DFBPPR18115 ---- Animal proteins ---- Short-wave-sensitive opsin 1
Source.2333: DFBPPR18116 ---- Animal proteins ---- Carbonic anhydrase 4
Source.2334: DFBPPR18117 ---- Animal proteins ---- Matrix metalloproteinase-23
Source.2335: DFBPPR18128 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.2336: DFBPPR18135 ---- Animal proteins ---- Dihydrofolate reductase
Source.2337: DFBPPR18138 ---- Animal proteins ---- AP-1 complex subunit mu-1
Source.2338: DFBPPR18151 ---- Animal proteins ---- Coagulation factor XIII A chain
Source.2339: DFBPPR18154 ---- Animal proteins ---- WD repeat-containing protein 44
Source.2340: DFBPPR18156 ---- Animal proteins ---- Arf-GAP with SH3 domain, ANK repeat and PH domain-containing protein 1
Source.2341: DFBPPR18166 ---- Animal proteins ---- Selenoprotein P
Source.2342: DFBPPR18192 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 2
Source.2343: DFBPPR18193 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.2344: DFBPPR18196 ---- Animal proteins ---- Adhesion G protein-coupled receptor E5
Source.2345: DFBPPR18197 ---- Animal proteins ---- Bax inhibitor 1
Source.2346: DFBPPR18209 ---- Animal proteins ---- Sodium-dependent noradrenaline transporter
Source.2347: DFBPPR18210 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.2348: DFBPPR18217 ---- Animal proteins ---- Alkylated DNA repair protein alkB homolog 8
Source.2349: DFBPPR18219 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.2350: DFBPPR18222 ---- Animal proteins ---- Xylosyltransferase 2
Source.2351: DFBPPR18235 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.2352: DFBPPR18239 ---- Animal proteins ---- Nucleobindin-1
Source.2353: DFBPPR18240 ---- Animal proteins ---- Dual specificity protein kinase CLK3
Source.2354: DFBPPR18242 ---- Animal proteins ---- Heparanase
Source.2355: DFBPPR18244 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.2356: DFBPPR18248 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.2357: DFBPPR18249 ---- Animal proteins ---- Argininosuccinate synthase
Source.2358: DFBPPR18260 ---- Animal proteins ---- 2-oxoglutarate dehydrogenase, mitochondrial
Source.2359: DFBPPR18261 ---- Animal proteins ---- S-adenosylmethionine decarboxylase proenzyme
Source.2360: DFBPPR18269 ---- Animal proteins ---- Coagulation factor XI
Source.2361: DFBPPR18276 ---- Animal proteins ---- 2-hydroxyacyl-CoA lyase 2
Source.2362: DFBPPR18283 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.2363: DFBPPR18289 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 20
Source.2364: DFBPPR18301 ---- Animal proteins ---- SOSS complex subunit B1
Source.2365: DFBPPR18304 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.2366: DFBPPR18305 ---- Animal proteins ---- Aldehyde dehydrogenase X, mitochondrial
Source.2367: DFBPPR18306 ---- Animal proteins ---- Serine/threonine-protein kinase 10
Source.2368: DFBPPR18310 ---- Animal proteins ---- Serine/arginine-rich splicing factor 7
Source.2369: DFBPPR18311 ---- Animal proteins ---- Protein farnesyltransferase/geranylgeranyltransferase type-1 subunit alpha
Source.2370: DFBPPR18315 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.2371: DFBPPR18316 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.2372: DFBPPR18317 ---- Animal proteins ---- G-protein coupled receptor 37-like 1
Source.2373: DFBPPR18319 ---- Animal proteins ---- MMS19 nucleotide excision repair protein homolog
Source.2374: DFBPPR18320 ---- Animal proteins ---- Serine/threonine-protein kinase NLK
Source.2375: DFBPPR18348 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.2376: DFBPPR18352 ---- Animal proteins ---- Proenkephalin-B
Source.2377: DFBPPR18353 ---- Animal proteins ---- Lactosylceramide alpha-2,3-sialyltransferase
Source.2378: DFBPPR18355 ---- Animal proteins ---- Carboxypeptidase Q
Source.2379: DFBPPR18356 ---- Animal proteins ---- Solute carrier family 2, facilitated glucose transporter member 2
Source.2380: DFBPPR18362 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.2381: DFBPPR18369 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.2382: DFBPPR18372 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.2383: DFBPPR18375 ---- Animal proteins ---- Nucleoporin SEH1
Source.2384: DFBPPR18377 ---- Animal proteins ---- Importin subunit alpha-5
Source.2385: DFBPPR18380 ---- Animal proteins ---- Cytosolic carboxypeptidase-like protein 5
Source.2386: DFBPPR18381 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.2387: DFBPPR18390 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.2388: DFBPPR18402 ---- Animal proteins ---- Uromodulin
Source.2389: DFBPPR18403 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.2390: DFBPPR18405 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP10
Source.2391: DFBPPR18410 ---- Animal proteins ---- Thromboxane A2 receptor
Source.2392: DFBPPR18411 ---- Animal proteins ---- Inhibin beta B chain
Source.2393: DFBPPR18414 ---- Animal proteins ---- NADPH--cytochrome P450 reductase
Source.2394: DFBPPR18416 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6
Source.2395: DFBPPR18417 ---- Animal proteins ---- Parathyroid hormone/parathyroid hormone-related peptide receptor
Source.2396: DFBPPR18419 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.2397: DFBPPR18420 ---- Animal proteins ---- Cytochrome P450 2D14
Source.2398: DFBPPR18424 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor type 2
Source.2399: DFBPPR18436 ---- Animal proteins ---- Ubiquitin-conjugating enzyme E2 H
Source.2400: DFBPPR18440 ---- Animal proteins ---- Protein 4.2
Source.2401: DFBPPR18444 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.2402: DFBPPR18446 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.2403: DFBPPR18452 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 22
Source.2404: DFBPPR18463 ---- Animal proteins ---- Secretogranin-2
Source.2405: DFBPPR18464 ---- Animal proteins ---- Regucalcin
Source.2406: DFBPPR18472 ---- Animal proteins ---- P2Y purinoceptor 1
Source.2407: DFBPPR18474 ---- Animal proteins ---- Peroxisomal carnitine O-octanoyltransferase
Source.2408: DFBPPR18483 ---- Animal proteins ---- DNA damage-binding protein 2
Source.2409: DFBPPR18485 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.2410: DFBPPR18491 ---- Animal proteins ---- Cell division cycle 5-like protein
Source.2411: DFBPPR18492 ---- Animal proteins ---- ADP-ribosylation factor-like protein 1
Source.2412: DFBPPR18493 ---- Animal proteins ---- H(+)/Cl(-) exchange transporter 7
Source.2413: DFBPPR18495 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.2414: DFBPPR18499 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.2415: DFBPPR18505 ---- Animal proteins ---- Retinol dehydrogenase 8
Source.2416: DFBPPR18513 ---- Animal proteins ---- Placenta growth factor
Source.2417: DFBPPR18517 ---- Animal proteins ---- Scavenger receptor cysteine-rich type 1 protein M130
Source.2418: DFBPPR18522 ---- Animal proteins ---- POU domain, class 5, transcription factor 1
Source.2419: DFBPPR18523 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.2420: DFBPPR18533 ---- Animal proteins ---- V-type proton ATPase subunit d 1
Source.2421: DFBPPR18536 ---- Animal proteins ---- Plastin-1
Source.2422: DFBPPR18542 ---- Animal proteins ---- Chemokine-like receptor 1
Source.2423: DFBPPR18547 ---- Animal proteins ---- AP-2 complex subunit mu
Source.2424: DFBPPR18550 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.2425: DFBPPR18556 ---- Animal proteins ---- Transketolase
Source.2426: DFBPPR18557 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.2427: DFBPPR18565 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 4
Source.2428: DFBPPR18568 ---- Animal proteins ---- Cdc42 effector protein 2
Source.2429: DFBPPR18574 ---- Animal proteins ---- Stearoyl-CoA desaturase 5
Source.2430: DFBPPR18580 ---- Animal proteins ---- GLIPR1-like protein 1
Source.2431: DFBPPR18582 ---- Animal proteins ---- Retinol-binding protein 3
Source.2432: DFBPPR18583 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.2433: DFBPPR18588 ---- Animal proteins ---- CD166 antigen
Source.2434: DFBPPR18589 ---- Animal proteins ---- Interleukin-13
Source.2435: DFBPPR18606 ---- Animal proteins ---- Transcriptional repressor NF-X1
Source.2436: DFBPPR18608 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.2437: DFBPPR18611 ---- Animal proteins ---- Tribbles homolog 3
Source.2438: DFBPPR18618 ---- Animal proteins ---- AP-2 complex subunit beta
Source.2439: DFBPPR18620 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.2440: DFBPPR18627 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.2441: DFBPPR18636 ---- Animal proteins ---- AP-2 complex subunit alpha-2
Source.2442: DFBPPR18647 ---- Animal proteins ---- Creatine kinase B-type
Source.2443: DFBPPR18653 ---- Animal proteins ---- Palmitoyltransferase ZDHHC21
Source.2444: DFBPPR18673 ---- Animal proteins ---- Isobutyryl-CoA dehydrogenase, mitochondrial
Source.2445: DFBPPR18695 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial
Source.2446: DFBPPR18699 ---- Animal proteins ---- Lysyl oxidase homolog 4
Source.2447: DFBPPR18704 ---- Animal proteins ---- Phosphatidylinositol-3-phosphatase SAC1
Source.2448: DFBPPR18714 ---- Animal proteins ---- Lysosome-associated membrane glycoprotein 5
Source.2449: DFBPPR18716 ---- Animal proteins ---- 2-oxoisovalerate dehydrogenase subunit alpha, mitochondrial
Source.2450: DFBPPR18717 ---- Animal proteins ---- Pituitary adenylate cyclase-activating polypeptide type I receptor
Source.2451: DFBPPR18722 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.2452: DFBPPR18724 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.2453: DFBPPR18730 ---- Animal proteins ---- Eyes absent homolog 2
Source.2454: DFBPPR18733 ---- Animal proteins ---- Hyaluronan synthase 2
Source.2455: DFBPPR18739 ---- Animal proteins ---- Bone morphogenetic protein 3
Source.2456: DFBPPR18741 ---- Animal proteins ---- Coatomer subunit beta'
Source.2457: DFBPPR18744 ---- Animal proteins ---- Oxytocin receptor
Source.2458: DFBPPR18747 ---- Animal proteins ---- Adenosine receptor A1
Source.2459: DFBPPR18751 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.2460: DFBPPR18752 ---- Animal proteins ---- Serine/arginine-rich splicing factor 3
Source.2461: DFBPPR18755 ---- Animal proteins ---- 5-aminolevulinate synthase, erythroid-specific, mitochondrial
Source.2462: DFBPPR18757 ---- Animal proteins ---- Mevalonate kinase
Source.2463: DFBPPR18764 ---- Animal proteins ---- PRA1 family protein 3
Source.2464: DFBPPR18765 ---- Animal proteins ---- Methylosome protein 50
Source.2465: DFBPPR18766 ---- Animal proteins ---- Negative elongation factor E
Source.2466: DFBPPR18802 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.2467: DFBPPR18803 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter B(0)AT2
Source.2468: DFBPPR18804 ---- Animal proteins ---- Importin subunit alpha-8
Source.2469: DFBPPR18806 ---- Animal proteins ---- Pseudouridylate synthase 7 homolog
Source.2470: DFBPPR18812 ---- Animal proteins ---- Vesicle-associated membrane protein 3
Source.2471: DFBPPR18813 ---- Animal proteins ---- Acyl-CoA synthetase short-chain family member 3, mitochondrial
Source.2472: DFBPPR18816 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 1, mitochondrial
Source.2473: DFBPPR18817 ---- Animal proteins ---- Protein argonaute-3
Source.2474: DFBPPR18819 ---- Animal proteins ---- Proteasome activator complex subunit 4
Source.2475: DFBPPR18822 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.2476: DFBPPR18826 ---- Animal proteins ---- Growth/differentiation factor 6
Source.2477: DFBPPR18827 ---- Animal proteins ---- Creatine kinase M-type
Source.2478: DFBPPR18829 ---- Animal proteins ---- Cytochrome b-c1 complex subunit 10
Source.2479: DFBPPR18830 ---- Animal proteins ---- Gamma-secretase subunit PEN-2
Source.2480: DFBPPR18832 ---- Animal proteins ---- Shiftless antiviral inhibitor of ribosomal frameshifting protein homolog
Source.2481: DFBPPR18837 ---- Animal proteins ---- Coatomer subunit alpha
Source.2482: DFBPPR18840 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F
Source.2483: DFBPPR18842 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.2484: DFBPPR18844 ---- Animal proteins ---- Phosphatidylinositol 4-kinase alpha
Source.2485: DFBPPR18846 ---- Animal proteins ---- Sex-determining region Y protein
Source.2486: DFBPPR18856 ---- Animal proteins ---- Synaptic vesicle glycoprotein 2A
Source.2487: DFBPPR18857 ---- Animal proteins ---- RPE-retinal G protein-coupled receptor
Source.2488: DFBPPR18859 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.2489: DFBPPR18863 ---- Animal proteins ---- Testis-specific Y-encoded protein 1
Source.2490: DFBPPR18866 ---- Animal proteins ---- Autophagy-related protein 9A
Source.2491: DFBPPR18867 ---- Animal proteins ---- Tissue alpha-L-fucosidase
Source.2492: DFBPPR18871 ---- Animal proteins ---- Methionine synthase
Source.2493: DFBPPR18878 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.2494: DFBPPR18879 ---- Animal proteins ---- Corrinoid adenosyltransferase
Source.2495: DFBPPR18886 ---- Animal proteins ---- Interleukin-12 receptor subunit beta-2
Source.2496: DFBPPR18888 ---- Animal proteins ---- Glutathione hydrolase 6
Source.2497: DFBPPR18891 ---- Animal proteins ---- Developmentally-regulated GTP-binding protein 2
Source.2498: DFBPPR18900 ---- Animal proteins ---- Uridine 5'-monophosphate synthase
Source.2499: DFBPPR18903 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.2500: DFBPPR18904 ---- Animal proteins ---- Protein KASH5
Source.2501: DFBPPR18907 ---- Animal proteins ---- Recombining binding protein suppressor of hairless
Source.2502: DFBPPR18913 ---- Animal proteins ---- NLR family CARD domain-containing protein 4
Source.2503: DFBPPR18914 ---- Animal proteins ---- Polycomb protein EED
Source.2504: DFBPPR18920 ---- Animal proteins ---- Profilin-1
Source.2505: DFBPPR18922 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.2506: DFBPPR18925 ---- Animal proteins ---- Neurochondrin
Source.2507: DFBPPR18928 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.2508: DFBPPR18941 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.2509: DFBPPR18944 ---- Animal proteins ---- Myotubularin-related protein 9
Source.2510: DFBPPR18947 ---- Animal proteins ---- Thyroid receptor-interacting protein 6
Source.2511: DFBPPR18949 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-2
Source.2512: DFBPPR18950 ---- Animal proteins ---- Proteinase-activated receptor 3
Source.2513: DFBPPR18951 ---- Animal proteins ---- DNA excision repair protein ERCC-8
Source.2514: DFBPPR18954 ---- Animal proteins ---- Putative RNA polymerase II subunit B1 CTD phosphatase RPAP2
Source.2515: DFBPPR18959 ---- Animal proteins ---- Galactose mutarotase
Source.2516: DFBPPR18961 ---- Animal proteins ---- Transmembrane protein 184A
Source.2517: DFBPPR18962 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.2518: DFBPPR18963 ---- Animal proteins ---- F-box/WD repeat-containing protein 7
Source.2519: DFBPPR18969 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.2520: DFBPPR18983 ---- Animal proteins ---- Endothelial protein C receptor
Source.2521: DFBPPR18985 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.2522: DFBPPR18997 ---- Animal proteins ---- Striatin-3
Source.2523: DFBPPR19007 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1
Source.2524: DFBPPR19021 ---- Animal proteins ---- Methanethiol oxidase
Source.2525: DFBPPR19026 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG1
Source.2526: DFBPPR19038 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.2527: DFBPPR19043 ---- Animal proteins ---- Threonine--tRNA ligase 1, cytoplasmic
Source.2528: DFBPPR19068 ---- Animal proteins ---- CXXC-type zinc finger protein 1
Source.2529: DFBPPR19070 ---- Animal proteins ---- Scavenger receptor class A member 5
Source.2530: DFBPPR19077 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 1
Source.2531: DFBPPR19086 ---- Animal proteins ---- Leucine-rich repeat transmembrane neuronal protein 1
Source.2532: DFBPPR19087 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.2533: DFBPPR19088 ---- Animal proteins ---- ATP-dependent RNA helicase DDX19A
Source.2534: DFBPPR19101 ---- Animal proteins ---- DNA polymerase subunit gamma-2, mitochondrial
Source.2535: DFBPPR19109 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.2536: DFBPPR19115 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.2537: DFBPPR19119 ---- Animal proteins ---- Phospholipase D2
Source.2538: DFBPPR19120 ---- Animal proteins ---- Collagen alpha-1(X) chain
Source.2539: DFBPPR19121 ---- Animal proteins ---- Adhesion G-protein coupled receptor D1
Source.2540: DFBPPR19122 ---- Animal proteins ---- Carbonic anhydrase 3
Source.2541: DFBPPR19128 ---- Animal proteins ---- Spermadhesin-1
Source.2542: DFBPPR19137 ---- Animal proteins ---- Serpin H1
Source.2543: DFBPPR19138 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase E
Source.2544: DFBPPR19141 ---- Animal proteins ---- Target of rapamycin complex subunit LST8
Source.2545: DFBPPR19153 ---- Animal proteins ---- Copine-6
Source.2546: DFBPPR19154 ---- Animal proteins ---- Cytoplasmic dynein 1 intermediate chain 2
Source.2547: DFBPPR19161 ---- Animal proteins ---- Anaphase-promoting complex subunit 11
Source.2548: DFBPPR19167 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A regulatory subunit B'' subunit gamma
Source.2549: DFBPPR19177 ---- Animal proteins ---- Peroxisomal membrane protein PEX16
Source.2550: DFBPPR19178 ---- Animal proteins ---- Sodium-dependent neutral amino acid transporter SLC6A17
Source.2551: DFBPPR19183 ---- Animal proteins ---- Testis anion transporter 1
Source.2552: DFBPPR19195 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a2
Source.2553: DFBPPR19199 ---- Animal proteins ---- Integrin alpha-5
Source.2554: DFBPPR19201 ---- Animal proteins ---- 3-oxoacyl-[acyl-carrier-protein] synthase, mitochondrial
Source.2555: DFBPPR19207 ---- Animal proteins ---- Putative sodium-coupled neutral amino acid transporter 7
Source.2556: DFBPPR19215 ---- Animal proteins ---- Dysferlin
Source.2557: DFBPPR19216 ---- Animal proteins ---- Cysteine protease ATG4B
Source.2558: DFBPPR19217 ---- Animal proteins ---- Pre-mRNA-processing factor 6
Source.2559: DFBPPR19218 ---- Animal proteins ---- Mitotic checkpoint protein BUB3
Source.2560: DFBPPR19220 ---- Animal proteins ---- Nicotinate phosphoribosyltransferase
Source.2561: DFBPPR19221 ---- Animal proteins ---- Rabphilin-3A
Source.2562: DFBPPR19225 ---- Animal proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase
Source.2563: DFBPPR19226 ---- Animal proteins ---- Caseinolytic peptidase B protein homolog
Source.2564: DFBPPR19229 ---- Animal proteins ---- Interferon alpha-F
Source.2565: DFBPPR19230 ---- Animal proteins ---- Interferon alpha-G
Source.2566: DFBPPR19231 ---- Animal proteins ---- S-phase kinase-associated protein 1
Source.2567: DFBPPR19237 ---- Animal proteins ---- Cadherin-18
Source.2568: DFBPPR19238 ---- Animal proteins ---- E3 ubiquitin-protein ligase RNF128
Source.2569: DFBPPR19241 ---- Animal proteins ---- Gap junction beta-1 protein
Source.2570: DFBPPR19250 ---- Animal proteins ---- Brevican core protein
Source.2571: DFBPPR19251 ---- Animal proteins ---- Leucine-rich repeat-containing G-protein coupled receptor 5
Source.2572: DFBPPR19255 ---- Animal proteins ---- Neutrophil cytosol factor 2
Source.2573: DFBPPR19259 ---- Animal proteins ---- Protein transport protein Sec16B
Source.2574: DFBPPR19264 ---- Animal proteins ---- Claudin-16
Source.2575: DFBPPR19265 ---- Animal proteins ---- 28S ribosomal protein S29, mitochondrial
Source.2576: DFBPPR19266 ---- Animal proteins ---- Ubiquitin/ISG15-conjugating enzyme E2 L6
Source.2577: DFBPPR19270 ---- Animal proteins ---- Zinc transporter ZIP4
Source.2578: DFBPPR19283 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.2579: DFBPPR19285 ---- Animal proteins ---- Delta-1-pyrroline-5-carboxylate dehydrogenase, mitochondrial
Source.2580: DFBPPR19286 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.2581: DFBPPR19289 ---- Animal proteins ---- Somatostatin receptor type 5
Source.2582: DFBPPR19294 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I
Source.2583: DFBPPR19296 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein B
Source.2584: DFBPPR19298 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.2585: DFBPPR19314 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IIB
Source.2586: DFBPPR19320 ---- Animal proteins ---- Palmitoyl-protein thioesterase ABHD10, mitochondrial
Source.2587: DFBPPR19324 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.2588: DFBPPR19325 ---- Animal proteins ---- Transketolase-like protein 1
Source.2589: DFBPPR19329 ---- Animal proteins ---- CD302 antigen
Source.2590: DFBPPR19334 ---- Animal proteins ---- Lysosomal acid phosphatase
Source.2591: DFBPPR19335 ---- Animal proteins ---- Dynein intermediate chain 1, axonemal
Source.2592: DFBPPR19340 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.2593: DFBPPR19359 ---- Animal proteins ---- Spartin
Source.2594: DFBPPR19363 ---- Animal proteins ---- Ethanolaminephosphotransferase 1
Source.2595: DFBPPR19365 ---- Animal proteins ---- Inactive rhomboid protein 1
Source.2596: DFBPPR19367 ---- Animal proteins ---- Atypical chemokine receptor 1
Source.2597: DFBPPR19370 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.2598: DFBPPR19379 ---- Animal proteins ---- Advanced glycosylation end product-specific receptor
Source.2599: DFBPPR19384 ---- Animal proteins ---- Complement component C9
Source.2600: DFBPPR19389 ---- Animal proteins ---- Small nuclear ribonucleoprotein E
Source.2601: DFBPPR19391 ---- Animal proteins ---- Vesicle-associated membrane protein-associated protein A
Source.2602: DFBPPR19392 ---- Animal proteins ---- Mitochondrial enolase superfamily member 1
Source.2603: DFBPPR19401 ---- Animal proteins ---- Small integral membrane protein 20
Source.2604: DFBPPR19402 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.2605: DFBPPR19408 ---- Animal proteins ---- Tumor protein p63-regulated gene 1-like protein
Source.2606: DFBPPR19414 ---- Animal proteins ---- Exocyst complex component 8
Source.2607: DFBPPR19416 ---- Animal proteins ---- Gamma-glutamyl hydrolase
Source.2608: DFBPPR19421 ---- Animal proteins ---- Zinc finger-containing ubiquitin peptidase 1
Source.2609: DFBPPR19423 ---- Animal proteins ---- RILP-like protein 1
Source.2610: DFBPPR19426 ---- Animal proteins ---- Neurosecretory protein VGF
Source.2611: DFBPPR19428 ---- Animal proteins ---- CAAX prenyl protease 2
Source.2612: DFBPPR19430 ---- Animal proteins ---- Aryl-hydrocarbon-interacting protein-like 1
Source.2613: DFBPPR19432 ---- Animal proteins ---- ATP synthase subunit ATP5MPL, mitochondrial
Source.2614: DFBPPR19435 ---- Animal proteins ---- Interferon alpha-D
Source.2615: DFBPPR19447 ---- Animal proteins ---- Cytochrome b561 domain-containing protein 2
Source.2616: DFBPPR19448 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.2617: DFBPPR19449 ---- Animal proteins ---- SCO-spondin
Source.2618: DFBPPR19454 ---- Animal proteins ---- Acetylserotonin O-methyltransferase
Source.2619: DFBPPR19455 ---- Animal proteins ---- Tropomodulin-1
Source.2620: DFBPPR19466 ---- Animal proteins ---- N-acylglucosamine 2-epimerase
Source.2621: DFBPPR19467 ---- Animal proteins ---- Integral membrane protein GPR137
Source.2622: DFBPPR19469 ---- Animal proteins ---- Cholinesterase
Source.2623: DFBPPR19471 ---- Animal proteins ---- Ribosome biogenesis protein WDR12
Source.2624: DFBPPR19474 ---- Animal proteins ---- Procollagen-lysine,2-oxoglutarate 5-dioxygenase 1
Source.2625: DFBPPR19475 ---- Animal proteins ---- Coronin-7
Source.2626: DFBPPR19487 ---- Animal proteins ---- Protein disulfide isomerase CRELD1
Source.2627: DFBPPR19489 ---- Animal proteins ---- Keratocan
Source.2628: DFBPPR19492 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 4
Source.2629: DFBPPR19497 ---- Animal proteins ---- G1/S-specific cyclin-E2
Source.2630: DFBPPR19500 ---- Animal proteins ---- Complement C2
Source.2631: DFBPPR19504 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.2632: DFBPPR19510 ---- Animal proteins ---- Transportin-1
Source.2633: DFBPPR19511 ---- Animal proteins ---- Citrate synthase, mitochondrial
Source.2634: DFBPPR19513 ---- Animal proteins ---- Homeobox protein EMX2
Source.2635: DFBPPR19515 ---- Animal proteins ---- Protein strawberry notch homolog 2
Source.2636: DFBPPR19525 ---- Animal proteins ---- Tomoregulin-2
Source.2637: DFBPPR19526 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase E
Source.2638: DFBPPR19527 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 15A
Source.2639: DFBPPR19528 ---- Animal proteins ---- Methionine--tRNA ligase, cytoplasmic
Source.2640: DFBPPR19543 ---- Animal proteins ---- Protein transport protein Sec23A
Source.2641: DFBPPR19551 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.2642: DFBPPR19554 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.2643: DFBPPR19556 ---- Animal proteins ---- Suppressor of tumorigenicity 14 protein homolog
Source.2644: DFBPPR19560 ---- Animal proteins ---- Protein transport protein Sec23B
Source.2645: DFBPPR19562 ---- Animal proteins ---- Ubiquinone biosynthesis monooxygenase COQ6, mitochondrial
Source.2646: DFBPPR19563 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit K
Source.2647: DFBPPR19569 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.2648: DFBPPR19570 ---- Animal proteins ---- Transmembrane protein 8B
Source.2649: DFBPPR19573 ---- Animal proteins ---- F-box only protein 7
Source.2650: DFBPPR19576 ---- Animal proteins ---- TBC1 domain family member 20
Source.2651: DFBPPR19579 ---- Animal proteins ---- Sodium- and chloride-dependent GABA transporter 2
Source.2652: DFBPPR19583 ---- Animal proteins ---- Orexin receptor type 1
Source.2653: DFBPPR19584 ---- Animal proteins ---- Xaa-Pro aminopeptidase 1
Source.2654: DFBPPR19585 ---- Animal proteins ---- Interferon alpha-1
Source.2655: DFBPPR19591 ---- Animal proteins ---- Phosphorylated adapter RNA export protein
Source.2656: DFBPPR19604 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21C
Source.2657: DFBPPR19605 ---- Animal proteins ---- Hepatocyte growth factor-like protein
Source.2658: DFBPPR19608 ---- Animal proteins ---- Anoctamin-4
Source.2659: DFBPPR19609 ---- Animal proteins ---- Chemokine C-C motif receptor-like 2
Source.2660: DFBPPR19612 ---- Animal proteins ---- Lysosomal-trafficking regulator
Source.2661: DFBPPR19617 ---- Animal proteins ---- Suppressor of cytokine signaling 2
Source.2662: DFBPPR19630 ---- Animal proteins ---- Glycerol kinase
Source.2663: DFBPPR19647 ---- Animal proteins ---- Sorting nexin-4
Source.2664: DFBPPR19652 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.2665: DFBPPR19657 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.2666: DFBPPR19658 ---- Animal proteins ---- Sodium-independent sulfate anion transporter
Source.2667: DFBPPR19660 ---- Animal proteins ---- Phosphorylase b kinase gamma catalytic chain, liver/testis isoform
Source.2668: DFBPPR19661 ---- Animal proteins ---- Golgi pH regulator
Source.2669: DFBPPR19664 ---- Animal proteins ---- Protein OS-9
Source.2670: DFBPPR19666 ---- Animal proteins ---- Forkhead box protein P1
Source.2671: DFBPPR19672 ---- Animal proteins ---- Gap junction beta-6 protein
Source.2672: DFBPPR19673 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase
Source.2673: DFBPPR19682 ---- Animal proteins ---- F-box only protein 2
Source.2674: DFBPPR19685 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.2675: DFBPPR19688 ---- Animal proteins ---- TBC1 domain family member 2A
Source.2676: DFBPPR19691 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-1
Source.2677: DFBPPR19694 ---- Animal proteins ---- Palmitoyltransferase ZDHHC4
Source.2678: DFBPPR19697 ---- Animal proteins ---- Sodium/myo-inositol cotransporter
Source.2679: DFBPPR19710 ---- Animal proteins ---- Beta-galactosidase
Source.2680: DFBPPR19721 ---- Animal proteins ---- G-protein coupled receptor 4
Source.2681: DFBPPR19774 ---- Animal proteins ---- ATP-dependent RNA helicase DDX25
Source.2682: DFBPPR19775 ---- Animal proteins ---- Cytochrome P450 2U1
Source.2683: DFBPPR19778 ---- Animal proteins ---- Sodium- and chloride-dependent taurine transporter
Source.2684: DFBPPR19786 ---- Animal proteins ---- Chorionic somatomammotropin hormone 1
Source.2685: DFBPPR19793 ---- Animal proteins ---- Cyclin-F
Source.2686: DFBPPR19807 ---- Animal proteins ---- Spermine synthase
Source.2687: DFBPPR19810 ---- Animal proteins ---- Seipin
Source.2688: DFBPPR19818 ---- Animal proteins ---- Protein YIPF6
Source.2689: DFBPPR19824 ---- Animal proteins ---- Glutaminyl-peptide cyclotransferase-like protein
Source.2690: DFBPPR19827 ---- Animal proteins ---- Visual system homeobox 1
Source.2691: DFBPPR19832 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.2692: DFBPPR19833 ---- Animal proteins ---- Contactin-1
Source.2693: DFBPPR19847 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit C
Source.2694: DFBPPR19851 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.2695: DFBPPR19858 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A
Source.2696: DFBPPR19860 ---- Animal proteins ---- Transketolase-like protein 2
Source.2697: DFBPPR19862 ---- Animal proteins ---- Splicing factor 3B subunit 3
Source.2698: DFBPPR19863 ---- Animal proteins ---- Dihydropteridine reductase
Source.2699: DFBPPR19865 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.2700: DFBPPR19866 ---- Animal proteins ---- Actin-related protein 8
Source.2701: DFBPPR19868 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H1
Source.2702: DFBPPR19872 ---- Animal proteins ---- Glucose-6-phosphatase 3
Source.2703: DFBPPR19873 ---- Animal proteins ---- Syntaxin-8
Source.2704: DFBPPR19879 ---- Animal proteins ---- TBC1 domain family member 14
Source.2705: DFBPPR19883 ---- Animal proteins ---- N-arachidonyl glycine receptor
Source.2706: DFBPPR19887 ---- Animal proteins ---- Tribbles homolog 2
Source.2707: DFBPPR19897 ---- Animal proteins ---- 39S ribosomal protein L51, mitochondrial
Source.2708: DFBPPR19899 ---- Animal proteins ---- Receptor expression-enhancing protein 6
Source.2709: DFBPPR19901 ---- Animal proteins ---- Aspartate--tRNA ligase, cytoplasmic
Source.2710: DFBPPR19902 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.2711: DFBPPR19906 ---- Animal proteins ---- Deoxyribose-phosphate aldolase
Source.2712: DFBPPR19907 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.2713: DFBPPR19910 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.2714: DFBPPR19918 ---- Animal proteins ---- Histidine--tRNA ligase, mitochondrial
Source.2715: DFBPPR19919 ---- Animal proteins ---- Tripeptidyl-peptidase 2
Source.2716: DFBPPR19923 ---- Animal proteins ---- Metastasis-associated protein MTA3
Source.2717: DFBPPR19925 ---- Animal proteins ---- Complement factor H
Source.2718: DFBPPR19929 ---- Animal proteins ---- Ermin
Source.2719: DFBPPR19933 ---- Animal proteins ---- Oligoribonuclease, mitochondrial
Source.2720: DFBPPR19951 ---- Animal proteins ---- Somatostatin receptor type 2
Source.2721: DFBPPR19953 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.2722: DFBPPR19954 ---- Animal proteins ---- Glutamate-rich WD repeat-containing protein 1
Source.2723: DFBPPR19957 ---- Animal proteins ---- Gap junction beta-2 protein
Source.2724: DFBPPR19963 ---- Animal proteins ---- DnaJ homolog subfamily C member 14
Source.2725: DFBPPR19971 ---- Animal proteins ---- Cathepsin Z
Source.2726: DFBPPR19973 ---- Animal proteins ---- Plastin-3
Source.2727: DFBPPR19981 ---- Animal proteins ---- Zinc finger protein AEBP2
Source.2728: DFBPPR19982 ---- Animal proteins ---- 3'(2'),5'-bisphosphate nucleotidase 1
Source.2729: DFBPPR19983 ---- Animal proteins ---- G-protein coupled receptor 39
Source.2730: DFBPPR19984 ---- Animal proteins ---- Angiopoietin-related protein 7
Source.2731: DFBPPR19985 ---- Animal proteins ---- Prokineticin receptor 2
Source.2732: DFBPPR19988 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase MINDY-3
Source.2733: DFBPPR19990 ---- Animal proteins ---- Synaptonemal complex protein 3
Source.2734: DFBPPR19991 ---- Animal proteins ---- F-box/LRR-repeat protein 5
Source.2735: DFBPPR20005 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.2736: DFBPPR20008 ---- Animal proteins ---- Serine incorporator 3
Source.2737: DFBPPR20014 ---- Animal proteins ---- Transcription factor COE2
Source.2738: DFBPPR20017 ---- Animal proteins ---- Lysoplasmalogenase
Source.2739: DFBPPR20023 ---- Animal proteins ---- Cysteine and glycine-rich protein 2
Source.2740: DFBPPR20024 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.2741: DFBPPR20025 ---- Animal proteins ---- Importin subunit alpha-7
Source.2742: DFBPPR20029 ---- Animal proteins ---- Sodium- and chloride-dependent glycine transporter 1
Source.2743: DFBPPR20039 ---- Animal proteins ---- N-acetylglucosamine-6-phosphate deacetylase
Source.2744: DFBPPR20042 ---- Animal proteins ---- Neuroendocrine convertase 1
Source.2745: DFBPPR20055 ---- Animal proteins ---- Myelin protein zero-like protein 1
Source.2746: DFBPPR20068 ---- Animal proteins ---- H2.0-like homeobox protein
Source.2747: DFBPPR20070 ---- Animal proteins ---- Dual specificity protein phosphatase 26
Source.2748: DFBPPR20076 ---- Animal proteins ---- General transcription factor IIF subunit 2
Source.2749: DFBPPR20077 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.2750: DFBPPR20079 ---- Animal proteins ---- Nuclear pore complex protein Nup93
Source.2751: DFBPPR20082 ---- Animal proteins ---- Calcium-binding and coiled-coil domain-containing protein 1
Source.2752: DFBPPR20089 ---- Animal proteins ---- Fascin-2
Source.2753: DFBPPR20095 ---- Animal proteins ---- Putative histone-lysine N-methyltransferase PRDM6
Source.2754: DFBPPR20097 ---- Animal proteins ---- AP-1 complex subunit beta-1
Source.2755: DFBPPR20099 ---- Animal proteins ---- tRNA (guanine-N(7)-)-methyltransferase non-catalytic subunit WDR4
Source.2756: DFBPPR20103 ---- Animal proteins ---- Protein MAL2
Source.2757: DFBPPR20112 ---- Animal proteins ---- Proteasome assembly chaperone 1
Source.2758: DFBPPR20119 ---- Animal proteins ---- Cathepsin L2
Source.2759: DFBPPR20129 ---- Animal proteins ---- 2-aminomuconic semialdehyde dehydrogenase
Source.2760: DFBPPR20131 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.2761: DFBPPR20141 ---- Animal proteins ---- Paired box protein Pax-6
Source.2762: DFBPPR20147 ---- Animal proteins ---- Serine incorporator 1
Source.2763: DFBPPR20153 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.2764: DFBPPR20156 ---- Animal proteins ---- Peptidyl-prolyl cis-trans isomerase FKBP9
Source.2765: DFBPPR20157 ---- Animal proteins ---- Hydroxyproline dehydrogenase
Source.2766: DFBPPR20160 ---- Animal proteins ---- Angio-associated migratory cell protein
Source.2767: DFBPPR20162 ---- Animal proteins ---- Periodic tryptophan protein 1 homolog
Source.2768: DFBPPR20178 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.2769: DFBPPR20179 ---- Animal proteins ---- Methylthioribose-1-phosphate isomerase
Source.2770: DFBPPR20181 ---- Animal proteins ---- Choline transporter-like protein 2
Source.2771: DFBPPR20202 ---- Animal proteins ---- Acyl-coenzyme A thioesterase 9, mitochondrial
Source.2772: DFBPPR20207 ---- Animal proteins ---- Protein YIF1A
Source.2773: DFBPPR20209 ---- Animal proteins ---- Ran-specific GTPase-activating protein
Source.2774: DFBPPR20211 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1B
Source.2775: DFBPPR20220 ---- Animal proteins ---- Endosome/lysosome-associated apoptosis and autophagy regulator family member 2
Source.2776: DFBPPR20222 ---- Animal proteins ---- Kelch-like protein 12
Source.2777: DFBPPR20227 ---- Animal proteins ---- 2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline decarboxylase
Source.2778: DFBPPR20234 ---- Animal proteins ---- Argininosuccinate lyase
Source.2779: DFBPPR20244 ---- Animal proteins ---- Zinc finger FYVE domain-containing protein 26
Source.2780: DFBPPR20246 ---- Animal proteins ---- Epsilon-sarcoglycan
Source.2781: DFBPPR20248 ---- Animal proteins ---- Ras-related protein Rab-28
Source.2782: DFBPPR20253 ---- Animal proteins ---- Cysteine protease ATG4A
Source.2783: DFBPPR20258 ---- Animal proteins ---- Ribosome biogenesis regulatory protein homolog
Source.2784: DFBPPR20261 ---- Animal proteins ---- Protein SCO1 homolog, mitochondrial
Source.2785: DFBPPR20271 ---- Animal proteins ---- EEF1A lysine methyltransferase 3
Source.2786: DFBPPR20272 ---- Animal proteins ---- Fatty acyl-CoA reductase 2
Source.2787: DFBPPR20274 ---- Animal proteins ---- Phospholipase A1 member A
Source.2788: DFBPPR20275 ---- Animal proteins ---- Malonate--CoA ligase ACSF3, mitochondrial
Source.2789: DFBPPR20277 ---- Animal proteins ---- Transmembrane protein 214
Source.2790: DFBPPR20280 ---- Animal proteins ---- Sodium-dependent phosphate transporter 2
Source.2791: DFBPPR20282 ---- Animal proteins ---- SOSS complex subunit B2
Source.2792: DFBPPR20287 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 4
Source.2793: DFBPPR20291 ---- Animal proteins ---- Cone-rod homeobox protein
Source.2794: DFBPPR20294 ---- Animal proteins ---- Ion channel TACAN
Source.2795: DFBPPR20299 ---- Animal proteins ---- AP-5 complex subunit mu-1
Source.2796: DFBPPR20308 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.2797: DFBPPR20310 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2
Source.2798: DFBPPR20313 ---- Animal proteins ---- 40S ribosomal protein S9
Source.2799: DFBPPR20317 ---- Animal proteins ---- Cadherin-13
Source.2800: DFBPPR20320 ---- Animal proteins ---- Neuropeptides B/W receptor type 2
Source.2801: DFBPPR20321 ---- Animal proteins ---- Heat shock protein 105 kDa
Source.2802: DFBPPR20322 ---- Animal proteins ---- GTPase Era, mitochondrial
Source.2803: DFBPPR20327 ---- Animal proteins ---- 28S ribosomal protein S5, mitochondrial
Source.2804: DFBPPR20329 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.2805: DFBPPR20334 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.2806: DFBPPR20338 ---- Animal proteins ---- Equilibrative nucleoside transporter 3
Source.2807: DFBPPR20349 ---- Animal proteins ---- Lysosomal protective protein
Source.2808: DFBPPR20355 ---- Animal proteins ---- RING finger protein 10
Source.2809: DFBPPR20370 ---- Animal proteins ---- 28S ribosomal protein S35, mitochondrial
Source.2810: DFBPPR20376 ---- Animal proteins ---- Cytoplasmic tRNA 2-thiolation protein 2
Source.2811: DFBPPR20380 ---- Animal proteins ---- Signal recognition particle receptor subunit alpha
Source.2812: DFBPPR20382 ---- Animal proteins ---- Ewing's tumor-associated antigen 1 homolog
Source.2813: DFBPPR20385 ---- Animal proteins ---- UDP-N-acetylglucosamine transporter
Source.2814: DFBPPR20389 ---- Animal proteins ---- Leucine-rich repeat-containing protein 7
Source.2815: DFBPPR20390 ---- Animal proteins ---- Neuropeptides B/W receptor type 1
Source.2816: DFBPPR20393 ---- Animal proteins ---- Putative nuclease HARBI1
Source.2817: DFBPPR20397 ---- Animal proteins ---- Medium-chain acyl-CoA ligase ACSF2, mitochondrial
Source.2818: DFBPPR20398 ---- Animal proteins ---- Porphobilinogen deaminase
Source.2819: DFBPPR20405 ---- Animal proteins ---- Oxygen-regulated protein 1
Source.2820: DFBPPR20407 ---- Animal proteins ---- Phosphatidylinositol 3-kinase regulatory subunit gamma
Source.2821: DFBPPR20414 ---- Animal proteins ---- 39S ribosomal protein L3, mitochondrial
Source.2822: DFBPPR20416 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.2823: DFBPPR20421 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.2824: DFBPPR20422 ---- Animal proteins ---- WD repeat-containing protein 61
Source.2825: DFBPPR20426 ---- Animal proteins ---- Thimet oligopeptidase
Source.2826: DFBPPR20427 ---- Animal proteins ---- Mitochondria-eating protein
Source.2827: DFBPPR20428 ---- Animal proteins ---- Rab effector Noc2
Source.2828: DFBPPR20434 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 1
Source.2829: DFBPPR20439 ---- Animal proteins ---- T-cell surface protein tactile
Source.2830: DFBPPR20444 ---- Animal proteins ---- Ribonuclease P/MRP protein subunit POP5
Source.2831: DFBPPR20448 ---- Animal proteins ---- Triggering receptor expressed on myeloid cells 1
Source.2832: DFBPPR20450 ---- Animal proteins ---- Neurotrophin receptor-interacting factor homolog
Source.2833: DFBPPR20451 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.2834: DFBPPR20464 ---- Animal proteins ---- Protein phosphatase 1 regulatory subunit 3C
Source.2835: DFBPPR20467 ---- Animal proteins ---- Tetranectin
Source.2836: DFBPPR20478 ---- Animal proteins ---- Macoilin
Source.2837: DFBPPR20490 ---- Animal proteins ---- Ornithine aminotransferase, mitochondrial
Source.2838: DFBPPR20496 ---- Animal proteins ---- Inactive C-alpha-formylglycine-generating enzyme 2
Source.2839: DFBPPR20499 ---- Animal proteins ---- Transmembrane protein 102
Source.2840: DFBPPR20500 ---- Animal proteins ---- Zinc transporter ZIP1
Source.2841: DFBPPR20507 ---- Animal proteins ---- G protein-coupled receptor 161
Source.2842: DFBPPR20508 ---- Animal proteins ---- Aurora kinase A and ninein-interacting protein
Source.2843: DFBPPR20510 ---- Animal proteins ---- Josephin-1
Source.2844: DFBPPR20521 ---- Animal proteins ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.2845: DFBPPR20523 ---- Animal proteins ---- Vacuolar protein-sorting-associated protein 36
Source.2846: DFBPPR20525 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC6
Source.2847: DFBPPR20526 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.2848: DFBPPR20529 ---- Animal proteins ---- Transgelin
Source.2849: DFBPPR20532 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.2850: DFBPPR20535 ---- Animal proteins ---- FAD-dependent oxidoreductase domain-containing protein 1
Source.2851: DFBPPR20542 ---- Animal proteins ---- ADP-ribosylation factor 2
Source.2852: DFBPPR20543 ---- Animal proteins ---- Procollagen galactosyltransferase 1
Source.2853: DFBPPR20554 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp4
Source.2854: DFBPPR20558 ---- Animal proteins ---- N-acetylglucosaminyl-phosphatidylinositol de-N-acetylase
Source.2855: DFBPPR20559 ---- Animal proteins ---- Tricarboxylate transport protein, mitochondrial
Source.2856: DFBPPR20560 ---- Animal proteins ---- Draxin
Source.2857: DFBPPR20562 ---- Animal proteins ---- 12S rRNA N4-methylcytidine methyltransferase
Source.2858: DFBPPR20563 ---- Animal proteins ---- ADP-ribosylation factor-like protein 4D
Source.2859: DFBPPR20565 ---- Animal proteins ---- Prokineticin receptor 1
Source.2860: DFBPPR20566 ---- Animal proteins ---- RecQ-mediated genome instability protein 2
Source.2861: DFBPPR20575 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.2862: DFBPPR20577 ---- Animal proteins ---- Inositol 1,4,5-trisphosphate receptor-interacting protein
Source.2863: DFBPPR20582 ---- Animal proteins ---- Vacuolar protein sorting-associated protein 16 homolog
Source.2864: DFBPPR20591 ---- Animal proteins ---- WD repeat-containing protein 74
Source.2865: DFBPPR20592 ---- Animal proteins ---- Protein Hikeshi
Source.2866: DFBPPR20599 ---- Animal proteins ---- Cleavage and polyadenylation specificity factor subunit 1
Source.2867: DFBPPR20602 ---- Animal proteins ---- Interferon regulatory factor 6
Source.2868: DFBPPR20605 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.2869: DFBPPR20612 ---- Animal proteins ---- Dolichol kinase
Source.2870: DFBPPR20614 ---- Animal proteins ---- Xylulose kinase
Source.2871: DFBPPR20615 ---- Animal proteins ---- Seizure 6-like protein 2
Source.2872: DFBPPR20618 ---- Animal proteins ---- Large subunit GTPase 1 homolog
Source.2873: DFBPPR20619 ---- Animal proteins ---- Extracellular matrix protein 2
Source.2874: DFBPPR20622 ---- Animal proteins ---- Tetraspanin-5
Source.2875: DFBPPR20623 ---- Animal proteins ---- Retina and anterior neural fold homeobox protein 2
Source.2876: DFBPPR20625 ---- Animal proteins ---- DIS3-like exonuclease 1
Source.2877: DFBPPR20636 ---- Animal proteins ---- Transforming growth factor-beta receptor-associated protein 1
Source.2878: DFBPPR20643 ---- Animal proteins ---- Fibrinogen-like protein 1
Source.2879: DFBPPR20649 ---- Animal proteins ---- Methylmalonyl-CoA epimerase, mitochondrial
Source.2880: DFBPPR20650 ---- Animal proteins ---- WD repeat-containing protein 91
Source.2881: DFBPPR20653 ---- Animal proteins ---- Carboxylesterase 4A
Source.2882: DFBPPR20655 ---- Animal proteins ---- Adenosine deaminase-like protein
Source.2883: DFBPPR20658 ---- Animal proteins ---- G-protein coupled receptor family C group 5 member C
Source.2884: DFBPPR20660 ---- Animal proteins ---- ADP-ribosylation factor 3
Source.2885: DFBPPR20661 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.2886: DFBPPR20662 ---- Animal proteins ---- C4b-binding protein alpha chain
Source.2887: DFBPPR20663 ---- Animal proteins ---- Gap junction beta-3 protein
Source.2888: DFBPPR20665 ---- Animal proteins ---- PWWP domain-containing DNA repair factor 3A
Source.2889: DFBPPR20667 ---- Animal proteins ---- 39S ribosomal protein L13, mitochondrial
Source.2890: DFBPPR20680 ---- Animal proteins ---- Lysophosphatidic acid receptor 5
Source.2891: DFBPPR20686 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.2892: DFBPPR20693 ---- Animal proteins ---- Tetraspanin-12
Source.2893: DFBPPR20694 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.2894: DFBPPR20696 ---- Animal proteins ---- Protein shisa-2 homolog
Source.2895: DFBPPR20705 ---- Animal proteins ---- Anaphase-promoting complex subunit 10
Source.2896: DFBPPR20709 ---- Animal proteins ---- Proline-rich protein 5-like
Source.2897: DFBPPR20710 ---- Animal proteins ---- BMP/retinoic acid-inducible neural-specific protein 1
Source.2898: DFBPPR20714 ---- Animal proteins ---- Phosphomevalonate kinase
Source.2899: DFBPPR20715 ---- Animal proteins ---- SLAIN motif-containing protein 2
Source.2900: DFBPPR20722 ---- Animal proteins ---- Serine beta-lactamase-like protein LACTB, mitochondrial
Source.2901: DFBPPR20731 ---- Animal proteins ---- Protein transport protein Sec61 subunit alpha isoform 2
Source.2902: DFBPPR20733 ---- Animal proteins ---- Integrator complex subunit 12
Source.2903: DFBPPR20734 ---- Animal proteins ---- Probable imidazolonepropionase
Source.2904: DFBPPR20746 ---- Animal proteins ---- Fibronectin type III and SPRY domain-containing protein 1
Source.2905: DFBPPR20751 ---- Animal proteins ---- Sorting and assembly machinery component 50 homolog
Source.2906: DFBPPR20755 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 7
Source.2907: DFBPPR20757 ---- Animal proteins ---- F-box only protein 9
Source.2908: DFBPPR20758 ---- Animal proteins ---- Exosome complex component RRP45
Source.2909: DFBPPR20767 ---- Animal proteins ---- GTP cyclohydrolase 1 feedback regulatory protein
Source.2910: DFBPPR20776 ---- Animal proteins ---- C4b-binding protein beta chain
Source.2911: DFBPPR20777 ---- Animal proteins ---- Sodium-coupled monocarboxylate transporter 2
Source.2912: DFBPPR20779 ---- Animal proteins ---- Myelin regulatory factor-like protein
Source.2913: DFBPPR20782 ---- Animal proteins ---- Deoxynucleotidyltransferase terminal-interacting protein 1
Source.2914: DFBPPR20793 ---- Animal proteins ---- 39S ribosomal protein L28, mitochondrial
Source.2915: DFBPPR20794 ---- Animal proteins ---- Rab-like protein 6
Source.2916: DFBPPR20798 ---- Animal proteins ---- Dolichyl-diphosphooligosaccharide--protein glycosyltransferase 48 kDa subunit
Source.2917: DFBPPR20801 ---- Animal proteins ---- Probable G-protein coupled receptor 171
Source.2918: DFBPPR20802 ---- Animal proteins ---- Integrator complex subunit 7
Source.2919: DFBPPR20804 ---- Animal proteins ---- N-acetyl-D-glucosamine kinase
Source.2920: DFBPPR20822 ---- Animal proteins ---- Ethanolamine-phosphate cytidylyltransferase
Source.2921: DFBPPR20823 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.2922: DFBPPR20836 ---- Animal proteins ---- Protein RRP5 homolog
Source.2923: DFBPPR20839 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 2
Source.2924: DFBPPR20844 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.2925: DFBPPR20847 ---- Animal proteins ---- Protein SHQ1 homolog
Source.2926: DFBPPR20851 ---- Animal proteins ---- Fucose mutarotase
Source.2927: DFBPPR20853 ---- Animal proteins ---- Hemopexin
Source.2928: DFBPPR20870 ---- Animal proteins ---- HMG box-containing protein 1
Source.2929: DFBPPR20872 ---- Animal proteins ---- Transmembrane protein 150C
Source.2930: DFBPPR20876 ---- Animal proteins ---- RNA-binding motif, single-stranded-interacting protein 1
Source.2931: DFBPPR20879 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.2932: DFBPPR20884 ---- Animal proteins ---- Transmembrane protein 237
Source.2933: DFBPPR20891 ---- Animal proteins ---- Protein lifeguard 1
Source.2934: DFBPPR20895 ---- Animal proteins ---- Solute carrier family 22 member 16
Source.2935: DFBPPR20896 ---- Animal proteins ---- Ribonuclease H2 subunit B
Source.2936: DFBPPR20918 ---- Animal proteins ---- Histidine ammonia-lyase
Source.2937: DFBPPR20925 ---- Animal proteins ---- Elongation factor 1-beta
Source.2938: DFBPPR20927 ---- Animal proteins ---- ADP-ribosylation factor 4
Source.2939: DFBPPR20930 ---- Animal proteins ---- Centromere protein U
Source.2940: DFBPPR20931 ---- Animal proteins ---- P2Y purinoceptor 14
Source.2941: DFBPPR20932 ---- Animal proteins ---- Ig-like V-type domain-containing protein FAM187A
Source.2942: DFBPPR20951 ---- Animal proteins ---- Chitinase domain-containing protein 1
Source.2943: DFBPPR20954 ---- Animal proteins ---- Secretagogin
Source.2944: DFBPPR20961 ---- Animal proteins ---- Tetraspanin-17
Source.2945: DFBPPR20970 ---- Animal proteins ---- ETS homologous factor
Source.2946: DFBPPR20974 ---- Animal proteins ---- Short-chain dehydrogenase/reductase 3
Source.2947: DFBPPR20994 ---- Animal proteins ---- Transmembrane 9 superfamily member 1
Source.2948: DFBPPR20999 ---- Animal proteins ---- Protein SERAC1
Source.2949: DFBPPR21006 ---- Animal proteins ---- AT-rich interactive domain-containing protein 5A
Source.2950: DFBPPR21015 ---- Animal proteins ---- POC1 centriolar protein homolog A
Source.2951: DFBPPR21022 ---- Animal proteins ---- Transmembrane 4 L6 family member 5
Source.2952: DFBPPR21024 ---- Animal proteins ---- Glycosylated lysosomal membrane protein
Source.2953: DFBPPR21026 ---- Animal proteins ---- Fetal and adult testis-expressed transcript protein homolog
Source.2954: DFBPPR21029 ---- Animal proteins ---- L-lactate dehydrogenase A-like 6B
Source.2955: DFBPPR21033 ---- Animal proteins ---- 26S proteasome complex subunit SEM1
Source.2956: DFBPPR21042 ---- Animal proteins ---- Kelch-like protein 21
Source.2957: DFBPPR21047 ---- Animal proteins ---- WD repeat-containing protein 48
Source.2958: DFBPPR21055 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.2959: DFBPPR21058 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.2960: DFBPPR21059 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.2961: DFBPPR21071 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.2962: DFBPPR21075 ---- Animal proteins ---- Constitutive coactivator of PPAR-gamma-like protein 1
Source.2963: DFBPPR21084 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.2964: DFBPPR21098 ---- Animal proteins ---- Pre T-cell antigen receptor alpha
Source.2965: DFBPPR21102 ---- Animal proteins ---- Gamma-glutamylcyclotransferase
Source.2966: DFBPPR21108 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.2967: DFBPPR21112 ---- Animal proteins ---- TBC1 domain family member 7
Source.2968: DFBPPR21113 ---- Animal proteins ---- Peptidase inhibitor 16
Source.2969: DFBPPR21122 ---- Animal proteins ---- Derlin-3
Source.2970: DFBPPR21124 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.2971: DFBPPR21126 ---- Animal proteins ---- Methionine--tRNA ligase, mitochondrial
Source.2972: DFBPPR21136 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.2973: DFBPPR21141 ---- Animal proteins ---- Biotinidase
Source.2974: DFBPPR21147 ---- Animal proteins ---- Transmembrane protein 88
Source.2975: DFBPPR21151 ---- Animal proteins ---- Zinc finger protein 350
Source.2976: DFBPPR21164 ---- Animal proteins ---- Probable cytosolic iron-sulfur protein assembly protein CIAO1
Source.2977: DFBPPR21168 ---- Animal proteins ---- Pyruvate dehydrogenase phosphatase regulatory subunit, mitochondrial
Source.2978: DFBPPR21173 ---- Animal proteins ---- Sorting nexin-11
Source.2979: DFBPPR21182 ---- Animal proteins ---- Probable G-protein coupled receptor 173
Source.2980: DFBPPR21185 ---- Animal proteins ---- Lymphocyte antigen 6H
Source.2981: DFBPPR21187 ---- Animal proteins ---- Plasmolipin
Source.2982: DFBPPR21191 ---- Animal proteins ---- RAS protein activator like-3
Source.2983: DFBPPR21196 ---- Animal proteins ---- Beta-crystallin A4
Source.2984: DFBPPR21202 ---- Animal proteins ---- Leukotriene B4 receptor 1
Source.2985: DFBPPR21203 ---- Animal proteins ---- Nuclear protein 2
Source.2986: DFBPPR21218 ---- Animal proteins ---- B-cell receptor-associated protein 29
Source.2987: DFBPPR21221 ---- Animal proteins ---- Short-chain dehydrogenase/reductase family 42E member 1
Source.2988: DFBPPR21222 ---- Animal proteins ---- Cytosolic carboxypeptidase 3
Source.2989: DFBPPR21228 ---- Animal proteins ---- Inactive hydroxysteroid dehydrogenase-like protein 1
Source.2990: DFBPPR21230 ---- Animal proteins ---- Dynein light chain 4, axonemal
Source.2991: DFBPPR21243 ---- Animal proteins ---- Transmembrane protein 198
Source.2992: DFBPPR21251 ---- Animal proteins ---- B9 domain-containing protein 2
Source.2993: DFBPPR21253 ---- Animal proteins ---- Sorting nexin-8
Source.2994: DFBPPR21259 ---- Animal proteins ---- Elongation factor 1-delta
Source.2995: DFBPPR21262 ---- Animal proteins ---- Probable tRNA methyltransferase 9B
Source.2996: DFBPPR21275 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.2997: DFBPPR21277 ---- Animal proteins ---- Glucose-6-phosphate exchanger SLC37A2
Source.2998: DFBPPR21284 ---- Animal proteins ---- Tetratricopeptide repeat protein 30B
Source.2999: DFBPPR21289 ---- Animal proteins ---- Protein disulfide-isomerase A5
Source.3000: DFBPPR21291 ---- Animal proteins ---- 39S ribosomal protein L18, mitochondrial
Source.3001: DFBPPR21298 ---- Animal proteins ---- SH3KBP1-binding protein 1
Source.3002: DFBPPR21301 ---- Animal proteins ---- Lymphocyte antigen 6D
Source.3003: DFBPPR21304 ---- Animal proteins ---- NTF2-related export protein 2
Source.3004: DFBPPR21307 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.3005: DFBPPR21310 ---- Animal proteins ---- von Willebrand factor A domain-containing protein 1
Source.3006: DFBPPR21311 ---- Animal proteins ---- WD repeat-containing protein 18
Source.3007: DFBPPR21317 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.3008: DFBPPR21319 ---- Animal proteins ---- V-type proton ATPase subunit H
Source.3009: DFBPPR21324 ---- Animal proteins ---- Transmembrane protein 115
Source.3010: DFBPPR21328 ---- Animal proteins ---- Outer dense fiber protein 3
Source.3011: DFBPPR21330 ---- Animal proteins ---- 60S ribosomal export protein NMD3
Source.3012: DFBPPR21333 ---- Animal proteins ---- DDB1- and CUL4-associated factor 15
Source.3013: DFBPPR21338 ---- Animal proteins ---- S-adenosylmethionine mitochondrial carrier protein
Source.3014: DFBPPR21339 ---- Animal proteins ---- Zinc finger protein 692
Source.3015: DFBPPR21340 ---- Animal proteins ---- Ribosome-releasing factor 2, mitochondrial
Source.3016: DFBPPR21341 ---- Animal proteins ---- Cell cycle control protein 50C
Source.3017: DFBPPR21349 ---- Animal proteins ---- Probable cationic amino acid transporter
Source.3018: DFBPPR21355 ---- Animal proteins ---- Coiled-coil domain-containing protein 151
Source.3019: DFBPPR21360 ---- Animal proteins ---- Transmembrane protein 158
Source.3020: DFBPPR21363 ---- Animal proteins ---- Pleckstrin homology-like domain family A member 2
Source.3021: DFBPPR21364 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 10-like protein
Source.3022: DFBPPR21368 ---- Animal proteins ---- Ferric-chelate reductase 1
Source.3023: DFBPPR21370 ---- Animal proteins ---- Lipase maturation factor 2
Source.3024: DFBPPR21371 ---- Animal proteins ---- TRPM8 channel-associated factor 2
Source.3025: DFBPPR21377 ---- Animal proteins ---- Hemoglobin subunit mu
Source.3026: DFBPPR21385 ---- Animal proteins ---- Neuromedin-U receptor 2
Source.3027: DFBPPR21387 ---- Animal proteins ---- Surfeit locus protein 4
Source.3028: DFBPPR21396 ---- Animal proteins ---- Mitochondrial import receptor subunit TOM6 homolog
Source.3029: DFBPPR21406 ---- Animal proteins ---- Cell division cycle-associated protein 2
Source.3030: DFBPPR21413 ---- Animal proteins ---- Protein kinase C-binding protein NELL2
Source.3031: DFBPPR21415 ---- Animal proteins ---- Leucine-rich repeat-containing protein 39
Source.3032: DFBPPR21418 ---- Animal proteins ---- Angiopoietin-related protein 1
Source.3033: DFBPPR21426 ---- Animal proteins ---- ORM1-like protein 3
Source.3034: DFBPPR21434 ---- Animal proteins ---- Ankyrin repeat and SOCS box protein 15
Source.3035: DFBPPR21435 ---- Animal proteins ---- ETS-related transcription factor Elf-5
Source.3036: DFBPPR21436 ---- Animal proteins ---- Actin-related protein 2/3 complex subunit 1A
Source.3037: DFBPPR21437 ---- Animal proteins ---- Distal membrane-arm assembly complex protein 2
Source.3038: DFBPPR21438 ---- Animal proteins ---- Transmembrane protein 120B
Source.3039: DFBPPR21443 ---- Animal proteins ---- CKLF-like MARVEL transmembrane domain-containing protein 8
Source.3040: DFBPPR21447 ---- Animal proteins ---- Transmembrane protein 39A
Source.3041: DFBPPR21448 ---- Animal proteins ---- Protein N-lysine methyltransferase METTL21A
Source.3042: DFBPPR21451 ---- Animal proteins ---- Nurim
Source.3043: DFBPPR21457 ---- Animal proteins ---- Zinc finger protein 330
Source.3044: DFBPPR21458 ---- Animal proteins ---- Transmembrane protein 163
Source.3045: DFBPPR21460 ---- Animal proteins ---- SREBP regulating gene protein
Source.3046: DFBPPR21471 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.3047: DFBPPR21472 ---- Animal proteins ---- Rho guanine nucleotide exchange factor 9
Source.3048: DFBPPR21480 ---- Animal proteins ---- WD repeat and FYVE domain-containing protein 1
Source.3049: DFBPPR21482 ---- Animal proteins ---- Glycosyltransferase 6 domain-containing protein 1
Source.3050: DFBPPR21483 ---- Animal proteins ---- F-box/LRR-repeat protein 8
Source.3051: DFBPPR21484 ---- Animal proteins ---- Armadillo repeat-containing protein 8
Source.3052: DFBPPR21488 ---- Animal proteins ---- Probable ubiquitin carboxyl-terminal hydrolase MINDY-4
Source.3053: DFBPPR21489 ---- Animal proteins ---- Pre-mRNA-splicing factor 18
Source.3054: DFBPPR21495 ---- Animal proteins ---- Synaptosomal-associated protein 47
Source.3055: DFBPPR21505 ---- Animal proteins ---- Tetraspanin-1
Source.3056: DFBPPR21513 ---- Animal proteins ---- Profilin-3
Source.3057: DFBPPR21515 ---- Animal proteins ---- P2Y purinoceptor 2
Source.3058: DFBPPR21522 ---- Animal proteins ---- ATP-dependent RNA helicase DQX1
Source.3059: DFBPPR21524 ---- Animal proteins ---- Insulin-like growth factor-binding protein 3 receptor
Source.3060: DFBPPR21527 ---- Animal proteins ---- Programmed cell death protein 2
Source.3061: DFBPPR21528 ---- Animal proteins ---- Vasculin
Source.3062: DFBPPR21533 ---- Animal proteins ---- Zinc finger protein 19
Source.3063: DFBPPR21534 ---- Animal proteins ---- 39S ribosomal protein L46, mitochondrial
Source.3064: DFBPPR21541 ---- Animal proteins ---- Protein FAM210A
Source.3065: DFBPPR21551 ---- Animal proteins ---- Suppressor of cytokine signaling 4
Source.3066: DFBPPR21552 ---- Animal proteins ---- SPRY domain-containing SOCS box protein 3
Source.3067: DFBPPR21568 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.3068: DFBPPR21571 ---- Animal proteins ---- Mitochondrial fission regulator 2
Source.3069: DFBPPR21573 ---- Animal proteins ---- Tetratricopeptide repeat protein 30A
Source.3070: DFBPPR21577 ---- Animal proteins ---- Actin-like protein 7A
Source.3071: DFBPPR21584 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.3072: DFBPPR21585 ---- Animal proteins ---- Ras-related protein Rab-19
Source.3073: DFBPPR21587 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.3074: DFBPPR21591 ---- Animal proteins ---- Homeobox protein aristaless-like 4
Source.3075: DFBPPR21593 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.3076: DFBPPR21600 ---- Animal proteins ---- Phosphatidylinositol N-acetylglucosaminyltransferase subunit H
Source.3077: DFBPPR21605 ---- Animal proteins ---- Transmembrane protein 138
Source.3078: DFBPPR21609 ---- Animal proteins ---- Protein PHTF1
Source.3079: DFBPPR21612 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.3080: DFBPPR21613 ---- Animal proteins ---- Probable inactive glycosyltransferase 25 family member 3
Source.3081: DFBPPR21617 ---- Animal proteins ---- Proteasome assembly chaperone 3
Source.3082: DFBPPR21623 ---- Animal proteins ---- Notchless protein homolog 1
Source.3083: DFBPPR21634 ---- Animal proteins ---- Pyridine nucleotide-disulfide oxidoreductase domain-containing protein 1
Source.3084: DFBPPR21638 ---- Animal proteins ---- 28S ribosomal protein S10, mitochondrial
Source.3085: DFBPPR21641 ---- Animal proteins ---- U5 small nuclear ribonucleoprotein 40 kDa protein
Source.3086: DFBPPR21644 ---- Animal proteins ---- Mpv17-like protein 2
Source.3087: DFBPPR21647 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 35 kDa protein
Source.3088: DFBPPR21649 ---- Animal proteins ---- NTF2-related export protein 1
Source.3089: DFBPPR21650 ---- Animal proteins ---- Synaptonemal complex central element protein 1
Source.3090: DFBPPR21653 ---- Animal proteins ---- Cytochrome P450 20A1
Source.3091: DFBPPR21655 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 7
Source.3092: DFBPPR21659 ---- Animal proteins ---- Peptide chain release factor 1-like, mitochondrial
Source.3093: DFBPPR21660 ---- Animal proteins ---- DNA-directed RNA polymerase III subunit RPC8
Source.3094: DFBPPR21665 ---- Animal proteins ---- Exocyst complex component 3-like protein
Source.3095: DFBPPR21666 ---- Animal proteins ---- Importin-13
Source.3096: DFBPPR21672 ---- Animal proteins ---- Kelch domain-containing protein 10
Source.3097: DFBPPR21682 ---- Animal proteins ---- Protein SYS1 homolog
Source.3098: DFBPPR21685 ---- Animal proteins ---- Prenylcysteine oxidase-like
Source.3099: DFBPPR21695 ---- Animal proteins ---- Choline transporter-like protein 3
Source.3100: DFBPPR21697 ---- Animal proteins ---- UDP-galactose translocator
Source.3101: DFBPPR21705 ---- Animal proteins ---- Transmembrane protein 50B
Source.3102: DFBPPR21711 ---- Animal proteins ---- Hydrolethalus syndrome protein 1 homolog
Source.3103: DFBPPR21715 ---- Animal proteins ---- Junctional protein associated with coronary artery disease homolog
Source.3104: DFBPPR21716 ---- Animal proteins ---- Asparagine--tRNA ligase, cytoplasmic
Source.3105: DFBPPR21718 ---- Animal proteins ---- Synaptotagmin-like protein 2
Source.3106: DFBPPR21724 ---- Animal proteins ---- Transducin beta-like protein 3
Source.3107: DFBPPR21725 ---- Animal proteins ---- TBCC domain-containing protein 1
Source.3108: DFBPPR21728 ---- Animal proteins ---- Galectin-9
Source.3109: DFBPPR21730 ---- Animal proteins ---- Post-GPI attachment to proteins factor 2
Source.3110: DFBPPR21732 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1
Source.3111: DFBPPR21734 ---- Animal proteins ---- TBC1 domain family member 1
Source.3112: DFBPPR21739 ---- Animal proteins ---- Sorting nexin-15
Source.3113: DFBPPR21752 ---- Animal proteins ---- Major facilitator superfamily domain-containing protein 10
Source.3114: DFBPPR21757 ---- Animal proteins ---- Transmembrane protein 190
Source.3115: DFBPPR21766 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 12
Source.3116: DFBPPR21773 ---- Animal proteins ---- Isoamyl acetate-hydrolyzing esterase 1 homolog
Source.3117: DFBPPR21778 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 5
Source.3118: DFBPPR21781 ---- Animal proteins ---- WD repeat-containing protein 1
Source.3119: DFBPPR21788 ---- Animal proteins ---- Keratin-associated protein 3-3
Source.3120: DFBPPR21789 ---- Animal proteins ---- Protein kish-B
Source.3121: DFBPPR21800 ---- Animal proteins ---- Carbonic anhydrase-related protein 10
Source.3122: DFBPPR21802 ---- Animal proteins ---- Antigen WC1.1
Source.3123: DFBPPR21804 ---- Animal proteins ---- Myelin and lymphocyte protein
Source.3124: DFBPPR21805 ---- Animal proteins ---- 60S ribosomal protein L19
Source.3125: DFBPPR21808 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.3126: DFBPPR21809 ---- Animal proteins ---- Glycosyltransferase 8 domain-containing protein 1
Source.3127: DFBPPR21812 ---- Animal proteins ---- Reticulon-4-interacting protein 1, mitochondrial
Source.3128: DFBPPR21815 ---- Animal proteins ---- ORM1-like protein 2
Source.3129: DFBPPR21818 ---- Animal proteins ---- Zinc finger protein 410
Source.3130: DFBPPR21835 ---- Animal proteins ---- Protein misato homolog 1
Source.3131: DFBPPR21838 ---- Animal proteins ---- Mitochondrial import inner membrane translocase subunit Tim17-B
Source.3132: DFBPPR21839 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.3133: DFBPPR21845 ---- Animal proteins ---- PAK4-inhibitor INKA2
Source.3134: DFBPPR21849 ---- Animal proteins ---- ALS2 C-terminal-like protein
Source.3135: DFBPPR21853 ---- Animal proteins ---- F-box/LRR-repeat protein 14
Source.3136: DFBPPR21870 ---- Animal proteins ---- Integrator complex subunit 14
Source.3137: DFBPPR21871 ---- Animal proteins ---- Serpin B10
Source.3138: DFBPPR21874 ---- Animal proteins ---- Oncoprotein-induced transcript 3 protein
Source.3139: DFBPPR21882 ---- Animal proteins ---- Insulin-like peptide INSL6
Source.3140: DFBPPR21885 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.3141: DFBPPR21889 ---- Animal proteins ---- Secretion-regulating guanine nucleotide exchange factor
Source.3142: DFBPPR21890 ---- Animal proteins ---- Probable inactive peptidyl-prolyl cis-trans isomerase-like 6
Source.3143: DFBPPR21899 ---- Animal proteins ---- Gametocyte-specific factor 1
Source.3144: DFBPPR21900 ---- Animal proteins ---- Cyclin-D1-binding protein 1
Source.3145: DFBPPR21902 ---- Animal proteins ---- Centromere protein N
Source.3146: DFBPPR21906 ---- Animal proteins ---- Mpv17-like protein
Source.3147: DFBPPR21915 ---- Animal proteins ---- Tetraspanin-13
Source.3148: DFBPPR21916 ---- Animal proteins ---- GTPase IMAP family member 6
Source.3149: DFBPPR21929 ---- Animal proteins ---- Elongation factor 1-gamma
Source.3150: DFBPPR21933 ---- Animal proteins ---- DDB1- and CUL4-associated factor 11
Source.3151: DFBPPR21936 ---- Animal proteins ---- Peroxisomal membrane protein 2
Source.3152: DFBPPR21939 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H5
Source.3153: DFBPPR21946 ---- Animal proteins ---- Zinc finger protein 414
Source.3154: DFBPPR21950 ---- Animal proteins ---- Solute carrier family 25 member 48
Source.3155: DFBPPR21951 ---- Animal proteins ---- Protein ABHD11
Source.3156: DFBPPR21955 ---- Animal proteins ---- Calcium-responsive transcription factor
Source.3157: DFBPPR21963 ---- Animal proteins ---- Protein zwilch homolog
Source.3158: DFBPPR21967 ---- Animal proteins ---- GTP-binding protein 10
Source.3159: DFBPPR21972 ---- Animal proteins ---- LRRN4 C-terminal-like protein
Source.3160: DFBPPR21973 ---- Animal proteins ---- Protein FAM234A
Source.3161: DFBPPR21974 ---- Animal proteins ---- Autophagy-related protein 101
Source.3162: DFBPPR21980 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.3163: DFBPPR21987 ---- Animal proteins ---- Ribonuclease H2 subunit C
Source.3164: DFBPPR21993 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.3165: DFBPPR22008 ---- Animal proteins ---- Fanconi anemia group C protein homolog
Source.3166: DFBPPR22009 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1
Source.3167: DFBPPR22010 ---- Animal proteins ---- Protein-lysine methyltransferase METTL21E
Source.3168: DFBPPR22014 ---- Animal proteins ---- Solute carrier family 43 member 3
Source.3169: DFBPPR22015 ---- Animal proteins ---- Solute carrier family 35 member F5
Source.3170: DFBPPR22019 ---- Animal proteins ---- ATP-binding cassette sub-family F member 2
Source.3171: DFBPPR22023 ---- Animal proteins ---- Myotubularin-related protein 9-like
Source.3172: DFBPPR22030 ---- Animal proteins ---- U11/U12 small nuclear ribonucleoprotein 25 kDa protein
Source.3173: DFBPPR22039 ---- Animal proteins ---- T-complex protein 1 subunit zeta-2
Source.3174: DFBPPR22047 ---- Animal proteins ---- WD repeat-containing protein 6
Source.3175: DFBPPR22055 ---- Animal proteins ---- Solute carrier family 35 member E3
Source.3176: DFBPPR22057 ---- Animal proteins ---- Fatty acid desaturase 6
Source.3177: DFBPPR22068 ---- Animal proteins ---- Protein GPR108
Source.3178: DFBPPR22069 ---- Animal proteins ---- Retrotransposon-like protein 1
Source.3179: DFBPPR22070 ---- Animal proteins ---- Maturin
Source.3180: DFBPPR22092 ---- Animal proteins ---- Kelch-like protein 36
Source.3181: DFBPPR22102 ---- Animal proteins ---- Solute carrier family 46 member 3
Source.3182: DFBPPR22103 ---- Animal proteins ---- Serine incorporator 2
Source.3183: DFBPPR22123 ---- Animal proteins ---- Protein KRI1 homolog
Source.3184: DFBPPR22127 ---- Animal proteins ---- Tumor protein p53-inducible protein 11
Source.3185: DFBPPR22128 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.3186: DFBPPR22131 ---- Animal proteins ---- F-box/WD repeat-containing protein 2
Source.3187: DFBPPR22139 ---- Animal proteins ---- WD repeat and SOCS box-containing protein 2
Source.3188: DFBPPR22142 ---- Animal proteins ---- Tubulin epsilon and delta complex protein 2
Source.3189: DFBPPR22143 ---- Animal proteins ---- Hippocampus abundant transcript-like protein 1
Source.3190: DFBPPR22145 ---- Animal proteins ---- Putative malate dehydrogenase 1B
Source.3191: DFBPPR22146 ---- Animal proteins ---- Leucine-rich repeat-containing protein 41
Source.3192: DFBPPR22147 ---- Animal proteins ---- Immunoglobulin superfamily containing leucine-rich repeat protein
Source.3193: DFBPPR22152 ---- Animal proteins ---- Nucleolar protein 11
Source.3194: DFBPPR22155 ---- Animal proteins ---- IQ domain-containing protein F1
Source.3195: DFBPPR22156 ---- Animal proteins ---- Cell division cycle protein 123 homolog
Source.3196: DFBPPR22158 ---- Animal proteins ---- Dynein assembly factor with WDR repeat domains 1
Source.3197: DFBPPR22162 ---- Animal proteins ---- Transmembrane protein 245
Source.3198: DFBPPR22167 ---- Animal proteins ---- Transmembrane protein 143
Source.3199: DFBPPR22177 ---- Animal proteins ---- Protein C9orf135 homolog
Source.3200: DFBPPR22179 ---- Animal proteins ---- CDKN2AIP N-terminal-like protein
Source.3201: DFBPPR22182 ---- Animal proteins ---- Protein TOPAZ1
Source.3202: DFBPPR22186 ---- Animal proteins ---- Transmembrane and ubiquitin-like domain-containing protein 2
Source.3203: DFBPPR22203 ---- Animal proteins ---- Serum amyloid A-4 protein
Source.3204: DFBPPR22205 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.3205: DFBPPR22207 ---- Animal proteins ---- Fas apoptotic inhibitory molecule 1
Source.3206: DFBPPR22209 ---- Animal proteins ---- Transmembrane protein 147
Source.3207: DFBPPR22210 ---- Animal proteins ---- Peroxisomal membrane protein 4
Source.3208: DFBPPR22211 ---- Animal proteins ---- Ribonuclease P protein subunit p25-like protein
Source.3209: DFBPPR22214 ---- Animal proteins ---- Transmembrane protein 39B
Source.3210: DFBPPR22225 ---- Animal proteins ---- F-box/WD repeat-containing protein 9
Source.3211: DFBPPR22228 ---- Animal proteins ---- Rho GTPase-activating protein 36
Source.3212: DFBPPR22232 ---- Animal proteins ---- Transmembrane protein 176A
Source.3213: DFBPPR22236 ---- Animal proteins ---- Coronin-2A
Source.3214: DFBPPR22237 ---- Animal proteins ---- Spermatogenesis-associated protein 5-like protein 1
Source.3215: DFBPPR22238 ---- Animal proteins ---- StAR-related lipid transfer protein 5
Source.3216: DFBPPR22240 ---- Animal proteins ---- Ataxin-10
Source.3217: DFBPPR22245 ---- Animal proteins ---- Thyroid transcription factor 1-associated protein 26
Source.3218: DFBPPR22247 ---- Animal proteins ---- NXPE family member 3
Source.3219: DFBPPR22259 ---- Animal proteins ---- Transmembrane 6 superfamily member 1
Source.3220: DFBPPR22271 ---- Animal proteins ---- Primary cilium assembly protein FAM149B1
Source.3221: DFBPPR22273 ---- Animal proteins ---- 39S ribosomal protein L45, mitochondrial
Source.3222: DFBPPR22277 ---- Animal proteins ---- Actin-like protein 7B
Source.3223: DFBPPR22279 ---- Animal proteins ---- THUMP domain-containing protein 3
Source.3224: DFBPPR22281 ---- Animal proteins ---- Asparagine synthetase domain-containing protein 1
Source.3225: DFBPPR22283 ---- Animal proteins ---- F-box only protein 8
Source.3226: DFBPPR22284 ---- Animal proteins ---- Transmembrane protein 184C
Source.3227: DFBPPR22285 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-1-interacting protein 2
Source.3228: DFBPPR22287 ---- Animal proteins ---- BAG family molecular chaperone regulator 5
Source.3229: DFBPPR22289 ---- Animal proteins ---- Heme-binding protein 1
Source.3230: DFBPPR22290 ---- Animal proteins ---- Cell death activator CIDE-B
Source.3231: DFBPPR22296 ---- Animal proteins ---- Kelch domain-containing protein 2
Source.3232: DFBPPR22299 ---- Animal proteins ---- Tetraspanin-31
Source.3233: DFBPPR22301 ---- Animal proteins ---- Transmembrane protein 184B
Source.3234: DFBPPR22311 ---- Animal proteins ---- Calcium-binding and spermatid-specific protein 1
Source.3235: DFBPPR22320 ---- Animal proteins ---- Transmembrane protein 229B
Source.3236: DFBPPR22331 ---- Animal proteins ---- Zinc finger SWIM domain-containing protein 8
Source.3237: DFBPPR22334 ---- Animal proteins ---- Protein HP-25 homolog 1
Source.3238: DFBPPR22335 ---- Animal proteins ---- Paraneoplastic antigen Ma2 homolog
Source.3239: DFBPPR22338 ---- Animal proteins ---- Probable cystatin-16
Source.3240: DFBPPR22343 ---- Animal proteins ---- Protein RRNAD1
Source.3241: DFBPPR22347 ---- Animal proteins ---- Etoposide-induced protein 2.4 homolog
Source.3242: DFBPPR22355 ---- Animal proteins ---- Glutamine-rich protein 1
Source.3243: DFBPPR22358 ---- Animal proteins ---- Dynein assembly factor 3, axonemal
Source.3244: DFBPPR22359 ---- Animal proteins ---- Sorting nexin-29
Source.3245: DFBPPR22366 ---- Animal proteins ---- Metallo-beta-lactamase domain-containing protein 1
Source.3246: DFBPPR22370 ---- Animal proteins ---- Synaptogyrin-4
Source.3247: DFBPPR22372 ---- Animal proteins ---- WD repeat-containing protein 92
Source.3248: DFBPPR22375 ---- Animal proteins ---- Mth938 domain-containing protein
Source.3249: DFBPPR22376 ---- Animal proteins ---- 60S ribosomal protein L31
Source.3250: DFBPPR22378 ---- Animal proteins ---- Coiled-coil domain-containing protein 86
Source.3251: DFBPPR22381 ---- Animal proteins ---- F-box only protein 39
Source.3252: DFBPPR22383 ---- Animal proteins ---- Transmembrane protein 185B
Source.3253: DFBPPR22389 ---- Animal proteins ---- Quinone oxidoreductase-like protein 1
Source.3254: DFBPPR22390 ---- Animal proteins ---- Protein unc-93 homolog A
Source.3255: DFBPPR22393 ---- Animal proteins ---- PDZ domain-containing protein GIPC2
Source.3256: DFBPPR22397 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.3257: DFBPPR22404 ---- Animal proteins ---- Actin-like protein 9
Source.3258: DFBPPR22415 ---- Animal proteins ---- Methyltransferase-like protein 9
Source.3259: DFBPPR22418 ---- Animal proteins ---- Transmembrane protein 160
Source.3260: DFBPPR22438 ---- Animal proteins ---- Transmembrane 4 L6 family member 18
Source.3261: DFBPPR22442 ---- Animal proteins ---- ZAR1-like protein
Source.3262: DFBPPR22444 ---- Animal proteins ---- Tetraspanin-11
Source.3263: DFBPPR22449 ---- Animal proteins ---- Complement C1q and tumor necrosis factor-related protein 9
Source.3264: DFBPPR22451 ---- Animal proteins ---- RING finger protein 151
Source.3265: DFBPPR22455 ---- Animal proteins ---- Phosducin-like protein 2
Source.3266: DFBPPR22468 ---- Animal proteins ---- Queuosine salvage protein
Source.3267: DFBPPR22472 ---- Animal proteins ---- Aldehyde dehydrogenase family 16 member A1
Source.3268: DFBPPR22477 ---- Animal proteins ---- EF-hand calcium-binding domain-containing protein 3
Source.3269: DFBPPR22489 ---- Animal proteins ---- Paraneoplastic antigen Ma1 homolog
Source.3270: DFBPPR22492 ---- Animal proteins ---- SAYSvFN domain-containing protein 1
Source.3271: DFBPPR22493 ---- Animal proteins ---- PC-esterase domain-containing protein 1B
Source.3272: DFBPPR22494 ---- Animal proteins ---- Protein FAM53C
Source.3273: DFBPPR22495 ---- Animal proteins ---- Transmembrane protein 68
Source.3274: DFBPPR22503 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein-like
Source.3275: DFBPPR22504 ---- Animal proteins ---- Protein HP-25 homolog 2
Source.3276: DFBPPR22505 ---- Animal proteins ---- Protein HP-20 homolog
Source.3277: DFBPPR22507 ---- Animal proteins ---- Secernin-3
Source.3278: DFBPPR22510 ---- Animal proteins ---- GPALPP motifs-containing protein 1
Source.3279: DFBPPR22517 ---- Animal proteins ---- F-box only protein 15
Source.3280: DFBPPR22527 ---- Animal proteins ---- Transmembrane protein 169
Source.3281: DFBPPR22539 ---- Animal proteins ---- Membrane-spanning 4-domains subfamily A member 18
Source.3282: DFBPPR22542 ---- Animal proteins ---- Transmembrane protein 151B
Source.3283: DFBPPR22584 ---- Animal proteins ---- Arginine vasopressin-induced protein 1
Source.3284: DFBPPR22591 ---- Animal proteins ---- Leucine-rich repeat-containing protein 51
Source.3285: DFBPPR22595 ---- Animal proteins ---- Transmembrane protein 268
Source.3286: DFBPPR22600 ---- Animal proteins ---- Trafficking protein particle complex subunit 13
Source.3287: DFBPPR22603 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.3288: DFBPPR22606 ---- Animal proteins ---- WD repeat-containing protein 53
Source.3289: DFBPPR22607 ---- Animal proteins ---- Transmembrane protein 128
Source.3290: DFBPPR22629 ---- Animal proteins ---- Coiled-coil domain-containing protein 153
Source.3291: DFBPPR22633 ---- Animal proteins ---- Transmembrane protein 270
Source.3292: DFBPPR22644 ---- Animal proteins ---- BTB/POZ domain-containing protein KCTD18
Source.3293: DFBPPR22648 ---- Animal proteins ---- Ankyrin repeat domain-containing protein 65
Source.3294: DFBPPR22665 ---- Animal proteins ---- UPF0686 protein C11orf1 homolog
Source.3295: DFBPPR22669 ---- Animal proteins ---- Uncharacterized protein C5orf46 homolog
Source.3296: DFBPPR22676 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.3297: DFBPPR22677 ---- Animal proteins ---- Uncharacterized protein CXorf49 homolog
Source.3298: DFBPPR22679 ---- Animal proteins ---- MORN repeat-containing protein 3
Source.3299: DFBPPR22686 ---- Animal proteins ---- Vertnin
Source.3300: DFBPPR22688 ---- Animal proteins ---- Oxidoreductase-like domain-containing protein 1
Source.3301: DFBPPR22689 ---- Animal proteins ---- Protein FAM166B
Source.3302: DFBPPR22695 ---- Animal proteins ---- MORN repeat-containing protein 5
Source.3303: DFBPPR22708 ---- Animal proteins ---- Pregnancy-associated protein bPAP
Source.3304: DFBPPR22726 ---- Animal proteins ---- Uncharacterized protein C16orf90 homolog
Source.3305: DFBPPR22738 ---- Animal proteins ---- Uncharacterized protein C12orf29 homolog
Source.3306: DFBPPR22741 ---- Animal proteins ---- Required for excision 1-B domain-containing protein
Source.3307: DFBPPR22743 ---- Animal proteins ---- CMT1A duplicated region transcript 4 protein homolog
Source.3308: DFBPPR22744 ---- Animal proteins ---- Uncharacterized protein C10orf82 homolog
Source.3309: DFBPPR22746 ---- Animal proteins ---- Uncharacterized protein C1orf146 homolog
Source.3310: DFBPPR22748 ---- Animal proteins ---- Uncharacterized protein C5orf34 homolog
Source.3311: DFBPPR22751 ---- Animal proteins ---- Uncharacterized protein C8orf74 homolog
Source.3312: DFBPPR8530 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.3313: DFBPPR8534 ---- Animal proteins ---- Zona pellucida sperm-binding protein 4
Source.3314: DFBPPR8536 ---- Animal proteins ---- Dipeptidyl peptidase 4
Source.3315: DFBPPR8539 ---- Animal proteins ---- Pancreatic alpha-amylase
Source.3316: DFBPPR8543 ---- Animal proteins ---- Sterol regulatory element-binding protein 1
Source.3317: DFBPPR8544 ---- Animal proteins ---- Xaa-Pro aminopeptidase 2
Source.3318: DFBPPR8550 ---- Animal proteins ---- Complement C3
Source.3319: DFBPPR8551 ---- Animal proteins ---- Aminopeptidase N
Source.3320: DFBPPR8556 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.3321: DFBPPR8565 ---- Animal proteins ---- Villin-1
Source.3322: DFBPPR8569 ---- Animal proteins ---- Ryanodine receptor 1
Source.3323: DFBPPR8571 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.3324: DFBPPR8572 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.3325: DFBPPR8575 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.3326: DFBPPR8583 ---- Animal proteins ---- Amiloride-sensitive amine oxidase [copper-containing]
Source.3327: DFBPPR8585 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.3328: DFBPPR8594 ---- Animal proteins ---- Trifunctional enzyme subunit alpha, mitochondrial
Source.3329: DFBPPR8596 ---- Animal proteins ---- Gelsolin
Source.3330: DFBPPR8597 ---- Animal proteins ---- Diacylglycerol kinase alpha
Source.3331: DFBPPR8601 ---- Animal proteins ---- Mothers against decapentaplegic homolog 4
Source.3332: DFBPPR8602 ---- Animal proteins ---- TGF-beta receptor type-2
Source.3333: DFBPPR8607 ---- Animal proteins ---- Prolactin
Source.3334: DFBPPR8608 ---- Animal proteins ---- Zona pellucida sperm-binding protein 3
Source.3335: DFBPPR8610 ---- Animal proteins ---- Signal transducer and activator of transcription 5B
Source.3336: DFBPPR8617 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.3337: DFBPPR8619 ---- Animal proteins ---- Long-chain specific acyl-CoA dehydrogenase, mitochondrial
Source.3338: DFBPPR8620 ---- Animal proteins ---- Isocitrate dehydrogenase [NADP], mitochondrial
Source.3339: DFBPPR8621 ---- Animal proteins ---- Amyloid-beta A4 protein
Source.3340: DFBPPR8622 ---- Animal proteins ---- Estrogen receptor
Source.3341: DFBPPR8627 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.3342: DFBPPR8629 ---- Animal proteins ---- 2'-5'-oligoadenylate synthase 1
Source.3343: DFBPPR8630 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.3344: DFBPPR8631 ---- Animal proteins ---- D-amino-acid oxidase
Source.3345: DFBPPR8633 ---- Animal proteins ---- Alpha-2A adrenergic receptor
Source.3346: DFBPPR8636 ---- Animal proteins ---- Peroxisome proliferator-activated receptor gamma coactivator 1-alpha
Source.3347: DFBPPR8638 ---- Animal proteins ---- Lipoprotein lipase
Source.3348: DFBPPR8644 ---- Animal proteins ---- Transforming growth factor beta receptor type 3
Source.3349: DFBPPR8645 ---- Animal proteins ---- NT-3 growth factor receptor
Source.3350: DFBPPR8646 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.3351: DFBPPR8649 ---- Animal proteins ---- Acrosin
Source.3352: DFBPPR8650 ---- Animal proteins ---- Beta-2 adrenergic receptor
Source.3353: DFBPPR8660 ---- Animal proteins ---- Interleukin-12 subunit beta
Source.3354: DFBPPR8662 ---- Animal proteins ---- Eukaryotic initiation factor 4A-III
Source.3355: DFBPPR8664 ---- Animal proteins ---- Liver carboxylesterase
Source.3356: DFBPPR8671 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.3357: DFBPPR8674 ---- Animal proteins ---- Calpain-3
Source.3358: DFBPPR8675 ---- Animal proteins ---- Receptor of activated protein C kinase 1
Source.3359: DFBPPR8677 ---- Animal proteins ---- Phosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit gamma isoform
Source.3360: DFBPPR8681 ---- Animal proteins ---- Toll-like receptor 9
Source.3361: DFBPPR8682 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.3362: DFBPPR8684 ---- Animal proteins ---- Sialoadhesin
Source.3363: DFBPPR8691 ---- Animal proteins ---- Presenilin-2
Source.3364: DFBPPR8693 ---- Animal proteins ---- TGF-beta receptor type-1
Source.3365: DFBPPR8694 ---- Animal proteins ---- Spastin
Source.3366: DFBPPR8695 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3367: DFBPPR8698 ---- Animal proteins ---- Prorelaxin
Source.3368: DFBPPR8699 ---- Animal proteins ---- ADP-ribosylation factor 6
Source.3369: DFBPPR8703 ---- Animal proteins ---- AP2-associated protein kinase 1
Source.3370: DFBPPR8705 ---- Animal proteins ---- Unconventional myosin-VI
Source.3371: DFBPPR8710 ---- Animal proteins ---- Leptin receptor
Source.3372: DFBPPR8711 ---- Animal proteins ---- Fumarate hydratase, mitochondrial
Source.3373: DFBPPR8715 ---- Animal proteins ---- Serine/threonine-protein kinase Nek6
Source.3374: DFBPPR8716 ---- Animal proteins ---- Thyroid peroxidase
Source.3375: DFBPPR8719 ---- Animal proteins ---- Prelamin-A/C
Source.3376: DFBPPR8725 ---- Animal proteins ---- Transcription factor SOX-9
Source.3377: DFBPPR8726 ---- Animal proteins ---- Serine-protein kinase ATM
Source.3378: DFBPPR8728 ---- Animal proteins ---- Aquaporin-1
Source.3379: DFBPPR8736 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1
Source.3380: DFBPPR8740 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.3381: DFBPPR8742 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 2
Source.3382: DFBPPR8746 ---- Animal proteins ---- Electron transfer flavoprotein-ubiquinone oxidoreductase, mitochondrial
Source.3383: DFBPPR8747 ---- Animal proteins ---- Bifunctional coenzyme A synthase
Source.3384: DFBPPR8751 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.3385: DFBPPR8752 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.3386: DFBPPR8757 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.3387: DFBPPR8758 ---- Animal proteins ---- Caveolin-2
Source.3388: DFBPPR8759 ---- Animal proteins ---- Caveolin-3
Source.3389: DFBPPR8765 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.3390: DFBPPR8768 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.3391: DFBPPR8770 ---- Animal proteins ---- Golgi-resident adenosine 3',5'-bisphosphate 3'-phosphatase
Source.3392: DFBPPR8779 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.3393: DFBPPR8794 ---- Animal proteins ---- NPC intracellular cholesterol transporter 1
Source.3394: DFBPPR8797 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.3395: DFBPPR8817 ---- Animal proteins ---- Cytochrome b-245 heavy chain
Source.3396: DFBPPR8821 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.3397: DFBPPR8822 ---- Animal proteins ---- Apolipoprotein E
Source.3398: DFBPPR8834 ---- Animal proteins ---- 1-acylglycerol-3-phosphate O-acyltransferase ABHD5
Source.3399: DFBPPR8835 ---- Animal proteins ---- Iodotyrosine deiodinase 1
Source.3400: DFBPPR8837 ---- Animal proteins ---- Blood vessel epicardial substance
Source.3401: DFBPPR8839 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.3402: DFBPPR8849 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.3403: DFBPPR8850 ---- Animal proteins ---- ADP-ribosylation factor-like protein 3
Source.3404: DFBPPR8855 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.3405: DFBPPR8856 ---- Animal proteins ---- Alpha-(1,6)-fucosyltransferase
Source.3406: DFBPPR8858 ---- Animal proteins ---- Cell division cycle protein 20 homolog
Source.3407: DFBPPR8860 ---- Animal proteins ---- Nucleoside diphosphate kinase B
Source.3408: DFBPPR8868 ---- Animal proteins ---- Somatostatin receptor type 2
Source.3409: DFBPPR8879 ---- Animal proteins ---- Glandular kallikrein
Source.3410: DFBPPR8884 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3411: DFBPPR8902 ---- Animal proteins ---- Cytochrome P450 2E1
Source.3412: DFBPPR8905 ---- Animal proteins ---- Zonadhesin
Source.3413: DFBPPR8906 ---- Animal proteins ---- Sialidase-1
Source.3414: DFBPPR8908 ---- Animal proteins ---- Extracellular calcium-sensing receptor
Source.3415: DFBPPR8916 ---- Animal proteins ---- Glutaryl-CoA dehydrogenase, mitochondrial
Source.3416: DFBPPR8921 ---- Animal proteins ---- L-dopachrome tautomerase
Source.3417: DFBPPR8923 ---- Animal proteins ---- Cubilin
Source.3418: DFBPPR8924 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.3419: DFBPPR8925 ---- Animal proteins ---- Neutral alpha-glucosidase AB
Source.3420: DFBPPR8932 ---- Animal proteins ---- ATPase inhibitor, mitochondrial
Source.3421: DFBPPR8933 ---- Animal proteins ---- ATPase inhibitor, mitochondrial
Source.3422: DFBPPR8938 ---- Animal proteins ---- Polypeptide N-acetylgalactosaminyltransferase 1
Source.3423: DFBPPR8945 ---- Animal proteins ---- Coagulation factor V
Source.3424: DFBPPR8954 ---- Animal proteins ---- N-acetyllactosaminide alpha-1,3-galactosyltransferase
Source.3425: DFBPPR8969 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha
Source.3426: DFBPPR8972 ---- Animal proteins ---- Lutropin subunit beta
Source.3427: DFBPPR8978 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H4
Source.3428: DFBPPR8981 ---- Animal proteins ---- Deleted in malignant brain tumors 1 protein
Source.3429: DFBPPR8983 ---- Animal proteins ---- Receptor activity-modifying protein 1
Source.3430: DFBPPR8984 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.3431: DFBPPR8987 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase delta-4
Source.3432: DFBPPR8988 ---- Animal proteins ---- Erythropoietin
Source.3433: DFBPPR8990 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.3434: DFBPPR9004 ---- Animal proteins ---- Serum amyloid P-component
Source.3435: DFBPPR9008 ---- Animal proteins ---- Sterol regulatory element-binding protein cleavage-activating protein
Source.3436: DFBPPR9011 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.3437: DFBPPR9027 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.3438: DFBPPR9030 ---- Animal proteins ---- Beta-hexosaminidase subunit beta
Source.3439: DFBPPR9034 ---- Animal proteins ---- Carbohydrate-binding protein AWN
Source.3440: DFBPPR9041 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.3441: DFBPPR9042 ---- Animal proteins ---- 4-hydroxyphenylpyruvate dioxygenase
Source.3442: DFBPPR9043 ---- Animal proteins ---- Cytosol aminopeptidase
Source.3443: DFBPPR9047 ---- Animal proteins ---- BRCA1-A complex subunit RAP80
Source.3444: DFBPPR9051 ---- Animal proteins ---- Retinol-binding protein 4
Source.3445: DFBPPR9061 ---- Animal proteins ---- Caspase-1
Source.3446: DFBPPR9068 ---- Animal proteins ---- Epididymis-specific alpha-mannosidase
Source.3447: DFBPPR9073 ---- Animal proteins ---- Vitronectin
Source.3448: DFBPPR9079 ---- Animal proteins ---- Prolactin receptor
Source.3449: DFBPPR9080 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.3450: DFBPPR9086 ---- Animal proteins ---- Radical S-adenosyl methionine domain-containing protein 2
Source.3451: DFBPPR9093 ---- Animal proteins ---- Hemopexin
Source.3452: DFBPPR9096 ---- Animal proteins ---- Carboxypeptidase A1
Source.3453: DFBPPR9101 ---- Animal proteins ---- Cystathionine gamma-lyase
Source.3454: DFBPPR9103 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.3455: DFBPPR9104 ---- Animal proteins ---- Adenosine deaminase 2
Source.3456: DFBPPR9105 ---- Animal proteins ---- Lysine-specific demethylase 5C
Source.3457: DFBPPR9112 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.3458: DFBPPR9118 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.3459: DFBPPR9119 ---- Animal proteins ---- Glycine N-methyltransferase
Source.3460: DFBPPR9121 ---- Animal proteins ---- Endoplasmin
Source.3461: DFBPPR9122 ---- Animal proteins ---- Betaine--homocysteine S-methyltransferase 1
Source.3462: DFBPPR9126 ---- Animal proteins ---- Taurochenodeoxycholic 6 alpha-hydroxylase
Source.3463: DFBPPR9127 ---- Animal proteins ---- Transferrin receptor protein 1
Source.3464: DFBPPR9128 ---- Animal proteins ---- Interleukin-13
Source.3465: DFBPPR9132 ---- Animal proteins ---- Dystrophin
Source.3466: DFBPPR9136 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.3467: DFBPPR9157 ---- Animal proteins ---- POU domain, class 2, transcription factor 2
Source.3468: DFBPPR9164 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.3469: DFBPPR9190 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.3470: DFBPPR9195 ---- Animal proteins ---- Sex-determining region Y protein
Source.3471: DFBPPR9196 ---- Animal proteins ---- Steroid 21-hydroxylase
Source.3472: DFBPPR9200 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3473: DFBPPR9202 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2B
Source.3474: DFBPPR9212 ---- Animal proteins ---- Dihydrofolate reductase
Source.3475: DFBPPR9213 ---- Animal proteins ---- Chemokine-like receptor 1
Source.3476: DFBPPR9217 ---- Animal proteins ---- Coagulation factor VIII
Source.3477: DFBPPR9218 ---- Animal proteins ---- POU domain, class 3, transcription factor 3
Source.3478: DFBPPR9219 ---- Animal proteins ---- Coagulation factor XII
Source.3479: DFBPPR9220 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.3480: DFBPPR9221 ---- Animal proteins ---- Catalase
Source.3481: DFBPPR9225 ---- Animal proteins ---- Methylmalonyl-CoA mutase, mitochondrial
Source.3482: DFBPPR9227 ---- Animal proteins ---- Acylamino-acid-releasing enzyme
Source.3483: DFBPPR9228 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.3484: DFBPPR9229 ---- Animal proteins ---- Estrogen receptor beta
Source.3485: DFBPPR9230 ---- Animal proteins ---- Transcription factor SOX-10
Source.3486: DFBPPR9235 ---- Animal proteins ---- Apomucin
Source.3487: DFBPPR9236 ---- Animal proteins ---- Radixin
Source.3488: DFBPPR9245 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.3489: DFBPPR9246 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.3490: DFBPPR9248 ---- Animal proteins ---- 5-hydroxytryptamine receptor 2A
Source.3491: DFBPPR9253 ---- Animal proteins ---- Growth hormone-releasing hormone receptor
Source.3492: DFBPPR9255 ---- Animal proteins ---- Thimet oligopeptidase
Source.3493: DFBPPR9259 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.3494: DFBPPR9262 ---- Animal proteins ---- Phosphatidylinositol 3-kinase catalytic subunit type 3
Source.3495: DFBPPR9264 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.3496: DFBPPR9268 ---- Animal proteins ---- Vitamin D(3) 25-hydroxylase
Source.3497: DFBPPR9269 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.3498: DFBPPR9274 ---- Animal proteins ---- Lactosylceramide 1,3-N-acetyl-beta-D-glucosaminyltransferase
Source.3499: DFBPPR9277 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.3500: DFBPPR9279 ---- Animal proteins ---- PRA1 family protein 3
Source.3501: DFBPPR9283 ---- Animal proteins ---- Neuroendocrine convertase 2
Source.3502: DFBPPR9284 ---- Animal proteins ---- Transcription factor A, mitochondrial
Source.3503: DFBPPR9288 ---- Animal proteins ---- Beta-microseminoprotein
Source.3504: DFBPPR9289 ---- Animal proteins ---- Carbonic anhydrase 3
Source.3505: DFBPPR9299 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.3506: DFBPPR9308 ---- Animal proteins ---- Aromatase 3
Source.3507: DFBPPR9310 ---- Animal proteins ---- Vasopressin V2 receptor
Source.3508: DFBPPR9313 ---- Animal proteins ---- SRSF protein kinase 3
Source.3509: DFBPPR9314 ---- Animal proteins ---- Regucalcin
Source.3510: DFBPPR9316 ---- Animal proteins ---- Homeobox protein prophet of Pit-1
Source.3511: DFBPPR9320 ---- Animal proteins ---- Aromatase 1
Source.3512: DFBPPR9322 ---- Animal proteins ---- Solute carrier family 5 member 4
Source.3513: DFBPPR9324 ---- Animal proteins ---- Carbohydrate-binding protein AQN-3
Source.3514: DFBPPR9326 ---- Animal proteins ---- Tripartite motif-containing protein 26
Source.3515: DFBPPR9330 ---- Animal proteins ---- Receptor activity-modifying protein 3
Source.3516: DFBPPR9335 ---- Animal proteins ---- Galactose mutarotase
Source.3517: DFBPPR9336 ---- Animal proteins ---- Cholesterol 25-hydroxylase
Source.3518: DFBPPR9340 ---- Animal proteins ---- Orexin receptor type 2
Source.3519: DFBPPR9345 ---- Animal proteins ---- Relaxin-3
Source.3520: DFBPPR9354 ---- Animal proteins ---- D(1A) dopamine receptor
Source.3521: DFBPPR9357 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.3522: DFBPPR9360 ---- Animal proteins ---- Oxytocin receptor
Source.3523: DFBPPR9361 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.3524: DFBPPR9363 ---- Animal proteins ---- Moesin
Source.3525: DFBPPR9364 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.3526: DFBPPR9365 ---- Animal proteins ---- Aromatase 2
Source.3527: DFBPPR9371 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.3528: DFBPPR9376 ---- Animal proteins ---- Delta-type opioid receptor
Source.3529: DFBPPR9380 ---- Animal proteins ---- Gamma-interferon-inducible-lysosomal thiol reductase
Source.3530: DFBPPR9393 ---- Animal proteins ---- Neuropeptide Y receptor type 5
Source.3531: DFBPPR9396 ---- Animal proteins ---- GTP-binding protein SAR1b
Source.3532: DFBPPR9400 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.3533: DFBPPR9402 ---- Animal proteins ---- Small nuclear ribonucleoprotein E
Source.3534: DFBPPR9406 ---- Animal proteins ---- Creatine kinase B-type
Source.3535: DFBPPR9407 ---- Animal proteins ---- Creatine kinase B-type
Source.3536: DFBPPR9410 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3537: DFBPPR9411 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3538: DFBPPR9412 ---- Animal proteins ---- Acyl-CoA desaturase
Source.3539: DFBPPR9417 ---- Animal proteins ---- Signal transducer and activator of transcription 2
Source.3540: DFBPPR9423 ---- Animal proteins ---- E3 ubiquitin-protein ligase TRIM50
Source.3541: DFBPPR9433 ---- Animal proteins ---- Autophagy protein 5
Source.3542: DFBPPR9436 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.3543: DFBPPR9437 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.3544: DFBPPR9440 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.3545: DFBPPR9441 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.3546: DFBPPR9457 ---- Animal proteins ---- Dolichol-phosphate mannosyltransferase subunit 1
Source.3547: DFBPPR9458 ---- Animal proteins ---- Copper chaperone for superoxide dismutase
Source.3548: DFBPPR9465 ---- Animal proteins ---- Pro-epidermal growth factor
Source.3549: DFBPPR9467 ---- Animal proteins ---- Metalloreductase STEAP1
Source.3550: DFBPPR9483 ---- Animal proteins ---- Creatine kinase M-type
Source.3551: DFBPPR9484 ---- Animal proteins ---- Macoilin
Source.3552: DFBPPR9497 ---- Animal proteins ---- Myoglobin
Source.3553: DFBPPR9501 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.3554: DFBPPR9503 ---- Animal proteins ---- Sperm acrosome membrane-associated protein 1
Source.3555: DFBPPR9509 ---- Animal proteins ---- Unconventional myosin-VIIa
Source.3556: DFBPPR9511 ---- Animal proteins ---- Cholinesterase
Source.3557: DFBPPR9514 ---- Animal proteins ---- Cytochrome P450 4A24
Source.3558: DFBPPR9517 ---- Animal proteins ---- GTP-binding protein SAR1a
Source.3559: DFBPPR9527 ---- Animal proteins ---- Nuclear factor 1
Source.3560: DFBPPR9528 ---- Animal proteins ---- Cytochrome P450 4A25
Source.3561: DFBPPR9537 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.3562: DFBPPR9540 ---- Animal proteins ---- Geranylgeranyl transferase type-2 subunit alpha
Source.3563: DFBPPR9543 ---- Animal proteins ---- Beta-glucuronidase
Source.3564: DFBPPR9546 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1E
Source.3565: DFBPPR9548 ---- Animal proteins ---- Membrane progestin receptor alpha
Source.3566: DFBPPR9554 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.3567: DFBPPR9557 ---- Animal proteins ---- Complement C1q subcomponent subunit A
Source.3568: DFBPPR9558 ---- Animal proteins ---- Gap junction alpha-4 protein
Source.3569: DFBPPR9564 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H2
Source.3570: DFBPPR9565 ---- Animal proteins ---- Melanoma-associated antigen D1
Source.3571: DFBPPR9566 ---- Animal proteins ---- Choline transporter-like protein 2
Source.3572: DFBPPR9568 ---- Animal proteins ---- Antibacterial peptide PMAP-23
Source.3573: DFBPPR9569 ---- Animal proteins ---- Myelin proteolipid protein
Source.3574: DFBPPR9576 ---- Animal proteins ---- Lysoplasmalogenase
Source.3575: DFBPPR9600 ---- Animal proteins ---- P2Y purinoceptor 2
Source.3576: DFBPPR9601 ---- Animal proteins ---- 28S ribosomal protein S18b, mitochondrial
Source.3577: DFBPPR9610 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.3578: DFBPPR9616 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.3579: DFBPPR9631 ---- Animal proteins ---- Lithostathine
Source.3580: DFBPPR9632 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.3581: DFBPPR9648 ---- Animal proteins ---- Secretogranin-2
Source.3582: DFBPPR9651 ---- Animal proteins ---- Bestrophin-1
Source.3583: DFBPPR9660 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 2
Source.3584: DFBPPR9663 ---- Animal proteins ---- Elongation factor 1-gamma
Source.3585: DFBPPR9666 ---- Animal proteins ---- Orexin receptor type 1
Source.3586: DFBPPR9680 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.3587: DFBPPR9685 ---- Animal proteins ---- Interleukin-27 subunit alpha
Source.3588: DFBPPR9689 ---- Animal proteins ---- G-protein coupled receptor 4
Source.3589: DFBPPR9692 ---- Animal proteins ---- Mitochondria-eating protein
Source.3590: DFBPPR9694 ---- Animal proteins ---- Membrane progestin receptor beta
Source.3591: DFBPPR9695 ---- Animal proteins ---- Seminal plasma sperm motility inhibitor
Source.3592: DFBPPR9701 ---- Animal proteins ---- G-protein coupled receptor 39
Source.3593: DFBPPR9703 ---- Animal proteins ---- Membrane-associated transporter protein
Source.3594: DFBPPR9714 ---- Animal proteins ---- Vasoactive intestinal polypeptide receptor 1
Source.3595: DFBPPR9723 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D alpha chain
Source.3596: DFBPPR9724 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.3597: DFBPPR9727 ---- Animal proteins ---- FAST kinase domain-containing protein 4
Source.3598: DFBPPR9729 ---- Animal proteins ---- Secretagogin
Source.3599: DFBPPR9735 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype C alpha chain
Source.3600: DFBPPR9743 ---- Animal proteins ---- SLA class II histocompatibility antigen, DQ haplotype D beta chain
Source.3601: DFBPPR9746 ---- Animal proteins ---- Valine--tRNA ligase, mitochondrial
Source.3602: DFBPPR9749 ---- Animal proteins ---- Guanylin
Source.3603: DFBPPR9750 ---- Animal proteins ---- 60S ribosome subunit biogenesis protein NIP7 homolog
Source.3604: DFBPPR9756 ---- Animal proteins ---- Sodium/glucose cotransporter 5
Source.3605: DFBPPR9760 ---- Animal proteins ---- Tripartite motif-containing protein 10
Source.3606: DFBPPR9767 ---- Animal proteins ---- NADH dehydrogenase [ubiquinone] 1 beta subcomplex subunit 6
Source.3607: DFBPPR9781 ---- Animal proteins ---- Tripartite motif-containing protein 15
Source.3608: DFBPPR9783 ---- Animal proteins ---- Importin subunit alpha-8
Source.3609: DFBPPR9784 ---- Animal proteins ---- Translocator protein
Source.3610: DFBPPR9786 ---- Animal proteins ---- Adipogenin
Source.3611: DFBPPR9791 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.3612: DFBPPR9799 ---- Animal proteins ---- Cysteinyl leukotriene receptor 2
Source.3613: DFBPPR9813 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.3614: DFBPPR9818 ---- Animal proteins ---- Calpain-7
Source.3615: DFBPPR9819 ---- Animal proteins ---- 40S ribosomal protein S9
Source.3616: DFBPPR9820 ---- Animal proteins ---- WD repeat-containing protein 62
Source.3617: DFBPPR9828 ---- Animal proteins ---- Dynein light chain 4, axonemal
Source.3618: DFBPPR9831 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.3619: DFBPPR9843 ---- Animal proteins ---- P protein
Source.3620: DFBPPR9853 ---- Animal proteins ---- Tubulin--tyrosine ligase
Source.3621: DFBPPR9873 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.3622: DFBPPR9874 ---- Animal proteins ---- Fat storage-inducing transmembrane protein 1
Source.3623: DFBPPR9881 ---- Animal proteins ---- 60S ribosomal protein L31
Source.3624: DFBPPR9893 ---- Animal proteins ---- MICOS complex subunit MIC13
Source.3625: DFBPPR9915 ---- Animal proteins ---- Uteroferrin-associated basic protein 2
Source.3626: DFBPPR9917 ---- Animal proteins ---- Proteasome activator complex subunit 2
Source.3627: DFBPPR9934 ---- Animal proteins ---- Heme-binding protein 1
Source.3628: DFBPPR9937 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.3629: DFBPPR9948 ---- Animal proteins ---- Vertnin
Source.3630: DFBPPR9949 ---- Animal proteins ---- Coiled-coil domain-containing protein 127
Source.3631: DFBPPR9952 ---- Animal proteins ---- Serine/threonine-protein kinase TAO3
Source.3632: DFBPPR9954 ---- Animal proteins ---- Tolloid-like protein 1
Source.3633: DFBPPR9956 ---- Animal proteins ---- Fatty acid synthase
Source.3634: DFBPPR9958 ---- Animal proteins ---- Triosephosphate isomerase
Source.3635: DFBPPR9967 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.3636: DFBPPR9976 ---- Animal proteins ---- Red-sensitive opsin
Source.3637: DFBPPR9977 ---- Animal proteins ---- Signal transducer and activator of transcription 3
Source.3638: DFBPPR9979 ---- Animal proteins ---- Aminopeptidase Ey
Source.3639: DFBPPR9980 ---- Animal proteins ---- Cathelicidin-1
Source.3640: DFBPPR9981 ---- Animal proteins ---- Collagen alpha-1(I) chain
Source.3641: DFBPPR9983 ---- Animal proteins ---- Fibrinogen alpha chain
Source.3642: DFBPPR9985 ---- Animal proteins ---- Collagen alpha-1(II) chain
Source.3643: DFBPPR9990 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.3644: DFBPPR9992 ---- Animal proteins ---- Receptor of activated protein C kinase 1
Source.3645: DFBPPR9995 ---- Animal proteins ---- Melanocyte protein PMEL
Source.3646: DFBPPR10001 ---- Animal proteins ---- Fibrinogen beta chain
Source.3647: DFBPPR10002 ---- Animal proteins ---- Creatine kinase B-type
Source.3648: DFBPPR10006 ---- Animal proteins ---- Toll-like receptor 2 type-1
Source.3649: DFBPPR10011 ---- Animal proteins ---- Myosin-11
Source.3650: DFBPPR10013 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Src
Source.3651: DFBPPR10021 ---- Animal proteins ---- NT-3 growth factor receptor
Source.3652: DFBPPR10027 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1D
Source.3653: DFBPPR10029 ---- Animal proteins ---- Activin receptor type-2B
Source.3654: DFBPPR10034 ---- Animal proteins ---- Tyrosine-protein kinase SYK
Source.3655: DFBPPR10035 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.3656: DFBPPR10036 ---- Animal proteins ---- Acetyl-CoA carboxylase
Source.3657: DFBPPR10039 ---- Animal proteins ---- Activin receptor type-2A
Source.3658: DFBPPR10040 ---- Animal proteins ---- Estrogen receptor
Source.3659: DFBPPR10047 ---- Animal proteins ---- Ovocleidin-116
Source.3660: DFBPPR10048 ---- Animal proteins ---- Tyrosine-protein kinase Yes
Source.3661: DFBPPR10061 ---- Animal proteins ---- Ovocleidin-17
Source.3662: DFBPPR10062 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 11
Source.3663: DFBPPR10068 ---- Animal proteins ---- Transcription factor SOX-9
Source.3664: DFBPPR10069 ---- Animal proteins ---- DNA topoisomerase 2-alpha
Source.3665: DFBPPR10075 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.3666: DFBPPR10076 ---- Animal proteins ---- Bifunctional arginine demethylase and lysyl-hydroxylase JMJD6
Source.3667: DFBPPR10083 ---- Animal proteins ---- Myosin-9
Source.3668: DFBPPR10084 ---- Animal proteins ---- Nuclear factor 1 B-type
Source.3669: DFBPPR10086 ---- Animal proteins ---- Phosphoenolpyruvate carboxykinase [GTP], mitochondrial
Source.3670: DFBPPR10087 ---- Animal proteins ---- Pituitary homeobox 2
Source.3671: DFBPPR10089 ---- Animal proteins ---- Lysyl oxidase homolog 2
Source.3672: DFBPPR10090 ---- Animal proteins ---- Lissencephaly-1 homolog
Source.3673: DFBPPR10095 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase S
Source.3674: DFBPPR10096 ---- Animal proteins ---- BDNF/NT-3 growth factors receptor
Source.3675: DFBPPR10101 ---- Animal proteins ---- Lysophosphatidylserine lipase ABHD12
Source.3676: DFBPPR10102 ---- Animal proteins ---- Cyclin-dependent kinase 1
Source.3677: DFBPPR10103 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.3678: DFBPPR10105 ---- Animal proteins ---- ADP-ribosylation factor 6
Source.3679: DFBPPR10106 ---- Animal proteins ---- Glycerol-3-phosphate acyltransferase 3
Source.3680: DFBPPR10112 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-2
Source.3681: DFBPPR10114 ---- Animal proteins ---- Cadherin-5
Source.3682: DFBPPR10116 ---- Animal proteins ---- Cadherin-2
Source.3683: DFBPPR10119 ---- Animal proteins ---- Down syndrome cell adhesion molecule homolog
Source.3684: DFBPPR10120 ---- Animal proteins ---- Ephrin type-B receptor 2
Source.3685: DFBPPR10124 ---- Animal proteins ---- Gamma-aminobutyric acid receptor subunit gamma-2
Source.3686: DFBPPR10128 ---- Animal proteins ---- Focal adhesion kinase 1
Source.3687: DFBPPR10133 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.3688: DFBPPR10135 ---- Animal proteins ---- Serine/threonine-protein kinase B-raf
Source.3689: DFBPPR10138 ---- Animal proteins ---- Epidermal growth factor receptor
Source.3690: DFBPPR10143 ---- Animal proteins ---- Lysophospholipid acyltransferase 2
Source.3691: DFBPPR10144 ---- Animal proteins ---- Succinate dehydrogenase [ubiquinone] flavoprotein subunit, mitochondrial
Source.3692: DFBPPR10147 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase ROS
Source.3693: DFBPPR10149 ---- Animal proteins ---- Calpain-2 catalytic subunit
Source.3694: DFBPPR10156 ---- Animal proteins ---- Mothers against decapentaplegic homolog 5
Source.3695: DFBPPR10164 ---- Animal proteins ---- Insulin-like growth factor II
Source.3696: DFBPPR10167 ---- Animal proteins ---- Paired mesoderm homeobox protein 1
Source.3697: DFBPPR10168 ---- Animal proteins ---- TALPID3 protein
Source.3698: DFBPPR10175 ---- Animal proteins ---- Platelet-derived growth factor receptor alpha
Source.3699: DFBPPR10180 ---- Animal proteins ---- Teneurin-2
Source.3700: DFBPPR10181 ---- Animal proteins ---- Retinoid isomerohydrolase
Source.3701: DFBPPR10183 ---- Animal proteins ---- Villin-1
Source.3702: DFBPPR10184 ---- Animal proteins ---- LIM/homeobox protein Lhx1
Source.3703: DFBPPR10186 ---- Animal proteins ---- Insulin gene enhancer protein ISL-1
Source.3704: DFBPPR10190 ---- Animal proteins ---- TGF-beta receptor type-2
Source.3705: DFBPPR10192 ---- Animal proteins ---- Vascular endothelial growth factor receptor 1
Source.3706: DFBPPR10194 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase Yrk
Source.3707: DFBPPR10199 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.3708: DFBPPR10200 ---- Animal proteins ---- Ephrin type-A receptor 4
Source.3709: DFBPPR10201 ---- Animal proteins ---- Ephrin type-B receptor 1
Source.3710: DFBPPR10204 ---- Animal proteins ---- Neuronal cell adhesion molecule
Source.3711: DFBPPR10205 ---- Animal proteins ---- Noelin
Source.3712: DFBPPR10206 ---- Animal proteins ---- Unconventional myosin-VI
Source.3713: DFBPPR10210 ---- Animal proteins ---- Fibroblast growth factor receptor 1
Source.3714: DFBPPR10211 ---- Animal proteins ---- Fibroblast growth factor receptor 2
Source.3715: DFBPPR10213 ---- Animal proteins ---- Glycerophosphodiester phosphodiesterase domain-containing protein 5
Source.3716: DFBPPR10215 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.3717: DFBPPR10219 ---- Animal proteins ---- Presenilin-1
Source.3718: DFBPPR10224 ---- Animal proteins ---- Prolyl 3-hydroxylase 1
Source.3719: DFBPPR10232 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-4
Source.3720: DFBPPR10234 ---- Animal proteins ---- Fibroblast growth factor receptor 3
Source.3721: DFBPPR10236 ---- Animal proteins ---- Acid-sensing ion channel 1
Source.3722: DFBPPR10237 ---- Animal proteins ---- Serine/threonine-protein kinase Chk1
Source.3723: DFBPPR10241 ---- Animal proteins ---- Ephrin type-A receptor 7
Source.3724: DFBPPR10244 ---- Animal proteins ---- Inhibin beta A chain
Source.3725: DFBPPR10251 ---- Animal proteins ---- Integrin alpha-6
Source.3726: DFBPPR10255 ---- Animal proteins ---- Tyrosine-protein kinase Fyn
Source.3727: DFBPPR10257 ---- Animal proteins ---- Inner centromere protein
Source.3728: DFBPPR10258 ---- Animal proteins ---- Ephrin type-A receptor 5
Source.3729: DFBPPR10259 ---- Animal proteins ---- Frizzled-4
Source.3730: DFBPPR10263 ---- Animal proteins ---- Ephrin type-B receptor 3
Source.3731: DFBPPR10266 ---- Animal proteins ---- Transcription factor GATA-6
Source.3732: DFBPPR10269 ---- Animal proteins ---- Activin receptor type-1
Source.3733: DFBPPR10270 ---- Animal proteins ---- Agrin
Source.3734: DFBPPR10271 ---- Animal proteins ---- Cadherin-7
Source.3735: DFBPPR10275 ---- Animal proteins ---- Bone morphogenetic protein receptor type-1B
Source.3736: DFBPPR10277 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.3737: DFBPPR10278 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.3738: DFBPPR10279 ---- Animal proteins ---- Platelet-derived growth factor C
Source.3739: DFBPPR10281 ---- Animal proteins ---- GTP-binding nuclear protein Ran
Source.3740: DFBPPR10282 ---- Animal proteins ---- Reversion-inducing cysteine-rich protein with Kazal motifs
Source.3741: DFBPPR10283 ---- Animal proteins ---- Mothers against decapentaplegic homolog 6
Source.3742: DFBPPR10287 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.3743: DFBPPR10289 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.3744: DFBPPR10293 ---- Animal proteins ---- Toll-like receptor 2 type-2
Source.3745: DFBPPR10295 ---- Animal proteins ---- NAD-dependent protein deacylase sirtuin-5, mitochondrial
Source.3746: DFBPPR10297 ---- Animal proteins ---- Vitellogenin-2
Source.3747: DFBPPR10298 ---- Animal proteins ---- Caldesmon
Source.3748: DFBPPR10300 ---- Animal proteins ---- Unconventional myosin-Va
Source.3749: DFBPPR10301 ---- Animal proteins ---- Transcription factor SOX-2
Source.3750: DFBPPR10314 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.3751: DFBPPR10319 ---- Animal proteins ---- Actin, alpha cardiac muscle 1
Source.3752: DFBPPR10323 ---- Animal proteins ---- Tyrosine-protein kinase BTK
Source.3753: DFBPPR10324 ---- Animal proteins ---- CCR4-NOT transcription complex subunit 7
Source.3754: DFBPPR10329 ---- Animal proteins ---- Activity-regulated cytoskeleton-associated protein
Source.3755: DFBPPR10331 ---- Animal proteins ---- Calcineurin B homologous protein 3
Source.3756: DFBPPR10332 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 1
Source.3757: DFBPPR10337 ---- Animal proteins ---- Alpha-tectorin
Source.3758: DFBPPR10338 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.3759: DFBPPR10340 ---- Animal proteins ---- F-box DNA helicase 1
Source.3760: DFBPPR10347 ---- Animal proteins ---- Proto-oncogene tyrosine-protein kinase LCK
Source.3761: DFBPPR10351 ---- Animal proteins ---- Protein sidekick-2
Source.3762: DFBPPR10356 ---- Animal proteins ---- RNA cytosine-C(5)-methyltransferase NSUN2
Source.3763: DFBPPR10360 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-3
Source.3764: DFBPPR10361 ---- Animal proteins ---- Protein HIRA
Source.3765: DFBPPR10365 ---- Animal proteins ---- Delta(14)-sterol reductase LBR
Source.3766: DFBPPR10378 ---- Animal proteins ---- Muscle, skeletal receptor tyrosine protein kinase
Source.3767: DFBPPR10383 ---- Animal proteins ---- Cryptochrome-1
Source.3768: DFBPPR10384 ---- Animal proteins ---- Myosin-binding protein C, cardiac-type
Source.3769: DFBPPR10387 ---- Animal proteins ---- DNA-directed primase/polymerase protein
Source.3770: DFBPPR10388 ---- Animal proteins ---- Ephrin type-B receptor 5
Source.3771: DFBPPR10390 ---- Animal proteins ---- Protein sidekick-1
Source.3772: DFBPPR10392 ---- Animal proteins ---- Transcription factor p65
Source.3773: DFBPPR10393 ---- Animal proteins ---- Vitellogenin-1
Source.3774: DFBPPR10397 ---- Animal proteins ---- Tyrosine-protein kinase receptor TYRO3
Source.3775: DFBPPR10398 ---- Animal proteins ---- Inhibitor of nuclear factor kappa-B kinase subunit alpha
Source.3776: DFBPPR10399 ---- Animal proteins ---- Beta-galactoside alpha-2,6-sialyltransferase 1
Source.3777: DFBPPR10401 ---- Animal proteins ---- Heparanase
Source.3778: DFBPPR10404 ---- Animal proteins ---- Tyrosine-protein kinase JAK2
Source.3779: DFBPPR10411 ---- Animal proteins ---- DNA-dependent protein kinase catalytic subunit
Source.3780: DFBPPR10413 ---- Animal proteins ---- Ectonucleoside triphosphate diphosphohydrolase 8
Source.3781: DFBPPR10415 ---- Animal proteins ---- Semaphorin-3A
Source.3782: DFBPPR10422 ---- Animal proteins ---- Collagen alpha-1(XII) chain
Source.3783: DFBPPR10423 ---- Animal proteins ---- Sortilin-related receptor
Source.3784: DFBPPR10425 ---- Animal proteins ---- Fanconi anemia group J protein homolog
Source.3785: DFBPPR10426 ---- Animal proteins ---- Transcription factor SOX-10
Source.3786: DFBPPR10429 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-5
Source.3787: DFBPPR10430 ---- Animal proteins ---- Transferrin receptor protein 1
Source.3788: DFBPPR10431 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.3789: DFBPPR10432 ---- Animal proteins ---- Endoplasmin
Source.3790: DFBPPR10433 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.3791: DFBPPR10442 ---- Animal proteins ---- Neurexin-1
Source.3792: DFBPPR10443 ---- Animal proteins ---- Retinal dehydrogenase 2
Source.3793: DFBPPR10444 ---- Animal proteins ---- 5-aminolevulinate synthase, nonspecific, mitochondrial
Source.3794: DFBPPR10445 ---- Animal proteins ---- Collagen alpha-1(XVII) chain
Source.3795: DFBPPR10446 ---- Animal proteins ---- Protein Wnt-8c
Source.3796: DFBPPR10454 ---- Animal proteins ---- Fibroblast growth factor receptor-like 1
Source.3797: DFBPPR10457 ---- Animal proteins ---- Transcriptional enhancer factor TEF-3
Source.3798: DFBPPR10458 ---- Animal proteins ---- Neurofascin
Source.3799: DFBPPR10459 ---- Animal proteins ---- Reelin
Source.3800: DFBPPR10460 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-4
Source.3801: DFBPPR10461 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.3802: DFBPPR10465 ---- Animal proteins ---- Type II iodothyronine deiodinase
Source.3803: DFBPPR10470 ---- Animal proteins ---- Collagen alpha-1(III) chain
Source.3804: DFBPPR10471 ---- Animal proteins ---- Transcription factor SOX-21
Source.3805: DFBPPR10475 ---- Animal proteins ---- Adenylate cyclase type 9
Source.3806: DFBPPR10476 ---- Animal proteins ---- CAP-Gly domain-containing linker protein 1
Source.3807: DFBPPR10478 ---- Animal proteins ---- Actin, gamma-enteric smooth muscle
Source.3808: DFBPPR10482 ---- Animal proteins ---- ATP-dependent RNA helicase DDX1
Source.3809: DFBPPR10483 ---- Animal proteins ---- Mitochondrial sodium/calcium exchanger protein
Source.3810: DFBPPR10488 ---- Animal proteins ---- Sulfite oxidase
Source.3811: DFBPPR10492 ---- Animal proteins ---- Nuclear cap-binding protein subunit 1
Source.3812: DFBPPR10499 ---- Animal proteins ---- Prolactin receptor
Source.3813: DFBPPR10509 ---- Animal proteins ---- Calponin-1
Source.3814: DFBPPR10512 ---- Animal proteins ---- Collagen alpha-1(XIV) chain
Source.3815: DFBPPR10513 ---- Animal proteins ---- Parafibromin
Source.3816: DFBPPR10516 ---- Animal proteins ---- Adseverin
Source.3817: DFBPPR10523 ---- Animal proteins ---- Mitogen-activated protein kinase 9
Source.3818: DFBPPR10526 ---- Animal proteins ---- LIM domain kinase 2
Source.3819: DFBPPR10529 ---- Animal proteins ---- Cadherin-20
Source.3820: DFBPPR10533 ---- Animal proteins ---- DNA repair protein REV1
Source.3821: DFBPPR10540 ---- Animal proteins ---- Nucleoside diphosphate kinase
Source.3822: DFBPPR10547 ---- Animal proteins ---- Creatine kinase M-type
Source.3823: DFBPPR10551 ---- Animal proteins ---- Muscarinic acetylcholine receptor M2
Source.3824: DFBPPR10553 ---- Animal proteins ---- Piwi-like protein 1
Source.3825: DFBPPR10554 ---- Animal proteins ---- Creatine kinase S-type, mitochondrial
Source.3826: DFBPPR10559 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 3
Source.3827: DFBPPR10565 ---- Animal proteins ---- Acetylcholine receptor subunit delta
Source.3828: DFBPPR10568 ---- Animal proteins ---- 1-phosphatidylinositol 4,5-bisphosphate phosphodiesterase zeta-1
Source.3829: DFBPPR10571 ---- Animal proteins ---- Gap junction gamma-1 protein
Source.3830: DFBPPR10572 ---- Animal proteins ---- Protein Wnt-7b
Source.3831: DFBPPR10579 ---- Animal proteins ---- Lysine-specific demethylase 5B
Source.3832: DFBPPR10587 ---- Animal proteins ---- Beta-tectorin
Source.3833: DFBPPR10593 ---- Animal proteins ---- Mitogen-activated protein kinase 6
Source.3834: DFBPPR10594 ---- Animal proteins ---- Aromatase
Source.3835: DFBPPR10596 ---- Animal proteins ---- FERM, ARHGEF and pleckstrin domain-containing protein 1
Source.3836: DFBPPR10601 ---- Animal proteins ---- DNA mismatch repair protein Msh6
Source.3837: DFBPPR10602 ---- Animal proteins ---- DNA (cytosine-5)-methyltransferase 3A
Source.3838: DFBPPR10606 ---- Animal proteins ---- Unconventional myosin-Ic
Source.3839: DFBPPR10609 ---- Animal proteins ---- Homeobox protein DLX-5
Source.3840: DFBPPR10610 ---- Animal proteins ---- Denticleless protein homolog
Source.3841: DFBPPR10626 ---- Animal proteins ---- Class I histocompatibility antigen, F10 alpha chain
Source.3842: DFBPPR10630 ---- Animal proteins ---- Contactin-2
Source.3843: DFBPPR10633 ---- Animal proteins ---- Astacin-like metalloendopeptidase
Source.3844: DFBPPR10636 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 1
Source.3845: DFBPPR10639 ---- Animal proteins ---- Actin-related protein 3
Source.3846: DFBPPR10641 ---- Animal proteins ---- Signal peptide peptidase-like 2B
Source.3847: DFBPPR10650 ---- Animal proteins ---- Gelsolin
Source.3848: DFBPPR10659 ---- Animal proteins ---- Low-density lipoprotein receptor-related protein 8
Source.3849: DFBPPR10661 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase U
Source.3850: DFBPPR10663 ---- Animal proteins ---- L-dopachrome tautomerase
Source.3851: DFBPPR10665 ---- Animal proteins ---- Mitochondrial fission regulator 1
Source.3852: DFBPPR10670 ---- Animal proteins ---- Interferon lambda-3
Source.3853: DFBPPR10671 ---- Animal proteins ---- Cilia- and flagella-associated protein 65
Source.3854: DFBPPR10673 ---- Animal proteins ---- Katanin p80 WD40 repeat-containing subunit B1
Source.3855: DFBPPR10690 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.3856: DFBPPR10693 ---- Animal proteins ---- Ferrochelatase, mitochondrial
Source.3857: DFBPPR10694 ---- Animal proteins ---- Dihydrofolate reductase
Source.3858: DFBPPR10695 ---- Animal proteins ---- Telomeric repeat-binding factor 2-interacting protein 1
Source.3859: DFBPPR10699 ---- Animal proteins ---- Acetylcholinesterase
Source.3860: DFBPPR10705 ---- Animal proteins ---- Endoribonuclease Dicer
Source.3861: DFBPPR10710 ---- Animal proteins ---- Linker for activation of T-cells family member 2
Source.3862: DFBPPR10714 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-9
Source.3863: DFBPPR10716 ---- Animal proteins ---- Long-chain-fatty-acid--CoA ligase ACSBG2
Source.3864: DFBPPR10717 ---- Animal proteins ---- Tyrosine-protein phosphatase non-receptor type 1
Source.3865: DFBPPR10721 ---- Animal proteins ---- Limb region 1 protein homolog
Source.3866: DFBPPR10725 ---- Animal proteins ---- Cryptochrome-2
Source.3867: DFBPPR10729 ---- Animal proteins ---- Versican core protein
Source.3868: DFBPPR10731 ---- Animal proteins ---- Protein cereblon
Source.3869: DFBPPR10732 ---- Animal proteins ---- General transcription and DNA repair factor IIH helicase subunit XPB
Source.3870: DFBPPR10735 ---- Animal proteins ---- Semaphorin-3E
Source.3871: DFBPPR10736 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A1
Source.3872: DFBPPR10739 ---- Animal proteins ---- Transcription factor SOX-14
Source.3873: DFBPPR10741 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.3874: DFBPPR10742 ---- Animal proteins ---- LIM/homeobox protein Lhx3
Source.3875: DFBPPR10743 ---- Animal proteins ---- Phosphatidylcholine:ceramide cholinephosphotransferase 1
Source.3876: DFBPPR10746 ---- Animal proteins ---- P2Y purinoceptor 1
Source.3877: DFBPPR10757 ---- Animal proteins ---- Hemoglobin subunit epsilon
Source.3878: DFBPPR10771 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3879: DFBPPR10772 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3880: DFBPPR10773 ---- Animal proteins ---- POU domain, class 5, transcription factor 3
Source.3881: DFBPPR10777 ---- Animal proteins ---- Actin, cytoplasmic type 5
Source.3882: DFBPPR10791 ---- Animal proteins ---- Histone-binding protein RBBP4
Source.3883: DFBPPR10795 ---- Animal proteins ---- Amidophosphoribosyltransferase
Source.3884: DFBPPR10798 ---- Animal proteins ---- 5,6-dihydroxyindole-2-carboxylic acid oxidase
Source.3885: DFBPPR10800 ---- Animal proteins ---- DNA polymerase subunit gamma-1
Source.3886: DFBPPR10803 ---- Animal proteins ---- Cholesteryl ester transfer protein
Source.3887: DFBPPR10804 ---- Animal proteins ---- Integrin alpha-V
Source.3888: DFBPPR10807 ---- Animal proteins ---- Dystrophin
Source.3889: DFBPPR10808 ---- Animal proteins ---- S-phase kinase-associated protein 1
Source.3890: DFBPPR10810 ---- Animal proteins ---- Actin, cytoplasmic 2
Source.3891: DFBPPR10812 ---- Animal proteins ---- Cadherin-11
Source.3892: DFBPPR10815 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-10
Source.3893: DFBPPR10818 ---- Animal proteins ---- Tyrosine-protein kinase CSK
Source.3894: DFBPPR10827 ---- Animal proteins ---- Alpha-N-acetylgalactosaminide alpha-2,6-sialyltransferase 1
Source.3895: DFBPPR10833 ---- Animal proteins ---- Putative helicase MOV-10
Source.3896: DFBPPR10842 ---- Animal proteins ---- Zinc transporter 5
Source.3897: DFBPPR10846 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.3898: DFBPPR10847 ---- Animal proteins ---- Protein patched homolog 1
Source.3899: DFBPPR10850 ---- Animal proteins ---- Ovostatin
Source.3900: DFBPPR10855 ---- Animal proteins ---- Transcription factor SOX-3
Source.3901: DFBPPR10857 ---- Animal proteins ---- Smoothened homolog
Source.3902: DFBPPR10863 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.3903: DFBPPR10864 ---- Animal proteins ---- Cyclin-dependent kinase 9
Source.3904: DFBPPR10865 ---- Animal proteins ---- Transgelin
Source.3905: DFBPPR10868 ---- Animal proteins ---- Double-strand break repair protein MRE11
Source.3906: DFBPPR10869 ---- Animal proteins ---- Ribosomal oxygenase 1
Source.3907: DFBPPR10872 ---- Animal proteins ---- Inactive tyrosine-protein kinase 7
Source.3908: DFBPPR10874 ---- Animal proteins ---- Alkaline phosphatase, tissue-nonspecific isozyme
Source.3909: DFBPPR10876 ---- Animal proteins ---- Telomere-associated protein RIF1
Source.3910: DFBPPR10883 ---- Animal proteins ---- LARGE xylosyl- and glucuronyltransferase 2
Source.3911: DFBPPR10889 ---- Animal proteins ---- NAD(P)(+)--arginine ADP-ribosyltransferase 1
Source.3912: DFBPPR10890 ---- Animal proteins ---- Thioredoxin reductase-like selenoprotein T
Source.3913: DFBPPR10892 ---- Animal proteins ---- Myogenic factor 5
Source.3914: DFBPPR10894 ---- Animal proteins ---- Globoside alpha-1,3-N-acetylgalactosaminyltransferase 1
Source.3915: DFBPPR10900 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.3916: DFBPPR10901 ---- Animal proteins ---- Protein arginine N-methyltransferase 7
Source.3917: DFBPPR10905 ---- Animal proteins ---- Probable G-protein coupled receptor 149
Source.3918: DFBPPR10912 ---- Animal proteins ---- Neurexin-3-beta
Source.3919: DFBPPR10913 ---- Animal proteins ---- Myocyte-specific enhancer factor 2A
Source.3920: DFBPPR10915 ---- Animal proteins ---- Hepatic lectin
Source.3921: DFBPPR10918 ---- Animal proteins ---- Frizzled-2
Source.3922: DFBPPR10921 ---- Animal proteins ---- CUGBP Elav-like family member 1
Source.3923: DFBPPR10922 ---- Animal proteins ---- P2Y purinoceptor 3
Source.3924: DFBPPR10926 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 2
Source.3925: DFBPPR10927 ---- Animal proteins ---- Frizzled-7
Source.3926: DFBPPR10928 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 28
Source.3927: DFBPPR10930 ---- Animal proteins ---- WD repeat-containing protein 48
Source.3928: DFBPPR10935 ---- Animal proteins ---- Protein O-linked-mannose beta-1,4-N-acetylglucosaminyltransferase 2
Source.3929: DFBPPR10936 ---- Animal proteins ---- Ephrin-A2
Source.3930: DFBPPR10940 ---- Animal proteins ---- Protein piccolo
Source.3931: DFBPPR10945 ---- Animal proteins ---- Prosaposin
Source.3932: DFBPPR10946 ---- Animal proteins ---- Corticotropin-releasing factor receptor 1
Source.3933: DFBPPR10947 ---- Animal proteins ---- Cytosolic carboxypeptidase 1
Source.3934: DFBPPR10953 ---- Animal proteins ---- DNA repair and recombination protein RAD54-like
Source.3935: DFBPPR10956 ---- Animal proteins ---- Estrogen receptor beta
Source.3936: DFBPPR10957 ---- Animal proteins ---- Hemoglobin subunit rho
Source.3937: DFBPPR10959 ---- Animal proteins ---- Nuclear factor 1 A-type
Source.3938: DFBPPR10961 ---- Animal proteins ---- Nuclear factor 1 C-type
Source.3939: DFBPPR10964 ---- Animal proteins ---- Protein artemis
Source.3940: DFBPPR10965 ---- Animal proteins ---- Nuclear factor 1 X-type
Source.3941: DFBPPR10967 ---- Animal proteins ---- Interphotoreceptor matrix proteoglycan 2
Source.3942: DFBPPR10968 ---- Animal proteins ---- Visual system homeobox 2
Source.3943: DFBPPR10976 ---- Animal proteins ---- Lamin-B2
Source.3944: DFBPPR10978 ---- Animal proteins ---- Alpha-1,3-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase A
Source.3945: DFBPPR10985 ---- Animal proteins ---- Myotubularin-related protein 8
Source.3946: DFBPPR10986 ---- Animal proteins ---- Phosphoglycerate kinase
Source.3947: DFBPPR10989 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit alpha-2
Source.3948: DFBPPR10992 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.3949: DFBPPR10998 ---- Animal proteins ---- Prolyl 4-hydroxylase subunit alpha-1
Source.3950: DFBPPR10999 ---- Animal proteins ---- Adenosine receptor A1
Source.3951: DFBPPR11001 ---- Animal proteins ---- Neuronal acetylcholine receptor subunit beta-3
Source.3952: DFBPPR11002 ---- Animal proteins ---- Cartilage matrix protein
Source.3953: DFBPPR11003 ---- Animal proteins ---- Acetylcholine receptor subunit gamma
Source.3954: DFBPPR11006 ---- Animal proteins ---- Argininosuccinate synthase
Source.3955: DFBPPR11013 ---- Animal proteins ---- Band 3 anion transport protein
Source.3956: DFBPPR11014 ---- Animal proteins ---- NEDD8-conjugating enzyme UBE2F
Source.3957: DFBPPR11019 ---- Animal proteins ---- Cadherin-4
Source.3958: DFBPPR11023 ---- Animal proteins ---- 43 kDa receptor-associated protein of the synapse
Source.3959: DFBPPR11024 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.3960: DFBPPR11026 ---- Animal proteins ---- AP-2 complex subunit mu
Source.3961: DFBPPR11029 ---- Animal proteins ---- Myelin proteolipid protein
Source.3962: DFBPPR11033 ---- Animal proteins ---- Aminomethyltransferase, mitochondrial
Source.3963: DFBPPR11034 ---- Animal proteins ---- Small nuclear ribonucleoprotein E
Source.3964: DFBPPR11038 ---- Animal proteins ---- Cytosolic endo-beta-N-acetylglucosaminidase
Source.3965: DFBPPR11041 ---- Animal proteins ---- Chromodomain-helicase-DNA-binding protein 7
Source.3966: DFBPPR11045 ---- Animal proteins ---- Transcription factor SOX-11
Source.3967: DFBPPR11049 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 6
Source.3968: DFBPPR11050 ---- Animal proteins ---- Complement factor B-like protease
Source.3969: DFBPPR11053 ---- Animal proteins ---- Alpha-1,6-mannosyl-glycoprotein 4-beta-N-acetylglucosaminyltransferase
Source.3970: DFBPPR11059 ---- Animal proteins ---- Cell cycle control protein 50A
Source.3971: DFBPPR11062 ---- Animal proteins ---- Regucalcin
Source.3972: DFBPPR11065 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.3973: DFBPPR11071 ---- Animal proteins ---- Pituitary homeobox 1
Source.3974: DFBPPR11074 ---- Animal proteins ---- Hypoxia-inducible factor 1-alpha
Source.3975: DFBPPR11077 ---- Animal proteins ---- Tyrosinase
Source.3976: DFBPPR11082 ---- Animal proteins ---- Protein-glucosylgalactosylhydroxylysine glucosidase
Source.3977: DFBPPR11085 ---- Animal proteins ---- Putative oxidoreductase GLYR1
Source.3978: DFBPPR11088 ---- Animal proteins ---- Multifunctional protein ADE2
Source.3979: DFBPPR11090 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.3980: DFBPPR11092 ---- Animal proteins ---- Ataxin-3
Source.3981: DFBPPR11104 ---- Animal proteins ---- Importin subunit alpha-5
Source.3982: DFBPPR11108 ---- Animal proteins ---- Bifunctional methylenetetrahydrofolate dehydrogenase/cyclohydrolase, mitochondrial
Source.3983: DFBPPR11109 ---- Animal proteins ---- Fibrinogen-like protein 1-like protein
Source.3984: DFBPPR11111 ---- Animal proteins ---- N-acetylneuraminate lyase
Source.3985: DFBPPR11123 ---- Animal proteins ---- Multidrug resistance-associated protein 1
Source.3986: DFBPPR11125 ---- Animal proteins ---- Muscarinic acetylcholine receptor M4
Source.3987: DFBPPR11134 ---- Animal proteins ---- Keratocan
Source.3988: DFBPPR11135 ---- Animal proteins ---- Popeye domain-containing protein 3
Source.3989: DFBPPR11136 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase gamma
Source.3990: DFBPPR11143 ---- Animal proteins ---- Cholinephosphotransferase 1
Source.3991: DFBPPR11145 ---- Animal proteins ---- Chromatin assembly factor 1 subunit B
Source.3992: DFBPPR11146 ---- Animal proteins ---- Formin
Source.3993: DFBPPR11149 ---- Animal proteins ---- V-type proton ATPase catalytic subunit A
Source.3994: DFBPPR11152 ---- Animal proteins ---- Platelet-activating factor acetylhydrolase IB subunit alpha2
Source.3995: DFBPPR11157 ---- Animal proteins ---- Protein transport protein Sec31A
Source.3996: DFBPPR11159 ---- Animal proteins ---- PRA1 family protein 3
Source.3997: DFBPPR11161 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II delta chain
Source.3998: DFBPPR11166 ---- Animal proteins ---- Phosphatidylinositol 4-kinase type 2-beta
Source.3999: DFBPPR11168 ---- Animal proteins ---- Trimethyllysine dioxygenase, mitochondrial
Source.4000: DFBPPR11169 ---- Animal proteins ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase
Source.4001: DFBPPR11170 ---- Animal proteins ---- Histone-binding protein RBBP7
Source.4002: DFBPPR11172 ---- Animal proteins ---- Protein transport protein Sec16B
Source.4003: DFBPPR11182 ---- Animal proteins ---- Transcription factor HES-1
Source.4004: DFBPPR11188 ---- Animal proteins ---- Visual system homeobox 1
Source.4005: DFBPPR11190 ---- Animal proteins ---- Mitochondrial tRNA-specific 2-thiouridylase 1
Source.4006: DFBPPR11191 ---- Animal proteins ---- Protein argonaute-3
Source.4007: DFBPPR11192 ---- Animal proteins ---- Cytosolic purine 5'-nucleotidase
Source.4008: DFBPPR11196 ---- Animal proteins ---- Mitochondrial Rho GTPase 2
Source.4009: DFBPPR11201 ---- Animal proteins ---- ATP-dependent RNA helicase DHX30
Source.4010: DFBPPR11202 ---- Animal proteins ---- Myosin-binding protein C, fast-type
Source.4011: DFBPPR11203 ---- Animal proteins ---- Cyclic nucleotide-gated channel rod photoreceptor subunit alpha
Source.4012: DFBPPR11213 ---- Animal proteins ---- 26S proteasome non-ATPase regulatory subunit 13
Source.4013: DFBPPR11216 ---- Animal proteins ---- Gap junction alpha-5 protein
Source.4014: DFBPPR11221 ---- Animal proteins ---- Zinc finger homeobox protein 4
Source.4015: DFBPPR11222 ---- Animal proteins ---- FACT complex subunit SSRP1
Source.4016: DFBPPR11234 ---- Animal proteins ---- Bleomycin hydrolase
Source.4017: DFBPPR11236 ---- Animal proteins ---- Protein transport protein Sec23A
Source.4018: DFBPPR11242 ---- Animal proteins ---- GDNF family receptor alpha-1
Source.4019: DFBPPR11245 ---- Animal proteins ---- Serine-threonine kinase receptor-associated protein
Source.4020: DFBPPR11250 ---- Animal proteins ---- Polycomb protein EED
Source.4021: DFBPPR11251 ---- Animal proteins ---- Transcriptional enhancer factor TEF-5
Source.4022: DFBPPR11252 ---- Animal proteins ---- Transcription factor RelB homolog
Source.4023: DFBPPR11253 ---- Animal proteins ---- Peripherin-2
Source.4024: DFBPPR11257 ---- Animal proteins ---- Ventral anterior homeobox 1
Source.4025: DFBPPR11258 ---- Animal proteins ---- POU domain, class 2, transcription factor 1
Source.4026: DFBPPR11262 ---- Animal proteins ---- Cysteine protease ATG4B
Source.4027: DFBPPR11266 ---- Animal proteins ---- Protogenin
Source.4028: DFBPPR11270 ---- Animal proteins ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.4029: DFBPPR11271 ---- Animal proteins ---- Protection of telomeres protein 1
Source.4030: DFBPPR11274 ---- Animal proteins ---- Muscarinic acetylcholine receptor M3
Source.4031: DFBPPR11286 ---- Animal proteins ---- Protein wntless homolog
Source.4032: DFBPPR11300 ---- Animal proteins ---- MAM domain-containing glycosylphosphatidylinositol anchor protein 1
Source.4033: DFBPPR11310 ---- Animal proteins ---- Lysophosphatidic acid receptor 6
Source.4034: DFBPPR11317 ---- Animal proteins ---- Dickkopf-related protein 3
Source.4035: DFBPPR11325 ---- Animal proteins ---- Peptidase inhibitor 15
Source.4036: DFBPPR11339 ---- Animal proteins ---- Calsequestrin-2
Source.4037: DFBPPR11344 ---- Animal proteins ---- LIM/homeobox protein Lhx9
Source.4038: DFBPPR11345 ---- Animal proteins ---- LIM/homeobox protein LMX-1.2
Source.4039: DFBPPR11346 ---- Animal proteins ---- Diencephalon/mesencephalon homeobox protein 1
Source.4040: DFBPPR11348 ---- Animal proteins ---- Probable ATP-dependent RNA helicase DDX10
Source.4041: DFBPPR11352 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.4042: DFBPPR11367 ---- Animal proteins ---- Insulin gene enhancer protein ISL-2
Source.4043: DFBPPR11370 ---- Animal proteins ---- TLC domain-containing protein 1
Source.4044: DFBPPR11372 ---- Animal proteins ---- Methylthioribulose-1-phosphate dehydratase
Source.4045: DFBPPR11376 ---- Animal proteins ---- Lamin-A
Source.4046: DFBPPR11380 ---- Animal proteins ---- Paired box protein Pax-6
Source.4047: DFBPPR11384 ---- Animal proteins ---- WD40 repeat-containing protein SMU1
Source.4048: DFBPPR11390 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.4049: DFBPPR11397 ---- Animal proteins ---- Frizzled-3
Source.4050: DFBPPR11399 ---- Animal proteins ---- Probable glutamate--tRNA ligase, mitochondrial
Source.4051: DFBPPR11402 ---- Animal proteins ---- Contactin-associated protein-like 5
Source.4052: DFBPPR11406 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 47
Source.4053: DFBPPR11407 ---- Animal proteins ---- RAD52 motif-containing protein 1
Source.4054: DFBPPR11413 ---- Animal proteins ---- Tudor domain-containing protein 7
Source.4055: DFBPPR11416 ---- Animal proteins ---- 2-methoxy-6-polyprenyl-1,4-benzoquinol methylase, mitochondrial
Source.4056: DFBPPR11428 ---- Animal proteins ---- Ras-responsive element-binding protein 1
Source.4057: DFBPPR11433 ---- Animal proteins ---- Peroxiredoxin-like 2A
Source.4058: DFBPPR11438 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4059: DFBPPR11440 ---- Animal proteins ---- Golgi pH regulator
Source.4060: DFBPPR11443 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B delta isoform
Source.4061: DFBPPR11446 ---- Animal proteins ---- Ubiquitin carboxyl-terminal hydrolase 48
Source.4062: DFBPPR11449 ---- Animal proteins ---- Zinc transporter 7
Source.4063: DFBPPR11452 ---- Animal proteins ---- Paired mesoderm homeobox protein 2
Source.4064: DFBPPR11456 ---- Animal proteins ---- Cyclic AMP-dependent transcription factor ATF-2
Source.4065: DFBPPR11457 ---- Animal proteins ---- Homeobox protein DBX2
Source.4066: DFBPPR11462 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.4067: DFBPPR11469 ---- Animal proteins ---- Cotranscriptional regulator FAM172A homolog
Source.4068: DFBPPR11485 ---- Animal proteins ---- Phosphatidylserine synthase 1
Source.4069: DFBPPR11486 ---- Animal proteins ---- Chordin-like protein 1
Source.4070: DFBPPR11495 ---- Animal proteins ---- Calretinin
Source.4071: DFBPPR11496 ---- Animal proteins ---- MTOR-associated protein MEAK7
Source.4072: DFBPPR11512 ---- Animal proteins ---- Glucose-induced degradation protein 8 homolog
Source.4073: DFBPPR11513 ---- Animal proteins ---- Corepressor interacting with RBPJ 1
Source.4074: DFBPPR11515 ---- Animal proteins ---- Protein FAM53A
Source.4075: DFBPPR11530 ---- Animal proteins ---- Probable cation-transporting ATPase 13A4
Source.4076: DFBPPR11534 ---- Animal proteins ---- Coiled-coil domain-containing protein 80
Source.4077: DFBPPR11539 ---- Animal proteins ---- Cytosolic Fe-S cluster assembly factor NUBP2
Source.4078: DFBPPR11540 ---- Animal proteins ---- Homeobox protein MIXL1
Source.4079: DFBPPR11541 ---- Animal proteins ---- Tetraspanin-12
Source.4080: DFBPPR11544 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit L
Source.4081: DFBPPR11551 ---- Animal proteins ---- Isoleucine--tRNA ligase, mitochondrial
Source.4082: DFBPPR11552 ---- Animal proteins ---- RecQ-mediated genome instability protein 2
Source.4083: DFBPPR11553 ---- Animal proteins ---- V-type proton ATPase 116 kDa subunit a1
Source.4084: DFBPPR11563 ---- Animal proteins ---- Switch-associated protein 70
Source.4085: DFBPPR11567 ---- Animal proteins ---- Ovocalyxin-32
Source.4086: DFBPPR11571 ---- Animal proteins ---- Alpha-(1,3)-fucosyltransferase 10
Source.4087: DFBPPR11576 ---- Animal proteins ---- V-set and immunoglobulin domain-containing protein 1
Source.4088: DFBPPR11579 ---- Animal proteins ---- Actin-related protein 6
Source.4089: DFBPPR11585 ---- Animal proteins ---- Acyl-CoA-binding domain-containing protein 5
Source.4090: DFBPPR11586 ---- Animal proteins ---- DnaJ homolog subfamily C member 3
Source.4091: DFBPPR11587 ---- Animal proteins ---- Zinc finger protein 622
Source.4092: DFBPPR11590 ---- Animal proteins ---- Homeobox protein Hox-A2
Source.4093: DFBPPR11591 ---- Animal proteins ---- Gap junction beta-6 protein
Source.4094: DFBPPR11605 ---- Animal proteins ---- DNA repair protein complementing XP-A cells homolog
Source.4095: DFBPPR11607 ---- Animal proteins ---- Bromodomain adjacent to zinc finger domain protein 2B
Source.4096: DFBPPR11609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.4097: DFBPPR11610 ---- Animal proteins ---- MOB-like protein phocein
Source.4098: DFBPPR11617 ---- Animal proteins ---- DNA repair and recombination protein RAD54B
Source.4099: DFBPPR11619 ---- Animal proteins ---- Exocyst complex component 8
Source.4100: DFBPPR11624 ---- Animal proteins ---- BAG family molecular chaperone regulator 5
Source.4101: DFBPPR11625 ---- Animal proteins ---- Tripartite motif-containing protein 59
Source.4102: DFBPPR11627 ---- Animal proteins ---- WW domain-binding protein 4
Source.4103: DFBPPR11628 ---- Animal proteins ---- Beta-crystallin A2
Source.4104: DFBPPR11629 ---- Animal proteins ---- THO complex subunit 5 homolog
Source.4105: DFBPPR11634 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.4106: DFBPPR11636 ---- Animal proteins ---- Epithelial splicing regulatory protein 2
Source.4107: DFBPPR11644 ---- Animal proteins ---- Putative glutathione-specific gamma-glutamylcyclotransferase 2
Source.4108: DFBPPR11646 ---- Animal proteins ---- Frizzled-9
Source.4109: DFBPPR11654 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4110: DFBPPR11656 ---- Animal proteins ---- Hsp90 co-chaperone Cdc37
Source.4111: DFBPPR11659 ---- Animal proteins ---- Matrix remodeling-associated protein 8
Source.4112: DFBPPR11667 ---- Animal proteins ---- Heme transporter HRG1
Source.4113: DFBPPR11669 ---- Animal proteins ---- V-type proton ATPase subunit d 2
Source.4114: DFBPPR11676 ---- Animal proteins ---- Proteasome subunit alpha type-1
Source.4115: DFBPPR11688 ---- Animal proteins ---- Myosin-binding protein H
Source.4116: DFBPPR11691 ---- Animal proteins ---- Beta-crystallin A4
Source.4117: DFBPPR11705 ---- Animal proteins ---- SCO-spondin
Source.4118: DFBPPR11707 ---- Animal proteins ---- Nuclear cap-binding protein subunit 3
Source.4119: DFBPPR11721 ---- Animal proteins ---- Eukaryotic translation initiation factor 2A
Source.4120: DFBPPR11728 ---- Animal proteins ---- Mesoderm induction early response protein 1
Source.4121: DFBPPR11729 ---- Animal proteins ---- Elongation factor 1-beta
Source.4122: DFBPPR11732 ---- Animal proteins ---- Protein Hikeshi
Source.4123: DFBPPR11738 ---- Animal proteins ---- Ensconsin
Source.4124: DFBPPR11739 ---- Animal proteins ---- Centrosomal protein CCDC61
Source.4125: DFBPPR11748 ---- Animal proteins ---- G1/S-specific cyclin-E1
Source.4126: DFBPPR11751 ---- Animal proteins ---- NTF2-related export protein 2
Source.4127: DFBPPR11762 ---- Animal proteins ---- Trafficking protein particle complex subunit 5
Source.4128: DFBPPR11764 ---- Animal proteins ---- Tectonin beta-propeller repeat-containing protein 1
Source.4129: DFBPPR11771 ---- Animal proteins ---- Homeobox protein goosecoid
Source.4130: DFBPPR11773 ---- Animal proteins ---- Rab GTPase-activating protein 1-like
Source.4131: DFBPPR11776 ---- Animal proteins ---- Olfactory receptor-like protein COR4
Source.4132: DFBPPR11778 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.4133: DFBPPR11779 ---- Animal proteins ---- T-complex protein 1 subunit eta
Source.4134: DFBPPR11783 ---- Animal proteins ---- Olfactory receptor-like protein COR2
Source.4135: DFBPPR11785 ---- Animal proteins ---- ADP-ribosylation factor 5
Source.4136: DFBPPR11794 ---- Animal proteins ---- Nuclear protein MDM1
Source.4137: DFBPPR11800 ---- Animal proteins ---- Olfactory receptor-like protein COR5
Source.4138: DFBPPR11803 ---- Animal proteins ---- Translocation protein SEC62
Source.4139: DFBPPR11804 ---- Animal proteins ---- WD repeat-containing protein 91
Source.4140: DFBPPR11808 ---- Animal proteins ---- U4/U6 small nuclear ribonucleoprotein Prp3
Source.4141: DFBPPR11817 ---- Animal proteins ---- Meiosis regulator and mRNA stability factor 1
Source.4142: DFBPPR11819 ---- Animal proteins ---- Cytochrome c-type heme lyase
Source.4143: DFBPPR11827 ---- Animal proteins ---- Folliculin-interacting protein 1
Source.4144: DFBPPR11832 ---- Animal proteins ---- N-lysine methyltransferase SETD6
Source.4145: DFBPPR11835 ---- Animal proteins ---- Mitochondria-eating protein
Source.4146: DFBPPR11837 ---- Animal proteins ---- Protein FAM210A
Source.4147: DFBPPR11840 ---- Animal proteins ---- RELT-like protein 1
Source.4148: DFBPPR11853 ---- Animal proteins ---- Lipid droplet-associated hydrolase
Source.4149: DFBPPR11855 ---- Animal proteins ---- G-protein coupled receptor-associated protein LMBRD2
Source.4150: DFBPPR11857 ---- Animal proteins ---- Ufm1-specific protease 2
Source.4151: DFBPPR11858 ---- Animal proteins ---- WD repeat-containing protein 82
Source.4152: DFBPPR11860 ---- Animal proteins ---- Mediator of RNA polymerase II transcription subunit 24
Source.4153: DFBPPR11862 ---- Animal proteins ---- Brain-specific homeobox/POU domain protein 3
Source.4154: DFBPPR11864 ---- Animal proteins ---- Radixin
Source.4155: DFBPPR11872 ---- Animal proteins ---- Protein argonaute-4
Source.4156: DFBPPR11875 ---- Animal proteins ---- WD repeat-containing protein 61
Source.4157: DFBPPR11878 ---- Animal proteins ---- Prolyl endopeptidase-like
Source.4158: DFBPPR11880 ---- Animal proteins ---- Deleted in azoospermia-like
Source.4159: DFBPPR11882 ---- Animal proteins ---- Regulation of nuclear pre-mRNA domain-containing protein 1A
Source.4160: DFBPPR11883 ---- Animal proteins ---- Hypoxia up-regulated protein 1
Source.4161: DFBPPR11888 ---- Animal proteins ---- Zinc finger CCCH domain-containing protein 14
Source.4162: DFBPPR11898 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory subunit 3
Source.4163: DFBPPR11899 ---- Animal proteins ---- Protein ILRUN
Source.4164: DFBPPR11909 ---- Animal proteins ---- Cysteine protease ATG4A
Source.4165: DFBPPR11916 ---- Animal proteins ---- REST corepressor 3
Source.4166: DFBPPR11920 ---- Animal proteins ---- Transcription initiation factor TFIID subunit 2
Source.4167: DFBPPR11921 ---- Animal proteins ---- GATOR complex protein WDR59
Source.4168: DFBPPR11924 ---- Animal proteins ---- Centromere protein P
Source.4169: DFBPPR11929 ---- Animal proteins ---- Probable RNA-binding protein EIF1AD
Source.4170: DFBPPR11933 ---- Animal proteins ---- M-protein, striated muscle
Source.4171: DFBPPR11934 ---- Animal proteins ---- Gametogenetin-binding protein 2
Source.4172: DFBPPR11935 ---- Animal proteins ---- Retinal homeobox protein Rx2
Source.4173: DFBPPR11939 ---- Animal proteins ---- Ethylmalonyl-CoA decarboxylase
Source.4174: DFBPPR11947 ---- Animal proteins ---- Transcription factor SOX-8
Source.4175: DFBPPR11955 ---- Animal proteins ---- Solute carrier family 41 member 2
Source.4176: DFBPPR11956 ---- Animal proteins ---- Retinal homeobox protein Rx1
Source.4177: DFBPPR11957 ---- Animal proteins ---- DNA polymerase epsilon subunit 2
Source.4178: DFBPPR11958 ---- Animal proteins ---- Homeobox protein engrailed-1
Source.4179: DFBPPR11960 ---- Animal proteins ---- Lysosomal cobalamin transport escort protein LMBD1
Source.4180: DFBPPR11965 ---- Animal proteins ---- tRNA N(3)-methylcytidine methyltransferase METTL2
Source.4181: DFBPPR11969 ---- Animal proteins ---- Acetoacetyl-CoA synthetase
Source.4182: DFBPPR11977 ---- Animal proteins ---- Cleft lip and palate transmembrane protein 1-like protein
Source.4183: DFBPPR11978 ---- Animal proteins ---- ER membrane protein complex subunit 1
Source.4184: DFBPPR11982 ---- Animal proteins ---- Transcription termination factor 3, mitochondrial
Source.4185: DFBPPR11984 ---- Animal proteins ---- SET and MYND domain-containing protein 4
Source.4186: DFBPPR11990 ---- Animal proteins ---- Transcription factor SOX-1
Source.4187: DFBPPR11998 ---- Animal proteins ---- Kelch-like protein 15
Source.4188: DFBPPR11999 ---- Animal proteins ---- Dymeclin
Source.4189: DFBPPR12001 ---- Animal proteins ---- Pleckstrin homology domain-containing family F member 2
Source.4190: DFBPPR12009 ---- Animal proteins ---- Retrovirus-related Pol polyprotein
Source.4191: DFBPPR12013 ---- Animal proteins ---- Integrator complex subunit 7
Source.4192: DFBPPR12015 ---- Animal proteins ---- Homeobox protein Hox-D1
Source.4193: DFBPPR12016 ---- Animal proteins ---- ORM1-like protein 2
Source.4194: DFBPPR12017 ---- Animal proteins ---- Zinc finger protein CKR1
Source.4195: DFBPPR12019 ---- Animal proteins ---- Cobalamin trafficking protein CblD
Source.4196: DFBPPR12020 ---- Animal proteins ---- Lipase maturation factor 2
Source.4197: DFBPPR12030 ---- Animal proteins ---- Transmembrane protein 208
Source.4198: DFBPPR12033 ---- Animal proteins ---- Nuclear receptor coactivator 7
Source.4199: DFBPPR12034 ---- Animal proteins ---- Breast cancer metastasis-suppressor 1-like protein
Source.4200: DFBPPR12037 ---- Animal proteins ---- Zona pellucida-binding protein 1
Source.4201: DFBPPR12044 ---- Animal proteins ---- 39S ribosomal protein L37, mitochondrial
Source.4202: DFBPPR12051 ---- Animal proteins ---- GATOR complex protein WDR24
Source.4203: DFBPPR12052 ---- Animal proteins ---- Testis-expressed protein 10 homolog
Source.4204: DFBPPR12058 ---- Animal proteins ---- U3 small nucleolar RNA-associated protein 15 homolog
Source.4205: DFBPPR12060 ---- Animal proteins ---- Neurobeachin
Source.4206: DFBPPR12067 ---- Animal proteins ---- Transcription factor EC
Source.4207: DFBPPR12069 ---- Animal proteins ---- Transmembrane channel-like protein 7
Source.4208: DFBPPR12070 ---- Animal proteins ---- Transmembrane protein 237
Source.4209: DFBPPR12071 ---- Animal proteins ---- Cysteine and histidine-rich domain-containing protein 1
Source.4210: DFBPPR12075 ---- Animal proteins ---- Transmembrane protein 70, mitochondrial
Source.4211: DFBPPR12076 ---- Animal proteins ---- RRP12-like protein
Source.4212: DFBPPR12079 ---- Animal proteins ---- Transcription factor SPT20 homolog
Source.4213: DFBPPR12080 ---- Animal proteins ---- Integrator complex subunit 14
Source.4214: DFBPPR12084 ---- Animal proteins ---- EF-hand domain-containing family member C2
Source.4215: DFBPPR12087 ---- Animal proteins ---- Transmembrane protein 121
Source.4216: DFBPPR12088 ---- Animal proteins ---- Kelch-like protein 14
Source.4217: DFBPPR12090 ---- Animal proteins ---- DnaJ homolog subfamily C member 16
Source.4218: DFBPPR12092 ---- Animal proteins ---- Protein MMS22-like
Source.4219: DFBPPR12098 ---- Animal proteins ---- NEDD4-binding protein 1
Source.4220: DFBPPR12104 ---- Animal proteins ---- Solute carrier family 35 member G2
Source.4221: DFBPPR12108 ---- Animal proteins ---- Protein strawberry notch homolog 1
Source.4222: DFBPPR12109 ---- Animal proteins ---- Integrator complex subunit 10
Source.4223: DFBPPR12111 ---- Animal proteins ---- WD repeat-containing protein 1
Source.4224: DFBPPR12117 ---- Animal proteins ---- Cysteine-rich secretory protein LCCL domain-containing 1
Source.4225: DFBPPR12119 ---- Animal proteins ---- Lysosomal-associated transmembrane protein 4A
Source.4226: DFBPPR12120 ---- Animal proteins ---- Protein FAM234B
Source.4227: DFBPPR12126 ---- Animal proteins ---- Transmembrane protein 184C
Source.4228: DFBPPR12131 ---- Animal proteins ---- Exportin-4
Source.4229: DFBPPR12136 ---- Animal proteins ---- Protein PHTF2
Source.4230: DFBPPR12140 ---- Animal proteins ---- Centromere protein N
Source.4231: DFBPPR12141 ---- Animal proteins ---- CYFIP-related Rac1 interactor A
Source.4232: DFBPPR12144 ---- Animal proteins ---- TBC1 domain family member 23
Source.4233: DFBPPR12145 ---- Animal proteins ---- p21-activated protein kinase-interacting protein 1-like
Source.4234: DFBPPR12147 ---- Animal proteins ---- Serine/threonine-protein phosphatase 6 regulatory ankyrin repeat subunit C
Source.4235: DFBPPR12150 ---- Animal proteins ---- Heme-binding protein 1
Source.4236: DFBPPR12151 ---- Animal proteins ---- NHL repeat-containing protein 2
Source.4237: DFBPPR12155 ---- Animal proteins ---- Trafficking protein particle complex subunit 11
Source.4238: DFBPPR12160 ---- Animal proteins ---- Transmembrane protein 229B
Source.4239: DFBPPR12166 ---- Animal proteins ---- Leucine-rich repeat-containing protein 45
Source.4240: DFBPPR12204 ---- Animal proteins ---- Leucine-rich repeat-containing protein 40
Source.4241: DFBPPR12207 ---- Animal proteins ---- WD repeat, SAM and U-box domain-containing protein 1
Source.4242: DFBPPR12211 ---- Animal proteins ---- Transmembrane protein 180
Source.4243: DFBPPR12218 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein homolog
Source.4244: DFBPPR12224 ---- Animal proteins ---- WD repeat and coiled-coil-containing protein
Source.4245: DFBPPR12228 ---- Animal proteins ---- Transmembrane protein 68
Source.4246: DFBPPR12233 ---- Animal proteins ---- Tetratricopeptide repeat protein 27
Source.4247: DFBPPR12235 ---- Animal proteins ---- Myb/SANT-like DNA-binding domain-containing protein 2
Source.4248: DFBPPR12237 ---- Animal proteins ---- Thyroid adenoma-associated protein homolog
Source.4249: DFBPPR12243 ---- Animal proteins ---- Glycosyltransferase-like domain-containing protein 1
Source.4250: DFBPPR12254 ---- Animal proteins ---- Cytochrome P450 1A2
Source.4251: DFBPPR12256 ---- Animal proteins ---- Calsequestrin-1
Source.4252: DFBPPR12257 ---- Animal proteins ---- Polyunsaturated fatty acid lipoxygenase ALOX15
Source.4253: DFBPPR12260 ---- Animal proteins ---- Triosephosphate isomerase
Source.4254: DFBPPR12263 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 2
Source.4255: DFBPPR12267 ---- Animal proteins ---- Angiotensin-converting enzyme
Source.4256: DFBPPR12268 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.4257: DFBPPR12269 ---- Animal proteins ---- Potassium voltage-gated channel subfamily A member 5
Source.4258: DFBPPR12270 ---- Animal proteins ---- Glycogenin-1
Source.4259: DFBPPR12272 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 1
Source.4260: DFBPPR12275 ---- Animal proteins ---- Ryanodine receptor 3
Source.4261: DFBPPR12279 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, skeletal muscle isoform
Source.4262: DFBPPR12281 ---- Animal proteins ---- Ryanodine receptor 1
Source.4263: DFBPPR12282 ---- Animal proteins ---- Cytochrome P450 1A1
Source.4264: DFBPPR12284 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit beta
Source.4265: DFBPPR12285 ---- Animal proteins ---- Galactoside alpha-(1,2)-fucosyltransferase 2
Source.4266: DFBPPR12286 ---- Animal proteins ---- Helicase-like transcription factor
Source.4267: DFBPPR12290 ---- Animal proteins ---- Ryanodine receptor 2
Source.4268: DFBPPR12292 ---- Animal proteins ---- Protein kinase C gamma type
Source.4269: DFBPPR12295 ---- Animal proteins ---- Sodium/hydrogen exchanger 3
Source.4270: DFBPPR12296 ---- Animal proteins ---- Neprilysin
Source.4271: DFBPPR12297 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4272: DFBPPR12299 ---- Animal proteins ---- Myocilin
Source.4273: DFBPPR12302 ---- Animal proteins ---- UDP-N-acetylglucosamine--peptide N-acetylglucosaminyltransferase 110 kDa subunit
Source.4274: DFBPPR12305 ---- Animal proteins ---- Hepatic triacylglycerol lipase
Source.4275: DFBPPR12306 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.4276: DFBPPR12310 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1C
Source.4277: DFBPPR12311 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4278: DFBPPR12313 ---- Animal proteins ---- Probable phospholipid-transporting ATPase IF
Source.4279: DFBPPR12315 ---- Animal proteins ---- Voltage-dependent calcium channel gamma-1 subunit
Source.4280: DFBPPR12316 ---- Animal proteins ---- Sodium/potassium-transporting ATPase subunit beta-2
Source.4281: DFBPPR12321 ---- Animal proteins ---- Voltage-dependent N-type calcium channel subunit alpha-1B
Source.4282: DFBPPR12324 ---- Animal proteins ---- Androgen receptor
Source.4283: DFBPPR12326 ---- Animal proteins ---- Phosphatidylcholine-sterol acyltransferase
Source.4284: DFBPPR12332 ---- Animal proteins ---- Bile salt export pump
Source.4285: DFBPPR12336 ---- Animal proteins ---- Apolipoprotein D
Source.4286: DFBPPR12337 ---- Animal proteins ---- Apolipoprotein E
Source.4287: DFBPPR12338 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 1
Source.4288: DFBPPR12341 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.4289: DFBPPR12346 ---- Animal proteins ---- Adenylate cyclase type 5
Source.4290: DFBPPR12349 ---- Animal proteins ---- Calcium/calmodulin-dependent protein kinase type II subunit delta
Source.4291: DFBPPR12353 ---- Animal proteins ---- Cytochrome P450 2E1
Source.4292: DFBPPR12355 ---- Animal proteins ---- Glucose-6-phosphate isomerase
Source.4293: DFBPPR12359 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 3
Source.4294: DFBPPR12365 ---- Animal proteins ---- Sucrase-isomaltase, intestinal
Source.4295: DFBPPR12368 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.4296: DFBPPR12373 ---- Animal proteins ---- Phospholipase B1, membrane-associated
Source.4297: DFBPPR12374 ---- Animal proteins ---- Sortilin-related receptor
Source.4298: DFBPPR12377 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.4299: DFBPPR12378 ---- Animal proteins ---- GDH/6PGL endoplasmic bifunctional protein
Source.4300: DFBPPR12380 ---- Animal proteins ---- N-acylethanolamine-hydrolyzing acid amidase
Source.4301: DFBPPR12381 ---- Animal proteins ---- Protein kinase C epsilon type
Source.4302: DFBPPR12382 ---- Animal proteins ---- Solute carrier family 15 member 1
Source.4303: DFBPPR12385 ---- Animal proteins ---- Myosin-11
Source.4304: DFBPPR12388 ---- Animal proteins ---- Voltage-dependent L-type calcium channel subunit alpha-1S
Source.4305: DFBPPR12392 ---- Animal proteins ---- Large neutral amino acids transporter small subunit 2
Source.4306: DFBPPR12394 ---- Animal proteins ---- Plasma membrane calcium-transporting ATPase 1
Source.4307: DFBPPR12395 ---- Animal proteins ---- ADP-ribosyl cyclase/cyclic ADP-ribose hydrolase 1
Source.4308: DFBPPR12396 ---- Animal proteins ---- Voltage-dependent P/Q-type calcium channel subunit alpha-1A
Source.4309: DFBPPR12399 ---- Animal proteins ---- Gap junction alpha-1 protein
Source.4310: DFBPPR12404 ---- Animal proteins ---- Alpha-1A adrenergic receptor
Source.4311: DFBPPR12408 ---- Animal proteins ---- Vitronectin
Source.4312: DFBPPR12410 ---- Animal proteins ---- Secretory phospholipase A2 receptor
Source.4313: DFBPPR12412 ---- Animal proteins ---- Potassium voltage-gated channel subfamily D member 2
Source.4314: DFBPPR12415 ---- Animal proteins ---- 72 kDa type IV collagenase
Source.4315: DFBPPR12422 ---- Animal proteins ---- Voltage-dependent R-type calcium channel subunit alpha-1E
Source.4316: DFBPPR12423 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4317: DFBPPR12427 ---- Animal proteins ---- Sarcoplasmic/endoplasmic reticulum calcium ATPase 2
Source.4318: DFBPPR12428 ---- Animal proteins ---- Sodium channel protein type 9 subunit alpha
Source.4319: DFBPPR12432 ---- Animal proteins ---- Potassium/sodium hyperpolarization-activated cyclic nucleotide-gated channel 4
Source.4320: DFBPPR12434 ---- Animal proteins ---- Aminopeptidase N
Source.4321: DFBPPR12440 ---- Animal proteins ---- Protein argonaute-2
Source.4322: DFBPPR12447 ---- Animal proteins ---- Canalicular multispecific organic anion transporter 1
Source.4323: DFBPPR12450 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.4324: DFBPPR12453 ---- Animal proteins ---- Lactase-phlorizin hydrolase
Source.4325: DFBPPR12454 ---- Animal proteins ---- Matrix metalloproteinase-14
Source.4326: DFBPPR12459 ---- Animal proteins ---- Cytochrome P450 4A6
Source.4327: DFBPPR12466 ---- Animal proteins ---- Cytochrome P450 4A7
Source.4328: DFBPPR12467 ---- Animal proteins ---- Medium-wave-sensitive opsin 1
Source.4329: DFBPPR12469 ---- Animal proteins ---- Hemopexin
Source.4330: DFBPPR12473 ---- Animal proteins ---- Nitric oxide synthase, brain
Source.4331: DFBPPR12475 ---- Animal proteins ---- Potassium-transporting ATPase subunit beta
Source.4332: DFBPPR12479 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A activator
Source.4333: DFBPPR12486 ---- Animal proteins ---- Adenylate cyclase type 10
Source.4334: DFBPPR12491 ---- Animal proteins ---- Matrix metalloproteinase-9
Source.4335: DFBPPR12494 ---- Animal proteins ---- V(D)J recombination-activating protein 1
Source.4336: DFBPPR12500 ---- Animal proteins ---- Cystathionine beta-synthase
Source.4337: DFBPPR12501 ---- Animal proteins ---- Ezrin
Source.4338: DFBPPR12503 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.4339: DFBPPR12504 ---- Animal proteins ---- Collagenase 3
Source.4340: DFBPPR12506 ---- Animal proteins ---- Liver carboxylesterase 1
Source.4341: DFBPPR12512 ---- Animal proteins ---- Carbonic anhydrase 4
Source.4342: DFBPPR12520 ---- Animal proteins ---- Cytochrome P450 4A4
Source.4343: DFBPPR12521 ---- Animal proteins ---- Cocaine esterase
Source.4344: DFBPPR12531 ---- Animal proteins ---- Solute carrier family 12 member 4
Source.4345: DFBPPR12533 ---- Animal proteins ---- Sarcolemmal membrane-associated protein
Source.4346: DFBPPR12534 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit beta isoform
Source.4347: DFBPPR12539 ---- Animal proteins ---- Growth hormone secretagogue receptor type 1
Source.4348: DFBPPR12540 ---- Animal proteins ---- Calcitonin receptor
Source.4349: DFBPPR12548 ---- Animal proteins ---- C5a anaphylatoxin chemotactic receptor 1
Source.4350: DFBPPR12549 ---- Animal proteins ---- Sodium/myo-inositol cotransporter 2
Source.4351: DFBPPR12550 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4352: DFBPPR12553 ---- Animal proteins ---- Anti-Muellerian hormone type-2 receptor
Source.4353: DFBPPR12555 ---- Animal proteins ---- Glycogen debranching enzyme
Source.4354: DFBPPR12556 ---- Animal proteins ---- Actin, aortic smooth muscle
Source.4355: DFBPPR12558 ---- Animal proteins ---- Creatine kinase M-type
Source.4356: DFBPPR12563 ---- Animal proteins ---- Stromelysin-1
Source.4357: DFBPPR12565 ---- Animal proteins ---- Protein-glutamine gamma-glutamyltransferase K
Source.4358: DFBPPR12568 ---- Animal proteins ---- Potassium voltage-gated channel subfamily H member 2
Source.4359: DFBPPR12570 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1D
Source.4360: DFBPPR12574 ---- Animal proteins ---- Cytochrome P450 2A11
Source.4361: DFBPPR12582 ---- Animal proteins ---- Cyclic nucleotide-gated olfactory channel
Source.4362: DFBPPR12592 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.4363: DFBPPR12594 ---- Animal proteins ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.4364: DFBPPR12595 ---- Animal proteins ---- Hyaluronidase PH-20
Source.4365: DFBPPR12605 ---- Animal proteins ---- Vitamin K-dependent protein S
Source.4366: DFBPPR12606 ---- Animal proteins ---- Cytochrome P450 4A5
Source.4367: DFBPPR12607 ---- Animal proteins ---- Basigin
Source.4368: DFBPPR12609 ---- Animal proteins ---- Trimeric intracellular cation channel type A
Source.4369: DFBPPR12612 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 19-1
Source.4370: DFBPPR12616 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.4371: DFBPPR12617 ---- Animal proteins ---- Metabotropic glutamate receptor 6
Source.4372: DFBPPR12620 ---- Animal proteins ---- RLA class I histocompatibility antigen, alpha chain 11/11
Source.4373: DFBPPR12625 ---- Animal proteins ---- Dimethylaniline monooxygenase [N-oxide-forming] 4
Source.4374: DFBPPR12626 ---- Animal proteins ---- E-selectin
Source.4375: DFBPPR12629 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A catalytic subunit alpha isoform
Source.4376: DFBPPR12632 ---- Animal proteins ---- Caveolin-2
Source.4377: DFBPPR12636 ---- Animal proteins ---- Complement component C9
Source.4378: DFBPPR12653 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.4379: DFBPPR12657 ---- Animal proteins ---- Dehydrogenase/reductase SDR family member 4
Source.4380: DFBPPR12658 ---- Animal proteins ---- Tripartite motif-containing protein 72
Source.4381: DFBPPR12666 ---- Animal proteins ---- Collagen alpha-2(I) chain
Source.4382: DFBPPR12668 ---- Animal proteins ---- Anion exchange protein 3
Source.4383: DFBPPR12675 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.4384: DFBPPR12682 ---- Animal proteins ---- Glycine N-methyltransferase
Source.4385: DFBPPR12693 ---- Animal proteins ---- Solute carrier family 22 member 1
Source.4386: DFBPPR12699 ---- Animal proteins ---- Prolactin receptor
Source.4387: DFBPPR12700 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4388: DFBPPR12701 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4389: DFBPPR12708 ---- Animal proteins ---- Pulmonary surfactant-associated protein B
Source.4390: DFBPPR12710 ---- Animal proteins ---- Endoplasmin
Source.4391: DFBPPR12717 ---- Animal proteins ---- Phosphorylase b kinase regulatory subunit alpha, liver isoform
Source.4392: DFBPPR12722 ---- Animal proteins ---- Myelin proteolipid protein
Source.4393: DFBPPR12731 ---- Animal proteins ---- Cholinesterase
Source.4394: DFBPPR12743 ---- Animal proteins ---- Katanin p60 ATPase-containing subunit A-like 1
Source.4395: DFBPPR12750 ---- Animal proteins ---- Anion exchange protein 2
Source.4396: DFBPPR12753 ---- Animal proteins ---- Elongation factor 1-beta
Source.4397: DFBPPR12756 ---- Animal proteins ---- Aromatase
Source.4398: DFBPPR12771 ---- Animal proteins ---- Sodium channel subunit beta-1
Source.4399: DFBPPR12773 ---- Animal proteins ---- Aryl hydrocarbon receptor nuclear translocator
Source.4400: DFBPPR12774 ---- Animal proteins ---- Arginase-2, mitochondrial
Source.4401: DFBPPR12784 ---- Animal proteins ---- Cadherin-16
Source.4402: DFBPPR12788 ---- Animal proteins ---- Macrophage metalloelastase
Source.4403: DFBPPR12794 ---- Animal proteins ---- Chloride channel protein 2
Source.4404: DFBPPR12798 ---- Animal proteins ---- Cytochrome P450 2A10
Source.4405: DFBPPR12802 ---- Animal proteins ---- Complement C3 alpha chain
Source.4406: DFBPPR12808 ---- Animal proteins ---- UDP-glucuronosyltransferase 1-6
Source.4407: DFBPPR12818 ---- Animal proteins ---- fMet-Leu-Phe receptor
Source.4408: DFBPPR12820 ---- Animal proteins ---- Endothelin receptor type B
Source.4409: DFBPPR12823 ---- Animal proteins ---- Pepsin F
Source.4410: DFBPPR12828 ---- Animal proteins ---- Retinol-binding protein 4
Source.4411: DFBPPR12834 ---- Animal proteins ---- B1 bradykinin receptor
Source.4412: DFBPPR12835 ---- Animal proteins ---- Chloride channel protein ClC-Ka
Source.4413: DFBPPR12838 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.4414: DFBPPR12840 ---- Animal proteins ---- Alpha-1D adrenergic receptor
Source.4415: DFBPPR12842 ---- Animal proteins ---- Multidrug and toxin extrusion protein 2
Source.4416: DFBPPR12847 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B beta isoform
Source.4417: DFBPPR12851 ---- Animal proteins ---- UDP-glucuronosyltransferase 1A4
Source.4418: DFBPPR12855 ---- Animal proteins ---- Solute carrier family 12 member 7
Source.4419: DFBPPR12856 ---- Animal proteins ---- Leupaxin
Source.4420: DFBPPR12859 ---- Animal proteins ---- Collagen alpha-1(VIII) chain
Source.4421: DFBPPR12860 ---- Animal proteins ---- ATP-sensitive inward rectifier potassium channel 11
Source.4422: DFBPPR12861 ---- Animal proteins ---- Leukocyte cell-derived chemotaxin 1
Source.4423: DFBPPR12862 ---- Animal proteins ---- Tumor necrosis factor-inducible gene 6 protein
Source.4424: DFBPPR12864 ---- Animal proteins ---- Type I iodothyronine deiodinase
Source.4425: DFBPPR12866 ---- Animal proteins ---- L-lactate dehydrogenase B chain
Source.4426: DFBPPR12870 ---- Animal proteins ---- Protein transport protein Sec16B
Source.4427: DFBPPR12874 ---- Animal proteins ---- Gastrin/cholecystokinin type B receptor
Source.4428: DFBPPR12877 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.4429: DFBPPR12881 ---- Animal proteins ---- CX3C chemokine receptor 1
Source.4430: DFBPPR12886 ---- Animal proteins ---- Calcium-activated potassium channel subunit beta-1
Source.4431: DFBPPR12887 ---- Animal proteins ---- Amine sulfotransferase
Source.4432: DFBPPR12888 ---- Animal proteins ---- Myoglobin
Source.4433: DFBPPR12895 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B16
Source.4434: DFBPPR12896 ---- Animal proteins ---- T-lymphocyte activation antigen CD80
Source.4435: DFBPPR12901 ---- Animal proteins ---- Eukaryotic translation initiation factor 3 subunit I
Source.4436: DFBPPR12902 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B14
Source.4437: DFBPPR12904 ---- Animal proteins ---- UDP-glucuronosyltransferase 2B13
Source.4438: DFBPPR12907 ---- Animal proteins ---- Cyclin-dependent kinase-like 2
Source.4439: DFBPPR12911 ---- Animal proteins ---- Neurolysin, mitochondrial
Source.4440: DFBPPR12913 ---- Animal proteins ---- 15 kDa protein A
Source.4441: DFBPPR12914 ---- Animal proteins ---- Lipase member H
Source.4442: DFBPPR12922 ---- Animal proteins ---- 15 kDa protein B
Source.4443: DFBPPR12923 ---- Animal proteins ---- Pancreatic triacylglycerol lipase
Source.4444: DFBPPR12925 ---- Animal proteins ---- Methylmalonic aciduria type A homolog, mitochondrial
Source.4445: DFBPPR12936 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.4446: DFBPPR12937 ---- Animal proteins ---- Zonadhesin
Source.4447: DFBPPR12938 ---- Animal proteins ---- D-amino-acid oxidase
Source.4448: DFBPPR12941 ---- Animal proteins ---- Tuftelin-interacting protein 11
Source.4449: DFBPPR12943 ---- Animal proteins ---- Solute carrier family 22 member 8
Source.4450: DFBPPR12948 ---- Animal proteins ---- Apolipoprotein C-IV
Source.4451: DFBPPR12952 ---- Animal proteins ---- Serum amyloid A-1 protein
Source.4452: DFBPPR12962 ---- Animal proteins ---- Coronin-1B
Source.4453: DFBPPR12966 ---- Animal proteins ---- Heart- and neural crest derivatives-expressed protein 1
Source.4454: DFBPPR12969 ---- Animal proteins ---- Prolactin
Source.4455: DFBPPR12972 ---- Animal proteins ---- Sodium/nucleoside cotransporter
Source.4456: DFBPPR12974 ---- Animal proteins ---- Serum amyloid A-3 protein
Source.4457: DFBPPR12976 ---- Animal proteins ---- Eukaryotic translation initiation factor 4 gamma 1
Source.4458: DFBPPR12987 ---- Animal proteins ---- Sodium- and chloride-dependent creatine transporter 1
Source.4459: DFBPPR12989 ---- Animal proteins ---- Eukaryotic translation initiation factor 1A
Source.4460: DFBPPR12997 ---- Animal proteins ---- Inter-alpha-trypsin inhibitor heavy chain H3
Source.4461: DFBPPR12999 ---- Animal proteins ---- Short transient receptor potential channel 1
Source.4462: DFBPPR13005 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 4
Source.4463: DFBPPR13010 ---- Animal proteins ---- Sodium- and chloride-dependent betaine transporter
Source.4464: DFBPPR13012 ---- Animal proteins ---- Cholecystokinin receptor type A
Source.4465: DFBPPR13019 ---- Animal proteins ---- Serine/threonine-protein phosphatase 2A 55 kDa regulatory subunit B gamma isoform
Source.4466: DFBPPR13020 ---- Animal proteins ---- Phosphatidylethanolamine-binding protein 1
Source.4467: DFBPPR13023 ---- Animal proteins ---- Elongator complex protein 1
Source.4468: DFBPPR13024 ---- Animal proteins ---- Erythropoietin
Source.4469: DFBPPR13037 ---- Animal proteins ---- Sodium-dependent multivitamin transporter
Source.4470: DFBPPR13039 ---- Animal proteins ---- Guanine nucleotide-binding protein subunit beta-5
Source.4471: DFBPPR13047 ---- Animal proteins ---- Elongation factor 1-delta
Source.4472: DFBPPR13052 ---- Animal proteins ---- Ubiquitin-like protein 4A
Source.4473: DFBPPR13055 ---- Animal proteins ---- Serum amyloid A-2 protein
Source.4474: DFBPPR13065 ---- Animal proteins ---- Tartrate-resistant acid phosphatase type 5
Source.4475: DFBPPR13072 ---- Animal proteins ---- Solute carrier family 22 member 7
Source.4476: DFBPPR13084 ---- Animal proteins ---- Ig heavy chain V-A2 region K-25
Source.4477: DFBPPR13091 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4478: DFBPPR13098 ---- Animal proteins ---- Epithelial membrane protein 1
Source.4479: DFBPPR13112 ---- Animal proteins ---- Ig heavy chain V-A1 region BS-5
Source.4480: DFBPPR13114 ---- Animal proteins ---- Ig heavy chain V-A2 region BS-1
Source.4481: DFBPPR13115 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.4482: DFBPPR13119 ---- Animal proteins ---- Ig alpha chain C region
Source.4483: DFBPPR13142 ---- Animal proteins ---- Phospholipase A2
Source.4484: DFBPPR13143 ---- Animal proteins ---- Toll-like receptor 9
Source.4485: DFBPPR13144 ---- Animal proteins ---- Cytosolic phospholipase A2
Source.4486: DFBPPR13151 ---- Animal proteins ---- Transferrin receptor protein 1
Source.4487: DFBPPR13157 ---- Animal proteins ---- Inhibin beta A chain
Source.4488: DFBPPR13160 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.4489: DFBPPR13161 ---- Animal proteins ---- Interferon-induced GTP-binding protein Mx1
Source.4490: DFBPPR13162 ---- Animal proteins ---- Estrogen receptor
Source.4491: DFBPPR13164 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4492: DFBPPR13171 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4493: DFBPPR13176 ---- Animal proteins ---- Aromatase
Source.4494: DFBPPR13177 ---- Animal proteins ---- Prostaglandin E synthase
Source.4495: DFBPPR13179 ---- Animal proteins ---- Toll-like receptor 2
Source.4496: DFBPPR13184 ---- Animal proteins ---- 5-hydroxytryptamine receptor 1B
Source.4497: DFBPPR13197 ---- Animal proteins ---- Caveolin-2
Source.4498: DFBPPR13205 ---- Animal proteins ---- Collagenase 3
Source.4499: DFBPPR13206 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4500: DFBPPR13221 ---- Animal proteins ---- Interleukin-4 receptor subunit alpha
Source.4501: DFBPPR13223 ---- Animal proteins ---- Caspase-1
Source.4502: DFBPPR13226 ---- Animal proteins ---- Lutropin/choriogonadotropin subunit beta
Source.4503: DFBPPR13227 ---- Animal proteins ---- Carbonic anhydrase 3
Source.4504: DFBPPR13228 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4505: DFBPPR13229 ---- Animal proteins ---- Gelsolin
Source.4506: DFBPPR13231 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4507: DFBPPR13242 ---- Animal proteins ---- E-selectin
Source.4508: DFBPPR13249 ---- Animal proteins ---- Calcium-activated chloride channel regulator 1
Source.4509: DFBPPR13254 ---- Animal proteins ---- Phosphoglycerate kinase 1
Source.4510: DFBPPR13257 ---- Animal proteins ---- Prolactin
Source.4511: DFBPPR13258 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4512: DFBPPR13268 ---- Animal proteins ---- Glycogen debranching enzyme
Source.4513: DFBPPR13272 ---- Animal proteins ---- Carnitine O-palmitoyltransferase 1, liver isoform
Source.4514: DFBPPR13277 ---- Animal proteins ---- Cholinesterase
Source.4515: DFBPPR13281 ---- Animal proteins ---- Adenosine receptor A2a
Source.4516: DFBPPR13282 ---- Animal proteins ---- Dual specificity phosphatase 29
Source.4517: DFBPPR13283 ---- Animal proteins ---- Aldehyde dehydrogenase, mitochondrial
Source.4518: DFBPPR13293 ---- Animal proteins ---- Phosphoglycerate kinase 2
Source.4519: DFBPPR13300 ---- Animal proteins ---- Sex-determining region Y protein
Source.4520: DFBPPR13304 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.4521: DFBPPR13312 ---- Animal proteins ---- Alpha-2B adrenergic receptor
Source.4522: DFBPPR13320 ---- Animal proteins ---- Superoxide dismutase [Mn], mitochondrial
Source.4523: DFBPPR13323 ---- Animal proteins ---- Myoglobin
Source.4524: DFBPPR13334 ---- Animal proteins ---- Anion exchange protein 2
Source.4525: DFBPPR13335 ---- Animal proteins ---- Interleukin-7 receptor subunit alpha
Source.4526: DFBPPR13336 ---- Animal proteins ---- Amine oxidase [flavin-containing] A
Source.4527: DFBPPR13345 ---- Animal proteins ---- Melanocyte-stimulating hormone receptor
Source.4528: DFBPPR13349 ---- Animal proteins ---- Cysteine-rich secretory protein 3
Source.4529: DFBPPR13350 ---- Animal proteins ---- Carbohydrate-binding protein AWN
Source.4530: DFBPPR13358 ---- Animal proteins ---- Erythropoietin
Source.4531: DFBPPR13369 ---- Animal proteins ---- Inactive ribonuclease-like protein 10
Source.4532: DFBPPR13374 ---- Animal proteins ---- Retinol-binding protein 4
Source.4533: DFBPPR13382 ---- Animal proteins ---- Gap junction beta-1 protein
Source.4534: DFBPPR13388 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4535: DFBPPR13398 ---- Animal proteins ---- Elongation factor 1-gamma
Source.4536: DFBPPR13406 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4537: DFBPPR13419 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.4538: DFBPPR13423 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.4539: DFBPPR13425 ---- Animal proteins ---- Toll-like receptor 2
Source.4540: DFBPPR13427 ---- Animal proteins ---- Mast/stem cell growth factor receptor Kit
Source.4541: DFBPPR13431 ---- Animal proteins ---- Beta-mannosidase
Source.4542: DFBPPR13434 ---- Animal proteins ---- Aromatase
Source.4543: DFBPPR13436 ---- Animal proteins ---- Transmembrane protein 147
Source.4544: DFBPPR13437 ---- Animal proteins ---- C-X-C chemokine receptor type 3
Source.4545: DFBPPR13444 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4546: DFBPPR13446 ---- Animal proteins ---- Long-wave-sensitive opsin 1
Source.4547: DFBPPR13451 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.4548: DFBPPR13457 ---- Animal proteins ---- Nitric oxide synthase, inducible
Source.4549: DFBPPR13467 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4550: DFBPPR13471 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.4551: DFBPPR13472 ---- Animal proteins ---- Sex-determining region Y protein
Source.4552: DFBPPR13477 ---- Animal proteins ---- Prolactin
Source.4553: DFBPPR13513 ---- Animal proteins ---- Ubiquitin-related modifier 1
Source.4554: DFBPPR13533 ---- Animal proteins ---- Retinal dehydrogenase 1
Source.4555: DFBPPR13534 ---- Animal proteins ---- Chitinase-3-like protein 1
Source.4556: DFBPPR13536 ---- Animal proteins ---- Hyaluronidase-2
Source.4557: DFBPPR13545 ---- Animal proteins ---- Prolactin
Source.4558: DFBPPR13546 ---- Animal proteins ---- Platelet-derived growth factor subunit B
Source.4559: DFBPPR13551 ---- Animal proteins ---- Cytochrome P450 1A1
Source.4560: DFBPPR13558 ---- Animal proteins ---- Prostaglandin G/H synthase 2
Source.4561: DFBPPR13559 ---- Animal proteins ---- Very-long-chain (3R)-3-hydroxyacyl-CoA dehydratase 1
Source.4562: DFBPPR13560 ---- Animal proteins ---- P-selectin
Source.4563: DFBPPR13568 ---- Animal proteins ---- Lipoprotein lipase
Source.4564: DFBPPR13570 ---- Animal proteins ---- Gap junction alpha-8 protein
Source.4565: DFBPPR13572 ---- Animal proteins ---- mRNA decay activator protein ZFP36
Source.4566: DFBPPR13576 ---- Animal proteins ---- Toll-like receptor 9
Source.4567: DFBPPR13579 ---- Animal proteins ---- Follicle-stimulating hormone receptor
Source.4568: DFBPPR13582 ---- Animal proteins ---- 1-acyl-sn-glycerol-3-phosphate acyltransferase alpha
Source.4569: DFBPPR13583 ---- Animal proteins ---- Caveolin-2
Source.4570: DFBPPR13585 ---- Animal proteins ---- Hepatocyte growth factor receptor
Source.4571: DFBPPR13587 ---- Animal proteins ---- Aquaporin-1
Source.4572: DFBPPR13590 ---- Animal proteins ---- Gap junction alpha-3 protein
Source.4573: DFBPPR13591 ---- Animal proteins ---- Cystic fibrosis transmembrane conductance regulator
Source.4574: DFBPPR13595 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4575: DFBPPR13596 ---- Animal proteins ---- Toll-like receptor 2
Source.4576: DFBPPR13603 ---- Animal proteins ---- Acetyl-CoA carboxylase 1
Source.4577: DFBPPR13606 ---- Animal proteins ---- Estrogen receptor
Source.4578: DFBPPR13608 ---- Animal proteins ---- Myosin light chain kinase, smooth muscle
Source.4579: DFBPPR13609 ---- Animal proteins ---- Lutropin subunit beta
Source.4580: DFBPPR13611 ---- Animal proteins ---- C-X-C chemokine receptor type 4
Source.4581: DFBPPR13612 ---- Animal proteins ---- Thyrotropin receptor
Source.4582: DFBPPR13617 ---- Animal proteins ---- NAD(P) transhydrogenase, mitochondrial
Source.4583: DFBPPR13621 ---- Animal proteins ---- Amiloride-sensitive sodium channel subunit beta
Source.4584: DFBPPR13622 ---- Animal proteins ---- ATP-citrate synthase
Source.4585: DFBPPR13623 ---- Animal proteins ---- Estrogen receptor beta
Source.4586: DFBPPR13624 ---- Animal proteins ---- Sodium/glucose cotransporter 1
Source.4587: DFBPPR13627 ---- Animal proteins ---- Erythropoietin
Source.4588: DFBPPR13629 ---- Animal proteins ---- Copper-transporting ATPase 2
Source.4589: DFBPPR13632 ---- Animal proteins ---- Growth hormone receptor
Source.4590: DFBPPR13634 ---- Animal proteins ---- Beta-3 adrenergic receptor
Source.4591: DFBPPR13643 ---- Animal proteins ---- Transcription factor SOX-2
Source.4592: DFBPPR13644 ---- Animal proteins ---- Activin receptor type-2A
Source.4593: DFBPPR13666 ---- Animal proteins ---- Prostaglandin F2-alpha receptor
Source.4594: DFBPPR13675 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.4595: DFBPPR13677 ---- Animal proteins ---- Prolactin receptor
Source.4596: DFBPPR13680 ---- Animal proteins ---- Interferon alpha/beta receptor 2
Source.4597: DFBPPR13684 ---- Animal proteins ---- Beta-1 adrenergic receptor
Source.4598: DFBPPR13693 ---- Animal proteins ---- Antithrombin-III
Source.4599: DFBPPR13703 ---- Animal proteins ---- Oviduct-specific glycoprotein
Source.4600: DFBPPR13708 ---- Animal proteins ---- Renin
Source.4601: DFBPPR13715 ---- Animal proteins ---- Ceroid-lipofuscinosis neuronal protein 5
Source.4602: DFBPPR13716 ---- Animal proteins ---- Trichohyalin
Source.4603: DFBPPR13718 ---- Animal proteins ---- Antigen-presenting glycoprotein CD1d
Source.4604: DFBPPR13726 ---- Animal proteins ---- Thyroxine 5-deiodinase
Source.4605: DFBPPR13729 ---- Animal proteins ---- F-box/LRR-repeat protein 21
Source.4606: DFBPPR13731 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4607: DFBPPR13749 ---- Animal proteins ---- Uroporphyrinogen decarboxylase
Source.4608: DFBPPR13753 ---- Animal proteins ---- Sodium-dependent phosphate transport protein 2A
Source.4609: DFBPPR13754 ---- Animal proteins ---- Cytochrome P450 11B1, mitochondrial
Source.4610: DFBPPR13755 ---- Animal proteins ---- Aromatase
Source.4611: DFBPPR13757 ---- Animal proteins ---- Prostaglandin E2 omega-hydroxylase CYP4F21
Source.4612: DFBPPR13760 ---- Animal proteins ---- Ceruloplasmin
Source.4613: DFBPPR13761 ---- Animal proteins ---- Gap junction beta-2 protein
Source.4614: DFBPPR13762 ---- Animal proteins ---- Carboxylesterase 5A
Source.4615: DFBPPR13766 ---- Animal proteins ---- Alpha-2-HS-glycoprotein
Source.4616: DFBPPR13769 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4617: DFBPPR13770 ---- Animal proteins ---- Corticosteroid-binding globulin
Source.4618: DFBPPR13781 ---- Animal proteins ---- Protein-arginine deiminase type-3
Source.4619: DFBPPR13782 ---- Animal proteins ---- BMP and activin membrane-bound inhibitor homolog
Source.4620: DFBPPR13791 ---- Animal proteins ---- Cholinesterase
Source.4621: DFBPPR13805 ---- Animal proteins ---- Serum amyloid A protein
Source.4622: DFBPPR13816 ---- Animal proteins ---- T-cell surface glycoprotein CD1b-1
Source.4623: DFBPPR13836 ---- Animal proteins ---- Myeloid differentiation primary response protein MyD88
Source.4624: DFBPPR13844 ---- Animal proteins ---- Sex-determining region Y protein
Source.4625: DFBPPR13848 ---- Animal proteins ---- Oxytocin receptor
Source.4626: DFBPPR13869 ---- Animal proteins ---- Keratin, high sulfur matrix protein, IIIB4
Source.4627: DFBPPR13872 ---- Animal proteins ---- Keratin, high sulfur matrix protein, IIIB3
Source.4628: DFBPPR13884 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 6
Source.4629: DFBPPR13891 ---- Animal proteins ---- Natural resistance-associated macrophage protein 1
Source.4630: DFBPPR13898 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.4631: DFBPPR13910 ---- Animal proteins ---- Pituitary-specific positive transcription factor 1
Source.4632: DFBPPR13927 ---- Animal proteins ---- Secreted phosphoprotein 24
Source.4633: DFBPPR13933 ---- Animal proteins ---- Thyrotropin-releasing hormone receptor
Source.4634: DFBPPR13936 ---- Animal proteins ---- Abnormal spindle-like microcephaly-associated protein homolog
Source.4635: DFBPPR13937 ---- Animal proteins ---- Prostaglandin E2 receptor EP3 subtype
Source.4636: DFBPPR13947 ---- Animal proteins ---- Cortactin-binding protein 2
Source.4637: DFBPPR13950 ---- Animal proteins ---- Protein TOPAZ1
Source.4638: DFBPPR13961 ---- Animal proteins ---- Elongation factor 1-delta
Source.4639: DFBPPR13969 ---- Animal proteins ---- Suppressor of tumorigenicity 7 protein
Source.4640: DFBPPR13986 ---- Animal proteins ---- Cytochrome c iso-1/iso-2
Source.4641: DFBPPR13988 ---- Animal proteins ---- Cytochrome c oxidase subunit 1
Source.4642: DFBPPR13993 ---- Animal proteins ---- Insulin
Source.4643: DFBPPR13994 ---- Animal proteins ---- Receptor-type tyrosine-protein phosphatase C
Source.4644: DFBPPR13996 ---- Animal proteins ---- Actin, alpha skeletal muscle
Source.4645: DFBPPR13997 ---- Animal proteins ---- Dual specificity mitogen-activated protein kinase kinase 2
Source.4646: DFBPPR13998 ---- Animal proteins ---- Mitogen-activated protein kinase 8B
Source.4647: DFBPPR13999 ---- Animal proteins ---- Mitogen-activated protein kinase 8A
Source.4648: DFBPPR14003 ---- Animal proteins ---- Dihydropyridine-sensitive L-type skeletal muscle calcium channel subunit alpha-1
Source.4649: DFBPPR14004 ---- Animal proteins ---- Tyrosine-protein kinase JAK1
Source.4650: DFBPPR14006 ---- Animal proteins ---- Acyl-CoA desaturase
Source.4651: DFBPPR14007 ---- Animal proteins ---- Cystatin
Source.4652: DFBPPR14009 ---- Animal proteins ---- Cytochrome c oxidase subunit 2
Source.4653: DFBPPR14011 ---- Animal proteins ---- Transforming growth factor beta-1 proprotein
Source.4654: DFBPPR14015 ---- Animal proteins ---- Cytochrome c oxidase subunit 3
Source.4655: DFBPPR14017 ---- Animal proteins ---- Ependymin
Source.4656: DFBPPR14021 ---- Animal proteins ---- Actin, cytoplasmic 1
Source.4657: DFBPPR14025 ---- Animal proteins ---- Granulin-1
Source.4658: DFBPPR14027 ---- Animal proteins ---- L-lactate dehydrogenase A chain
Source.4659: DFBPPR14040 ---- Animal proteins ---- NADH-ubiquinone oxidoreductase chain 1
Source.4660: DFBPPR14054 ---- Animal proteins ---- Pro-neuropeptide Y
Source.4661: DFBPPR14057 ---- Animal proteins ---- Granulin-2
Source.4662: DFBPPR14058 ---- Animal proteins ---- Granulin-3
Source.4663: DFBPPR14076 ---- Marine protein ---- Lys-63-specific deubiquitinase BRCC36
Source.4664: DFBPPR14079 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.4665: DFBPPR14084 ---- Marine protein ---- Eukaryotic initiation factor 4A-III
Source.4666: DFBPPR14087 ---- Marine protein ---- Lissencephaly-1 homolog A
Source.4667: DFBPPR14088 ---- Marine protein ---- Lissencephaly-1 homolog B
Source.4668: DFBPPR14097 ---- Marine protein ---- Katanin p60 ATPase-containing subunit A1
Source.4669: DFBPPR14099 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.4670: DFBPPR14100 ---- Marine protein ---- Cytochrome b
Source.4671: DFBPPR14102 ---- Marine protein ---- Anamorsin-B
Source.4672: DFBPPR14104 ---- Marine protein ---- Anamorsin-A
Source.4673: DFBPPR14105 ---- Marine protein ---- GTP-binding nuclear protein Ran
Source.4674: DFBPPR14111 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.4675: DFBPPR14113 ---- Marine protein ---- G-protein coupled receptor 183
Source.4676: DFBPPR14119 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.4677: DFBPPR14121 ---- Marine protein ---- Vertebrate ancient opsin
Source.4678: DFBPPR14122 ---- Marine protein ---- Galactocerebrosidase
Source.4679: DFBPPR14126 ---- Marine protein ---- Nuclear cap-binding protein subunit 1
Source.4680: DFBPPR14129 ---- Marine protein ---- Methylthioribulose-1-phosphate dehydratase
Source.4681: DFBPPR14138 ---- Marine protein ---- F-box/LRR-repeat protein 5
Source.4682: DFBPPR14143 ---- Marine protein ---- Actin, cytoplasmic 1
Source.4683: DFBPPR14159 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.4684: DFBPPR14167 ---- Marine protein ---- Actin-related protein 8
Source.4685: DFBPPR14171 ---- Marine protein ---- Golgi pH regulator
Source.4686: DFBPPR14176 ---- Marine protein ---- Serine palmitoyltransferase small subunit A
Source.4687: DFBPPR14182 ---- Marine protein ---- N-lysine methyltransferase setd6
Source.4688: DFBPPR14199 ---- Marine protein ---- Choline transporter-like protein 2
Source.4689: DFBPPR14201 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-B
Source.4690: DFBPPR14203 ---- Marine protein ---- Probable cytosolic iron-sulfur protein assembly protein ciao1-A
Source.4691: DFBPPR14204 ---- Marine protein ---- Riboflavin transporter 2
Source.4692: DFBPPR14207 ---- Marine protein ---- Ubiquitin-like protein 4A-B
Source.4693: DFBPPR14208 ---- Marine protein ---- Ubiquitin-like protein 4A-A
Source.4694: DFBPPR14210 ---- Marine protein ---- Tetraspanin-9
Source.4695: DFBPPR14218 ---- Marine protein ---- 60S ribosomal protein L18a
Source.4696: DFBPPR14240 ---- Marine protein ---- Otolin-1
Source.4697: DFBPPR14241 ---- Marine protein ---- Cystatin
Source.4698: DFBPPR14242 ---- Marine protein ---- Cytochrome b
Source.4699: DFBPPR14257 ---- Marine protein ---- Somatolactin
Source.4700: DFBPPR14258 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.4701: DFBPPR14262 ---- Marine protein ---- Pro-opiomelanocortin
Source.4702: DFBPPR14267 ---- Marine protein ---- Cytochrome c oxidase subunit 4 isoform 2, mitochondrial
Source.4703: DFBPPR14269 ---- Marine protein ---- Citrate synthase, mitochondrial
Source.4704: DFBPPR14290 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.4705: DFBPPR14293 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.4706: DFBPPR14297 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.4707: DFBPPR14311 ---- Marine protein ---- ATP synthase epsilon chain, chloroplastic
Source.4708: DFBPPR14312 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.4709: DFBPPR14316 ---- Marine protein ---- 50S ribosomal protein L28, chloroplastic
Source.4710: DFBPPR14331 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.4711: DFBPPR14332 ---- Marine protein ---- Ribulose bisphosphate carboxylase large chain
Source.4712: DFBPPR14333 ---- Marine protein ---- Ferredoxin-dependent glutamate synthase
Source.4713: DFBPPR14336 ---- Marine protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.4714: DFBPPR14339 ---- Marine protein ---- Light-independent protochlorophyllide reductase iron-sulfur ATP-binding protein
Source.4715: DFBPPR14340 ---- Marine protein ---- ATP-dependent zinc metalloprotease FtsH
Source.4716: DFBPPR14351 ---- Marine protein ---- Photosystem II CP43 reaction center protein
Source.4717: DFBPPR14359 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta'
Source.4718: DFBPPR14368 ---- Marine protein ---- Probable transcriptional regulator ycf27
Source.4719: DFBPPR14370 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta''
Source.4720: DFBPPR14377 ---- Marine protein ---- DNA-directed RNA polymerase subunit beta
Source.4721: DFBPPR14380 ---- Marine protein ---- tRNA(Ile)-lysidine synthase, chloroplastic
Source.4722: DFBPPR14384 ---- Marine protein ---- Cytochrome b6-f complex subunit 8
Source.4723: DFBPPR14388 ---- Marine protein ---- Magnesium-protoporphyrin IX monomethyl ester [oxidative] cyclase
Source.4724: DFBPPR14419 ---- Marine protein ---- Photosystem II reaction center protein K
Source.4725: DFBPPR14437 ---- Marine protein ---- 30S ribosomal protein S3, chloroplastic
Source.4726: DFBPPR14440 ---- Marine protein ---- ATP synthase epsilon chain, chloroplastic
Source.4727: DFBPPR14452 ---- Marine protein ---- Cytochrome c biogenesis protein CcsA
Source.4728: DFBPPR14465 ---- Marine protein ---- 50S ribosomal protein L16, chloroplastic
Source.4729: DFBPPR14486 ---- Marine protein ---- Putative transport permease ycf38
Source.4730: DFBPPR14488 ---- Marine protein ---- Putative cytochrome c-type biogenesis protein DbsD-like
Source.4731: DFBPPR14501 ---- Marine protein ---- 50S ribosomal protein L28, chloroplastic
Source.4732: DFBPPR14507 ---- Marine protein ---- Uncharacterized protein ycf39
Source.4733: DFBPPR14519 ---- Marine protein ---- Uncharacterized protein ycf21
Source.4734: DFBPPR14525 ---- Marine protein ---- Uncharacterized protein ycf55
Source.4735: DFBPPR14536 ---- Marine protein ---- Potassium voltage-gated channel subfamily A member 2
Source.4736: DFBPPR14538 ---- Marine protein ---- Estrogen receptor
Source.4737: DFBPPR14539 ---- Marine protein ---- Aryl hydrocarbon receptor nuclear translocator
Source.4738: DFBPPR14540 ---- Marine protein ---- Cytochrome P450 1A1
Source.4739: DFBPPR14544 ---- Marine protein ---- Cytochrome P450 1A3
Source.4740: DFBPPR14550 ---- Marine protein ---- Complement C3
Source.4741: DFBPPR14554 ---- Marine protein ---- Shaker-related potassium channel tsha2
Source.4742: DFBPPR14555 ---- Marine protein ---- Vitellogenin
Source.4743: DFBPPR14563 ---- Marine protein ---- Beta-2 adrenergic receptor
Source.4744: DFBPPR14564 ---- Marine protein ---- Piwi-like protein 2
Source.4745: DFBPPR14565 ---- Marine protein ---- Estrogen receptor beta
Source.4746: DFBPPR14567 ---- Marine protein ---- C5a anaphylatoxin chemotactic receptor 1
Source.4747: DFBPPR14568 ---- Marine protein ---- Cytochrome c oxidase subunit 1
Source.4748: DFBPPR14569 ---- Marine protein ---- Collagen alpha-2(I) chain
Source.4749: DFBPPR14572 ---- Marine protein ---- V(D)J recombination-activating protein 1
Source.4750: DFBPPR14580 ---- Marine protein ---- Cytochrome P450 2M1
Source.4751: DFBPPR14584 ---- Marine protein ---- N-acylneuraminate cytidylyltransferase
Source.4752: DFBPPR14588 ---- Marine protein ---- Nitric oxide synthase, inducible
Source.4753: DFBPPR14589 ---- Marine protein ---- Hemoglobin subunit beta-1
Source.4754: DFBPPR14590 ---- Marine protein ---- Cytochrome b
Source.4755: DFBPPR14592 ---- Marine protein ---- Intelectin
Source.4756: DFBPPR14604 ---- Marine protein ---- Anamorsin
Source.4757: DFBPPR14605 ---- Marine protein ---- Cytochrome c oxidase subunit 2
Source.4758: DFBPPR14612 ---- Marine protein ---- Complement component C9
Source.4759: DFBPPR14627 ---- Marine protein ---- Cytochrome c oxidase subunit 3
Source.4760: DFBPPR14646 ---- Marine protein ---- Radical S-adenosyl methionine domain-containing protein 2
Source.4761: DFBPPR14652 ---- Marine protein ---- Hypoxia-inducible factor 1-alpha
Source.4762: DFBPPR14653 ---- Marine protein ---- Myeloid differentiation primary response protein MyD88
Source.4763: DFBPPR14658 ---- Marine protein ---- Pituitary-specific positive transcription factor 1
Source.4764: DFBPPR14660 ---- Marine protein ---- Otolin-1
Source.4765: DFBPPR14662 ---- Marine protein ---- Creatine kinase, testis isozyme
Source.4766: DFBPPR14669 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-I
Source.4767: DFBPPR14673 ---- Marine protein ---- NADH-ubiquinone oxidoreductase chain 1
Source.4768: DFBPPR14677 ---- Marine protein ---- C3a anaphylatoxin chemotactic receptor
Source.4769: DFBPPR14679 ---- Marine protein ---- Otolith matrix protein 1
Source.4770: DFBPPR14681 ---- Marine protein ---- Neuronal acetylcholine receptor subunit alpha-9-II
Source.4771: DFBPPR14683 ---- Marine protein ---- Ammonium transporter Rh type C
Source.4772: DFBPPR14698 ---- Marine protein ---- Cystatin
Source.4773: DFBPPR14705 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform A
Source.4774: DFBPPR14712 ---- Marine protein ---- Protein transport protein Sec61 subunit alpha isoform B
Source.4775: DFBPPR14720 ---- Marine protein ---- Transcription initiation factor IIA subunit 2
Source.4776: DFBPPR14729 ---- Marine protein ---- Protein LEG1 homolog
Source.4777: DFBPPR14737 ---- Marine protein ---- Ubiquitin-like protein 4A-B
Source.4778: DFBPPR14738 ---- Marine protein ---- Ubiquitin-like protein 4A-A
Source.4779: DFBPPR14744 ---- Marine protein ---- Nucleoside diphosphate kinase B
Source.4780: DFBPPR14754 ---- Marine protein ---- Clotting factor C
Source.4781: DFBPPR14757 ---- Marine protein ---- Clotting factor G alpha subunit
Source.4782: DFBPPR14760 ---- Marine protein ---- Big defensin
Source.4783: DFBPPR14762 ---- Marine protein ---- Coagulogen
Source.4784: DFBPPR14764 ---- Marine protein ---- Intracellular coagulation inhibitor 1
Source.4785: DFBPPR14767 ---- Marine protein ---- Hemocyte protein-glutamine gamma-glutamyltransferase
Source.4786: DFBPPR14770 ---- Marine protein ---- Lectin L6
Source.4787: DFBPPR14771 ---- Marine protein ---- L-cystatin
Source.4788: DFBPPR14790 ---- Marine protein ---- Tubulin alpha-1 chain
Source.4789: DFBPPR14797 ---- Marine protein ---- Gonad-inhibiting hormone
Source.4790: DFBPPR14799 ---- Marine protein ---- Arginine kinase
Source.4791: DFBPPR14800 ---- Marine protein ---- Crustacyanin-A1 subunit
Source.4792: DFBPPR14801 ---- Marine protein ---- Gelsolin, cytoplasmic
Source.4793: DFBPPR14804 ---- Marine protein ---- Crustacyanin-C1 subunit
Source.4794: DFBPPR14821 ---- Marine protein ---- Guanine nucleotide-binding protein G(I)/G(S)/G(T) subunit beta-1
Source.4795: DFBPPR14865 ---- Marine protein ---- Hemoglobin cathodic subunit beta
Source.4796: DFBPPR14879 ---- Microorganism protein ---- Pentafunctional AROM polypeptide
Source.4797: DFBPPR14880 ---- Microorganism protein ---- Spindle assembly checkpoint kinase
Source.4798: DFBPPR14901 ---- Microorganism protein ---- Plasma membrane ATPase
Source.4799: DFBPPR14902 ---- Microorganism protein ---- Lysophospholipase
Source.4800: DFBPPR14903 ---- Microorganism protein ---- Transcription elongation factor SPT6
Source.4801: DFBPPR14916 ---- Microorganism protein ---- Putative lipase ATG15
Source.4802: DFBPPR14924 ---- Microorganism protein ---- E3 ubiquitin-protein ligase UBR1
Source.4803: DFBPPR14926 ---- Microorganism protein ---- Cytochrome c1, heme protein, mitochondrial
Source.4804: DFBPPR14930 ---- Microorganism protein ---- Vacuolar protein sorting-associated protein 27
Source.4805: DFBPPR14933 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 1
Source.4806: DFBPPR14935 ---- Microorganism protein ---- Actin
Source.4807: DFBPPR14937 ---- Microorganism protein ---- Sulfate adenylyltransferase
Source.4808: DFBPPR14939 ---- Microorganism protein ---- ATP-dependent DNA helicase II subunit 1
Source.4809: DFBPPR14940 ---- Microorganism protein ---- CCR4-Not complex 3'-5'-exoribonuclease subunit Ccr4
Source.4810: DFBPPR14946 ---- Microorganism protein ---- Cytochrome c oxidase subunit 1
Source.4811: DFBPPR14951 ---- Microorganism protein ---- Octanoyltransferase, mitochondrial
Source.4812: DFBPPR14955 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 catalytic subunit
Source.4813: DFBPPR14963 ---- Microorganism protein ---- Autophagy-related protein 27
Source.4814: DFBPPR14973 ---- Microorganism protein ---- Lon protease homolog, mitochondrial
Source.4815: DFBPPR14974 ---- Microorganism protein ---- Alpha,alpha-trehalose-phosphate synthase [UDP-forming] 56 kDa subunit
Source.4816: DFBPPR14976 ---- Microorganism protein ---- Adenylate kinase
Source.4817: DFBPPR14980 ---- Microorganism protein ---- Ribonuclease T2-like
Source.4818: DFBPPR14982 ---- Microorganism protein ---- Cytochrome P450 monooxygenase PUL2
Source.4819: DFBPPR14986 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.4820: DFBPPR14993 ---- Microorganism protein ---- Histone chaperone ASF1
Source.4821: DFBPPR14994 ---- Microorganism protein ---- Serine/threonine-protein kinase MEC1
Source.4822: DFBPPR14997 ---- Microorganism protein ---- High osmolarity signaling protein SHO1
Source.4823: DFBPPR15009 ---- Microorganism protein ---- Fructose-bisphosphate aldolase
Source.4824: DFBPPR15011 ---- Microorganism protein ---- Cytochrome b
Source.4825: DFBPPR15014 ---- Microorganism protein ---- AP-1-like transcription factor YAP1
Source.4826: DFBPPR15022 ---- Microorganism protein ---- Pyruvate decarboxylase
Source.4827: DFBPPR15027 ---- Microorganism protein ---- Histone acetyltransferase GCN5
Source.4828: DFBPPR15028 ---- Microorganism protein ---- Iron-sulfur clusters transporter ATM1, mitochondrial
Source.4829: DFBPPR15029 ---- Microorganism protein ---- Dol-P-Glc:Glc(2)Man(9)GlcNAc(2)-PP-Dol alpha-1,2-glucosyltransferase
Source.4830: DFBPPR15033 ---- Microorganism protein ---- Enoate reductase 1
Source.4831: DFBPPR15038 ---- Microorganism protein ---- Adenine deaminase
Source.4832: DFBPPR15041 ---- Microorganism protein ---- Autophagy protein 5
Source.4833: DFBPPR15043 ---- Microorganism protein ---- Guanosine-diphosphatase
Source.4834: DFBPPR15047 ---- Microorganism protein ---- tRNA pseudouridine synthase 1
Source.4835: DFBPPR15049 ---- Microorganism protein ---- Ubiquitin-like modifier-activating enzyme ATG7
Source.4836: DFBPPR15057 ---- Microorganism protein ---- Protein transport protein SEC13
Source.4837: DFBPPR15059 ---- Microorganism protein ---- Iron transport multicopper oxidase FET3
Source.4838: DFBPPR15065 ---- Microorganism protein ---- Lactose regulatory protein LAC9
Source.4839: DFBPPR15067 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit B
Source.4840: DFBPPR15071 ---- Microorganism protein ---- Palmitoyltransferase AKR1
Source.4841: DFBPPR15074 ---- Microorganism protein ---- tRNA-dihydrouridine(47) synthase [NAD(P)(+)]
Source.4842: DFBPPR15077 ---- Microorganism protein ---- Endopolyphosphatase
Source.4843: DFBPPR15078 ---- Microorganism protein ---- Autophagy-related protein 11
Source.4844: DFBPPR15085 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.4845: DFBPPR15090 ---- Microorganism protein ---- Transketolase
Source.4846: DFBPPR15096 ---- Microorganism protein ---- Acetyl-coenzyme A synthetase 2
Source.4847: DFBPPR15097 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 1
Source.4848: DFBPPR15109 ---- Microorganism protein ---- GPI inositol-deacylase
Source.4849: DFBPPR15111 ---- Microorganism protein ---- mRNA cap guanine-N7 methyltransferase
Source.4850: DFBPPR15114 ---- Microorganism protein ---- Methylated-DNA--protein-cysteine methyltransferase
Source.4851: DFBPPR15116 ---- Microorganism protein ---- Glucan 1,3-beta-glucosidase
Source.4852: DFBPPR15118 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC2
Source.4853: DFBPPR15119 ---- Microorganism protein ---- Protein SEY1
Source.4854: DFBPPR15121 ---- Microorganism protein ---- Peptide-N(4)-(N-acetyl-beta-glucosaminyl)asparagine amidase
Source.4855: DFBPPR15122 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.4856: DFBPPR15123 ---- Microorganism protein ---- JmjC domain-containing histone demethylation protein 1
Source.4857: DFBPPR15129 ---- Microorganism protein ---- Protein transport protein SEC61 subunit alpha
Source.4858: DFBPPR15130 ---- Microorganism protein ---- Heterogeneous nuclear rnp K-like protein 2
Source.4859: DFBPPR15137 ---- Microorganism protein ---- Dolichyl pyrophosphate Glc1Man9GlcNAc2 alpha-1,3-glucosyltransferase
Source.4860: DFBPPR15154 ---- Microorganism protein ---- Methylthioribose-1-phosphate isomerase
Source.4861: DFBPPR15160 ---- Microorganism protein ---- Palmitoyltransferase PFA3
Source.4862: DFBPPR15161 ---- Microorganism protein ---- Vacuolar membrane protease
Source.4863: DFBPPR15166 ---- Microorganism protein ---- GMP synthase [glutamine-hydrolyzing]
Source.4864: DFBPPR15167 ---- Microorganism protein ---- Methylthioribulose-1-phosphate dehydratase
Source.4865: DFBPPR15175 ---- Microorganism protein ---- ATP-dependent RNA helicase MAK5
Source.4866: DFBPPR15178 ---- Microorganism protein ---- Phosphoglycerate kinase
Source.4867: DFBPPR15182 ---- Microorganism protein ---- Mitochondrial transcription factor 1
Source.4868: DFBPPR15184 ---- Microorganism protein ---- Eukaryotic translation initiation factor 3 subunit C
Source.4869: DFBPPR15188 ---- Microorganism protein ---- DNA mismatch repair protein MSH3
Source.4870: DFBPPR15197 ---- Microorganism protein ---- ATP-dependent RNA helicase FAL1
Source.4871: DFBPPR15199 ---- Microorganism protein ---- mRNA-capping enzyme subunit alpha
Source.4872: DFBPPR15201 ---- Microorganism protein ---- Acetyl-CoA hydrolase
Source.4873: DFBPPR15206 ---- Microorganism protein ---- Neutral trehalase
Source.4874: DFBPPR15207 ---- Microorganism protein ---- Triosephosphate isomerase
Source.4875: DFBPPR15217 ---- Microorganism protein ---- GPI mannosyltransferase 1
Source.4876: DFBPPR15232 ---- Microorganism protein ---- U3 small nucleolar RNA-associated protein 10
Source.4877: DFBPPR15243 ---- Microorganism protein ---- Coupling of ubiquitin conjugation to ER degradation protein 1
Source.4878: DFBPPR15246 ---- Microorganism protein ---- ATP synthase subunit a
Source.4879: DFBPPR15255 ---- Microorganism protein ---- Ribosome biogenesis protein ERB1
Source.4880: DFBPPR15256 ---- Microorganism protein ---- SEC14 cytosolic factor
Source.4881: DFBPPR15257 ---- Microorganism protein ---- Ribosome biogenesis protein YTM1
Source.4882: DFBPPR15258 ---- Microorganism protein ---- Invertase
Source.4883: DFBPPR15260 ---- Microorganism protein ---- Repressible acid phosphatase
Source.4884: DFBPPR15266 ---- Microorganism protein ---- Phosphatidylethanolamine N-methyltransferase
Source.4885: DFBPPR15276 ---- Microorganism protein ---- Guanine nucleotide-binding protein subunit gamma
Source.4886: DFBPPR15284 ---- Microorganism protein ---- Sorting nexin MVP1
Source.4887: DFBPPR15285 ---- Microorganism protein ---- Superoxide dismutase 1 copper chaperone
Source.4888: DFBPPR15286 ---- Microorganism protein ---- Deoxyhypusine synthase
Source.4889: DFBPPR15287 ---- Microorganism protein ---- NEDD8-conjugating enzyme UBC12
Source.4890: DFBPPR15288 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 2A activator 2
Source.4891: DFBPPR15289 ---- Microorganism protein ---- Nucleolar protein 9
Source.4892: DFBPPR15293 ---- Microorganism protein ---- GPI ethanolamine phosphate transferase 2
Source.4893: DFBPPR15310 ---- Microorganism protein ---- pH-response regulator protein palH/RIM21
Source.4894: DFBPPR15313 ---- Microorganism protein ---- Ornithine aminotransferase
Source.4895: DFBPPR15315 ---- Microorganism protein ---- Porphobilinogen deaminase
Source.4896: DFBPPR15316 ---- Microorganism protein ---- Protein URE2
Source.4897: DFBPPR15318 ---- Microorganism protein ---- Peroxisomal targeting signal receptor
Source.4898: DFBPPR15323 ---- Microorganism protein ---- Protein HIR1
Source.4899: DFBPPR15329 ---- Microorganism protein ---- GPI mannosyltransferase 2
Source.4900: DFBPPR15330 ---- Microorganism protein ---- Probable endonuclease LCL3
Source.4901: DFBPPR15335 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 18
Source.4902: DFBPPR15341 ---- Microorganism protein ---- Cytochrome c oxidase subunit 3
Source.4903: DFBPPR15351 ---- Microorganism protein ---- Protein transport protein SEC31
Source.4904: DFBPPR15352 ---- Microorganism protein ---- Cytosolic Fe-S cluster assembly factor CFD1
Source.4905: DFBPPR15362 ---- Microorganism protein ---- DNA polymerase epsilon subunit B
Source.4906: DFBPPR15364 ---- Microorganism protein ---- Uncharacterized killer plasmid pGKL-2 helicase
Source.4907: DFBPPR15367 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 1
Source.4908: DFBPPR15369 ---- Microorganism protein ---- 2-(3-amino-3-carboxypropyl)histidine synthase subunit 2
Source.4909: DFBPPR15370 ---- Microorganism protein ---- Mitochondrial division protein 1
Source.4910: DFBPPR15371 ---- Microorganism protein ---- Protein HIR2
Source.4911: DFBPPR15374 ---- Microorganism protein ---- Glutamine synthetase
Source.4912: DFBPPR15377 ---- Microorganism protein ---- Mitochondrial presequence protease
Source.4913: DFBPPR15378 ---- Microorganism protein ---- IMP-specific 5'-nucleotidase 1
Source.4914: DFBPPR15381 ---- Microorganism protein ---- Protein ERD1
Source.4915: DFBPPR15382 ---- Microorganism protein ---- Sensitive to high expression protein 9 homolog, mitochondrial
Source.4916: DFBPPR15384 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 14
Source.4917: DFBPPR15393 ---- Microorganism protein ---- Inner membrane assembly complex subunit 17
Source.4918: DFBPPR15397 ---- Microorganism protein ---- Nucleolar GTP-binding protein 2
Source.4919: DFBPPR15398 ---- Microorganism protein ---- Transcription activator of gluconeogenesis ERT1
Source.4920: DFBPPR15399 ---- Microorganism protein ---- 40S ribosomal protein S21
Source.4921: DFBPPR15401 ---- Microorganism protein ---- Probable cyclodipeptide synthase PUL1
Source.4922: DFBPPR15410 ---- Microorganism protein ---- Mitochondrial inner membrane protease ATP23
Source.4923: DFBPPR15416 ---- Microorganism protein ---- Protein SOP4
Source.4924: DFBPPR15421 ---- Microorganism protein ---- Cytochrome c lysine N-methyltransferase 1
Source.4925: DFBPPR15425 ---- Microorganism protein ---- Ribosome-releasing factor 2, mitochondrial
Source.4926: DFBPPR15437 ---- Microorganism protein ---- Ubiquitin-like-conjugating enzyme ATG10
Source.4927: DFBPPR15438 ---- Microorganism protein ---- 3-keto-steroid reductase
Source.4928: DFBPPR15459 ---- Microorganism protein ---- Peroxisomal biogenesis factor 6
Source.4929: DFBPPR15467 ---- Microorganism protein ---- Serine/threonine-protein phosphatase 4 regulatory subunit 3
Source.4930: DFBPPR15471 ---- Microorganism protein ---- Polynucleotide 5'-hydroxyl-kinase GRC3
Source.4931: DFBPPR15479 ---- Microorganism protein ---- Phosphoenolpyruvate carboxykinase (ATP)
Source.4932: DFBPPR15480 ---- Microorganism protein ---- Outer spore wall assembly protein SHE10
Source.4933: DFBPPR15481 ---- Microorganism protein ---- Probable cytosolic iron-sulfur protein assembly protein 1
Source.4934: DFBPPR15487 ---- Microorganism protein ---- Restriction of telomere capping protein 1
Source.4935: DFBPPR15492 ---- Microorganism protein ---- Vacuolar fusion protein CCZ1
Source.4936: DFBPPR15493 ---- Microorganism protein ---- Actin-like protein ARP6
Source.4937: DFBPPR15494 ---- Microorganism protein ---- Protein STU1
Source.4938: DFBPPR15497 ---- Microorganism protein ---- Translocation protein SEC62
Source.4939: DFBPPR15498 ---- Microorganism protein ---- Autophagy-related protein 22
Source.4940: DFBPPR15499 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 12
Source.4941: DFBPPR15509 ---- Microorganism protein ---- Protein phosphatase methylesterase 1
Source.4942: DFBPPR15512 ---- Microorganism protein ---- Vacuolar membrane-associated protein IML1
Source.4943: DFBPPR15524 ---- Microorganism protein ---- COP9 signalosome complex subunit 10
Source.4944: DFBPPR15529 ---- Microorganism protein ---- Oleate activated transcription factor 3
Source.4945: DFBPPR15538 ---- Microorganism protein ---- pH-response regulator protein palA/RIM20
Source.4946: DFBPPR15540 ---- Microorganism protein ---- Probable intron-encoded endonuclease aI3
Source.4947: DFBPPR15543 ---- Microorganism protein ---- Mediator of RNA polymerase II transcription subunit 7
Source.4948: DFBPPR15546 ---- Microorganism protein ---- DNA polymerase
Source.4949: DFBPPR15550 ---- Microorganism protein ---- COPII coat assembly protein SEC16
Source.4950: DFBPPR15553 ---- Microorganism protein ---- Structure-specific endonuclease subunit SLX4
Source.4951: DFBPPR15557 ---- Microorganism protein ---- DNA damage checkpoint protein LCD1
Source.4952: DFBPPR15566 ---- Microorganism protein ---- Autophagy-related protein 32
Source.4953: DFBPPR15570 ---- Microorganism protein ---- Glucose starvation modulator protein 1
Source.4954: DFBPPR15573 ---- Microorganism protein ---- Mitochondrial thiamine pyrophosphate carrier 1
Source.4955: DFBPPR15577 ---- Microorganism protein ---- Chromatin modification-related protein EAF7
Source.4956: DFBPPR15580 ---- Microorganism protein ---- Oligosaccharide translocation protein RFT1
Source.4957: DFBPPR15581 ---- Microorganism protein ---- Maintenance of telomere capping protein 6
Source.4958: DFBPPR15582 ---- Microorganism protein ---- T-complex protein 1 subunit delta
Source.4959: DFBPPR15592 ---- Microorganism protein ---- UDP-galactose transporter homolog 1
Source.4960: DFBPPR15599 ---- Microorganism protein ---- Pre-mRNA-splicing factor SYF1
Source.4961: DFBPPR15600 ---- Microorganism protein ---- SVP1-like protein 2
Source.4962: DFBPPR15605 ---- Microorganism protein ---- Ribosome biogenesis protein NSA2
Source.4963: DFBPPR15611 ---- Microorganism protein ---- Calpain-like protease palB/RIM13
Source.4964: DFBPPR15614 ---- Microorganism protein ---- Cytochrome c oxidase assembly protein COX16, mitochondrial
Source.4965: DFBPPR15619 ---- Microorganism protein ---- ATPase expression protein 2, mitochondrial
Source.4966: DFBPPR15621 ---- Microorganism protein ---- Spore membrane assembly protein 2
Source.4967: DFBPPR15623 ---- Microorganism protein ---- General transcriptional corepressor TUP1
Source.4968: DFBPPR15625 ---- Microorganism protein ---- DNA polymerase
Source.4969: DFBPPR15641 ---- Microorganism protein ---- Ribosomal lysine N-methyltransferase 5
Source.4970: DFBPPR15643 ---- Microorganism protein ---- Peroxisome assembly protein 22
Source.4971: DFBPPR15656 ---- Microorganism protein ---- Pre-mRNA-splicing factor CWC25
Source.4972: DFBPPR15660 ---- Microorganism protein ---- ASTRA-associated protein 1
Source.4973: DFBPPR15673 ---- Microorganism protein ---- ATPase synthesis protein 25, mitochondrial
Source.4974: DFBPPR15675 ---- Microorganism protein ---- DNA replication complex GINS protein PSF1
Source.4975: DFBPPR15676 ---- Microorganism protein ---- Antagonist of mitotic exit network protein 1
Source.4976: DFBPPR15680 ---- Microorganism protein ---- Protein SYM1
Source.4977: DFBPPR15690 ---- Microorganism protein ---- Inclusion body clearance protein IML2
Source.4978: DFBPPR15691 ---- Microorganism protein ---- 60S ribosomal protein L3
Source.4979: DFBPPR15694 ---- Microorganism protein ---- DNA mismatch repair protein HSM3
Source.4980: DFBPPR15701 ---- Microorganism protein ---- pH-response regulator protein palF/RIM8
Source.4981: DFBPPR15704 ---- Microorganism protein ---- Oxidation resistance protein 1
Source.4982: DFBPPR15705 ---- Microorganism protein ---- WD repeat-containing protein JIP5
Source.4983: DFBPPR15709 ---- Microorganism protein ---- Increased rDNA silencing protein 4
Source.4984: DFBPPR15714 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 39, mitochondrial
Source.4985: DFBPPR15715 ---- Microorganism protein ---- Protein RMD9, mitochondrial
Source.4986: DFBPPR15724 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 9, mitochondrial
Source.4987: DFBPPR15726 ---- Microorganism protein ---- Protein SBE2
Source.4988: DFBPPR15727 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 3
Source.4989: DFBPPR15730 ---- Microorganism protein ---- Suppressor of hydroxyurea sensitivity protein 2
Source.4990: DFBPPR15734 ---- Microorganism protein ---- 40S ribosomal protein S29
Source.4991: DFBPPR15735 ---- Microorganism protein ---- Cargo-transport protein YPP1
Source.4992: DFBPPR15736 ---- Microorganism protein ---- Restriction of telomere capping protein 5
Source.4993: DFBPPR15744 ---- Microorganism protein ---- Peroxisomal membrane protein PEX21
Source.4994: DFBPPR15748 ---- Microorganism protein ---- Vacuolar membrane protein KLLA0F03465g
Source.4995: DFBPPR15755 ---- Microorganism protein ---- Respiratory growth induced protein 1
Source.4996: DFBPPR15762 ---- Microorganism protein ---- Altered inheritance of mitochondria protein 6
Source.4997: DFBPPR15764 ---- Microorganism protein ---- Oxidant-induced cell-cycle arrest protein 5
Source.4998: DFBPPR15770 ---- Microorganism protein ---- F-box protein COS111
Source.4999: DFBPPR15774 ---- Microorganism protein ---- Protein SIA1
Source.5000: DFBPPR15795 ---- Microorganism protein ---- L-lactate dehydrogenase
Source.5001: DFBPPR15797 ---- Microorganism protein ---- Dihydrofolate reductase
Source.5002: DFBPPR15807 ---- Microorganism protein ---- PTS system sorbose-specific EIIB component
Source.5003: DFBPPR15808 ---- Microorganism protein ---- Valine--tRNA ligase
Source.5004: DFBPPR15814 ---- Microorganism protein ---- Amidophosphoribosyltransferase
Source.5005: DFBPPR15825 ---- Microorganism protein ---- 5-deoxy-glucuronate isomerase
Source.5006: DFBPPR15826 ---- Microorganism protein ---- Galactose-1-phosphate uridylyltransferase
Source.5007: DFBPPR15835 ---- Microorganism protein ---- Alcohol dehydrogenase (quinone), dehydrogenase subunit
Source.5008: DFBPPR15836 ---- Microorganism protein ---- Ubiquinol oxidase subunit 1
Source.5009: DFBPPR15846 ---- Microorganism protein ---- Exoglucanase 3
Source.5010: DFBPPR15848 ---- Microorganism protein ---- Polyphenol oxidase 2
Source.5011: DFBPPR15853 ---- Microorganism protein ---- Polyphenol oxidase 4
Source.5012: DFBPPR15854 ---- Microorganism protein ---- Polyphenol oxidase 1
Source.5013: DFBPPR15855 ---- Microorganism protein ---- 5-aminolevulinate synthase, mitochondrial
Source.5014: DFBPPR15858 ---- Microorganism protein ---- Endo-1,4-beta-xylanase
Source.5015: DFBPPR15862 ---- Microorganism protein ---- Cellulose-growth-specific protein
Source.5016: DFBPPR15866 ---- Microorganism protein ---- Delta-1-pyrroline-5-carboxylate dehydrogenase
Source.5017: DFBPPR15870 ---- Microorganism protein ---- Glucose-6-phosphate isomerase
Source.5018: DFBPPR15872 ---- Microorganism protein ---- Glutamine synthetase
Source.5019: DFBPPR15873 ---- Microorganism protein ---- NADP-specific glutamate dehydrogenase
Source.5020: DFBPPR15884 ---- Microorganism protein ---- Putative serine protease
Source.5021: DFBPPR15887 ---- Microorganism protein ---- Uncharacterized protein ORF1
Source.5022: DFBPPR0001 ---- Plant protein ---- Gamma conglutin 1
Source.5023: DFBPPR0002 ---- Plant protein ---- 13-hydroxylupanine O-tigloyltransferase
Source.5024: DFBPPR0007 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5025: DFBPPR0008 ---- Plant protein ---- Gamma conglutin 2
Source.5026: DFBPPR7751 ---- Plant protein ---- Cyanohydrin beta-glucosyltransferase
Source.5027: DFBPPR7756 ---- Plant protein ---- P-(S)-hydroxymandelonitrile lyase
Source.5028: DFBPPR7758 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 3
Source.5029: DFBPPR7759 ---- Plant protein ---- Eugenol O-methyltransferase
Source.5030: DFBPPR7760 ---- Plant protein ---- Tyrosine N-monooxygenase
Source.5031: DFBPPR7761 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5032: DFBPPR7762 ---- Plant protein ---- NADPH--cytochrome P450 reductase
Source.5033: DFBPPR7763 ---- Plant protein ---- Probable bifunctional methylthioribulose-1-phosphate dehydratase/enolase-phosphatase E1
Source.5034: DFBPPR7766 ---- Plant protein ---- Cytochrome c oxidase subunit 1
Source.5035: DFBPPR7768 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 1
Source.5036: DFBPPR7772 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.5037: DFBPPR7777 ---- Plant protein ---- Arginine biosynthesis bifunctional protein ArgJ, chloroplastic
Source.5038: DFBPPR7779 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.5039: DFBPPR7784 ---- Plant protein ---- Phosphoenolpyruvate carboxylase 2
Source.5040: DFBPPR7787 ---- Plant protein ---- Fatty acid desaturase DES3
Source.5041: DFBPPR7793 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.5042: DFBPPR7796 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.5043: DFBPPR7797 ---- Plant protein ---- Granule-bound starch synthase 1, chloroplastic/amyloplastic
Source.5044: DFBPPR7800 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.5045: DFBPPR7804 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.5046: DFBPPR7809 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.5047: DFBPPR7811 ---- Plant protein ---- Fatty acid desaturase DES2
Source.5048: DFBPPR7813 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase 1
Source.5049: DFBPPR7814 ---- Plant protein ---- Phytochrome a
Source.5050: DFBPPR7820 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.5051: DFBPPR7830 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.5052: DFBPPR7833 ---- Plant protein ---- Cytochrome b6-f complex subunit 8
Source.5053: DFBPPR7834 ---- Plant protein ---- 1,2-dihydroxy-3-keto-5-methylthiopentene dioxygenase homolog 2
Source.5054: DFBPPR7844 ---- Plant protein ---- Actin-1
Source.5055: DFBPPR7855 ---- Plant protein ---- Probable fatty acid desaturase DES1
Source.5056: DFBPPR7856 ---- Plant protein ---- Maturase K
Source.5057: DFBPPR7862 ---- Plant protein ---- Cytochrome P450 98A1
Source.5058: DFBPPR7866 ---- Plant protein ---- Photosystem II reaction center protein K
Source.5059: DFBPPR7877 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.5060: DFBPPR7895 ---- Plant protein ---- CASP-like protein UU-1
Source.5061: DFBPPR7914 ---- Plant protein ---- CASP-like protein 1U2
Source.5062: DFBPPR7916 ---- Plant protein ---- CASP-like protein 1U3
Source.5063: DFBPPR7918 ---- Plant protein ---- CASP-like protein 1U1
Source.5064: DFBPPR7934 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.5065: DFBPPR7945 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.5066: DFBPPR7948 ---- Plant protein ---- Probable sucrose-phosphate synthase
Source.5067: DFBPPR7952 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.5068: DFBPPR7964 ---- Plant protein ---- Sucrose synthase
Source.5069: DFBPPR7973 ---- Plant protein ---- Maturase K
Source.5070: DFBPPR7988 ---- Plant protein ---- Bifunctional levopimaradiene synthase, chloroplastic
Source.5071: DFBPPR7990 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5072: DFBPPR7992 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.5073: DFBPPR8007 ---- Plant protein ---- Maturase K
Source.5074: DFBPPR8027 ---- Plant protein ---- Fe(3+)-Zn(2+) purple acid phosphatase
Source.5075: DFBPPR8033 ---- Plant protein ---- Uricase-2
Source.5076: DFBPPR8035 ---- Plant protein ---- Endochitinase
Source.5077: DFBPPR8038 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5078: DFBPPR8040 ---- Plant protein ---- Nitrate reductase [NADH] 1
Source.5079: DFBPPR8041 ---- Plant protein ---- Nitrate reductase [NADH] 2
Source.5080: DFBPPR8044 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.5081: DFBPPR8047 ---- Plant protein ---- Acid beta-fructofuranosidase
Source.5082: DFBPPR8053 ---- Plant protein ---- Ferritin, chloroplastic
Source.5083: DFBPPR8055 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.5084: DFBPPR8058 ---- Plant protein ---- Endochitinase CH5B
Source.5085: DFBPPR8059 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.5086: DFBPPR8072 ---- Plant protein ---- Phosphoenolpyruvate carboxylase
Source.5087: DFBPPR8076 ---- Plant protein ---- Glycerol-3-phosphate acyltransferase, chloroplastic
Source.5088: DFBPPR8083 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.5089: DFBPPR8084 ---- Plant protein ---- Zeatin O-xylosyltransferase
Source.5090: DFBPPR8086 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.5091: DFBPPR8088 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.5092: DFBPPR8089 ---- Plant protein ---- Glutamine synthetase PR-2
Source.5093: DFBPPR8095 ---- Plant protein ---- Profilin-1
Source.5094: DFBPPR8098 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 6, chloroplastic
Source.5095: DFBPPR8102 ---- Plant protein ---- Translation initiation factor IF-2, chloroplastic
Source.5096: DFBPPR8103 ---- Plant protein ---- Chalcone synthase 17
Source.5097: DFBPPR8104 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.5098: DFBPPR8106 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.5099: DFBPPR8112 ---- Plant protein ---- Cytochrome b6-f complex subunit 8
Source.5100: DFBPPR8118 ---- Plant protein ---- Ribulose bisphosphate carboxylase/oxygenase activase, chloroplastic
Source.5101: DFBPPR8120 ---- Plant protein ---- Protein TIC 214
Source.5102: DFBPPR8134 ---- Plant protein ---- 30S ribosomal protein S3, chloroplastic
Source.5103: DFBPPR8144 ---- Plant protein ---- Maturase K
Source.5104: DFBPPR8146 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.5105: DFBPPR8153 ---- Plant protein ---- Thaumatin-like protein
Source.5106: DFBPPR8155 ---- Plant protein ---- Protein Ycf2
Source.5107: DFBPPR8156 ---- Plant protein ---- Nodulin-30
Source.5108: DFBPPR8213 ---- Plant protein ---- Alpha-copaene synthase
Source.5109: DFBPPR8215 ---- Plant protein ---- Eupatolide synthase
Source.5110: DFBPPR8220 ---- Plant protein ---- Ribulose bisphosphate carboxylase large chain
Source.5111: DFBPPR8221 ---- Plant protein ---- sn-2 acyl-lipid omega-3 desaturase (ferredoxin), chloroplastic
Source.5112: DFBPPR8222 ---- Plant protein ---- Germacrene A synthase 1
Source.5113: DFBPPR8223 ---- Plant protein ---- Germacrene A synthase 2
Source.5114: DFBPPR8224 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A1
Source.5115: DFBPPR8227 ---- Plant protein ---- Photosystem I P700 chlorophyll a apoprotein A2
Source.5116: DFBPPR8237 ---- Plant protein ---- Photosystem II CP43 reaction center protein
Source.5117: DFBPPR8238 ---- Plant protein ---- Ribulose bisphosphate carboxylase small chain, chloroplastic
Source.5118: DFBPPR8241 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta'
Source.5119: DFBPPR8245 ---- Plant protein ---- Stearoyl-[acyl-carrier-protein] 9-desaturase, chloroplastic
Source.5120: DFBPPR8247 ---- Plant protein ---- Nucleoside diphosphate kinase
Source.5121: DFBPPR8250 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 5, chloroplastic
Source.5122: DFBPPR8257 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit 1, chloroplastic
Source.5123: DFBPPR8260 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit H, chloroplastic
Source.5124: DFBPPR8269 ---- Plant protein ---- ATP-dependent Clp protease proteolytic subunit
Source.5125: DFBPPR8272 ---- Plant protein ---- DNA-directed RNA polymerase subunit beta
Source.5126: DFBPPR8274 ---- Plant protein ---- Cytochrome c oxidase subunit 3
Source.5127: DFBPPR8275 ---- Plant protein ---- Photosystem II CP47 reaction center protein
Source.5128: DFBPPR8276 ---- Plant protein ---- NAD(P)H-quinone oxidoreductase subunit J, chloroplastic
Source.5129: DFBPPR8277 ---- Plant protein ---- Profilin
Source.5130: DFBPPR8278 ---- Plant protein ---- Cytochrome b6-f complex subunit 8
Source.5131: DFBPPR8279 ---- Plant protein ---- Oxygen-evolving enhancer protein 1, chloroplastic
Source.5132: DFBPPR8300 ---- Plant protein ---- Protein Ycf2
Source.5133: DFBPPR8301 ---- Plant protein ---- Photosystem II reaction center protein K
Source.5134: DFBPPR8304 ---- Plant protein ---- Protein TIC 214
Source.5135: DFBPPR8307 ---- Plant protein ---- ATP synthase epsilon chain, chloroplastic
Source.5136: DFBPPR8316 ---- Plant protein ---- Cytochrome c biogenesis protein CcsA
Source.5137: DFBPPR8319 ---- Plant protein ---- Serine/threonine-protein phosphatase PP2A catalytic subunit
Source.5138: DFBPPR8341 ---- Plant protein ---- Cysteine proteinase inhibitor A
Source.5139: DFBPPR8354 ---- Plant protein ---- Pollen-specific protein SF21
Link-research
Link 1: DFBPACEI0535----Grains----Sake lees
Link 2: DFBPACEI1176----Wakame (undaria pinnatifida)----Wakame hydrolysates
Link 3: DFBPACEI1193----Wakame (Undaria pinnatifida)----Extract of wakame powder
Link 4: DFBPACEI1211----Shrimp----Izumi shrimp
Link 5: DFBPACEI1217----Antarctic krill (Euphausia superba)----Antarctic krill tail meat
Link 6: DFBPACEI1317----Bovine milk----Casein
Link 7: DFBPACEI1346----Land snail (Helix aspersa)----Hepatopancreas (by-product)
Link 8: DFBPACEI1351----Rapseed (Napin)----Rapseed meal protein
Link 9: DFBPACEI1553----Chum salmon----Defatted chum salmon muscle protein
Link 10: DFBPACEI1897----Amaranth seed proteins----Amaranth glutelins
Link 11: DFBPACEI1986----Soy, Rice, Wheat, Pea----Soy/Rice/Wheat/Pea proteins
Biological/Functional activity & target protein
ACE-inhibitory activity

The peptide exhibited potent Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) inhibitory activity with an IC50 value of 1.1 uM.

Specific target protein(s) Specific Target Protein(s):
Angiotensin-converting enzyme
Taste properties & Structure
Bitterness
Literature report N.D
Bitter prediction tools Bitter taste prediction
SMILES N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=CN2)C1=C2C=CC=C1)C(=O)O
Preparation method
Mode of preparation

Fermentation

Enzyme(s)/starter culture

Industrial hydrolysis with a protease mixture consisting of Bacillus licheniformis.

Stability & Cytotoxicity
Peptide stability
Literature report: N.D
EHP-Tool: Enzymatic Hydrolysis Prediction Tool (EHP-Tool)
Peptide cytotoxicity
Literature report: No measured
Prediction: ToxinPred
Additional information
Additional information

(1) The hydrolysates of Alfalfa white protein or the peptide VW may be used as antihypertensive.
(2) By using the MIXCPC method, fractions enriched in the ACE inhibitory peptide VW were obtained from an Alfalfa white protein concentrate hydrolysate showing interesting anti-hypertensive properties [1].

Database cross-references
DFBP
[D1] DFBPANHY0070, DFBPANHY0071, DFBPANHY0072, DFBPANHY0618, DFBPANHY0069, DFBPANHY0917, DFBPANHY0707
[D2] DFBPANOX0427
[D3] DFBPALGL0001
[D4] DFBPINPE0018
[D5] DFBPMUFU0130
BIOPEP-UWM [D6] 3486, 8461, 8928, 9387
APD [D7] -
BioPepDB [D8] -
MBPDB [D9] -
Reference(s)
Primary literature Kapel, R., Rahhou, E., Lecouturier, D., Guillochon, D., Dhulster, P. Characterization of an antihypertensive peptide from an Alfalfa white protein hydrolysate produced by a continuous enzymatic membrane reactor. Process Biochemistry. 2006, 41, 1961-6.
Other literature(s)

[1] Boudesocque L ,  Kapel R ,  Paris C , et al. Concentration and selective fractionation of an antihypertensive peptide from an alfalfa white proteins hydrolysate by mixed ion-exchange centrifugal partition chromatography[J]. Journal of Chromatography, B, 2012, 905:23-30.

PubDate 2006
Copyright © 2020. Record / license number: Chongqing ICP No. 2000214